update deps

56 files changed, 23538 insertions, 0 deletions

diff --git a/libs/subzero/__init__.py b/libs/subzero/__init__.py
new file mode 100644
index 000000000..d21438cdf
--- /dev/null
+++ b/libs/subzero/__init__.py
@@ -0,0 +1,2 @@
+# coding=utf-8
+
diff --git a/libs/subzero/analytics.py b/libs/subzero/analytics.py
new file mode 100644
index 000000000..297bcf2c5
--- /dev/null
+++ b/libs/subzero/analytics.py
@@ -0,0 +1,33 @@
+# coding=utf-8
+
+import struct
+import binascii
+
+from pyga.requests import Event, Page, Tracker, Session, Visitor, Config
+
+
+def track_event(category=None, action=None, label=None, value=None, identifier=None, first_use=None, add=None,
+                noninteraction=True):
+    anonymousConfig = Config()
+    anonymousConfig.anonimize_ip_address = True
+
+    tracker = Tracker('UA-86466078-1', 'none', conf=anonymousConfig)
+    visitor = Visitor()
+
+    # convert the last 8 bytes of the machine identifier to an integer to get a "unique" user
+    visitor.unique_id = struct.unpack("!I", binascii.unhexlify(identifier[32:]))[0]/2
+
+    if add:
+        # add visitor's ip address (will be anonymized)
+        visitor.ip_address = add
+
+    if first_use:
+        visitor.first_visit_time = first_use
+
+    session = Session()
+    event = Event(category=category, action=action, label=label, value=value, noninteraction=noninteraction)
+    path = u"/" + u"/".join([category, action, label])
+    page = Page(path.lower())
+
+    tracker.track_event(event, session, visitor)
+    tracker.track_pageview(page, session, visitor)
diff --git a/libs/subzero/cache_backends/__init__.py b/libs/subzero/cache_backends/__init__.py
new file mode 100644
index 000000000..9bad5790a
--- /dev/null
+++ b/libs/subzero/cache_backends/__init__.py
@@ -0,0 +1 @@
+# coding=utf-8
diff --git a/libs/subzero/cache_backends/file.py b/libs/subzero/cache_backends/file.py
new file mode 100644
index 000000000..1ad404deb
--- /dev/null
+++ b/libs/subzero/cache_backends/file.py
@@ -0,0 +1,51 @@
+# coding=utf-8
+from dogpile.cache.api import CacheBackend, NO_VALUE
+from fcache.cache import FileCache
+
+
+class SZFileBackend(CacheBackend):
+    def __init__(self, arguments):
+        self._cache = FileCache(arguments.pop("appname", None), flag=arguments.pop("flag", "c"),
+                                serialize=arguments.pop("serialize", True),
+                                app_cache_dir=arguments.pop("app_cache_dir", None))
+
+    def get(self, key):
+        value = self._cache.get(key, NO_VALUE)
+
+        return value
+
+    def get_multi(self, keys):
+        ret = [
+            self._cache.get(key, NO_VALUE)
+            for key in keys]
+
+        return ret
+
+    def set(self, key, value):
+        self._cache[key] = value
+
+    def set_multi(self, mapping):
+        for key, value in mapping.items():
+            self._cache[key] = value
+
+    def delete(self, key):
+        self._cache.pop(key, None)
+
+    def delete_multi(self, keys):
+        for key in keys:
+            self._cache.pop(key, None)
+
+    @property
+    def all_filenames(self):
+        return self._cache._all_filenames()
+
+    def sync(self, force=False):
+        if (hasattr(self._cache, "_buffer") and self._cache._buffer) or force:
+            self._cache.sync()
+
+    def clear(self):
+        self._cache.clear()
+        if not hasattr(self._cache, "_buffer") or self._cache._sync:
+            self._cache._sync = False
+            self._cache._buffer = {}
+
diff --git a/libs/subzero/constants.py b/libs/subzero/constants.py
new file mode 100644
index 000000000..43297b2a2
--- /dev/null
+++ b/libs/subzero/constants.py
@@ -0,0 +1,47 @@
+# coding=utf-8
+
+OS_PLEX_USERAGENT = 'plexapp.com v9.0'
+
+DEPENDENCY_MODULE_NAMES = ['subliminal', 'subliminal_patch', 'enzyme', 'guessit', 'subzero', 'libfilebot']
+PERSONAL_MEDIA_IDENTIFIER = "com.plexapp.agents.none"
+PLUGIN_IDENTIFIER_SHORT = "subzero"
+PLUGIN_IDENTIFIER = "com.plexapp.agents.%s" % PLUGIN_IDENTIFIER_SHORT
+PLUGIN_NAME = "Sub-Zero"
+PREFIX = "/video/%s" % PLUGIN_IDENTIFIER_SHORT
+
+TITLE = "%s Subtitles" % PLUGIN_NAME
+ART      = 'art-default.jpg'
+ICON     = 'icon-default.jpg'
+ICON_SUB = 'icon-sub.jpg'
+
+DEFAULT_TIMEOUT = 15
+
+
+# media types as on https://github.com/Arcanemagus/plex-api/wiki/MediaTypes
+MOVIE = 1
+SHOW = 2
+SEASON = 3
+EPISODE = 4
+TRAILER = 5
+COMIC = 6
+PERSON = 7
+ARTIST = 8
+ALBUM = 9
+TRACK = 10
+PHOTO_ALBUM = 11
+PICTURE = 12
+PHOTO = 13
+CLIP = 14
+PLAYLIST_ITEM = 15
+
+MEDIA_TYPE_TO_STRING = {
+    MOVIE: "movie",
+    SHOW: "show"
+}
+
+
+mode_map = {
+    "a": "auto",
+    "m": "manual",
+    "b": "auto-better"
+}
\ No newline at end of file
diff --git a/libs/subzero/history_storage.py b/libs/subzero/history_storage.py
new file mode 100644
index 000000000..38d859d55
--- /dev/null
+++ b/libs/subzero/history_storage.py
@@ -0,0 +1,120 @@
+# coding=utf-8
+
+import datetime
+import logging
+import traceback
+import types
+
+from subzero.language import Language
+
+from constants import mode_map
+
+logger = logging.getLogger(__name__)
+
+
+class SubtitleHistoryItem(object):
+    item_title = None
+    section_title = None
+    rating_key = None
+    provider_name = None
+    lang_name = None
+    lang_data = None
+    score = None
+    thumb = None
+    time = None
+    mode = "a"
+
+    def __init__(self, item_title, rating_key, section_title=None, subtitle=None, thumb=None, mode="a", time=None):
+        self.item_title = item_title
+        self.section_title = section_title
+        self.rating_key = str(rating_key)
+        self.provider_name = subtitle.provider_name
+        self.lang_name = str(subtitle.language.name)
+        self.lang_data = str(subtitle.language.alpha3), \
+                         str(subtitle.language.country) if subtitle.language.country else None, \
+                         str(subtitle.language.script) if subtitle.language.script else None
+        self.score = subtitle.score
+        self.thumb = thumb
+        self.time = time or datetime.datetime.now()
+        self.mode = mode
+
+    @property
+    def title(self):
+        return u"%s: %s" % (self.section_title, self.item_title)
+
+    @property
+    def language(self):
+        if self.lang_data:
+            lang_data = [s if s != "None" else None for s in self.lang_data]
+            if lang_data[0]:
+                return Language(lang_data[0], country=lang_data[1], script=lang_data[2])
+
+    @property
+    def mode_verbose(self):
+        return mode_map.get(self.mode, "Unknown")
+
+    def __repr__(self):
+        return unicode(self)
+
+    def __unicode__(self):
+        return u"%s (Score: %s)" % (unicode(self.item_title), self.score)
+
+    def __str__(self):
+        return str(self.rating_key)
+
+    def __hash__(self):
+        return hash((self.rating_key, self.score))
+
+    def __eq__(self, other):
+        return (self.rating_key, self.score) == (other.rating_key, other.score)
+
+    def __ne__(self, other):
+        # Not strictly necessary, but to avoid having both x==y and x!=y
+        # True at the same time
+        return not (self == other)
+
+
+class SubtitleHistory(object):
+    size = 100
+    storage = None
+    threadkit = None
+
+    def __init__(self, storage, threadkit, size=100):
+        self.size = size
+        self.storage = storage
+        self.threadkit = threadkit
+
+    def add(self, item_title, rating_key, section_title=None, subtitle=None, thumb=None, mode="a", time=None):
+        with self.threadkit.Lock(key="sub_history_add"):
+            items = self.items
+
+            item = SubtitleHistoryItem(item_title, rating_key, section_title=section_title, subtitle=subtitle,
+                                       thumb=thumb, mode=mode, time=time)
+
+            # insert item
+            items.insert(0, item)
+
+            # clamp item amount
+            items = items[:self.size]
+
+            # store items
+            self.storage.SaveObject("subtitle_history", items)
+
+    @property
+    def items(self):
+        try:
+            items = self.storage.LoadObject("subtitle_history") or []
+        except:
+            items = []
+            logger.error("Failed to load history storage: %s" % traceback.format_exc())
+
+        if not isinstance(items, types.ListType):
+            items = []
+        else:
+            items = items[:]
+        return items
+
+    def destroy(self):
+        self.storage = None
+        self.threadkit = None
+
diff --git a/libs/subzero/intent.py b/libs/subzero/intent.py
new file mode 100644
index 000000000..174e68fee
--- /dev/null
+++ b/libs/subzero/intent.py
@@ -0,0 +1,101 @@
+# coding=utf-8
+
+import datetime
+import threading
+
+lock = threading.Lock()
+
+
+class TempIntent(object):
+    timeout = 1000  # milliseconds
+    store = None
+
+    def __init__(self, timeout=1000, store=None):
+        self.timeout = timeout
+        if store is None:
+            raise NotImplementedError
+
+        self.store = store
+
+    def get(self, kind, *keys):
+        with lock:
+            # iter all requested keys
+            for key in keys:
+                hit = False
+
+                # skip key if invalid
+                if not key:
+                    continue
+
+                # valid kind?
+                if kind in self.store:
+                    now = datetime.datetime.now()
+                    key = str(key)
+
+                    # iter all known kinds (previously created)
+                    for known_key in self.store[kind].keys():
+                        # may need locking, for now just play it safe
+                        data = self.store[kind].get(known_key, {})
+                        ends = data.get("timeout")
+                        if not ends:
+                            continue
+
+                        timed_out = False
+                        if now > ends:
+                            timed_out = True
+
+                        # key and kind in storage, and not timed out = hit
+                        if known_key == key and not timed_out:
+                            hit = True
+
+                        if timed_out:
+                            try:
+                                del self.store[kind][key]
+                            except:
+                                continue
+
+                    if hit:
+                        return True
+        return False
+
+    def resolve(self, kind, key):
+        with lock:
+            if kind in self.store and key in self.store[kind]:
+                del self.store[kind][key]
+                return True
+            return False
+
+    def set(self, kind, key, data=None, timeout=None):
+        with lock:
+            if kind not in self.store:
+                self.store[kind] = {}
+
+            key = str(key)
+            self.store[kind][key] = {
+                "data": data,
+                "timeout": datetime.datetime.now() + datetime.timedelta(milliseconds=timeout or self.timeout)
+            }
+
+    def has(self, kind, key):
+        with lock:
+            if kind not in self.store:
+                return False
+            return key in self.store[kind]
+
+    def cleanup(self):
+        now = datetime.datetime.now()
+        clear_all = False
+        for kind, info in self.store.items():
+            for key, intent_data in info.items():
+                # legacy intent data, clear everything
+                if not isinstance(intent_data, dict):
+                    clear_all = True
+                    continue
+
+                if now > intent_data["timeout"]:
+                    del self.store[kind][key]
+        if clear_all:
+            self.store.clear()
+
+        self.store.save()
+
diff --git a/libs/subzero/language.py b/libs/subzero/language.py
new file mode 100644
index 000000000..af486c4ed
--- /dev/null
+++ b/libs/subzero/language.py
@@ -0,0 +1,112 @@
+# coding=utf-8
+from babelfish.exceptions import LanguageError
+
+from babelfish import Language as Language_, basestr
+
+
+repl_map = {
+    "dk": "da",
+    "nld": "nl",
+    "english": "en",
+}
+
+
+def language_from_stream(l):
+    if not l:
+        raise LanguageError()
+    for method in ("fromietf", "fromalpha3t", "fromalpha3b"):
+        try:
+            return getattr(Language, method)(l)
+        except (LanguageError, ValueError):
+            pass
+    raise LanguageError()
+
+
+def wrap_forced(f):
+    def inner(*args, **kwargs):
+        """
+        classmethod wrapper
+        :param args: args[0] = cls
+        :param kwargs:
+        :return:
+        """
+        args = list(args)
+        cls = args[0]
+        args = args[1:]
+        s = args.pop(0)
+        base, forced = s.split(":") if ":" in s else (s, False)
+        instance = f(cls, base, *args, **kwargs)
+        if isinstance(instance, Language):
+            instance.forced = forced == "forced"
+        return instance
+
+    return inner
+
+
+class Language(Language_):
+    forced = False
+
+    def __init__(self, language, country=None, script=None, unknown=None, forced=False):
+        self.forced = forced
+        super(Language, self).__init__(language, country=country, script=script, unknown=unknown)
+
+    def __getstate__(self):
+        return self.alpha3, self.country, self.script, self.forced
+
+    def __setstate__(self, state):
+        self.alpha3, self.country, self.script, self.forced = state
+
+    def __eq__(self, other):
+        if isinstance(other, basestr):
+            return str(self) == other
+        if not isinstance(other, Language):
+            return False
+        return (self.alpha3 == other.alpha3 and
+                self.country == other.country and
+                self.script == other.script and
+                bool(self.forced) == bool(other.forced))
+
+    def __str__(self):
+        return super(Language, self).__str__() + (":forced" if self.forced else "")
+
+    @property
+    def basename(self):
+        return super(Language, self).__str__()
+
+    def __getattr__(self, name):
+        ret = super(Language, self).__getattr__(name)
+        if isinstance(ret, Language):
+            ret.forced = self.forced
+        return ret
+
+    @classmethod
+    def rebuild(cls, instance, **replkw):
+        state = instance.__getstate__()
+        attrs = ("country", "script", "forced")
+        language = state[0]
+        kwa = dict(zip(attrs, state[1:]))
+        kwa.update(replkw)
+        return cls(language, **kwa)
+
+    @classmethod
+    @wrap_forced
+    def fromcode(cls, code, converter):
+        return Language(*Language_.fromcode(code, converter).__getstate__())
+
+    @classmethod
+    @wrap_forced
+    def fromietf(cls, ietf):
+        ietf_lower = ietf.lower()
+        if ietf_lower in repl_map:
+            ietf = repl_map[ietf_lower]
+
+        return Language(*Language_.fromietf(ietf).__getstate__())
+
+    @classmethod
+    @wrap_forced
+    def fromalpha3b(cls, s):
+        if s in repl_map:
+            s = repl_map[s]
+            return Language(*Language_.fromietf(s).__getstate__())
+
+        return Language(*Language_.fromalpha3b(s).__getstate__())
diff --git a/libs/subzero/lib/__init__.py b/libs/subzero/lib/__init__.py
new file mode 100644
index 000000000..2c1fe6987
--- /dev/null
+++ b/libs/subzero/lib/__init__.py
@@ -0,0 +1,2 @@
+
+import dict, geezip, httpfake, io, json, rar, which
\ No newline at end of file
diff --git a/libs/subzero/lib/dict.py b/libs/subzero/lib/dict.py
new file mode 100644
index 000000000..3f327dcf4
--- /dev/null
+++ b/libs/subzero/lib/dict.py
@@ -0,0 +1,163 @@
+# coding=utf-8
+
+
+class DictProxy(object):
+    store = None
+
+    def __init__(self, d):
+        self.Dict = d
+        super(DictProxy, self).__init__()
+
+        if self.store not in self.Dict or not self.Dict[self.store]:
+            self.Dict[self.store] = self.setup_defaults()
+        self.save()
+        self.__initialized = True
+
+    def __getattr__(self, name):
+        if name in self.Dict[self.store]:
+            return self.Dict[self.store][name]
+        return getattr(super(DictProxy, self), name)
+
+    def __setattr__(self, name, value):
+        if not self.__dict__.has_key(
+                '_DictProxy__initialized'):  # this test allows attributes to be set in the __init__ method
+            return object.__setattr__(self, name, value)
+
+        elif self.__dict__.has_key(name):  # any normal attributes are handled normally
+            object.__setattr__(self, name, value)
+
+        else:
+            if name in self.Dict[self.store]:
+                self.Dict[self.store][name] = value
+                return
+        object.__setattr__(self, name, value)
+
+    def __cmp__(self, d):
+        return cmp(self.Dict[self.store], d)
+
+    def __contains__(self, item):
+        return item in self.Dict[self.store]
+
+    def __setitem__(self, key, item):
+        self.Dict[self.store][key] = item
+        self.Dict.Save()
+
+    def __iter__(self):
+        return iter(self.Dict[self.store])
+
+    def __getitem__(self, key):
+        if key in self.Dict[self.store]:
+            return self.Dict[self.store][key]
+
+    def __repr__(self):
+        return repr(self.Dict[self.store])
+
+    def __str__(self):
+        return str(self.Dict[self.store])
+
+    def __len__(self):
+        return len(self.Dict[self.store].keys())
+
+    def __delitem__(self, key):
+        del self.Dict[self.store][key]
+
+    def save(self):
+        self.Dict.Save()
+
+    def clear(self):
+        del self.Dict[self.store]
+        return None
+
+    def copy(self):
+        return self.Dict[self.store].copy()
+
+    def has_key(self, k):
+        return k in self.Dict[self.store]
+
+    def pop(self, k, d=None):
+        return self.Dict[self.store].pop(k, d)
+
+    def update(self, *args, **kwargs):
+        return self.Dict[self.store].update(*args, **kwargs)
+
+    def keys(self):
+        return self.Dict[self.store].keys()
+
+    def values(self):
+        return self.Dict[self.store].values()
+
+    def items(self):
+        return self.Dict[self.store].items()
+
+    def __unicode__(self):
+        return unicode(repr(self.Dict[self.store]))
+
+    def setup_defaults(self):
+        raise NotImplementedError
+
+
+class Dicked(object):
+    """
+    mirrors a dictionary; readonly
+    """
+    _entries = None
+
+    def __init__(self, **entries):
+        self._entries = entries or None
+        for key, value in entries.iteritems():
+            self.__dict__[key] = (Dicked(**value) if isinstance(value, dict) else value)
+
+    def __repr__(self):
+        return str(self)
+
+    def __unicode__(self):
+        return unicode(self.__digged__)
+
+    def __str__(self):
+        return str(self.__digged__)
+
+    def __lt__(self, d):
+        return self._entries < d
+
+    def __le__(self, d):
+        return self._entries <= d
+
+    def __eq__(self, d):
+        if d is None and not self._entries:
+            return True
+
+        return self._entries == d
+
+    def __ne__(self, d):
+        return self._entries != d
+
+    def __gt__(self, d):
+        return self._entries > d
+
+    def __ge__(self, d):
+        return self._entries >= d
+
+    def __getattr__(self, name):
+        # fixme: this might be wildly stupid; maybe implement stuff like .iteritems() directly
+        return getattr(self._entries, name, Dicked())
+
+    @property
+    def __digged__(self):
+        return {key: value for key, value in self.__dict__.iteritems() if key != "_entries"}
+
+    def __len__(self):
+        return len(self.__digged__)
+
+    def __nonzero__(self):
+        return bool(self.__digged__)
+
+    def __iter__(self):
+        return iter(self.__digged__)
+
+    def __hash__(self):
+        return hash(self.__digged__)
+
+    def __getitem__(self, name):
+        if name in self._entries:
+            return getattr(self, name)
+        raise KeyError(name)
diff --git a/libs/subzero/lib/geezip.py b/libs/subzero/lib/geezip.py
new file mode 100644
index 000000000..89657834f
--- /dev/null
+++ b/libs/subzero/lib/geezip.py
@@ -0,0 +1,37 @@
+# coding=utf-8
+
+import gzip
+from zlib import Z_FINISH
+
+
+__all__ = ["GeezipFile", "open", "Z_FINISH"]
+
+
+def open(filename, mode="rb", compresslevel=9):
+    """Shorthand for GzipFile(filename, mode, compresslevel).
+
+    The filename argument is required; mode defaults to 'rb'
+    and compresslevel defaults to 9.
+
+    """
+    return GeezipFile(filename, mode, compresslevel)
+
+
+class GeezipFile(gzip.GzipFile):
+    def close(self):
+        fileobj = self.fileobj
+        if fileobj is None:
+            return
+        self.fileobj = None
+        try:
+            if self.mode == gzip.WRITE:
+                fileobj.write(self.compress.flush(Z_FINISH))
+                gzip.write32u(fileobj, self.crc)
+                # self.size may exceed 2GB, or even 4GB
+                gzip.write32u(fileobj, self.size & 0xffffffffL)
+                fileobj.flush()
+        finally:
+            myfileobj = self.myfileobj
+            if myfileobj:
+                self.myfileobj = None
+                myfileobj.close()
diff --git a/libs/subzero/lib/httpfake.py b/libs/subzero/lib/httpfake.py
new file mode 100644
index 000000000..93b591a55
--- /dev/null
+++ b/libs/subzero/lib/httpfake.py
@@ -0,0 +1,45 @@
+# coding=utf-8
+
+
+class PlexPyNativeResponseProxy(object):
+    """
+    The equally stupid counterpart to Sub-Zero.support.lib.PlexPyNativeRequestProxy.
+    Incompletely mimics a requests response object for the plex.py library to use.
+    """
+    data = None
+    headers = None
+    response_code = None
+    request = None
+
+    def __init__(self, response, status_code, request):
+        if response:
+            self.data = response.content
+            self.headers = response.headers
+        self.response_code = status_code
+        self.request = request
+
+    def content(self):
+        return self.data
+
+    content = property(content)
+
+    def status_code(self):
+        return self.response_code
+
+    status_code = property(status_code)
+
+    def url(self):
+        return self.request.url
+
+    url = property(url)
+
+    def __str__(self):
+        return str(self.data)
+
+    def __unicode__(self):
+        return unicode(self.data)
+
+    def __repr__(self):
+        return repr(self.data)
+
+
diff --git a/libs/subzero/lib/io.py b/libs/subzero/lib/io.py
new file mode 100644
index 000000000..07c442972
--- /dev/null
+++ b/libs/subzero/lib/io.py
@@ -0,0 +1,99 @@
+# coding=utf-8
+
+import os
+import sys
+
+from scandir import scandir as _scandir
+
+# thanks @ plex trakt scrobbler: https://github.com/trakt/Plex-Trakt-Scrobbler/blob/master/Trakttv.bundle/Contents/Libraries/Shared/plugin/core/io.py
+
+
+class FileIO(object):
+    @staticmethod
+    def exists(path):
+        return os.path.exists(path)
+
+    @staticmethod
+    def delete(path):
+        os.remove(path)
+
+    @staticmethod
+    def read(path, mode='r'):
+        with open(path, mode) as fp:
+            data = fp.read()
+
+        return data
+
+    @staticmethod
+    def write(path, data, mode='w'):
+        with open(path, mode) as fp:
+            fp.write(data)
+
+
+VALID_ENCODINGS = ("latin1", "utf-8", "mbcs")
+
+
+def get_viable_encoding():
+    # fixme: bad
+    encoding = sys.getfilesystemencoding()
+    return "utf-8" if not encoding or encoding.lower() not in VALID_ENCODINGS else encoding
+
+
+class ScandirListdirEntryStub(object):
+    """
+    A class which mimics the entries returned by scandir, for fallback purposes when using listdir instead.
+    """
+    __slots__ = ('name', '_d_type', '_stat', '_lstat', '_scandir_path', '_path', '_inode')
+
+    def __init__(self, scandir_path, name, d_type, inode):
+        self._scandir_path = scandir_path
+        self.name = name
+        self._d_type = d_type
+        self._inode = inode
+        self._stat = None
+        self._lstat = None
+        self._path = None
+
+    @property
+    def path(self):
+        if self._path is None:
+            self._path = os.path.join(self._scandir_path, self.name)
+        return self._path
+
+    def stat(self, follow_symlinks=True):
+        path = self.path
+        if follow_symlinks and self.is_symlink():
+            path = os.path.realpath(path)
+
+        return os.stat(path)
+
+    def is_dir(self, follow_symlinks=True):
+        path = self.path
+        if follow_symlinks and self.is_symlink():
+            path = os.path.realpath(path)
+
+        return os.path.isdir(path)
+
+    def is_file(self, follow_symlinks=True):
+        path = self.path
+        if follow_symlinks and self.is_symlink():
+            path = os.path.realpath(path)
+
+        return os.path.isfile(path)
+
+    def is_symlink(self):
+        return os.path.islink(self.path)
+
+
+def scandir_listdir_fallback(path):
+    for fn in os.listdir(path):
+        yield ScandirListdirEntryStub(path, fn, None, None)
+
+
+def scandir(path):
+    try:
+        return _scandir(path)
+
+    # fallback for systems where sys.getfilesystemencoding() returns the "wrong" value
+    except UnicodeDecodeError:
+        return scandir_listdir_fallback(path)
diff --git a/libs/subzero/lib/json.py b/libs/subzero/lib/json.py
new file mode 100644
index 000000000..d3f3184a2
--- /dev/null
+++ b/libs/subzero/lib/json.py
@@ -0,0 +1,40 @@
+# coding=utf-8
+from gzip import GzipFile
+
+from json_tricks import TricksEncoder
+from json_tricks.nonp import DEFAULT_ENCODERS, ENCODING, is_py3, BytesIO
+
+
+def dumps(obj, sort_keys=None, cls=TricksEncoder, obj_encoders=DEFAULT_ENCODERS, extra_obj_encoders=(),
+          primitives=False, compression=None, allow_nan=False, conv_str_byte=False, **jsonkwargs):
+    """
+    Convert a nested data structure to a json string.
+
+    :param obj: The Python object to convert.
+    :param sort_keys: Keep this False if you want order to be preserved.
+    :param cls: The json encoder class to use, defaults to NoNumpyEncoder which gives a warning for numpy arrays.
+    :param obj_encoders: Iterable of encoders to use to convert arbitrary objects into json-able promitives.
+    :param extra_obj_encoders: Like `obj_encoders` but on top of them: use this to add encoders without replacing defaults. Since v3.5 these happen before default encoders.
+    :param allow_nan: Allow NaN and Infinity values, which is a (useful) violation of the JSON standard (default False).
+    :param conv_str_byte: Try to automatically convert between strings and bytes (assuming utf-8) (default False).
+    :return: The string containing the json-encoded version of obj.
+
+    Other arguments are passed on to `cls`. Note that `sort_keys` should be false if you want to preserve order.
+    """
+    if not hasattr(extra_obj_encoders, '__iter__'):
+        raise TypeError('`extra_obj_encoders` should be a tuple in `json_tricks.dump(s)`')
+    encoders = tuple(extra_obj_encoders) + tuple(obj_encoders)
+    txt = cls(sort_keys=sort_keys, obj_encoders=encoders, allow_nan=allow_nan,
+              primitives=primitives, **jsonkwargs).encode(obj)
+    #if not is_py3 and isinstance(txt, str):
+    #    txt = unicode(txt, ENCODING)
+    if not compression:
+        return txt
+    if compression is True:
+        compression = 5
+    txt = txt.encode(ENCODING)
+    sh = BytesIO()
+    with GzipFile(mode='wb', fileobj=sh, compresslevel=compression) as zh:
+        zh.write(txt)
+    gzstring = sh.getvalue()
+    return gzstring
diff --git a/libs/subzero/lib/rar.py b/libs/subzero/lib/rar.py
new file mode 100644
index 000000000..8e9cdafc8
--- /dev/null
+++ b/libs/subzero/lib/rar.py
@@ -0,0 +1,25 @@
+# coding=utf-8
+
+import logging
+import rarfile
+
+log = logging.getLogger(__name__)
+
+
+class RarFile(rarfile.RarFile):
+    def read(self, fname, psw=None):
+        """
+        read specific content of rarfile without parsing
+        :param fname:
+        :param psw:
+        :return:
+        """
+        cmd = [rarfile.UNRAR_TOOL] + list(rarfile.ORIG_OPEN_ARGS)
+
+        with rarfile.XTempFile(self._rarfile) as rf:
+            log.debug(u"RAR CMD: %s", cmd + [rf, fname])
+            p = rarfile.custom_popen(cmd + [rf, fname])
+            output = p.communicate()[0]
+            rarfile.check_returncode(p, output)
+
+            return output
diff --git a/libs/subzero/lib/which.py b/libs/subzero/lib/which.py
new file mode 100644
index 000000000..e65a7d900
--- /dev/null
+++ b/libs/subzero/lib/which.py
@@ -0,0 +1,42 @@
+# coding=utf-8
+
+# https://gist.github.com/4368898
+# Public domain code by anatoly techtonik <[email protected]>
+# AKA Linux `which` and Windows `where`
+
+import os
+import sys
+
+
+def find_executable(executable, path=None):
+    """Find if 'executable' can be run. Looks for it in 'path'
+    (string that lists directories separated by 'os.pathsep';
+    defaults to os.environ['PATH']). Checks for all executable
+    extensions. Returns full path or None if no command is found.
+    """
+    if path is None:
+        path = os.environ['PATH']
+    paths = path.split(os.pathsep)
+    extlist = ['']
+    if os.name == 'os2':
+        (base, ext) = os.path.splitext(executable)
+        # executable files on OS/2 can have an arbitrary extension, but
+        # .exe is automatically appended if no dot is present in the name
+        if not ext:
+            executable = executable + ".exe"
+    elif sys.platform == 'win32':
+        pathext = os.environ['PATHEXT'].lower().split(os.pathsep)
+        (base, ext) = os.path.splitext(executable)
+        if ext.lower() not in pathext:
+            extlist = pathext
+    for ext in extlist:
+        execname = executable + ext
+        if os.path.isfile(execname):
+            return execname
+        else:
+            for p in paths:
+                f = os.path.join(p, execname)
+                if os.path.isfile(f):
+                    return f
+    else:
+        return None
diff --git a/libs/subzero/modification/__init__.py b/libs/subzero/modification/__init__.py
new file mode 100644
index 000000000..d6008b17b
--- /dev/null
+++ b/libs/subzero/modification/__init__.py
@@ -0,0 +1,5 @@
+# coding=utf-8
+
+from registry import registry
+from mods import hearing_impaired, ocr_fixes, fps, offset, common, color
+from main import SubtitleModifications, SubMod
diff --git a/libs/subzero/modification/dictionaries/__init__.py b/libs/subzero/modification/dictionaries/__init__.py
new file mode 100644
index 000000000..201b7409a
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/__init__.py
@@ -0,0 +1,3 @@
+# coding=utf-8
+
+from data import data
\ No newline at end of file
diff --git a/libs/subzero/modification/dictionaries/data.py b/libs/subzero/modification/dictionaries/data.py
new file mode 100644
index 000000000..2ec9253f7
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/data.py
@@ -0,0 +1,198 @@
+import re
+from collections import OrderedDict
+data = {'bos': {'BeginLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'EndLines': {'data': OrderedDict(),
+                      'pattern': None},
+         'PartialLines': {'data': OrderedDict([(u'da nadjem', u'na\u0107i'), (u'da nadjes', u'na\u0107i'), (u'da budes', u'biti'), (u'da ides', u'i\u0107i'), (u'da prodemo', u'pro\u0107i'), (u'da udem', u'u\u0107i'), (u'gdje ides', u'kamo ide\u0161'), (u'Gdje ides', u'Kamo ide\u0161'), (u'hocu da budem', u'\u017eelim biti'), (u'Hocu da budem', u'\u017delim biti'), (u'hocu da kazem', u'\u017eelim re\u0107i'), (u'hoces da kazes', u'\u017eeli\u0161 re\u0107i'), (u'hoce da kaze', u'\u017eeli re\u0107i'), (u'kao sto sam', u'kao \u0161to sam'), (u'me leda', u'me le\u0111a'), (u'medu nama', u'me\u0111u nama'), (u'moramo da idemo', u'moramo i\u0107i'), (u'moras da ides', u'mora\u0161 i\u0107i'), (u'na vecer', u'nave\u010der'), (u'Na vecer', u'Nave\u010der'), (u'ne cu', u'ne\u0107u'), (u'ne ces', u'ne\u0107e\u0161'), (u'ne\u0161to sto', u'ne\u0161to \u0161to'), (u'ono sto', u'ono \u0161to'), (u'Ono sto', u'Ono \u0161to'), (u'reci \u0107u', u're\u0107i \u0107u'), (u'sto ti se ne', u'\u0161to ti se ne'), (u'sto vise', u'\u0161to vi\u0161e'), (u'sve sto', u'sve \u0161to'), (u'Zao mi', u'\u017dao mi'), (u'zao mi', u'\u017eao mi'), (u'Zato sto', u'Zato \u0161to'), (u'zato sto', u'zato \u0161to'), (u'znas sto', u'zna\u0161 \u0161to'), (u'zna\u0161 sto', u'zna\u0161 \u0161to')]),
+                          'pattern': u'(?um)(?:(?<=\\s)|(?<=^)|(?<=\\b))(?:da\\ nadjem|da\\ nadjes|da\\ budes|da\\ ides|da\\ prodemo|da\\ udem|gdje\\ ides|Gdje\\ ides|hocu\\ da\\ budem|Hocu\\ da\\ budem|hocu\\ da\\ kazem|hoces\\ da\\ kazes|hoce\\ da\\ kaze|kao\\ sto\\ sam|me\\ leda|medu\\ nama|moramo\\ da\\ idemo|moras\\ da\\ ides|na\\ vecer|Na\\ vecer|ne\\ cu|ne\\ ces|ne\\\u0161to\\ sto|ono\\ sto|Ono\\ sto|reci\\ \\\u0107u|sto\\ ti\\ se\\ ne|sto\\ vise|sve\\ sto|Zao\\ mi|zao\\ mi|Zato\\ sto|zato\\ sto|znas\\ sto|zna\\\u0161\\ sto)(?:(?=\\s)|(?=$)|(?=\\b))'},
+         'PartialWordsAlways': {'data': OrderedDict([(u'\xb6\xb6', u'\u266b'), (u'\xb6', u'\u266a')]),
+                                'pattern': None},
+         'WholeLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'WholeWords': {'data': OrderedDict([(u'andele', u'an\u0111ele'), (u'andeli', u'an\u0111eli'), (u'bacas', u'baca\u0161'), (u'bas', u'ba\u0161'), (u'Bas', u'Ba\u0161'), (u'basta', u'vrt'), (u'Basta', u'Vrt'), (u'baste', u'vrtovi'), (u'Baste', u'Vrtovi'), (u'basti', u'vrtu'), (u'Basti', u'Vrtu'), (u'bastom', u'vrtom'), (u'Bastom', u'Vrtom'), (u'bastu', u'vrt'), (u'Bastu', u'Vrt'), (u'Bice', u'Bi\u0107e'), (u'bice', u'bi\u0107e'), (u'Bice\u0161', u'Bit \u0107e\u0161'), (u'Bicu', u'Bit \u0107u'), (u'bicu', u'bi\u0107u'), (u'blagonaklonoscu', u'blagonaklono\u0161\u0107u'), (u'blizi', u'bli\u017ei'), (u'bljesti', u'blije\u0161ti'), (u'Bljesti', u'Blije\u0161ti'), (u'bojis', u'boji\u0161'), (u'braca', u'bra\u0107a'), (u'Braca', u'Bra\u0107a'), (u'broncane', u'bron\u010dane'), (u'broncanu', u'bron\u010danu'), (u'budes', u'bude\u0161'), (u'caj', u'\u010daj'), (u'caja', u'\u010daja'), (u'Cak', u'\u010cak'), (u'cak', u'\u010dak'), (u'cale', u'tata'), (u'Cao', u'\u0106ao'), (u'cao', u'\u0107ao'), (u'cas', u'sat'), (u'casno', u'\u010dasno'), (u'Casno', u'\u010casno'), (u'castis', u'\u010dasti\u0161'), (u'casu', u'ca\u0161u'), (u'ca\u0161u', u'\u010da\u0161u'), (u'cebe', u'deku'), (u'cega', u'\u010dega'), (u'Cek', u'\u010cek'), (u'cek', u'\u010dek'), (u'cekali', u'\u010dekali'), (u'cekas', u'\u010deka\u0161'), (u'Cemu', u'\u010cemu'), (u'cemu', u'\u010demu'), (u'cerka', u'k\u0107i'), (u'Cerka', u'K\u0107i'), (u'cerke', u'k\u0107eri'), (u'Cerke', u'K\u0107eri'), (u'cerku', u'k\u0107er'), (u'Cerku', u'K\u0107er'), (u'ces', u'\u0107e\u0161'), (u'cesce', u'\u010de\u0161\u0107e'), (u'Cesce', u'\u010ce\u0161\u0107e'), (u'Ceskoj', u'\u010ce\u0161koj'), (u'cestitki', u'\u010destitki'), (u'cesto', u'\u010desto'), (u'Cesto', u'\u010cesto'), (u'cetiri', u'\u010detiri'), (u'Cetiri', u'\u010cetiri'), (u'cetri', u'\u010detiri'), (u'cetu', u'\u010detu'), (u'ceznja', u'\u010de\u017enja'), (u'ceznje', u'\u010de\u017enje'), (u'ceznji', u'\u010de\u017enji'), (u'ceznjom', u'\u010de\u017enjom'), (u'ceznju', u'\u010de\u017enju'), (u'ceznu', u'\u010deznu'), (u'ce\u0161', u'\u0107e\u0161'), (u'Cija', u'\u010cija'), (u'cija', u'\u010dija'), (u'cije', u'\u010dije'), (u'Ciji', u'\u010ciji'), (u'ciji', u'\u010diji'), (u'cijih', u'\u010dijih'), (u'Cijih', u'\u010cijih'), (u'cijim', u'\u010dijim'), (u'Cijim', u'\u010cijim'), (u'Cim', u'\u010cim'), (u'cim', u'\u010dim'), (u'cime', u'\u010dime'), (u'cinila', u'\u010dinila'), (u'cinili', u'\u010dinili'), (u'cinio', u'\u010dinio'), (u'cinis', u'\u010dini\u0161'), (u'ciniti', u'\u010diniti'), (u'cipka', u'\u010dipka'), (u'cipku', u'\u010dipku'), (u'cita', u'\u010dita'), (u'citao', u'\u010ditao'), (u'citas', u'\u010dita\u0161'), (u'citavu', u'\u010ditavu'), (u'cizme', u'\u010dizme'), (u'clan', u'\u010dlan'), (u'Clan', u'\u010clan'), (u'clanke', u'\u010dlanke'), (u'clanove', u'\u010dlanove'), (u'clanovi', u'\u010dlanovi'), (u'clanovima', u'\u010dlanovima'), (u'cmo', u'\u0107emo'), (u'corsokak', u'slijepa ulica'), (u'corsokaku', u'slijepoj ulici'), (u'cosak', u'ugao'), (u'cosku', u'uglu'), (u'covece', u'\u010dovje\u010de'), (u'covek', u'\u010dovjek'), (u'covjece', u'\u010dovje\u010de'), (u'covjecnost', u'\u010dovje\u010dnost'), (u'covjek', u'\u010dovjek'), (u'covjeka', u'\u010dovjeka'), (u'covjeku', u'\u010dovjeku'), (u'crpeci', u'crpe\u0107i'), (u'cte', u'\u0107ete'), (u'Cu', u'\u0106u'), (u'Ce\u0161', u'\u0106e\u0161'), (u'Ce', u'\u0106e'), (u'Cemo', u'\u0106emo'), (u'Cete', u'\u0106ete'), (u'cu', u'\u0107u'), (u'ce', u'\u0107e'), (u'cemo', u'\u0107emo'), (u'cete', u'\u0107ete'), (u'cudi', u'\u010dudi'), (u'Cudo', u'\u010cudo'), (u'cudo', u'\u010dudo'), (u'Cujte', u'\u010cujte'), (u'cula', u'\u010dula'), (u'culi', u'\u010duli'), (u'Culi', u'\u010culi'), (u'culima', u'\u010dulima'), (u'cuo', u'\u010duo'), (u'Cuo', u'\u010cuo'), (u'cupam', u'\u010dupam'), (u'cutanje', u'\u0161utnja'), (u'Cutanje', u'\u0160utnja'), (u'cutao', u'\u0161utio'), (u'Cutao', u'\u0160utio'), (u'cuti', u'\u010duti'), (u'cutljiv', u'\u0161utljiv'), (u'cutnja', u'\u0161utnja'), (u'cuvali', u'\u010duvali'), (u'cuveni', u'\u010duveni'), (u'dace', u'dat \u0107e'), (u'dacemo', u'dat \u0107emo'), (u'davo', u'vrag'), (u'definise', u'definira'), (u'definisi', u'definiraj'), (u'Desava', u'Doga\u0111a'), (u'desava', u'doga\u0111a'), (u'disemo', u'di\u0161emo'), (u'disi', u'di\u0161i'), (u'dobijes', u'dobije\u0161'), (u'dobivas', u'dobiva\u0161'), (u'doci', u'do\u0107i'), (u'dode', u'do\u0111e'), (u'dodem', u'do\u0111em'), (u'dodes', u'do\u0111e\u0161'), (u'dodete', u'do\u0111ete'), (u'dode\u0161', u'do\u0111e\u0161'), (u'Dodi', u'Do\u0111i'), (u'dodi', u'do\u0111i'), (u'dodite', u'do\u0111ite'), (u'Dodji', u'Do\u0111i'), (u'dodji', u'do\u0111i'), (u'Dodjite', u'Do\u0111ite'), (u'dodjite', u'do\u0111ite'), (u'Dodju', u'Do\u0111u'), (u'dodju', u'do\u0111u'), (u'dodu', u'do\u0111u'), (u'dolazis', u'dolazi\u0161'), (u'dopustao', u'dopu\u0161tao'), (u'dorucak', u'doru\u010dak'), (u'dorucku', u'doru\u010dku'), (u'Dosao', u'Do\u0161ao'), (u'dosao', u'do\u0161ao'), (u'drhteci', u'drhte\u0107i'), (u'drhte\u0107i', u'drhte\u0107i'), (u'Drhte\u0107i', u'Drhte\u0107i'), (u'drugacija', u'druga\u010dija'), (u'Drugacije', u'Druga\u010dije'), (u'drugacije', u'druga\u010dije'), (u'drugaciji', u'druga\u010diji'), (u'Drugaciji', u'Druga\u010diji'), (u'drukciji', u'druga\u010diji'), (u'drveca', u'drve\u0107a'), (u'drvece', u'drve\u0107e'), (u'drvecem', u'drve\u0107em'), (u'drvecu', u'drve\u0107u'), (u'drzi', u'dr\u017ei'), (u'Drzim', u'Dr\u017eim'), (u'dugmici', u'gumbi\u0107i'), (u'duze', u'du\u017ee'), (u'duzinom', u'du\u017einom'), (u'dzanki', u'ovisnik'), (u'Dzejk', u'Jake'), (u'Dzime', u'Jime'), (u'Dzone', u'Johne'), (u'flasom', u'fla\u0161om'), (u'flasu', u'fla\u0161u'), (u'fucka', u'fu\u0107ka'), (u'funkcionisu', u'funkcioniraju'), (u'gacice', u'ga\u0107ice'), (u'gadao', u'ga\u0111ao'), (u'gadis', u'gadi\u0161'), (u'Gadis', u'Gadi\u0161'), (u'gdica', u'g\u0111ica'), (u'gdice', u'g\u0111ice'), (u'gdici', u'g\u0111ici'), (u'gdicu', u'g\u0111icu'), (u'gdu', u'g\u0111u'), (u'glupaco', u'glupa\u010do'), (u'govoris', u'govori\u0161'), (u'gradani', u'gra\u0111ani'), (u'gradic', u'gradi\u0107'), (u'gradica', u'gradi\u0107a'), (u'gradicu', u'gradi\u0107u'), (u'grancica', u'gran\u010dica'), (u'grancicu', u'gran\u010dicu'), (u'gresci', u'gre\u0161ci'), (u'grese', u'grije\u0161e'), (u'greski', u'gre\u0161ci'), (u'gresku', u'gre\u0161ku'), (u'gubis', u'gubi\u0161'), (u'Hoces', u'Ho\u0107e\u0161'), (u'hoces', u'ho\u0107e\u0161'), (u'hocu', u'ho\u0107u'), (u'Hocu', u'Ho\u0107u'), (u'hodas', u'hoda\u0161'), (u'htjeo', u'htio'), (u'iceg', u'i\u010deg'), (u'icega', u'i\u010dega'), (u'icemu', u'i\u010demu'), (u'Ici', u'I\u0107i'), (u'ici', u'i\u0107i'), (u'Ides', u'Ide\u0161'), (u'ides', u'ide\u0161'), (u'iduce', u'idu\u0107e'), (u'iduceg', u'idu\u0107eg'), (u'iducem', u'idu\u0107em'), (u'Iduci', u'Idu\u0107i'), (u'iduci', u'idu\u0107i'), (u'ignorisi', u'ignoriraju'), (u'igras', u'igra\u0161'), (u'Ijudi', u'ljudi'), (u'imas', u'ima\u0161'), (u'imidz', u'imid\u017e'), (u'inace', u'ina\u010de'), (u'Inace', u'Ina\u010de'), (u'isao', u'i\u0161ao'), (u'Isao', u'I\u0161ao'), (u'iscupao', u'i\u0161\u010dupao'), (u'ise\u0107emo', u'izrezati'), (u'isla', u'i\u0161la'), (u'istjece', u'istje\u010de'), (u'istrazio', u'istrazio'), (u'Istrazio', u'Istrazio'), (u'isuvise', u'previ\u0161e'), (u'izaci', u'iza\u0107i'), (u'Izaci', u'Iza\u0107i'), (u'izade', u'iza\u0111e'), (u'Izade', u'Iza\u0111e'), (u'izadem', u'iza\u0111em'), (u'izades', u'iza\u0111e\u0161'), (u'izadete', u'iza\u0111ete'), (u'Izadi', u'Iza\u0111i'), (u'izadi', u'iza\u0111i'), (u'izasao', u'iza\u0161ao'), (u'izasla', u'iza\u0161la'), (u'izici', u'izi\u0107i'), (u'izluduje', u'izlu\u0111uje'), (u'izluduju', u'izlu\u0111uju'), (u'izmedu', u'izme\u0111u'), (u'Izmedu', u'Izme\u0111u'), (u'izostri', u'izo\u0161tri'), (u'izostrim', u'izo\u0161trim'), (u'izvuci', u'izvu\u0107i'), (u'i\u0161cupao', u'i\u0161\u010dupao'), (u'jebes', u'jebe\u0161'), (u'Jebes', u'Jebe\u0161'), (u'jos', u'jo\u0161'), (u'Jos', u'Jo\u0161'), (u'juce', u'ju\u010der'), (u'Juce', u'Ju\u010der'), (u'jucer', u'ju\u010der'), (u'Jucer', u'Ju\u010der'), (u'kaslja', u'ka\u0161lja'), (u'kaze', u'ka\u017ee'), (u'Kaze', u'Ka\u017ee'), (u'kazemo', u'ka\u017eemo'), (u'kazite', u'ka\u017eite'), (u'Kazite', u'Ka\u017eite'), (u'kazu', u'ka\u017eu'), (u'Kcer', u'K\u0107er'), (u'kcer', u'k\u0107er'), (u'kcerka', u'k\u0107i'), (u'Kcerka', u'K\u0107i'), (u'kcerkama', u'k\u0107erima'), (u'kcerku', u'k\u0107er'), (u'Kcerku', u'K\u0107er'), (u'kecap', u'ke\u010dap'), (u'kecapa', u'ke\u010dapa'), (u'kise', u'ki\u0161e'), (u'kisi', u'ki\u0161i'), (u'kleknes', u'klekne\u0161'), (u'kociji', u'ko\u010diji'), (u'kolaca', u'kola\u010da'), (u'kolace', u'kola\u010de'), (u'komadic', u'komadi\u0107'), (u'komsijama', u'susjedima'), (u'komsije', u'susjedi'), (u'komsiji', u'susjedu'), (u'komsiluk', u'susjedstvo'), (u'komsiluku', u'susjedstvu'), (u'kom\u0161ija', u'susjed'), (u'Kom\u0161ija', u'Susjed'), (u'Konkurise', u'Konkurira'), (u'konkurise', u'konkurira'), (u'konkurisem', u'konkuriram'), (u'konkurisu', u'konkuriraju'), (u'kontrolisu', u'kontroliraju'), (u'kosulja', u'ko\u0161ulja'), (u'kosulje', u'ko\u0161ulje'), (u'kosulji', u'ko\u0161ulji'), (u'kosulju', u'ko\u0161ulju'), (u'kovceg', u'kov\u010deg'), (u'kovcegu', u'kov\u010degu'), (u'krada', u'kra\u0111a'), (u'Krada', u'Kra\u0111a'), (u'Krece', u'Kre\u0107e'), (u'krece', u'kre\u0107e'), (u'Kreci', u'Kre\u0107i'), (u'kreci', u'kre\u0107i'), (u'krecu', u'kre\u0107u'), (u'kre\u0107es', u'kre\u0107e\u0161'), (u'krosnje', u'kro\u0161nje'), (u'krvaris', u'krvari\u0161'), (u'kuca', u'ku\u0107a'), (u'kucama', u'ku\u0107ama'), (u'kuce', u'ku\u0107e'), (u'kuci', u'ku\u0107i'), (u'kusa', u'ku\u0161a'), (u'kusas', u'ku\u0161a\u0161'), (u'ku\u010da', u'ku\u0107a'), (u'ku\u010di', u'ku\u0107i'), (u'lakocom', u'lako\u0107om'), (u'laz', u'la\u017e'), (u'lazac', u'la\u017eljivac'), (u'laze', u'la\u017ee'), (u'lazi', u'la\u017ei'), (u'lazne', u'la\u017ene'), (u'lazni', u'la\u017eni'), (u'lazov', u'la\u017eljivac'), (u'ledja', u'le\u0111a'), (u'ledjima', u'le\u0111ima'), (u'leprsa', u'lepr\u0161a'), (u'lezala', u'le\u017eala'), (u'lezali', u'le\u017eali'), (u'lezati', u'le\u017eati'), (u'lezis', u'le\u017ei\u0161'), (u'Lezis', u'Le\u017ei\u0161'), (u'lici', u'li\u010di'), (u'licim', u'li\u010dim'), (u'licis', u'li\u010di\u0161'), (u'licnost', u'li\u010dnost'), (u'licnosti', u'li\u010dnosti'), (u'lijecniku', u'lije\u010dniku'), (u'ljubis', u'ljubi\u0161'), (u'los', u'lo\u0161'), (u'losa', u'lo\u0161a'), (u'losu', u'lo\u0161u'), (u'majcine', u'maj\u010dine'), (u'masini', u'ma\u0161ini'), (u'medu', u'me\u0111u'), (u'Medutim', u'Me\u0111utim'), (u'medutim', u'me\u0111utim'), (u'mici', u'mi\u010di'), (u'Mici', u'Mi\u010di'), (u'micu', u'mi\u010du'), (u'mislis', u'misli\u0161'), (u'Mislis', u'Misli\u0161'), (u'mjesecevom', u'mjese\u010devom'), (u'mjesecine', u'mjese\u010dine'), (u'mjesecini', u'mjese\u010dini'), (u'mjesecinu', u'mjese\u010dinu'), (u'mladic', u'mladi\u0107'), (u'moc', u'mo\u0107'), (u'moci', u'mo\u0107i'), (u'motivisu', u'motiviraju'), (u'mozda', u'mo\u017eda'), (u'Mozda', u'Mo\u017eda'), (u'moze', u'mo\u017ee'), (u'mozete', u'mo\u017eete'), (u'mreza', u'mre\u017ea'), (u'mrezu', u'mre\u017eu'), (u'mrzis', u'mrzi\u0161'), (u'muce', u'mu\u010de'), (u'mucenik', u'mu\u010denik'), (u'mucne', u'mu\u010dne'), (u'muska', u'mu\u0161ka'), (u'muz', u'mu\u017e'), (u'muza', u'mu\u017ea'), (u'naci', u'na\u0107i'), (u'Naci', u'Na\u0107i'), (u'nacin', u'na\u010din'), (u'nadem', u'na\u0111em'), (u'Nadem', u'Na\u0111em'), (u'nademo', u'na\u0111emo'), (u'nades', u'na\u0111e\u0161'), (u'Nades', u'Na\u0111e\u0161'), (u'nadete', u'na\u0111ete'), (u'nadici', u'nadi\u0107i'), (u'nadje', u'na\u0111e'), (u'Nadje', u'Na\u0111e'), (u'nadjen', u'na\u0111en'), (u'nadjes', u'na\u0111e\u0161'), (u'Nadjes', u'Na\u0111e\u0161'), (u'nadjete', u'na\u0111ete'), (u'nagovestaj', u'nagovje\u0161taj'), (u'najvise', u'najvise'), (u'Najvise', u'Najvi\u0161e'), (u'naklonoscu', u'nakolono\u0161\u0107u'), (u'naocale', u'nao\u010dale'), (u'Napisite', u'Napi\u0161ite'), (u'nasa', u'na\u0161a'), (u'Nase', u'Na\u0161e'), (u'nase', u'na\u0161e'), (u'naseg', u'na\u0161eg'), (u'nasi', u'na\u0161i'), (u'Nasi', u'Na\u0161i'), (u'nasao', u'na\u0161ao'), (u'Nasao', u'Na\u0161ao'), (u'nasla', u'na\u0161la'), (u'Nasla', u'Na\u0161la'), (u'nasli', u'na\u0161li'), (u'Nasli', u'Na\u0161li'), (u'nasoj', u'na\u0161oj'), (u'nasrecu', u'na sre\u0107u'), (u'nastavis', u'nastavi\u0161'), (u'nasu', u'na\u0161u'), (u'nauce', u'nau\u010de'), (u'neceg', u'ne\u010deg'), (u'necega', u'ne\u010dega'), (u'necemo', u'ne\u0107emo'), (u'necemu', u'ne\u010demu'), (u'necije', u'ne\u010dije'), (u'neciji', u'ne\u010diji'), (u'necim', u'ne\u010dim'), (u'necovjecnost', u'ne\u010dovje\u010dnost'), (u'necovjecnosti', u'ne\u010dovje\u010dnosti'), (u'necu', u'ne\u0107u'), (u'Necu', u'Ne\u0107u'), (u'nekaze', u'ne ka\u017ee'), (u'nekoc', u'neko\u0107'), (u'Nemas', u'Nema\u0161'), (u'nemas', u'nema\u0161'), (u'Nesreca', u'Nesre\u0107a'), (u'nesto', u'ne\u0161to'), (u'Nesto', u'Ne\u0161to'), (u'new yorski', u'njujor\u0161ki'), (u'Nezan', u'Nje\u017ean'), (u'nezan', u'nje\u017ean'), (u'nezna', u'nje\u017ena'), (u'Neznam', u'Ne znam'), (u'Neznas', u'Ne znas'), (u'Neznajuci', u'Ne znaju\u0107i'), (u'Neznavsi', u'Ne znav\u0161i'), (u'neznam', u'ne znam'), (u'neznas', u'ne znas'), (u'neznajuci', u'ne znaju\u0107i'), (u'neznavsi', u'ne znav\u0161i'), (u'nezni', u'nje\u017eni'), (u'neznih', u'nje\u017enih'), (u'neznim', u'nje\u017enim'), (u'nezno', u'nje\u017eno'), (u'neznu', u'nje\u017enu'), (u'niceg', u'ni\u010deg'), (u'nicega', u'ni\u010dega'), (u'nicemu', u'ni\u010demu'), (u'nicija', u'ni\u010dija'), (u'niciji', u'ni\u010diji'), (u'nicim', u'ni\u010dim'), (u'njezno', u'nje\u017eno'), (u'nju jorski', u'njujor\u0161ki'), (u'noci', u'no\u0107i'), (u'nocnu', u'no\u0107nu'), (u'nosac', u'nosa\u010d'), (u'nosices', u'nosit \u0107e\u0161'), (u'nosis', u'nosi\u0161'), (u'noz', u'no\u017e'), (u'nozem', u'no\u017eem'), (u'Obecao', u'Obe\u0107ao'), (u'Obezbedjuju', u'Osiguravaju'), (u'obezbedjuju', u'osiguravaju'), (u'obide', u'obi\u0111e'), (u'objasnis', u'objasni\u0161'), (u'obozavalac', u'obo\u017eavatelj'), (u'obracas', u'obra\u0107a\u0161'), (u'obra\u0107as', u'obra\u0107a\u0161'), (u'obuce', u'obu\u010de'), (u'obucem', u'obu\u010dem'), (u'oceve', u'o\u010deve'), (u'ocito', u'o\u010dito'), (u'ocnjaci', u'o\u010dnjaci'), (u'odes', u'ode\u0161'), (u'odlazis', u'odlazi\u0161'), (u'odlezati', u'odle\u017eati'), (u'odlucim', u'odlu\u010dim'), (u'odmice', u'odmi\u010de'), (u'odraduje', u'odra\u0111uje'), (u'odreden', u'odre\u0111en'), (u'odreduje', u'odre\u0111uje'), (u'odredujemo', u'odre\u0111ujemo'), (u'odvec', u'odve\u0107'), (u'ogrtac', u'ogrta\u010d'), (u'ohrabrujuce', u'ohrabruju\u0107e'), (u'ojacam', u'oja\u010dam'), (u'okrece', u'okre\u0107e'), (u'opasac', u'opasa\u010d'), (u'operise', u'operira'), (u'operisemo', u'operiramo'), (u'operisete', u'operirate'), (u'operise\u0161', u'operira\u0161'), (u'osecaces', u'osje\u0107at \u0107e\u0161'), (u'osjecaces', u'osje\u0107at \u0107e\u0161'), (u'osjecam', u'osje\u0107am'), (u'osjecanja', u'osje\u0107anja'), (u'oslobada', u'osloba\u0111a'), (u'ostra', u'o\u0161tra'), (u'ostre', u'o\u0161tre'), (u'ostri', u'o\u0161tri'), (u'ostrom', u'o\u0161trom'), (u'ostru', u'o\u0161tru'), (u'osvrnes', u'osvrne\u0161'), (u'Osvrnes', u'Osvrne\u0161'), (u'otezala', u'ote\u017eala'), (u'otidi', u'oti\u0111i'), (u'otidji', u'oti\u0111i'), (u'otisao', u'oti\u0161ao'), (u'oziljak', u'o\u017eiljak'), (u'palaca', u'pala\u010da'), (u'palaci', u'pala\u010di'), (u'palacu', u'pala\u010du'), (u'papucama', u'papu\u010dama'), (u'parce', u'komadi\u0107'), (u'pateci', u'pate\u0107i'), (u'patis', u'pati\u0161'), (u'pcela', u'p\u010dela'), (u'pcele', u'p\u010dele'), (u'pecini', u'pe\u0107ini'), (u'pecinski', u'pe\u0107inski'), (u'peraca', u'pera\u010da'), (u'Peraci', u'Pera\u010di'), (u'pica', u'pi\u0107a'), (u'pice', u'pi\u0107e'), (u'picem', u'pi\u0107em'), (u'pijes', u'pije\u0161'), (u'pisacoj', u'pisa\u0107oj'), (u'pise', u'pi\u0161e'), (u'pisem', u'pi\u0161em'), (u'pisemo', u'pi\u0161emo'), (u'pises', u'pi\u0161e\u0161'), (u'pisite', u'pi\u0161ite'), (u'pisu', u'pi\u0161u'), (u'pitas', u'pita\u0161'), (u'placa', u'pla\u0107a'), (u'placam', u'pla\u0107am'), (u'placanje', u'pla\u0107anje'), (u'placanjem', u'pla\u0107anjem'), (u'place', u'pla\u010de'), (u'placem', u'pla\u010dem'), (u'placete', u'pla\u010dete'), (u'place\u0161', u'pla\u010de\u0161'), (u'placu', u'pla\u0107u'), (u'placuci', u'pla\u010du\u0107i'), (u'Plasi', u'Boji'), (u'plazi', u'pla\u017ei'), (u'plazu', u'pla\u017eu'), (u'plese', u'ple\u0161e'), (u'plesemo', u'ple\u0161emo'), (u'plesete', u'ple\u0161ete'), (u'plesu', u'ple\u0161u'), (u'ploca', u'plo\u010da'), (u'ploce', u'plo\u010de'), (u'pluca', u'plu\u0107a'), (u'plucima', u'plu\u0107ima'), (u'pobjeci', u'pobje\u0107i'), (u'pobjeduje', u'pobje\u0111uje'), (u'poceli', u'po\u010deli'), (u'poceo', u'po\u010deo'), (u'pocetak', u'po\u010detak'), (u'pocevsi', u'po\u010dev\u0161i'), (u'pocev\u0161i', u'po\u010dev\u0161i'), (u'poci', u'po\u0107i'), (u'pocinje', u'po\u010dinje'), (u'pociva', u'po\u010diva'), (u'pocivali', u'po\u010divali'), (u'pocivao', u'po\u010divao'), (u'pode', u'po\u0111e'), (u'podi', u'po\u0111i'), (u'podici', u'podi\u0107i'), (u'Podici', u'Podi\u0107i'), (u'podimo', u'po\u0111imo'), (u'Podimo', u'Po\u0111imo'), (u'podje', u'po\u0111e'), (u'Podje', u'Po\u0111e'), (u'Podji', u'Po\u0111i'), (u'podji', u'po\u0111i'), (u'podneses', u'podnese\u0161'), (u'podocnjacima', u'podo\u010dnjacima'), (u'podocnjake', u'podo\u010dnjake'), (u'podstice', u'poti\u010de'), (u'poduzeca', u'poduze\u0107a'), (u'poduzece', u'poduze\u0107e'), (u'poduzecu', u'poduze\u0107u'), (u'pojesce', u'pojest \u0107e'), (u'pojiliste', u'pojili\u0161te'), (u'pokazi', u'poka\u017ei'), (u'Pokazi', u'Poka\u017ei'), (u'pokrece', u'pokre\u0107e'), (u'pokusaj', u'poku\u0161aj'), (u'pokusam', u'poku\u0161am'), (u'pokusas', u'poku\u0161a\u0161'), (u'poletis', u'poleti\u0161'), (u'polozaja', u'polo\u017eaja'), (u'polozaju', u'polo\u017eaju'), (u'pomaci', u'pomaknuti'), (u'pomazes', u'poma\u017ee\u0161'), (u'pomislis', u'pomisli\u0161'), (u'pomognes', u'pomogne\u0161'), (u'poneses', u'ponese\u0161'), (u'ponovis', u'ponovi\u0161'), (u'poreci', u'pore\u0107i'), (u'porice', u'pori\u010de'), (u'posalji', u'po\u0161alji'), (u'Posalji', u'Po\u0161alji'), (u'posaljite', u'po\u0161aljite'), (u'posle', u'poslije'), (u'posluzili', u'poslu\u017eili'), (u'Posluzite', u'Poslu\u017eite'), (u'posluzite', u'poslu\u017eite'), (u'postaras', u'pobrine\u0161'), (u'posto', u'po\u0161to'), (u'Posto', u'Po\u0161to'), (u'potece', u'pote\u010de'), (u'potice', u'poti\u010de'), (u'potici', u'poti\u010di'), (u'potjece', u'potje\u010de'), (u'potjecem', u'potje\u010dem'), (u'potjeces', u'potje\u010de\u0161'), (u'potpises', u'potpi\u0161e\u0161'), (u'povedes', u'povede\u0161'), (u'pozuda', u'po\u017euda'), (u'pozude', u'po\u017eude'), (u'pozudi', u'po\u017eudi'), (u'pozudu', u'po\u017eudu'), (u'prakticno', u'prakti\u010dno'), (u'premasuje', u'prema\u0161uje'), (u'premasuju', u'prema\u0161uju'), (u'preporuca', u'preporu\u010duje'), (u'presao', u'pre\u0161ao'), (u'presjecen', u'presje\u010den'), (u'Previse', u'Previ\u0161e'), (u'previse', u'previ\u0161e'), (u'preziveo', u'pre\u017eivio'), (u'Priblizi', u'Pribli\u017ei'), (u'price', u'pri\u010de'), (u'prici', u'pri\u010di'), (u'pricu', u'pri\u010du'), (u'Pridji', u'Pri\u0111i'), (u'pridji', u'pri\u0111i'), (u'prijeci', u'prije\u0107i'), (u'prijedi', u'prije\u0111i'), (u'prilazis', u'prilazi\u0161'), (u'prisao', u'pri\u0161ao'), (u'priusti', u'priu\u0161ti'), (u'priustimo', u'priu\u0161timo'), (u'priustiti', u'priu\u0161titi'), (u'proci', u'pro\u0107i'), (u'prodavac', u'prodava\u010d'), (u'promasio', u'proma\u0161io'), (u'Promasio', u'Proma\u0161io'), (u'prosao', u'pro\u0161ao'), (u'prosla', u'pro\u0161la'), (u'Prosle', u'Pro\u0161le'), (u'prosle', u'pro\u0161le'), (u'prosli', u'pro\u0161li'), (u'Prosli', u'Pro\u0161li'), (u'proslim', u'pro\u0161lim'), (u'proslo', u'pro\u0161lo'), (u'Proslo', u'Pro\u0161lo'), (u'provedes', u'provede\u0161'), (u'provlaci', u'provla\u010di'), (u'provlacimo', u'provla\u010dimo'), (u'pticica', u'pti\u010dica'), (u'pticicu', u'pti\u010dicu'), (u'pucini', u'pu\u010dini'), (u'pupcanu', u'pup\u010danu'), (u'pusac', u'pu\u0161a\u010d'), (u'pusaci', u'pu\u0161a\u010di'), (u'pusi', u'pu\u0161i'), (u'pusimo', u'pu\u0161imo'), (u'pusite', u'pu\u0161ite'), (u'pustam', u'pu\u0161tam'), (u'racunare', u'ra\u010dunala'), (u'racunari', u'ra\u010dunala'), (u'radis', u'radi\u0161'), (u'Radis', u'Radi\u0161'), (u'raskosni', u'rasko\u0161ni'), (u'razumes', u'razumije\u0161'), (u'Razumes', u'Razumije\u0161'), (u'rec', u'rije\u010d'), (u'rece', u're\u010de'), (u'Receno', u'Re\u010deno'), (u'receno', u're\u010deno'), (u'recima', u'rije\u010dima'), (u'resimo', u'rije\u0161imo'), (u'rijec', u'rije\u010d'), (u'Rijeci', u'Rije\u010di'), (u'rijedji', u'rje\u0111i'), (u'rjedji', u'rje\u0111i'), (u'Rjesit', u'Rije\u0161it'), (u'rodena', u'ro\u0111ena'), (u'rodeni', u'ro\u0111eni'), (u'rodis', u'rodi\u0161'), (u'rodjen', u'ro\u0111en'), (u'rucno', u'ru\u010dno'), (u'ruza', u'ru\u017ea'), (u'ruzan', u'ru\u017ean'), (u'ruzu', u'ru\u017eu'), (u'sadrze', u'sadr\u017ee'), (u'sadrzi', u'sadr\u017ei'), (u'salje', u'\u0161alje'), (u'saljes', u'\u0161alje\u0161'), (u'salju', u'\u0161alju'), (u'sasila', u'sa\u0161ila'), (u'sasili', u'sa\u0161ili'), (u'sasio', u'sa\u0161io'), (u'sasiti', u'sa\u0161iti'), (u'savescu', u'savje\u0161\u0107u'), (u'savijescu', u'savje\u0161\u0107u'), (u'sedeces', u'sjedit \u0107e\u0161'), (u'sedis', u'sjedi\u0161'), (u'sedista', u'sjedala'), (u'sediste', u'sjedi\u0161te'), (u'sendvic', u'sendvi\u010d'), (u'sesir', u'\u0161e\u0161ir'), (u'sesirom', u'\u0161e\u0161irom'), (u'sest', u'\u0161est'), (u'setala', u'\u0161etala'), (u'setam', u'\u0161etam'), (u'setis', u'sjeti\u0161'), (u'seva', u'\u0161eva'), (u'sevu', u'\u0161evu'), (u'sezdeset', u'\u0161ezdeset'), (u'Sidji', u'Si\u0111i'), (u'sidji', u'si\u0111i'), (u'sijecanj', u'sije\u010danj'), (u'siroki', u'\u0161iroki'), (u'sjecaju', u'sje\u0107aju'), (u'sjecam', u'sje\u0107am'), (u'Sjecam', u'Sje\u0107am'), (u'sjecanja', u'sje\u0107anja'), (u'sjecanje', u'sje\u0107anje'), (u'skace', u'ska\u010de'), (u'skaci', u'ska\u010di'), (u'skacu', u'ska\u010du'), (u'sklanjas', u'sklanja\u0161'), (u'sklonoscu', u'sklono\u0161\u0107u'), (u'sklupcam', u'sklup\u010dam'), (u'skola', u'\u0161kola'), (u'Skola', u'\u0160kola'), (u'Skotska', u'\u0160kotska'), (u'Skotskoj', u'\u0160kotskoj'), (u'skrt', u'\u0161krt'), (u'skrte', u'\u0161krte'), (u'skrusena', u'skru\u0161ena'), (u'Skrusena', u'Skru\u0161ena'), (u'sledeca', u'sljede\u0107a'), (u'Sledece', u'Sljede\u0107e'), (u'sledeci', u'sljede\u0107i'), (u'Sledeci', u'Sljede\u0107i'), (u'slicno', u'sli\u010dno'), (u'sljedeci', u'sljede\u0107i'), (u'Sljedeci', u'Sljede\u0107i'), (u'slozila', u'slo\u017eila'), (u'slozili', u'slo\u017eili'), (u'slozio', u'slo\u017eio'), (u'sloziti', u'slo\u017eiti'), (u'slucaja', u'slu\u010daja'), (u'Smatras', u'Smatra\u0161'), (u'smatras', u'smatra\u0161'), (u'smece', u'sme\u0107e'), (u'smeda', u'sme\u0111a'), (u'smedem', u'sme\u0111em'), (u'smedi', u'sme\u0111i'), (u'smedoj', u'sme\u0111oj'), (u'smedu', u'sme\u0111u'), (u'smesak', u'smje\u0161ak'), (u'Smijes', u'Smije\u0161'), (u'smijes', u'smije\u0161'), (u'smionoscu', u'smiono\u0161\u0107u'), (u'smraci', u'smra\u010di'), (u'smracilo', u'smra\u010dilo'), (u'smrcu', u'smr\u0107u'), (u'snimacete', u'snimat \u0107ete'), (u'sokiras', u'\u0161okira\u0161'), (u'spases', u'spasi\u0161'), (u'Spases', u'Spasi\u0161'), (u'spavaca', u'spava\u0107a'), (u'spavacoj', u'spava\u0107oj'), (u'spominjes', u'spominje\u0161'), (u'spustamo', u'spu\u0161tamo'), (u'srdacan', u'srda\u010dan'), (u'srecom', u'sre\u0107om'), (u'sresce', u'srest \u0107e'), (u'sre\u0161ce', u'srest \u0107e'), (u'srljas', u'srlja\u0161'), (u'Sta', u'\u0160to'), (u'sta', u'\u0161to'), (u'stab', u'sto\u017eer'), (u'Stab', u'Sto\u017eer'), (u'stagod', u'\u0161to god'), (u'stampa', u'tisak'), (u'stampati', u'tiskati'), (u'stampi', u'tisku'), (u'stampom', u'tiskom'), (u'stampu', u'tisak'), (u'standa', u'\u0161tanda'), (u'standu', u'\u0161tandu'), (u'stavis', u'stavi\u0161'), (u'Stavise', u'\u0160tovi\u0161e'), (u'Stavi\u0107emo', u'Stavit \u0107emo'), (u'steceni', u'ste\u010deni'), (u'stezuci', u'ste\u017eu\u0107i'), (u'stici', u'sti\u0107i'), (u'stojis', u'stoji\u0161'), (u'Stojis', u'Stoji\u0161'), (u'stp', u'\u0161to'), (u'strasan', u'stra\u0161an'), (u'strasno', u'stra\u0161no'), (u'sudeci', u'sude\u0107i'), (u'sudenja', u'su\u0111enja'), (u'sudenje', u'su\u0111enje'), (u'sudenju', u'su\u0111enju'), (u'sugerisu', u'predla\u017eu'), (u'sumnjas', u'sumnja\u0161'), (u'sumska', u'\u0161umska'), (u'sumski', u'\u0161umski'), (u'sumskoj', u'\u0161umskoj'), (u'supak', u'\u0161upak'), (u'suraduj', u'sura\u0111uj'), (u'suraduje', u'sura\u0111uje'), (u'suradujemo', u'sura\u0111ujemo'), (u'suraduju', u'sura\u0111uju'), (u'Suraduj', u'Sura\u0111uj'), (u'Suraduje', u'Sura\u0111uje'), (u'Suradujemo', u'Sura\u0111ujemo'), (u'Suraduju', u'Sura\u0111uju'), (u'sustina', u'bit'), (u'sustine', u'biti'), (u'sustini', u'biti'), (u'Sustine', u'Biti'), (u'Sustini', u'Biti'), (u'Sustinom', u'Biti'), (u'sustinom', u'biti'), (u'sustinski', u'bitni'), (u'suti', u'\u0161uti'), (u'Suti', u'\u0160uti'), (u'svacije', u'sva\u010dije'), (u'svaciji', u'sva\u010diji'), (u'svaciju', u'sva\u010diju'), (u'svecan', u'sve\u010dan'), (u'svecani', u'sve\u010dani'), (u'svez', u'svje\u017e'), (u'sveza', u'svje\u017ea'), (u'svezu', u'svje\u017eu'), (u'svezi', u'svje\u017ei'), (u'sveze', u'svje\u017ee'), (u'svezim', u'svje\u017eim'), (u'svezom', u'svje\u017eom'), (u'svezoj', u'svje\u017eoj'), (u'svezinom', u'svje\u017einom'), (u'svezina', u'svje\u017eina'), (u'svezinu', u'svje\u017einu'), (u'svezini', u'svje\u017eini'), (u'svezine', u'svje\u017eine'), (u'Svida', u'Svi\u0111a'), (u'svidala', u'svi\u0111ala'), (u'svidalo', u'svi\u0111alo'), (u'svidam', u'svi\u0111am'), (u'svidao', u'svi\u0111ao'), (u'sviras', u'svira\u0161'), (u'taknes', u'takne\u0161'), (u'takode', u'tako\u0111er'), (u'takoder', u'tako\u0111er'), (u'takodje', u'tako\u0111er'), (u'Takodje', u'Tako\u0111er'), (u'tece', u'te\u010de'), (u'teska', u'te\u0161ka'), (u'Teska', u'Te\u0161ka'), (u'teske', u'te\u0161ke'), (u'teski', u'te\u0161ki'), (u'tesko', u'te\u0161ko'), (u'Tesko', u'Te\u0161ko'), (u'teskom', u'te\u0161kom'), (u'tezak', u'te\u017eak'), (u'Tezak', u'Te\u017eak'), (u'teze', u'te\u017ee'), (u'tezi', u'te\u017ei'), (u'Tezi', u'Te\u017ei'), (u'tezimo', u'te\u017eimo'), (u'Tezimo', u'Te\u017eimo'), (u'tezinu', u'te\u017einu'), (u'tezis', u'te\u017ei\u0161'), (u'Tezi\u0161', u'Te\u017ei\u0161'), (u'tisuce', u'tisu\u0107e'), (u'tisucu', u'tisu\u0107u'), (u'Tocak', u'Kota\u010d'), (u'tocak', u'kota\u010d'), (u'tocka', u'to\u010dka'), (u'tocku', u'to\u010dku'), (u'trajace', u'trajat \u0107e'), (u'Trajace', u'Trajat \u0107e'), (u'trazis', u'tra\u017ei\u0161'), (u'trcao', u'tr\u010dao'), (u'trce', u'tr\u010de'), (u'Trce', u'Tr\u010de'), (u'trci', u'tr\u010di'), (u'Trci', u'Tr\u010di'), (u'trcim', u'tr\u010dim'), (u'Trcim', u'Tr\u010dim'), (u'trcimo', u'tr\u010dimo'), (u'trebas', u'treba\u0161'), (u'Trebas', u'Treba\u0161'), (u'treci', u'tre\u0107i'), (u'tricarija', u'tri\u010darija'), (u'trudis', u'trudi\u0161'), (u'trunuce', u'trunut \u0107e'), (u'tuce', u'tu\u010de'), (u'tuces', u'tu\u010de\u0161'), (u'tucom', u'tu\u010dom'), (u'tucu', u'tu\u010dnjavu'), (u'tudje', u'tu\u0111e'), (u'tudjeg', u'tu\u0111eg'), (u'tudoj', u'tu\u0111oj'), (u'tudom', u'tu\u0111om'), (u'tudjem', u'tu\u0111em'), (u'tudem', u'tu\u0111em'), (u'tumaras', u'tumara\u0161'), (u'tvoris', u'tvori\u0161'), (u'ubedjuju', u'uvjeravaju'), (u'ubijes', u'ubije\u0161'), (u'Ubijes', u'Ubije\u0161'), (u'uceni', u'u\u010deni'), (u'uci', u'u\u0107i'), (u'ucine', u'u\u010dine'), (u'ucinimo', u'u\u010dinimo'), (u'ucinio', u'u\u010dinio'), (u'ucio', u'u\u010dio'), (u'Ucio', u'U\u010dio'), (u'udas', u'uda\u0161'), (u'udete', u'u\u0111ete'), (u'ude\u0161', u'ude\u0161'), (u'udi', u'u\u0111i'), (u'Udi', u'U\u0111i'), (u'Udje', u'U\u0111e'), (u'udje', u'u\u0111e'), (u'udjes', u'u\u0111e\u0161'), (u'ugriscu', u'ugrist \u0107u'), (u'ukljestena', u'uklije\u0161tena'), (u'ukljucujuci', u'uklju\u010duju\u0107i'), (u'umes', u'umije\u0161'), (u'umiruci', u'umiru\u0107i'), (u'umrecu', u'umrijet \u0107u'), (u'umres', u'umre\u0161'), (u'unistice', u'uni\u0161tit \u0107e'), (u'uopce', u'uop\u0107e'), (u'Uopce', u'Uop\u0107e'), (u'Uopste', u'Uop\u0107e'), (u'uopste', u'uop\u0107e'), (u'upoznas', u'upozna\u0161'), (u'uradis', u'u\u010dini\u0161'), (u'usao', u'u\u0161ao'), (u'Usao', u'U\u0161ao'), (u'usli', u'u\u0161li'), (u'Usmjerice', u'Usmjerit \u0107e'), (u'uspanicio', u'uspani\u010dio'), (u'utapas', u'utapa\u0161'), (u'utesi', u'utje\u0161i'), (u'utesim', u'utje\u0161im'), (u'uzinu', u'u\u017einu'), (u'uzivo', u'u\u017eivo'), (u'valda', u'valjda'), (u'vasa', u'va\u0161a'), (u'vaseg', u'va\u0161eg'), (u'Vaseg', u'Va\u0161eg'), (u'vasem', u'va\u0161em'), (u'vasi', u'va\u0161i'), (u'vasoj', u'va\u0161oj'), (u'vazi', u'vrijedi'), (u'Vec', u'Ve\u0107'), (u'vec', u've\u0107'), (u'vecan', u'vje\u010dan'), (u'vecera', u've\u010dera'), (u'Veceras', u'Ve\u010deras'), (u'veceras', u've\u010deras'), (u'vecere', u've\u010dere'), (u'veceri', u've\u010deri'), (u'veceru', u've\u010deru'), (u'vecih', u've\u0107ih'), (u'vecitim', u'vje\u010ditim'), (u'vecna', u'vje\u010dna'), (u'vecno', u'vje\u010dno'), (u'vecnost', u'vje\u010dnost'), (u'verovacu', u'vjerovat \u0107u'), (u'vice', u'vi\u010de'), (u'vicem', u'vi\u010dem'), (u'vicemo', u'vi\u010demo'), (u'vices', u'vi\u010de\u0161'), (u'vicete', u'vi\u010dete'), (u'viden', u'vi\u0111en'), (u'Viden', u'Vi\u0111en'), (u'vishe', u'vi\u0161e'), (u'vjencali', u'vjen\u010dali'), (u'vjencati', u'vjen\u010dati'), (u'vjerujes', u'vjeruje\u0161'), (u'Vjerujes', u'Vjeruje\u0161'), (u'vjetrenjace', u'vjetrenja\u010de'), (u'voce', u'vo\u0107e'), (u'vocka', u'vo\u0107ka'), (u'vocku', u'vo\u0107ku'), (u'vocnjak', u'vo\u0107njak'), (u'vocnjaku', u'vo\u0107njaku'), (u'vodic', u'vodi\u010d'), (u'vodju', u'vo\u0111u'), (u'vozac', u'voza\u010d'), (u'Vozac', u'Voza\u010d'), (u'vozaca', u'voza\u010da'), (u'vracam', u'vra\u0107am'), (u'vracen', u'vra\u010den'), (u'vrazja', u'vra\u017eja'), (u'vrazji', u'vra\u017eji'), (u'vreca', u'vre\u010da'), (u'vrece', u'vre\u0107e'), (u'vrecu', u'vre\u0107u'), (u'vredja', u'vrije\u0111a'), (u'vredjanje', u'vrije\u0111anje'), (u'vrtic', u'vrti\u0107'), (u'vrtica', u'vrti\u0107a'), (u'vrticu', u'vrti\u0107u'), (u'zacepe', u'za\u010depe'), (u'Zacepi', u'Za\u010depi'), (u'Zadrzi', u'Zadr\u017ei'), (u'zadrzi', u'zadr\u017ei'), (u'zaduzen', u'zadu\u017een'), (u'Zaduzen', u'Zadu\u017een'), (u'zagrlis', u'zagrli\u0161'), (u'zaljenja', u'\u017ealjenja'), (u'zaljenje', u'\u017ealjenje'), (u'zalosna', u'\u017ealosna'), (u'Zalosna', u'\u017dalosna'), (u'zaokruzi', u'zaokru\u017ei'), (u'zaokruzim', u'zaokru\u017eim'), (u'zaokruzimo', u'zaokru\u017eimo'), (u'zapoceli', u'zapo\u010deli'), (u'zarucen', u'zaru\u010den'), (u'zasto', u'za\u0161to'), (u'Zasto', u'Za\u0161to'), (u'zateci', u'zate\u0107i'), (u'zatvoris', u'zatvori\u0161'), (u'zdrebe', u'\u017edrijebe'), (u'Zele', u'\u017dele'), (u'zele', u'\u017eele'), (u'Zeleci', u'\u017dele\u0107i'), (u'zelila', u'\u017eeljela'), (u'Zelis', u'\u017deli\u0161'), (u'zelis', u'\u017eeli\u0161'), (u'zene', u'\u017eene'), (u'zenke', u'\u017eenke'), (u'zesce', u'\u017ee\u0161\u0107e'), (u'zezas', u'zeza\u0161'), (u'zita', u'\u017eita'), (u'zito', u'\u017eito'), (u'zitu', u'\u017eitu'), (u'ziv', u'\u017eiv'), (u'ziva', u'\u017eiva'), (u'zive', u'\u017eive'), (u'zivi', u'\u017eivi'), (u'zivis', u'\u017eivi\u0161'), (u'zivjeo', u'\u017eivio'), (u'Zivjeo', u'\u017divio'), (u'zmureo', u'\u017emirio'), (u'znacaj', u'zna\u010daj'), (u'znacaja', u'zna\u010daja'), (u'znace', u'zna\u010de'), (u'znace\u0161', u'znat \u0107e\u0161'), (u'znas', u'zna\u0161'), (u'Znas', u'Zna\u0161'), (u'zuris', u'zuri\u0161'), (u'zutoj', u'\u017eutoj'), (u'zvanican', u'slu\u017eben'), (u'\u0107es', u'\u0107e\u0161'), (u'\u0107te', u'\u0107ete'), (u'\u010cime', u'\u010cime'), (u'\u017eelis', u'\u017eeli\u0161'), (u'\u017diveo', u'\u017divio')]),
+                        'pattern': u'(?um)(\\b|^)(?:andele|andeli|bacas|bas|Bas|basta|Basta|baste|Baste|basti|Basti|bastom|Bastom|bastu|Bastu|Bice|bice|Bice\\\u0161|Bicu|bicu|blagonaklonoscu|blizi|bljesti|Bljesti|bojis|braca|Braca|broncane|broncanu|budes|caj|caja|Cak|cak|cale|Cao|cao|cas|casno|Casno|castis|casu|ca\\\u0161u|cebe|cega|Cek|cek|cekali|cekas|Cemu|cemu|cerka|Cerka|cerke|Cerke|cerku|Cerku|ces|cesce|Cesce|Ceskoj|cestitki|cesto|Cesto|cetiri|Cetiri|cetri|cetu|ceznja|ceznje|ceznji|ceznjom|ceznju|ceznu|ce\\\u0161|Cija|cija|cije|Ciji|ciji|cijih|Cijih|cijim|Cijim|Cim|cim|cime|cinila|cinili|cinio|cinis|ciniti|cipka|cipku|cita|citao|citas|citavu|cizme|clan|Clan|clanke|clanove|clanovi|clanovima|cmo|corsokak|corsokaku|cosak|cosku|covece|covek|covjece|covjecnost|covjek|covjeka|covjeku|crpeci|cte|Cu|Ce\\\u0161|Ce|Cemo|Cete|cu|ce|cemo|cete|cudi|Cudo|cudo|Cujte|cula|culi|Culi|culima|cuo|Cuo|cupam|cutanje|Cutanje|cutao|Cutao|cuti|cutljiv|cutnja|cuvali|cuveni|dace|dacemo|davo|definise|definisi|Desava|desava|disemo|disi|dobijes|dobivas|doci|dode|dodem|dodes|dodete|dode\\\u0161|Dodi|dodi|dodite|Dodji|dodji|Dodjite|dodjite|Dodju|dodju|dodu|dolazis|dopustao|dorucak|dorucku|Dosao|dosao|drhteci|drhte\\\u0107i|Drhte\\\u0107i|drugacija|Drugacije|drugacije|drugaciji|Drugaciji|drukciji|drveca|drvece|drvecem|drvecu|drzi|Drzim|dugmici|duze|duzinom|dzanki|Dzejk|Dzime|Dzone|flasom|flasu|fucka|funkcionisu|gacice|gadao|gadis|Gadis|gdica|gdice|gdici|gdicu|gdu|glupaco|govoris|gradani|gradic|gradica|gradicu|grancica|grancicu|gresci|grese|greski|gresku|gubis|Hoces|hoces|hocu|Hocu|hodas|htjeo|iceg|icega|icemu|Ici|ici|Ides|ides|iduce|iduceg|iducem|Iduci|iduci|ignorisi|igras|Ijudi|imas|imidz|inace|Inace|isao|Isao|iscupao|ise\\\u0107emo|isla|istjece|istrazio|Istrazio|isuvise|izaci|Izaci|izade|Izade|izadem|izades|izadete|Izadi|izadi|izasao|izasla|izici|izluduje|izluduju|izmedu|Izmedu|izostri|izostrim|izvuci|i\\\u0161cupao|jebes|Jebes|jos|Jos|juce|Juce|jucer|Jucer|kaslja|kaze|Kaze|kazemo|kazite|Kazite|kazu|Kcer|kcer|kcerka|Kcerka|kcerkama|kcerku|Kcerku|kecap|kecapa|kise|kisi|kleknes|kociji|kolaca|kolace|komadic|komsijama|komsije|komsiji|komsiluk|komsiluku|kom\\\u0161ija|Kom\\\u0161ija|Konkurise|konkurise|konkurisem|konkurisu|kontrolisu|kosulja|kosulje|kosulji|kosulju|kovceg|kovcegu|krada|Krada|Krece|krece|Kreci|kreci|krecu|kre\\\u0107es|krosnje|krvaris|kuca|kucama|kuce|kuci|kusa|kusas|ku\\\u010da|ku\\\u010di|lakocom|laz|lazac|laze|lazi|lazne|lazni|lazov|ledja|ledjima|leprsa|lezala|lezali|lezati|lezis|Lezis|lici|licim|licis|licnost|licnosti|lijecniku|ljubis|los|losa|losu|majcine|masini|medu|Medutim|medutim|mici|Mici|micu|mislis|Mislis|mjesecevom|mjesecine|mjesecini|mjesecinu|mladic|moc|moci|motivisu|mozda|Mozda|moze|mozete|mreza|mrezu|mrzis|muce|mucenik|mucne|muska|muz|muza|naci|Naci|nacin|nadem|Nadem|nademo|nades|Nades|nadete|nadici|nadje|Nadje|nadjen|nadjes|Nadjes|nadjete|nagovestaj|najvise|Najvise|naklonoscu|naocale|Napisite|nasa|Nase|nase|naseg|nasi|Nasi|nasao|Nasao|nasla|Nasla|nasli|Nasli|nasoj|nasrecu|nastavis|nasu|nauce|neceg|necega|necemo|necemu|necije|neciji|necim|necovjecnost|necovjecnosti|necu|Necu|nekaze|nekoc|Nemas|nemas|Nesreca|nesto|Nesto|new\\ yorski|Nezan|nezan|nezna|Neznam|Neznas|Neznajuci|Neznavsi|neznam|neznas|neznajuci|neznavsi|nezni|neznih|neznim|nezno|neznu|niceg|nicega|nicemu|nicija|niciji|nicim|njezno|nju\\ jorski|noci|nocnu|nosac|nosices|nosis|noz|nozem|Obecao|Obezbedjuju|obezbedjuju|obide|objasnis|obozavalac|obracas|obra\\\u0107as|obuce|obucem|oceve|ocito|ocnjaci|odes|odlazis|odlezati|odlucim|odmice|odraduje|odreden|odreduje|odredujemo|odvec|ogrtac|ohrabrujuce|ojacam|okrece|opasac|operise|operisemo|operisete|operise\\\u0161|osecaces|osjecaces|osjecam|osjecanja|oslobada|ostra|ostre|ostri|ostrom|ostru|osvrnes|Osvrnes|otezala|otidi|otidji|otisao|oziljak|palaca|palaci|palacu|papucama|parce|pateci|patis|pcela|pcele|pecini|pecinski|peraca|Peraci|pica|pice|picem|pijes|pisacoj|pise|pisem|pisemo|pises|pisite|pisu|pitas|placa|placam|placanje|placanjem|place|placem|placete|place\\\u0161|placu|placuci|Plasi|plazi|plazu|plese|plesemo|plesete|plesu|ploca|ploce|pluca|plucima|pobjeci|pobjeduje|poceli|poceo|pocetak|pocevsi|pocev\\\u0161i|poci|pocinje|pociva|pocivali|pocivao|pode|podi|podici|Podici|podimo|Podimo|podje|Podje|Podji|podji|podneses|podocnjacima|podocnjake|podstice|poduzeca|poduzece|poduzecu|pojesce|pojiliste|pokazi|Pokazi|pokrece|pokusaj|pokusam|pokusas|poletis|polozaja|polozaju|pomaci|pomazes|pomislis|pomognes|poneses|ponovis|poreci|porice|posalji|Posalji|posaljite|posle|posluzili|Posluzite|posluzite|postaras|posto|Posto|potece|potice|potici|potjece|potjecem|potjeces|potpises|povedes|pozuda|pozude|pozudi|pozudu|prakticno|premasuje|premasuju|preporuca|presao|presjecen|Previse|previse|preziveo|Priblizi|price|prici|pricu|Pridji|pridji|prijeci|prijedi|prilazis|prisao|priusti|priustimo|priustiti|proci|prodavac|promasio|Promasio|prosao|prosla|Prosle|prosle|prosli|Prosli|proslim|proslo|Proslo|provedes|provlaci|provlacimo|pticica|pticicu|pucini|pupcanu|pusac|pusaci|pusi|pusimo|pusite|pustam|racunare|racunari|radis|Radis|raskosni|razumes|Razumes|rec|rece|Receno|receno|recima|resimo|rijec|Rijeci|rijedji|rjedji|Rjesit|rodena|rodeni|rodis|rodjen|rucno|ruza|ruzan|ruzu|sadrze|sadrzi|salje|saljes|salju|sasila|sasili|sasio|sasiti|savescu|savijescu|sedeces|sedis|sedista|sediste|sendvic|sesir|sesirom|sest|setala|setam|setis|seva|sevu|sezdeset|Sidji|sidji|sijecanj|siroki|sjecaju|sjecam|Sjecam|sjecanja|sjecanje|skace|skaci|skacu|sklanjas|sklonoscu|sklupcam|skola|Skola|Skotska|Skotskoj|skrt|skrte|skrusena|Skrusena|sledeca|Sledece|sledeci|Sledeci|slicno|sljedeci|Sljedeci|slozila|slozili|slozio|sloziti|slucaja|Smatras|smatras|smece|smeda|smedem|smedi|smedoj|smedu|smesak|Smijes|smijes|smionoscu|smraci|smracilo|smrcu|snimacete|sokiras|spases|Spases|spavaca|spavacoj|spominjes|spustamo|srdacan|srecom|sresce|sre\\\u0161ce|srljas|Sta|sta|stab|Stab|stagod|stampa|stampati|stampi|stampom|stampu|standa|standu|stavis|Stavise|Stavi\\\u0107emo|steceni|stezuci|stici|stojis|Stojis|stp|strasan|strasno|sudeci|sudenja|sudenje|sudenju|sugerisu|sumnjas|sumska|sumski|sumskoj|supak|suraduj|suraduje|suradujemo|suraduju|Suraduj|Suraduje|Suradujemo|Suraduju|sustina|sustine|sustini|Sustine|Sustini|Sustinom|sustinom|sustinski|suti|Suti|svacije|svaciji|svaciju|svecan|svecani|svez|sveza|svezu|svezi|sveze|svezim|svezom|svezoj|svezinom|svezina|svezinu|svezini|svezine|Svida|svidala|svidalo|svidam|svidao|sviras|taknes|takode|takoder|takodje|Takodje|tece|teska|Teska|teske|teski|tesko|Tesko|teskom|tezak|Tezak|teze|tezi|Tezi|tezimo|Tezimo|tezinu|tezis|Tezi\\\u0161|tisuce|tisucu|Tocak|tocak|tocka|tocku|trajace|Trajace|trazis|trcao|trce|Trce|trci|Trci|trcim|Trcim|trcimo|trebas|Trebas|treci|tricarija|trudis|trunuce|tuce|tuces|tucom|tucu|tudje|tudjeg|tudoj|tudom|tudjem|tudem|tumaras|tvoris|ubedjuju|ubijes|Ubijes|uceni|uci|ucine|ucinimo|ucinio|ucio|Ucio|udas|udete|ude\\\u0161|udi|Udi|Udje|udje|udjes|ugriscu|ukljestena|ukljucujuci|umes|umiruci|umrecu|umres|unistice|uopce|Uopce|Uopste|uopste|upoznas|uradis|usao|Usao|usli|Usmjerice|uspanicio|utapas|utesi|utesim|uzinu|uzivo|valda|vasa|vaseg|Vaseg|vasem|vasi|vasoj|vazi|Vec|vec|vecan|vecera|Veceras|veceras|vecere|veceri|veceru|vecih|vecitim|vecna|vecno|vecnost|verovacu|vice|vicem|vicemo|vices|vicete|viden|Viden|vishe|vjencali|vjencati|vjerujes|Vjerujes|vjetrenjace|voce|vocka|vocku|vocnjak|vocnjaku|vodic|vodju|vozac|Vozac|vozaca|vracam|vracen|vrazja|vrazji|vreca|vrece|vrecu|vredja|vredjanje|vrtic|vrtica|vrticu|zacepe|Zacepi|Zadrzi|zadrzi|zaduzen|Zaduzen|zagrlis|zaljenja|zaljenje|zalosna|Zalosna|zaokruzi|zaokruzim|zaokruzimo|zapoceli|zarucen|zasto|Zasto|zateci|zatvoris|zdrebe|Zele|zele|Zeleci|zelila|Zelis|zelis|zene|zenke|zesce|zezas|zita|zito|zitu|ziv|ziva|zive|zivi|zivis|zivjeo|Zivjeo|zmureo|znacaj|znacaja|znace|znace\\\u0161|znas|Znas|zuris|zutoj|zvanican|\\\u0107es|\\\u0107te|\\\u010cime|\\\u017eelis|\\\u017diveo)(\\b|$)'}},
+ 'dan': {'BeginLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'EndLines': {'data': OrderedDict(),
+                      'pattern': None},
+         'PartialLines': {'data': OrderedDict(),
+                          'pattern': None},
+         'PartialWordsAlways': {'data': OrderedDict([(u'\xa4', u'o'), (u'IVI', u'M'), (u'lVI', u'M'), (u'IVl', u'M'), (u'lVl', u'M'), (u'\xb6\xb6', u'\u266b'), (u'\xb6', u'\u266a')]),
+                                'pattern': None},
+         'WholeLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'WholeWords': {'data': OrderedDict([(u'Haner', u'Han er'), (u'JaveL', u'Javel'), (u'Pa//e', u'Palle'), (u'bffte', u'bitte'), (u'Utro//gt', u'Utroligt'), (u'Kommerdu', u'Kommer du'), (u'smi/er', u'smiler'), (u'/eg', u'leg'), (u'harvinger', u'har vinger'), (u'/et', u'let'), (u'erjeres', u'er jeres'), (u'hardet', u'har det'), (u't\xe6nktjer', u't\xe6nkt jer'), (u'erjo', u'er jo'), (u'sti/', u'stil'), (u'Iappe', u'lappe'), (u'Beklagel\xe7', u'Beklager,'), (u'vardet', u'var det'), (u'afden', u'af den'), (u'snupperjeg', u'snupper jeg'), (u'ikkejeg', u'ikke jeg'), (u'bliverjeg', u'bliver jeg'), (u'hartravit', u'har travlt'), (u'pandekagef/ag', u'pandekageflag'), (u'Stormvarsell', u'Stormvarsel!'), (u'stormvejn', u'stormvejr.'), (u'morgenkomp/et', u'morgenkomplet'), (u'/yv', u'lyv'), (u'varjo', u'var jo'), (u'/eger', u'leger'), (u'harjeg', u'har jeg'), (u'havdejeg', u'havde jeg'), (u'hvorjeg', u'hvor jeg'), (u'n\xe5rjeg', u'n\xe5r jeg'), (u'g\xe5rvi', u'g\xe5r vi'), (u'atjeg', u'at jeg'), (u'isine', u'i sine'), (u'f\xe5rjeg', u'f\xe5r jeg'), (u'k\xe6rtighed', u'k\xe6rlighed'), (u'skullejeg', u'skulle jeg'), (u'laest', u'l\xe6st'), (u'laese', u'l\xe6se'), (u'g\xf8rjeg', u'g\xf8r jeg'), (u'g\xf8rvi', u'g\xf8r vi'), (u'angrerjo', u'angrer jo'), (u'Hvergang', u'Hver gang'), (u'erder', u'er der'), (u'villetilgive', u'ville tilgive'), (u'\ufb01eme', u'fjeme'), (u'genopst\xe5ri', u'genopst\xe5r i'), (u'svigtejer', u'svigte jer'), (u'kommernu', u'kommer nu'), (u'n\xe5rman', u'n\xe5r man'), (u'erfire', u'er fire'), (u'Hvorfor\ufb01nderdu', u'Hvorfor \ufb01nder du'), (u'undertigt', u'underligt'), (u'itroen', u'i troen'), (u'erl\xf8gnt', u'er l\xf8gn!'), (u'g\xf8rden', u'g\xf8r den'), (u'forhelvede', u'for helvede'), (u'hjpe', u'hj\xe6lpe'), (u'togeti', u'toget i'), (u'M\xe5jeg', u'M\xe5 jeg'), (u'savnerjer', u'savner jer'), (u'erjeg', u'er jeg'), (u'vaere', u'v\xe6re'), (u'geme', u'gerne'), (u'trorp\xe5', u'tror p\xe5'), (u'forham', u'for ham'), (u'afham', u'af ham'), (u'harjo', u'har jo'), (u'ovema\ufb01et', u'overnattet'), (u'begae\ufb01ighed', u'beg\xe6rlighed'), (u'sy\u2019g', u'syg'), (u'Imensjeg', u'Imens jeg'), (u'bliverdu', u'bliver du'), (u'\ufb01ser', u'fiser'), (u'manipuierer', u'manipulerer'), (u'forjeg', u'for jeg'), (u'iivgivendefor', u'livgivende for'), (u'formig', u'for mig'), (u'Hardu', u'Har du'), (u'fornold', u'forhold'), (u'defrelste', u'de frelste'), (u'S\xe5jeg', u'S\xe5 jeg'), (u'varjeg', u'var jeg'), (u'g\xf8rved', u'g\xf8r ved'), (u'kalderjeg', u'kalder jeg'), (u'\ufb02ytte', u'flytte'), (u'handlerdet', u'handler det'), (u'trorjeg', u'tror jeg'), (u'\ufb02ytter', u'flytter'), (u'soverjeg', u'sover jeg'), (u'\ufb01nderud', u'\ufb01nder ud'), (u'naboerp\xe5', u'naboer p\xe5'), (u'ervildt', u'er vildt'), (u'v\xe6reher', u'v\xe6re her'), (u'hyggerjer', u'hygger jer'), (u'borjo', u'bor jo'), (u'kommerikke', u'kommer ikke'), (u'folkynde', u'forkynde'), (u'farglad', u'far glad'), (u'misterjeg', u'mister jeg'), (u'\ufb01nt', u'fint'), (u'Harl', u'Har I'), (u'bedejer', u'bede jer'), (u'synesjeg', u'synes jeg'), (u'vartil', u'var til'), (u'eren', u'er en'), (u'\\Al', u'Vil'), (u'\\A', u'Vi'), (u'fjeme', u'fjerne'), (u'Iigefyldt', u'lige fyldt'), (u'ertil', u'er til'), (u'fa\ufb01igt', u'farligt'), (u'\ufb01nder', u'finder'), (u'\ufb01ndes', u'findes'), (u'irettesae\ufb01else', u'irettes\xe6ttelse'), (u'ermed', u'er med'), (u'\xe8n', u'\xe9n'), (u'gikjoi', u'gik jo i'), (u'Hvisjeg', u'Hvis jeg'), (u'ovema\ufb01er', u'overnatter'), (u'hoident', u'holdent'), (u'\\Adne', u'Vidne'), (u'fori', u'for i'), (u'vei', u'vel'), (u'savnerjerjo', u'savner jer jo'), (u'elskerjer', u'elsker jer'), (u'harl\xf8jet', u'har l\xf8jet'), (u'eri', u'er i'), (u'\ufb01ende', u'fjende'), (u'derjo', u'der jo'), (u'sigerjo', u'siger jo'), (u'menerjeg', u'mener jeg'), (u'Harjeg', u'Har jeg'), (u'sigerjeg', u'siger jeg'), (u'splitterjeg', u'splitter jeg'), (u'erjournalist', u'er journalist'), (u'erjoumalist', u'er journalist'), (u'Forjeg', u'For jeg'), (u'g\xe2rjeg', u'g\xe5r jeg'), (u'N\xe2rjeg', u'N\xe5r jeg'), (u'a\ufb02lom', u'afkom'), (u'farerjo', u'farer jo'), (u'tagerjeg', u'tager jeg'), (u'Virkerjeg', u'Virker jeg'), (u'morerjer', u'morer jer'), (u'kommerjo', u'kommer jo'), (u'istand', u'i stand'), (u'b\xf8m', u'b\xf8rn'), (u'frygterjeg', u'frygter jeg'), (u'kommerjeg', u'kommer jeg'), (u'eriournalistelev', u'er journalistelev'), (u'harfat', u'har fat'), (u'f\xe5r\ufb01ngre', u'f\xe5r \ufb01ngre'), (u'sl\xe2rjeg', u'sl\xe5r jeg'), (u'bam', u'barn'), (u'erjournalistelev', u'er journalistelev'), (u'politietjo', u'politiet jo'), (u'elskerjo', u'elsker jo'), (u'vari', u'var i'), (u'fornemmerjeres', u'fornemmer jeres'), (u'udkl\xe6kketl', u'udkl\xe6kket!'), (u'\xed', u'i'), (u'nyi', u'ny i'), (u'Iumijelse', u'forn\xf8jelse'), (u'vures', u'vores'), (u'I/Vash\xedngtan', u'Washington'), (u'opleverjeg', u'oplever jeg'), (u'PANTEL\xc3NER', u'PANTEL\xc5NER'), (u'Gudmurgen', u'Godmorgen'), (u'SKYDEV\xc3BEN', u'SKYDEV\xc5BEN'), (u'P\xc3LIDELIG', u'P\xc5LIDELIG'), (u'avertalte', u'overtalte'), (u'Oms\xedder', u'Omsider'), (u'lurteb\xe5d', u'lorteb\xe5d'), (u'Telrslning', u'Tekstning'), (u'miU\xf8', u'milj\xf8'), (u'g\xe5ri', u'g\xe5r i'), (u'Fan/el', u'Farvel'), (u'abe\ufb01\xe6s', u'abefj\xe6s'), (u'hartalt', u'har talt'), (u'\\\xc5rkelig', u'Virkelig'), (u'beklagerjeg', u'beklager jeg'), (u'N\xe5rjeg', u'N\xe5r jeg'), (u'rnaend', u'm\xe6nd'), (u'vaskebjorn', u'vaskebj\xf8rn'), (u'Ivil', u'I vil'), (u'besog', u'bes\xf8g'), (u'Vaer', u'V\xe6r'), (u'Undersogte', u'Unders\xf8gte'), (u'modte', u'm\xf8dte'), (u'toj', u't\xf8j'), (u'fodt', u'f\xf8dt'), (u'gore', u'g\xf8re'), (u'provede', u'pr\xf8vede'), (u'forste', u'f\xf8rste'), (u'igang', u'i gang'), (u'ligenu', u'lige nu'), (u'clet', u'det'), (u'Strombell', u'Strombel!'), (u'tmvlt', u'travlt'), (u'studererjournalistik', u'studerer journalistik'), (u'inforrnererjeg', u'informerer jeg'), (u'omk\ufb01ng', u'omkring'), (u'tilAsg\xe5rd', u'til Asg\xe5rd'), (u'Kederjeg', u'Keder jeg'), (u'jaettetamp', u'j\xe6ttetamp'), (u'erjer', u'er jer'), (u'atjulehygge', u'at julehygge'), (u'Ueneste', u'tjeneste'), (u'foltsaetter', u'forts\xe6tter'), (u'A/ice', u'Alice'), (u'tvivlerjeg', u'tvivler jeg'), (u'henterjer', u'henter jer'), (u'forst\xe5rjeg', u'forst\xe5r jeg'), (u'hvisjeg', u'hvis jeg'), (u'/\xe6rt', u'l\xe6rt'), (u'vfgtrgt', u'vigtigt'), (u'hurtigtjeg', u'hurtigt jeg'), (u'kenderjo', u'kender jo'), (u'seiv', u'selv'), (u'/\xe6gehuset', u'l\xe6gehuset'), (u'herjo', u'her jo'), (u'stolerjeg', u'stoler jeg'), (u'digi', u'dig i'), (u'taberi', u'taber i'), (u'sl\xe5rjeres', u'sl\xe5r jeres'), (u'laere', u'l\xe6re'), (u'tr\xe6nerwushu', u'tr\xe6ner wushu'), (u'efterjeg', u'efter jeg'), (u'e\ufb01er', u'efter'), (u'dui', u'du i'), (u'a\ufb01en', u'aften'), (u'bliveri', u'bliver i'), (u'acceptererjer', u'accepterer jer'), (u'drikkerjo', u'drikker jo'), (u'\ufb01anjin', u'Tianjin'), (u'erl\xe6nge', u'er l\xe6nge'), (u'erikke', u'er ikke'), (u'medjer', u'med jer'), (u'Tmykke', u'Tillykke'), (u"'\ufb01anjins", u'Tianjins'), (u'Mesteri', u'Mester i'), (u'sagdetil', u'sagde til'), (u'indei', u'inde i'), (u'o\ufb01e', u'ofte'), (u"'\ufb01lgiv", u'Tilgiv'), (u'Lf\xe5r', u'I f\xe5r'), (u'viserjer', u'viser jer'), (u'Rejsjerblot', u'Rejs jer blot'), (u"'\ufb01llad", u'Tillad'), (u'iiiie\ufb01nger', u'lille\ufb01nger'), (u'VILOMFATTE', u'VIL OMFATTE'), (u'mo\ufb01o', u'motto'), (u'g\xf8rjer', u'g\xf8r jer'), (u'gifi', u'gift'), (u'hardu', u'har du'), (u'gi\ufb01', u'gift'), (u'Iaeggerjeg', u'l\xe6gger jeg'), (u'iet', u'i et'), (u'sv/yte', u'svigte'), (u'ti/', u'til'), (u'Wdal', u'Vidal'), (u'\ufb01\xe5et', u'f\xe5et'), (u'Hvo/for', u'Hvorfor'), (u'hellerikke', u'heller ikke'), (u'Wlle', u'Ville'), (u'dr/ver', u'driver'), (u'V\\\ufb02lliam', u'William'), (u'V\\\ufb02lliams', u'Williams'), (u'Vk\ufb01lliam', u'William'), (u'v\xe5dejakke', u'v\xe5de jakke'), (u'k\xe6\ufb02l', u'k\xe6ft!'), (u'sagdejeg', u'sagde jeg'), (u'oven/ejet', u'overvejet'), (u'karameisauce', u'karamelsauce'), (u'Lf\xf8lgej\xf8disk', u'If\xf8lge j\xf8disk'), (u'blevjo', u'blev jo'), (u'asiateri', u'asiater i'), (u'erV\\\ufb02lliam', u'er William'), (u'lidt\ufb02ov', u'lidt \ufb02ov'), (u'sagdejo', u'sagde jo'), (u'erlige', u'er lige'), (u'Vt\ufb01lliam', u'William'), (u'W\ufb01II', u'Will'), (u'a\ufb02darede', u'afklarede'), (u'hj\xe6iperjeg', u'hj\xe6lper jeg'), (u'laderjeg', u'lader jeg'), (u'H\xe2ndledsbeskyttere', u'H\xe5ndledsbeskyttere'), (u'Lsabels', u'Isabels'), (u'G\xf8rjeg', u'G\xf8r jeg'), (u'm\xe2jeg', u'm\xe5 jeg'), (u'ogjeg', u'og jeg'), (u'gjordejeg', u'gjorde jeg'), (u'villejeg', u'ville jeg'), (u'Vl\ufb02lliams', u'Williams'), (u'Dajeg', u'Da jeg'), (u'iorden', u'i orden'), (u'fandtjeg', u'fandt jeg'), (u'Tilykke', u'Tillykke'), (u'k\xf8rerjer', u'k\xf8rer jer'), (u'g\xf8fjeg', u'g\xf8r jeg'), (u'Selvflgelig', u'Selvf\xf8lgelig'), (u'fdder', u'fadder'), (u'bnfaldt', u'b\xf8nfaldt'), (u't\\/ehovedede', u'tvehovedede'), (u'EIler', u'Eller'), (u'ringerjeg', u'ringer jeg'), (u'blevv\xe6k', u'blev v\xe6k'), (u'st\xe1rjeg', u'st\xe5r jeg'), (u'varforbi', u'var forbi'), (u'harfortalt', u'har fortalt'), (u'iflere', u'i flere'), (u't\xf8rjeg', u't\xf8r jeg'), (u'kunnejeg', u'kunne jeg'), (u'm\xe1', u'm\xe5'), (u'hart\xe6nkt', u'har t\xe6nkt'), (u'F\xe1rjeg', u'F\xe5r jeg'), (u'afdelingervar', u'afdelinger var'), (u'0rd', u'ord'), (u'p\xe1st\xe1', u'p\xe5st\xe5'), (u'gr\xe1haret', u'gr\xe5haret'), (u'varforbl\xf8ffende', u'var forbl\xf8ffende'), (u'holdtjeg', u'holdt jeg'), (u'h\xe6ngerjo', u'h\xe6nger jo'), (u'fikjeg', u'fik jeg'), (u'f\xe1r', u'f\xe5r'), (u'Hvorforf\xf8lerjeg', u'Hvorfor f\xf8ler jeg'), (u'harfeber', u'har feber'), (u'\xe1ndssvagt', u'\xe5ndssvagt'), (u'0g', u'Og'), (u'vartre', u'var tre'), (u'abner', u'\xe5bner'), (u'garjeg', u'g\xe5r jeg'), (u'sertil', u'ser til'), (u'hvorfin', u'hvor fin'), (u'harfri', u'har fri'), (u'forstarjeg', u'forst\xe5r jeg'), (u'S\xe4', u'S\xe5'), (u'hvorfint', u'hvor fint'), (u'm\xe6rkerjeg', u'm\xe6rker jeg'), (u'ogsa', u'ogs\xe5'), (u'n\xe1rjeg', u'n\xe5r jeg'), (u'Jas\xe1', u'Jas\xe5'), (u'b\xe1ndoptager', u'b\xe5ndoptager'), (u'bed\xe1rende', u'bed\xe5rende'), (u's\xe1', u's\xe5'), (u'n\xe1r', u'n\xe5r'), (u'kunnejo', u'kunne jo'), (u'Brammertil', u'Brammer til'), (u'serjeg', u'ser jeg'), (u'gikjeg', u'gik jeg'), (u'udholderjeg', u'udholder jeg'), (u'm\xe1neder', u'm\xe5neder'), (u'vartr\xe6t', u'var tr\xe6t'), (u'd\xe1rligt', u'd\xe5rligt'), (u'klaretjer', u'klaret jer'), (u'pavirkelig', u'p\xe5virkelig'), (u'spekulererjeg', u'spekulerer jeg'), (u'fors\xf8gerjeg', u'fors\xf8ger jeg'), (u'huskerjeg', u'husker jeg'), (u'ifavnen', u'i favnen'), (u'skullejo', u'skulle jo'), (u'vartung', u'var tung'), (u'varfuldst\xe6ndig', u'var fuldst\xe6ndig'), (u'Paskedag', u'P\xe5skedag'), (u'turi', u'tur i'), (u'spillerschumanns', u'spiller Schumanns'), (u'forst\xe1rjeg', u'forst\xe5r jeg'), (u'istedet', u'i stedet'), (u'n\xe1rfrem', u'n\xe5r frem'), (u'habertrods', u'h\xe5ber trods'), (u'forf\xf8rste', u'for f\xf8rste'), (u'varto', u'var to'), (u'overtil', u'over til'), (u'forfem', u'for fem'), (u'holdtjo', u'holdt jo'), (u'passerjo', u'passer jo'), (u'ellerto', u'eller to'), (u'hartrods', u'har trods'), (u'harfuldst\xe6ndig', u'har fuldst\xe6ndig'), (u'g\xe5rjeg', u'g\xe5r jeg'), (u'giderjeg', u'gider jeg'), (u'forjer', u'for jer'), (u'erindrerjeg', u'erindrer jeg'), (u't\xe6nkerjeg', u't\xe6nker jeg'), (u'GAEt', u'G\xc5ET'), (u'h\xf8rerjo', u'h\xf8rer jo'), (u'forladerjeg', u'forlader jeg'), (u'kosterjo', u'koster jo'), (u'fort\xe6llerjeg', u'fort\xe6ller jeg'), (u'Forstyrrerjeg', u'Forstyrrer jeg'), (u'tjekkerjeg', u'tjekker jeg'), (u'erjurist', u'er jurist'), (u'tlLBUD', u'TILBUD'), (u'serjo', u'se rjo'), (u'bederjeg', u'beder jeg'), (u'bilderjeg', u'bilder jeg'), (u'ULVEtlME', u'ULVETlME'), (u'sk\xe6rerjo', u'sk\xe6rer jo'), (u'afjer', u'af jer'), (u'ordnerjeg', u'ordner jeg'), (u'giverjeg', u'giver jeg'), (u'rejservi', u'rejser vi'), (u'fangerjeg', u'fanger jeg'), (u'erjaloux', u'er jaloux'), (u'glemmerjeg', u'glemmer jeg'), (u'Beh\xf8verjeg', u'Beh\xf8ver jeg'), (u'harvi', u'har vi'), (u'ertyndere', u'er tyndere'), (u'f\xe5rtordenvejr', u'f\xe5r tordenvejr'), (u'varf\xe6rdig', u'var f\xe6rdig'), (u'h\xf8rerfor', u'h\xf8rer for'), (u'varvel', u'var vel'), (u'erforbi', u'er forbi'), (u'AIle', u'Alle'), (u'l\xe6serjo', u'l\xe6ser jo'), (u'Edgarer', u'Edgar er'), (u'hartaget', u'har taget'), (u'derer', u'der er'), (u'stikkerfrem', u'stikker frem'), (u'haraldrig', u'har aldrig'), (u'ellerfar', u'eller far'), (u'erat', u'er at'), (u'turtil', u'tur til'), (u'erf\xe6rdig', u'er f\xe6rdig'), (u'f\xf8lerjeg', u'f\xf8ler jeg'), (u'jerfra', u'jer fra'), (u'eralt', u'er alt'), (u'harfaktisk', u'har faktisk'), (u'harfundet', u'har fundet'), (u'harvendt', u'har vendt'), (u'Kunstneraf', u'Kunstner af'), (u'ervel', u'er vel'), (u'st\xe5ransigt', u'st\xe5r ansigt'), (u'Erjeg', u'Er jeg'), (u'venterjeg', u'venter jeg'), (u'Hvorvar', u'Hvor var'), (u'varfint', u'var fint'), (u'ervarmt', u'er varmt'), (u'g\xe5rfint', u'g\xe5r fint'), (u'flyverforbi', u'flyver forbi'), (u'Dervar', u'Der var'), (u'dervar', u'der var'), (u'mener\xe5ndeligt', u'mener \xe5ndeligt'), (u'forat', u'for at'), (u'herovertil', u'herover til'), (u'soverfor', u'sover for'), (u'begyndtejeg', u'begyndte jeg'), (u'vendertilbage', u'vender tilbage'), (u'erforf\xe6rdelig', u'er forf\xe6rdelig'), (u'g\xf8raltid', u'g\xf8r altid'), (u'ertilbage', u'er tilbage'), (u'harv\xe6ret', u'har v\xe6ret'), (u'bagoverellertil', u'bagover eller til'), (u'hertaler', u'her taler'), (u'v\xe5gnerjeg', u'v\xe5gner jeg'), (u'vartomt', u'var tomt'), (u'g\xe5rfrem', u'g\xe5r frem'), (u'talertil', u'taler til'), (u'ertryg', u'er tryg'), (u'ansigtervendes', u'ansigter vendes'), (u'hervirkeligt', u'her virkeligt'), (u'herer', u'her er'), (u'dr\xf8mmerjo', u'dr\xf8mmer jo'), (u'erfuldkommen', u'er fuldkommen'), (u'hveren', u'hver en'), (u'erfej', u'er fej'), (u'datterforg\xe6ves', u'datter forg\xe6ves'), (u'fors\xf8gerjo', u'fors\xf8ger jo'), (u'ertom', u'er tom'), (u'vareftermiddag', u'var eftermiddag'), (u'vartom', u'var tom'), (u'angerellerforventninger', u'anger eller forventninger'), (u'k\xf8rtejeg', u'k\xf8rte jeg'), (u'Hvorforfort\xe6ller', u'Hvorfor fort\xe6ller'), (u'g\xe5rtil', u'g\xe5r til'), (u'ringerefter', u'ringer efter'), (u's\xf8gertilflugt', u's\xf8ger tilflugt'), (u'ertvunget', u'er tvunget'), (u'megetjeg', u'meget jeg'), (u'varikke', u'var ikke'), (u'Derermange', u'Der e rmange'), (u'dervilhindre', u'der vil hindre'), (u'ers\xe5', u'er s\xe5'), (u'Detforst\xe5rLeggodt', u'Det forst\xe5r jeg godt'), (u'ergodt', u'er godt'), (u'vorventen', u'vor venten'), (u'tagerfejl', u'tager fejl'), (u'ellerer', u'eller er'), (u'laverjeg', u'laver jeg'), (u'0mgang', u'omgang'), (u'afst\xe1r', u'afst\xe5r'), (u'p\xe1', u'p\xe5'), (u'rejserjeg', u'rejser jeg'), (u'ellertage', u'eller tage'), (u'takkerjeg', u'takker jeg'), (u'ertilf\xe6ldigvis', u'er tilf\xe6ldigvis'), (u'fremstar', u'fremst\xe5r'), (u'ert\xe6t', u'er t\xe6t'), (u'ijeres', u'i jeres'), (u'Sagdejeg', u'Sagde jeg'), (u'overi', u'over i'), (u'plukkerjordb\xe6r', u'plukker jordb\xe6r'), (u'klarerjeg', u'klarer jeg'), (u'jerfire', u'jer fire'), (u't\xe1beligste', u't\xe5beligste'), (u'sigertvillingerne', u'siger tvillingerne'), (u'erfaktisk', u'er faktisk'), (u'g\xe1r', u'g\xe5r'), (u'harvasket', u'har vasket'), (u'harplukketjordb\xe6rtil', u'har plukket jordb\xe6r til'), (u'plukketjordb\xe6r', u'plukket jordb\xe6r'), (u'klaverfireh\xe6ndigt', u'klaver fireh\xe6ndigt'), (u'erj\xe6vnaldrende', u'er j\xe6vnaldrende'), (u'tierjeg', u'tier jeg'), (u'Hvorerden', u'Hvor er den'), (u'0veraltjeg', u'overalt jeg'), (u'g\xe5rp\xe5', u'g\xe5r p\xe5'), (u'finderjeg', u'finder jeg'), (u'serhans', u'ser hans'), (u'tiderbliver', u'tider bliver'), (u'ellertrist', u'eller trist'), (u'forst\xe5rjeres', u'forst\xe5r jeres'), (u'Hvorsj\xe6len', u'Hvor sj\xe6len'), (u'finderro', u'finder ro'), (u'sidderjeg', u'sidder jeg'), (u'tagerjo', u'tager jo'), (u'efterjeres', u'efter jeres'), (u'10O', u'100'), (u'besluttedejeg', u'besluttede jeg'), (u'varsket', u'var sket'), (u'uadskillige', u'uadskillelige'), (u'harjetlag', u'har jetlag'), (u'lkke', u'Ikke'), (u'lntet', u'Intet'), (u'afsl\xf8rerjeg', u'afsl\xf8rer jeg'), (u'm\xe5jeg', u'm\xe5 jeg'), (u'Vl', u'VI'), (u'atbygge', u'at bygge'), (u'detmakabre', u'det makabre'), (u'vilikke', u'vil ikke'), (u'talsmandbekr\xe6fter', u'talsmand bekr\xe6fter'), (u'vedatrenovere', u'ved at renovere'), (u'fors\xf8geratforst\xe5', u'fors\xf8ger at forst\xe5'), (u'ersket', u'er sket'), (u'morderp\xe5', u'morder p\xe5'), (u'frifodiRosewood', u'fri fod i Rosewood'), (u'holdtpressem\xf8de', u'holdt pressem\xf8de'), (u'lngen', u'Ingen'), (u'lND', u'IND'), (u'henterjeg', u'henter jeg'), (u'lsabel', u'Isabel'), (u'lsabels', u'Isabels'), (u'vinderjo', u'vinder jo'), (u'r\xf8dmerjo', u'r\xf8dmer jo'), (u'etjakkes\xe6t', u'et jakkes\xe6t'), (u'gl\xe6derjeg', u'gl\xe6der jeg'), (u'lgen', u'Igen'), (u'ls\xe6r', u'Is\xe6r'), (u'iparken', u'i parken'), (u'n\xe5rl', u'n\xe5r I'), (u'tilA1', u'til A1'), (u'FBl', u'FBI'), (u'viljo', u'vil jo'), (u'detp\xe5', u'det p\xe5'), (u'KIar', u'Klar'), (u'PIan', u'Plan'), (u'EIIer', u'Eller'), (u'FIot', u'Flot'), (u'AIIe', u'Alle'), (u'AIt', u'Alt'), (u'KIap', u'Klap'), (u'PIaza', u'Plaza'), (u'SIap', u'Slap'), (u'I\xe5', u'l\xe5'), (u'BIing', u'Bling'), (u'GIade', u'Glade'), (u'Iejrb\xe5lssange', u'lejrb\xe5lssange'), (u'bedtjer', u'bedt jer'), (u'h\xf8rerjeg', u'h\xf8rer jeg'), (u'F\xe5rjeg', u'F\xe5r jeg'), (u'fikJames', u'fik James'), (u'atsnakke', u'at snakke'), (u'varkun', u'var kun'), (u'retterjeg', u'retter jeg'), (u'ernormale', u'er normale'), (u'viljeg', u'vil jeg'), (u'S\xe6tjer', u'S\xe6t jer'), (u'udsatham', u'udsat ham'), (u'afen', u'af en'), (u'p\xe5jorden', u'p\xe5 jorden'), (u'afdem', u'af dem'), (u'kmt', u'km/t')]),
+                        'pattern': u"(?um)(\\b|^)(?:Haner|JaveL|Pa\\/\\/e|bffte|Utro\\/\\/gt|Kommerdu|smi\\/er|\\/eg|harvinger|\\/et|erjeres|hardet|t\\\xe6nktjer|erjo|sti\\/|Iappe|Beklagel\\\xe7|vardet|afden|snupperjeg|ikkejeg|bliverjeg|hartravit|pandekagef\\/ag|Stormvarsell|stormvejn|morgenkomp\\/et|\\/yv|varjo|\\/eger|harjeg|havdejeg|hvorjeg|n\\\xe5rjeg|g\\\xe5rvi|atjeg|isine|f\\\xe5rjeg|k\\\xe6rtighed|skullejeg|laest|laese|g\\\xf8rjeg|g\\\xf8rvi|angrerjo|Hvergang|erder|villetilgive|\\\ufb01eme|genopst\\\xe5ri|svigtejer|kommernu|n\\\xe5rman|erfire|Hvorfor\\\ufb01nderdu|undertigt|itroen|erl\\\xf8gnt|g\\\xf8rden|forhelvede|hjpe|togeti|M\\\xe5jeg|savnerjer|erjeg|vaere|geme|trorp\\\xe5|forham|afham|harjo|ovema\\\ufb01et|begae\\\ufb01ighed|sy\\\u2019g|Imensjeg|bliverdu|\\\ufb01ser|manipuierer|forjeg|iivgivendefor|formig|Hardu|fornold|defrelste|S\\\xe5jeg|varjeg|g\\\xf8rved|kalderjeg|\\\ufb02ytte|handlerdet|trorjeg|\\\ufb02ytter|soverjeg|\\\ufb01nderud|naboerp\\\xe5|ervildt|v\\\xe6reher|hyggerjer|borjo|kommerikke|folkynde|farglad|misterjeg|\\\ufb01nt|Harl|bedejer|synesjeg|vartil|eren|\\\\Al|\\\\A|fjeme|Iigefyldt|ertil|fa\\\ufb01igt|\\\ufb01nder|\\\ufb01ndes|irettesae\\\ufb01else|ermed|\\\xe8n|gikjoi|Hvisjeg|ovema\\\ufb01er|hoident|\\\\Adne|fori|vei|savnerjerjo|elskerjer|harl\\\xf8jet|eri|\\\ufb01ende|derjo|sigerjo|menerjeg|Harjeg|sigerjeg|splitterjeg|erjournalist|erjoumalist|Forjeg|g\\\xe2rjeg|N\\\xe2rjeg|a\\\ufb02lom|farerjo|tagerjeg|Virkerjeg|morerjer|kommerjo|istand|b\\\xf8m|frygterjeg|kommerjeg|eriournalistelev|harfat|f\\\xe5r\\\ufb01ngre|sl\\\xe2rjeg|bam|erjournalistelev|politietjo|elskerjo|vari|fornemmerjeres|udkl\\\xe6kketl|\\\xed|nyi|Iumijelse|vures|I\\/Vash\\\xedngtan|opleverjeg|PANTEL\\\xc3NER|Gudmurgen|SKYDEV\\\xc3BEN|P\\\xc3LIDELIG|avertalte|Oms\\\xedder|lurteb\\\xe5d|Telrslning|miU\\\xf8|g\\\xe5ri|Fan\\/el|abe\\\ufb01\\\xe6s|hartalt|\\\\\\\xc5rkelig|beklagerjeg|N\\\xe5rjeg|rnaend|vaskebjorn|Ivil|besog|Vaer|Undersogte|modte|toj|fodt|gore|provede|forste|igang|ligenu|clet|Strombell|tmvlt|studererjournalistik|inforrnererjeg|omk\\\ufb01ng|tilAsg\\\xe5rd|Kederjeg|jaettetamp|erjer|atjulehygge|Ueneste|foltsaetter|A\\/ice|tvivlerjeg|henterjer|forst\\\xe5rjeg|hvisjeg|\\/\\\xe6rt|vfgtrgt|hurtigtjeg|kenderjo|seiv|\\/\\\xe6gehuset|herjo|stolerjeg|digi|taberi|sl\\\xe5rjeres|laere|tr\\\xe6nerwushu|efterjeg|e\\\ufb01er|dui|a\\\ufb01en|bliveri|acceptererjer|drikkerjo|\\\ufb01anjin|erl\\\xe6nge|erikke|medjer|Tmykke|\\'\\\ufb01anjins|Mesteri|sagdetil|indei|o\\\ufb01e|\\'\\\ufb01lgiv|Lf\\\xe5r|viserjer|Rejsjerblot|\\'\\\ufb01llad|iiiie\\\ufb01nger|VILOMFATTE|mo\\\ufb01o|g\\\xf8rjer|gifi|hardu|gi\\\ufb01|Iaeggerjeg|iet|sv\\/yte|ti\\/|Wdal|\\\ufb01\\\xe5et|Hvo\\/for|hellerikke|Wlle|dr\\/ver|V\\\\\\\ufb02lliam|V\\\\\\\ufb02lliams|Vk\\\ufb01lliam|v\\\xe5dejakke|k\\\xe6\\\ufb02l|sagdejeg|oven\\/ejet|karameisauce|Lf\\\xf8lgej\\\xf8disk|blevjo|asiateri|erV\\\\\\\ufb02lliam|lidt\\\ufb02ov|sagdejo|erlige|Vt\\\ufb01lliam|W\\\ufb01II|a\\\ufb02darede|hj\\\xe6iperjeg|laderjeg|H\\\xe2ndledsbeskyttere|Lsabels|G\\\xf8rjeg|m\\\xe2jeg|ogjeg|gjordejeg|villejeg|Vl\\\ufb02lliams|Dajeg|iorden|fandtjeg|Tilykke|k\\\xf8rerjer|g\\\xf8fjeg|Selvflgelig|fdder|bnfaldt|t\\\\\\/ehovedede|EIler|ringerjeg|blevv\\\xe6k|st\\\xe1rjeg|varforbi|harfortalt|iflere|t\\\xf8rjeg|kunnejeg|m\\\xe1|hart\\\xe6nkt|F\\\xe1rjeg|afdelingervar|0rd|p\\\xe1st\\\xe1|gr\\\xe1haret|varforbl\\\xf8ffende|holdtjeg|h\\\xe6ngerjo|fikjeg|f\\\xe1r|Hvorforf\\\xf8lerjeg|harfeber|\\\xe1ndssvagt|0g|vartre|abner|garjeg|sertil|hvorfin|harfri|forstarjeg|S\\\xe4|hvorfint|m\\\xe6rkerjeg|ogsa|n\\\xe1rjeg|Jas\\\xe1|b\\\xe1ndoptager|bed\\\xe1rende|s\\\xe1|n\\\xe1r|kunnejo|Brammertil|serjeg|gikjeg|udholderjeg|m\\\xe1neder|vartr\\\xe6t|d\\\xe1rligt|klaretjer|pavirkelig|spekulererjeg|fors\\\xf8gerjeg|huskerjeg|ifavnen|skullejo|vartung|varfuldst\\\xe6ndig|Paskedag|turi|spillerschumanns|forst\\\xe1rjeg|istedet|n\\\xe1rfrem|habertrods|forf\\\xf8rste|varto|overtil|forfem|holdtjo|passerjo|ellerto|hartrods|harfuldst\\\xe6ndig|g\\\xe5rjeg|giderjeg|forjer|erindrerjeg|t\\\xe6nkerjeg|GAEt|h\\\xf8rerjo|forladerjeg|kosterjo|fort\\\xe6llerjeg|Forstyrrerjeg|tjekkerjeg|erjurist|tlLBUD|serjo|bederjeg|bilderjeg|ULVEtlME|sk\\\xe6rerjo|afjer|ordnerjeg|giverjeg|rejservi|fangerjeg|erjaloux|glemmerjeg|Beh\\\xf8verjeg|harvi|ertyndere|f\\\xe5rtordenvejr|varf\\\xe6rdig|h\\\xf8rerfor|varvel|erforbi|AIle|l\\\xe6serjo|Edgarer|hartaget|derer|stikkerfrem|haraldrig|ellerfar|erat|turtil|erf\\\xe6rdig|f\\\xf8lerjeg|jerfra|eralt|harfaktisk|harfundet|harvendt|Kunstneraf|ervel|st\\\xe5ransigt|Erjeg|venterjeg|Hvorvar|varfint|ervarmt|g\\\xe5rfint|flyverforbi|Dervar|dervar|mener\\\xe5ndeligt|forat|herovertil|soverfor|begyndtejeg|vendertilbage|erforf\\\xe6rdelig|g\\\xf8raltid|ertilbage|harv\\\xe6ret|bagoverellertil|hertaler|v\\\xe5gnerjeg|vartomt|g\\\xe5rfrem|talertil|ertryg|ansigtervendes|hervirkeligt|herer|dr\\\xf8mmerjo|erfuldkommen|hveren|erfej|datterforg\\\xe6ves|fors\\\xf8gerjo|ertom|vareftermiddag|vartom|angerellerforventninger|k\\\xf8rtejeg|Hvorforfort\\\xe6ller|g\\\xe5rtil|ringerefter|s\\\xf8gertilflugt|ertvunget|megetjeg|varikke|Derermange|dervilhindre|ers\\\xe5|Detforst\\\xe5rLeggodt|ergodt|vorventen|tagerfejl|ellerer|laverjeg|0mgang|afst\\\xe1r|p\\\xe1|rejserjeg|ellertage|takkerjeg|ertilf\\\xe6ldigvis|fremstar|ert\\\xe6t|ijeres|Sagdejeg|overi|plukkerjordb\\\xe6r|klarerjeg|jerfire|t\\\xe1beligste|sigertvillingerne|erfaktisk|g\\\xe1r|harvasket|harplukketjordb\\\xe6rtil|plukketjordb\\\xe6r|klaverfireh\\\xe6ndigt|erj\\\xe6vnaldrende|tierjeg|Hvorerden|0veraltjeg|g\\\xe5rp\\\xe5|finderjeg|serhans|tiderbliver|ellertrist|forst\\\xe5rjeres|Hvorsj\\\xe6len|finderro|sidderjeg|tagerjo|efterjeres|10O|besluttedejeg|varsket|uadskillige|harjetlag|lkke|lntet|afsl\\\xf8rerjeg|m\\\xe5jeg|Vl|atbygge|detmakabre|vilikke|talsmandbekr\\\xe6fter|vedatrenovere|fors\\\xf8geratforst\\\xe5|ersket|morderp\\\xe5|frifodiRosewood|holdtpressem\\\xf8de|lngen|lND|henterjeg|lsabel|lsabels|vinderjo|r\\\xf8dmerjo|etjakkes\\\xe6t|gl\\\xe6derjeg|lgen|ls\\\xe6r|iparken|n\\\xe5rl|tilA1|FBl|viljo|detp\\\xe5|KIar|PIan|EIIer|FIot|AIIe|AIt|KIap|PIaza|SIap|I\\\xe5|BIing|GIade|Iejrb\\\xe5lssange|bedtjer|h\\\xf8rerjeg|F\\\xe5rjeg|fikJames|atsnakke|varkun|retterjeg|ernormale|viljeg|S\\\xe6tjer|udsatham|afen|p\\\xe5jorden|afdem|kmt)(\\b|$)"}},
+ 'deu': {'BeginLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'EndLines': {'data': OrderedDict(),
+                      'pattern': None},
+         'PartialLines': {'data': OrderedDict(),
+                          'pattern': None},
+         'PartialWordsAlways': {'data': OrderedDict([(u'IVI', u'M'), (u'IVl', u'M'), (u'I\\/I', u'M'), (u'I\\/l', u'M'), (u'lVI', u'M'), (u'lVl', u'M'), (u'l\\/I', u'M'), (u'l\\/l', u'M'), (u'\xa4', u'o'), (u'\xb6\xb6', u'\u266b'), (u'\xb6', u'\u266a')]),
+                                'pattern': None},
+         'WholeLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'WholeWords': {'data': OrderedDict([(u'/a', u'Ja'), (u'/ch', u'Ich'), (u'/d/of', u'Idiot'), (u'/ebte', u'lebte'), (u'/eid', u'leid'), (u'/hn', u'ihn'), (u'/hnen', u'Ihnen'), (u'/hr', u'Ihr'), (u'/hre', u'Ihre'), (u'/hren', u'Ihren'), (u'/m', u'im'), (u'/mmer', u'immer'), (u'/n', u'In'), (u'/ndividuen', u'Individuen'), (u'/nn', u'Inn'), (u'/oe', u'Joe'), (u'/sf', u'ist'), (u'/sf/0/1n', u'Ist John'), (u'/ungs', u'Jungs'), (u'/Vfinuten', u'Minuten'), (u'/\xe9nger', u'l\xe4nger'), (u'/\xe9uft', u'l\xe4uft'), (u'0/1', u'Oh'), (u'0/me', u'ohne'), (u'0/vne', u'ohne'), (u'00om', u'000 m'), (u'100m', u'100 m'), (u'120m', u'120 m'), (u'13Oj\xa7hrie', u'130-j\xe4hrige'), (u'145m', u'145 m'), (u'150m', u'150 m'), (u'160m', u'160 m'), (u'165m', u'165 m'), (u'19m', u'19 m'), (u'20m', u'20 m'), (u'27m', u'27 m'), (u'30m', u'30 m'), (u'37m', u'37 m'), (u'38m', u'38 m'), (u'3km', u'3 km'), (u'5/ch', u'sich'), (u'5/cher', u'sicher'), (u'5/cherer', u'sicherer'), (u'5/e', u'Sie'), (u'5/nd', u'Sind'), (u'500m', u'500 m'), (u'5ulSere', u'\xe4u\xdfere'), (u'60m', u'60 m'), (u'6de', u'\xf6de'), (u'6dere', u'\xf6dere'), (u'6ffne', u'\xf6ffne'), (u'6ffnen', u'\xf6ffnen'), (u'6ffnet', u'\xd6ffnet'), (u'6fter', u'\xf6fter'), (u'750m', u'750 m'), (u'85m', u'85 m'), (u'90m', u'90 m'), (u'a//em', u'allem'), (u'A//es', u'Alles'), (u'abbeif$en', u'abbei\xdfen'), (u'abdrficken', u'abdr\xfccken'), (u'aBen', u'a\xdfen'), (u'abergl\xe9iubischen', u'abergl\xe4ubischen'), (u'aberja', u'aber ja'), (u'aberjemand', u'aber jemand'), (u'Aberjetzt', u'Aber jetzt'), (u'abf\xe9hrt', u'abf\xe4hrt'), (u'abf\xe9illt', u'abf\xe4llt'), (u'abgef\xe9rbt', u'abgef\xe4rbt'), (u'abgeh\xe9ngt', u'abgeh\xe4ngt'), (u'abgeh\xe9rt', u'abgeh\xf6rt'), (u'abgelost', u'abgel\xf6st'), (u'abgesprengli', u'abgesprengt!'), (u'abgestfirztl', u'abgest\xfcrzt'), (u'abgestilrzt', u'abgest\xfcrzt'), (u'abgestofien', u'abgesto\xdfen'), (u'abgew\xe9hlt', u'abgew\xe4hlt'), (u'abgew\xe9hnen', u'abgew\xf6hnen'), (u'abgew\xe9hnt', u'abgew\xf6hnt'), (u'abge\xe9nderten', u'abge\xe4nderten'), (u'abh\xe9ingt', u'abh\xe4ngt'), (u'abh\xe9ngen', u'abh\xe4ngen'), (u'abh\xe9ngig', u'abh\xe4ngig'), (u'abh\xe9ngiges', u'abh\xe4ngiges'), (u'Abh\xe9rstationen', u'Abh\xf6rstationen'), (u'Abjetzt', u'Ab jetzt'), (u'abkfihlen', u'abk\xfchlen'), (u'Abkfirzung', u'Abk\xfcrzung'), (u'abkommlich', u'abk\xf6mmlich'), (u'Ablegenl', u'Ablegen!'), (u'ablfisen', u'abl\xf6sen'), (u'ablosen', u'abl\xf6sen'), (u'Ablosung', u'Abl\xf6sung'), (u'abreif$en', u'abrei\xdfen'), (u'Abrijcken', u'Abr\xfccken'), (u'abr\xe9umen', u'abr\xe4umen'), (u'Absch/ed', u'Abschied'), (u'abschiefien', u'abschie\xdfen'), (u'abschlief$en', u'abschlie\xdfen'), (u'abschliefien', u'abschlie\xdfen'), (u'abschwiiren', u'abschw\xf6ren'), (u'abstoflsend', u'absto\xdfend'), (u'Abtrijnnige', u'Abtr\xfcnnige'), (u'abwiirgt', u'abw\xfcrgt'), (u'abw\xe9gen', u'abw\xe4gen'), (u'abzuh\xe9ren', u'abzuh\xf6ren'), (u'abzuschwiiren', u'abzuschw\xf6ren'), (u'abzusfofien', u'abzusto\xdfen'), (u'ACh', u'Ach'), (u'Achtungl', u'Achtung!'), (u'Achzen', u'\xc4chzen'), (u'ACHZT', u'\xc4CHZT'), (u'Acic', u'Acid'), (u'ADDRESSDATEI', u'ADRESSDATEI'), (u'Adi\xf6s', u'Adi\xf3s'), (u'Admiralitat', u'Admiralit\xe4t'), (u'Admiralit\xe9it', u'Admiralit\xe4t'), (u'Admiralit\xe9t', u'Admiralit\xe4t'), (u'Aff\xe9re', u'Aff\xe4re'), (u'Aff\xe9ren', u'Aff\xe4ren'), (u'AFl', u'AFI'), (u'aggresivem', u'aggressivem'), (u'Agypten', u'\xc4gypten'), (u'aher', u'aber'), (u'AI/en/vichtigste', u'Allerwichtigste'), (u'Ain/vays', u'Airways'), (u'AIs', u'Als'), (u'Aktivit\xe9iten', u'Aktivit\xe4ten'), (u'Aktivit\xe9ten', u'Aktivit\xe4ten'), (u'AKTMERT', u'AKTIVIERT'), (u'Alarmsfufe', u'Alarmstufe'), (u'albem', u'albern'), (u'Albtriiume', u'Albtr\xe4ume'), (u'ale', u'als'), (u'alleinl', u'allein!'), (u'allejubeln', u'alle jubeln'), (u'allern\xe9chsten', u'allern\xe4chsten'), (u'Allmiichtigerl', u'Allm\xe4chtiger!'), (u'Allm\xe9chtige', u'Allm\xe4chtige'), (u'Allm\xe9chtiger', u'Allm\xe4chtiger'), (u'allm\xe9hlich', u'allm\xe4hlich'), (u'Allm\xe9ichtiger', u'Allm\xe4chtiger'), (u'Allsparkl', u'Allspark!'), (u'allt\xe9iglichen', u'allt\xe4glichen'), (u'ALTESTE', u'\xc4LTESTE'), (u'Altester', u'\xc4ltester'), (u'Alzte', u'\xc4rzte'), (u"Amerx'kaner", u'Amerikaner'), (u'amfisierst', u'am\xfcsierst'), (u'Amiilsierst', u'Am\xfcsierst'), (u'amiisieren', u'am\xfcsieren'), (u'amiisierenl', u'am\xfcsieren!'), (u'amiisierte', u'am\xfcsierte'), (u'Amijsant', u'Am\xfcsant'), (u'amlllsant', u'am\xfcsant'), (u'amlllsiert', u'am\xfcsiert'), (u'amtlsant', u'am\xfcsant'), (u'Amusanf', u'Am\xfcsant'), (u'amusant', u'am\xfcsant'), (u'Amusiert', u'Am\xfcsiert'), (u'Anderst', u'\xc4nderst'), (u'Anderung', u'\xc4nderung'), (u'Anderungen', u'\xc4nderungen'), (u"anfa'ngt", u'anf\xe4ngt'), (u'Anffihrer', u'Anf\xfchrer'), (u'Anffingerl', u'Anf\xe4nger!'), (u'Anfiihrer', u'Anf\xfchrer'), (u'anfijhlt', u'anf\xfchlt'), (u'Anfingerl', u'Anf\xe4nger!'), (u'Anfuhrer', u'Anf\xfchrer'), (u'Anfuhrern', u'Anf\xfchrern'), (u'Anf\xe9inger', u'Anf\xe4nger'), (u'Anf\xe9ingergliick', u'Anf\xe4ngergl\xfcck'), (u'Anf\xe9nge', u'Anf\xe4nge'), (u'anf\xe9ngst', u'anf\xe4ngst'), (u'anf\xe9ngt', u'anf\xe4ngt'), (u'angebrfillt', u'angebr\xfcllt'), (u'angebrullt', u'angebr\xfcllt'), (u'angefiihrt', u'angef\xfchrt'), (u'ANGEHCHDRIGE', u'ANGEH\xd6RIGE'), (u'angehfirt', u'angeh\xf6rt'), (u'Angehtirigen', u'Angeh\xf6rigen'), (u'angeh\xe9ren', u'angeh\xf6ren'), (u'angeh\xe9rt', u'angeh\xf6rt'), (u'angel\xe9chelt', u'angel\xe4chelt'), (u'angerilhrt', u'anger\xfchrt'), (u'anger\ufb02hrt', u'anger\xfchrt'), (u'angeschweifit', u'angeschwei\xdft'), (u'angespruht', u'angespr\xfcht'), (u'angetiltert', u'anget\xfctert'), (u'Angriffspl\xe9nen', u'Angriffspl\xe4nen'), (u'Angstschweili', u'Angstschwei\xdf'), (u'anhiiren', u'anh\xf6ren'), (u'Anh\xe9inger', u'Anh\xe4nger'), (u'anh\xe9lt', u'anh\xe4lt'), (u'anh\xe9ngen', u'anh\xe4ngen'), (u'anh\xe9ren', u'anh\xf6ren'), (u'ankijndigen', u'ank\xfcndigen'), (u'anliigen', u'anl\xfcgen'), (u'anlugen', u'anl\xfcgen'), (u'anmal3ende', u'anma\xdfende'), (u'ann\xe9hern', u'ann\xe4hern'), (u'anriihrst', u'anr\xfchrst'), (u'anrijuhren', u'anr\xfchren'), (u'anst\xe9indig', u'anst\xe4ndig'), (u'anst\xe9indiger', u'anst\xe4ndiger'), (u'anst\xe9indiges', u'anst\xe4ndiges'), (u'anst\xe9ndig', u'anst\xe4ndig'), (u'anst\xe9ndige', u'anst\xe4ndige'), (u'anst\xe9ndigen', u'anst\xe4ndigen'), (u'Anst\xe9ndiges', u'Anst\xe4ndiges'), (u'Antik\xe9rper', u'Antik\xf6rper'), (u'Antiquit\xe9t', u'Antiquit\xe4t'), (u'Antistrahlenger\xe9t', u'Antistrahlenger\xe4t'), (u'antwortenl', u'antworten!'), (u'Anwe/sung', u'Anweisung'), (u'Anwe/sungen', u'Anweisungen'), (u'Anw\xe9iltin', u'Anw\xe4ltin'), (u'Anw\xe9lte', u'Anw\xe4lte'), (u'Anw\xe9ltin', u'Anw\xe4ltin'), (u'Anzilge', u'Anz\xfcge'), (u'Anztinden', u'Anz\xfcnden'), (u'Anzuge', u'Anz\xfcge'), (u'Anzugen', u'Anz\xfcgen'), (u'anzuhiiren', u'anzuh\xf6ren'), (u'anzuhoren', u'anzuh\xf6ren'), (u'anzundenl', u'anz\xfcnden!'), (u'anzupiibeln', u'anzup\xf6beln'), (u'An\xe9sthesie', u'An\xe4sthesie'), (u'An\xe9sthesieprofessor', u'An\xe4sthesieprofessor'), (u'An\xe9sthesieteam', u'An\xe4sthesieteam'), (u'An\xe9sthesist', u'An\xe4sthesist'), (u'An\xe9sthesisten', u'An\xe4sthesisten'), (u'An\xe9sthetikum', u'An\xe4sthetikum'), (u'ARBEITERI', u'ARBEITER:'), (u'Arbeitsfl\ufb02gel', u'Arbeitsfl\xfcgel'), (u'Armeefunkger\xe9t', u'Armeefunkger\xe4t'), (u'Armel', u'\xc4rmel'), (u'Arschkichern', u'Arschl\xf6chern'), (u'Arschliicher', u'Arschl\xf6cher'), (u'Arschliichern', u'Arschl\xf6chern'), (u'Arschl\xe9cher', u'Arschl\xf6cher'), (u'Arschl\xe9chern', u'Arschl\xf6chern'), (u'Arzte', u'\xc4rzte'), (u'Arzten', u'\xc4rzten'), (u'Arztin', u'\xc4rztin'), (u'Atemger\xe9usche', u'Atemger\xe4usche'), (u'Atlantikkiiste', u'Atlantikk\xfcste'), (u'Atlantikkuste', u'Atlantikk\xfcste'), (u'ATMOSPHARE', u'ATMOSPH\xc4RE'), (u'Atmosph\xe9re', u'Atmosph\xe4re'), (u'Atmosph\xe9renbereich', u'Atmosph\xe4renbereich'), (u'Atmosph\xe9reneinflugsequenz', u'Atmosph\xe4reneinflugsequenz'), (u'Atmosph\xe9reneintritt', u'Atmosph\xe4reneintritt'), (u'Attenfaiter', u'Attent\xe4ter'), (u'Attent\xe9iter', u'Attent\xe4ter'), (u'Attent\xe9ter', u'Attent\xe4ter'), (u'Attent\xe9ters', u'Attent\xe4ters'), (u'Attraktivit\xe9t', u'Attraktivit\xe4t'), (u'auBen', u'au\xdfen'), (u'Aubenblick', u'Augenblick'), (u'AuBenbord', u'Au\xdfenbord'), (u'AuBenwelt', u'Au\xdfenwelt'), (u'auBer', u'au\xdfer'), (u'AuBerdem', u'Au\xdferdem'), (u'auBerhalb', u'au\xdferhalb'), (u'auc/1', u'auch'), (u'auchl', u'auch!'), (u'Auf$erdem', u'Au\xdferdem'), (u'auf3er', u'au\xdfer'), (u'aufAugenh6he', u'auf Augenh\xf6he'), (u'aufblilhende', u'aufbl\xfchende'), (u"auff'a'ngt", u'auff\xe4ngt'), (u'Auff\xe9lliges', u'Auff\xe4lliges'), (u'aufgebltiht', u'aufgebl\xfcht'), (u'aufgeftlhrt', u'aufgef\xfchrt'), (u'aufgeh\xe9ingt', u'aufgeh\xe4ngt'), (u'aufgeh\xe9rt', u'aufgeh\xf6rt'), (u'aufgekl\xe9rt', u'aufgekl\xe4rt'), (u'aufger\xe9umt', u'aufger\xe4umt'), (u'aufgespiefit', u'aufgespie\xdft'), (u'aufgewiihlter', u'aufgew\xfchlter'), (u'aufgez\xe9hlt', u'aufgez\xe4hlt'), (u'Aufh6ren', u'Aufh\xf6ren'), (u'aufhbren', u'aufh\xf6ren'), (u'aufhdrf', u'aufh\xf6rt'), (u'aufhfiren', u'aufh\xf6ren'), (u'aufhiiren', u'aufh\xf6ren'), (u'Aufhoren', u'Aufh\xf6ren'), (u'Aufh\xe9iren', u'Aufh\xf6ren'), (u'aufh\xe9ngen', u'aufh\xe4ngen'), (u'Aufh\xe9ren', u'Aufh\xf6ren'), (u'aufh\xe9renl', u'aufh\xf6ren'), (u'aufi', u'auf,'), (u'Aufienministerium', u'Au\xdfenministerium'), (u'aufier', u'au\xdfer'), (u'Aufierdem', u'Au\xdferdem'), (u'aufiergew\xe9hnliche', u'au\xdfergew\xf6hnliche'), (u'aufierhalb', u'au\xdferhalb'), (u'Aufierirdischer', u'Au\xdferirdischer'), (u'Aufierlich', u'\xc4u\xdferlich'), (u'aufierordentlich', u'au\xdferordentlich'), (u'Aufkenposten', u'Au\xdfenposten'), (u'aufkisen', u'aufl\xf6sen'), (u'aufkl\xe9ren', u'aufkl\xe4ren'), (u'Aufkl\xe9rung', u'Aufkl\xe4rung'), (u'aufl', u'auf!'), (u'Aufl6sung', u'Aufl\xf6sung'), (u'aufliisen', u'aufl\xf6sen'), (u'auflser', u'au\xdfer'), (u'aufl\xe9sen', u'aufl\xf6sen'), (u'aufmiibeln', u'aufm\xf6beln'), (u'aufraumte', u'aufr\xe4umte'), (u'aufr\xe9umen', u'aufr\xe4umen'), (u'aufschlief$en', u'aufschlie\xdfen'), (u'Aufschlull', u'Aufschluss'), (u'aufSer', u'au\xdfer'), (u'aufSIJBigkeiten', u'auf S\xfc\xdfigkeiten'), (u'aufspturen', u'aufsp\xfcren'), (u'aufstellenl', u'aufstellen!'), (u'Aufst\xe9ndige', u'Aufst\xe4ndische'), (u'aufTanis', u'auf Tanis'), (u'Auftr\xe9ge', u'Auftr\xe4ge'), (u'aufvv\xe9ndigen', u'aufw\xe4ndigen'), (u'aufw\xe9ichst', u'aufw\xe4chst'), (u'aufw\xe9rmen', u'aufw\xe4rmen'), (u'aufZ>er', u'au\xdfer'), (u'Aufztlge', u'Aufz\xfcge'), (u'aufzuhiivren', u'aufzuh\xf6ren'), (u'aufzukl\xe9ren', u'aufzukl\xe4ren'), (u'aufzuldsen', u'aufzul\xf6sen'), (u'aufzur\xe9umen', u'aufzur\xe4umen'), (u'aufz\xe9hlen', u'aufz\xe4hlen'), (u'auf\xe9er', u'au\xdfer'), (u'auf\ufb02iegen', u'auffliegen'), (u'Augenm\xe9igen', u'Augenm\xe4gen'), (u"aul'5er", u'au\xdfer'), (u'aul3er', u'au\xdfer'), (u'Aul3erdem', u'Au\xdferdem'), (u'aul5er', u'au\xdfer'), (u'aulier', u'au\xdfer'), (u'Aulierdem', u'Au\xdferdem'), (u'auliergewfihnlich', u'au\xdfergew\xf6hnlich'), (u'aulierhalb', u'au\xdferhalb'), (u'Aulierirdischen', u'Au\xdferirdischen'), (u'auller', u'au\xdfer'), (u'aullerhalb', u'au\xdferhalb'), (u'AulSer', u'Au\xdfer'), (u'AulSerdem', u'Au\xdferdem'), (u'ausdriicken', u'ausdr\xfccken'), (u'ausdriickt', u'ausdr\xfcckt'), (u'ausdrijcken', u'ausdr\xfccken'), (u'ausdrucklicher', u'ausdr\xfccklicher'), (u'Ausdr\ufb02cken', u'Ausdr\xfccken'), (u'Ausen/v\xe9hlte', u'Auserw\xe4hlte'), (u'Ausen/v\xe9hlter', u'Auserw\xe4hlter'), (u'auserw\xe9hlt', u'auserw\xe4hlt'), (u'Ausffillen', u'Ausf\xfcllen'), (u'ausfijhren', u'ausf\xfchren'), (u'ausfijhrt', u'ausf\xfchrt'), (u'ausfuhren', u'ausf\xfchren'), (u'ausfullt', u'ausf\xfcllt'), (u'ausgef\ufb02llt', u'ausgef\xfcllt'), (u'ausgeliischt', u'ausgel\xf6scht'), (u'ausgeliist', u'ausgel\xf6st'), (u'ausgel\xe9ist', u'ausgel\xf6st'), (u'ausgel\xe9scht', u'ausgel\xf6scht'), (u'ausgel\xe9st', u'ausgel\xf6st'), (u'ausgeriickt', u'ausger\xfcckt'), (u'ausgerijstet', u'ausger\xfcstet'), (u'AUSGEWAHLT', u'AUSGEW\xc4HLT'), (u'ausgew\xe9hlt', u'ausgew\xe4hlt'), (u'Ausg\xe9ngen', u'Ausg\xe4ngen'), (u'aush6hlen', u'aush\xf6hlen'), (u'aushiilt', u'aush\xe4lt'), (u'Aushilfspunkerl', u'Aushilfspunker!'), (u'aush\xe9lt', u'aush\xe4lt'), (u'ausilben', u'aus\xfcben'), (u'Auskunfte', u'Ausk\xfcnfte'), (u'ausl', u'aus!'), (u'Ausl\xe9nder', u'Ausl\xe4nder'), (u'Ausl\xe9nderl', u'Ausl\xe4nder'), (u'ausl\xe9schen', u'ausl\xf6schen'), (u'ausl\xe9sen', u'ausl\xf6sen'), (u'Ausl\xe9ser', u'Ausl\xf6ser'), (u'AusmaB', u'Ausma\xdf'), (u'ausprobie\ufb02', u'ausprobiert'), (u'Ausriistung', u'Ausr\xfcstung'), (u'ausrusten', u'ausr\xfcsten'), (u'Ausrustung', u'Ausr\xfcstung'), (u'Ausschullware', u'Ausschussware'), (u'ausschwinnenl', u'ausschw\xe4rmen!'), (u'auszudriicken', u'auszudr\xfccken'), (u'auszuschliefien', u'auszuschlie\xdfen'), (u'auszuw\xe9hlen', u'auszuw\xe4hlen'), (u'Autorit\xe9t', u'Autorit\xe4t'), (u'Autoschlilssel', u'Autoschl\xfcssel'), (u'Autoschl\ufb02ssel', u'Autoschl\xfcssel'), (u'au\ufb02/viihlt', u'aufw\xfchlt'), (u'Au\ufb02ergewiihnlich', u'Au\xdfergew\xf6hnlich'), (u'Azevedol', u'Azevedo!'), (u'A\ufb02es', u'Alles'), (u'B/ick', u'Blick'), (u'b/olog/sch', u'biologisch'), (u'b/sschen', u'bisschen'), (u'B6se', u'B\xf6se'), (u'B6sem', u'B\xf6sem'), (u'B6ser', u'B\xf6ser'), (u'Babym\xe9dchen', u'Babym\xe4dchen'), (u'Ballastst\xe9ffchen', u'Ballastst\xf6ffchen'), (u'Ballm\xe9dchen', u'Ballm\xe4dchen'), (u'Ballm\xe9idchen', u'Ballm\xe4dchen'), (u'Ballonverk\xe9ufer', u'Ballonverk\xe4ufer'), (u'Balzenl', u'Balzen!'), (u'Bankijberfall', u'Bank\xfcberfall'), (u'Barbarenilberfall', u'Barbaren\xfcberfall'), (u'Barenk\xe9nig', u'Barenk\xf6nig'), (u'basfeln', u'basteln'), (u'Bastianol', u'Bastiano!'), (u'Bastlano', u'Bastiano'), (u'Bauchfellentztmdung', u'Bauchfellentz\xfcndung'), (u'Bauchkr\xe9mpfe', u'Bauchkr\xe4mpfe'), (u'bauf\xe9llig', u'bauf\xe4llig'), (u'bauf\xe9llige', u'bauf\xe4llige'), (u'Baumst\xe9mme', u'Baumst\xe4mme'), (u'Baupl\xe9ne', u'Baupl\xe4ne'), (u'Bbses', u'B\xf6ses'), (u'be/de', u'beide'), (u'bedecktl', u'bedeckt!'), (u'Bedilrfnisse', u'Bed\xfcrfnisse'), (u'Bedilrfnissen', u'Bed\xfcrfnissen'), (u'Bedllirfnisse', u'Bed\xfcrfnisse'), (u'bedrijckt', u'bedr\xfcckt'), (u'bedr\xe9ngen', u'bedr\xe4ngen'), (u'bedr\xe9ngt', u'bedr\xe4ngt'), (u'bedr\xe9ngten', u'bedr\xe4ngten'), (u'Beeilungf', u'Beeilung!'), (u'Beeilungl', u'Beeilung!'), (u'Beerdingungsinsiiiui', u'Beerdigungsinstitut'), (u'Beerdingungsinstitut', u'Beerdigungsinstitut'), (u'Befehll', u'Befehl!'), (u'beffirdert', u'bef\xf6rdert'), (u'Beffirderung', u'Bef\xf6rderung'), (u'befiirchte', u'bef\xfcrchte'), (u'befiirchteten', u'bef\xfcrchteten'), (u'befiirdert', u'bef\xf6rdert'), (u'befiirderte', u'bef\xf6rderte'), (u'Befiirderung', u'Bef\xf6rderung'), (u'befilrchtete', u'bef\xfcrchtete'), (u'befllirchte', u'bef\xfcrchte'), (u'befurworte', u'bef\xfcrworte'), (u'befurwortet', u'bef\xfcrwortet'), (u'bef\xe9rdere', u'bef\xf6rdere'), (u'bef\xe9rdert', u'bef\xf6rdert'), (u'Bef\xe9rderung', u'Bef\xf6rderung'), (u'beg/ng', u'beging'), (u'begl\ufb02ckt', u'begl\xfcckt'), (u'begniigt', u'begn\xfcgt'), (u'begrfindetes', u'begr\xfcndetes'), (u'Begriiliungsruf', u'Begr\xfc\xdfungsruf'), (u'begrijfien', u'begr\xfc\xdfen'), (u'Begrilfiung', u'Begr\xfc\xdfung'), (u'Begrilfkung', u'Begr\xfc\xdfung'), (u"begrL'llZ>en", u'begr\xfc\xdfen'), (u'BegrUBungsruf', u'Begr\xfc\xdfungsruf'), (u'begrUf$t', u'begr\xfc\xdft'), (u'begrufie', u'begr\xfc\xdfe'), (u'begrufit', u'begr\xfc\xdft'), (u'Begrundung', u'Begr\xfcndung'), (u'Beh6rden', u'Beh\xf6rden'), (u'beh\xe9lt', u'beh\xe4lt'), (u'Beh\xe9lter', u'Beh\xe4lter'), (u'beh\xe9mmert', u'beh\xe4mmert'), (u'beiB', u'bei\xdf'), (u'beiBen', u'bei\xdfen'), (u'beiBt', u'bei\xdft'), (u'beif$t', u'bei\xdft'), (u'beif2>en', u'bei\xdfen'), (u'beifken', u'bei\xdfen'), (u'beiflsen', u'bei\xdfen'), (u'beijenen', u'bei jenen'), (u'Beiliring', u'Bei\xdfring'), (u'BEKAMPFEN', u'BEK\xc4MPFEN'), (u'bekannf', u'bekannt'), (u'bekanntermafken', u'bekannterma\xdfen'), (u'bek\xe9me', u'bek\xe4me'), (u'bek\xe9mpfen', u'bek\xe4mpfen'), (u'Bek\xe9mpfung', u'Bek\xe4mpfung'), (u'bel', u'bei'), (u'belde', u'beide'), (u'beliellsen', u'belie\xdfen'), (u'belm', u'beim'), (u'Beltlftungstunnels', u'Bel\xfcftungstunnels'), (u'Beluftungstunnel', u'Bel\xfcftungstunnel'), (u'Beluftungstunnell', u'Bel\xfcftungstunnel!'), (u'bel\xe9stigen', u'bel\xe4stigen'), (u'Bemiihe', u'Bem\xfche'), (u'Bemiihen', u'Bem\xfchen'), (u"bemL'lhe", u'bem\xfche'), (u'bemtuht', u'bem\xfcht'), (u'bemuhen', u'bem\xfchen'), (u'bemuhten', u'bem\xfchten'), (u'Ben\xe9tigen', u'Ben\xf6tigen'), (u'ben\xe9tigt', u'ben\xf6tigt'), (u'ben\xe9tigten', u'ben\xf6tigten'), (u'Beobachtar', u'Beobachter'), (u'bereft', u'bereit'), (u'bereitf\xe9ndet', u'bereitf\xe4ndet'), (u'beriichtigtsten', u'ber\xfcchtigtsten'), (u'beriichtlgten', u'ber\xfcchtigten'), (u'beriihmt', u'ber\xfchmt'), (u'Beriihmtheiten', u'Ber\xfchmtheiten'), (u'beriihren', u'ber\xfchren'), (u'Beriihrend', u'Ber\xfchrend'), (u'beriihrt', u'ber\xfchrt'), (u'Beriihrtl', u'Ber\xfchrt!'), (u'berijhrt', u'ber\xfchrt'), (u'berilhmter', u'ber\xfchmter'), (u'berilhrt', u'ber\xfchrt'), (u'Berilhrung', u'Ber\xfchrung'), (u'Berks/1/re', u'Berkshire'), (u"BerL'lhre", u'Ber\xfchre'), (u'berllichtigter', u'ber\xfcchtigter'), (u'berllihren', u'ber\xfchren'), (u'berllihrt', u'ber\xfchrt'), (u'berlllhmten', u'ber\xfchmten'), (u'Bern/e', u'Bernie'), (u'beruhrt', u'ber\xfchrt'), (u'beruhrte', u'ber\xfchrte'), (u'ber\ufb02hmter', u'ber\xfchmter'), (u'besafi', u'besa\xdf'), (u"Besch'a'ftigt", u'Besch\xe4ftigt'), (u'bescheifien', u'beschei\xdfen'), (u'beschiftigt', u'besch\xe4ftigt'), (u'beschiiftigt', u'besch\xe4ftigt'), (u'beschiitzen', u'besch\xfctzen'), (u'beschiitzt', u'besch\xfctzt'), (u'beschiltze', u'besch\xfctze'), (u'beschiltzen', u'besch\xfctzen'), (u'beschleun/gt', u'beschleunigt'), (u'beschliefkt', u'beschlie\xdft'), (u'beschlie\ufb02tloszuziehen', u'beschlie\xdft loszuziehen'), (u'beschllitzet', u'besch\xfctzet'), (u'beschllitzt', u'besch\xfctzt'), (u'beschr\xe9nkt', u'beschr\xe4nkt'), (u'Beschr\xe9nkungen', u'Beschr\xe4nkungen'), (u'beschtitze', u'besch\xfctze'), (u'beschutzen', u'besch\xfctzen'), (u'besch\xe9digt', u'besch\xe4digt'), (u'besch\xe9ftigen', u'besch\xe4ftigen'), (u'besch\xe9ftigt', u'besch\xe4ftigt'), (u'besch\xe9ftigte', u'besch\xe4ftigte'), (u'besch\xe9ftigten', u'besch\xe4ftigten'), (u'besch\xe9iftige', u'besch\xe4ftige'), (u'besch\xe9iftigt', u'besch\xe4ftigt'), (u'Besch\xe9imen', u'Besch\xe4men'), (u'besch\xe9mendste', u'besch\xe4mendste'), (u'besch\xe9oligen', u'besch\xe4digen'), (u'besch\ufb02tzen', u'besch\xfctzen'), (u'Besch\ufb02tzer', u'Besch\xfctzer'), (u'Besf\xe9f/gen', u'Best\xe4tigen'), (u'Besitztijmer', u'Besitzt\xfcmer'), (u'BESTATIGE', u'BEST\xc4TIGE'), (u'BESTATIGT', u'BEST\xc4TIGT'), (u'bestenl', u'besten!'), (u'bestiirzt', u'best\xfcrzt'), (u'bestiitigen', u'best\xe4tigen'), (u'bestltigt', u'best\xe4tigt'), (u"bestx'mmt", u'bestimmt'), (u'best\xe9indige', u'best\xe4ndige'), (u'best\xe9itigt', u'best\xe4tigt'), (u'Best\xe9itigung', u'Best\xe4tigung'), (u'Best\xe9itigungen', u'Best\xe4tigungen'), (u'Best\xe9tige', u'Best\xe4tige'), (u'Best\xe9tigen', u'Best\xe4tigen'), (u'best\xe9tigt', u'best\xe4tigt'), (u'Best\xe9tigung', u'Best\xe4tigung'), (u'bes\xe9inftigen', u'bes\xe4nftigen'), (u'bes\xe9inftigt', u'bes\xe4nftigt'), (u'bes\xe9nftigen', u'bes\xe4nftigen'), (u'Betiiubt', u'Bet\xe4ubt'), (u'betriibt', u'betr\xfcbt'), (u'betriigen', u'betr\xfcgen'), (u'Betriiger', u'Betr\xfcger'), (u'betriigt', u'betr\xfcgt'), (u'betrijgen', u'betr\xfcgen'), (u'Betrijgerl', u'Betr\xfcger!'), (u'betrilgen', u'betr\xfcgen'), (u'betrtlgerischer', u'betr\xfcgerischer'), (u'betr\xe9chtliches', u'betr\xe4chtliches'), (u'Betr\xe9ge', u'Betr\xe4ge'), (u'betr\xe9gt', u'betr\xe4gt'), (u'Bettw\xe9ische', u'Bettw\xe4sche'), (u'Beviilkerung', u'Bev\xf6lkerung'), (u'bevorwir', u'bevor wir'), (u'bev\xe9lkern', u'bev\xf6lkern'), (u'bewegf', u'bewegt'), (u'Bew\xe9hrungsauflage', u'Bew\xe4hrungsauflage'), (u'bew\xe9ihrte', u'bew\xe4hrte'), (u'bew\xe9iltigen', u'bew\xe4ltigen'), (u'bew\xe9issern', u'bew\xe4ssern'), (u'bew\xe9lkten', u'bew\xf6lkten'), (u'bew\xe9ltigen', u'bew\xe4ltigen'), (u'Bew\xe9ltigung', u'Bew\xe4ltigung'), (u'bew\xe9ssern', u'bew\xe4ssern'), (u'Bew\xe9sserungssysteme', u'Bew\xe4sserungssysteme'), (u'Bezirksgelinde', u'Bezirksgel\xe4nde'), (u'bezuglich', u'bez\xfcglich'), (u'be\xe9ingstigende', u'be\xe4ngstigende'), (u'be\xe9ngstigend', u'be\xe4ngstigend'), (u'be\xe9ngstigender', u'be\xe4ngstigender'), (u'bffnen', u'\xf6ffnen'), (u'Bficher', u'B\xfccher'), (u'Bfiro', u'B\xfcro'), (u'bfirsten', u'b\xfcrsten'), (u'bfise', u'b\xf6se'), (u'bfisen', u'b\xf6sen'), (u'bfiser', u'b\xf6ser'), (u'bfises', u'b\xf6ses'), (u'bfiseste', u'b\xf6seste'), (u'bfisesten', u'b\xf6sesten'), (u'bgsonderen', u'besonderen'), (u'BI6de', u'Bl\xf6de'), (u'Bierbfichse', u'Bierb\xfcchse'), (u'Biicher', u'B\xfccher'), (u'Biicherei', u'B\xfccherei'), (u'Biick', u'B\xfcck'), (u'Biiffel', u'B\xfcffel'), (u'BIiHlt', u'Bl\xfcht'), (u'Biihne', u'B\xfchne'), (u'Biilcherei', u'B\xfccherei'), (u'BIind', u'Blind'), (u'Biirger', u'B\xfcrger'), (u'Biirgerrechte', u'B\xfcrgerrechte'), (u'Biiro', u'B\xfcro'), (u'Biiros', u'B\xfcros'), (u'Biirotiir', u'B\xfcrot\xfcr'), (u'biirsten', u'b\xfcrsten'), (u'Biise', u'B\xf6se'), (u'Biisen', u'B\xf6sen'), (u'biises', u'b\xf6ses'), (u'Bijchern', u'B\xfcchern'), (u'Bijhne', u'B\xfchne'), (u'Bijndnis', u'B\xfcndnis'), (u'Bijrger', u'B\xfcrger'), (u'Bijrgermeister', u'B\xfcrgermeister'), (u'Bijro', u'B\xfcro'), (u'Bijrokraten', u'B\xfcrokraten'), (u'Bijrzel', u'B\xfcrzel'), (u'Bilchern', u'B\xfcchern'), (u'Bildseitenverh\xe9ltnis', u'Bildseitenverh\xe4ltnis'), (u'Bilndel', u'B\xfcndel'), (u'Bilro', u'B\xfcro'), (u'BIood', u'Blood'), (u'BIQIS', u'Blo\xdf'), (u'Bischiife', u'Bisch\xf6fe'), (u'Bischiifen', u'Bisch\xf6fen'), (u'Bisch\xe9fe', u'Bisch\xf6fe'), (u'bistja', u'bist ja'), (u'bistjetzt', u'bist jetzt'), (u'Bittejetzt', u'Bitte jetzt'), (u'bittersiJl3es', u'bitters\xfc\xdfes'), (u'Bittesch\xe9n', u'Bittesch\xf6n'), (u'BIue', u'Blue'), (u'bi\xdfchen', u'bisschen'), (u'BL1hne', u'B\xfchne'), (u'Bl6cke', u'Bl\xf6cke'), (u'bl6d', u'bl\xf6d'), (u'bl6de', u'bl\xf6de'), (u'bl6den', u'bl\xf6den'), (u'bl6der', u'bl\xf6der'), (u'bl6des', u'bl\xf6des'), (u'Bl6dian', u'Bl\xf6dian'), (u'Bl6dmann', u'Bl\xf6dmann'), (u'Bl6dsinn', u'Bl\xf6dsinn'), (u'Blauaugel', u'Blauauge!'), (u'Blddes', u'Bl\xf6des'), (u'Ble/bf', u'Bleibt'), (u'bleibenl', u'bleiben!'), (u'blelbenl', u'blelben!'), (u'Blfidmann', u'Bl\xf6dmann'), (u'Blfidsinn', u'Bl\xf6dsinn'), (u'Blfimchen', u'Bl\xfcmchen'), (u'BLicher', u'B\xfccher'), (u'BLihne', u'B\xfchne'), (u'Bliid', u'Bl\xf6d'), (u'bliide', u'bl\xf6de'), (u'bliiden', u'bl\xf6den'), (u'bliidere', u'bl\xf6dere'), (u'bliides', u'bl\xf6des'), (u'Bliidmann', u'Bl\xf6dmann'), (u'Bliidsinn', u'Bl\xf6dsinn'), (u'bliiht', u'bl\xfcht'), (u'bliirgerlichen', u'b\xfcrgerlichen'), (u'Blijmchen', u'Bl\xfcmchen'), (u'Bllck', u'Blick'), (u'Bllindel', u'B\xfcndel'), (u'Blllroklammer', u'B\xfcroklammer'), (u'bln', u'bin'), (u'bloB', u'blo\xdf'), (u'bloBen', u'blo\xdfen'), (u'bloBstellen', u'blo\xdfstellen'), (u'blockiertl', u'blockiert!'), (u'BLODE', u'BL\xd6DE'), (u'blof$', u'blo\xdf'), (u'blofl', u'blo\xdf'), (u'Blol2>', u'Blo\xdf'), (u'blol3', u'blo\xdf'), (u'blol3>', u'blo\xdf'), (u'blol3stellen', u'blo\xdfstellen'), (u'bloli', u'blo\xdf'), (u'blolistellen', u'blo\xdfstellen'), (u'blolls', u'blo\xdf'), (u'bls', u'bis'), (u'Blst', u'Bist'), (u'bltte', u'bitte'), (u'Blumenstr\xe9iulichen', u'Blumenstr\xe4u\xdfchen'), (u'Blument\xe9pfen', u'Blument\xf6pfen'), (u'Blutgetr\xe4nkte', u'Blut getr\xe4nkte'), (u'Blutgetr\xe9nkte', u'Blutgetr\xe4nkte'), (u'blutjungl', u'blutjung!'), (u'blutriinstig', u'blutr\xfcnstig'), (u'Blutvergiefien', u'Blutvergie\xdfen'), (u'bl\xe9d', u'bl\xf6d'), (u'Bl\xe9de', u'Bl\xf6de'), (u'bl\xe9den', u'bl\xf6den'), (u'bl\xe9der', u'bl\xf6der'), (u'Bl\xe9des', u'Bl\xf6des'), (u'Bl\xe9dheit', u'Bl\xf6dheit'), (u'Bl\xe9dmann', u'Bl\xf6dmann'), (u'Bl\xe9dsinn', u'Bl\xf6dsinn'), (u'Bl\xe9iser', u'Bl\xe4ser'), (u'Bl\xe9ser', u'Bl\xe4ser'), (u'bl\xe9st', u'bl\xe4st'), (u'Bnjicke', u'Br\xfccke'), (u'Bodensch\xe9tze', u'Bodensch\xe4tze'), (u'Bogenschiefien', u'Bogenschie\xdfen'), (u'Bogenschiefienl', u'Bogenschie\xdfen!'), (u'Bogenschiefiens', u'Bogenschie\xdfens'), (u'Bogenschiitze', u'Bogensch\xfctze'), (u'Bogenschiitzen', u'Bogensch\xfctzen'), (u'Bogenschijtze', u'Bogensch\xfctze'), (u'Bogenschijtzen', u'Bogensch\xfctzen'), (u'Bogenschutzen', u'Bogensch\xfctzen'), (u'Bogenschutzenl', u'Bogensch\xfctzen!'), (u'BOnjour', u'Bonjour'), (u'bosartige', u'b\xf6sartige'), (u'Bracken', u'Brocken'), (u'Briicke', u'Br\xfccke'), (u'Briicken', u'Br\xfccken'), (u'Briider', u'Br\xfcder'), (u'Briihe', u'Br\xfche'), (u'Briillen', u'Br\xfcllen'), (u'briillt', u'br\xfcllt'), (u'Brijcke', u'Br\xfccke'), (u'Brijderlichkeit', u'Br\xfcderlichkeit'), (u'brijllen', u'br\xfcllen'), (u'Brilcke', u'Br\xfccke'), (u'Brilder', u'Br\xfcder'), (u'Brilllen', u'Br\xfcllen'), (u'brillltjeden', u'br\xfcllt jeden'), (u'Brilnette', u'Br\xfcnette'), (u'Brilsten', u'Br\xfcsten'), (u'brilten', u'br\xfcten'), (u"BrL'lcke", u'Br\xfccke'), (u"brL'lllen", u'br\xfcllen'), (u'brlliderliche', u'br\xfcderliche'), (u'Brllidern', u'Br\xfcdern'), (u'Brlliste', u'Br\xfcste'), (u'Broschijre', u'Brosch\xfcre'), (u'Broschilren', u'Brosch\xfcren'), (u'Broschuren', u'Brosch\xfcren'), (u'Brucke', u'Br\xfccke'), (u'Brucken', u'Br\xfccken'), (u'Brudern', u'Br\xfcdern'), (u'Bruhe', u'Br\xfche'), (u'brullen', u'br\xfcllen'), (u'brullt', u'br\xfcllt'), (u'Brutalitiit', u'Brutalit\xe4t'), (u'Brutzelhtihnchen', u'Brutzelh\xfchnchen'), (u'Br\xe9chtet', u'Br\xe4chtet'), (u'Br\xe9iutigam', u'Br\xe4utigam'), (u'Br\xe9sel', u'Br\xf6sel'), (u'Br\xe9tchen', u'Br\xf6tchen'), (u'br\xe9uchte', u'br\xe4uchte'), (u'br\xe9uchten', u'br\xe4uchten'), (u'br\xe9unen', u'br\xe4unen'), (u'Br\xe9ute', u'Br\xe4ute'), (u'Br\ufb02cke', u'Br\xfccke'), (u'Br\ufb02der', u'Br\xfcder'), (u'Btiro', u'B\xfcro'), (u'Btiser', u'B\xf6ser'), (u'Bucher', u'B\xfccher'), (u'Buchern', u'B\xfcchern'), (u'Budgetkiirzung', u'Budgetk\xfcrzung'), (u'BUFO', u'B\xfcro'), (u'Bugschutzgerate', u'Bugschutzger\xe4te'), (u'Buhnenbild', u'B\xfchnenbild'), (u'Bullel', u'Bulle!'), (u'Buml', u'Bum!'), (u'Bundnis', u'B\xfcndnis'), (u'Burger', u'B\xfcrger'), (u'Burgerrechtlerin', u'B\xfcrgerrechtlerin'), (u'Buro', u'B\xfcro'), (u'BURO', u'B\xdcRO'), (u'Burol', u'B\xfcro!'), (u'Burottlr', u'B\xfcrot\xfcr'), (u'Busche', u'B\xfcsche'), (u'B\xe9ickchen', u'B\xe4ckchen'), (u'B\xe9ickerei', u'B\xe4ckerei'), (u'B\xe9ille', u'B\xe4lle'), (u'B\xe9inder', u'B\xe4nder'), (u'B\xe9ir', u'B\xe4r'), (u'B\xe9irgermeister', u'B\xfcrgermeister'), (u'B\xe9iro', u'B\xfcro'), (u'b\xe9ise', u'b\xf6se'), (u'B\xe9iume', u'B\xe4ume'), (u'B\xe9nder', u'B\xe4nder'), (u'B\xe9r', u'B\xe4r'), (u'B\xe9ren', u'B\xe4ren'), (u'B\xe9renhasser', u'B\xe4renhasser'), (u'B\xe9renhunger', u'B\xe4renhunger'), (u'B\xe9renj\xe9ger', u'B\xe4renj\xe4ger'), (u'B\xe9renk\xe9nig', u'B\xe4renk\xf6nig'), (u'B\xe9renlaute', u'B\xe4renlaute'), (u'B\xe9renrolle', u'B\xe4renrolle'), (u'B\xe9renschnitzereien', u'B\xe4renschnitzereien'), (u'B\xe9renstimmen', u'B\xe4renstimmen'), (u'B\xe9rin', u'B\xe4rin'), (u'B\xe9risch', u'B\xe4risch'), (u'B\xe9rs', u'B\xe4rs'), (u'B\xe9rte', u'B\xe4rte'), (u'b\xe9s', u'b\xf6s'), (u'b\xe9se', u'b\xf6se'), (u'b\xe9sen', u'b\xf6sen'), (u'B\xe9ses', u'B\xf6ses'), (u'B\xe9ume', u'B\xe4ume'), (u'B\xe9umen', u'B\xe4umen'), (u'B\ufb02chern', u'B\xfcchern'), (u'B\ufb02ste', u'B\xfcste'), (u'Cafe', u'Caf\xe9'), (u'Caf\xe4', u'Caf\xe9'), (u'CASAREN', u'C\xc4SAREN'), (u'Charakterm\xe9ngel', u'Charakterm\xe4ngel'), (u'Charakterst\xe9rke', u'Charakterst\xe4rke'), (u'Chrlntlna', u'Christina'), (u'Ciden', u'\xf6den'), (u'Ciffnet', u'\xd6ffnet'), (u'Cihrchen', u'\xd6hrchen'), (u'Citro\xe9n', u'Citro\xebn'), (u'clamit', u'damit'), (u'class', u'dass'), (u'Clbernimmt', u'\xfcbernimmt'), (u'cler', u'der'), (u'Coimbrasl', u'Coimbras!'), (u'CommanderWill', u'Commander Will'), (u'Corenillal', u'Corenilla!'), (u'Cowboyscheifi', u'Cowboyschei\xdf'), (u'C\xe9sar', u'C\xe4sar'), (u'D/e', u'Die'), (u'd/ese', u'diese'), (u'd/esem', u'diesem'), (u'd/esen', u'diesen'), (u'D/eser', u'Dieser'), (u'D/eses', u'Dieses'), (u'D/sko', u'Disko'), (u'dabel', u'dabei'), (u'dachfen', u'dachten'), (u'daffir', u'daf\xfcr'), (u'dafiir', u'daf\xfcr'), (u'Dafijr', u'Daf\xfcr'), (u'Dafijur', u'Daf\xfcr'), (u'Dafilr', u'Daf\xfcr'), (u"dafL'lr", u'daf\xfcr'), (u'dafLir', u'daf\xfcr'), (u'dafljr', u'daf\xfcr'), (u'dafllir', u'daf\xfcr'), (u'Daflllrwar', u'Daf\xfcr war'), (u'daftir', u'daf\xfcr'), (u'dafUr', u'daf\xfcr'), (u'dafzjir', u'daf\xfcr'), (u'dajemand', u'da jemand'), (u'dal', u'da!'), (u'Damenh\xe9nde', u'Damenh\xe4nde'), (u'damitl', u'damit!'), (u'damlt', u'damit'), (u'DANEMARK', u'D\xc4NEMARK'), (u'darfiber', u'dar\xfcber'), (u'Dariiber', u'Dar\xfcber'), (u'darijber', u'dar\xfcber'), (u'Darilber', u'Dar\xfcber'), (u"dart/'ber", u'dar\xfcber'), (u'dartlber', u'dar\xfcber'), (u'DARUBER', u'DAR\xdcBER'), (u'DarUber', u'Dar\xfcber'), (u'dasjetzt', u'das jetzt'), (u'dasl', u'das!'), (u'Dateniibermittlung', u'Daten\xfcbermittlung'), (u'dauem', u'dauern'), (u'dauerf', u'dauert'), (u'dazugeh\xe9ren', u'dazugeh\xf6ren'), (u'Da\xdf', u'Dass'), (u'Da\ufb02lr', u'Daf\xfcr'), (u'Ddrfern', u'D\xf6rfern'), (u'def', u'der'), (u'Defekf/v', u'Detektiv'), (u'deinerZelle', u'deiner Zelle'), (u'deln', u'dein'), (u'delne', u'deine'), (u'demfiltigen', u'dem\xfctigen'), (u'Demijtigung', u'Dem\xfctigung'), (u'demllitige', u'dem\xfctige'), (u'demllitigen', u'dem\xfctigen'), (u'denkwurdiger', u'denkw\xfcrdiger'), (u'denkw\ufb02rdiger', u'denkw\xfcrdiger'), (u'derAbgeordnete', u'der Abgeordnete'), (u'derAusgabe', u'der Ausgabe'), (u'derAusl6ser', u'der Ausl\xf6ser'), (u"DerjL'lngste", u'Der j\xfcngste'), (u'derjunge', u'der junge'), (u'dermaben', u'derma\xdfen'), (u'derTyp', u'der Typ'), (u'derWeg', u'der Weg'), (u'derWelle', u'der Welle'), (u'DerWL1rfel', u'Der W\xfcrfel'), (u'DerZauberer', u'Der Zauberer'), (u'de__n', u'den'), (u'dfeserr', u'diesem'), (u'dffentlichen', u'\xf6ffentlichen'), (u'dffnen', u'\xf6ffnen'), (u'Dfimonen', u'D\xe4monen'), (u'dfinn', u'd\xfcnn'), (u'dichl', u'dich!'), (u'diej\xfcngste', u'die J\xfcngste'), (u'dienstunfahig', u'dienstunf\xe4hig'), (u'Dieselkapit\xe9in', u'Dieselkapit\xe4n'), (u'Dieselkapit\xe9n', u'Dieselkapit\xe4n'), (u'Dieselmotorenl', u'Dieselmotoren!'), (u'dieserAufnahme', u'dieser Aufnahme'), (u'Dieserjunge', u'Dieser junge'), (u'Diiit', u'Di\xe4t'), (u'diirfe', u'd\xfcrfe'), (u'Diirfen', u'D\xfcrfen'), (u'diirft', u'd\xfcrft'), (u'diirfte', u'd\xfcrfte'), (u'dijfien', u'd\xfcrfen'), (u'dijnn', u'd\xfcnn'), (u'dijrfen', u'd\xfcrfen'), (u'Dijrfte', u'D\xfcrfte'), (u'dijstere', u'd\xfcstere'), (u'dilmmer', u'd\xfcmmer'), (u'dilrfen', u'd\xfcrfen'), (u'dilrft', u'd\xfcrft'), (u'dilrften', u'd\xfcrften'), (u'dilrftig', u'd\xfcrftig'), (u'Dine', u'D\xe4ne'), (u'dirja', u'dir ja'), (u'dirjemand', u'dir jemand'), (u'dirjetzt', u'dir jetzt'), (u'dirJulie', u'dir Julie'), (u'dirl', u'dir!'), (u'dirwehzutun', u'dir wehzutun'), (u'Di\xe9t', u'Di\xe4t'), (u'Di\xe9tberaterin', u'Di\xe4tberaterin'), (u'Di\xe9tbier', u'Di\xe4tbier'), (u'dlch', u'dich'), (u'Dle', u'Die'), (u'dles', u'dies'), (u'Dlese', u'Diese'), (u'Dlfit', u'Di\xe4t'), (u'Dlitplan', u'Di\xe4tplan'), (u'dllirfen', u'd\xfcrfen'), (u'dllirft', u'd\xfcrft'), (u'dllirstet', u'd\xfcrstet'), (u'dlr', u'dir'), (u'doc/1', u'doch'), (u'dochl', u'doch!'), (u'dolthin', u'dorthin'), (u'Doppelgfiner', u'Doppelg\xe4nger'), (u'Doppelgfinger', u'Doppelg\xe4nger'), (u'Doppelg\xe9inger', u'Doppelg\xe4nger'), (u'Doppelg\xe9nger', u'Doppelg\xe4nger'), (u'Doppelzijngig', u'Doppelz\xfcngig'), (u'doppelztmgiger', u'doppelz\xfcngiger'), (u'dor', u'der'), (u"Dr'a'ngt", u'Dr\xe4ngt'), (u'drachengriinen', u'drachengr\xfcnen'), (u'Drahte', u'Dr\xe4hte'), (u'dranl', u'dran!'), (u'drau/3en', u'drau\xdfen'), (u'drau/Sen', u'drau\xdfen'), (u'drauBen', u'drau\xdfen'), (u'drauf$en', u'drau\xdfen'), (u'draufdrilcken', u'draufdr\xfccken'), (u'draufgestllirzt', u'draufgest\xfcrzt'), (u'draufg\xe9ngerisch', u'draufg\xe4ngerisch'), (u'draufien', u'drau\xdfen'), (u'draufken', u'drau\xdfen'), (u'drauflsenl', u'drau\xdfen!'), (u'drauf\xe9en', u'drau\xdfen'), (u'drauilen', u'drau\xdfen'), (u'draul3en', u'drau\xdfen'), (u'draul5en', u'drau\xdfen'), (u'draulien', u'drau\xdfen'), (u'draullen', u'drau\xdfen'), (u'draulSen', u'drau\xdfen'), (u'Dreckl\xe9chern', u'Dreckl\xf6chern'), (u'Drecksmiihle', u'Drecksm\xfchle'), (u'Drecks\xe9cke', u'Drecks\xe4cke'), (u'drfiben', u'dr\xfcben'), (u'Drfick', u'Dr\xfcck'), (u'Drfingeln', u'Dr\xe4ngeln'), (u'drih', u'dritt'), (u'driiben', u'dr\xfcben'), (u'driicken', u'dr\xfccken'), (u'driickt', u'dr\xfcckt'), (u'drijben', u'dr\xfcben'), (u'drijber', u'dr\xfcber'), (u'drijck', u'dr\xfcck'), (u'drijckt', u'dr\xfcckt'), (u'drilben', u'dr\xfcben'), (u'drilber', u'dr\xfcber'), (u'drilcken', u'dr\xfccken'), (u'drLiber', u'dr\xfcber'), (u'drlliben', u'dr\xfcben'), (u'drlllben', u'dr\xfcben'), (u'Drogenabh\xe9ngige', u'Drogenabh\xe4ngige'), (u'Drticken', u'Dr\xfccken'), (u'druben', u'dr\xfcben'), (u'drubenl', u'dr\xfcben!'), (u'druber', u'dr\xfcber'), (u'Druckkn\xe9pfe', u'Druckkn\xf6pfe'), (u'drunterliegt', u'drunter liegt'), (u'Dr\xe9nage', u'Dr\xe4nage'), (u'dr\xe9ngeln', u'dr\xe4ngeln'), (u'dr\xe9ngen', u'dr\xe4ngen'), (u'dr\xe9ngt', u'dr\xe4ngt'), (u'dr\ufb02ben', u'dr\xfcben'), (u'dtirft', u'd\xfcrft'), (u'dtlrfen', u'd\xfcrfen'), (u'Dudels\xe9cken', u'Dudels\xe4cken'), (u"dUFf\u20acl'1", u'd\xfcrfen'), (u'dul', u'du!'), (u'dull', u'dass'), (u'Dummk6pfe', u'Dummk\xf6pfe'), (u'Dummkiipfe', u'Dummk\xf6pfe'), (u'Dunnschiss', u'D\xfcnnschiss'), (u'durchdrficken', u'durchdr\xfccken'), (u'durchdr\xe9ngen', u'durchdr\xe4ngen'), (u'Durchfiihrung', u'Durchf\xfchrung'), (u'durchfuhren', u'durchf\xfchren'), (u'durchgefiihlt', u'durchgef\xfchrt'), (u'durchgefijhrt', u'durchgef\xfchrt'), (u'durchgefuhrt', u'durchgef\xfchrt'), (u'durchgef\ufb02hrt', u'durchgef\xfchrt'), (u'Durchg\xe9nge', u'Durchg\xe4nge'), (u'Durchladenl', u'Durchladen!'), (u'durchlfichere', u'durchl\xf6chere'), (u'durchsetzungsf\xe9higer', u'durchsetzungsf\xe4higer'), (u'durchst\xe9bern', u'durchst\xf6bern'), (u'durchwilhlt', u'durchw\xfchlt'), (u'durchzufilhren', u'durchzuf\xfchren'), (u'durchzufuhren', u'durchzuf\xfchren'), (u'Durfen', u'D\xfcrfen'), (u'durft', u'd\xfcrft'), (u'dusterer', u'd\xfcsterer'), (u'D\xe9cher', u'D\xe4cher'), (u'D\xe9imon', u'D\xe4mon'), (u'D\xe9imonen', u'D\xe4monen'), (u'D\xe9inemark', u'D\xe4nemark'), (u'D\xe9inemarks', u'D\xe4nemarks'), (u'D\xe9inen', u'D\xe4nen'), (u'd\xe9inisches', u'd\xe4nisches'), (u'd\xe9mlich', u'd\xe4mlich'), (u'D\xe9mliche', u'D\xe4mliche'), (u'd\xe9mlichen', u'd\xe4mlichen'), (u'd\xe9mlicher', u'd\xe4mlicher'), (u'd\xe9mlichl', u'd\xe4mlich'), (u'd\xe9mmert', u'd\xe4mmert'), (u'D\xe9monenb\xe9ren', u'D\xe4monenb\xe4ren'), (u'd\xe9monischen', u'd\xe4monischen'), (u'D\xe9rme', u'D\xe4rme'), (u'D\xe9rrfleisch', u'D\xf6rrfleisch'), (u'D\xe9umchen', u'D\xe4umchen'), (u'd\ufb02rfen', u'd\xfcrfen'), (u'E//e', u'Elle'), (u'e/n', u'ein'), (u'e/ne', u'eine'), (u'e/nem', u'einem'), (u'e/nen', u'einen'), (u'e/ner', u'einer'), (u'e/nes', u'eines'), (u'e/ns', u'eins'), (u'e/nsf', u'einst'), (u'E9YPt', u'Egypt'), (u'Ea/vtes', u'Echtes'), (u'ebenbfirtig', u'ebenb\xfcrtig'), (u'ebenburtige', u'ebenb\xfcrtige'), (u'Ec/vte', u'Echte'), (u'echfen', u'echten'), (u'edelm\ufb02tig', u'edelm\xfctig'), (u'efn', u'ein'), (u'efwas', u'etwas'), (u'Eheminner', u'Ehem\xe4nner'), (u'Ehem\xe9nnern', u'Ehem\xe4nnern'), (u'Ehezerstfirerin', u'Ehezerst\xf6rerin'), (u'Ehrenbijrger', u'Ehrenb\xfcrger'), (u'EHRENBURGERSCHAFT', u'EHRENB\xdcRGERSCHAFT'), (u'Ehreng\xe9iste', u'Ehreng\xe4ste'), (u'Eichhfirnchen', u'Eichh\xf6rnchen'), (u'Eichhiirnchen', u'Eichh\xf6rnchen'), (u'Eichh\xe9rnchens', u'Eichh\xf6rnchens'), (u'eifersfichtig', u'eifers\xfcchtig'), (u'eifersiichtig', u'eifers\xfcchtig'), (u'eifers\ufb02chtig', u'eifers\xfcchtig'), (u'eigenh\xe9ndig', u'eigenh\xe4ndig'), (u'eigenmlchtig', u'eigenm\xe4chtig'), (u'eigenntltziges', u'eigenn\xfctziges'), (u'Eihnlich', u'\xe4hnlich'), (u'Eimen/veise', u'Eimerweise'), (u'Einbruche', u'Einbr\xfcche'), (u'eindriicken', u'eindr\xfccken'), (u'Eindring/Inge', u'Eindringlinge'), (u'eindrucken', u'eindr\xfccken'), (u'einejunge', u'eine junge'), (u'einerfr\ufb02hen', u'einer fr\xfchen'), (u'einervorfuhrung', u'einer Vorf\xfchrung'), (u'einfiihren', u'einf\xfchren'), (u'Einfiihrung', u'Einf\xfchrung'), (u'einfilgen', u'einf\xfcgen'), (u'einfilhlsamsten', u'einf\xfchlsamsten'), (u'einflllgen', u'einf\xfcgen'), (u'Einflusse', u'Einfl\xfcsse'), (u'einfugen', u'einf\xfcgen'), (u'einfuhrten', u'einf\xfchrten'), (u'Einfuhrung', u'Einf\xfchrung'), (u'Einf\xe9ltige', u'Einf\xe4ltige'), (u'eingefiigt', u'eingef\xfcgt'), (u'eingef\ufb02gt', u'eingef\xfcgt'), (u'eingehiillt', u'eingeh\xfcllt'), (u'eingepr\xe9gt', u'eingepr\xe4gt'), (u'einger\xe9iumt', u'einger\xe4umt'), (u'einger\xe9umt', u'einger\xe4umt'), (u'eingeschl\xe9fert', u'eingeschl\xe4fert'), (u'eingeschr\xe9nkt', u'eingeschr\xe4nkt'), (u'eingesch\xe9itzt', u'eingesch\xe4tzt'), (u'eingesch\xe9tzt', u'eingesch\xe4tzt'), (u'eingesturzt', u'eingest\xfcrzt'), (u'eingieBt', u'eingie\xdft'), (u'eingschaltet', u'eingeschaltet'), (u'Einh\xe9rnern', u'Einh\xf6rner'), (u'einlegenl', u'einlegen!'), (u'einl\xe9dt', u'einl\xe4dt'), (u'einl\xe9sen', u'einl\xf6sen'), (u'Einsatzfahigkeit', u'Einsatzf\xe4higkeit'), (u'Einschiichterung', u'Einsch\xfcchterung'), (u'Einschliefklich', u'Einschlie\xdflich'), (u'Einschlielilich', u'Einschlie\xdflich'), (u'einstellenl', u'einstellen!'), (u'Eins\xe9tze', u'Eins\xe4tze'), (u'eint\xe9nig', u'eint\xf6nig'), (u'Einzelg\xe9ngerin', u'Einzelg\xe4ngerin'), (u'einzusch\xe9tzen', u'einzusch\xe4tzen'), (u'Eisstiirme', u'Eisst\xfcrme'), (u'Elektrizit\xe9t', u'Elektrizit\xe4t'), (u'elfenbeingetfinte', u'elfenbeinget\xf6nte'), (u'elit\xe9rer', u'elit\xe4rer'), (u'Eln', u'Ein'), (u'Elne', u'Eine'), (u'elnem', u'einem'), (u'Elnen', u'Einen'), (u'elner', u'einer'), (u'Elnes', u'Eines'), (u'empfindungsf\xe9higen', u'empfindungsf\xe4higen'), (u'Empf\xe9inger', u'Empf\xe4nger'), (u'empf\xe9ngt', u'empf\xe4ngt'), (u'Empiirend', u'Emp\xf6rend'), (u'Empiirendste', u'Emp\xf6rendste'), (u'empiirt', u'emp\xf6rt'), (u'emst', u'ernst'), (u'en/varten', u'erwarten'), (u'En/vartungen', u'Erwartungen'), (u'en/v\xe9hnt', u'erw\xe4hnt'), (u'Enchant\xe4', u'Enchant\xe9'), (u'endgiiltig', u'endg\xfcltig'), (u'endgultig', u'endg\xfcltig'), (u'endgultigen', u'endg\xfcltigen'), (u'endg\ufb02ltig', u'endg\xfcltig'), (u'endlichl', u'endlich!'), (u'ENERIGE', u'ENERGIE'), (u'enfternt', u'entfernt'), (u'Engl\xe9nder', u'Engl\xe4nder'), (u'Engl\xe9nderin', u'Engl\xe4nderin'), (u'eniillen', u'erf\xfcllen'), (u'entbl6Bte', u'entbl\xf6\xdfte'), (u'entbl6f$en', u'entbl\xf6\xdfen'), (u'entfiihre', u'entf\xfchre'), (u'entfiihrt', u'entf\xfchrt'), (u'entfiihrte', u'entf\xfchrte'), (u'Entfiihrung', u'Entf\xfchrung'), (u'Entftihrung', u'Entf\xfchrung'), (u'ENTFUHRUNGSVERDACHTIGER', u'ENTF\xdcHRUNGSVERD\xc4CHTIGER'), (u'enthllt', u'enth\xe4lt'), (u'enthUllt', u'enth\xfcllt'), (u'enth\xe9lt', u'enth\xe4lt'), (u'entliiften', u'entl\xfcften'), (u'Entliiftungen', u'Entl\xfcftungen'), (u'Entlijlftungen', u'Entl\xfcftungen'), (u'entluften', u'entl\xfcften'), (u'entl\xe9sst', u'entl\xe4sst'), (u'Entreilit', u'Entrei\xdft'), (u'entriistet', u'entr\xfcstet'), (u'entr\xe9itseln', u'entr\xe4tseln'), (u'Entschlrfen', u'Entsch\xe4rfen'), (u'Entschlull', u'Entschluss'), (u'ENTSCHLUSSELN', u'ENTSCHL\xdcSSELN'), (u'Entschlussen', u'Entschl\xfcssen'), (u'entsch\xe9rfen', u'entsch\xe4rfen'), (u'enttausche', u'entt\xe4usche'), (u'enttiiuscht', u'entt\xe4uscht'), (u'Enttluscht', u'Entt\xe4uscht'), (u'Enttluschungen', u'Entt\xe4uschungen'), (u'entt\xe9iuschen', u'entt\xe4uschen'), (u'entt\xe9uschen', u'entt\xe4uschen'), (u'entt\xe9uschst', u'entt\xe4uschst'), (u'entt\xe9uscht', u'entt\xe4uscht'), (u'Entv\\/Urfe', u'Entw\xfcrfe'), (u'Entwicklungsl\xe9ndern', u'Entwicklungsl\xe4ndern'), (u'entzllickt', u'entz\xfcckt'), (u'entzllindet', u'entz\xfcndet'), (u'entzuckend', u'entz\xfcckend'), (u'entzundet', u'entz\xfcndet'), (u'enzv\xe9rmt', u'erw\xe4rmt'), (u'Er6ffnen', u'Er\xf6ffnen'), (u'erb\xe9rml/ch', u'erb\xe4rmlich'), (u'erb\xe9rmlich', u'erb\xe4rmlich'), (u'Erb\xe9rmliches', u'Erb\xe4rmliches'), (u'Erdnijsse', u'Erdn\xfcsse'), (u'erdriickt', u'erdr\xfcckt'), (u'erd\xe9ihnliche', u'erd\xe4hnliche'), (u'erfebst', u'erlebst'), (u'erffillen', u'erf\xfcllen'), (u'erfiffnet', u'er\xf6ffnet'), (u'erfiille', u'erf\xfclle'), (u'erfiillen', u'erf\xfcllen'), (u'erfiillt', u'erf\xfcllt'), (u'erfijllt', u'erf\xfcllt'), (u'erfillle', u'erf\xfclle'), (u'erfilllen', u'erf\xfcllen'), (u'erfilllt', u'erf\xfcllt'), (u'erfllille', u'erf\xfclle'), (u'erfllillt', u'erf\xfcllt'), (u'erflllllen', u'erf\xfcllen'), (u'Erfolgl', u'Erfolg!'), (u'erfullen', u'erf\xfcllen'), (u'erfullt', u'erf\xfcllt'), (u'erf\xe9hrst', u'erf\xe4hrst'), (u'erf\xe9hrt', u'erf\xe4hrt'), (u'erf\ufb02llen', u'erf\xfcllen'), (u'ergrllindet', u'ergr\xfcndet'), (u'erhalfen', u'erhalten'), (u'Erhdhe', u'Erh\xf6he'), (u'erhiihter', u'erh\xf6hter'), (u'erhiiren', u'erh\xf6ren'), (u'ERHKLT', u'ERH\xc4LT'), (u'erhllt', u'erh\xe4lt'), (u'erh\xe9hen', u'erh\xf6hen'), (u'erh\xe9ht', u'erh\xf6ht'), (u'erh\xe9ilt', u'erh\xe4llt'), (u'erh\xe9lt', u'erh\xe4lt'), (u'erh\xe9rt', u'erh\xf6rt'), (u'erh\xe9rte', u'erh\xf6rte'), (u'eriiffnet', u'er\xf6ffnet'), (u'erja', u'er ja'), (u'erjetzt', u'er jetzt'), (u'erjung', u'er jung'), (u"erkl'a'ren", u'erkl\xe4ren'), (u"erkl'air's", u"erkl\xe4r's"), (u'erklaren', u'erkl\xe4ren'), (u'erklfire', u'erkl\xe4re'), (u'Erklfirung', u'Erkl\xe4rung'), (u'erklirt', u'erkl\xe4rt'), (u'erkllre', u'erkl\xe4re'), (u'erkllrt', u'erkl\xe4rt'), (u'erkllrte', u'erkl\xe4rte'), (u'erkllrten', u'erkl\xe4rten'), (u'Erkllrung', u'Erkl\xe4rung'), (u'erkl\xe9ir', u'erkl\xe4r'), (u'erkl\xe9ire', u'erkl\xe4re'), (u'erkl\xe9iren', u'erkl\xe4ren'), (u'erkl\xe9r', u'erkl\xe4r'), (u"erkl\xe9r's", u"erkl\xe4r's"), (u'erkl\xe9rbar', u'erkl\xe4rbar'), (u'Erkl\xe9re', u'Erkl\xe4re'), (u'erkl\xe9ren', u'erkl\xe4ren'), (u'erkl\xe9rt', u'erkl\xe4rt'), (u'Erkl\xe9rung', u'Erkl\xe4rung'), (u'erk\xe9ltest', u'erkaltest'), (u"erlC'>st", u'erl\xf6st'), (u'erldse', u'erl\xf6se'), (u'Erled/gen', u'Erledigen'), (u'erlieB', u'erlie\xdf'), (u'erlnnem', u'erinnern'), (u'erl\xe9scht', u'erl\xf6scht'), (u'erl\xe9sen', u'erl\xf6sen'), (u'erl\xe9st', u'erl\xf6st'), (u'Erl\xe9sung', u'Erl\xf6sung'), (u'ermbglichen', u'erm\xf6glichen'), (u'Erm\xe9chtige', u'Erm\xe4chtige'), (u'erm\xe9glicht', u'erm\xf6glicht'), (u'erm\xe9glichte', u'erm\xf6glichte'), (u'ernlllchtert', u'ern\xfcchtert'), (u'ern\xe9hren', u'ern\xe4hren'), (u'Ern\xe9hrung', u'Ern\xe4hrung'), (u'eroffnet', u'er\xf6ffnet'), (u'Erpressungsscheilie', u'Erpressungsschei\xdfe'), (u'err\xe9tst', u'err\xe4tst'), (u'erschieB', u'erschie\xdf'), (u'erschieBen', u'erschie\xdfen'), (u'erschiefien', u'erschie\xdfen'), (u'erschiefit', u'erschie\xdft'), (u'erschiefke', u'erschie\xdfe'), (u'erschielie', u'erschie\xdfe'), (u'Erschielit', u'Erschie\xdft'), (u'erschiipft', u'ersch\xf6pft'), (u'erschiittert', u'ersch\xfcttert'), (u'erschilttert', u'ersch\xfcttert'), (u'erschl\xe9gt', u'erschl\xe4gt'), (u'ERTCHDNT', u'ERT\xd6NT'), (u'ERTCNT', u'ERT\xd6NT'), (u'ERTGNT', u'ERT\xd6NT'), (u'ertiffnen', u'er\xf6ffnen'), (u'ertr\xe9gst', u'ertr\xe4gst'), (u'ertr\xe9inken', u'ertr\xe4nken'), (u'ert\xe9nt', u'ert\xf6nt'), (u'ervvartez', u'erwartet'), (u'ervvilrgen', u'erw\xfcrgen'), (u'ervv\xe9hnen', u'erw\xe4hnen'), (u'ervv\xe9ihnen', u'erw\xe4hnen'), (u'ervv\xe9ihnt', u'erw\xe4hnt'), (u'ervv\xe9ihnte', u'erw\xe4hnte'), (u'Erv\\/an', u'Erwan'), (u"Erv\\/an's", u"Erwan's"), (u"erw'a'hnt", u'erw\xe4hnt'), (u'Erwar', u'Er war'), (u'erwe/sen', u'erweisen'), (u'Erwfirmung', u'Erw\xe4rmung'), (u'Erwird', u'Er wird'), (u'Erwtirde', u'Er w\xfcrde'), (u'erw\xe9gt', u'erw\xe4gt'), (u'Erw\xe9gung', u'Erw\xe4gung'), (u'Erw\xe9hne', u'Erw\xe4hne'), (u'erw\xe9hnen', u'erw\xe4hnen'), (u'erw\xe9hnt', u'erw\xe4hnt'), (u'erw\xe9hnte', u'erw\xe4hnte'), (u'Erw\xe9hnung', u'Erw\xe4hnung'), (u'erw\xe9ihlt', u'erw\xe4hlt'), (u'erw\xe9ihnt', u'erw\xe4hnt'), (u'erw\xe9rmt', u'erw\xe4rmt'), (u"erz'a'hlt", u'erz\xe4hlt'), (u'Erzdiiizese', u'Erzdi\xf6zese'), (u'erzfihlen', u'erz\xe4hlen'), (u'Erzfihler', u'Erz\xe4hler'), (u'erzihlenl', u'erz\xe4hlen!'), (u'erziihlen', u'erz\xe4hlen'), (u'erziihlt', u'erz\xe4hlt'), (u'erziirnt', u'erz\xfcrnt'), (u'erzilrnt', u'erz\xfcrnt'), (u'erzllirnt', u'erz\xfcrnt'), (u'erzurnen', u'erz\xfcrnen'), (u'erz\xe9hl', u'erz\xe4hl'), (u'erz\xe9hle', u'erz\xe4hle'), (u'Erz\xe9hlen', u'Erz\xe4hlen'), (u'erz\xe9hlerische', u'erz\xe4hlerische'), (u'erz\xe9hlerischen', u'erz\xe4hlerischen'), (u'erz\xe9hlerischer', u'erz\xe4hlerischer'), (u'Erz\xe9hlkunste', u'Erz\xe4hlk\xfcnste'), (u'erz\xe9hlst', u'erz\xe4hlst'), (u'erz\xe9hlt', u'erz\xe4hlt'), (u'erz\xe9hlte', u'erz\xe4hlte'), (u'Erz\xe9hlung', u'Erz\xe4hlung'), (u'Erz\xe9ihl', u'Erz\xe4hl'), (u'Erz\xe9ihle', u'Erz\xe4hle'), (u'erz\xe9ihlen', u'erz\xe4hlen'), (u'erz\xe9ihlst', u'erz\xe4hlst'), (u'erz\xe9ihlt', u'erz\xe4hlt'), (u'erz\xe9ihlte', u'erz\xe4hlte'), (u'er\xe9ffnen', u'er\xf6ffnen'), (u'er\xe9ffnet', u'er\xf6ffnet'), (u'er\xe9ffnete', u'er\xf6ffnete'), (u'Er\xe9ffnungsaufnahme', u'Er\xf6ffnungsaufnahme'), (u'Er\xe9ffnungssequenz', u'Er\xf6ffnungssequenz'), (u'Er\xe9ffnungsszene', u'Er\xf6ffnungsszene'), (u'Er\ufb02lllen', u'Erf\xfcllen'), (u'etemity', u'eternity'), (u'etvva', u'etwa'), (u'euc/1', u'euch'), (u'Europ\xe9er', u'Europ\xe4er'), (u'europ\xe9ische', u'europ\xe4ische'), (u"ex'nfac'/7", u'einfach'), (u'Examenspriifungen', u'Examenspr\xfcfungen'), (u'Exekutivzust\xe9noligkeit', u'Exekutivzust\xe4ndigkeit'), (u'Explosionenl', u'Explosionen!'), (u'Extrablattl', u'Extrablatt!'), (u'F/nden', u'Finden'), (u'F/ugba/I', u'Flugball'), (u'Fahnrich', u'F\xe4hnrich'), (u'fahrlissiges', u'fahrl\xe4ssiges'), (u'Fairbankverlieh', u'Fairbank verlieh'), (u'Fallef', u'Falle!'), (u'fallengelassen', u'fallen gelassen'), (u'Fallschirmj\xe9gereinheiten', u'Fallschirmj\xe4gereinheiten'), (u'Fam/Z/e', u'Familie'), (u'Fa\xdf', u'Fass'), (u'FBl', u'FBI'), (u'Fe/nd', u'Feind'), (u'fehlschl\xe9gt', u'fehlschl\xe4gt'), (u'Feindberllihrung', u'Feindber\xfchrung'), (u'Feind\xfcbewvachung', u'Feind\xfcberwachung'), (u'feltig', u'fertig'), (u'femen', u'fernen'), (u'fernh\xe9ilt', u'fernh\xe4lt'), (u'Festhaltenl', u'Festhalten!'), (u'Fettw\xe9nste', u'Fettw\xe4nste'), (u'Feuen/vehr', u'Feuerwehr'), (u'Feuerliischer', u'Feuerl\xf6scher'), (u'Feuervvehrrnann', u'Feuerwehrrnann'), (u'Feuerwehrl', u'Feuerwehr!'), (u'Feuerwfirmen', u'Feuer w\xe4rmen'), (u'Feue\ufb02', u'Feuer!'), (u"ff'Ul'1\u20acf'\u20acl'1", u'fr\xfcheren'), (u'Ffiegen', u'Fliegen'), (u'ffihft', u'f\xfchlt'), (u'ffihren', u'f\xfchren'), (u'ffinf', u'f\xfcnf'), (u'ffir', u'f\xfcr'), (u'ffirchte', u'f\xfcrchte'), (u'ffirs', u'f\xfcrs'), (u'ffittere', u'f\xfcttere'), (u'FI6he', u'Fl\xf6he'), (u'Fiasenm\xe9iher', u'Rasenm\xe4her'), (u'fibel', u'\xfcbel'), (u'fiber', u'\xfcber'), (u'fiberdressierter', u'\xfcberdressierter'), (u'fibergezogen', u'\xfcbergezogen'), (u'fiberhaupt', u'\xfcberhaupt'), (u'fiberholt', u'\xfcberholt'), (u'fiberlegt', u'\xfcberlegt'), (u'fibernachtet', u'\xfcbernachtet'), (u'fiberspannt', u'\xfcberspannt'), (u'fibertreiben', u'\xfcbertreiben'), (u'fiberzfichtete', u'\xfcberz\xfcchtete'), (u'fibrig', u'\xfcbrig'), (u'Fieferenz', u'Referenz'), (u'Fieifi', u'Rei\xdf'), (u'fiffentlichkeit', u'\xd6ffentlichkeit'), (u'fiffnen', u'\xf6ffnen'), (u'fiffnest', u'\xf6ffnest'), (u'fifter', u'\xf6fter'), (u'Fihigkeit', u'F\xe4higkeit'), (u'fihneln', u'\xe4hneln'), (u'Fihrt', u'F\xe4hrt'), (u'fiihl', u'f\xfchl'), (u'fiihle', u'f\xfchle'), (u'fiihlen', u'f\xfchlen'), (u'fiihlst', u'f\xfchlst'), (u'fiihlt', u'f\xfchlt'), (u'Fiihlte', u'F\xfchlte'), (u'Fiihre', u'F\xfchre'), (u'Fiihren', u'F\xfchren'), (u'Fiihrerin', u'F\xfchrerin'), (u'Fiihrerschein', u'F\xfchrerschein'), (u'fiihrfe', u'f\xfchrte'), (u'fiihrt', u'f\xfchrt'), (u'fiihrte', u'f\xfchrte'), (u'Fiihrungsf\xe9ihigkeiten', u'F\xfchrungsf\xe4higkeiten'), (u'Fiihrungsprogramm', u'F\xfchrungsprogramm'), (u'Fiihrungsstil', u'F\xfchrungsstil'), (u'Fiilcksicht', u'R\xfccksicht'), (u'fiillen', u'f\xfcllen'), (u'fiinden', u'f\xe4nden'), (u'fiinf', u'f\xfcnf'), (u'fiinfhundert', u'f\xfcnfhundert'), (u'fiinfzehn', u'f\xfcnfzehn'), (u'fiir', u'f\xfcr'), (u'fiirchte', u'f\xfcrchte'), (u'fiirchten', u'f\xfcrchten'), (u'fiirchterlich', u'f\xfcrchterlich'), (u'fiirchterlichl', u'f\xfcrchterlich!'), (u'fiirchterllches', u'f\xfcrchterliches'), (u'fiirchtet', u'f\xfcrchtet'), (u'fiirchteten', u'f\xfcrchteten'), (u'fiirjeden', u'f\xfcr jeden'), (u'Fiirmchen', u'F\xf6rmchen'), (u'fiirs', u'f\xfcrs'), (u'Fijgen', u'F\xfcgen'), (u'fijhl', u'f\xfchl'), (u'fijhle', u'f\xfchle'), (u'fijhlen', u'f\xfchlen'), (u'fijhlst', u'f\xfchlst'), (u'fijhlt', u'f\xfchlt'), (u'fijhren', u'f\xfchren'), (u'Fijhrer', u'F\xfchrer'), (u'fijhrt', u'f\xfchrt'), (u'Fijhrungsqualit\xe9iten', u'F\xfchrungsqualit\xe4ten'), (u'FiJl3en', u'F\xfc\xdfen'), (u'Fijlie', u'F\xfc\xdfe'), (u'fijlr', u'f\xfcr'), (u'Fijnf', u'F\xfcnf'), (u'Fijnfziger', u'F\xfcnfziger'), (u'fijr', u'f\xfcr'), (u'fijrchte', u'f\xfcrchte'), (u'fijrchten', u'f\xfcrchten'), (u'Fijrjedenl', u'F\xfcr jeden!'), (u'fijrs', u'f\xfcrs'), (u'fiJrVorteile', u'f\xfcr Vorteile'), (u'fijttern', u'f\xfcttern'), (u'fijur', u'f\xfcr'), (u'filhl', u'f\xfchl'), (u'filhle', u'f\xfchle'), (u'filhlen', u'f\xfchlen'), (u'filhlte', u'f\xfchlte'), (u'filhre', u'f\xfchre'), (u'filhren', u'f\xfchren'), (u'Filhrern', u'F\xfchrern'), (u'Filhrerschein', u'F\xfchrerschein'), (u'filhrst', u'f\xfchrst'), (u'filhrt', u'f\xfchrt'), (u'filhrte', u'f\xfchrte'), (u'filhrten', u'f\xfchrten'), (u'Filhrung', u'F\xfchrung'), (u'Fillle', u'F\xfclle'), (u'Filll\xe9en', u'F\xfc\xdfen'), (u'Filmemachen', u'Filme machen'), (u'Filml', u'Film!'), (u'filnf', u'f\xfcnf'), (u'Filn\ufb02', u'F\xfcnf!'), (u'Filr', u'F\xfcr'), (u"filr'ne", u"f\xfcr'ne"), (u'filrchten', u'f\xfcrchten'), (u'filrchterlich', u'f\xfcrchterlich'), (u'filrs', u'f\xfcrs'), (u'filter', u'\xe4lter'), (u'findem', u'\xe4ndern'), (u'findenlassen', u'finden lassen'), (u'Fingerabdrijcke', u'Fingerabdr\xfccke'), (u'Fingerabdrilcke', u'Fingerabdr\xfccke'), (u'Fingerniigeln', u'Fingern\xe4geln'), (u'Fingern\xe9gel', u'Fingern\xe4gel'), (u'Fingern\xe9geln', u'Fingern\xe4geln'), (u'fingstlich', u'\xe4ngstlich'), (u'Fiothaarige', u'Rothaarige'), (u'Firmen\xe9rzte', u'Firmen\xe4rzte'), (u'Fischk\xe9pfe', u'Fischk\xf6pfe'), (u'FIUssigkeitsgleichgewicht', u'Fl\xfcssigkeitsgleichgewicht'), (u'Fiusten', u'F\xe4usten'), (u'FIynn', u'Flynn'), (u'fjffnen', u'\xf6ffnen'), (u"fL'1'r", u'f\xfcr'), (u"fL'1hle", u'f\xfchle'), (u"FL'1r", u'F\xfcr'), (u"fL'ir", u'f\xfcr'), (u"fL'lr", u'f\xfcr'), (u'fL1r', u'f\xfcr'), (u'Fl6he', u'Fl\xf6he'), (u'Flclse', u'Rose'), (u'fleifkige', u'flei\xdfige'), (u'fleifkiges', u'flei\xdfiges'), (u'fleil3ig', u'flei\xdfig'), (u'Fleischb\xe9llchen', u'Fleischb\xe4llchen'), (u"Fleischkl6l'Sen", u'Fleischkl\xf6\xdfen'), (u'Flfige', u'Fl\xfcge'), (u'Flfigell', u'Fl\xfcgel!'), (u'flfistert', u'fl\xfcstert'), (u'Flhigkeiten', u'F\xe4higkeiten'), (u'Flhnrich', u'F\xe4hnrich'), (u'Flhnriche', u'F\xe4hnriche'), (u'flieBen', u'flie\xdfen'), (u'Fliefiband', u'Flie\xdfband'), (u'Fliefiheck', u'Flie\xdfheck'), (u'Flieflsb\xe9nder', u'Flie\xdfb\xe4nder'), (u'flielit', u'flie\xdft'), (u'flielSt', u'flie\xdft'), (u'FLif$e', u'F\xfc\xdfe'), (u'fLihlt', u'f\xfchlt'), (u'fliichtige', u'fl\xfcchtige'), (u'Fliigel', u'Fl\xfcgel'), (u'flijchtig', u'fl\xfcchtig'), (u'Flijgel', u'Fl\xfcgel'), (u'Flijgelfedernl', u'Fl\xfcgelfedern!'), (u'Flilssige', u'Fl\xfcssige'), (u'flilstert', u'fl\xfcstert'), (u'fLir', u'f\xfcr'), (u'fljhrt', u'f\xfchrt'), (u'Fljr', u'F\xfcr'), (u"flJr'n", u"f\xfcr'n"), (u'fllihrst', u'f\xfchrst'), (u'Fllihrt', u'F\xfchrt'), (u'fllinf', u'f\xfcnf'), (u'fllinften', u'f\xfcnften'), (u'Fllinkchen', u'F\xfcnkchen'), (u'Fllir', u'F\xfcr'), (u'fllirchte', u'f\xfcrchte'), (u'fllirchten', u'f\xfcrchten'), (u'fllirchterlichen', u'f\xfcrchterlichen'), (u'fllirchtet', u'f\xfcrchtet'), (u'Fllirsten', u'F\xfcrsten'), (u'Fllitterungszeitenl', u'F\xfctterungszeiten!'), (u'flllgte', u'f\xfcgte'), (u'flllgten', u'f\xfcgten'), (u'flllhrten', u'fl\xfchrten'), (u'Flllhrung', u'F\xfchrung'), (u'Fllligel', u'Fl\xfcgel'), (u'flllistern', u'fl\xfcstern'), (u'fllllstert', u'fl\xfcstert'), (u'flllrchte', u'f\xfcrchte'), (u'flllrchten', u'f\xfcrchten'), (u'flllrjede', u'f\xfcr jede'), (u'Flohtransporterl', u'Flohtransporter!'), (u'Floli', u'Flo\xdf'), (u'Flottenalzt', u'Flottenarzt'), (u'Flottenstiitzpunkt', u'Flottenst\xfctzpunkt'), (u'Flottenstutzpunkt', u'Flottenst\xfctzpunkt'), (u'Flrma', u'Firma'), (u'fltlsterte', u'fl\xfcsterte'), (u'Fluchtig', u'Fl\xfcchtig'), (u'Flughdhe', u'Flugh\xf6he'), (u'Flughiihe', u'Flugh\xf6he'), (u'Flugh\xe9ifen', u'Flugh\xe4fen'), (u'Flugunf\xe9ihig', u'Flugunf\xe4hig'), (u'flugunf\xe9ihigen', u'flugunf\xe4higen'), (u'Flugunf\xe9ihigl', u'Flugunf\xe4hig!'), (u'Flugzeugl', u'Flugzeug!'), (u'FLUSSIGER', u'FL\xdcSSIGER'), (u'Flustereffekt', u'Fl\xfcstereffekt'), (u'Flustern', u'Fl\xfcstern'), (u'FLUSTERT', u'FL\xdcSTERT'), (u'fl\ufb02stern', u'fl\xfcstern'), (u'fl\ufb02sterten', u'fl\xfcsterten'), (u'Folgendesz', u'Folgendes:'), (u'fortgespiilt', u'fortgesp\xfclt'), (u'fortspiilen', u'fortsp\xfclen'), (u'fortw\xe9hrend', u'fortw\xe4hrend'), (u'Fr/ed/10/', u'Friedhof'), (u'Fr5ulein', u'Fr\xe4ulein'), (u'Fr6hliche', u'Fr\xf6hliche'), (u'Frachfmodule', u'Frachtmodule'), (u'Frafi', u'Fra\xdf'), (u'fragfe', u'fragte'), (u"Fral'S", u'Fra\xdf'), (u'fralken', u'fra\xdfen'), (u'Franzfisisch', u'Franz\xf6sisch'), (u'Franziisin', u'Franz\xf6sin'), (u'franziisische', u'franz\xf6sische'), (u'franziisischen', u'franz\xf6sischen'), (u'franziisischer', u'franz\xf6sischer'), (u'franziisisches', u'franz\xf6sisches'), (u'Franz\xe9sisch', u'Franz\xf6sisch'), (u'franz\xe9sische', u'franz\xf6sische'), (u'franz\xe9sischen', u'franz\xf6sischen'), (u'franz\xe9sischer', u'franz\xf6sischer'), (u'Franz\xe9sisches', u'Franz\xf6sisches'), (u'FRAULEIN', u'FR\xc4ULEIN'), (u'fre/em', u'freiem'), (u'freffen', u'treffen'), (u'freilieB', u'freilie\xdf'), (u'freimiitigen', u'freim\xfctigen'), (u'Fressger\xe9usche', u'Fressger\xe4usche'), (u'Frfichtekuchen', u'Fr\xfcchtekuchen'), (u'frfih', u'fr\xfch'), (u'frfiher', u'fr\xfcher'), (u'Friedh\xe9fe', u'Friedh\xf6fe'), (u'Friichtchen', u'Fr\xfcchtchen'), (u'friih', u'fr\xfch'), (u'friihen', u'fr\xfchen'), (u'friiher', u'fr\xfcher'), (u'friihere', u'fr\xfchere'), (u'friihliche', u'fr\xf6hliche'), (u'friihlichen', u'fr\xf6hlichen'), (u'Friihstiick', u'Fr\xfchst\xfcck'), (u'friilher', u'fr\xfcher'), (u'friilhesten', u'fr\xfchesten'), (u'Frijchte', u'Fr\xfcchte'), (u'frijh', u'fr\xfch'), (u'frijher', u'fr\xfcher'), (u'frijherer', u'fri\xfcherer'), (u'frilh', u'fr\xfch'), (u'frilhen', u'fr\xfchen'), (u'Frilher', u'Fr\xfcher'), (u'frilhere', u'fr\xfchere'), (u'Frilhst\ufb02ck', u'Fr\xfchst\xfcck'), (u'Fris6r', u'Fris\xf6r'), (u"frL'lher", u'fr\xfcher'), (u'Frljihling', u'Fr\xfchling'), (u'Frllichte', u'Fr\xfcchte'), (u'frllih', u'fr\xfch'), (u'frlliher', u'fr\xfcher'), (u'Frllihstiickskiiche', u'Fr\xfchst\xfccksk\xfcche'), (u'fro/1', u'froh'), (u'FROHLICHE', u'FR\xd6HLICHE'), (u'frtih', u'fr\xfch'), (u'Frtiher', u'Fr\xfcher'), (u'Frtihliche', u'Fr\xf6hliche'), (u'Frtihstticksei', u'Fr\xfchst\xfccksei'), (u'Frtlh', u'Fr\xfch'), (u'FrUh', u'Fr\xfch'), (u'FRUHE', u'FR\xdcHE'), (u'fruhe', u'fr\xfche'), (u'fruhen', u'fr\xfchen'), (u'Fruher', u'Fr\xfcher'), (u'fruheren', u'fr\xfcheren'), (u'Fruhling', u'Fr\xfchling'), (u'Fruhlingsrolle', u'Fr\xfchlingsrolle'), (u'FrUhstUck', u'Fr\xfchstuck'), (u'Fruhstuck', u'Fr\xfchst\xfcck'), (u'frUhstUcken', u'fr\xfchst\xfccken'), (u'fr\xe9hliches', u'fr\xf6hliches'), (u'fr\xe9ihfiches', u'fr\xf6hliches'), (u'fr\xe9ihlich', u'fr\xf6hlich'), (u'Fr\xe9iulein', u'Fr\xe4ulein'), (u'fr\xe9nen', u'fr\xf6nen'), (u'Fr\xe9sche', u'Fr\xf6sche'), (u'Fr\xe9ulein', u'Fr\xe4ulein'), (u'ftihlen', u'f\xfchlen'), (u'Ftillhorn', u'F\xfcllhorn'), (u'Ftir', u'F\xfcr'), (u'Ftirs', u'F\xfcrs'), (u'Ftlhrung', u'F\xfchrung'), (u'ftlrchte', u'f\xfcrchte'), (u'ftmf', u'f\xfcnf'), (u'Fu/3', u'Fu\xdf'), (u'FuB', u'Fu\xdf'), (u'FuBballspieler', u'Fu\xdfballspieler'), (u'FUBen', u'F\xfc\xdfen'), (u'Fuf$', u'Fu\xdf'), (u'Fufi', u'Fu\xdf'), (u'Fufiabdrucke', u'Fu\xdfabdr\xfccke'), (u'Fufiballtraining', u'Fu\xdfballtraining'), (u'FufL', u'Fu\xdf'), (u'Fuflsball', u'Fu\xdfball'), (u'Fuflsballszene', u'Fu\xdfballszene'), (u"fUhl't", u'f\xfchrt'), (u'fuhle', u'f\xfchle'), (u'fuhlst', u'f\xfchlst'), (u'fUhlt', u'f\xfchlt'), (u'fUhre', u'f\xfchre'), (u'fUhrt', u'f\xfchrt'), (u'fuhrte', u'f\xfchrte'), (u'fuhrten', u'f\xfchrten'), (u'Fuhrung', u'F\xfchrung'), (u'Fuhrungsf\xe9higkeiten', u'F\xfchrungsf\xe4higkeiten'), (u'Fuhrungsoffizier', u'F\xfchrungsoffizier'), (u'Fuhrungsqualit\xe9t', u'F\xfchrungsqualit\xe4t'), (u'FUI3en', u'F\xfc\xdfen'), (u'Fuli', u'Fu\xdf'), (u'Fuliball', u'Fu\xdfball'), (u'Fulisohlen', u'Fu\xdfsohlen'), (u'FUller', u'F\xfcller'), (u'fUllten', u'f\xfcllten'), (u'fumt', u'f\xfchlt'), (u'Fundbiiro', u'Fundb\xfcro'), (u'FUnf', u'F\xfcnf'), (u'Funftbeste', u'F\xfcnftbeste'), (u'Funkchen', u'F\xfcnkchen'), (u'Funkger\xe9it', u'Funkger\xe4t'), (u'Funkger\xe9ite', u'Funkger\xe4te'), (u'Funkger\xe9t', u'Funkger\xe4t'), (u'funktionstilchtig', u'funktionst\xfcchtig'), (u'FUR', u'F\xdcR'), (u'Fur', u'F\xfcr'), (u"fUrAusweichmanc'\xa7ver", u'f\xfcr Ausweichman\xf6ver'), (u'furchteinfl6Bend', u'furchteinfl\xf6\xdfend'), (u'furchteinfl6Bende', u'furchteinfl\xf6\xdfende'), (u'furchten', u'f\xfcrchten'), (u'Furchtest', u'F\xfcrchtest'), (u'furchtet', u'f\xfcrchtet'), (u'furchteten', u'f\xfcrchteten'), (u'fureinander', u'f\xfcreinander'), (u'furjeden', u'f\xfcr jeden'), (u'furjemanden', u'f\xfcr jemanden'), (u'furjudische', u'fur j\xfcdische'), (u'furs', u'f\xfcrs'), (u'FUrWalter', u'F\xfcr Walter'), (u'fut', u'tut'), (u'Fu\ufb02ballspiel', u'Fu\xdfballspiel'), (u'F\xa7hnlein', u'F\xe4hnlein'), (u'f\xe9//t', u'f\xe4llt'), (u'f\xe9hig', u'f\xe4hig'), (u'F\xe9higkeit', u'F\xe4higkeit'), (u'F\xe9higkeiten', u'F\xe4higkeiten'), (u'f\xe9hnen', u'f\xf6hnen'), (u'F\xe9hnens', u'F\xf6hnens'), (u'F\xe9hnerei', u'F\xf6hnerei'), (u'F\xe9hnleinmiitter', u'F\xe4hnleinm\xfctter'), (u'F\xe9hre', u'F\xe4hre'), (u'f\xe9hrst', u'f\xe4hrst'), (u'f\xe9hrt', u'f\xe4hrt'), (u'F\xe9ihigkeit', u'F\xe4higkeit'), (u'F\xe9ihigkeiten', u'F\xe4higkeiten'), (u'f\xe9ihrt', u'f\xe4hrt'), (u'f\xe9illst', u'f\xe4llst'), (u'f\xe9illt', u'f\xe4llt'), (u'F\xe9ilschung', u'F\xe4lschung'), (u'F\xe9ingt', u'F\xe4ngt'), (u'f\xe9ir', u'f\xfcr'), (u'F\xe9lle', u'F\xe4lle'), (u'F\xe9llen', u'F\xe4llen'), (u'f\xe9lligl', u'f\xe4llig'), (u'F\xe9llt', u'F\xe4llt'), (u"f\xe9llt's", u"f\xe4llt's"), (u'F\xe9lschen', u'F\xe4lschen'), (u'F\xe9lschung', u'F\xe4lschung'), (u'f\xe9nde', u'f\xe4nde'), (u'F\xe9ngst', u'F\xe4ngst'), (u'F\xe9ngt', u'F\xe4ngt'), (u'f\xe9rben', u'f\xe4rben'), (u'f\xe9rbt', u'f\xe4rbt'), (u'f\xe9rdern', u'f\xf6rdern'), (u'f\xe9rmlich', u'f\xf6rmlich'), (u'F\xe9ustlinge', u'F\xe4ustlinge'), (u"f\xfcr'ne", u"f\xfcr 'ne"), (u'f\xfcrchlerlichen', u'f\xfcrchterlichen'), (u'f\xfcrjede', u'f\xfcr jede'), (u'f\xfcrjeden', u'f\xfcr jeden'), (u'F\ufb02hrungsprogramm', u'F\xfchrungsprogramm'), (u'F\ufb02hrungsstil', u'F\xfchrungsstil'), (u'f\ufb02llen', u'f\xfcllen'), (u'f\ufb02llt', u'f\xe4llt'), (u'f\ufb02nf', u'f\xfcnf'), (u'F\ufb02r', u'F\xfcr'), (u'f\ufb02rchte', u'f\xfcrchte'), (u'f\ufb02rjeden', u'f\xfcr jeden'), (u'g/bf', u'gibt'), (u'g/bsf', u'gibst'), (u'G5ste', u'G\xe4ste'), (u'G6nn', u'G\xf6nn'), (u"G6t'lllche", u'G\xf6ttliche'), (u'G6tter', u'G\xf6tter'), (u'G6ttern', u'G\xf6ttern'), (u'Gamilonl', u'Gamilon!'), (u'ganzlich', u'g\xe4nzlich'), (u'gardel', u'garde!'), (u'Gasbrfiter', u'Gasbr\xe4ter'), (u'gauze', u'ganze'), (u'GCJKTEN', u'G\xd6KTEN'), (u'ge6lt', u'ge\xf6lt'), (u'gebauf', u'gebaut'), (u'Gebiez', u'Gebiet'), (u'Gebi\xe9ude', u'Geb\xe4ude'), (u'gebliebenl', u'geblieben!'), (u'GEBRAUCHTWAGENIPOLIZEIITAXI', u'GEBRAUCHTWAGEN/POLIZEI/TAXI'), (u'Gebr\xe9u', u'Gebr\xe4u'), (u'gebs', u"geb's"), (u'gebuhrend', u'geb\xfchrend'), (u'Geb\xe9ick', u'Geb\xe4ck'), (u'Geb\xe9iude', u'Geb\xe4ude'), (u'geb\xe9rdet', u'geb\xe4rdet'), (u'Geb\xe9rmutter', u'Geb\xe4rmutter'), (u'Geb\xe9rmutterhals', u'Geb\xe4rmutterhals'), (u'Geb\xe9ude', u'Geb\xe4ude'), (u'Geb\xe9udedach', u'Geb\xe4udedach'), (u'Geb\xe9uden', u'Geb\xe4uden'), (u'Geb\xe9udes', u'Geb\xe4udes'), (u'gedemiitigt', u'gedem\xfctigt'), (u'gedemijtigt', u'gedem\xfctigt'), (u'gedemllitigt', u'gedem\xfctigt'), (u'gedrtickt', u'gedr\xfcckt'), (u'gedr\xe9ngt', u'gedr\xe4ngt'), (u'Ged\xe9chtnisverlustes', u'Ged\xe4chtnisverlustes'), (u'Ged\xe9ichtnis', u'Ged\xe4chtnis'), (u'ged\xe9mpft', u'ged\xe4mpft'), (u"gef'a'hrlich", u'gef\xe4hrlich'), (u"gef'a'llt", u'gef\xe4llt'), (u'gef5IIt', u'gef\xe4llt'), (u'gefahrdet', u'gef\xe4hrdet'), (u'gefahrlich', u'gef\xe4hrlich'), (u'gefallsllichtige', u'gefalls\xfcchtige'), (u'GEFANGNISTECHNOLOGIE', u'GEF\xc4NGNISTECHNOLOGIE'), (u'Gefechtsausrustung', u'Gefechtsausr\xfcstung'), (u'Geffihl', u'Gef\xfchl'), (u'geffihrt', u'gef\xfchrt'), (u'geffillt', u'gef\xe4llt'), (u'Gefihrliche', u'Gef\xe4rliche'), (u'Gefiihl', u'Gef\xfchl'), (u'Gefiihle', u'Gef\xfchle'), (u'Gefiihlen', u'Gef\xfchlen'), (u'Gefiihlslebens', u'Gef\xfchlslebens'), (u'gefiihlsmiliigen', u'gef\xfchlsm\xe4\xdfigen'), (u'gefiihrt', u'gef\xfchrt'), (u'gefiillst', u'gef\xe4llst'), (u'gefiillt', u'gef\xfcllt'), (u'gefiirchtet', u'gef\xfcrchtet'), (u'Gefijhl', u'Gef\xfchl'), (u'Gefijhle', u'Gef\xfchle'), (u'gefijhlt', u'gef\xfchlt'), (u'gefijllte', u'gef\xfcllte'), (u'Gefilhl', u'Gef\xfchl'), (u'Gefilhle', u'Gef\xfchle'), (u'gefillt', u'gef\xe4llt'), (u'Gefingnis', u'Gef\xe4ngnis'), (u"gefL'lllten", u'gef\xfcllten'), (u'Geflilster', u'Gefl\xfcster'), (u'gefllihllos', u'gef\xfchllos'), (u'Geflllhlsduselige', u'Gef\xfchlsduselige'), (u'GEFLUSTERT', u'GEFL\xdcSTERT'), (u'Geftuhle', u'Gef\xfchle'), (u'Gefuhl', u'Gef\xfchl'), (u'Gefuhle', u'Gef\xfchle'), (u'Gefuhlen', u'Gef\xfchlen'), (u'gefuhlt', u'gef\xfchlt'), (u'gefuhlvolle', u'gef\xfchlvolle'), (u'gefurchtet', u'gef\xfcrchtet'), (u'Gef\xe9hrde', u'Gef\xe4hrde'), (u'gef\xe9hrden', u'gef\xe4hrden'), (u'gef\xe9hrdet', u'gef\xe4hrdet'), (u'Gef\xe9hrdung', u'Gef\xe4hrdung'), (u'gef\xe9hrlich', u'gef\xe4hrlich'), (u'gef\xe9hrliche', u'gef\xe4hrliche'), (u'gef\xe9hrlicher', u'gef\xe4hrlicher'), (u'gef\xe9hrlicheren', u'gef\xe4hrlicheren'), (u'Gef\xe9hrliches', u'Gef\xe4hrliches'), (u'Gef\xe9hrt', u'Gef\xe4hrt'), (u'gef\xe9ihrden', u'gef\xe4hrden'), (u'gef\xe9ihrdet', u'gef\xe4hrdet'), (u'gef\xe9ihrlich', u'gef\xe4hrlich'), (u'Gef\xe9ihrte', u'Gef\xe4hrte'), (u'Gef\xe9ihrten', u'Gef\xe4hrten'), (u'gef\xe9illt', u'gef\xe4llt'), (u"Gef\xe9illt's", u"Gef\xe4llt's"), (u'gef\xe9llf', u'gef\xe4llt'), (u'gef\xe9llfs', u"gef\xe4llt's"), (u'gef\xe9llig', u'gef\xe4llig'), (u'gef\xe9lligst', u'gef\xe4lligst'), (u'gef\xe9llst', u'gef\xe4llst'), (u'Gef\xe9llt', u'Gef\xe4llt'), (u"Gef\xe9llt's", u"Gef\xe4llt's"), (u'gef\xe9lscht', u'gef\xe4lscht'), (u'Gef\xe9ngnis', u'Gef\xe4ngnis'), (u'Gef\xe9ngnisregeln', u'Gef\xe4ngnisregeln'), (u'Gef\xe9ngnisse', u'Gef\xe4ngnisse'), (u'Gef\xe9ngnissen', u'Gef\xe4ngnissen'), (u'Gef\xe9ngnisses', u'Gef\xe4ngnisses'), (u'Gef\xe9ngniswagen', u'Gef\xe4ngniswagen'), (u'gef\ufb02gig', u'gef\xfcgig'), (u'gegenfiber', u'gegen\xfcber'), (u'gegeniiber', u'gegen\xfcber'), (u'gegeniibertritt', u'gegen\xfcbertritt'), (u'gegeniiberzusfehen', u'gegen\xfcberzustehen'), (u'gegenijber', u'gegen\xfcber'), (u'gegenlliber', u'gegen\xfcber'), (u'gegenlliberstehen', u'gegen\xfcberstehen'), (u'Gegenstrfimung', u'Gegenstr\xf6mung'), (u'Gegenstr\xe9mung', u'Gegenstr\xf6mung'), (u'Gegensttlck', u'Gegenst\xfcck'), (u'Gegenst\xe9nde', u'Gegenst\xe4nde'), (u'gegenuber', u'gegen\xfcber'), (u'Gegenverschwiirung', u'Gegenverschw\xf6rung'), (u'gegenw\xe9rtigen', u'gegenw\xe4rtigen'), (u'gegriindet', u'gegr\xfcndet'), (u'gegrijfit', u'gegr\xfc\xdft'), (u'gegrilfit', u'gegr\xfc\xdft'), (u'GegrUl3t', u'Gegr\xfc\xdft'), (u'gegrundet', u'gegr\xfcndet'), (u'geh6ren', u'geh\xf6ren'), (u'geh6rt', u'geh\xf6rt'), (u'gehdrt', u'geh\xf6rt'), (u'GeheilS', u'Gehei\xdf'), (u'geheilSen', u'gehei\xdfen'), (u'gehejetzt', u'gehe jetzt'), (u'gehf', u'geht'), (u'gehfiirt', u'geh\xf6rt'), (u'gehfire', u'geh\xf6re'), (u'gehfiren', u'geh\xf6ren'), (u'gehfirt', u'geh\xf6rt'), (u'gehiipft', u'geh\xfcpft'), (u'Gehiir', u'Geh\xf6r'), (u'gehiire', u'geh\xf6re'), (u'gehiiren', u'geh\xf6ren'), (u'gehiirst', u'geh\xf6rst'), (u'gehiirt', u'geh\xf6rt'), (u'Gehim', u'Gehirn'), (u'Gehirnsch\xe9den', u'Gehirnsch\xe4den'), (u'gehlngt', u'geh\xe4ngt'), (u'gehore', u'geh\xf6re'), (u'gehoren', u'geh\xf6ren'), (u'gehort', u'geh\xf6rt'), (u"geht'sl", u"geht's!"), (u'Gehtirt', u'Geh\xf6rt'), (u'gehtjetzt', u'geht jetzt'), (u'geh\xe9irt', u'geh\xf6rt'), (u'Geh\xe9iuteten', u'Geh\xe4uteten'), (u'geh\xe9r', u'geh\xf6r'), (u'geh\xe9re', u'geh\xf6re'), (u'geh\xe9ren', u'geh\xf6ren'), (u'geh\xe9rst', u'geh\xf6rst'), (u'Geh\xe9rt', u'Geh\xf6rt'), (u'geh\xe9rten', u'geh\xf6rten'), (u'geh\xe9rtf', u'geh\xf6rt!'), (u'geiiffnet', u'ge\xf6ffnet'), (u'geilbt', u'ge\xfcbt'), (u'geistesgestort', u'geistesgest\xf6rt'), (u'Gei\ufb02blatt', u'Gei\xdfblatt'), (u'Gei\ufb02blattstaude', u'Gei\xdfblattstaude'), (u'gekiisst', u'gek\xfcsst'), (u'gekiisstl', u'gek\xfcsst!'), (u'gekijndigt', u'gek\xfcndigt'), (u'gekijsst', u'gek\xfcsst'), (u'gekilsst', u'gek\xfcsst'), (u'gekimpfl', u'gek\xe4mpft'), (u'gekimpft', u'gek\xe4mpft'), (u'geklautl', u'geklaut!'), (u'gekliirt', u'gekl\xe4rt'), (u'gekllrt', u'gekl\xe4rt'), (u'gekl\xe9rt', u'gekl\xe4rt'), (u'gekriint', u'gekr\xf6nt'), (u'gekrijmmt', u'gekr\xfcmmt'), (u'GEKUHLTER', u'GEK\xdcHLTER'), (u'gekurzt', u'gek\xfcrzt'), (u'gek\xe9mpft', u'gek\xe4mpft'), (u'gelaufenl', u'gelaufen!'), (u'gelegf', u'gelegt'), (u'gelegtwurde', u'gelegt wurde'), (u'geliist', u'gel\xf6st'), (u'gelilftet', u'gel\xfcftet'), (u'gelndert', u'ge\xe4ndert'), (u'Gelst', u'Geist'), (u'Geltungsbedurfnis', u'Geltungsbed\xfcrfnis'), (u'GELUBDE', u'GEL\xdcBDE'), (u'Gel\xe9chter', u'Gel\xe4chter'), (u'gel\xe9hmt', u'gel\xe4hmt'), (u'gel\xe9ischt', u'gel\xf6scht'), (u'Gel\xe9nde', u'Gel\xe4nde'), (u'gel\xe9nge', u'gel\xe4nge'), (u'gel\xe9st', u'gel\xf6st'), (u'gem', u'gern'), (u'gemafiregelt', u'gema\xdfregelt'), (u'Geme', u'Gerne'), (u'gemfitliches', u'gem\xfctliches'), (u'Gemiise', u'Gem\xfcse'), (u'gemiitlich', u'gem\xfctlich'), (u'Gemijlse', u'Gem\xfcse'), (u'Gemilt', u'Gem\xfct'), (u'gemiltlicher', u'gem\xfctlicher'), (u'GemLise', u'Gem\xfcse'), (u'Gemut', u'Gem\xfct'), (u'gem\xe9fi', u'gem\xe4\xdf'), (u'Gem\xe9fk', u'Gem\xe4\xdf'), (u'gem\xe9ht', u'gem\xe4ht'), (u'Gem\xe9ili', u'Gem\xe4\xdf'), (u'Gem\xe9lde', u'Gem\xe4lde'), (u'Gem\xe9lden', u'Gem\xe4lden'), (u'Genaul', u'Genau!'), (u'genieBt', u'genie\xdft'), (u'genief$en', u'genie\xdfen'), (u'Geniefien', u'Genie\xdfen'), (u'geniefk', u'genie\xdf'), (u'genielien', u'genie\xdfen'), (u'genielken', u'genie\xdfen'), (u'genie\ufb02en', u'genie\xdfen'), (u'genligen', u'gen\xfcgen'), (u'genlligend', u'gen\xfcgend'), (u'genlligt', u'gen\xfcgt'), (u'genlllgend', u'gen\xfcgend'), (u'genugt', u'gen\xfcgt'), (u'genugte', u'gen\xfcgte'), (u'georfef', u'geortet'), (u'gepfluckt', u'gepfl\xfcckt'), (u'gepriifter', u'gepr\xfcfter'), (u'gepruft', u'gepr\xfcft'), (u'Gep\xe9ck', u'Gep\xe4ck'), (u'gerfit', u'ger\xe4t'), (u'Geriichte', u'Ger\xfcchte'), (u'Geriite', u'Ger\xe4te'), (u'Gerijcht', u'Ger\xfccht'), (u'Gerllicht', u'Ger\xfccht'), (u'gerllistet', u'ger\xfcstet'), (u'gernhaben', u'gern-haben'), (u'gernntgt', u'ger\xf6ntgt'), (u'ger\xe9it', u'ger\xe4t'), (u'Ger\xe9iusch', u'Ger\xe4usch'), (u'Ger\xe9t', u'Ger\xe4t'), (u'Ger\xe9te', u'Ger\xe4te'), (u'Ger\xe9tschaften', u'Ger\xe4tschaften'), (u'ger\xe9umt', u'ger\xe4umt'), (u'Ger\xe9usch', u'Ger\xe4usch'), (u'Ger\xe9usche', u'Ger\xe4usche'), (u'ger\xe9uschvoll', u'ger\xe4uschvoll'), (u'geschafff', u'geschafft'), (u'GESCHAFTSFUHRER', u'GESCH\xc4FTSF\xdcHRER'), (u'gescha\ufb02i', u'geschafft'), (u'Geschfift', u'Gesch\xe4ft'), (u'geschfimt', u'gesch\xe4mt'), (u'Geschift', u'Gesch\xe4ft'), (u'Geschifte', u'Gesch\xe4fte'), (u'Geschiftsleute', u'Gesch\xe4ftsleute'), (u'Geschiftswelt', u'Gesch\xe4ftswelt'), (u'geschiidigt', u'gesch\xe4digt'), (u'Geschiift', u'Gesch\xe4ft'), (u'Geschiiftsleben', u'Gesch\xe4ftsleben'), (u'geschijtzten', u'gesch\xfctzten'), (u'Geschiltz', u'Gesch\xfctz'), (u'Geschiltze', u'Gesch\xfctze'), (u'Geschiltzrohre', u'Gesch\xfctzrohre'), (u'Geschiltzturm', u'Gesch\xfctzturm'), (u'geschlijpftl', u'geschl\xfcpft!'), (u'Geschllitzstellungen', u'Gesch\xfctzstellungen'), (u'geschnfiffelt', u'geschn\xfcffelt'), (u'Geschtitz', u'Gesch\xfctz'), (u'Geschtltz', u'Gesch\xfctz'), (u'Geschutz', u'Gesch\xfctz'), (u'Geschutze', u'Gesch\xfctze'), (u'Geschwiir', u'Geschw\xfcr'), (u'Geschwllir', u'Geschw\xfcr'), (u'Geschwur', u'Geschw\xfcr'), (u'geschw\xe9cht', u'geschw\xe4cht'), (u'geschw\xe9ingert', u'geschw\xe4ngert'), (u'Geschw\xe9tz', u'Geschw\xe4tz'), (u'Gesch\xe9ft', u'Gesch\xe4ft'), (u'Gesch\xe9fte', u'Gesch\xe4fte'), (u'Gesch\xe9ftige', u'Gesch\xe4ftige'), (u'gesch\xe9ftlich', u'gesch\xe4ftlich'), (u'Gesch\xe9fts', u'Gesch\xe4fts'), (u'Gesch\xe9ftsleben', u'Gesch\xe4ftsleben'), (u'Gesch\xe9ift', u'Gesch\xe4ft'), (u'Gesch\xe9ifte', u'Gesch\xe4fte'), (u'gesch\xe9iftsm\xe9ifiig', u'gesch\xe4ftsm\xe4\xdfig'), (u'gesch\xe9itzt', u'gesch\xe4tzt'), (u'gesch\xe9nolet', u'gesch\xe4ndet'), (u'Gesch\ufb02tze', u'Gesch\xfctze'), (u'Gesetzeshiiter', u'Gesetzesh\xfcter'), (u'Gesichtl', u'Gesicht!'), (u'Gesichtsausdrijcke', u'Gesichtsausdr\xfccke'), (u'Gesiiff', u'Ges\xf6ff'), (u'gesiindigt', u'ges\xfcndigt'), (u'gespiirt', u'gesp\xfcrt'), (u'Gesprach', u'Gespr\xe4ch'), (u'GESPRACH', u'GESPR\xc4CH'), (u'GESPRACHE', u'GESPR\xc4CHE'), (u'Gespr\xe9ch', u'Gespr\xe4ch'), (u'Gespr\xe9che', u'Gespr\xe4che'), (u'Gespr\xe9iche', u'Gespr\xe4che'), (u'Gespr\xe9ichsthema', u'Gespr\xe4chsthema'), (u'Gespur', u'Gesp\xfcr'), (u'gestiirt', u'gest\xf6rt'), (u'gestijrzt', u'gest\xfcrzt'), (u'gestijtzte', u'gest\xfctzte'), (u'gestof$en', u'gesto\xdfen'), (u'gestolken', u'gesto\xdfen'), (u'Gestriipp', u'Gestr\xfcpp'), (u'Gestrijpp', u'Gestr\xfcpp'), (u'GESTURZT', u'GEST\xdcRZT'), (u'gest\xe9irt', u'gest\xf6rt'), (u'Gest\xe9ndnis', u'Gest\xe4ndnis'), (u'gest\xe9rt', u'gest\xf6rt'), (u'gest\ufb02rzt', u'gest\xfcrzt'), (u'Gesundheitsbehijrde', u'Gesundheitsbeh\xf6rde'), (u'Gesundheitsftlrsorge', u'Gesundheitsf\xfcrsorge'), (u'Ges\xe9fitaschel', u'Ges\xe4\xdftasche!'), (u'Ges\xe9iffstaschenl', u'Ges\xe4\xdftaschen!'), (u'get6tet', u'get\xf6tet'), (u'Getiise', u'Get\xf6se'), (u'getiitet', u'get\xf6tet'), (u"getr'a'umt", u'getr\xe4umt'), (u'getr\xe9umt', u'getr\xe4umt'), (u'get\xe9tet', u'get\xf6tet'), (u'get\xe9tetf', u'get\xf6tet!'), (u'get\xe9uscht', u'get\xe4uscht'), (u'gev\xe9gelt', u'gev\xf6gelt'), (u'gew6hnt', u'gew\xf6hnt'), (u'GEWACHSHAUS', u'GEW\xc4CHSHAUS'), (u'gewaltt\xe9tig', u'gewaltt\xe4tig'), (u'gewarnf', u'gewarnt'), (u'Gewerkschaftsfunktion\xe9ren', u'Gewerkschaftsfunktion\xe4ren'), (u'gewfinscht', u'gew\xfcnscht'), (u'Gewiasenskon\ufb02ikte', u'Gewissenskon\ufb02ikte'), (u'gewiihlt', u'gew\xe4hlt'), (u'gewiihnen', u'gew\xf6hnen'), (u'gewiihnlich', u'gew\xf6hnlich'), (u'gewiihnlicher', u'gew\xf6hnlicher'), (u'gewiihnliches', u'gew\xf6hnliches'), (u'gewiihnt', u'gew\xf6hnt'), (u'gewiinscht', u'gew\xfcnscht'), (u'gewijhnlichen', u'gew\xf6hnlichen'), (u'gewijnscht', u'gew\xfcnscht'), (u'gewissermafien', u'gewisserma\xdfen'), (u'gewissermallsen', u'gewisserma\xdfen'), (u'gewlllnscht', u'gew\xfcnscht'), (u'Gewohnheitstiter', u'Gewohnheitst\xe4ter'), (u'gewtinscht', u'gew\xfcnscht'), (u'gewunscht', u'gew\xfcnscht'), (u'gewunschten', u'gew\xfcnschten'), (u'Gew\xe9chshaus', u'Gew\xe4chshaus'), (u'gew\xe9hlt', u'gew\xe4hlt'), (u'gew\xe9hnen', u'gew\xf6hnen'), (u'gew\xe9hnlicher', u'gew\xf6hnlicher'), (u'gew\xe9hnst', u'gew\xf6hnst'), (u'gew\xe9hnt', u'gew\xf6hnt'), (u'Gew\xe9hren', u'Gew\xe4hren'), (u'gew\xe9hrt', u'gew\xe4hrt'), (u'Gew\xe9isser', u'Gew\xe4sser'), (u'Gew\xe9ssern', u'Gew\xe4ssern'), (u'gezfichtet', u'gez\xfcchtet'), (u'gezilndet', u'gez\xfcndet'), (u'gez\xe9hlt', u'gez\xe4hlt'), (u'gez\xe9ihlt', u'gez\xe4hlt'), (u'gez\xe9ihmt', u'gez\xe4hmt'), (u'ge\xe9ndert', u'ge\xe4ndert'), (u"GF6l'1Z6fUf", u'Grenze f\xfcr'), (u'Gfirtel', u'G\xfcrtel'), (u'Gfirtner', u'G\xe4rtner'), (u'Gfiste', u'G\xe4ste'), (u'Gfitter', u'G\xf6tter'), (u'Ghrchen', u'\xd6hrchen'), (u'gibtjede', u'gibt jede'), (u'gibtk', u"gibt's"), (u'gibts', u"gibt's"), (u'gieBen', u'gie\xdfen'), (u'GieBkanne', u'Gie\xdfkanne'), (u'gief$t', u'gie\xdft'), (u'giefit', u'gie\xdft'), (u'gielit', u'gie\xdft'), (u'gignalton', u'Signalton'), (u'giinstiger', u'g\xfcnstiger'), (u'Giire', u'G\xf6re'), (u'Giite', u'G\xfcte'), (u'giitiger', u'g\xfctiger'), (u'Giitter', u'G\xf6tter'), (u'Giittliche', u'G\xf6ttliche'), (u'giittlichen', u'g\xf6ttlichen'), (u'Gijte', u'G\xfcte'), (u'Gijtel', u'G\xfcte!'), (u'Gilrtel', u'G\xfcrtel'), (u'Gilte', u'G\xfcte'), (u'Giltiger', u'G\xfctiger'), (u'Gitarrenkl\xe9nge', u'Gitarrenkl\xe4nge'), (u'Gite', u'G\xfcte'), (u'GIUck', u'Gl\xfcck'), (u"GIUCKliCl'1", u'Gl\xfccklich'), (u"GL'lte", u'G\xfcte'), (u'Glaubwurdigkeit', u'Glaubw\xfcrdigkeit'), (u'Glaubwurdigkeitl', u'Glaubw\xfcrdigkeit!'), (u'glaubw\ufb02rdig', u'glaubw\xfcrdig'), (u'glb', u'gib'), (u'glbt', u'gibt'), (u'Gle/ch', u'Gleich'), (u'gleichgiiltig', u'gleichg\xfcltig'), (u'gleichm\xe9mig', u'gleichm\xe4\xdfig'), (u'Glfick', u'Gl\xfcck'), (u'glficklich', u'gl\xfccklich'), (u'Glfickspilz', u'Gl\xfcckspilz'), (u'Gliick', u'Gl\xfcck'), (u'Gliickchen', u'Gl\xf6ckchen'), (u'gliicklich', u'gl\xfccklich'), (u'gliicklicher', u'gl\xfccklicher'), (u'Gliicksbringer', u'Gl\xfccksbringer'), (u'Gliickssfr\xe9hne', u'Gl\xfccksstr\xe4hne'), (u'Gliickwunsch', u'Gl\xfcckwunsch'), (u'gliilcklich', u'gl\xfccklich'), (u'Glijck', u'Gl\xfcck'), (u'glijcklich', u'gl\xfccklich'), (u'Glilck', u'Gl\xfcck'), (u'glilcklich', u'gl\xfccklich'), (u'Glilckwunsch', u'Gl\xfcckwunsch'), (u'Glillck', u'Gl\xfcck'), (u'gllinstig', u'g\xfcnstig'), (u'gllinstigem', u'g\xfcnstigem'), (u'gllinstigen', u'g\xfcnstigen'), (u'glljcklich', u'gl\xfccklich'), (u'glllicklich', u'gl\xfccklich'), (u'glllickliche', u'gl\xfcckliche'), (u'Glllte', u'G\xfcte'), (u'Glorifiziertl', u'Glorifiziert!'), (u'glticklich', u'gl\xfccklich'), (u'Gltickszahlen', u'Gl\xfcckszahlen'), (u'gltlckliohes', u'gl\xfcckliches'), (u'Gluck', u'Gl\xfcck'), (u'glucklich', u'gl\xfccklich'), (u'gluckliche', u'gl\xfcckliche'), (u'GLUCKSELIGKEIT', u'GL\xdcCKSELIGKEIT'), (u'Gluckwunsch', u'Gl\xfcckwunsch'), (u'Gluok', u'Gl\xfcck'), (u'gluoklich', u'gl\xfccklich'), (u'Glupsch\xe9ugige', u'Glupsch\xe4ugige'), (u'glutheilie', u'gluthei\xdfe'), (u'gl\xe9inzende', u'gl\xe4nzende'), (u'gl\xe9nzende', u'gl\xe4nzende'), (u'gl\xe9nzte', u'gl\xe4nzte'), (u'Gl\xe9ser', u'Gl\xe4ser'), (u'gl\xe9ubige', u'gl\xe4ubige'), (u'Gl\xe9ubigen', u'Gl\xe4ubigen'), (u'Gl\ufb02ck', u'Gl\xfcck'), (u'Gl\ufb02cklich', u'Gl\xfccklich'), (u'Gl\ufb02ckstag', u'Gl\xfcckstag'), (u'Gl\ufb02ckwilnsche', u'Gl\xfcckw\xfcnsche'), (u'gnidig', u'gn\xe4dig'), (u'Gnllnden', u'Gr\xfcnden'), (u'gn\xe9dig', u'gn\xe4dig'), (u'gn\xe9dige', u'gn\xe4dige'), (u'gn\xe9digen', u'gn\xe4digen'), (u'Gn\xe9digste', u'Gn\xe4digste'), (u'gn\xe9idig', u'gn\xe4dig'), (u'Goff', u'Gott'), (u'Golfballweili', u'Golfballwei\xdf'), (u'gonnst', u'g\xf6nnst'), (u'gottesfllirchtiger', u'gottesf\xfcrchtiger'), (u'Gottverdammt', u'Gott verdammt'), (u'Go\ufb02', u'Gott'), (u'Gr6Be', u'Gr\xf6\xdfe'), (u'gr6Ber', u'gr\xf6\xdfer'), (u'gr6Bere', u'gr\xf6\xdfere'), (u'gr6Beren', u'gr\xf6\xdferen'), (u'Gr6Bte', u'Gr\xf6\xdfte'), (u'Gr6Bten', u'Gr\xf6\xdften'), (u'gr6Bter', u'gr\xf6\xdfter'), (u'gr6Btes', u'gr\xf6\xdftes'), (u'gr6f$te', u'gr\xf6\xdfte'), (u'gr6f$ten', u'gr\xf6\xdften'), (u'gr6f5ten', u'gr\xf6\xdften'), (u'gr6I3ter', u'gr\xf6\xdfter'), (u'gr6ISten', u'gr\xf6\xdften'), (u'Gr6l3e', u'Gr\xf6\xdfe'), (u'gr6l3ter', u'gr\xf6\xdfter'), (u'Grabst\xe9tte', u'Grabst\xe4tte'), (u'gratulierel', u'gratuliere!'), (u'grClf$en', u'gr\xfc\xdfen'), (u'grfilieren', u'gr\xf6\xdferen'), (u'Grfiner', u'Gr\xfcner'), (u'griil3e', u'gr\xfc\xdfe'), (u'griiliere', u'gr\xf6\xdfere'), (u'griiliten', u'gr\xf6\xdften'), (u'griin', u'gr\xfcn'), (u'Griinde', u'Gr\xfcnde'), (u'Griinden', u'Gr\xfcnden'), (u'griindlich', u'gr\xfcndlich'), (u'Griine', u'Gr\xfcne'), (u'griinen', u'gr\xfcnen'), (u'Griiner', u'Gr\xfcner'), (u'griin\xe9iugige', u'gr\xfcn\xe4ugige'), (u'griin\xe9iugiges', u'gr\xfcn\xe4ugiges'), (u'grii\ufb02te', u'gr\xf6\xdfte'), (u'Grijbeln', u'Gr\xfcbeln'), (u'griJBen', u'gr\xfc\xdfen'), (u'grijn', u'gr\xfcn'), (u'Grijnde', u'Gr\xfcnde'), (u'grijnden', u'gr\xfcnden'), (u'grijndlich', u'gr\xfcndlich'), (u'grijnes', u'gr\xfcnes'), (u'Grijnfutter', u'Gr\xfcnfutter'), (u'Grilbelt', u'Gr\xfcbelt'), (u'grilfken', u'gr\xfc\xdfen'), (u'Grillh\xe9hnchen', u'Grillh\xe4hnchen'), (u'Grilnde', u'Gr\xfcnde'), (u'Grilnden', u'Gr\xfcnden'), (u'grilndet', u'gr\xfcndet'), (u'grilndlich', u'gr\xfcndlich'), (u'grilndlicherf', u'gr\xfcndlicher!'), (u'grilndlichl', u'gr\xfcndlich!'), (u'grilne', u'gr\xfcne'), (u'Grilnschn\xe9bel', u'Gr\xfcnschn\xe4bel'), (u'grim', u'gr\xfcn'), (u'Grime', u'Gr\xf6\xdfe'), (u'grinco', u'gringo'), (u'Grllinde', u'Gr\xfcnde'), (u'grllinden', u'gr\xfcnden'), (u'grllindlich', u'gr\xfcndlich'), (u'grlllnes', u'gr\xfcnes'), (u'Gro/3artig', u'Gro\xdfartig'), (u'gro/3es', u'gro\xdfes'), (u'gro/3zUgig', u'gro\xdfz\xfcgig'), (u'Gro/Bstadt', u'Gro\xdfstadt'), (u'gro/Ken', u'gro\xdfen'), (u'groB', u'gro\xdf'), (u'groBartig', u'gro\xdfartig'), (u'GroBe', u'Gro\xdfe'), (u'GroBes', u'Gro\xdfes'), (u'GroBmutter', u'Gro\xdfmutter'), (u'GroBteil', u'Gro\xdfteil'), (u'groBziJgiger', u'gro\xdfz\xfcgiger'), (u'grof$', u'gro\xdf'), (u'grof$artig', u'gro\xdfartig'), (u'grof$artigen', u'gro\xdfartigen'), (u'grof$e', u'gro\xdfe'), (u'grof$er', u'gro\xdfer'), (u'grof$es', u'gro\xdfes'), (u'grof3', u'gro\xdf'), (u'grof3>artige', u'gro\xdfartige'), (u'Grof3e', u'Gro\xdfe'), (u'grof3en', u'gro\xdfen'), (u'grof3erAlien', u'gro\xdfer Alien'), (u'grof5es', u'gro\xdfes'), (u'Grofbvaters', u'Gro\xdfvaters'), (u'grofi', u'gro\xdf'), (u'Grofiangriffs', u'Gro\xdfangriffs'), (u'Grofiartig', u'Gro\xdfartig'), (u'grofiartige', u'gro\xdfartige'), (u'grofiartigen', u'gro\xdfartigen'), (u'grofiartiger', u'gro\xdfartiger'), (u'Grofiartiges', u'Gro\xdfartiges'), (u'Grofibritannien', u'Gro\xdfbritannien'), (u'Grofidiebstahl', u'Gro\xdfdiebstahl'), (u'Grofie', u'Gro\xdfe'), (u'grofier', u'gro\xdfer'), (u'grofies', u'gro\xdfes'), (u'grofiten', u'gr\xf6\xdften'), (u'grofk', u'gro\xdf'), (u'Grofkartig', u'Gro\xdfartig'), (u'grofke', u'gro\xdfe'), (u'Grofken', u'Gro\xdfen'), (u'Grofker', u'Gro\xdfer'), (u'Grofkvater', u'Gro\xdfvater'), (u'grofLe', u'gro\xdfe'), (u'grofler', u'gro\xdfer'), (u'groflsartig', u'gro\xdfartig'), (u'groflsartige', u'gro\xdfartige'), (u'Groflse', u'Gro\xdfe'), (u'groflsen', u'gro\xdfen'), (u'Grofser', u'Gro\xdfer'), (u'grol', u'gro\xdf'), (u"grol'3>en", u'gro\xdfen'), (u'grol2>', u'gro\xdf'), (u'grol2>en', u'gro\xdfen'), (u'grol3>es', u'gro\xdfes'), (u'grol3e', u'gro\xdfe'), (u'grol3er', u'gro\xdfer'), (u'Grol3raum', u'Gro\xdfraum'), (u'groli', u'gro\xdf'), (u'Groliartig', u'Gro\xdfartig'), (u'groliartige', u'gro\xdfartige'), (u'groliartigen', u'gro\xdfartigen'), (u'grolie', u'gro\xdfe'), (u'grolien', u'gro\xdfen'), (u'groliherzig', u'gro\xdfherzig'), (u'Grolimutter', u'Gro\xdfmutter'), (u'Grolisegel', u'Gro\xdfsegel'), (u'Grolkvater', u'Gro\xdfvater'), (u'groller', u'gro\xdfer'), (u'Grollser', u'Gro\xdfer'), (u'grollzugig', u'gro\xdfz\xfcgig'), (u'grolS', u'gro\xdf'), (u'grolSe', u'gro\xdfe'), (u'GrolSeltern', u'Gro\xdfeltern'), (u'grolSer', u'gro\xdfer'), (u'GrolSvater', u'Gro\xdfvater'), (u'grolZ~', u'gro\xdfe'), (u'gror$er', u'gro\xdfer'), (u'grorker', u'gro\xdfer'), (u'grosses', u'gro\xdfes'), (u'GROSSTE', u'GR\xd6SSTE'), (u'gro\ufb02', u'gro\xdf'), (u'gro\ufb02e', u'gro\xdfe'), (u'Gro\ufb02stadtkind', u'Gro\xdfstadtkind'), (u'Gro\ufb02vater', u'Gro\xdfvater'), (u'Grtin', u'Gr\xfcn'), (u'Grtmde', u'Gr\xfcnde'), (u'GruB', u'Gru\xdf'), (u'Grubenausg\xe9nge', u'Grubenausg\xe4nge'), (u'Gruf$', u'Gru\xdf'), (u'grUf$en', u'gr\xfc\xdfen'), (u'grufit', u'gr\xfc\xdft'), (u'Gruli', u'Gru\xdf'), (u'Grulikarte', u'Gru\xdfkarte'), (u'Grulikarten', u'Gru\xdfkarten'), (u'Grun', u'Gr\xfcn'), (u'grundlich', u'gr\xfcndlich'), (u'Grundstiick', u'Grundst\xfcck'), (u'grunds\xe9tzlich', u'grunds\xe4tzlich'), (u'grune', u'gr\xfcne'), (u'grunen', u'gr\xfcnen'), (u'Gr\xe9ben', u'Gr\xe4ben'), (u'gr\xe9bst', u'gr\xe4bst'), (u'gr\xe9fier', u'gr\xf6\xdfer'), (u'gr\xe9fkte', u'gr\xf6\xdfte'), (u'gr\xe9flserer', u'gr\xf6\xdferer'), (u'Gr\xe9ifite', u'Gr\xf6\xdfte'), (u'gr\xe9illten', u'gr\xf6\xdften'), (u'gr\xe9sslich', u'gr\xe4sslich'), (u'Gr\xe9uel', u'Gr\xe4uel'), (u'gr\ufb02ndlich', u'gr\xfcndlich'), (u'gr\ufb02ne', u'gr\xfcne'), (u'gull', u'gut!'), (u'Gummist\xe9psel', u'Gummist\xf6psel'), (u'Gumml', u'Gummi'), (u'GUNSTIGSTEN', u'G\xdcNSTIGSTEN'), (u'Gurtell', u'G\xfcrtel!'), (u'gutaussehend', u'gut aussehend'), (u'gutaussehender', u'gut aussehender'), (u'GUte', u'G\xfcte'), (u'gutgebaut', u'gut gebaut'), (u'gutgehen', u'gut gehen'), (u'Gutmijtigkeit', u'Gutm\xfctigkeit'), (u'g\xe9be', u'g\xe4be'), (u'g\xe9ben', u'g\xe4ben'), (u'g\xe9ibe', u'g\xe4be'), (u'G\xe9ittern', u'G\xf6ttern'), (u'G\xe9lisch', u'G\xe4lisch'), (u'G\xe9lische', u'G\xe4lische'), (u'g\xe9lisches', u'g\xe4lisches'), (u'G\xe9nsehaut', u'G\xe4nsehaut'), (u'G\xe9nsen', u'G\xe4nsen'), (u'G\xe9nze', u'G\xe4nze'), (u'G\xe9rfen', u'G\xe4rten'), (u'G\xe9rtnern', u'G\xe4rtnern'), (u'G\xe9ste', u'G\xe4ste'), (u'G\xe9stezimmer', u'G\xe4stezimmer'), (u'G\xe9tter', u'G\xf6tter'), (u'G\xe9tterspeise', u'G\xf6tterspeise'), (u'G\xe9ttin', u'G\xf6ttin'), (u'G\xe9ttliche', u'G\xf6ttliche'), (u'g\xe9ttlichen', u'g\xf6ttlichen'), (u'G\xe9tze', u'G\xf6tze'), (u'G\u20acfUhl6', u'Gef\xfchle'), (u'G\u20acStFUpp', u'Gestr\xfcpp'), (u"h<'>'r't", u'h\xf6rt'), (u"h<'5r", u'h\xf6r'), (u"h'a'lt", u'h\xe4lt'), (u"H'a'nde", u'H\xe4nde'), (u"H'a'nden", u'H\xe4nden'), (u"H'a'ttest", u'H\xe4ttest'), (u'H/', u'Hi'), (u'H/er', u'Hier'), (u'h/nfer', u'hinter'), (u'h5tte', u'h\xe4tte'), (u'H6fe', u'H\xf6fe'), (u'h6flich', u'h\xf6flich'), (u'H6fling', u'H\xf6fling'), (u'H6hen', u'H\xf6hen'), (u'h6her', u'h\xf6her'), (u'h6here', u'h\xf6here'), (u'H6HERER', u'H\xd6HERER'), (u'H6hle', u'H\xf6hle'), (u'H6l1e', u'H\xf6rte'), (u'H6lle', u'H\xf6lle'), (u'H6llen', u'H\xf6llen'), (u'h6lte', u'h\xf6rte'), (u'H6r', u'H\xf6r'), (u'h6re', u'h\xf6re'), (u'h6ren', u'h\xf6ren'), (u'H6rer', u'H\xf6rer'), (u'H6rner', u'H\xf6rner'), (u'h6rst', u'h\xf6rst'), (u'h6rt', u'h\xf6rt'), (u'h6rte', u'h\xf6rte'), (u'Ha/s', u'Hals'), (u'Haarbijrstel', u'Haarb\xfcrste!'), (u'Haarhfirste', u'Haarb\xfcrste'), (u'Haarl', u'Haar!'), (u'Haarstr\xe9hne', u'Haarstr\xe4hne'), (u"hab'jemanden", u"hab' jemanden"), (u'Hah', u'H\xe4h'), (u'halbstlllndiges', u'halbst\xfcndiges'), (u'halbvervvandelt', u'halbverwandelt'), (u'halfef', u'haltet'), (u'Hallfjchen', u'Hall\xf6chen'), (u'hallol', u'hallo!'), (u'Halsb\xe9nder', u'Halsb\xe4nder'), (u'Halsl', u'Hals!'), (u'haltenl', u'halten!'), (u'Haltjohnny', u'Halt Johnny'), (u'Hammersch\xe9del', u'Hammersch\xe4del'), (u'Handfl\xe9che', u'Handfl\xe4che'), (u'Handlungsstr\xe9nge', u'Handlungsstr\xe4nge'), (u'harfe', u'harte'), (u'hartn\xe9ickig', u'hartn\xe4ckig'), (u'Hasenful', u'Hasenfu\xdf'), (u'Hasenfull', u'Hasenfu\xdf'), (u'hassq', u'hasse'), (u'Hastja', u'Hast ja'), (u'hatjetzt', u'hat jetzt'), (u'hatta', u'hatte'), (u'Haupfbus', u'Hauptbus'), (u'Hauptaktion\xe9ire', u'Hauptaktion\xe4re'), (u'Hauptaktion\xe9irinnen', u'Hauptaktion\xe4rinnen'), (u'Hauptkabell', u'Hauptkabel!'), (u'haupts\xe9chlich', u'haupts\xe4chlich'), (u'haupts\xe9ichlich', u'haupts\xe4chlich'), (u'Haupttrib\ufb02ne', u'Haupttrib\xfcne'), (u'Hauptverschwiirer', u'Hauptverschw\xf6rer'), (u'Hauptwasserrohrwar', u'Hauptwasserrohr war'), (u'Hausfirzte', u'Haus\xe4rzte'), (u'Haush\xe9lterin', u'Haush\xe4lterin'), (u'Hausschlilssel', u'Hausschl\xfcssel'), (u'Haustilr', u'Haust\xfcr'), (u'Hausubervvachung', u'Haus\xfcberwachung'), (u'ha\xdft', u'hasst'), (u'Hbr', u'H\xf6r'), (u"hc'5ren", u'h\xf6ren'), (u"hc'\xa7r", u'h\xf6r'), (u'hdchsfens', u'h\xf6chstens'), (u'Hdchstleistung', u'H\xf6chstleistung'), (u'hdher', u'h\xf6her'), (u'Hdlle', u'H\xf6lle'), (u'Hdllenfeuer', u'H\xf6llenfeuer'), (u'hdre', u'h\xf6re'), (u'hdren', u'h\xf6ren'), (u'hdrsf', u'h\xf6rst'), (u'hdrten', u'horten'), (u'He/nr/ch', u'Heinrich'), (u'hedeutest', u'bedeutest'), (u'hegrfille', u'begr\xfc\xdfe'), (u'heiB', u'hei\xdf'), (u'heiBe', u'hei\xdfe'), (u'heiBen', u'hei\xdfen'), (u'HeiBer', u'Hei\xdfer'), (u'heiBes', u'hei\xdfes'), (u'heiBt', u'hei\xdft'), (u'heif$', u'hei\xdf'), (u'heif$e', u'hei\xdfe'), (u'heif$es', u'hei\xdfes'), (u'Heif$t', u'Hei\xdft'), (u'heif3>en', u'hei\xdfen'), (u'heif3t', u'hei\xdft'), (u'heif5en', u'hei\xdfen'), (u'heifie', u'hei\xdfe'), (u'heifiem', u'hei\xdfem'), (u'heifien', u'hei\xdfen'), (u'heifit', u'hei\xdft'), (u'heifkt', u'hei\xdft'), (u'heifLt', u'hei\xdft'), (u'heifZ>e', u'hei\xdfe'), (u"heil'$", u'hei\xdf'), (u"heil'$en", u'hei\xdfen'), (u"heil'$t", u'hei\xdft'), (u"heil'Se", u'hei\xdfe'), (u'heil2>en', u'hei\xdfen'), (u'heil2>t', u'hei\xdft'), (u'heil3en', u'hei\xdfen'), (u'heil3t', u'hei\xdft'), (u'heil5e', u'hei\xdfe'), (u'heil5t', u'hei\xdft'), (u'heili', u'hei\xdf'), (u'heilies', u'hei\xdfes'), (u'heilit', u'hei\xdft'), (u'heillst', u'hei\xdft'), (u'heilZ~', u'hei\xdft'), (u'heir$', u'hei\xdf'), (u'heisst', u'hei\xdft'), (u'Helllger', u'Heiliger'), (u'Helzlichen', u'Herzlichen'), (u"Hen'je", u'Herrje'), (u'herabstofien', u'herabsto\xdfen'), (u'heransttlrmtet', u'heranst\xfcrmtet'), (u'heraush\xe9ngendem', u'heraush\xe4ngendem'), (u'herhfiren', u'herh\xf6ren'), (u'herh\xe9ren', u'herh\xf6ren'), (u'heriiber', u'her\xfcber'), (u'HerrSchmidt', u'Herr Schmidt'), (u'herumf\xe9hrt', u'herumf\xe4hrt'), (u'herumkehren', u'herum kehren'), (u'herumlluft', u'heruml\xe4uft'), (u'herumzuwijhlen', u'herumzuw\xfchlen'), (u'Herzrhythmusst\xe9rungen', u'Herzrhythmusst\xf6rungen'), (u'Herzschlielierei', u'Herzschlie\xdferei'), (u'Herzstlllck', u'Herzst\xfcck'), (u'Heuta', u'Heute'), (u'Hexenhtltte', u'Hexenh\xfctte'), (u'HeY\xb7', u'Hey.'), (u'Hfibscheste', u'H\xfcbscheste'), (u'hfiherer', u'h\xf6herer'), (u'hfihsch', u'h\xfcbsch'), (u'Hfilfte', u'H\xe4fte'), (u'Hfille', u'H\xf6lle'), (u'hfilt', u'h\xe4lt'), (u'hfiltst', u'h\xe4ltst'), (u'Hfin', u'H\xf6rt'), (u'hfipft', u'h\xfcpft'), (u'Hfir', u'H\xf6r'), (u'hfiren', u'h\xf6ren'), (u'hfirst', u'h\xf6rst'), (u'hfirt', u'h\xf6rt'), (u'hfitte', u'h\xe4tte'), (u'hfitten', u'h\xe4tten'), (u'hie/3', u'hie\xdf'), (u'hieB', u'hie\xdf'), (u'hiefL', u'hie\xdf'), (u'hiel3', u'hie\xdf'), (u'hiells', u'hie\xdf'), (u'hierhergereist', u'hierher gereist'), (u'hierherzuriick', u'hierher zur\xfcck'), (u'hierijber', u'hier\xfcber'), (u'hierjede', u'hier jede'), (u'hierjeder', u'hier jeder'), (u'hierl', u'hier!'), (u'hierL', u'hie\xdf'), (u'hierwar', u'hier war'), (u'hierzum', u'hier-zum'), (u'hie\ufb02', u'hie\xdf'), (u'Hiibsch', u'H\xfcbsch'), (u'Hiibsche', u'H\xfcbsche'), (u'Hiibscher', u'H\xfcbscher'), (u'hiibschl', u'h\xfcbsch!'), (u'hiichst', u'h\xf6chst'), (u'hiichstens', u'h\xf6chstens'), (u'hiichster', u'h\xf6chster'), (u'hiichstpersiinlich', u'h\xf6chstpers\xf6nlich'), (u'Hiifen', u'H\xf6fen'), (u'hiifischen', u'h\xf6fischen'), (u'Hiifling', u'H\xf6fling'), (u'Hiigel', u'H\xfcgel'), (u'Hiihe', u'H\xf6he'), (u'Hiihepunkt', u'H\xf6hepunkt'), (u'hiiher', u'h\xf6her'), (u'hiihere', u'h\xf6here'), (u'Hiihlen', u'H\xf6hlen'), (u'Hiihnchen', u'H\xfchnchen'), (u'Hiihner', u'H\xfchner'), (u'Hiihnerkl\xe9fkchen', u'H\xfchnerkl\xf6\xdfchen'), (u'Hiilfte', u'H\xe4lfte'), (u'Hiille', u'H\xf6lle'), (u'Hiillenstreitmacht', u'H\xf6llenstreitmacht'), (u'hiillischen', u'h\xf6llischen'), (u'hiipfen', u'h\xfcpfen'), (u'Hiir', u'H\xf6r'), (u'hiire', u'h\xf6re'), (u'Hiiren', u'H\xf6ren'), (u'Hiirer', u'H\xf6rer'), (u'Hiiret', u'H\xf6ret'), (u'Hiirjetzt', u'H\xf6r jetzt'), (u'Hiirt', u'H\xf6rt'), (u'hiirte', u'h\xf6rte'), (u'hiirtest', u'h\xf6rtest'), (u'Hiissliches', u'H\xe4ssliches'), (u'Hiite', u'H\xfcte'), (u'Hiiten', u'H\xfcten'), (u'hiitet', u'h\xfctet'), (u'Hiitte', u'H\xe4tte'), (u'hiitten', u'h\xe4tten'), (u'Hiitten', u'H\xfctten'), (u'hijbsch', u'h\xfcbsch'), (u'hijbschen', u'h\xfcbschen'), (u'hijbsches', u'h\xfcbsches'), (u'Hijfte', u'H\xfcfte'), (u'Hijften', u'H\xfcften'), (u'Hijgel', u'H\xfcgel'), (u'Hijgels', u'H\xfcgels'), (u'Hijpfburgl', u'H\xfcpfburg!'), (u'hijpfe', u'h\xfcpfe'), (u'hijpfen', u'h\xfcpfen'), (u'hijre', u'h\xf6re'), (u'Hijren', u'H\xf6ren'), (u'Hijrer', u'H\xf6rer'), (u'hilbsch', u'h\xfcbsch'), (u'hilbsche', u'h\xfcbsche'), (u'hilbschen', u'h\xfcbschen'), (u'hilbscher', u'h\xfcbscher'), (u'Hilfel', u'Hilfe!'), (u'HILFSPERSONALI', u'HILFSPERSONAL:'), (u'Hilgel', u'H\xfcgel'), (u'hillig', u'billig'), (u'Hilt', u'H\xe4lt'), (u'hil\ufb02', u'hilft'), (u'Him', u'Hirn'), (u'Himmell', u'Himmel!'), (u'hineintr\xe9umen', u'hineintr\xe4umen'), (u'hinfijhrt', u'hinf\xfchrt'), (u'hingefiihrt', u'hingef\xfchrt'), (u'hingehdren', u'hingeh\xf6ren'), (u'hingehiiren', u'hingeh\xf6ren'), (u'hinilber', u'hin\xfcber'), (u'hinreiliend', u'hinrei\xdfend'), (u'hinschmeifit', u'hinschmei\xdft'), (u'HintenN\xe4ldler', u'Hinterw\xe4ldler'), (u'Hintergrundl\xe9rm', u'Hintergrundl\xe4rm'), (u'hinterhfiltig', u'hinterh\xe4ltig'), (u'hinterh\xe9iltiger', u'hinterh\xe4ltiger'), (u'Hinterh\xe9iltigl', u'Hinterh\xe4ltig!'), (u'hinterh\xe9ltige', u'hinterh\xe4ltige'), (u'hinterh\xe9ltiger', u'hinterh\xe4ltiger'), (u'Hinterk\xe9pfen', u'Hinterk\xf6pfen'), (u'hinterlieBe', u'hinterlie\xdfe'), (u'hinterl\xe9sst', u'hinterl\xe4sst'), (u'Hintersttlbchen', u'Hinterst\xfcbchen'), (u'Hintertur', u'Hintert\xfcr'), (u'hinwollen', u'hin wollen'), (u'hinzufuhren', u'hinzuf\xfchren'), (u'hinzuf\ufb02gten', u'hinzuf\xfcgten'), (u'Hirnrnel', u'Himmel'), (u'hirteste', u'h\xe4rteste'), (u'hisslich', u'h\xe4sslich'), (u'Hi\xe9tte', u'H\xe4tte'), (u'Hler', u'Her'), (u'hler', u'hier'), (u'hllf', u'hilf'), (u'hllibsch', u'h\xfcbsch'), (u'Hllindinnen', u'H\xfcndinnen'), (u'Hlllpf', u'H\xfcpf'), (u'hln', u'hin'), (u'Hlnbllck', u'Hinblick'), (u'hltte', u'h\xe4tte'), (u'Hltten', u'H\xe4tten'), (u'Hochfrequenzst\xe9rungenl', u'Hochfrequenzst\xf6rungen!'), (u'hochl', u'hoch!'), (u'Hochsicherheitsgef\xe9ngnis', u'Hochsicherheitsgef\xe4ngnis'), (u'Hochstens', u'H\xf6chstens'), (u'Hochzeitskostiime', u'Hochzeitskost\xfcme'), (u'Hohek', u'Hoheit'), (u'Hohepunkt', u'H\xf6hepunkt'), (u'hohere', u'h\xf6here'), (u'HoHo', u'Hoho'), (u'Holle', u'H\xf6lle'), (u'Holzsttlck', u'Holzst\xfcck'), (u'hor', u'h\xf6r'), (u'Horen', u'H\xf6ren'), (u'Hosenscheifker', u'Hosenschei\xdfer'), (u'Hosenscheiiker', u'Hosenschei\xdfer'), (u'Hosenschei\ufb02er', u'Hosenschei\xdfer'), (u'Hotelg\xe9ste', u'Hotelg\xe4ste'), (u'HQHE', u'H\xd6HE'), (u'htibscher', u'h\xfcbscher'), (u'Htihnchen', u'H\xfchnchen'), (u'Htipfen', u'H\xfcpfen'), (u'Htipfenl', u'H\xfcpfen!'), (u'htiren', u'h\xf6ren'), (u'hubsch', u'h\xfcbsch'), (u'hubsche', u'h\xfcbsche'), (u'hubschen', u'h\xfcbschen'), (u'Hubscher', u'H\xfcbscher'), (u'hubscheres', u'h\xfcbscheres'), (u'Hubsches', u'H\xfcbsches'), (u'Huhner', u'H\xfchner'), (u'humon/oll', u'humorvoll'), (u'Hundchen', u'H\xfcndchen'), (u'Hundebullel', u'Hundebulle!'), (u'Hunden\xe9pfe', u'Hunden\xe4pfe'), (u'Hundescheilie', u'Hundeschei\xdfe'), (u'Hundl', u'Hund!'), (u'HUNG', u'H\xfclle'), (u'hunte', u'bunte'), (u'Hurensiihne', u'Hurens\xf6hne'), (u'Hurensohnl', u'Hurensohn!'), (u'Huterin', u'H\xfcterin'), (u'HUtte', u'H\xfctte'), (u'Hypoglyk\xe9mie', u'Hypoglyk\xe4mie'), (u'h\xe9', u'h\xe4'), (u'H\xe9chste', u'H\xf6chste'), (u'h\xe9chsten', u'h\xf6chsten'), (u'H\xe9chstens', u'H\xf6chstens'), (u'H\xe9chstpers\xe9nlich', u'H\xf6chstpers\xf6nlich'), (u'H\xe9fen', u'H\xe4fen'), (u'h\xe9flich', u'h\xf6flich'), (u'H\xe9ftling', u'H\xe4ftling'), (u'H\xe9ftlinge', u'H\xe4ftlinge'), (u'H\xe9ftlingsr\xe9te', u'H\xe4ftlingsr\xe4te'), (u'H\xe9hef', u'H\xf6he!'), (u'H\xe9hepunkt', u'H\xf6hepunkt'), (u'h\xe9her', u'h\xf6her'), (u'h\xe9heren', u'h\xf6heren'), (u'H\xe9i', u'H\xe4'), (u'H\xe9ifen', u'H\xe4fen'), (u'H\xe9ilften', u'H\xe4lften'), (u'h\xe9iltst', u'h\xe4ltst'), (u'H\xe9inde', u'H\xe4nde'), (u'h\xe9ing', u'h\xe4ng'), (u'h\xe9ingen', u'h\xe4ngen'), (u'h\xe9ingt', u'h\xe4ngt'), (u'h\xe9ir', u'h\xf6r'), (u'h\xe9irter', u'h\xe4rter'), (u'h\xe9itt', u'h\xe4tt'), (u'H\xe9itte', u'H\xe4tte'), (u'h\xe9itten', u'h\xe4tten'), (u'h\xe9ittest', u'h\xe4ttest'), (u'h\xe9iufig', u'h\xe4ufig'), (u'H\xe9lfte', u'H\xe4lfte'), (u'H\xe9lle', u'H\xf6lle'), (u'H\xe9llen', u'H\xf6llen'), (u'H\xe9llenloch', u'H\xf6llenloch'), (u'h\xe9llisch', u'h\xf6llisch'), (u'h\xe9llische', u'h\xf6llische'), (u'h\xe9lt', u'h\xe4lt'), (u'H\xe9ltst', u'H\xe4ltst'), (u'h\xe9lzernes', u'h\xf6lzernes'), (u'h\xe9misch', u'h\xe4misch'), (u'H\xe9mmer', u'H\xe4mmer'), (u'h\xe9mmernde', u'h\xe4mmernde'), (u'H\xe9moglobin', u'H\xe4moglobin'), (u'H\xe9morrhoiden', u'H\xe4morrhoiden'), (u'H\xe9ndchen', u'H\xe4ndchen'), (u'H\xe9nde', u'H\xe4nde'), (u'H\xe9ndedruck', u'H\xe4ndedruck'), (u'H\xe9nden', u'H\xe4nden'), (u'H\xe9ndlerin', u'H\xe4ndlerin'), (u'h\xe9ng', u'h\xe4ng'), (u'h\xe9ngen', u'h\xe4ngen'), (u'h\xe9ngend', u'h\xe4ngend'), (u'h\xe9ngst', u'h\xe4ngst'), (u'h\xe9ngt', u'h\xe4ngt'), (u'H\xe9r', u'H\xf6r'), (u'h\xe9re', u'h\xf6re'), (u'h\xe9ren', u'h\xf6ren'), (u'H\xe9rgesch\xe9idigte', u'H\xf6rgesch\xe4digte'), (u'h\xe9rst', u'h\xf6rst'), (u'h\xe9rt', u'h\xf6rt'), (u'h\xe9rte', u'h\xf6rte'), (u'h\xe9rten', u'h\xf6rten'), (u'h\xe9rter', u'h\xe4rter'), (u'H\xe9rzu', u'H\xf6r zu'), (u'H\xe9schen', u'Haschen'), (u'h\xe9sslich', u'h\xe4sslich'), (u'h\xe9sslicher', u'h\xe4sslicher'), (u'h\xe9sslichl', u'h\xe4sslich'), (u'h\xe9sslichste', u'h\xe4sslichste'), (u'h\xe9tt', u'h\xe4tt'), (u'H\xe9tte', u'H\xe4tte'), (u'h\xe9tten', u'h\xe4tten'), (u"h\xe9tten's", u"h\xe4tten's"), (u'h\xe9ttest', u'h\xe4ttest'), (u'H\xe9ttet', u'H\xe4ttet'), (u'H\xe9ufi', u'H\xe4ufi'), (u'h\xe9ufig', u'h\xe4ufig'), (u'h\xe9ufiger', u'h\xe4ufiger'), (u'H\xe9ufigkeit', u'H\xe4ufigkeit'), (u'h\xe9ufigsten', u'h\xe4ufigsten'), (u'H\xe9user', u'H\xe4user'), (u'H\xe9usern', u'H\xe4usern'), (u'h\xe9ute', u'h\xe4ute'), (u'H\u20acY', u'Hey'), (u'H\ufb02geln', u'H\xfcgeln'), (u"i'\xa7ffne", u'\xd6ffne'), (u'I/egen', u'liegen'), (u'I5sst', u'l\xe4sst'), (u'I5stern', u'l\xe4stern'), (u'I6sen', u'l\xf6sen'), (u'Ia\xdf', u'lass'), (u'Ia\xdft', u'lasst'), (u'Icll', u'Ich'), (u'identifizieet', u'identifiziert'), (u'IDENTITAT', u'IDENTIT\xc4T'), (u'IE', u'I\xdf'), (u'Iebendigl', u'lebendig!'), (u'Iebenslinglich', u'lebensl\xe4glich'), (u'Iebtjetzt', u'lebt jetzt'), (u'Ieck', u'leck'), (u'Iehn', u'lehn'), (u'Ieid\u201a', u'leid\u201a'), (u'Ieinenlose', u'leinenlose'), (u'Ienistische', u'leninistische'), (u'Ietztendlich', u'letztendlich'), (u'Ifigt', u'l\xfcgt'), (u'Ihrdllirft', u'Ihr d\xfcrft'), (u'ihrja', u'ihr ja'), (u'ihrjemals', u'ihr jemals'), (u'ihrjetzt', u'ihr jetzt'), (u'ihrjeweiliges', u'ihr jeweiliges'), (u'ihrVater', u'ihr Vater'), (u'ihrvorstrafenregister', u'ihr Vorstrafenregister'), (u'ihrwahres', u'ihr wahres'), (u'Ihrwerdet', u'Ihr werdet'), (u'ihrzwei', u'ihr zwei'), (u'iibel', u'\xfcbel'), (u'iibemehmen', u'\xfcbernehmen'), (u'iiber', u'\xfcber'), (u'iiberall', u'\xfcberall'), (u'iiberallhin', u'\xfcberallhin'), (u'iiberdauern', u'\xfcberdauern'), (u'iiberdauerte', u'\xfcberdauerte'), (u'iibereinstimmte', u'\xfcbereinstimme'), (u'iiberfallen', u'\xfcberfallen'), (u'iiberfiel', u'\xfcberfiel'), (u'iibergeben', u'\xfcbergeben'), (u'iiberhaupt', u'\xfcberhaupt'), (u'iiberhiirt', u'\xfcberh\xf6rt'), (u'iiberholt', u'\xfcberholt'), (u'iiberholter', u'\xfcberholter'), (u'iiberkam', u'\xfcberkam'), (u'iiberlassen', u'\xfcberlassen'), (u'iiberleben', u'\xfcberleben'), (u'iiberlebt', u'\xfcberlebt'), (u'iiberlegen', u'\xfcberlegen'), (u'iiberlegten', u'\xfcberlegten'), (u'iibernahmen', u'\xfcbernahmen'), (u'iibernehme', u'\xfcbernehme'), (u'iibernehmen', u'\xfcbernehmen'), (u'iibernimmt', u'\xfcbernimmt'), (u'iibernommen', u'\xfcbernommen'), (u'iiberpriife', u'\xfcberpr\xfcfe'), (u'iiberpriifen', u'\xfcberpr\xfcfen'), (u'iiberpriift', u'\xfcberpr\xfcft'), (u'iiberpriiften', u'\xfcberpr\xfcften'), (u'iiberqueren', u'\xfcberqueren'), (u'iiberragen', u'\xfcberragen'), (u'iiberrascht', u'\xfcberrascht'), (u'iiberraschte', u'\xfcberraschte'), (u'iiberreden', u'\xfcberreden'), (u'iiberschritten', u'\xfcberschritten'), (u'iibersetzen', u'\xfcbersetzen'), (u'iibersetzt', u'\xfcbersetzt'), (u'iibersteigt', u'\xfcbersteigt'), (u'iibertragen', u'\xfcbertragen'), (u'iibertreffen', u'\xfcbertreffen'), (u'iibertreib', u'\xfcbertreib'), (u'iibertreiben', u'\xfcbertreiben'), (u'iibertrieben', u'\xfcbertrieben'), (u'iiberzeugen', u'\xfcberzeugen'), (u'iiberzeugt', u'\xfcberzeugt'), (u'iiblich', u'\xfcblich'), (u'iibliche', u'\xfcbliche'), (u'iibrig', u'\xfcbrig'), (u'IieB', u'lie\xdf'), (u'Iiebte', u'liebte'), (u"Iief's", u"lief's"), (u'Iiehe', u'liebe'), (u'Iie\ufb02est', u'lie\xdfest'), (u'iiffentlichen', u'\xf6ffentlichen'), (u'iiffentliches', u'\xf6ffentliches'), (u'iiffnest', u'\xf6ffnest'), (u'iifter', u'\xf6fter'), (u'iihnllchkelt', u'\xc4hnllchkelt'), (u'Iisst', u'l\xe4sst'), (u'ijbel', u'\xfcbel'), (u'ijben', u'\xfcben'), (u'ijberall', u'\xfcberall'), (u'ijberhaupt', u'\xfcberhaupt'), (u'ijberlegene', u'\xfcberlegene'), (u'ijbernehme', u'\xfcbernehme'), (u'ijbernimmst', u'\xfcbernimmst'), (u'ijberprijfen', u'\xfcberpr\xfcfen'), (u'ijberreden', u'\xfcberreden'), (u'ijbertrage', u'\xfcbertrage'), (u'ijberwunden', u'\xfcberwunden'), (u'ijberzeugen', u'\xfcberzeugen'), (u'ijberzogen', u'\xfcberzogen'), (u'Il6her', u'h\xf6her'), (u'IleiB', u'hei\xdf'), (u'Ill', u'III'), (u'Illfie', u'Wie'), (u'Ilrger', u'\xc4rger'), (u'Ilufierste', u'\xc4u\xdferste'), (u'immerja', u'immer ja'), (u'immerjung', u'immer jung'), (u'immerweinen', u'immer weinen'), (u'immerw\xe4hrende', u'immer w\xe4hrende'), (u'immerw\xe9hrende', u'immerw\xe4hrende'), (u'Improvisiation', u'Improvisation'), (u'Impulswellengeschutz', u'Impulswellengesch\xfctz'), (u'INBRUNSTIGE', u'INBR\xdcNSTIGE'), (u'instfindig', u'inst\xe4ndig'), (u'intramuskul\xe9r', u'intramuskul\xe4r'), (u'INVASIONSFLOTFE', u'INVASIONSFLOTTE'), (u'Iosgeliist', u'losgel\xf6st'), (u'Iosgel\xe9st', u'losgel\xf6st'), (u'Ioszuliisen', u'loszul\xf6sen'), (u'ip', u'in'), (u'irn', u'im'), (u'irrefuhren', u'irref\xfchren'), (u'irrefuhrende', u'irref\xfchrende'), (u'istja', u'ist ja'), (u'istjedoch', u'ist jedoch'), (u'istjemand', u'ist jemand'), (u'istjetzt', u'ist jetzt'), (u'istJohnny', u'ist Johnny'), (u'istjung', u'ist jung'), (u'istweg', u'ist weg'), (u'ITIUSSEFI', u'm\xfcssen'), (u'ITIUSSGI7', u'm\xfcssen'), (u'ITTITTRZ', u'Danke.'), (u'Ivl\xe9gliche', u'M\xf6gliche'), (u'I\xe9cheln', u'l\xe4cheln'), (u'I\xe9cherlich', u'l\xe4cherlich'), (u'I\xe9cherlichen', u'l\xe4cherlichen'), (u'I\xe9hmt', u'l\xe4hmt'), (u'I\xe9iuft', u'l\xe4uft'), (u'I\xe9nger', u'l\xe4nger'), (u'I\xe9sst', u'l\xe4sst'), (u'I\xe9sste', u'l\xe4sste'), (u'I\xe9uft', u'l\xe4uft'), (u'J0Shua', u'Joshua'), (u'Jackettkaufen', u'Jackett kaufen'), (u'jahr', u'Jahr'), (u'jahre', u'Jahre'), (u'jahren', u'Jahren'), (u'JAHRIGE', u'J\xc4HRIGE'), (u'jal', u'ja!'), (u'jemandenl', u'jemanden!'), (u'jetztl', u'jetzt!'), (u'jiidisch', u'j\xfcdisch'), (u'Jiingem', u'J\xfcngern'), (u'jiingerwar', u'j\xfcnger war'), (u'Jiingste', u'J\xfcngste'), (u'jilnger', u'j\xfcnger'), (u'Jlllngling', u'J\xfcngling'), (u'job', u'Job'), (u'Jogglng', u'Jogging'), (u'john', u'John'), (u'johnny', u'Johnny'), (u'journalisten', u'Journalisten'), (u'Jullo', u'Julie'), (u'JUNGFRAULICHE', u'JUNGFR\xc4ULICHE'), (u'jungfr\xe9uliche', u'jungfr\xe4uliche'), (u'jungfr\xe9ulichen', u'jungfr\xe4ulichen'), (u'jungfr\xe9ulicher', u'jungfr\xe4ulicher'), (u'Jungfr\xe9ulichkeit', u'Jungfr\xe4ulichkeit'), (u'Jungsl', u'Jungs!'), (u'Jungste', u'J\xfcngste'), (u'Jurlgs', u'Jungs'), (u'Justitzministeriums', u'Justizministeriums'), (u'J\xe9ger', u'J\xe4ger'), (u'J\xe9hrige', u'J\xe4hrige'), (u'j\xe9hrigen', u'j\xe4hrigen'), (u'j\xe9hriger', u'j\xe4hriger'), (u'j\xe9hrlich', u'j\xe4hrlich'), (u'J\xe9iger', u'J\xe4ger'), (u'j\xe9ihrigen', u'j\xe4hrigen'), (u'j\xe9mmerlich', u'j\xe4mmerlich'), (u"k'a'mpfen", u'k\xe4mpfen'), (u'K/no', u'Kino'), (u'K/Varte', u'Warte'), (u'K/Velle', u'Welle'), (u'K5NIGIN', u'K\xd6NIGIN'), (u'K6der', u'K\xf6der'), (u'K6ln', u'K\xf6ln'), (u'K6nig', u'K\xf6nig'), (u'K6nige', u'K\xf6nige'), (u'K6nigin', u'K\xf6nigin'), (u'k6nnen', u'k\xf6nnen'), (u"k6nnen's", u"k\xf6nnen's"), (u'k6nnest', u'k\xf6nntest'), (u'k6nnt', u'k\xf6nnt'), (u'K6nnte', u'K\xf6nnte'), (u"k6nnte's", u"k\xf6nnte's"), (u'k6nnten', u'k\xf6nnten'), (u'k6nntest', u'k\xf6nntest'), (u'K6pfe', u'K\xf6pfe'), (u'K6rper', u'K\xf6rper'), (u'K6rpers', u'K\xf6rpers'), (u'K6stlich', u'K\xf6stlich'), (u'Kabelm\xe9nner', u'Kabelm\xe4nner'), (u'kalf', u'kalt'), (u'kaltblijtig', u'kaltbl\xfctig'), (u'kampfen', u'k\xe4mpfen'), (u'Kampfj\xe9ger', u'Kampfj\xe4ger'), (u'Kanarienviigeln', u'Kanarienv\xf6geln'), (u"kann'sja", u"kann's ja"), (u'kannstja', u'kannst ja'), (u'Kan\xe9len', u'Kan\xe4len'), (u'Kapitan', u'Kapit\xe4n'), (u'Kapitln', u'Kapit\xe4n'), (u'Kapitlnen', u'Kapit\xe4nen'), (u'Kapitlns', u'Kapit\xe4ns'), (u'Kapit\xe9in', u'Kapit\xe4n'), (u'Kapit\xe9inleutnant', u'Kapit\xe4nleutnant'), (u'Kapit\xe9ins', u'Kapit\xe4ns'), (u'Kapit\xe9n', u'Kapit\xe4n'), (u'Kapit\xe9nleutnant', u'Kapit\xe4nleutnant'), (u'Kapit\xe9ns', u'Kapit\xe4ns'), (u"Kapt'n", u"K\xe4pt'n"), (u'kaputthaust', u'kaputt haust'), (u'Kartoffelsch\xe9len', u'Kartoffelsch\xe4len'), (u'Kassettenger\xe9it', u'Kassettenger\xe4t'), (u'kbnnen', u'k\xf6nnen'), (u'kbnnten', u'k\xf6nnten'), (u'kdnnen', u'k\xf6nnen'), (u'kdnnfe', u'k\xf6nnte'), (u'kdnnte', u'k\xf6nnte'), (u'ke/ne', u'keine'), (u'Kefn', u'Kein'), (u'Keh/1', u'Kehrt'), (u'Keithl', u'Keith!'), (u'keln', u'kein'), (u'kelne', u'keine'), (u'Keri', u'Kerl'), (u'kfime', u'k\xe4me'), (u'Kfimmer', u'K\xfcmmer'), (u'kfimmere', u'k\xfcmmere'), (u'kfimmern', u'k\xfcmmern'), (u'kfimmert', u'k\xfcmmert'), (u'kfimpft', u'k\xe4mpft'), (u'kfimpften', u'k\xe4mpften'), (u'Kfinig', u'K\xf6nig'), (u'Kfinnen', u'K\xf6nnen'), (u'kfinnte', u'k\xf6nnte'), (u'Kfinnten', u'K\xf6nnten'), (u'Kfinntest', u'K\xf6nntest'), (u'Kfiss', u'K\xfcss'), (u'Kfisschen', u'K\xfcsschen'), (u'Kfissen', u'K\xfcssen'), (u'Kfjnnte', u'K\xf6nnte'), (u'Khnlichkeit', u'\xc4hnlichkeit'), (u'KIar', u'Klar'), (u'Kifig', u'K\xe4fig'), (u'Kiiche', u'K\xfcche'), (u'Kiichenhelfer', u'K\xfcchenhelfer'), (u'Kiichln', u'K\xf6chin'), (u'Kiihe', u'K\xfche'), (u'Kiihlbox', u'K\xfchlbox'), (u'kiihler', u'k\xfchler'), (u'Kiihlschrank', u'K\xfchlschrank'), (u'kiimmem', u'k\xfcmmern'), (u'kiimmer', u'k\xfcmmer'), (u'kiimmere', u'k\xfcmmere'), (u'Kiimmern', u'K\xfcmmern'), (u'kiindigen', u'k\xfcndigen'), (u'Kiinig', u'K\xf6nig'), (u'Kiinige', u'K\xf6nige'), (u'Kiinigen', u'K\xf6nigen'), (u'Kiinigin', u'K\xf6nigin'), (u'Kiiniginnen', u'K\xf6niginnen'), (u'kiinigliche', u'k\xf6nigliche'), (u'kiiniglichen', u'k\xf6niglichen'), (u'kiiniglicher', u'k\xf6niglicher'), (u'Kiinigreichs', u'K\xf6nigreichs'), (u'Kiinigs', u'K\xf6nigs'), (u'Kiinigtum', u'K\xf6nigtum'), (u'kiinne', u'k\xf6nne'), (u'kiinnen', u'k\xf6nnen'), (u'kiinnt', u'k\xf6nnt'), (u'Kiinnte', u'K\xf6nnte'), (u'kiinnten', u'k\xf6nnten'), (u'kiinntest', u'k\xf6nntest'), (u'kiinntet', u'k\xf6nntet'), (u'Kiinstler', u'K\xfcnstler'), (u'kiinstlerischen', u'k\xfcnstlerischen'), (u'kiipfen', u'k\xf6pfen'), (u'Kiirper', u'K\xf6rper'), (u'Kiirperfunktionen', u'K\xf6rperfunktionen'), (u'Kiirperhaltung', u'K\xf6rperhaltung'), (u'kiirperliche', u'k\xf6rperliche'), (u'Kiirperliches', u'K\xf6rperliches'), (u'Kiirpersprache', u'K\xf6rpersprache'), (u'Kiirperverletzung', u'K\xf6rperverletzung'), (u'kiirzen', u'k\xfcrzen'), (u'kiirzerzutreten', u'k\xfcrzerzutreten'), (u'kiirzeste', u'k\xfcrzeste'), (u'Kiisschen', u'K\xfcsschen'), (u'Kiissen', u'K\xfcssen'), (u'Kiisst', u'K\xfcsst'), (u'Kiiste', u'K\xfcste'), (u'kiistlich', u'k\xf6stlich'), (u'Kijche', u'K\xfcche'), (u'Kijhlschrank', u'K\xfchlschrank'), (u'Kijmmere', u'K\xfcmmere'), (u'kijmmern', u'k\xfcmmern'), (u'kijmmernl', u'k\xfcmmern!'), (u'kijmmerst', u'k\xfcmmerst'), (u'kijmmerten', u'k\xfcmmerten'), (u'kijndigt', u'k\xfcndigt'), (u'kijnnen', u'k\xf6nnen'), (u'kijnnt', u'k\xf6nnt'), (u'kijnnte', u'k\xf6nnte'), (u'kijnnten', u'k\xf6nnten'), (u'Kijnstler', u'K\xfcnstler'), (u'Kijrbis', u'K\xfcrbis'), (u'kijrzlich', u'k\xfcrzlich'), (u'kijrzliche', u'k\xfcrzliche'), (u'Kijrzungen', u'K\xfcrzungen'), (u'kijsst', u'k\xfcsst'), (u'Kijste', u'K\xfcste'), (u'Kilche', u'K\xfcche'), (u'Kilchlein', u'K\xfcchlein'), (u'kilhlen', u'k\xfchlen'), (u'kilhler', u'k\xfchler'), (u'Kilhlkreislauf', u'K\xfchlkreislauf'), (u'Kilhlschrank', u'K\xfchlschrank'), (u'Kilmmern', u'K\xfcmmern'), (u'Kilmmert', u'K\xfcmmert'), (u'kilndigen', u'k\xfcndigen'), (u'kilnstliche', u'k\xfcnstliche'), (u'kilss', u'k\xfcss'), (u'kilsse', u'k\xfcsse'), (u'kilssen', u'k\xfcssen'), (u'Kinderm\xe9dchen', u'Kinderm\xe4dchen'), (u'Kinderspiell', u'Kinderspiel!'), (u'Kindsk\xe9pfe', u'Kindsk\xf6pfe'), (u'kiokflip', u'kickflip'), (u'KIotz', u'Klotz'), (u"KL'lr", u'K\xfcr'), (u"KL'lste", u'K\xfcste'), (u'Klapsmiihle', u'Klapsm\xfchle'), (u'Klassem\xe9dchen', u'Klassem\xe4dchen'), (u'kle/ne', u'kleine'), (u'Kleidergr6Be', u'Kleidergr\xf6\xdfe'), (u'Kleidergrfilie', u'Kleidergr\xf6\xdfe'), (u'Kleinerl', u'Kleiner!'), (u'kleinwiichsige', u'kleinw\xfcchsige'), (u'kleinwilchsiges', u'kleinw\xfcchsiges'), (u'klijger', u'kl\xfcger'), (u'klijgsten', u'kl\xfcgsten'), (u'klilger', u'kl\xfcger'), (u"kLinft'gen", u"k\xfcnft'gen"), (u'klirst', u'kl\xe4rst'), (u'kljmmere', u'k\xfcmmere'), (u'Kllirze', u'K\xfcrze'), (u'kllissen', u'k\xfcssen'), (u'Klliste', u'K\xfcste'), (u'Klllche', u'K\xfcche'), (u'klllhnsten', u'k\xfchnsten'), (u'kllllger', u'kl\xfcger'), (u'Klobtlrsten', u'Klob\xfcrsten'), (u'klop\ufb02l', u'klopft!'), (u"Klpt'n", u"K\xe4pt'n"), (u"Klpt'nl", u"K\xe4pt'n!"), (u"Klpt'ns", u"K\xe4pt'ns"), (u'Klse', u'K\xe4se'), (u'Klseschnuffelei', u'K\xe4seschn\xfcffelei'), (u'Kltigste', u'Kl\xfcgste'), (u'Klugschei\ufb02er', u'Klugschei\xdfer'), (u'kl\xe9ffen', u'kl\xe4ffen'), (u'Kl\xe9iren', u'Kl\xe4ren'), (u'Kl\xe9ranlage', u'Kl\xe4ranlage'), (u'Kl\xe9re', u'Kl\xe4re'), (u'kl\xe9ren', u'kl\xe4ren'), (u'Kn6pf', u'Kn\xf6pf'), (u'Knallttite', u'Knallt\xfcte'), (u'Knastwill', u'Knast will'), (u'Knderung', u'\xc4nderung'), (u'Knochengrfinde', u'Knochengr\xfcnde'), (u'Knofen', u'Knoten'), (u'Knuller', u'Kn\xfcller'), (u'Knupf', u'Kn\xfcpf'), (u'Knupfe', u'Kn\xfcpfe'), (u'knupfen', u'kn\xfcpfen'), (u'knzjipfe', u'kn\xfcpfe'), (u'Kn\xe9dell', u'Kn\xf6del!'), (u'kn\xe9pf', u'kn\xf6pf'), (u'Kn\xe9pfe', u'Kn\xf6pfe'), (u'Kn\xe9sten', u'Kn\xe4sten'), (u'Kofferraumschliissel', u'Kofferraumschl\xfcssel'), (u'Kohlens\xe9ure', u'Kohlens\xe4ure'), (u'Komaf\xe9lle', u'Komaf\xe4lle'), (u'Komaf\xe9llen', u'Komaf\xe4llen'), (u'Kombiise', u'Komb\xfcse'), (u'Kombuse', u'Komb\xfcse'), (u'Komiidie', u'Kom\xf6die'), (u'kommerz/ellen', u'kommerziellen'), (u'kommjetzt', u'komm jetzt'), (u'Kompatibilitfits', u'Kompatibilit\xe4ts'), (u'Kompatibilit\xe9its', u'Kompatibilit\xe4ts'), (u'Kompatiblit5ts', u'Kompatiblit\xe4ts'), (u'Kom\xe9die', u'Kom\xf6die'), (u'KONIGIN', u'K\xd6NIGIN'), (u'konne', u'k\xf6nne'), (u'konnen', u'k\xf6nnen'), (u'konnt', u'k\xf6nnt'), (u'konsen/ativ', u'konservativ'), (u'Kopfabreifimann', u'Kopfabrei\xdfmann'), (u'Kopfgeldj\xe9ger', u'Kopfgeldj\xe4ger'), (u'Kopfgeldj\xe9gern', u'Kopfgeldj\xe4gern'), (u'Kopfm\xe9fiig', u'Kopfm\xe4\xdfig'), (u'Kopfnijsse', u'Kopfn\xfcsse'), (u'kostengtlnstige', u'kosteng\xfcnstige'), (u'Kostiim', u'Kost\xfcm'), (u'Kostiimdesigner', u'Kost\xfcmdesigner'), (u'Kostiimdesignerin', u'Kost\xfcmdesignerin'), (u'Kostiimdrama', u'Kost\xfcmdrama'), (u'Kostiime', u'Kost\xfcme'), (u'Kostiims', u'Kost\xfcms'), (u'Kostume', u'Kost\xfcme'), (u'Kost\ufb02m', u'Kost\xfcm'), (u'kr/egen', u'kriegen'), (u'kr6ne', u'kr\xf6ne'), (u'kr6nen', u'kr\xf6nen'), (u'Kr6ten', u'Kr\xf6ten'), (u'Krafte', u'Kr\xe4fte'), (u'Kraftwfirfel', u'Kraftw\xfcrfel'), (u'Kranf\ufb02hrer', u'Kranf\xfchrer'), (u'Kreativit\xe9t', u'Kreativit\xe4t'), (u'Kreuzverhor', u'Kreuzverh\xf6r'), (u'krfiftiger', u'kr\xe4ftiger'), (u'Krfiutertee', u'Kr\xe4utertee'), (u'Kriegserkl\xe9rungen', u'Kriegserkl\xe4rungen'), (u'Kriegsfuhrung', u'Kriegsf\xfchrung'), (u'Kriegsschauplatze', u'Kriegsschaupl\xe4tze'), (u'Kriifte', u'Kr\xe4fte'), (u'Kriinung', u'Kr\xf6nung'), (u'Kriinungsfeier', u'Kr\xf6nungsfeier'), (u'Krijppel', u'Kr\xfcppel'), (u'Krijte', u'Kr\xf6te'), (u'Kronjuwell', u'Kronjuwel!'), (u'KROTE', u'KR\xd6TE'), (u'Krsche', u'\xc4rsche'), (u'Kr\xe9fte', u'Kr\xe4fte'), (u'Kr\xe9ften', u'Kr\xe4ften'), (u'Kr\xe9ftigsten', u'Kr\xe4ftigsten'), (u'Kr\xe9he', u'Kr\xe4he'), (u'kr\xe9ht', u'kr\xe4ht'), (u'kr\xe9ichzt', u'kr\xe4chzt'), (u'Kr\xe9ifte', u'Kr\xe4fte'), (u'Kr\xe9iutertee', u'Kr\xe4utertee'), (u'Kr\xe9mpfe', u'Kr\xe4mpfe'), (u'kr\xe9nte', u'kr\xf6nte'), (u'Kr\xe9te', u'Kr\xf6te'), (u'Kr\xe9tes', u'Kr\xf6tes'), (u'Kr\xe9utern', u'Kr\xe4utern'), (u'Kr\xe9utersenf', u'Kr\xe4utersenf'), (u'Ktiche', u'K\xfcche'), (u'Ktinige', u'K\xf6nige'), (u'ktinntest', u'k\xf6nntest'), (u'Ktisschen', u'K\xfcsschen'), (u'ktlmmere', u'k\xfcmmere'), (u'ktznnen', u'k\xf6nnen'), (u'Kuche', u'K\xfcche'), (u'KUCHE', u'K\xdcCHE'), (u'Kuckucksger\xe9usch', u'Kuckucksger\xe4usch'), (u"KUl'ZSCl'1lUSS9", u'K\xfcrzschl\xfcsse'), (u'kulz', u'kurz'), (u'kummer', u'k\xfcmmer'), (u'Kummere', u'K\xfcmmere'), (u'kummern', u'k\xfcmmern'), (u'kummert', u'k\xfcmmert'), (u'Kumpell', u'Kumpel!'), (u'Kunststficke', u'Kunstst\xfccke'), (u'Kunststticke', u'Kunstst\xfccke'), (u'Kuriosit\xe9ten', u'Kuriosit\xe4ten'), (u'kurzeste', u'k\xfcrzeste'), (u'kurzte', u'k\xfcrzte'), (u'Kurzwellenfunkger\xe9te', u'Kurzwellenfunkger\xe4te'), (u'Kurzzeitgediichtnis', u'Kurzzeitged\xe4chtnis'), (u'Kurzzeitged\xe9chtnis', u'Kurzzeitged\xe4chtnis'), (u'KUS1I\u20ac', u'K\xfcste'), (u'Kuschelhengstl', u'Kuschelhengst!'), (u'KUSSE', u'K\xdcSSE'), (u'KUSSGH', u'k\xfcssen'), (u'kusste', u'k\xfcsste'), (u'KUSTE', u'K\xdcSTE'), (u'Kuste', u'K\xfcste'), (u'K\xe9fer', u'K\xe4fer'), (u'K\xe9fig', u'K\xe4fig'), (u'k\xe9ime', u'k\xe4me'), (u'k\xe9impfen', u'k\xe4mpfen'), (u'k\xe9impfend', u'k\xe4mpfend'), (u'k\xe9impft', u'k\xe4mpft'), (u'k\xe9impfte', u'k\xe4mpfte'), (u'k\xe9impften', u'k\xe4mpften'), (u'k\xe9impftest', u'k\xe4mpftest'), (u'k\xe9impfwie', u'k\xe4mpf wie'), (u'K\xe9inguru', u'K\xe4nguru'), (u'k\xe9innen', u'k\xf6nnen'), (u'k\xe9innte', u'k\xf6nnte'), (u'K\xe9irper', u'K\xf6rper'), (u'K\xe9ise', u'K\xe4se'), (u'K\xe9isebrunnen', u'K\xe4sebrunnen'), (u'K\xe9lte', u'K\xe4lte'), (u'k\xe9lter', u'k\xe4lter'), (u'k\xe9lteste', u'k\xe4lteste'), (u'k\xe9me', u'k\xe4me'), (u'k\xe9men', u'k\xe4men'), (u'k\xe9mpfe', u'k\xe4mpfe'), (u'K\xe9mpfen', u'K\xe4mpfen'), (u'K\xe9mpfer', u'K\xe4mpfer'), (u'k\xe9mpferische', u'k\xe4mpferische'), (u'k\xe9mpfst', u'k\xe4mpfst'), (u'k\xe9mpft', u'k\xe4mpft'), (u'k\xe9mpfte', u'k\xe4mpfte'), (u'k\xe9mpften', u'k\xe4mpften'), (u'k\xe9mt', u'k\xe4mt'), (u'K\xe9nig', u'K\xf6nig'), (u'K\xe9nige', u'K\xf6nige'), (u'K\xe9nigin', u'K\xf6nigin'), (u'K\xe9niginl', u'K\xf6nigin!'), (u'K\xe9niginnen', u'K\xf6niginnen'), (u'k\xe9niglich', u'k\xf6niglich'), (u'k\xe9nigliche', u'k\xf6nigliche'), (u'k\xe9niglichen', u'k\xf6niglichen'), (u'k\xe9nigliches', u'k\xf6nigliches'), (u'K\xe9nigreich', u'K\xf6nigreich'), (u'K\xe9nigreichs', u'K\xf6nigreichs'), (u'K\xe9nigs', u'K\xf6nigs'), (u'K\xe9nigsfamilie', u'K\xf6nigsfamilie'), (u'k\xe9nne', u'k\xf6nne'), (u'k\xe9nnen', u'k\xf6nnen'), (u'k\xe9nnt', u'k\xf6nnt'), (u'k\xe9nnte', u'k\xf6nnte'), (u'K\xe9nnten', u'K\xf6nnten'), (u'K\xe9nntest', u'K\xf6nntest'), (u'K\xe9nntet', u'K\xf6nntet'), (u'K\xe9pfchen', u'K\xf6pfchen'), (u'K\xe9pfe', u'K\xf6pfe'), (u'K\xe9pfen', u'K\xf6pfen'), (u'k\xe9pft', u'k\xf6pft'), (u"K\xe9pt'n", u"K\xe4pt'n"), (u'K\xe9rbchen', u'K\xf6rbchen'), (u'K\xe9rbchengr\xe9fie', u'K\xf6rbchengr\xf6\xdfe'), (u'K\xe9rben', u'K\xf6rben'), (u'K\xe9rper', u'K\xf6rper'), (u'K\xe9rperfunktionen', u'K\xf6rperfunktionen'), (u'k\xe9rperlich', u'k\xf6rperlich'), (u'k\xe9rperliche', u'k\xf6rperliche'), (u'K\xe9rperproportionen', u'K\xf6rperproportionen'), (u'K\xe9rpersprache', u'K\xf6rpersprache'), (u'K\xe9rpertyp', u'K\xf6rpertyp'), (u'K\xe9rperverletzung', u'K\xf6rperverletzung'), (u'K\xe9rper\xe9ffnungen', u'K\xf6rper\xf6ffnungen'), (u'K\xe9se', u'K\xe4se'), (u'K\xe9sebrett', u'K\xe4sebrett'), (u'K\xe9secracker', u'K\xe4secracker'), (u'k\xe9stlich', u'k\xf6stlich'), (u'K\xe9ter', u'K\xf6ter'), (u'K\xe9tern', u'K\xf6tern'), (u'K\ufb02mmere', u'K\xfcmmere'), (u'k\ufb02mmern', u'k\xfcmmern'), (u"L'a'cherlich", u'L\xe4cherlich'), (u"L'a'ndern", u'L\xe4ndern'), (u"l'a'sst", u'l\xe4sst'), (u"l'a'uft", u'l\xe4uft'), (u'l/chtes', u'lichtes'), (u'l/Vings', u'Wings'), (u'L5cheln', u'L\xe4cheln'), (u'L6ffel', u'L\xf6ffel'), (u'L6schen', u'L\xf6schen'), (u'L6se', u'L\xf6se'), (u'l6sen', u'l\xf6sen'), (u'L6wen', u'L\xf6wen'), (u'L6win', u'L\xf6win'), (u'LADIESMANZ17', u'LADIESMAN217'), (u'Landh\xe9user', u'Landh\xe4user'), (u'Landstra\ufb02e', u'Landstra\xdfe'), (u'Lands\xe9iugetier', u'Lands\xe4ugetier'), (u'langl', u'lang!'), (u'langweiligl', u'langweilig!'), (u'Lasergestutzte', u'Lasergest\xfctzte'), (u'Laserzielger\xe9t', u'Laserzielger\xe4t'), (u'Lattenzaunwei\ufb02', u'Lattenzaunwei\xdf'), (u'Laudal', u'Lauda!'), (u'laufl', u'lauf!'), (u'Lau\ufb02', u'Lauf!'), (u'La\xdf', u'Lass'), (u'lch', u'Ich'), (u'ldee', u'Idee'), (u'ldeen', u'Ideen'), (u'ldelia', u'Idelia'), (u'ldentifikation', u'Identifikation'), (u'ldentifikationsnummer', u'Identifikationsnummer'), (u'ldentifikationssignal', u'Identifikationssignal'), (u'ldentifizierung', u'Identifizierung'), (u"ldentit'a'tsscheibe", u'ldentit\xe4tsscheibe'), (u'ldioten', u'Idioten'), (u'ldloten', u'Idioten'), (u'Le/d', u'Leid'), (u'Lebenl', u'Leben!'), (u'lebensf\xe9hig', u'lebensf\xe4hig'), (u'lebensl\xe9nglich', u'lebensl\xe4nglich'), (u'lebensmijlde', u'lebensm\xfcde'), (u'Lebersch\xe9den', u'Lebersch\xe4den'), (u'leergegessen', u'leer gegessen'), (u'legend\xe9re', u'legend\xe4re'), (u'legend\xe9ren', u'legend\xe4ren'), (u'Legion\xe9r', u'Legion\xe4r'), (u'Legion\xe9re', u'Legion\xe4re'), (u'Lehe', u'Lebe'), (u'Leichensch\xe9ndung', u'Leichensch\xe4ndung'), (u'leichtjemanden', u'leicht jemanden'), (u'leidl', u'leid!'), (u'Leistuljg', u'Leistung'), (u'Lelbwfichter', u'Leibw\xe4chter'), (u'Leld', u'Leid'), (u'lemen', u'lernen'), (u'Lenks\xe9ule', u'Lenks\xe4ule'), (u'lfidt', u'l\xe4dt'), (u'lfigt', u'l\xfcgt'), (u'lfinger', u'l\xe4nger'), (u'lfiuft', u'l\xe4uft'), (u'Lfiuterung', u'L\xe4uterung'), (u'lgitt', u'Igitt'), (u'lgnorier', u'Ignorier'), (u'lhm', u'Ihm'), (u'lhn', u'Ihn'), (u'lhnen', u'Ihnen'), (u'lhnenl', u'Ihnen!'), (u'lhr', u'Ihr'), (u'lhre', u'Ihre'), (u'lhrem', u'Ihrem'), (u'lhren', u'Ihren'), (u'lhrer', u'Ihrer'), (u'lhrerverffigung', u'Ihrer Verf\xfcgung'), (u'lhres', u'Ihres'), (u'lhrfehlt', u'Ihr fehlt'), (u'lhrjemalsjemanden', u'lhr jemals jemanden'), (u'lhrVerteidiger', u'lhr Verteidiger'), (u'Libel', u'\xfcbel'), (u'Libelwollen', u'\xfcbelwollen'), (u'Liben', u'\xfcben'), (u'Liber', u'\xfcber'), (u'Liberall', u'\xfcberall'), (u'Liberdenken', u'\xfcberdenken'), (u'Liberdrllissig', u'\xfcberdr\xfcssig'), (u'Liberfallen', u'\xfcberfallen'), (u'Libergebrannt', u'\xfcbergebrannt'), (u'Liberhaupt', u'\xfcberhaupt'), (u'Liberlasst', u'\xfcberlasst'), (u'Liberleben', u'\xdcberleben'), (u'Liberlegen', u'\xfcberlegen'), (u'Liberlegt', u'\xfcberlegt'), (u'Libernimmt', u'\xfcbernimmt'), (u'Liberpriift', u'\xfcberpr\xfcft'), (u'Liberreden', u'\xfcberreden'), (u'Libersteht', u'\xfcbersteht'), (u'Liberstllirzen', u'\xfcberst\xfcrzen'), (u'Liberwachen', u'\xfcberwachen'), (u'Liberwacht', u'\xfcberwacht'), (u'Liberwinden', u'\xfcberwinden'), (u'Liberw\xe9ltigen', u'\xfcberw\xe4ltigen'), (u'Liberw\xe9ltigt', u'\xfcberw\xe4ltigt'), (u'Liberzeugt', u'\xfcberzeugt'), (u'Lible', u'\xfcble'), (u'Liblich', u'\xfcblich'), (u'Libliche', u'\xdcbliche'), (u'Librig', u'\xfcbrig'), (u'lie/3', u'lie\xdf'), (u'lie/Se', u'lie\xdfe'), (u'lieB', u'lie\xdf'), (u'lieBe', u'lie\xdfe'), (u'liebenswilrdig', u'liebensw\xfcrdig'), (u'liebenswurdiger', u'liebensw\xfcrdiger'), (u'Liebesgestiindnis', u'Liebesgest\xe4ndnis'), (u'Lieblingsbesch\xe9ftigung', u'Lieblingsbesch\xe4ftigung'), (u'Lieblingsrockerl', u'Lieblingsrocker!'), (u'Lieblingss\xe9tze', u'Lieblingss\xe4tze'), (u'lief2>en', u'lie\xdfen'), (u'Liefergebiihren', u'Liefergeb\xfchren'), (u'lieflsen', u'lie\xdfen'), (u'liegenlassen', u'liegen lassen'), (u'Liehe', u'Liebe'), (u'lieli', u'lie\xdf'), (u'lielien', u'lie\xdfen'), (u'Liellen', u'Lie\xdfen'), (u'liells', u'lie\xdf'), (u'lien', u'lie\xdf'), (u'Liicher', u'L\xf6cher'), (u'Liige', u'L\xfcge'), (u'Liigner', u'L\xfcgner'), (u'liinger', u'l\xe4nger'), (u'liischen', u'l\xf6schen'), (u'liischt', u'l\xf6scht'), (u'Liisst', u'L\xe4sst'), (u'liist', u'l\xf6st'), (u'Liisung', u'L\xf6sung'), (u'Liisungen', u'L\xf6sungen'), (u'Liiwen', u'L\xf6wen'), (u'Lii\ufb02ung', u'L\xfcftung'), (u'lijgen', u'l\xfcgen'), (u'Lijgner', u'L\xfcgner'), (u'Lilgner', u'L\xfcgner'), (u'lilgst', u'l\xfcgst'), (u'lilgt', u'l\xfcgt'), (u'Lilterer', u'\xc4lterer'), (u'LIMOUSINENSERVICE10I06', u'LIMOUSINENSERVICE 10:06'), (u'linger', u'l\xe4nger'), (u"lke's", u"Ike's"), (u'lkone', u'Ikone'), (u"lL'lgt", u'l\xfcgt'), (u'Llberstehen', u'\xfcberstehen'), (u'Llebe', u'Liebe'), (u'llebt', u'liebt'), (u'lllfie', u'Wie'), (u'lllfillensstark', u'Willensstark'), (u"lllfillie's", u"Willie's"), (u'lllfir', u'Wir'), (u'Lllignerl', u'L\xfcgner!'), (u'llligtl', u'l\xfcgt!'), (u'lllusionen', u'Illusionen'), (u'llngst', u'l\xe4ngst'), (u'llztlicher', u'\xe4rztlicher'), (u'lm', u'Im'), (u'lmbiss', u'Imbiss'), (u'lmmer', u'Immer'), (u'lmmigranten', u'Immigranten'), (u'lmpuls', u'Impuls'), (u'lmpulsantrieb', u'Impulsantrieb'), (u'lndianer', u'Indianer'), (u'lndianerin', u'Indianerin'), (u'lndianerm\xe9dchen', u'Indianerm\xe4dchen'), (u'lndianertanz', u'Indianertanz'), (u'lndikation', u'Indikation'), (u'lndividualit\xe9t', u'Individualit\xe4t'), (u'lndividuen', u'Individuen'), (u'lndividuum', u'Individuum'), (u'lnduktion', u'Induktion'), (u'lneffizienz', u'Ineffizienz'), (u'lnformationen', u'Informationen'), (u'lnfos', u'Infos'), (u'lngenieur', u'Ingenieur'), (u'lngenieure', u'Ingenieure'), (u'lnhalt', u'Inhalt'), (u'lnhalte', u'Inhalte'), (u'lnnenraum', u'Innenraum'), (u'lnnenr\xe9ume', u'Innenr\xe4ume'), (u'lnsekt', u'Insekt'), (u'lnsekten', u'Insekten'), (u'lnsel', u'Insel'), (u'lnserat', u'Inserat'), (u'lnspektion', u'Inspektion'), (u'lnstinkt', u'Instinkt'), (u'lnstinkte', u'Instinkte'), (u'lnstitut', u'Institut'), (u'lnstrumente', u'Instrumente'), (u'lnstrumentenwagen', u'Instrumentenwagen'), (u'lnsubordination', u'Insubordination'), (u'lntellektuellste', u'Intellektuellste'), (u'lntelligenz', u'Intelligenz'), (u'lntensivstation', u'Intensivstation'), (u'lnteraktion', u'Interaktion'), (u'lnteresse', u'Interesse'), (u'lnteressen', u'Interessen'), (u'lnternat', u'Internat'), (u'lntrigantin', u'Intrigantin'), (u'lntrigantl', u'Intrigant!'), (u'lntrigen', u'Intrigen'), (u'lnverness', u'Inverness'), (u'lnvestition', u'Investition'), (u'lnvestoren', u'Investoren'), (u'lnzucht', u'Inzucht'), (u'lo', u'Io'), (u'Lordk\xe9mmerer', u'Lordk\xe4mmerer'), (u'losf', u'los!'), (u'losl', u'los!'), (u'losw\ufb02rde', u'losw\xfcrde'), (u'Lou/e', u'Louie'), (u'Loyalit\xe9t', u'Loyalit\xe4t'), (u'lrak', u'Irak'), (u'lraner', u'Iraner'), (u'lren', u'Iren'), (u'Lrgendetvvas', u'Irgendetwas'), (u'lrland', u'Irland'), (u'lronhide', u'Ironhide'), (u'lronie', u'Ironie'), (u'lrre', u'Irre'), (u'lrren', u'Irren'), (u'lrrenanstalt', u'Irrenanstalt'), (u'lrrenhaus', u'Irrenhaus'), (u'lrrer', u'Irrer'), (u'lrrgarten', u'Irrgarten'), (u'lrrlicht', u'Irrlicht'), (u'lrrlichter', u'Irrlichter'), (u'lrrsinn', u'Irrsinn'), (u'lrrsinns', u'Irrsinns'), (u'lrrtum', u'Irrtum'), (u'lscandar', u'Iscandar'), (u'lscandars', u'Iscandars'), (u'lsolierband', u'Isolierband'), (u'lss', u'Iss'), (u'lstja', u'Ist ja'), (u'ltaker', u'Itaker'), (u'ltakerflossen', u'Itakerflossen'), (u'ltalo', u'Italo'), (u'Ltiffel', u'L\xf6ffel'), (u'ltlgen', u'l\xfcgen'), (u'Lufijagen', u'Luft jagen'), (u'Luftballonsl', u'Luftballons!'), (u'Luftjagen', u'Luft jagen'), (u'Luftunterst\ufb02tzung', u'Luftunterst\xfctzung'), (u'LUgen', u'L\xfcgen'), (u'lvl\xe9idchen', u'M\xe4dchen'), (u'lwan', u'Iwan'), (u"l\xa7uft's", u"l\xe4uft's"), (u'L\xe9chelmfinderl', u'L\xe4chelm\xfcnder!'), (u'l\xe9cheln', u'l\xe4cheln'), (u'l\xe9chelt', u'l\xe4chelt'), (u'L\xe9cher', u'L\xf6cher'), (u'L\xe9cherlich', u'L\xe4cherlich'), (u'l\xe9cherliches', u'l\xe4cherliches'), (u'L\xe9chle', u'L\xe4chle'), (u'l\xe9dt', u'l\xe4dt'), (u'L\xe9ffel', u'L\xf6ffel'), (u'l\xe9ge', u'l\xe4ge'), (u'L\xe9icheln', u'L\xe4cheln'), (u'L\xe9icherlich', u'L\xe4cherlich'), (u'l\xe9ichle', u'l\xe4chle'), (u'L\xe9indchen', u'L\xe4ndchen'), (u'l\xe9ingst', u'l\xe4ngst'), (u'l\xe9isen', u'l\xf6sen'), (u'l\xe9issig', u'l\xe4ssig'), (u'l\xe9isst', u'l\xe4sst'), (u'L\xe9iuft', u'L\xe4uft'), (u'L\xe9jsung', u'L\xf6sung'), (u'L\xe9mmchen', u'L\xe4mmchen'), (u'L\xe9mmer', u'L\xe4mmer'), (u'L\xe9nder', u'L\xe4nder'), (u'L\xe9ndern', u'L\xe4ndern'), (u'L\xe9nge', u'L\xe4nge'), (u'L\xe9ngen', u'L\xe4ngen'), (u'l\xe9nger', u'l\xe4nger'), (u'l\xe9ngst', u'l\xe4ngst'), (u'l\xe9ngste', u'l\xe4ngste'), (u'L\xe9rm', u'L\xe4rm'), (u'L\xe9rmbeschwerden', u'L\xe4rmbeschwerden'), (u'l\xe9schen', u'l\xf6schen'), (u'L\xe9se', u'L\xf6se'), (u'L\xe9segeld', u'L\xf6segeld'), (u'l\xe9sst', u'l\xe4sst'), (u'l\xe9st', u'l\xf6st'), (u'l\xe9ste', u'l\xf6ste'), (u'l\xe9sten', u'l\xf6sten'), (u'l\xe9stig', u'listig'), (u'L\xe9sung', u'L\xf6sung'), (u'l\xe9ufig', u'l\xe4ufig'), (u'l\xe9ufst', u'l\xe4ufst'), (u'L\xe9uft', u'L\xe4uft'), (u'l\xe9uten', u'l\xe4uten'), (u'l\xe9utet', u'l\xe4utet'), (u'L\xe9we', u'L\xf6we'), (u'L\ufb02gner', u'L\xfcgner'), (u"M'a'dchen", u'M\xe4dchen'), (u'm/ese', u'miese'), (u'M/ffsommernachfsfraum', u'Mittsommernachtstraum'), (u'M/r', u'Mir'), (u'M0I8KUI', u'Molek\xfcl'), (u'm6belt', u'm\xf6belt'), (u'm6chte', u'm\xf6chte'), (u'm6chtest', u'm\xf6chtest'), (u'm6gen', u'm\xf6gen'), (u'm6glich', u'm\xf6glich'), (u'm6glichen', u'm\xf6glichen'), (u'm6glicher', u'm\xf6glicher'), (u'm6gt', u'm\xf6gt'), (u'M6rder', u'M\xf6rder'), (u'MaB', u'Ma\xdf'), (u'MaBgabe', u'Ma\xdfgabe'), (u'mac/1e', u'mache'), (u'mac/7', u'nach'), (u'machs', u"mach's"), (u'Machtiibernahme', u'Macht\xfcbernahme'), (u'madenschw\xe9inziger', u'madenschw\xe4nziger'), (u'Mafinahme', u'Ma\xdfnahme'), (u'Magengeschwiire', u'Magengeschw\xfcre'), (u'Magengeschwilr', u'Magengeschw\xfcr'), (u'Magengeschwtir', u'Magengeschw\xfcr'), (u'Magnolienbliiten', u'Magnolienbl\xfcten'), (u'Majesfait', u'Majest\xe4t'), (u'Majest\xe9it', u'Majest\xe4t'), (u'Majest\xe9t', u'Majest\xe4t'), (u'Majest\xe9ten', u'Majest\xe4ten'), (u'Mal2>en', u'Ma\xdfen'), (u'Mal3en', u'Ma\xdfen'), (u'malf', u'mal!'), (u'Malinahme', u'Ma\xdfnahme'), (u'mall', u'mal!'), (u'Mallregelten', u'Ma\xdfregelten'), (u'Mandverstation', u'Man\xf6verstation'), (u'Manfiver', u'Man\xf6ver'), (u'Maniiver', u'Man\xf6ver'), (u'Manikfire', u'Manik\xfcre'), (u'Mannscha\ufb02', u'Mannschaft'), (u"Mansclle\ufb02'enkm'5pfe", u'Manschettenkn\xf6pfe'), (u'Man\xe9iver', u'Man\xf6ver'), (u'Man\xe9ver', u'Man\xf6ver'), (u'man\xe9vrieren', u'man\xf6vrieren'), (u'man\xe9vrierf\xe9hig', u'man\xf6vrierf\xe4hig'), (u'Man\xe9vriermodus', u'Man\xf6vriermodus'), (u'Margoliserklfirung', u'Margoliserkl\xe4rung'), (u'Margoliserkl\xe9rung', u'Margoliserkl\xe4rung'), (u'marsch\xe9hnliche', u'marsch\xe4hnliche'), (u'Massagestllihlen', u'Massagest\xfchlen'), (u'Massenzerst\xe9rung', u'Massenzerst\xf6rung'), (u'Massenzerst\xe9rungswaffen', u'Massenzerst\xf6rungswaffen'), (u'Mater/al', u'Material'), (u'Maxiriicke', u'Maxir\xf6cke'), (u'Mayonaise', u'Mayonnaise'), (u'mbglichst', u'm\xf6glichst'), (u'Mdge', u'M\xf6ge'), (u'mdglichen/veise', u'm\xf6glicherweise'), (u'mdglicherweise', u'm\xf6glicherweise'), (u'Mdglichkeit', u'M\xf6glichkeit'), (u'me/n', u'mein'), (u'mehrZeit', u'mehr Zeit'), (u"mein'ja", u"mein' ja"), (u'meinerjetzigen', u'meiner jetzigen'), (u'Meinungs\xe9ufierung', u'Meinungs\xe4u\xdferung'), (u'Meisterbr\xe9u', u'Meisterbr\xe4u'), (u'Meisterstijck', u'Meisterst\xfcck'), (u'meistgehasste', u'meist gehasste'), (u'meln', u'mein'), (u'melne', u'meine'), (u'Mend', u'Mond'), (u'Menschenh\xe9indler', u'Menschenh\xe4ndler'), (u'Menstruationsst\xe9rungen', u'Menstruationsst\xf6rungen'), (u'Merkwiirdig', u'Merkw\xfcrdig'), (u'Merkwiirdige', u'Merkw\xfcrdige'), (u'merkwiirdiger', u'merkw\xfcrdiger'), (u'merkwilrdig', u'merkw\xfcrdig'), (u'merkwlllrdige', u'merkw\xfcrdige'), (u'merkwurdig', u'merkw\xfcrdig'), (u'merkwurolig', u'merkw\xfcrdig'), (u'merkw\ufb02rdig', u'merkw\xfcrdig'), (u'Messger\xe9t', u'Messger\xe4t'), (u'mfichte', u'm\xf6chte'), (u'Mfichten', u'M\xf6chten'), (u'Mfidchen', u'M\xe4dchen'), (u'Mfidchenl', u'M\xe4dchen!'), (u'Mfidels', u'M\xe4dels'), (u'mfigen', u'm\xf6gen'), (u'Mfigliche', u'M\xf6gliche'), (u'mfiglichen', u'm\xf6glichen'), (u'mfiglicherweise', u'm\xf6glicherweise'), (u'Mfill', u'M\xfcll'), (u'Mfillhalde', u'M\xfcllhalde'), (u'Mfinchen', u'M\xfcnchen'), (u'Mfinder', u'M\xfcnder'), (u'Mfinnern', u'M\xe4nnern'), (u'Mfissen', u'M\xfcssen'), (u'mfisst', u'm\xfcsst'), (u'mfisste', u'm\xfcsste'), (u'Mfjrder', u'M\xf6rder'), (u'Midchen', u'M\xe4dchen'), (u'Migrane', u'Migr\xe4ne'), (u'Migr\xe9ne', u'Migr\xe4ne'), (u'Migr\ufb02ne', u'Migr\xe4ne'), (u'miichte', u'm\xf6chte'), (u'Miichtegern', u'M\xf6chtegern'), (u'Miichten', u'M\xf6chten'), (u'miichtest', u'm\xf6chtest'), (u'miide', u'm\xfcde'), (u'Miidels', u'M\xe4dels'), (u'miides', u'm\xfcdes'), (u'miige', u'm\xf6ge'), (u'miigen', u'm\xf6gen'), (u'miiglich', u'm\xf6glich'), (u'miigliche', u'm\xf6gliche'), (u'miiglichen', u'm\xf6glichen'), (u'miigliches', u'm\xf6gliches'), (u'Miiglichkeit', u'M\xf6glichkeit'), (u'Miiglichkeiten', u'M\xf6glichkeiten'), (u'miigt', u'm\xf6gt'), (u'Miill', u'M\xfcll'), (u'Miillhalde', u'M\xfcllhalde'), (u'Miilltonnen', u'M\xfclltonnen'), (u'miilssen', u'm\xfcssen'), (u'miirderisch', u'm\xf6rderisch'), (u'miisse', u'm\xfcsse'), (u'Miissen', u'M\xfcssen'), (u'miisst', u'm\xfcsst'), (u'miisste', u'm\xfcsste'), (u'Miiuse', u'M\xe4use'), (u'mijchte', u'm\xf6chte'), (u'Mijcken', u'M\xfccken'), (u'Mijhe', u'M\xfche'), (u'Mijnzen', u'M\xfcnzen'), (u'mijssen', u'm\xfcssen'), (u'mijsst', u'm\xfcsst'), (u'mijsste', u'm\xfcsste'), (u'mijsstest', u'm\xfcsstest'), (u'Milchstrafie', u'Milchstra\xdfe'), (u'Milhe', u'M\xfche'), (u'Milhle', u'M\xfchle'), (u'MILITAR', u'MILIT\xc4R'), (u'Militiirprogramme', u'Milit\xe4rprogramme'), (u'Militir', u'Milit\xe4r'), (u'militlrische', u'milit\xe4rische'), (u'Milit\xe9irkodex', u'Milit\xe4rkodex'), (u'Milit\xe9r', u'Milit\xe4r'), (u'Milit\xe9rakademie', u'Milit\xe4rakademie'), (u'Milit\xe9rdienst', u'Milit\xe4rdienst'), (u'milit\xe9rischen', u'milit\xe4rischen'), (u'Milit\xe9rkodex', u'Milit\xe4rkodex'), (u'Milit\xe9rluftraum', u'Milit\xe4rluftraum'), (u'Milit\xe9rnetzwerk', u'Milit\xe4rnetzwerk'), (u'Milit\xe9rs', u'Milit\xe4rs'), (u'Milit\xe9rsystem', u'Milit\xe4rsystem'), (u'Millbilligung', u'Missbilligung'), (u'Millefs', u"Miller's"), (u'Millgeburt', u'Missgeburt'), (u'Milliard\xe9iren', u'Milliard\xe4ren'), (u'Million\xe9rssohn', u'Million\xe4rssohn'), (u'Milli\xe9quivalent', u'Milli\xe4quivalent'), (u'Millltonne', u'M\xfclltonne'), (u'millverstanden', u'missverstanden'), (u'milssen', u'm\xfcssen'), (u'milsst', u'm\xfcsst'), (u'milsste', u'm\xfcsste'), (u'milssten', u'm\xfcssten'), (u'Miltter', u'M\xfctter'), (u'Minenraumen', u'Minenr\xe4umen'), (u'Miniriicke', u'Minir\xf6cke'), (u'mirglauben', u'mir glauben'), (u'mirja', u'mir ja'), (u'mirje', u'mir je'), (u'mirjeglichen', u'mir jeglichen'), (u'mirjemals', u'mir jemals'), (u'mirjemand', u'mir jemand'), (u'mirjetzt', u'mir jetzt'), (u'mirso', u'mir so'), (u'mirvon', u'mir von'), (u'mirzu', u'mir zu'), (u'Miserabell', u'Miserabel!'), (u'missf\xe9llt', u'missf\xe4llt'), (u'Missverstfindnisl', u'Missverst\xe4ndnis!'), (u'Missverstiindnis', u'Missverst\xe4ndnis'), (u'Missverst\xe9ndnis', u'Missverst\xe4ndnis'), (u'Missverst\xe9ndnissen', u'Missverst\xe4ndnissen'), (u'Mistkerlel', u'Mistkerle!'), (u'Mistkiiter', u'Mistk\xf6ter'), (u'Miststiick', u'Mistst\xfcck'), (u'Mistst\ufb02cke', u'Mistst\xfccke'), (u'Mitbijrger', u'Mitb\xfcrger'), (u'Mitbilrger', u'Mitb\xfcrger'), (u'mitfiihlend', u'mitf\xfchlend'), (u'mitfiihlender', u'mitf\xfchlender'), (u'mitfuhlend', u'mitf\xfchlend'), (u'Mitgefiihl', u'Mitgef\xfchl'), (u'Mitgefuhl', u'Mitgef\xfchl'), (u'mitgehiirt', u'mitgeh\xf6rt'), (u'mitgez\xe9hlt', u'mitgez\xe4hlt'), (u'mitjedem', u'mit jedem'), (u'mitjemandem', u'mit jemandem'), (u'mittlen/veile', u'mittlerweile'), (u"ML'1nze", u'M\xfcnze'), (u'mlch', u'mich'), (u'Mldchen', u'M\xe4dchen'), (u'mLissen', u'm\xfcssen'), (u'Mljnder', u'M\xfcnder'), (u'Mllillschlucker', u'M\xfcllschlucker'), (u'Mllindel', u'M\xfcndel'), (u'Mllindung', u'M\xfcndung'), (u'mllissen', u'm\xfcssen'), (u'mllisst', u'm\xfcsst'), (u'Mlllhe', u'M\xfche'), (u'Mllllon', u'Million'), (u'Mllllonen', u'Millionen'), (u'mlllsst', u'm\xfcsst'), (u'Mllltterjedoch', u'M\xfctter jedoch'), (u'Mlnnern', u'M\xe4nnern'), (u'mlr', u'mir'), (u'mlrl', u'mir!'), (u'mlt', u'mit'), (u'moglich', u'm\xf6glich'), (u'Moglichkeit', u'M\xf6glichkeit'), (u'Moglichkeiten', u'M\xf6glichkeiten'), (u'Molekijle', u'Molek\xfcle'), (u"MolekL'lle", u'Molek\xfcle'), (u'Mondeinhiirner', u'Mondeinh\xf6rner'), (u'Mondeinhiirnerl', u'Mondeinh\xf6rner!'), (u'Mondeinh\xe9irner', u'Mondeinh\xf6rner'), (u'Mondk\xe9ilber', u'Mondk\xe4lber'), (u'Monl', u'Mom'), (u'MONTONEI', u'MONTONE:'), (u'Mordsiiberraschung', u'Mords\xfcberraschung'), (u'Mordverd\xe9chtiger', u'Mordverd\xe4chtiger'), (u'Morsealphabetl', u'Morsealphabet!'), (u'Motorger\xe9usch', u'Motorger\xe4usch'), (u'Motorger\xe9usche', u'Motorger\xe4usche'), (u"Mousset\ufb02e's", u"Moussette's"), (u'Mowen', u'M\xf6wen'), (u'Mtihe', u'M\xfche'), (u'Mtillschlucker', u'M\xfcllschlucker'), (u'mtissen', u'm\xfcssen'), (u'mtissenl', u'm\xfcssen!'), (u'Mtitzel', u'M\xfctze!'), (u'mtlde', u'm\xfcde'), (u'mtlsste', u'm\xfcsste'), (u'muBt', u'musst'), (u'Mucken', u'M\xfccken'), (u'mucksm\xe9uschenstill', u'mucksm\xe4uschenstill'), (u'mude', u'm\xfcde'), (u'Muhe', u'M\xfche'), (u'MUII', u'M\xfcll'), (u'mull', u'muss'), (u'MULL', u'M\xdcLL'), (u'mullte', u'musste'), (u'Mundl', u'Mund!'), (u'Mundung', u'M\xfcndung'), (u'Munzfernsprecher', u'M\xfcnzfernsprecher'), (u'Muskatnijsse', u'Muskatn\xfcsse'), (u'Muskelkumpelsl', u'Muskelkumpels!'), (u'muskul\xe9ren', u'muskul\xe4ren'), (u'mussen', u'm\xfcssen'), (u'MUSSEN', u'M\xdcSSEN'), (u"mUssen's", u"m\xfcssen's"), (u"muss_'\xa7e", u'musste'), (u'Musterschuler', u'Mustersch\xfcler'), (u'Mutterja', u'Mutter ja'), (u'mutterlich', u'm\xfctterlich'), (u'Mutze', u'M\xfctze'), (u'mu\xdf', u'muss'), (u'mu\xdft', u'musst'), (u'mu\xdfte', u'musste'), (u"mx't", u'mit'), (u'Mzlinnern', u'M\xe4nnern'), (u'M\xe9bel', u'M\xf6bel'), (u'm\xe9cht', u'm\xf6cht'), (u'M\xe9chte', u'M\xe4chte'), (u'm\xe9chte', u'm\xf6chte'), (u'M\xe9chtegern', u'M\xf6chtegern'), (u'm\xe9chten', u'm\xf6chten'), (u'm\xe9chtest', u'm\xf6chtest'), (u'm\xe9chtet', u'm\xf6chtet'), (u'm\xe9chtig', u'm\xe4chtig'), (u'm\xe9chtige', u'm\xe4chtige'), (u'm\xe9chtigen', u'm\xe4chtigen'), (u'm\xe9chtiger', u'm\xe4chtiger'), (u'm\xe9chtiges', u'm\xe4chtiges'), (u'm\xe9chtigste', u'm\xe4chtigste'), (u'm\xe9chtigsten', u'm\xe4chtigsten'), (u'M\xe9dchen', u'M\xe4dchen'), (u'M\xe9dchenh\xe9nden', u'M\xe4dchenh\xe4nden'), (u'M\xe9dchens', u'M\xe4dchens'), (u'M\xe9del', u'M\xe4del'), (u'M\xe9dels', u'M\xe4dels'), (u'M\xe9delsl', u'M\xe4dels!'), (u'M\xe9fiigung', u'M\xe4\xdfigung'), (u'm\xe9ge', u'm\xf6ge'), (u'M\xe9gen', u'M\xf6gen'), (u'M\xe9glich', u'M\xf6glich'), (u'm\xe9gliche', u'm\xf6gliche'), (u'M\xe9glichen', u'M\xf6glichen'), (u'M\xe9gliches', u'M\xf6gliches'), (u'M\xe9glichkeit', u'M\xf6glichkeit'), (u'M\xe9glichkeiten', u'M\xf6glichkeiten'), (u'm\xe9glichst', u'm\xf6glichst'), (u'm\xe9gt', u'm\xf6gt'), (u'm\xe9ichtig', u'm\xe4chtig'), (u'm\xe9ichtige', u'm\xe4chtige'), (u'm\xe9ichtigen', u'm\xe4chtigen'), (u'm\xe9ichtiger', u'm\xe4chtiger'), (u'M\xe9idchen', u'M\xe4dchen'), (u'M\xe9idel', u'M\xe4del'), (u'M\xe9inner', u'M\xe4nner'), (u'M\xe9innl', u'M\xe4nnl'), (u'm\xe9innlicher', u'm\xe4nnlicher'), (u'M\xe9irder', u'M\xf6rder'), (u'M\xe9irz', u'M\xe4rz'), (u'M\xe9nnchen', u'M\xe4nnchen'), (u'M\xe9nnchens', u'M\xe4nnchens'), (u'M\xe9nner', u'M\xe4nner'), (u'M\xe9nnerfreundschaft', u'M\xe4nnerfreundschaft'), (u'M\xe9nnern', u'M\xe4nnern'), (u'M\xe9nnersache', u'M\xe4nnersache'), (u'm\xe9nnlich', u'm\xe4nnlich'), (u'm\xe9nnliche', u'm\xe4nnliche'), (u'M\xe9ntel', u'M\xe4ntel'), (u'M\xe9olel', u'M\xe4del'), (u'M\xe9olels', u'M\xe4dels'), (u'M\xe9rchen', u'M\xe4rchen'), (u'M\xe9rchenl', u'M\xe4rchen!'), (u'M\xe9rchenprinzen', u'M\xe4rchenprinzen'), (u'M\xe9rder', u'M\xf6rder'), (u'M\xe9rtyrer', u'M\xe4rtyrer'), (u'M\xe9rz', u'M\xe4rz'), (u'M\xe9tresse', u'M\xe4tresse'), (u'M\xe9uschen', u'M\xe4uschen'), (u'M\xe9use', u'M\xe4use'), (u'M\xe9usehtipfer', u'M\xe4useh\xfcpfer'), (u'M\xe9usen', u'M\xe4usen'), (u'M\xe9userennen', u'M\xe4userennen'), (u'm\xfc\xdft', u'm\xfcsst'), (u'm\ufb02de', u'm\xfcde'), (u'm\ufb02ssen', u'm\xfcssen'), (u"n'a'chste", u'n\xe4chste'), (u"n'a'hert", u'n\xe4hert'), (u'n/chfs', u'nichts'), (u'n/chi', u'nicht'), (u'N/ck', u'Nick'), (u'n/e', u'nie'), (u'N6', u'N\xf6'), (u'n6tig', u'n\xf6tig'), (u'nac/1', u'nach'), (u'Nachf', u'Nacht'), (u'nachllssig', u'nachl\xe4ssig'), (u'nachl\xe9ssig', u'nachl\xe4ssig'), (u'nachl\xe9sst', u'nachl\xe4sst'), (u'nachprufen', u'nachpr\xfcfen'), (u'Nachschlussel', u'Nachschl\xfcssel'), (u'Nachste', u'N\xe4chste'), (u'NAHERT', u'N\xc4HERT'), (u'NAHERTE', u'N\xc4HERTE'), (u'Nat/on', u'Nation'), (u'natfirlich', u'nat\xfcrlich'), (u'Natiilrlich', u'Nat\xfcrlich'), (u'Natiirlich', u'Nat\xfcrlich'), (u'Natiirllch', u'Nat\xfcrlich'), (u'natijrlich', u'nat\xfcrlich'), (u'natijrlichen', u'nat\xfcrlichen'), (u'natilrlich', u'nat\xfcrlich'), (u'natilrliche', u'nat\xfcrliche'), (u"natL'lrlich", u'nat\xfcrlich'), (u'Natllirlich', u'Nat\xfcrlich'), (u'Nattirlich', u'Nat\xfcrlich'), (u'Nattlrlich', u'Nat\xfcrlich'), (u'Nattlrliohl', u'Nat\xfcrlich!'), (u'Naturlich', u'Naturloch'), (u'naturlich', u'nat\xfcrlich'), (u'naturlichen', u'nat\xfcrlichen'), (u'naturlichsten', u'nat\xfcrlichsten'), (u'Navajoweifi', u'Navajowei\xdf'), (u'ndtige', u'n\xf6tige'), (u'ne/n', u'nein'), (u'Nebengeb\xe9ude', u'Nebengeb\xe4ude'), (u'Nebengesch\xe9ift', u'Nebengesch\xe4ft'), (u'neffes', u'nettes'), (u'Nehmf', u'Nehmt'), (u'neinl', u'nein!'), (u'Neln', u'Nein'), (u'nerv6s', u'nerv\xf6s'), (u'Nervens\xe9ge', u'Nervens\xe4ge'), (u'Nervens\xe9ige', u'Nervens\xe4ge'), (u'nerviis', u'nerv\xf6s'), (u'Nerv\xe9s', u'Nerv\xf6s'), (u'ner\\/t', u'nervt'), (u'Neuankiimmlinge', u'Neuank\xf6mmlinge'), (u'neuromuskul\xe9ren', u'neuromuskul\xe4ren'), (u'Neuzug\xe9inge', u'Neuzug\xe4nge'), (u'Nfichster', u'N\xe4chster'), (u'NIANN', u'MANN'), (u'nichsten', u'n\xe4chsten'), (u'nichtim', u'nicht im'), (u'nichtjemand', u'nicht jemand'), (u'Nichtjetzt', u'Nicht jetzt'), (u'Nichtsl', u'Nichts!'), (u'nichtzurilckgelassen', u'nicht zur\xfcckgelassen'), (u'nic_l_1t', u'nicht'), (u'niederk\xe9mpfen', u'niederk\xe4mpfen'), (u'niederliells', u'niederlie\xdf'), (u'niedlichl', u'niedlich!'), (u'niher', u'n\xe4her'), (u'niichsten', u'n\xe4chsten'), (u'niichstes', u'n\xe4chstes'), (u'niirgeln', u'n\xf6rgeln'), (u'niitig', u'n\xf6tig'), (u'niitige', u'n\xf6tige'), (u'Nijssen', u'N\xfcssen'), (u'Nijsternl', u'N\xfcstern!'), (u'nijtzlich', u'n\xfctzlich'), (u'nilchtern', u'n\xfcchtern'), (u'niltzen', u'n\xfctzen'), (u'Nlagnaten', u'Magnaten'), (u'Nlannern', u'M\xe4nnern'), (u'nlchste', u'n\xe4chste'), (u'nlchsthoheren', u'n\xe4chsth\xf6heren'), (u'nlcht', u'nicht'), (u'nle', u'nie'), (u'Nlemalsl', u'Niemals!'), (u'Nlhe', u'N\xe4he'), (u'nlir', u'mir'), (u'nllitzen', u'n\xfctzen'), (u'Nl\xe9inner', u'M\xe4nner'), (u'noc/1', u'noch'), (u"Not/'all", u'Notfall'), (u'Notfalll', u'Notfall!'), (u'notig', u'n\xf6tig'), (u'notigen', u'n\xf6tigen'), (u'Notliige', u'Notl\xfcge'), (u'Notziindung', u'Notz\xfcndung'), (u'NUFI', u'Nur:'), (u'Nunja', u'Nun ja'), (u'Nurdich', u'Nur dich'), (u'nureins', u'nur eins'), (u'nurflustern', u'nur fl\xfcstern'), (u'Nurjetzt', u'Nur jetzt'), (u'nurl', u'nur 1'), (u'nurwunscht', u'nur w\xfcnscht'), (u'Nurzu', u'Nur zu'), (u'nus', u'aus'), (u'NUSSS', u'N\xfcsse'), (u'nutzlich', u'n\xfctzlich'), (u"Nx'emand", u'Niemand'), (u'N\xe9chste', u'N\xe4chste'), (u'n\xe9chsten', u'n\xe4chsten'), (u'N\xe9chster', u'N\xe4chster'), (u'n\xe9chstes', u'n\xe4chstes'), (u'N\xe9chte', u'N\xe4chte'), (u'N\xe9chten', u'N\xe4chten'), (u'n\xe9chtlichen', u'n\xe4chtlichen'), (u'N\xe9gel', u'N\xe4gel'), (u'N\xe9h', u'N\xe4h'), (u'N\xe9he', u'N\xe4he'), (u'n\xe9henf', u'n\xe4hert'), (u'n\xe9her', u'n\xe4her'), (u'n\xe9here', u'n\xe4here'), (u'N\xe9hern', u'N\xe4hern'), (u'n\xe9hernde', u'n\xe4hernde'), (u'n\xe9hert', u'n\xe4hert'), (u'n\xe9herte', u'n\xe4herte'), (u'n\xe9hren', u'n\xe4hren'), (u'n\xe9ht', u'n\xe4ht'), (u'N\xe9hten', u'N\xe4hten'), (u'N\xe9ichste', u'N\xe4chste'), (u'n\xe9ichsten', u'n\xe4chsten'), (u'N\xe9ichstes', u'N\xe4chstes'), (u'N\xe9ihe', u'N\xe4he'), (u'n\xe9iher', u'n\xe4her'), (u'n\xe9ihern', u'n\xe4hern'), (u'n\xe9ihert', u'n\xe4hert'), (u'N\xe9ihten', u'N\xe4hten'), (u'n\xe9imlich', u'n\xe4mlich'), (u'n\xe9mlich', u'n\xe4mlich'), (u'N\xe9pfe', u'N\xe4pfe'), (u'n\xe9rdlich', u'n\xf6rdlich'), (u'n\xe9rgelnde', u'n\xf6rgelnde'), (u'N\xe9rrin', u'N\xe4rrin'), (u'N\xe9schen', u'N\xe4schen'), (u'n\xe9tig', u'n\xf6tig'), (u'n\xe9tige', u'n\xf6tige'), (u'n\xe9tiges', u'n\xf6tiges'), (u'O8', u'08'), (u'obdachlosl', u'obdachlos!'), (u'Obefil\xe9iche', u'Oberfl\xe4che'), (u'OBERFLACHENSCHWERKRAFT', u'OBERFL\xc4CHENSCHWERKRAFT'), (u'Oberfl\xe9che', u'Oberfl\xe4che'), (u'Oberfl\xe9chen', u'Oberfl\xe4chen'), (u'oberfl\xe9chlich', u'oberfl\xe4chlich'), (u'oberfl\xe9chliche', u'oberfl\xe4chliche'), (u'Oberm\xe9inner', u'Oberm\xe4nner'), (u'Ober\ufb02fiche', u'Oberfl\xe4che'), (u"of/'en", u'offen'), (u'Offenslchtllch', u'Offensichtlich'), (u'Offentliches', u'\xd6ffentliches'), (u'Offentlichkeit', u'\xd6ffentlichkeit'), (u'Offne', u'\xd6ffne'), (u'Offnen', u'\xd6ffnen'), (u'Offnet', u'\xd6ffnet'), (u'ofi', u'oft'), (u'Ofiiziere', u'Offiziere'), (u'Ofiiziers', u'Offiziers'), (u'Oftweg', u'Oft weg'), (u'Of\ufb02cer', u'Officer'), (u'Ohnejede', u'Ohne jede'), (u'ohnm\xe9chtig', u'ohnm\xe4chtig'), (u'ohnm\xe9ichtig', u'ohnm\xe4chtig'), (u'OI', u'\xd6l'), (u'olas', u'das'), (u'oles', u'des'), (u'Oltanks', u'\xd6ltanks'), (u'OO', u'00'), (u'Orgelt\xe9ne', u'Orgelt\xf6ne'), (u'ORTI', u'ORT:'), (u'Ortl', u'Ort!'), (u'Ostfltlgel', u'Ostfl\xfcgel'), (u'Paliontologie', u'Pal\xe4ontologie'), (u'pallt', u'passt'), (u'Pal\xe9sten', u'Pal\xe4sten'), (u'Panfike/chen', u'Partikelchen'), (u'Papierbl\xe9tter', u'Papierbl\xe4tter'), (u'Papiertiite', u'Papiert\xfcte'), (u'Papiertilcher', u'Papiert\xfccher'), (u'Parfyknaller', u'Partyknaller'), (u'Partyhiite', u'Partyh\xfcte'), (u'Partyhijte', u'Partyh\xfcte'), (u'Passendervveise', u'Passenderweise'), (u'Paulgenauso', u'Paul genauso'), (u'pa\xdf', u'pass'), (u'pa\xdft', u'passt'), (u'peinliohl', u'peinlich'), (u'persdnlich', u'pers\xf6nlich'), (u'persfinlich', u'pers\xf6nlich'), (u'persiinlich', u'pers\xf6nlich'), (u'persiinliche', u'pers\xf6nliche'), (u'persiinlicher', u'pers\xf6nlicher'), (u'Persiinllchkeltsspaltun', u'Pers\xf6nllchkeltsspaltung'), (u'persijnliche', u'pers\xf6nliche'), (u'personlich', u'pers\xf6nlich'), (u'Personlichkeit', u'Pers\xf6nlichkeit'), (u'pers\xe9nlich', u'pers\xf6nlich'), (u'pers\xe9nliche', u'pers\xf6nliche'), (u'pers\xe9nlicher', u'pers\xf6nlicher'), (u'Pers\xe9nliches', u'Pers\xf6nliches'), (u'Pers\xe9nlichkeit', u'Pers\xf6nlichkeit'), (u'pe\ufb02g', u'peng'), (u'Pfadfindervvappen', u'Pfadfinderwappen'), (u'Pfad\ufb02ndeml', u'Pfad\ufb02ndern!'), (u'Pffitzen', u'Pf\xfctzen'), (u'Pfiitchen', u'Pf\xf6tchen'), (u'Pfippchen', u'P\xfcppchen'), (u"pflL'lgen", u'pfl\xfcgen'), (u'Pfllitze', u'Pf\xfctze'), (u'pflugte', u'pfl\xfcgte'), (u'Pfundbijro', u'Pfundb\xfcro'), (u'ph\xe9nomenal', u'ph\xe4nomenal'), (u'PIatz', u'Platz'), (u'Piimpel', u'P\xf6mpel'), (u'Piinlttchenltrawatte', u'P\xfcnktchenkrawatte'), (u'Pijppchen', u'P\xfcppchen'), (u'Pijppchenl', u'P\xfcppchen!'), (u'Planetenf', u'Planeten!'), (u'planm\xe9fiigen', u'planm\xe4\xdfigen'), (u'Plastikfr\xe9iuleinl', u'Plastikfr\xe4ulein!'), (u'plattmachen', u'platt machen'), (u'Plfitzchen', u'Pl\xe4tzchen'), (u'plfitzlich', u'pl\xf6tzlich'), (u'pliitzlich', u'pl\xf6tzlich'), (u'pliitzllch', u'pl\xf6tzlich'), (u'Pllllnderer', u'Pl\xfcnderer'), (u'plotzlich', u'pl\xf6tzlich'), (u'pl\xe9dieren', u'pl\xe4dieren'), (u'Pl\xe9ine', u'Pl\xe4ne'), (u'Pl\xe9inen', u'Pl\xe4nen'), (u'Pl\xe9itzchen', u'Pl\xe4tzchen'), (u'Pl\xe9itze', u'Pl\xe4tze'), (u'Pl\xe9ne', u'Pl\xe4ne'), (u'Pl\xe9tzchen', u'Pl\xe4tzchen'), (u'Pl\xe9tze', u'Platze'), (u'Pl\xe9tzel', u'Pl\xe4tze!'), (u'pl\xe9tzlich', u'pl\xf6tzlich'), (u'pl\xe9tzliche', u'pl\xf6tzliche'), (u'Pofkawoche', u'Polkawoche'), (u'Polizistl', u'Polizist!'), (u'pompiise', u'pomp\xf6se'), (u'popul\xe9r', u'popul\xe4r'), (u'potth\xe9sslich', u'potth\xe4sslich'), (u'prasentleren', u'pr\xe4sentieren'), (u'prfignant', u'pr\xe4gnant'), (u'Prfisentation', u'Pr\xe4sentation'), (u'Prfisi', u'Pr\xe4si'), (u'priide', u'pr\xfcde'), (u'Priife', u'Pr\xfcfe'), (u'priifen', u'pr\xfcfen'), (u'prijfen', u'pr\xfcfen'), (u"Priorit2a't", u'Priorit\xe4t'), (u'PRIORITKT', u'PRIORIT\xc4T'), (u'PRIORITKTSZUGANG', u'PRIORIT\xc4TSZUGANG'), (u'Priorit\xe9itszugang', u'Priorit\xe4tszugang'), (u'Priorit\xe9t', u'Priorit\xe4t'), (u'Prisident', u'Pr\xe4sident'), (u'Privatgem\xe9chern', u'Privatgem\xe4chern'), (u'Privatsph\xe9re', u'Privatsph\xe4re'), (u'Probfeme', u'Probleme'), (u'Profitinzerinnen', u'Profit\xe4nzerinnen'), (u'Protege', u'Prot\xe9g\xe9'), (u'prude', u'pr\xfcde'), (u'Pruf', u'Pr\xfcf'), (u'prufen', u'pr\xfcfen'), (u'Prugelei', u'Pr\xfcgelei'), (u'prugeln', u'pr\xfcgeln'), (u'pr\xe9chtig', u'pr\xe4chtig'), (u'Pr\xe9fekt', u'Pr\xe4fekt'), (u'pr\xe9historischer', u'pr\xe4historischer'), (u'pr\xe9ichtiger', u'pr\xe4chtiger'), (u'pr\xe9ichtiges', u'pr\xe4chtiges'), (u'Pr\xe9imie', u'Pr\xe4mie'), (u'pr\xe9ipotente', u'pr\xe4potente'), (u'pr\xe9isentiert', u'pr\xe4sentiert'), (u'Pr\xe9isidenten', u'Pr\xe4sidenten'), (u'Pr\xe9itorianer', u'Pr\xe4torianer'), (u'Pr\xe9mie', u'Pr\xe4mie'), (u'Pr\xe9operative', u'Pr\xe4operative'), (u'pr\xe9sentiere', u'pr\xe4sentiere'), (u'pr\xe9sentieren', u'pr\xe4sentieren'), (u'Pr\xe9sentiert', u'Pr\xe4sentiert'), (u'Pr\xe9senz', u'Pr\xe4senz'), (u'Pr\xe9sident', u'Pr\xe4sident'), (u'Pr\xe9sidenten', u'Pr\xe4sidenten'), (u'Pr\xe9sidentin', u'Pr\xe4sidentin'), (u'Pr\xe9sidentschaft', u'Pr\xe4sidentschaft'), (u'Pr\xe9torianer', u'Pr\xe4torianer'), (u'pr\xe9zise', u'pr\xe4zise'), (u'pr\xe9ziser', u'pr\xe4ziser'), (u'Pr\ufb02fungen', u'Pr\xfcfungen'), (u'Pubert\xe9it', u'Pubert\xe4t'), (u'Publlkuml', u'Publlkum!'), (u'PUPPCHEN', u'P\xdcPPCHEN'), (u'PUpst', u'Pupst'), (u'Purzelb\xe9ume', u'Purzelb\xe4ume'), (u'P\xe9ckchen', u'P\xe4ckchen'), (u'p\xe9idagogisch', u'p\xe4dagogisch'), (u'P\xe9irchen', u'P\xe4rchen'), (u'P\xe9rchen', u'P\xe4rchen'), (u'p\ufb02egen', u'pflegen'), (u'P\ufb02icht', u'Pflicht'), (u'p\ufb02ichtbewullt', u'pflichtbewusst'), (u'Qas', u'Das'), (u'Qualit\xe9tskontrolle', u'Qualit\xe4tskontrolle'), (u'Quten', u'guten'), (u'qu\xe9ilen', u'qu\xe4len'), (u'qu\xe9ilt', u'qu\xe4lt'), (u'Qu\xe9l', u'Qu\xe4l'), (u'Qu\xe9lt', u'Qu\xe4lt'), (u"R'a'che", u'R\xe4che'), (u'R/ck', u'Rick'), (u'R/nge', u'Ringe'), (u'R6mer', u'R\xf6mer'), (u'rachsiichtiger', u'rachs\xfcchtiger'), (u'ranghfiheren', u'rangh\xf6heren'), (u'rangh\xe9heren', u'rangh\xf6heren'), (u'ranzukommen', u'ran-zukommen'), (u'Rasenm\xe9herunfall', u'Rasenm\xe4herunfall'), (u'Rasterllibertragung', u'Raster\xfcbertragung'), (u'Rasterubertragung', u'Raster\xfcbertragung'), (u'Ratschl\xe9ige', u'Ratschl\xe4ge'), (u'Rattenf\xe9nger', u'Rattenf\xe4nger'), (u'Rauc/7', u'Rauch'), (u'Rauc/vender', u'Rauchender'), (u'rauhen', u'rauen'), (u'RAUMFAHRE', u'RAUMF\xc4HRE'), (u'Raumf\xe9hre', u'Raumf\xe4hre'), (u'Raumsschiff', u'Raumschiff'), (u'rausf\xe9hrt', u'rausf\xe4hrt'), (u'rausgeprtigeltl', u'rausgepr\xfcgelt!'), (u'rausliefien', u'rauslie\xdfen'), (u'rauszuschmeifien', u'rauszuschmei\xdfen'), (u'rau\ufb02', u'rau!'), (u'Re/se', u'Reise'), (u'Realit\xe9it', u'Realit\xe4t'), (u'Realit\xe9t', u'Realit\xe4t'), (u'Rechtgl\xe9ubige', u'Rechtgl\xe4ubige'), (u'rechtm\xe9fkigen', u'rechtm\xe4\xdfigen'), (u'RECHTSANWALTE', u'RECHTSANW\xc4LTE'), (u'rechtsl', u'rechts!'), (u'Reffer', u'Retter'), (u'regelm\xe9fiige', u'regelm\xe4\xdfige'), (u'Regenh\xe9igen', u'Regenb\xf6gen'), (u'Regenm\xe9ntel', u'Regenm\xe4ntel'), (u'Regierungsgehirnw\xe9ischesignal', u'Regierungsgehirnw\xe4schesignal'), (u'regul\xe9re', u'regul\xe4re'), (u'reiB', u'rei\xdf'), (u'reiBt', u'rei\xdft'), (u'Reichtfimer', u'Reicht\xfcmer'), (u'Reichtllimern', u'Reicht\xfcmern'), (u'reif$', u'rei\xdf'), (u'reif$en', u'rei\xdfen'), (u'Reifiverschluss', u'Rei\xdfverschluss'), (u'Reil3t', u'Rei\xdft'), (u'reil5', u'rei\xdf'), (u'Reili', u'Rei\xdf'), (u'reilien', u'rei\xdfen'), (u'Reilin\xe9gel', u'Rei\xdfn\xe4gel'), (u'Reillt', u'Rei\xdft'), (u'reilZ>', u'rei\xdf'), (u'reingeh\xe9ngt', u'reingeh\xe4ngt'), (u'Reingelegtl', u'Reingelegt!'), (u'reinhupft', u'reinh\xfcpft'), (u'reinl', u'rein!'), (u'reinstilrmen', u'reinst\xfcrmen'), (u'reiohen', u'reichen'), (u'REISSVERSCHLUSSGERAUSCH', u'REISSVERSCHLUSSGER\xc4USCH'), (u'rei\ufb02', u'rei\xdf'), (u'rei\ufb02en', u'rei\xdfen'), (u'relch', u'reich'), (u'religi6s', u'religi\xf6s'), (u'religiiiser', u'religi\xf6ser'), (u'religi\xe9s', u'religi\xf6s'), (u'Rels', u'Reis'), (u'Rentenbezuge', u'Rentenbez\xfcge'), (u'Repr\xe9sentantin', u'Repr\xe4sentantin'), (u'Rettungsflofi', u'Rettungsflo\xdf'), (u'Rev/er', u'Revier'), (u'rfiber', u'r\xfcber'), (u'rfiberwachsen', u'r\xfcberwachsen'), (u'Rfickseite', u'R\xfcckseite'), (u'rfihrselige', u'r\xfchrselige'), (u'rfilpse', u'r\xfclpse'), (u'Rfissel', u'R\xfcssel'), (u'RGMISCHE', u'R\xd6MISCHE'), (u'Richer', u'R\xe4cher'), (u'Riesenhfipfer', u'Riesenh\xfcpfer'), (u'Riesenspafi', u'Riesenspa\xdf'), (u'Riesentijr', u'Riesent\xfcr'), (u'riiber', u'r\xfcber'), (u'Riicheln', u'R\xf6cheln'), (u'riichelt', u'r\xf6chelt'), (u'Riick', u'R\xfcck'), (u'Riickblickend', u'R\xfcckblickend'), (u'Riicken', u'R\xfccken'), (u'Riickenlage', u'R\xfcckenlage'), (u'Riickenwind', u'R\xfcckenwind'), (u'riicksichtslos', u'r\xfccksichtslos'), (u'Riicksichtslosigkeit', u'R\xfccksichtslosigkeit'), (u'Riicksitz', u'R\xfccksitz'), (u'Riickw\xe9irts', u'R\xfcckw\xe4rts'), (u'Riickzug', u'R\xfcckzug'), (u'Riick\ufb02ug', u'R\xfcck\ufb02ug'), (u'riihrt', u'r\xfchrt'), (u'Riilpsen', u'R\xfclpsen'), (u'riilpst', u'r\xfclpst'), (u'Riimischen', u'R\xf6mischen'), (u'Riistung', u'R\xfcstung'), (u'Riiumlichkeiten', u'R\xe4umlichkeiten'), (u'Rijbe', u'R\xfcbe'), (u'rijber', u'r\xfcber'), (u'rijckgfingig', u'r\xfcckg\xe4ngig'), (u'rijckw\xe9irts', u'r\xfcckw\xe4rts'), (u'Rijsseltierl', u'R\xfcsseltier!'), (u'Rilbe', u'R\xfcbe'), (u'rilber', u'r\xfcber'), (u'rilberkommen', u'r\xfcberkommen'), (u'Rilckkehr', u'R\xfcckkehr'), (u'rilcksichtsloses', u'r\xfccksichtsloses'), (u'rilckw\xe9rts', u'r\xfcckw\xe4rts'), (u'Rillpsen', u'R\xfclpsen'), (u'Riol', u'Rio!'), (u'Rivalit\xe9t', u'Rivalit\xe4t'), (u"rL'lber", u'r\xfcber'), (u"RL'lhr", u'R\xfchr'), (u'rllicken', u'r\xfccken'), (u'rllickt', u'r\xfcckt'), (u'Rlllckgrat', u'R\xfcckgrat'), (u'Rlnge', u'Ringe'), (u'Rlumgerate', u'R\xe4umger\xe4te'), (u'ROMISCHE', u'R\xd6MISCHE'), (u'ROMISCHEN', u'R\xd6MISCHEN'), (u'rosa\xe9ugiges', u'rosa\xe4ugiges'), (u'rotiugiger', u'rot\xe4ugiger'), (u'Rotk\xe9ppchen', u'Rotk\xe4ppchen'), (u'Rott\xe9nen', u'Rott\xf6nen'), (u'Routinetlberprijfung', u'Routine\xfcberpr\xfcfung'), (u'Rticken', u'R\xfccken'), (u'rticksichtslos', u'r\xfccksichtslos'), (u'rtlber', u'r\xfcber'), (u'Rtlckseite', u'R\xfcckseite'), (u'ruber', u'r\xfcber'), (u'Ruberrutschen', u'R\xfcberrutschen'), (u'Ruckblende', u'R\xfcckblende'), (u'Ruckblick', u'R\xfcckblick'), (u'Rucken', u'R\xfccken'), (u'Ruckenlage', u'R\xfcckenlage'), (u'Ruckenwind', u'R\xfcckenwind'), (u'Ruckfall', u'R\xfcckfall'), (u'Ruckfrage', u'R\xfcckfrage'), (u'Ruckgriff', u'R\xfcckgriff'), (u'Ruckkehr', u'R\xfcckkehr'), (u'Rucksitz', u'R\xfccksitz'), (u'Ruckzugl', u'R\xfcckzug!'), (u'ruhlg', u'ruhig'), (u'ruhrenl', u'r\xfchren!'), (u'Ruhrt', u'R\xfchrt'), (u'Rul3', u'Ru\xdf'), (u'Rumgebrfillel', u'Rumgebr\xfclle!'), (u'rumhingen', u'rumh\xe4ngen'), (u'rumh\xe9ngen', u'rumh\xe4ngen'), (u'rumh\xe9ngst', u'rumh\xe4ngst'), (u'ruml\xe9uft', u'ruml\xe4uft'), (u'rumwuhlen', u'rumw\xfchlen'), (u'rumzuf\ufb02hren', u'rumzuf\xfchren'), (u'rum\xe9rgern', u'rum\xe4rgern'), (u'runterffihrt', u'runterf\xe4hrt'), (u'runtergespillt', u'runtergesp\xfclt'), (u'runtergesp\ufb02lt', u'runtergesp\xfclt'), (u'Runterl', u'Runter!'), (u'runterspillen', u'runtersp\xfclen'), (u'runterspllllen', u'runtersp\xfclen'), (u'runtersp\xfclt', u'runter-sp\xfclt'), (u'runtervverfen', u'runterwerfen'), (u'Rupem', u'Rupert!'), (u'Rustung', u'R\xfcstung'), (u'r\xe9che', u'r\xe4che'), (u'r\xe9chen', u'r\xe4chen'), (u'R\xe9cher', u'R\xe4cher'), (u'r\xe9cht', u'r\xe4cht'), (u'R\xe9der', u'R\xe4der'), (u'R\xe9dern', u'R\xe4dern'), (u'R\xe9hre', u'R\xf6hre'), (u'R\xe9idern', u'R\xe4dern'), (u'R\xe9itsel', u'R\xe4tsel'), (u'r\xe9itseln', u'r\xe4tseln'), (u'r\xe9itst', u'r\xe4tst'), (u'R\xe9iume', u'R\xe4ume'), (u'R\xe9mern', u'R\xf6mern'), (u'r\xe9mische', u'r\xf6mische'), (u'r\xe9mischen', u'r\xf6mischen'), (u'r\xe9mischer', u'r\xf6mischer'), (u'R\xe9nder', u'R\xe4nder'), (u'R\xe9nke', u'R\xe4nke'), (u'R\xe9nken', u'R\xe4nken'), (u'R\xe9ntgenaufnahme', u'R\xf6ntgenaufnahme'), (u'R\xe9ntgenbild', u'R\xf6ntgenbild'), (u'R\xe9son', u'R\xe4son'), (u'r\xe9t', u'r\xe4t'), (u'R\xe9tsel', u'R\xe4tsel'), (u'r\xe9tselhaft', u'r\xe4tselhaft'), (u'R\xe9tselhaftes', u'R\xe4tselhaftes'), (u'R\xe9ume', u'R\xe4ume'), (u'R\xe9umen', u'R\xe4umen'), (u'R\xe9umlichkeiten', u'R\xe4umlichkeiten'), (u'R\xe9umt', u'R\xe4umt'), (u'r\xe9uspert', u'r\xe4uspert'), (u'R\ufb02be', u'R\xfcbe'), (u'r\ufb02bergeguckt', u'r\xfcbergekuckt'), (u'R\ufb02ckkehr', u'R\xfcckkehr'), (u'S/e', u'Sie'), (u's/nd', u'sind'), (u'S5tze', u'S\xe4tze'), (u'S6hne', u'S\xf6hne'), (u'saB', u'sa\xdf'), (u'Sachverstlndiger', u'Sachverst\xe4ndiger'), (u'sagf', u'sagt'), (u'sagfen', u'sagten'), (u'Sammlerstiicken', u'Sammlerst\xfccken'), (u'Sands\xe9cke', u'Sands\xe4cke'), (u'Sanftmiltigen', u'Sanftm\xfctigen'), (u'Sanierungsbeh\xe9rde', u'Sanierungsbeh\xf6rde'), (u'Sanit\xe9ter', u'Sanit\xe4ter'), (u'Sargn\xe9gel', u'Sargn\xe4gel'), (u'sari', u'sa\xdf'), (u'Satellitenschijssel', u'Satellitensch\xfcssel'), (u'Satellitenschusseln', u'Satellitensch\xfcsseln'), (u'Satellitenuberwachung', u'Satelliten\xfcberwachung'), (u'Saugf\ufb02flsen', u'Saugf\xfc\xdfen'), (u'sc/10/1', u'schon'), (u'sc/16/1', u'sch\xf6n'), (u'sch/cken', u'schicken'), (u'Sch/ffe', u'Schiffe'), (u'sch6n', u'sch\xf6n'), (u'Schadeniiberpriifung', u'Schaden\xfcberpr\xfcfung'), (u'Schadenuberprtlfung', u'Schaden\xfcberpr\xfcfung'), (u'Scharfschijtze', u'Scharfsch\xfctze'), (u'schbn', u'sch\xf6n'), (u"schc'\xa7n", u'sch\xf6n'), (u'Schdn', u'Sch\xf6n'), (u'schdnen', u'sch\xf6nen'), (u'Schecksl', u'Schecks!'), (u'ScheiB', u'Schei\xdf'), (u'ScheiBe', u'Schei\xdfe'), (u'scheiBegal', u'schei\xdfegal'), (u'Scheif$e', u'Schei\xdfe'), (u'scheiffsel', u'schei\xdfe!'), (u'Scheifi', u'Schei\xdf'), (u'Scheifiding', u'Schei\xdfding'), (u'scheifie', u'schei\xdfe'), (u'Scheifiel', u'Schei\xdfe!'), (u'Scheifier', u'Schei\xdfer'), (u'Scheifihelm', u'Schei\xdfhelm'), (u'Scheifiloch', u'Schei\xdfloch'), (u'Scheifipascha', u'Schei\xdfpascha'), (u'Scheifisofa', u'Schei\xdfsofa'), (u'Scheifiweiber', u'Schei\xdfweiber'), (u'Scheifle', u'Schei\xdfe'), (u'Scheiiislangweilig', u'Schei\xdflangweilig'), (u"Scheil'$e", u'Schei\xdfe'), (u'Scheil3>er', u'Schei\xdfer'), (u'Scheil3e', u'Schei\xdfe'), (u'Scheili', u'Schei\xdf'), (u'Scheilie', u'Schei\xdfe'), (u'scheilien', u'schei\xdfen'), (u'Scheille', u'Schei\xdfe'), (u'Scheillel', u'Schei\xdfe!'), (u'ScheilSe', u'Schei\xdfe'), (u'ScheilZ>', u'Schei\xdf'), (u'Scheir$oling', u'Schei\xdfding'), (u'scheissegal', u'schei\xdfegal'), (u'Scheisskarre', u'Schei\xdfkarre'), (u'Schei\ufb02e', u'Schei\xdfe'), (u'scheme', u'schei\xdfe'), (u'scheuf$lich', u'scheu\xdflich'), (u'Scheulilich', u'Scheu\xdflich'), (u'schfichtern', u'sch\xfcchtern'), (u'schfimen', u'sch\xe4men'), (u'schfin', u'sch\xf6n'), (u'Schfine', u'Sch\xf6ne'), (u'schfinen', u'sch\xf6nen'), (u'Schfines', u'Sch\xf6nes'), (u'schfirfer', u'sch\xe4rfer'), (u'Schfissel', u'Sch\xfcssel'), (u'Schfitzchen', u'Sch\xe4tzchen'), (u'schfjnes', u'sch\xf6nes'), (u'Schideln', u'Sch\xe4deln'), (u'schief$en', u'schie\xdfen'), (u'Schief3>en', u'Schie\xdfen'), (u'Schiefien', u'Schie\xdfen'), (u'schiefit', u'schie\xdft'), (u'schiefZ>t', u'schie\xdft'), (u"schiel'5", u'schie\xdf'), (u'Schiel3t', u'Schie\xdft'), (u'schiellen', u'schie\xdfen'), (u'Schielmbung', u'Schie\xdf\xfcbung'), (u'schie\ufb02en', u'schie\xdfen'), (u'schie\ufb02t', u'schie\xdft'), (u'Schiffs\xe9rzte', u'Schiffs\xe4rzte'), (u'Schiffzerstfiren', u'Schiff zerst\xf6ren'), (u'Schifies', u'Schiffes'), (u'Schiidel', u'Sch\xe4del'), (u'schiilzen', u'sch\xe4tzen'), (u'schiin', u'sch\xf6n'), (u'schiine', u'sch\xf6ne'), (u'Schiinen', u'Sch\xf6nen'), (u'Schiiner', u'Sch\xf6ner'), (u'schiines', u'sch\xf6nes'), (u'Schiinheit', u'Sch\xf6nheit'), (u'Schiipfer', u'Sch\xf6pfer'), (u'Schiipfung', u'Sch\xf6pfung'), (u'Schiisse', u'Sch\xfcsse'), (u'Schiitt', u'Sch\xfctt'), (u'Schiittelfrost', u'Sch\xfcttelfrost'), (u'schiitten', u'sch\xfctten'), (u'schiittet', u'sch\xfcttet'), (u'schiitze', u'sch\xe4tze'), (u'schiitzen', u'sch\xfctzen'), (u'schiitzt', u'sch\xfctzt'), (u'schijn', u'sch\xf6n'), (u'Schijnes', u'Sch\xf6nes'), (u'schijng', u'sch\xf6n!'), (u'Schijssel', u'Sch\xfcssel'), (u'schijttelt', u'sch\xfcttelt'), (u'Schijtze', u'Sch\xfctze'), (u'schijtzen', u'sch\xfctzen'), (u'Schildkr\xe9te', u'Schildkr\xf6te'), (u'Schilrze', u'Sch\xfcrze'), (u'Schilsse', u'Sch\xfcsse'), (u'schiltten', u'sch\xfctten'), (u'schiltzen', u'sch\xfctzen'), (u'schimte', u'sch\xe4mte'), (u'Schizophrenia', u'Schizophrenie'), (u'Schi\xe9tze', u'Sch\xe4tze'), (u'Schlachtgetllimmels', u'Schlachtget\xfcmmels'), (u'Schlachtschifl', u'Schlachtschiff'), (u'schlafenl', u'schlafen!'), (u'Schlafk\xe9fern', u'Schlafk\xe4fern'), (u'Schlafmiitzenl', u'Schlafm\xfctzen!'), (u'Schlafm\ufb02tzel', u'Schlafm\xfctze!'), (u'Schlangeng\xe9ttin', u'Schlangeng\xf6ttin'), (u'Schlappschw\xe9nze', u'Schlappschw\xe4nze'), (u'Schlaumeierl', u'Schlaumeier!'), (u'schlechf', u'schlecht'), (u'Schlelistiinde', u'Schie\xdfst\xe4nde'), (u'Schlellen', u'Schie\xdfen'), (u'Schle\ufb02t', u'Schie\xdft'), (u'Schlfilsselparty', u'Schl\xfcsselparty'), (u'Schlfisse', u'Schl\xfcsse'), (u'SchlieBe', u'Schlie\xdfe'), (u'schlieBen', u'schlie\xdfen'), (u'schlieBIich', u'schlie\xdflich'), (u'schlieBlich', u'schlie\xdflich'), (u'SchlieBt', u'Schlie\xdft'), (u'schlief$en', u'schlie\xdfen'), (u'Schlief$lich', u'Schlie\xdflich'), (u'schlief2>lich', u'schlie\xdflich'), (u'schlief3t', u'schlie\xdft'), (u'Schliefie', u'Schlie\xdfe'), (u'schliefien', u'schlie\xdfen'), (u'Schliefilich', u'Schlie\xdflich'), (u'schlieflslich', u'schlie\xdflich'), (u'schliel3en', u'schlie\xdfen'), (u'schliel3lich', u'schlie\xdflich'), (u'Schliel5t', u'Schlie\xdft'), (u'schlielie', u'schlie\xdfe'), (u'schlielien', u'schlie\xdfen'), (u'schlielilich', u'schlie\xdflich'), (u'schliellsen', u'schlie\xdfen'), (u'SchlielSt', u'Schlie\xdft'), (u'Schliissel', u'Schl\xfcssel'), (u'Schliissell', u'Schl\xfcssel!'), (u'Schliisselmoment', u'Schl\xfcsselmoment'), (u'Schliisseln', u'Schl\xfcsseln'), (u'Schlijsse', u'Schl\xfcsse'), (u'Schlijssel', u'Schl\xfcssel'), (u'Schlijsselloch', u'Schl\xfcsselloch'), (u'Schlilssel', u'Schl\xfcssel'), (u'Schlilssell', u'Schl\xfcssel'), (u'Schlilsselparty', u'Schl\xfcsselparty'), (u'schlimmsterAlbtraum', u'schlimmster Albtraum'), (u'Schlle\ufb02en', u'Schlie\xdfen'), (u'Schllisse', u'Sch\xfcsse'), (u'schllitze', u'sch\xfctze'), (u'schllitzen', u'sch\xfctzen'), (u'Schlllissell', u'Schl\xfcssel!'), (u'Schlull', u'Schluss'), (u'Schlupfern', u'Schl\xfcpfern'), (u'Schlusselmoment', u'Schl\xfcsselmoment'), (u'Schlusselszenen', u'Schl\xfcsselszenen'), (u'Schlusselw\xe9rter', u'Schlusselw\xf6rter'), (u'Schlussl', u'Schluss!'), (u'Schlu\xdf', u'Schluss'), (u'Schl\xe9chter', u'Schl\xe4chter'), (u'schl\xe9fst', u'schl\xe4fst'), (u'Schl\xe9ft', u'Schl\xe4ft'), (u'Schl\xe9ge', u'Schl\xe4ge'), (u'Schl\xe9ger', u'Schl\xe4ger'), (u'Schl\xe9gerei', u'Schl\xe4gerei'), (u'schl\xe9gt', u'schl\xe4gt'), (u'schl\xe9ift', u'schl\xe4ft'), (u'schl\xe9igst', u'schl\xe4gst'), (u'Schl\ufb02ssel', u'Schl\xfcssel'), (u'Schmatzger\xe9usche', u'Schmatzger\xe4usche'), (u'SchmeiBt', u'Schmei\xdft'), (u'Schmeif$', u'Schmei\xdf'), (u'Schmeif$t', u'Schmei\xdft'), (u'Schmeifien', u'Schmei\xdfen'), (u'schmeifit', u'schmei\xdft'), (u'Schmeilit', u'Schmei\xdft'), (u'Schmei\ufb02', u'Schmei\xdf'), (u'Schmier\xe9l', u'Schmier\xf6l'), (u'schmiicken', u'schm\xfccken'), (u'schmilztl', u'schmilzt!'), (u'schmi\ufb02', u'schmiss'), (u'Schmuckk\xe9stchen', u'Schmuckk\xe4stchen'), (u'Schmuckstiick', u'Schmuckst\xfcck'), (u'Schnappschijsse', u'Schnappsch\xfcsse'), (u'Schnauzel', u'Schnauze!'), (u'Schneegest\xe9ber', u'Schneegest\xf6ber'), (u'Schneidez\xe9hnen', u'Schneidez\xe4hnen'), (u'Schneidez\xe9ihne', u'Schneidez\xe4hne'), (u'schnellf', u'schnell!'), (u'Schnfiffeln', u'Schn\xfcffeln'), (u'schnfiffelnl', u'schn\xfcffeln!'), (u'schnfiffelst', u'schn\xfcffelst'), (u'Schnfirsenkel', u'Schn\xfcrsenkel'), (u'schniiffele', u'schn\xfcffele'), (u'schnijffelt', u'schn\xfcffelt'), (u'Schnilffeln', u'Schn\xfcffeln'), (u'schnilrt', u'schn\xfcrt'), (u'Schnitzereigesch\xe9ft', u'Schnitzereigesch\xe4ft'), (u'Schniuzer', u'Schn\xe4uzer'), (u'Schnuoki', u'Schnucki'), (u'Schn\xe9ppchen', u'Schn\xe4ppchen'), (u'SchoB', u'Scho\xdf'), (u'Schofk', u'Scho\xdf'), (u'ScholShund', u'Scho\xdfhund'), (u'Schones', u'Sch\xf6nes'), (u'schonl', u'schon!'), (u'schopferische', u'sch\xf6pferische'), (u'scho\xdf', u'schoss'), (u'Schrankw\xe9nde', u'Schrankw\xe4nde'), (u'Schraubenschlijssel', u'Schraubenschl\xfcssel'), (u'schrecklichl', u'schrecklich!'), (u'Schriftist', u'Schrift ist'), (u'Schriftstijcks', u'Schriftst\xfccks'), (u'schr\xe9ge', u'schr\xe4ge'), (u'Schr\xe9ges', u'Schr\xe4ges'), (u'Schr\xe9nke', u'Schr\xe4nke'), (u'Schr\xe9nken', u'Schr\xe4nken'), (u'schtin', u'sch\xf6n'), (u'schtine', u'sch\xf6ne'), (u'Schtisse', u'Sch\xfcsse'), (u'schuchtern', u'sch\xfcchtern'), (u'Schuchterne', u'Sch\xfcchterne'), (u'Schuhl', u'Schuh!'), (u'Schuldgeftihlen', u'Schuldgef\xfchlen'), (u'Schulterl', u'Schulter!'), (u'Schutzen', u'Sch\xfctzen'), (u'Schutzr\xe9ume', u'Schutzr\xe4ume'), (u'SCHUTZT', u'SCH\xdcTZT'), (u"Schw6r's", u"Schw\xf6r's"), (u'Schwachkop\ufb02', u'Schwachkop!'), (u'Schwanzlutscherl', u'Schwanzlutscher!'), (u'Schwarzh\xe9ndler', u'Schwarzh\xe4ndler'), (u'Schwarzweills', u'Schwarzwei\xdf'), (u'schwei\ufb02durchnisst', u'schwei\xdfdurchn\xe4sst'), (u'schwerh\xe9rig', u'schwerh\xf6rig'), (u'schwiicht', u'schw\xe4cht'), (u'schwiire', u'schw\xf6re'), (u'schwiiren', u'schw\xf6ren'), (u'Schwimmanziige', u'Schwimmanz\xfcge'), (u'schwi\xe9rmten', u'schw\xe4rmten'), (u'schwnre', u'schw\xf6re'), (u'Schw\xe9che', u'Schw\xe4che'), (u'Schw\xe9chen', u'Schw\xe4chen'), (u'schw\xe9cher', u'schw\xe4cher'), (u'schw\xe9cheren', u'schw\xe4cheren'), (u'schw\xe9chsten', u'schw\xe4chsten'), (u'Schw\xe9icheanfall', u'Schw\xe4cheanfall'), (u'Schw\xe9ichen', u'Schw\xe4chen'), (u'schw\xe9icher', u'schw\xe4cher'), (u'Schw\xe9ichling', u'Schw\xe4chling'), (u'Schw\xe9irmerei', u'Schw\xe4rmerei'), (u'schw\xe9irzeste', u'schw\xe4rzeste'), (u'Schw\xe9mme', u'Schw\xe4mme'), (u'schw\xe9re', u'schw\xf6re'), (u'schw\xe9ren', u'schw\xf6ren'), (u'Schw\xe9rme', u'Schw\xe4rme'), (u'schw\xe9rmt', u'schw\xe4rmt'), (u'schw\xe9rmte', u'schw\xe4rmte'), (u'Schw\xe9tzer', u'Schw\xe4tzer'), (u'sch\xe9biger', u'sch\xe4biger'), (u'Sch\xe9del', u'Sch\xe4del'), (u'Sch\xe9den', u'Sch\xe4den'), (u'Sch\xe9inder', u'Sch\xe4nder'), (u'sch\xe9ine', u'sch\xf6ne'), (u'sch\xe9inen', u'sch\xf6nen'), (u'Sch\xe9iner', u'Sch\xf6ner'), (u'sch\xe9irfen', u'sch\xe4rfen'), (u'sch\xe9le', u'sch\xe4le'), (u'sch\xe9me', u'sch\xe4me'), (u'Sch\xe9n', u'Sch\xf6n'), (u'sch\xe9ne', u'sch\xf6ne'), (u'Sch\xe9nen', u'Sch\xf6nen'), (u'Sch\xe9ner', u'Sch\xf6ner'), (u'Sch\xe9nes', u'Sch\xf6nes'), (u'Sch\xe9nheit', u'Sch\xf6nheit'), (u'sch\xe9nl', u'sch\xf6n!'), (u'sch\xe9nste', u'sch\xf6nste'), (u'sch\xe9nsten', u'sch\xf6nsten'), (u'sch\xe9nstes', u'sch\xf6nstes'), (u'Sch\xe9tzchen', u'Sch\xe4tzchen'), (u'Sch\xe9tze', u'Sch\xe4tze'), (u'sch\xe9tzen', u'sch\xe4tzen'), (u'sch\xe9tzt', u'sch\xe4tzt'), (u'Sch\xe9tzung', u'Sch\xe4tzung'), (u'Sch\xe9umen', u'Sch\xe4umen'), (u'sch\ufb02chtern', u'sch\xfcchtern'), (u"SCl'1lUSS6l", u'Schl\xfcssel'), (u'Scllrift', u'Schrift'), (u'scmoss', u'SCHLOSS'), (u'se/n', u'sein'), (u'Se/wen', u'Sehen'), (u'sehenl', u'sehen!'), (u'Sehenswlllrdigkeiten', u'Sehensw\xfcrdigkeiten'), (u'Sehnsilchte', u'Sehns\xfcchte'), (u'sehrangespannt', u'sehr angespannt'), (u'sehrjung', u'sehr jung'), (u'Sehrwohl', u'Sehr wohl'), (u'sehrzufrieden', u'sehr zufrieden'), (u'sehtjetzt', u'seht jetzt'), (u'Seidenglattl', u'Seidenglatt!'), (u'seidjetzt', u'seid jetzt'), (u'Seitwann', u'Seit wann'), (u'SEKRETARIN', u'SEKRET\xc4RIN'), (u'Sekretiir', u'Sekret\xe4r'), (u'Sekretir', u'Sekret\xe4r'), (u'Sekret\xe9irin', u'Sekret\xe4rin'), (u'Sekret\xe9rin', u'Sekret\xe4rin'), (u'sel/g', u'selig'), (u'selbstl', u'selbst!'), (u'selbststiindig', u'selbstst\xe4ndig'), (u'selbstsuchtige', u'selbsts\xfcchtige'), (u'selbstverstindlich', u'selbstverst\xe4ndlich'), (u'Selbstverstlndlich', u'Selbstverst\xe4ndlich'), (u'Selbstverst\xe9indlich', u'Selbstverst\xe4ndlich'), (u'Selbstverst\xe9ndlich', u'Selbstverst\xe4ndlich'), (u'seld', u'seid'), (u'selhst', u'selbst'), (u'SeligerVater', u'Seliger Vater'), (u'seln', u'sein'), (u'Selt', u'Seit'), (u'sentimalen', u'sentimentalen'), (u'seri\xe9ser', u'seri\xf6ser'), (u'Sexualit\xe9t', u'Sexualit\xe4t'), (u'Sfe', u'Sie'), (u'Sfidamerikas', u'S\xfcdamerikas'), (u'Sfidwind', u'S\xfcdwind'), (u'Sfifies', u'S\xfc\xdfes'), (u'Sfihne', u'S\xf6hne'), (u'Sfildner', u'S\xf6ldner'), (u'Sfilie', u'S\xfc\xdfe'), (u'Sfilieste', u'S\xfc\xdfeste'), (u'Sfi\ufb02igkeiten', u'S\xfc\xdfigkeiten'), (u'sfnd', u'sind'), (u'SICHERHEITSBEHORDE', u'SICHERHEITSBEH\xd6RDE'), (u'Sicherheitsgrijnden', u'Sicherheitsgr\xfcnden'), (u'Sichtubervvachung', u'Sicht\xfcberwachung'), (u'Sichtunterstutzung', u'Sichtunterst\xfctzung'), (u'Sieja', u'Sie ja'), (u'Sifihnchen', u'S\xf6hnchen'), (u'Signalst\xe9rke', u'Signalst\xe4rke'), (u'Siiden', u'S\xfcden'), (u'Siidfrankreich', u'S\xfcdfrankreich'), (u'siidliche', u's\xfcdliche'), (u'siil$', u's\xfc\xdf'), (u'siili', u's\xfc\xdf'), (u'Siilie', u'S\xfc\xdfe'), (u'siilier', u's\xfc\xdfer'), (u"SIim's", u"Slim's"), (u'Siinde', u'S\xfcnde'), (u'Siinden', u'S\xfcnden'), (u'Siinder', u'S\xfcnder'), (u'siindigen', u's\xfcndigen'), (u'sii\ufb02en', u's\xfc\xdfen'), (u'siJB', u's\xfc\xdf'), (u'SiJBe', u'S\xfc\xdfe'), (u'siJchtige', u's\xfcchtige'), (u'sijlien', u'si\xfc\xdfen'), (u'sijliesten', u's\xfc\xdfesten'), (u'Sijsser', u'S\xfc\xdfer'), (u'Sildtunnel', u'S\xfcdtunnel'), (u'Silfie', u'S\xfc\xdfe'), (u'Silfier', u'S\xfc\xdfer'), (u'Silfies', u'S\xfc\xdfes'), (u'silfker', u's\xfc\xdfer'), (u'Silnden', u'S\xfcnden'), (u'Silndenbock', u'S\xfcndenbock'), (u'sindja', u'sind ja'), (u'Sirl', u'Sir!'), (u'Sj_r', u'Sir'), (u'Skilaufen', u'Ski laufen'), (u'skrupelloserAnw\xe9lte', u'skrupelloser Anw\xe4lte'), (u"sL'lf$e", u's\xfc\xdfe'), (u'sL1B', u's\xfc\xdf'), (u'slch', u'sich'), (u'sle', u'sie'), (u'slebe', u'siebe'), (u'sLif$', u's\xfc\xdf'), (u'SLif$e', u'S\xfc\xdfe'), (u'SLif$er', u'S\xfc\xdfer'), (u'sLif$es', u's\xfc\xdfes'), (u'SLilSe', u'S\xfc\xdfe'), (u'Slliden', u'S\xfcden'), (u'Sllinde', u'S\xfcnde'), (u'sllindigen', u's\xfcndigen'), (u'Slnd', u'Sind'), (u'Slr', u'Sir'), (u'Slrs', u'Sirs'), (u'SoBen', u'So\xdfen'), (u'sofortl', u'sofort!'), (u'soh\xe9nen', u'sch\xf6nen'), (u'Solien', u'So\xdfen'), (u'sollenl', u'sollen!'), (u'SONDERMULL', u'SONDERM\xdcLL'), (u'sorgf\xe9iltig', u'sorgf\xe4ltig'), (u'sorgf\xe9ltig', u'sorgf\xe4ltig'), (u'souver\xe9ine', u'souver\xe4ne'), (u'souver\xe9inen', u'souver\xe4nen'), (u'souver\xe9ner', u'souver\xe4ner'), (u"sp'a'ter", u'sp\xe4ter'), (u'sp/elen', u'spielen'), (u'SpaB', u'Spa\xdf'), (u'Spaf$', u'Spa\xdf'), (u'Spaf2>', u'Spa\xdf'), (u'Spaffs', u'Spa\xdf'), (u'Spafi', u'Spa\xdf'), (u'Spafls', u'Spa\xdf'), (u'SpafS', u'Spa\xdf'), (u"Spal'5", u'Spa\xdf'), (u'Spal2>', u'Spa\xdf'), (u'Spal3', u'Spa\xdf'), (u'Spali', u'Spa\xdf'), (u'Spall', u'Spa\xdf'), (u'Spass', u'Spa\xdf'), (u'spat', u'sp\xe4t'), (u'spektakular', u'spektakul\xe4r'), (u'Spell', u'Sp\xe4\xdf'), (u'Spells', u'Sp\xe4\xdf'), (u'Spell\xbb', u'Spa\xdf'), (u'Spezialit\xe9t', u'Spezialit\xe4t'), (u'spfit', u'sp\xe4t'), (u'SpieB', u'Spie\xdf'), (u'spief$ig', u'spie\xdfig'), (u'Spielzeuggeschfiftn', u'Spielzeuggesch\xe4ft--'), (u'spiilte', u'sp\xfclte'), (u'spiiren', u'sp\xfcren'), (u'spiirt', u'sp\xfcrt'), (u'spiit', u'sp\xe4t'), (u'spijre', u'sp\xfcre'), (u'spijren', u'sp\xfcren'), (u'spijrt', u'sp\xfcrt'), (u'Spillmeier', u'Sp\xfclmeier'), (u'spilre', u'sp\xfcre'), (u'spilren', u'sp\xfcren'), (u'spit', u'sp\xe4t'), (u'Spitzenfriihstiick', u'Spitzenfr\xfchst\xfcck'), (u"spLir's", u"sp\xfcr's"), (u'splliren', u'sp\xfcren'), (u'splter', u'sp\xe4ter'), (u'Sportilbertragung', u'Sport\xfcbertragung'), (u'Sportsfraund', u'Sportsfreund'), (u'Sprachpijppchen', u'Sprachp\xfcppchen'), (u'SPRACHPUPPCHEN', u'SPRACHP\xdcPPCHEN'), (u'Spriichlein', u'Spr\xfcchlein'), (u'Sprilht', u'Spr\xfcht'), (u'spr\xe9che', u'spr\xe4che'), (u'spr\xe9chen', u'spr\xe4chen'), (u'spr\xe9chet', u'spr\xe4chet'), (u'Spr\ufb02che', u'Spr\xfcche'), (u'spr\ufb02ht', u'spr\xfcht'), (u'spUl', u'sp\xfcl'), (u'spUr', u'sp\xfcr'), (u'spurbare', u'sp\xfcrbare'), (u'spUrt', u'sp\xfcrt'), (u'sp\xa7ter', u'sp\xe4ter'), (u'Sp\xe4\xdf', u'Spa\xdf'), (u'sp\xe9it', u'sp\xe4t'), (u'sp\xe9iter', u'sp\xe4ter'), (u'sp\xe9t', u'sp\xe4t'), (u'Sp\xe9ter', u'Sp\xe4ter'), (u'Sp\xe9tzchen', u'Sp\xe4tzchen'), (u'Sp\xe9tzchenl', u'Sp\xe4tzchen!'), (u'ssh', u'sah'), (u'st6Bt', u'st\xf6\xdft'), (u'st6hnt', u'st\xf6hnt'), (u'st6lSt', u'st\xf6\xdft'), (u'St6rt', u'St\xf6rt'), (u'ST@HNT', u'ST\xd6HNT'), (u'Staatsaff\xe9ren', u'Staatsaff\xe4ren'), (u'staatsbllirgerliches', u'staatsb\xfcrgerliches'), (u'Staatsgesch\xe9fte', u'Staatsgesch\xe4fte'), (u'Standardan\xe9sthesie', u'Standardan\xe4sthesie'), (u'standig', u'st\xe4ndig'), (u'STARSCREAMI', u'STARSCREAM:'), (u'station\xe9r', u'station\xe4r'), (u'Statusmeldungl', u'Statusmeldung!'), (u'stdrte', u'st\xf6rte'), (u'stecktjede', u'steckt jede'), (u'Stehenbleiben', u'Stehen bleiben'), (u'Stehvermiigen', u'Stehverm\xf6gen'), (u'Steigbilgeldinger', u'Steigb\xfcgeldinger'), (u'Steinh\xe9user', u'Steinh\xe4user'), (u'Sternenkijsse', u'Sternenk\xfcsse'), (u'Steuererkl\xe9rung', u'Steuererkl\xe4rung'), (u'Steuererkl\xe9rungen', u'Steuererkl\xe4rungen'), (u'Steuerprtifer', u'Steuerpr\xfcfer'), (u'Steuerprtifung', u'Steuerpr\xfcfung'), (u'Steuersiitzen', u'Steuers\xe4tzen'), (u'stfipseln', u'st\xf6pseln'), (u'stfiren', u'st\xf6ren'), (u'stfirker', u'st\xe4rker'), (u'Stfirt', u'St\xf6rt'), (u'stfirzt', u'st\xfcrzt'), (u'stieB', u'stie\xdf'), (u'Stiefbriider', u'Stiefbr\xfcder'), (u'Stiicke', u'St\xfccke'), (u'Stiihle', u'St\xfchle'), (u'Stiihlen', u'St\xfchlen'), (u'stiihnt', u'st\xf6hnt'), (u'Stiillen', u'St\xe4llen'), (u'Stiire', u'St\xf6re'), (u'stiiren', u'st\xf6ren'), (u'Stiirme', u'St\xfcrme'), (u'stiirmischen', u'st\xfcrmischen'), (u'Stiirsignale', u'St\xf6rsignale'), (u'stiirt', u'st\xf6rt'), (u'Stiirung', u'St\xf6rung'), (u'stiirzen', u'st\xfcrzen'), (u'Stiitzpunkt', u'St\xfctzpunkt'), (u'Stijck', u'St\xfcck'), (u'Stijckchen', u'St\xfcckchen'), (u'Stijcke', u'St\xfccke'), (u'stijhle', u'st\xfchle'), (u'stijrme', u'st\xfcrme'), (u'stijrzen', u'st\xfcrzen'), (u'Stilck', u'St\xfcck'), (u'Stilcke', u'St\xfccke'), (u'Stillckchen', u'St\xfcckchen'), (u'Stillst\xe9nde', u'Stillst\xe4nde'), (u'Stilvolll', u'Stilvoll!'), (u'stinden', u'st\xe4nden'), (u'Stldseite', u'S\xfcdseite'), (u'stleg', u'stieg'), (u'Stllihle', u'St\xfchle'), (u'Stllirmen', u'St\xfcrmen'), (u'stllirzt', u'st\xfcrzt'), (u'stlllrzen', u'st\xfcrzen'), (u'Stl\ufb02', u'Stift'), (u'sto/3en', u'sto\xdfen'), (u'StoB', u'Sto\xdf'), (u'stoBe', u'sto\xdfe'), (u'stof$en', u'sto\xdfen'), (u'Stofi', u'Sto\xdf'), (u'STOHNT', u'ST\xd6HNT'), (u'Stol3zahn', u'Sto\xdfzahn'), (u'Stol3zeit', u'Sto\xdfzeit'), (u'stolie', u'sto\xdfe'), (u'Storung', u'St\xf6rung'), (u'Str6men', u'Str\xf6men'), (u'str6mt', u'str\xf6mt'), (u'StraBe', u'Stra\xdfe'), (u'StraBen', u'Stra\xdfen'), (u'StraBenk6tern', u'Stra\xdfenk\xf6tern'), (u'Straf$e', u'Stra\xdfe'), (u'Strafiengang', u'Stra\xdfengang'), (u'Strafienratten', u'Stra\xdfenratten'), (u'Strafienschlacht', u'Stra\xdfenschlacht'), (u'Straflsenecke', u'Stra\xdfenecke'), (u'Straflsenmaler', u'Stra\xdfenmaler'), (u'Straflsenschilder', u'Stra\xdfenschilder'), (u'Straft\xe9ter', u'Straft\xe4ter'), (u'Strahlenschutzger\xe9t', u'Strahlenschutzger\xe4t'), (u'Strahlungsintensit\xe9t', u'Strahlungsintensit\xe4t'), (u'Stral3en', u'Stra\xdfen'), (u'Stral5e', u'Stra\xdfe'), (u'Stralie', u'Stra\xdfe'), (u'Straliengang', u'Stra\xdfengang'), (u'Stralienk\xe9ter', u'Stra\xdfenk\xf6ter'), (u'Straliensperre', u'Stra\xdfensperre'), (u'Streitkr\xe9fte', u'Streitkr\xe4fte'), (u'Streitkr\xe9ften', u'Streitkr\xe4ften'), (u'Streit\xe9xte', u'Streit\xe4xte'), (u'strfimten', u'str\xf6mten'), (u'Striimen', u'Str\xf6men'), (u'Striimungen', u'Str\xf6mungen'), (u'Stromschliige', u'Stromschl\xe4ge'), (u'Stromschnellenl', u'Stromschnellen!'), (u'Stromung', u'Str\xf6mung'), (u'Strullerl', u'Struller!'), (u'Str\xe9mung', u'Str\xf6mung'), (u'Str\xe9mungen', u'Str\xf6mungen'), (u'sturzte', u'st\xfcrzte'), (u'STUTZPUNKT', u'ST\xdcTZPUNKT'), (u'St\xe9be', u'St\xe4be'), (u'st\xe9hnt', u'st\xf6hnt'), (u'st\xe9hnte', u'st\xf6hnte'), (u'St\xe9idtchen', u'St\xe4dtchen'), (u'St\xe9idte', u'St\xe4dte'), (u'st\xe9indig', u'st\xe4ndig'), (u'St\xe9irke', u'St\xe4rke'), (u'st\xe9irker', u'st\xe4rker'), (u'St\xe9irkeres', u'St\xe4rkeres'), (u'st\xe9llst', u'st\xf6\xdft'), (u'St\xe9ndchen', u'St\xe4ndchen'), (u'St\xe9nder', u'St\xe4nder'), (u'St\xe9ndig', u'St\xe4ndig'), (u'st\xe9pseln', u'st\xf6pseln'), (u'st\xe9ren', u'st\xf6ren'), (u'St\xe9rke', u'St\xe4rke'), (u'St\xe9rken', u'St\xe4rken'), (u'st\xe9rker', u'st\xe4rker'), (u'St\xe9rkere', u'St\xe4rkere'), (u'st\xe9rkeres', u'st\xe4rkeres'), (u'st\xe9rkste', u'st\xe4rkste'), (u'st\xe9rst', u'st\xf6rst'), (u'st\xe9rt', u'st\xf6rt'), (u'St\xe9rung', u'St\xf6rung'), (u'St\xe9tten', u'St\xe4tten'), (u'St\ufb02ck', u'St\xfcck'), (u'St\ufb02hlen', u'St\xfchlen'), (u'sUB', u's\xfc\xdf'), (u'sUBe', u's\xfc\xdfe'), (u'Suchfeam', u'Suchteam'), (u'SUden', u'S\xfcden'), (u'Sudseite', u'S\xfcdseite'), (u'Sudwest', u'S\xfcdwest'), (u'sUf$', u's\xfc\xdf'), (u'SUf$e', u'S\xfc\xdfe'), (u'suMM\u2020', u'SUMMT'), (u'Suohet', u'Suchet'), (u'Superkr\xe9fte', u'Superkr\xe4fte'), (u'superl\xe9cherlich', u'superl\xe4cherlich'), (u"s\xa2'il3", u's\xfc\xdf'), (u'S\xe9cke', u'S\xe4cke'), (u'S\xe9ge', u'S\xe4ge'), (u's\xe9he', u's\xe4he'), (u'S\xe9hne', u'S\xf6hne'), (u'S\xe9hnen', u'S\xf6hnen'), (u'S\xe9icke', u'S\xe4cke'), (u'S\xe9inger', u'S\xe4nger'), (u'S\xe9iulen', u'S\xe4ulen'), (u'S\xe9ldner', u'S\xf6ldner'), (u's\xe9mfl/che', u's\xe4mtliche'), (u's\xe9mtliche', u's\xe4mtliche'), (u's\xe9mtlichen', u's\xe4mtlichen'), (u'S\xe9nger', u'S\xe4nger'), (u'S\xe9ngerin', u'S\xe4ngerin'), (u's\xe9ubern', u's\xe4ubern'), (u's\xe9uft', u's\xe4uft'), (u's\xe9ugen', u's\xe4ugen'), (u'S\xe9ulen', u'S\xe4ulen'), (u'S\xe9urewannen', u'S\xe4urewannen'), (u'S\ufb02dh\xe9ingen', u'S\xfcdh\xe4ngen'), (u'T6chter', u'T\xf6chter'), (u'T6pfchen', u'T\xf6pfchen'), (u'T6rn', u'T\xf6rn'), (u'T6rtchen', u'T\xf6rtchen'), (u't6te', u't\xf6te'), (u'T6ten', u'T\xf6ten'), (u't6tet', u't\xf6tet'), (u'TANZERINNEN', u'T\xc4NZERINNEN'), (u'Tater', u'T\xe4ter'), (u'tats\xe9chlich', u'tats\xe4chlich'), (u'tats\xe9chliche', u'tats\xe4chliche'), (u'tats\xe9ichlich', u'tats\xe4chlich'), (u'Tatverd\xe9ichtigen', u'Tatverd\xe4chtigen'), (u'Tauchg\xe9inge', u'Tauchg\xe4nge'), (u'Tauchg\xe9nge', u'Tauchg\xe4nge'), (u'Tauschgesch\xe9fte', u'Tauschgesch\xe4fte'), (u'Tauschgesch\xe9\ufb02e', u'Tauschgesch\xe4fte'), (u'Tbrn', u'T\xf6rn'), (u'tbten', u't\xf6ten'), (u'tdten', u't\xf6ten'), (u'tdtete', u't\xf6tete'), (u'Telefongespr\xe9che', u'Telefongespr\xe4che'), (u'Tempelsch\xe9nderf', u'Tempelsch\xe4nder!'), (u'TemPO', u'Tempo'), (u'TESTGELANDE', u'TESTGEL\xc4NDE'), (u'Testvorf\ufb02hrungen', u'Testvorf\xfchrungen'), (u'tfidlich', u't\xf6dlich'), (u'tfiitet', u't\xf6tet'), (u'Tfir', u'T\xfcr'), (u'tfirkischen', u't\xfcrkischen'), (u'Tfite', u'T\xfcte'), (u'Theaterstfick', u'Theaterst\xfcck'), (u'Therapiel', u'Therapie!'), (u'Thermalger\xe9t', u'Thermalger\xe4t'), (u'Thronr\xe9uber', u'Thronr\xe4uber'), (u'Thronr\xe9uberin', u'Thronr\xe4uberin'), (u'Tiefkilhlung', u'Tiefk\xfchlung'), (u'Tiefktih/system', u'Tiefk\xfchlsystem'), (u'Tiefktihleind\xe9mmung', u'Tiefk\xfchleind\xe4mmung'), (u'TIEFKUHL', u'TIEFK\xdcHL'), (u'Tiefkuhlstasis', u'Tiefk\xfchlstasis'), (u'Tiefkuhlung', u'Tiefk\xfchlung'), (u'tiglich', u't\xe4glich'), (u'tiichtige', u't\xfcchtige'), (u'tiint', u't\xf6nt'), (u'Tiipfchen', u'T\xf6pfchen'), (u'Tiipfchennummer', u'T\xf6pfchennummer'), (u'Tiir', u'T\xfcr'), (u'Tiiren', u'T\xfcren'), (u'Tiirl', u'T\xfcr!'), (u'Tiirme', u'T\xfcrme'), (u'tiite', u't\xf6te'), (u'Tiite', u'T\xfcte'), (u'tiiten', u't\xf6ten'), (u'tiitet', u't\xf6tet'), (u'tiitete', u't\xf6tete'), (u'TiJr', u'T\xfcr'), (u'Tijrme', u'T\xfcrme'), (u'Tilr', u'T\xfcr'), (u'Tilrglocke', u'T\xfcrglocke'), (u'Tilrklingel', u'T\xfcrklingel'), (u'Tilr\xe9ffner', u'T\xfcr\xf6ffner'), (u'Tippger\xe9usch', u'Tippger\xe4usch'), (u'Tischlenuerkstatt', u'Tischlerwerkstatt'), (u"TL'lr", u'T\xfcr'), (u'tlglich', u't\xe4glich'), (u'Tllir', u'T\xfcr'), (u'Tllirkei', u'T\xfcrkei'), (u'Tlllpfelchen', u'T\xfcpfelchen'), (u'TOILETTENSPULUNG', u'TOILETTENSP\xdcLUNG'), (u'Tonl', u'Ton'), (u'Toreroabs\xe9tze', u'Toreroabs\xe4tze'), (u'Tortenb\xe9ickerin', u'Tortenb\xe4ckerin'), (u'Tragfidie', u'Trag\xf6die'), (u'Tragiidie', u'Trag\xf6die'), (u'Trag\xe9die', u'Trag\xf6die'), (u'Trainingsijbung', u'Trainings\xfcbung'), (u'TRAUMKCRPER', u'TRAUMK\xd6RPER'), (u'treffan', u'treffen'), (u'trfiumen', u'tr\xe4umen'), (u'Tribiinen', u'Trib\xfcnen'), (u"trif'f't", u'trifft'), (u'trigt', u'tr\xe4gt'), (u'Triibsal', u'Tr\xfcbsal'), (u'Triimmem', u'Tr\xfcmmern'), (u'triistllch', u'tr\xf6stlich'), (u'Triistungen', u'Tr\xf6stungen'), (u'Triiume', u'Tr\xe4ume'), (u'Trilmmer', u'Tr\xfcmmer'), (u'triume', u'tr\xe4ume'), (u'Trockenger\xe9ite', u'Trockenger\xe4te'), (u'Trockenger\xe9te', u'Trockenger\xe4te'), (u'Tropfsteinhiihle', u'Tropfsteinh\xf6hle'), (u'Trottell', u'Trottel!'), (u'Trubsal', u'Tr\xfcbsal'), (u'tr\xe9ge', u'tr\xe4ge'), (u'Tr\xe9gerschiff', u'Tr\xe4gerschiff'), (u'tr\xe9gt', u'tr\xe4gt'), (u'Tr\xe9igerschiff', u'Tr\xe4gerschiff'), (u'tr\xe9igt', u'tr\xe4gt'), (u'tr\xe9ium', u'tr\xe4um'), (u'tr\xe9iume', u'tr\xe4ume'), (u'tr\xe9iumen', u'tr\xe4umen'), (u'tr\xe9iumt', u'tr\xe4umt'), (u'tr\xe9llert', u'tr\xe4llert'), (u'Tr\xe9ne', u'Tr\xe4ne'), (u'Tr\xe9nen', u'Tr\xe4nen'), (u'Tr\xe9um', u'Tr\xe4um'), (u'tr\xe9ume', u'tr\xe4ume'), (u'Tr\xe9umen', u'Tr\xe4umen'), (u'Tr\xe9umer', u'Tr\xe4umer'), (u'tr\xe9umst', u'tr\xe4umst'), (u'Tr\xe9umt', u'Tr\xe4umt'), (u'Tschiiss', u'Tsch\xfcss'), (u'Tschiissl', u'Tsch\xfcss!'), (u'tschijss', u'tsch\xfcss'), (u'Tschtiss', u'Tsch\xfcss'), (u'tsch\xfc\xdf', u'tsch\xfcss'), (u'Tsch\ufb02s', u'Tsch\xfcs'), (u'Ttir', u'T\xfcr'), (u'ttlckisch', u't\xfcckisch'), (u'Ttlte', u'T\xfcte'), (u'tubul\xe9re', u'tubul\xe4re'), (u'Tupperschiissel', u'Tuppersch\xfcssel'), (u'TUR', u'T\xdcR'), (u'TUr', u'T\xfcr'), (u'Turen', u'T\xfcren'), (u'TURKEI', u'T\xdcRKEI'), (u'Turmwiichter', u'Turmw\xe4chter'), (u'tutjetzt', u'tut jetzt'), (u'typlschl', u'typlsch!'), (u'T\xe9chter', u'T\xf6chter'), (u't\xe9d/ichen', u't\xf6dlichen'), (u't\xe9dlich', u't\xf6dlich'), (u't\xe9dliche', u't\xf6dliche'), (u't\xe9dlichen', u't\xf6dlichen'), (u't\xe9glich', u't\xe4glich'), (u't\xe9glichen', u't\xe4glichen'), (u't\xe9iglich', u't\xe4glich'), (u't\xe9itowieren', u't\xe4towieren'), (u't\xe9itowierte', u't\xe4towierte'), (u'T\xe9itowierung', u'T\xe4towierung'), (u't\xe9iuschen', u't\xe4uschen'), (u'T\xe9ler', u'T\xe4ler'), (u'T\xe9lpell', u'T\xf6lpel!'), (u'T\xe9nze', u'T\xe4nze'), (u'T\xe9nzerin', u'T\xe4nzerin'), (u'T\xe9pfchen', u'T\xf6pfchen'), (u'T\xe9pfchenquatsch', u'T\xf6pfchenquatsch'), (u'T\xe9pfchensache', u'T\xf6pfchensache'), (u't\xe9te', u't\xf6te'), (u'T\xe9ten', u'T\xf6ten'), (u't\xe9test', u't\xe4test'), (u't\xe9tet', u't\xf6tet'), (u't\xe9tete', u't\xf6tete'), (u't\xe9towieren', u't\xe4towieren'), (u't\xe9towierte', u't\xe4towierte'), (u'T\xe9towierung', u'T\xe4towierung'), (u'T\xe9towierungen', u'T\xe4towierungen'), (u't\xe9uschen', u't\xe4uschen'), (u't\xe9uscht', u't\xe4uscht'), (u'T\xe9uschung', u'T\xe4uschung'), (u'T\xe9uschungsman\xe9ver', u'T\xe4uschungsman\xf6ver'), (u"Ub6FpFUfl'T1al", u'\xfcberpr\xfcf'), (u"Ub6l'pl'Uf\u20ac", u'\xdcberpr\xfcfe'), (u'Ube', u'\xdcbe'), (u'Ubel', u'\xfcbel'), (u'Ubelkeit', u'\xdcbelkeit'), (u'Ubelt\xe9ter', u'\xdcbelt\xe4ter'), (u'Uben', u'\xdcben'), (u'Uben/vachen', u'\xdcberwachen'), (u'Uben/vacher', u'\xdcberwacher'), (u'Uben/vacht', u'\xdcberwacht'), (u'Uben/vachungen', u'\xdcberwachungen'), (u'Uben/vachungsgesetz', u'\xdcberwachungsgesetz'), (u'Uben/vinden', u'\xfcberwinden'), (u'Uber', u'\xfcber'), (u'UBER', u'\xdcBER'), (u'Uberall', u'\xfcberall'), (u'Uberanstrenge', u'\xfcberanstrenge'), (u'Uberanstrengung', u'\xdcberanstrengung'), (u'Uberarbeiten', u'\xdcberarbeiten'), (u'UberAuf$erirdische', u'\xfcber Au\xdferirdische'), (u'Uberaus', u'\xfcberaus'), (u'Uberbleibsel', u'\xdcberbleibsel'), (u'Uberblick', u'\xdcberblick'), (u'Uberbringe', u'\xfcberbringe'), (u'Uberdauern', u'\xfcberdauern'), (u'Uberdecken', u'\xfcberdecken'), (u'Ubereinstimmung', u'\xdcbereinstimmung'), (u'Uberfahren', u'\xfcberfahren'), (u'Uberfall', u'\xdcberfall'), (u'Uberflilssig', u'\xfcberfl\xfcssig'), (u'Ubergabe', u'\xdcbergabe'), (u'Ubergaben', u'\xdcbergaben'), (u'Ubergabepunkt', u'\xdcbergabepunkt'), (u'Ubergangen', u'\xfcbergangen'), (u'Ubergangsweise', u'\xfcbergangsweise'), (u'Ubergeben', u'\xfcbergeben'), (u'Ubergehen', u'\xfcbergehen'), (u'Uberhaupt', u'\xdcberhaupt'), (u'Uberholt', u'\xdcberholt'), (u'Uberholter', u'\xfcberholter'), (u'Uberh\xe9rt', u'\xfcberh\xf6rt'), (u'Uberjemanden', u'\xfcber jemanden'), (u'Uberlagerungs', u'\xdcberlagerungs'), (u'Uberlandleitungen', u'\xdcberlandleitungen'), (u'Uberlass', u'\xdcberlass'), (u'Uberlasse', u'\xfcberlasse'), (u'Uberlassen', u'\xfcberlassen'), (u'Uberlassenl', u'\xfcberlassen!'), (u'Uberlasteten', u'\xdcberlasteten'), (u'Uberleben', u'\xdcberleben'), (u'Uberlebende', u'\xdcberlebende'), (u'Uberlebenden', u'\xdcberlebenden'), (u'Uberlebenschancen', u'\xdcberlebenschancen'), (u'Uberlebenswichtigen', u'\xfcberlebenswichtigen'), (u'Uberlebt', u'\xfcberlebt'), (u'Uberleg', u'\xfcberleg'), (u'Uberlegen', u'\xdcberlegen'), (u'Uberlegenheit', u'\xdcberlegenheit'), (u'uberlegt', u'\xfcberlegt'), (u'Uberlegten', u'\xfcberlegten'), (u'Uberleiten', u'\xfcberleiten'), (u'Uberleitung', u'\xdcberleitung'), (u'Uberlieferungen', u'\xdcberlieferungen'), (u'Uberl\xe9sst', u'\xfcberl\xe4sst'), (u'Uberm', u'\xfcberm'), (u'Ubermorgen', u'\xdcbermorgen'), (u'Ubernachtungsgast', u'\xdcbernachtungsgast'), (u'Ubernahm', u'\xfcbernahm'), (u'Ubernahme', u'\xdcbernahme'), (u'Ubernahmen', u'\xfcbernahmen'), (u'Ubernehme', u'\xfcbernehme'), (u'Ubernehmen', u'\xfcbernehmen'), (u'Ubernimmst', u'\xfcbernimmst'), (u'ubernimmt', u'\xfcbernimmt'), (u'Ubernommen', u'\xfcbernommen'), (u'Uberpriifen', u'\xfcberpr\xfcfen'), (u'Uberprilfen', u'\xfcberpr\xfcfen'), (u'Uberprliifen', u'\xdcberpr\xfcfen'), (u'Uberprufe', u'\xfcberpr\xfcfe'), (u'Uberprufen', u'\xfcberpr\xfcfen'), (u'Uberpruft', u'\xfcberpr\xfcft'), (u'Uberraschend', u'\xdcberraschend'), (u'Uberrascht', u'\xdcberrascht'), (u'Uberraschte', u'\xdcberraschte'), (u'Uberraschter', u'\xfcberraschter'), (u'Uberraschung', u'\xdcberraschung'), (u'Uberraschungen', u'\xdcberraschungen'), (u'Uberraschungl', u'\xdcberraschung!'), (u'Uberreagiert', u'\xfcberreagiert'), (u'Uberreden', u'\xfcberreden'), (u'Uberredet', u'\xdcberredet'), (u'Uberreste', u'\xdcberreste'), (u'Uberrumpeln', u'\xfcberrumpeln'), (u'Uberrumple', u'\xdcberrumple'), (u'Ubers', u'\xfcbers'), (u'Uberschl\xe9gt', u'\xdcberschl\xe4gt'), (u'Uberschreiten', u'\xdcberschreiten'), (u'Uberschritten', u'\xfcberschritten'), (u'Uberschwemmung', u'\xdcberschwemmung'), (u'Ubersehen', u'\xfcbersehen'), (u'Ubersensibilit\xe9t', u'\xdcbersensibilit\xe4t'), (u'Ubersetzung', u'\xdcbersetzung'), (u'Uberspannte', u'\xfcberspannte'), (u'Uberspielt', u'\xfcberspielt'), (u'Uberstehen', u'\xdcberstehen'), (u'Ubersteigerten', u'\xfcbersteigerten'), (u'Ubersteigt', u'\xfcbersteigt'), (u'Uberstunden', u'\xdcberstunden'), (u'Ubertraf', u'\xfcbertraf'), (u'UBERTRAGEN', u'\xdcBERTRAGEN'), (u'Ubertragen', u'\xfcbertragen'), (u'UBERTRAGUNG', u'\xdcBERTRAGUNG'), (u'ubertreibe', u'\xfcbertreibe'), (u'Ubertreiben', u'\xfcbertreiben'), (u'Ubertrieben', u'\xfcbertrieben'), (u'Ubertriebene', u'\xdcbertriebene'), (u'ubertriebener', u'\xfcbertriebener'), (u'Ubertrifft', u'\xdcbertrifft'), (u'Ubervvachen', u'\xfcberwachen'), (u'Ubervvacht', u'\xfcberwacht'), (u'Ubervvachung', u'\xdcberwachung'), (u'Ubervvachungs', u'\xdcberwachungs'), (u'Ubervvachungsstaat', u'\xdcberwachungsstaat'), (u'Ubervvachungsstaats', u'\xdcberwachungsstaats'), (u'Ubervvachungsvideos', u'\xdcberwachungsvideos'), (u'Ubervv\xe9iltigend', u'\xfcberw\xe4ltigend'), (u'Uberwachen', u'\xfcberwachen'), (u'Uberwacher', u'\xdcberwacher'), (u'Uberwachung', u'\xdcberwachung'), (u'Uberzeuge', u'\xfcberzeuge'), (u'Uberzeugen', u'\xfcberzeugen'), (u'Uberzeugend', u'\xfcberzeugend'), (u'Uberzeugt', u'\xfcberzeugt'), (u'Uberzeugung', u'\xdcberzeugung'), (u'Uberzeugungen', u'\xdcberzeugungen'), (u'Uberziehen', u'\xfcberziehen'), (u'Uberzuleiten', u'\xfcberzuleiten'), (u'ublem', u'\xfcblem'), (u'Ubler', u'\xdcbler'), (u'Ubles', u'\xdcbles'), (u'Ublich', u'\xfcblich'), (u'Ubliche', u'\xdcbliche'), (u'ublichen', u'\xfcblichen'), (u'Ubrig', u'\xfcbrig'), (u'Ubrige', u'\xdcbrige'), (u'Ubrigen', u'\xdcbrigen'), (u'Ubrigens', u'\xfcbrigens'), (u'Ubrlgens', u'\xdcbrigens'), (u'Ubrllccol', u'Ubriacco!'), (u'Ubung', u'\xdcbung'), (u'Ubungsbedingungen', u'\xdcbungsbedingungen'), (u'Ubungsschiisse', u'\xdcbungssch\xfcsse'), (u'Ubungsschusse', u'\xdcbungssch\xfcsse'), (u"Ub\u20acf'pf'Uf\u20acl'1", u'\xfcberpr\xfcfen'), (u'Uher', u'\xdcber'), (u'ultrakiistlichl', u'ultrak\xf6stlich!'), (u'umgeriistet', u'umger\xfcstet'), (u'umg\xe9nglich', u'umg\xe4nglich'), (u'umhdren', u'umh\xf6ren'), (u'umh\xe9ngt', u'umh\xe4ngt'), (u'Umschlfigen', u'Umschl\xe4gen'), (u'umschlieBt', u'umschlie\xdft'), (u'Umst\xe9inden', u'Umst\xe4nden'), (u'Umst\xe9nde', u'Umst\xe4nde'), (u'Umst\xe9nden', u'Umst\xe4nden'), (u'umst\xe9ndlich', u'umst\xe4ndlich'), (u'umweltsch\xe9dlich', u'umweltsch\xe4dlich'), (u'unabhiingiges', u'unabh\xe4ngiges'), (u'unabh\xe9ingig', u'unabh\xe4ngig'), (u'unabh\xe9ngig', u'unabh\xe4ngig'), (u'unabl\xe9ssig', u'unabl\xe4ssig'), (u'Unauff\xe9lligeres', u'Unauff\xe4lligeres'), (u'unaufhalfsam', u'unaufhaltsam'), (u'unaufhiirlich', u'unaufh\xf6rlich'), (u'unaufh\xe9rlich', u'unaufh\xf6rlich'), (u'unaufi\xe9llig', u'unauff\xe4llig'), (u'unberijhrbar', u'unber\xfchrbar'), (u'unberllihrten', u'unber\xfchrten'), (u'unbesch\xe9digt', u'unbesch\xe4digt'), (u'Uncl', u'Und'), (u'undja', u'und ja'), (u'undjeder', u'und jeder'), (u'undjemand', u'und jemand'), (u'undjetzt', u'und jetzt'), (u'undlassenihn', u'und lassen ihn'), (u'undlhnen', u'und Ihnen'), (u'undurchfuhrbar', u'undurchf\xfchrbar'), (u'uneingeschr\xe9nkten', u'uneingeschr\xe4nkten'), (u'unergrilndliche', u'unergr\xfcndliche'), (u'unerhort', u'unerh\xf6rt'), (u'unerhorte', u'unerh\xf6rte'), (u'unerkl\xe9rliche', u'unerkl\xe4rliche'), (u'unerkl\xe9rlichen', u'unerkl\xe4rlichen'), (u'unertr\xe9glich', u'unertr\xe4glich'), (u"unf'a'hig", u'unf\xe4hig'), (u'Unfahigkeit', u'Unf\xe4higkeit'), (u'unfersfellen', u'unterstellen'), (u'unfiirmigen', u'unf\xf6rmigen'), (u'unf\xe9hig', u'unf\xe4hig'), (u'unf\xe9higste', u'unf\xe4higste'), (u'unf\xe9ihigste', u'unf\xe4higste'), (u'Unf\xe9ille', u'Unf\xe4lle'), (u'Unf\xe9lle', u'Unf\xe4lle'), (u'ungef\xe9hr', u'ungef\xe4hr'), (u'ungef\xe9hre', u'ungef\xe4hre'), (u'Ungef\xe9ihr', u'Ungef\xe4hr'), (u'ungef\xe9ihrlich', u'ungef\xe4hrlich'), (u'ungemutlich', u'ungem\xfctlich'), (u'ungenugend', u'ungen\xfcgend'), (u'ungestbrt', u'ungest\xf6rt'), (u'ungewfihnliche', u'ungew\xf6hnliche'), (u'Ungewfjhnliches', u'Ungew\xf6hnliches'), (u'ungewiihnlich', u'ungew\xf6hnlich'), (u'Ungewijhnliches', u'Ungew\xf6hnliches'), (u'ungew\xe9hnlich', u'ungew\xf6hnlich'), (u'ungew\xe9hnliche', u'ungew\xf6hnliche'), (u'ungew\xe9hnlichste', u'ungew\xf6hnlichste'), (u'ungfinstigen', u'ung\xfcnstigen'), (u'ungiiltig', u'ung\xfcltig'), (u'ungilnstig', u'ung\xfcnstig'), (u'Unglaubliohl', u'Unglaublich!'), (u'unglaubwurdig', u'unglaubw\xfcrdig'), (u'Unglfiubige', u'Ungl\xe4ubige'), (u'Ungliicklicherweise', u'Ungl\xfccklicherweise'), (u'Unglilck', u'Ungl\xfcck'), (u"Ungll'Jcklichervveise", u'Ungl\xfccklicherweise'), (u'Unglllick', u'Ungl\xfcck'), (u'unglllicklich', u'ungl\xfccklich'), (u'ungllllckliche', u'ungl\xfcckliche'), (u'unglucklich', u'ungl\xfccklich'), (u'Ungl\xe9ubiger', u'Ungl\xe4ubiger'), (u'ungultig', u'ung\xfcltig'), (u'ungunstigen', u'ung\xfcnstigen'), (u'unheimlichl', u'unheimlich!'), (u'UNHORBARES', u'UNH\xd6RBARES'), (u'unh\xe9flich', u'unh\xf6flich'), (u'Universitlt', u'Universit\xe4t'), (u'Universit\xe9t', u'Universit\xe4t'), (u'unlfisbare', u'unl\xf6sbare'), (u'unm6glich', u'unm\xf6glich'), (u'unmfiglich', u'unm\xf6glich'), (u'Unmiiglich', u'Unm\xf6glich'), (u'Unmiigliche', u'Unm\xf6gliche'), (u'unmijglich', u'unm\xf6glich'), (u'unmissverst\xe9ndlich', u'unmissverst\xe4ndlich'), (u'unmoglich', u'unm\xf6glich'), (u'Unmtioglich', u'Unm\xf6glich'), (u'Unm\xe9glich', u'Unm\xf6glich'), (u'unm\xe9glioh', u'unm\xf6glich'), (u'unnatiirliche', u'unnat\xfcrliche'), (u'unnaturliche', u'unnat\xfcrliche'), (u'unnfitigen', u'unn\xf6tigen'), (u'unniitig', u'unn\xf6tig'), (u'unnllitz', u'unn\xfctz'), (u'unn\xe9tig', u'unn\xf6tig'), (u'unn\xe9tigen', u'unn\xf6tigen'), (u'unol', u'und'), (u'unp\xe9sslich', u'unp\xe4sslich'), (u'UNREGELMASSIG', u'UNREGELM\xc4SSIG'), (u'Unregelm\xe9fiigkeiten', u'Unregelm\xe4\xdfigkeiten'), (u'unschliissig', u'unschl\xfcssig'), (u'unserejungen', u'unsere jungen'), (u'unsererAnw\xe9lte', u'unserer Anw\xe4lte'), (u'unsererjungfr\xe9ulichen', u'unserer jungfr\xe4ulichen'), (u'unsjede', u'uns jede'), (u'uns\xe9glich', u'uns\xe4glich'), (u'Untenuelt', u'Unterwelt'), (u'unterdriickten', u'unterdr\xfcckten'), (u'Unterdrilckung', u'\xdcnterdr\xfcckung'), (u'unterdrtlckte', u'unterdr\xfcckte'), (u'Unterdr\ufb02ckung', u'Unterdr\xfcckung'), (u'Unterhaltskostenl', u'Unterhaltskosten!'), (u'Unterhaltungsm\xe9fiig', u'Unterhaltungsm\xe4\xdfig'), (u'unterhfilt', u'unterh\xe4lt'), (u'unterh\xe9lt', u'unterh\xe4lt'), (u'unterschitzt', u'untersch\xe4tzt'), (u'untersch\xe9tzte', u'untersch\xe4tzte'), (u'unterstiitzt', u'unterst\xfctzt'), (u'Unterstiitzung', u'Unterst\xfctzung'), (u'unterstijtzt', u'unterst\xfctzt'), (u'Unterstiltzung', u'Unterst\xfctzung'), (u'Unterstllitzung', u'Unterst\xfctzung'), (u'unterstutzen', u'unterst\xfctzen'), (u'unterstutzt', u'unterst\xfctzt'), (u'Unterstutzten', u'Unterst\xfctzten'), (u'Unterstutzung', u'Unterst\xfctzung'), (u'Untersuchungsausschijsse', u'Untersuchungsaussch\xfcsse'), (u'Unterw\xe9sche', u'Unterw\xe4sche'), (u'untr\xe9stlich', u'untr\xf6stlich'), (u'Unt\xe9tigkeit', u'Unt\xe4tigkeit'), (u'unumg\xe9nglich', u'unumg\xe4nglich'), (u'unverm\xe9hlt', u'unverm\xe4hlt'), (u'Unverschfimtheitl', u'Unversch\xe4mtheit'), (u'unversch\xe9mte', u'unversch\xe4mte'), (u'Unversch\xe9mtheitl', u'Unversch\xe4mtheit'), (u'UNVERSTANDLICH', u'UNVERST\xc4NDLICH'), (u'UNVERSTANDLICHE', u'UNVERST\xc4NDLICHE'), (u'UNVERSTANDLICHER', u'UNVERST\xc4NDLICHER'), (u'UNVERSTANDLICHES', u'UNVERST\xc4NDLICHES'), (u'Unverst\xe9ndliche', u'Unverst\xe4ndliche'), (u'unverst\xe9ndlichen', u'unverst\xe4ndlichen'), (u'unverst\xe9ndliches', u'unverst\xe4ndliches'), (u'unverzlliglich', u'unverz\xfcglich'), (u'unver\xe9ndert', u'unver\xe4ndert'), (u'Unzerbrechliohen', u'Unzerbrechlichen'), (u'unzurechnungsfahig', u'unzurechnungsf\xe4hig'), (u'unzuverlassiger', u'unzuverl\xe4ssiger'), (u'Unzuverl\xe9ssiger', u'Unzuverl\xe4ssiger'), (u'unzuverl\xe9ssiges', u'unzuverl\xe4ssiges'), (u'unz\xe9hlige', u'unz\xe4hlige'), (u'unz\xe9hligen', u'unz\xe4hligen'), (u'unz\xe9ihlige', u'unz\xe4hlige'), (u'Urgrofivaters', u'Urgro\xdfvaters'), (u'Urlaubsuberschreitung', u'Urlaubs\xfcberschreitung'), (u'Ursprijnglich', u'Urspr\xfcnglich'), (u'ursprtmglich', u'urspr\xfcnglich'), (u'Ursprunglich', u'Urspr\xfcnglich'), (u'Ururgrofivater', u'Ururgro\xdfvater'), (u'v/el', u'viel'), (u'v/er', u'vier'), (u'v/erfe', u'vierte'), (u'v/erfes', u'viertes'), (u'V6gel', u'V\xf6gel'), (u'v6IIig', u'v\xf6llig'), (u'V6lker', u'V\xf6lker'), (u'V6llig', u'V\xf6llig'), (u'v6lllg', u'v\xf6llig'), (u'vdllig', u'v\xf6llig'), (u'Ve/Teidigungskr\xe9fte', u'Verteidigungskr\xe4fte'), (u'Velzeih', u'Verzeih'), (u'Velzeihung', u'Verzeihung'), (u'velzichte', u'verzichte'), (u'Ven/vandter', u'Verwandter'), (u'ven/v\xe9hntl', u'verw\xf6hnt!'), (u'Ventilationsfiffnung', u'Ventilations\xf6ffnung'), (u'Ventilatorsch\xe9chte', u'Ventilatorsch\xe4chte'), (u'VERACHTLICH', u'VER\xc4CHTLICH'), (u'verandert', u'ver\xe4ndert'), (u'Verbiindeten', u'Verb\xfcndeten'), (u'Verbilndeter', u'Verb\xfcndeter'), (u'verbliidet', u'verbl\xf6det'), (u'Verbliidung', u'Verbl\xf6dung'), (u'verbllirgen', u'verb\xfcrgen'), (u'verbrachfe', u'verbrachte'), (u'Verbrec/ver', u'Verbrecher'), (u'Verbtmdeter', u'Verb\xfcndeter'), (u'Verbundeten', u'Verb\xfcndeten'), (u'Verb\ufb02nolete', u'Verb\xfcndete'), (u'verdiichtigen', u'verd\xe4chtigen'), (u'verdiinnt', u'verd\xfcnnt'), (u'verdllistern', u'verd\xfcstern'), (u'verdr\ufb02ckt', u'verdr\xfcckt'), (u'verdunnt', u'verd\xfcnnt'), (u'verd\xe9chtig', u'verd\xe4chtig'), (u'Verd\xe9chtigen', u'Verd\xe4chtigen'), (u'verd\xe9chtiger', u'verd\xe4chtiger'), (u'verffilgbares', u'verf\xfcgbares'), (u'Verfiigung', u'Verf\xfcgung'), (u'verfiihren', u'verf\xfchren'), (u'verfiihrt', u'verf\xfchrt'), (u'verfiittem', u'verf\xfcttern'), (u'Verfijgung', u'Verf\xfcgung'), (u'verfilgst', u'verf\xfcgst'), (u'verfilgte', u'verf\xfcgte'), (u'Verfilgung', u'Verf\xfcgung'), (u'Verfilhrungskilnste', u'Verf\xfchrungsk\xfcnste'), (u'verflligen', u'verf\xfcgen'), (u'verfllihrt', u'verf\xfchrt'), (u'Verflllgung', u'Verf\xfcgung'), (u'verfolgf', u'verfolgt'), (u'verfolgtl', u'verfolgt!'), (u'VERFUGBAR', u'VERF\xdcGBAR'), (u'verfugt', u'verf\xfcgt'), (u'vergafk', u'verga\xdf'), (u'Vergniigen', u'Vergn\xfcgen'), (u'Vergniigens', u'Vergn\xfcgens'), (u'Vergniigungsausflug', u'Vergn\xfcgungsausflug'), (u'Vergnijgen', u'Vergn\xfcgen'), (u'Vergnilgen', u'Vergn\xfcgen'), (u'Vergnlligen', u'Vergn\xfcgen'), (u'Vergntigen', u'Vergn\xfcgen'), (u'Vergnugen', u'Vergn\xfcgen'), (u'vergnugt', u'vergn\xfcgt'), (u'vergnugte', u'vergn\xfcgte'), (u'Vergnugungsausflug', u'Vergn\xfcgungsausflug'), (u'vergr6Bern', u'vergr\xf6\xdfern'), (u'vergr\xe9fiern', u'vergr\xf6\xdfern'), (u'Vergr\xe9fierung', u'Vergr\xf6\xdferung'), (u'verg\xe9nglich', u'verg\xe4nglich'), (u'verhiirt', u'verh\xf6rt'), (u'Verhiitung', u'Verh\xfctung'), (u'Verhor', u'Verh\xf6r'), (u'verhort', u'verh\xf6rt'), (u'verhorten', u'verh\xf6rten'), (u'verh\xe9ilt', u'verh\xe4lt'), (u'verh\xe9lt', u'verh\xe4lt'), (u'Verh\xe9ltnis', u'Verh\xe4ltnis'), (u'Verh\xe9ltnisse', u'Verh\xe4ltnisse'), (u'verh\xe9ltst', u'verh\xe4ltst'), (u'veriindert', u'ver\xe4ndert'), (u'Verinderungen', u'Ver\xe4nderungen'), (u'verkilnden', u'verk\xfcnden'), (u'verkilndet', u'verk\xfcndet'), (u'verkniipft', u'verkn\xfcpft'), (u"verknUpf't", u'verkn\xfcpft'), (u'verkunde', u'verk\xfcnde'), (u'verkunden', u'verk\xfcnden'), (u'verkundet', u'verk\xfcndet'), (u'VERKUNDIGUNG', u'VERK\xdcNDIGUNG'), (u'Verk\xe9ufer', u'Verk\xe4ufer'), (u'verletztl', u'verletzt!'), (u'verlieB', u'verlie\xdf'), (u'verlielien', u'verlie\xdfen'), (u'verlorenl', u'verloren!'), (u'verl\xe9ingert', u'verl\xe4ngert'), (u'Verl\xe9ingerungskabel', u'Verl\xe4ngerungskabel'), (u'verl\xe9isst', u'verl\xe4sst'), (u'verl\xe9sst', u'verl\xe4sst'), (u'verl\xe9uft', u'verl\xe4uft'), (u"verm'aihlen", u'verm\xe4hlen'), (u'verm/ssf', u'vermisst'), (u'vermiibelt', u'verm\xf6belt'), (u'Vermiigt', u'Verm\xf6gt'), (u'Verm\xe9gen', u'Verm\xf6gen'), (u'verm\xe9hle', u'verm\xe4hle'), (u'verm\xe9hlen', u'verm\xe4hlen'), (u'verm\xe9hlt', u'verm\xe4hlt'), (u'Verm\xe9ihlung', u'Verm\xe4hlung'), (u'vernachl\xe9ssigt', u'vernachl\xe4ssigt'), (u'Vernachl\xe9ssigung', u'Vernachl\xe4ssigung'), (u'vernfinftig', u'vern\xfcnftig'), (u'vernfinftige', u'vern\xfcnftige'), (u'vernilnftig', u'vern\xfcnftig'), (u'vernllmftigsten', u'vern\xfcnftigsten'), (u'verntmftige', u'vern\xfcnftige'), (u'vernunftig', u'vern\xfcnftig'), (u'vernunftigsten', u'vern\xfcnftigsten'), (u'vern\ufb02nftig', u'vern\xfcnftig'), (u'verpa\xdft', u'verpasst'), (u'verpesfefe', u'verpestete'), (u'verprilgle', u'verpr\xfcgle'), (u'verprugeln', u'verpr\xfcgeln'), (u'Verp\ufb02ichtungen', u'Verpflichtungen'), (u'verrat', u'verr\xe4t'), (u'verrfickter', u'verr\xfcckter'), (u'verriickt', u'verr\xfcckt'), (u'Verriickte', u'Verr\xfcckte'), (u'Verriickten', u'Verr\xfcckten'), (u'Verriickter', u'Verr\xfcckter'), (u'verriicktes', u'verr\xfccktes'), (u'verrijckt', u'verr\xfcckt'), (u'verrijckte', u'verr\xfcckte'), (u'verrilckt', u'verr\xfcckt'), (u'Verrilckte', u'Verr\xfcckte'), (u'Verrilckter', u'Verr\xfcckter'), (u'Verrilcktes', u'Verr\xfccktes'), (u"verrL'lckt", u'verr\xfcckt'), (u'verrljckt', u'verr\xfcckt'), (u'verrllickt', u'verr\xfcckt'), (u'Verrllickte', u'Verr\xfcckte'), (u'Verrllickter', u'Verr\xfcckter'), (u'verrlllckte', u'verr\xfcckte'), (u'verrtickt', u'verr\xfcckt'), (u'verrUckt', u'verr\xfcckt'), (u'Verruckte', u'Verr\xfcckte'), (u'verruckten', u'verr\xfcckten'), (u'Verruckter', u'Verr\xfcckter'), (u'Verr\xe9iter', u'Verr\xe4ter'), (u'verr\xe9itst', u'verr\xe4itst'), (u'verr\xe9t', u'verr\xe4t'), (u'Verr\xe9ter', u'Verr\xe4ter'), (u'Verr\xe9terin', u'Verr\xe4terin'), (u'verr\xe9terisch', u'verr\xe4terisch'), (u'verr\xe9terischen', u'verr\xe4terischen'), (u'verr\ufb02ckt', u'verr\xfcckt'), (u'versaumt', u'vers\xe4umt'), (u'Verscheifier', u'Verschei\xdfer'), (u'verschiichtert', u'versch\xfcchtert'), (u'verschiitten', u'versch\xfctten'), (u'verschlucktl', u'verschluckt!'), (u'VERSCHLUSSELN', u'VERSCHL\xdcSSELN'), (u'VERSCHLUSSELT', u'VERSCHL\xdcSSELT'), (u'Verschlusselung', u'Verschl\xfcsselung'), (u'Verschnauferst', u'Verschnauf erst'), (u'Verschwdrung', u'Verschw\xf6rung'), (u'verschweilit', u'verschwei\xdft'), (u'Verschwiirer', u'Verschw\xf6rer'), (u'verschwiirerisch', u'verschw\xf6rerisch'), (u'Verschwiirern', u'Verschw\xf6rern'), (u'Verschwiirung', u'Verschw\xf6rung'), (u'Verschwiirungen', u'Verschw\xf6rungen'), (u'Verschw\xe9rer', u'Verschw\xf6rer'), (u'Verschw\xe9rung', u'Verschw\xf6rung'), (u'Verschw\xe9rungstheoretiker', u'Verschw\xf6rungstheoretiker'), (u'versch\xe9rft', u'versch\xe4rft'), (u'versfanden', u'verstanden'), (u'Versfehen', u'Verstehen'), (u'versiihnlich', u'vers\xf6hnlich'), (u'Versiihnung', u'Vers\xf6hnung'), (u'verslumte', u'vers\xe4umte'), (u'Verspfitung', u'Versp\xe4tung'), (u'verspiire', u'versp\xfcre'), (u'verspilre', u'versp\xfcre'), (u'verspiten', u'versp\xe4ten'), (u'versprijht', u'verspr\xfcht'), (u'verst0I3en', u'versto\xdfen'), (u'verst6Bt', u'verst\xf6\xdft'), (u'Verst6ISt', u'Verst\xf6\xdft'), (u'verst6l3t', u'verst\xf6\xdft'), (u'verstehejetzt', u'verstehe jetzt'), (u'Verstiindnis', u'Verst\xe4ndnis'), (u'verstiirkt', u'verst\xe4rkt'), (u'Verstiirkung', u'Verst\xe4rkung'), (u'verstilmmelst', u'verst\xfcmmelst'), (u'verstoBen', u'Versto\xdfen'), (u'verstofken', u'versto\xdfen'), (u'verstolien', u'versto\xdfen'), (u'verstummelt', u'verst\xfcmmelt'), (u'verstunde', u'verst\xfcnde'), (u'verstundest', u'verst\xfcndest'), (u'verst\xe9fkt', u'verst\xf6\xdft'), (u'verst\xe9indlich', u'verst\xe4ndlich'), (u'Verst\xe9irkung', u'Verst\xe4rkung'), (u'Verst\xe9ndigen', u'Verst\xe4ndigen'), (u'Verst\xe9ndigt', u'Verst\xe4ndigt'), (u'verst\xe9ndlich', u'verst\xe4ndlich'), (u'Verst\xe9ndnis', u'Verst\xe4ndnis'), (u'verst\xe9rken', u'verst\xe4rken'), (u'verst\xe9rkt', u'verst\xe4rkt'), (u'verst\xe9rkte', u'verst\xe4rkte'), (u'verst\xe9rkter', u'verst\xe4rkter'), (u'Verst\xe9rkung', u'Verst\xe4rkung'), (u'verst\xe9rt', u'verst\xf6rt'), (u'vers\xe9hnen', u'vers\xf6hnen'), (u'vers\xe9hnt', u'vers\xf6hnt'), (u'vers\xe9umen', u'vers\xe4umen'), (u'vers\xe9umt', u'vers\xe4umt'), (u'VERTRAGSLANGE', u'VERTRAGSL\xc4NGE'), (u'vertrauenswiirdig', u'vertrauensw\xfcrdig'), (u'vertrauenswtlrdig', u'vertrauensw\xfcrdig'), (u'vertrauenswtlrdigen', u'vertrauensw\xfcrdigen'), (u'vertr\xe9umte', u'vertr\xe4umte'), (u'vervvanzt', u'verwanzt'), (u'verwiistete', u'verw\xfcstete'), (u'verwllisten', u'verw\xfcsten'), (u'verwustet', u'verw\xfcstet'), (u'verw\xe9hnten', u'verw\xf6hnten'), (u'verw\xe9ihnen', u'verw\xf6hnen'), (u'verw\xe9ssert', u'verw\xe4ssert'), (u'verz\xe9gere', u'verz\xf6gere'), (u'Verz\xe9gerte', u'Verz\xf6gerte'), (u'Verz\xe9gerung', u'Verz\xf6gerung'), (u'ver\xe9ffentliche', u'ver\xf6ffentliche'), (u'ver\xe9ffentlichen', u'ver\xf6ffentlichen'), (u'ver\xe9ffentlicht', u'ver\xf6ffentlicht'), (u'ver\xe9indert', u'ver\xe4ndert'), (u'Ver\xe9inderung', u'Ver\xe4nderung'), (u'ver\xe9ndern', u'ver\xe4ndern'), (u'ver\xe9ndert', u'ver\xe4ndert'), (u'ver\xe9nderte', u'ver\xe4nderte'), (u'ver\xe9nderten', u'ver\xe4nderten'), (u'Ver\xe9nderung', u'Ver\xe4nderung'), (u'Ver\xe9nderungen', u'Ver\xe4nderungen'), (u'ver\xe9ngstigtes', u'ver\xe4ngstigtes'), (u'ver\xe9ppelt', u'ver\xe4ppelt'), (u'ver\xe9rgert', u'ver\xe4rgert'), (u'vewvendet', u'verwendet'), (u'vfillig', u'v\xf6llig'), (u'VGFKUFZGH', u'verk\xfcrzen'), (u'VI/illkommen', u'Willkommen'), (u'VI/itwicky', u'Witwicky'), (u'vial', u'viel'), (u'Videoiiben/vachung', u'Video\xfcberwachung'), (u'Vie/e', u'Viele'), (u'Vielfrafi', u'Vielfra\xdf'), (u'vielf\xe9ltig', u'vielf\xe4ltig'), (u'Vielleichtja', u'Vielleicht ja'), (u'vielversprechend', u'viel versprechend'), (u'Vieraugengespr\xe9ch', u'Vieraugengespr\xe4ch'), (u'vieriunge', u'vier junge'), (u'vierj\xe9hriges', u'vierj\xe4hriges'), (u'vierk\xe9pfige', u'vierk\xf6pfige'), (u'Viigel', u'V\xf6gel'), (u'viillig', u'v\xf6llig'), (u'viilliges', u'v\xf6lliges'), (u'Viterchen', u'V\xe4terchen'), (u'Vizepr\xe9isident', u'Vizepr\xe4sident'), (u'vlel', u'viel'), (u'Vlellelcht', u'Vielleicht'), (u'Vogelscheifke', u'Vogelschei\xdfe'), (u'Vogelscheilie', u'Vogelschei\xdfe'), (u'Volksm\xe9rchen', u'Volksm\xe4rchen'), (u'vollerjeder', u'voller jeder'), (u'vollmachen', u'voll machen'), (u'vollst\xe9ndig', u'vollst\xe4ndig'), (u'vollst\xe9ndige', u'vollst\xe4ndige'), (u'Volltrefferl', u'Volltreffer!'), (u'vollz\xe9hlig', u'vollz\xe4hlig'), (u'Volumenl', u'Volumen!'), (u'von/vagten', u'vorwagten'), (u'von/v\xe9irts', u'vorw\xe4rts'), (u'vonn6ten', u'vonn\xf6ten'), (u'Vonn\xe9irts', u'Vorw\xe4rts'), (u'Vordertiir', u'Vordert\xfcr'), (u'Vorderturl', u'Vordert\xfcr!'), (u'vordr\xe9ngelnl', u'vordr\xe4ngeln!'), (u'vorfibergehend', u'vor\xfcbergehend'), (u'Vorfuhrungen', u'Vorf\xfchrungen'), (u'vorgef\ufb02hrt', u'vorgef\xfchrt'), (u'Vorgiinge', u'Vorg\xe4nge'), (u'Vorg\xe9nger', u'Vorg\xe4nger'), (u'Vorg\xe9ngern', u'Vorg\xe4ngern'), (u'Vorh\xe9nge', u'Vorh\xe4nge'), (u'vorijbergehend', u'vor\xfcbergehend'), (u'vorilber', u'vor\xfcber'), (u'vorilbergehende', u'vor\xfcbergehende'), (u'vorkniipfen', u'vorkn\xf6pfen'), (u'Vorl\xe9ufer', u'Vorl\xe4ufer'), (u'Vorl\xe9ufig', u'Vorl\xe4ufig'), (u'Vorraus', u'Voraus'), (u'Vorschl\xe9ge', u'Vorschl\xe4ge'), (u'vorschriftsm\xe9fiig', u'vorschriftsm\xe4\xdfig'), (u'vorschriftsm\xe9iliig', u'vorschriftsm\xe4\xdfig'), (u'Vorsichtsmaflnahme', u'Vorsichtsma\xdfnahme'), (u'Vorstellungsgespr\xe9ch', u'Vorstellungsgespr\xe4ch'), (u'Vorstellungsgespr\xe9che', u'Vorstellungsgespr\xe4che'), (u'Vorstof$', u'Vorsto\xdf'), (u'Vortlbergehende', u'Vor\xfcbergehende'), (u'vort\xe9uschen', u'vort\xe4uschen'), (u'vorubergehend', u'vor\xfcbergehend'), (u'vorvv\xe9rts', u'vorw\xe4rts'), (u'Vorwfirts', u'Vorw\xe4rts'), (u'vorw\xe9rts', u'vorw\xe4rts'), (u'vorzfiglichl', u'vorz\xfcglich!'), (u'vor\ufb02ber', u'vor\xfcber'), (u'Vor\ufb02bergehend', u'Vor\xfcbergehend'), (u'VVACHMANN', u'WACHMANN'), (u'Vvaffen', u'Waffen'), (u'Vvagen', u'Wagen'), (u'VVarte', u'Warte'), (u'VVeif3>t', u'Wei\xdft'), (u"VVeil'2>t", u'Wei\xdft'), (u'VVir', u'Wir'), (u'VVM', u'WM'), (u'v\\/as', u'was'), (u'V\\/e', u'We'), (u'V\xe9gel', u'V\xf6gel'), (u'v\xe9geln', u'v\xf6geln'), (u'v\xe9gelt', u'v\xf6gelt'), (u'v\xe9llig', u'v\xf6llig'), (u"w/'r", u'wir'), (u'W/e', u'Wie'), (u'w/eder', u'wieder'), (u'W/nkel', u'Winkel'), (u'w/r', u'wir'), (u'w/rd', u'wird'), (u'w/rkl/ch', u'wirklich'), (u'W0', u'Wo'), (u'w5r', u'w\xe4r'), (u"w5r's", u"w\xe4r's"), (u'W6lfe', u'W\xf6lfe'), (u'W6lfen', u'W\xf6lfen'), (u'W99', u'Weg'), (u'Waffenschr\xe9nke', u'Waffenschr\xe4nke'), (u'wafs', u"w\xe4r's"), (u'wahrend', u'w\xe4hrend'), (u'WAHRENDDESSEN', u'W\xc4HRENDDESSEN'), (u'Wahrheitl', u'Wahrheit!'), (u'wail', u'weil'), (u'Walbl', u'Wal\xf6l'), (u'Walsinghaml', u'Walsingham!'), (u'wankelmiltig', u'wankelm\xfctig'), (u'ware', u'w\xe4re'), (u'WAREST', u'W\xc4REST'), (u'Warfe', u'Warte'), (u'warja', u'war ja'), (u'Waschbrettb\xe9uche', u'Waschbrettb\xe4uche'), (u'Waschb\xe9ir', u'Waschb\xe4r'), (u'Waschb\xe9iren', u'Waschb\xe4ren'), (u'Wasseranschlljssen', u'Wasseranschl\xfcssen'), (u'Wattekn\xe9uel', u'Wattekn\xe4uel'), (u'Wattest\xe9bchen', u'Wattest\xe4bchen'), (u"we're", u'w\xe4re'), (u"We'ro", u"We're"), (u'we/B', u'wei\xdf'), (u'We/Bf', u'Wei\xdft'), (u'we/fere', u'weitere'), (u'Wechsell', u'Wechsel!'), (u'weggebfirstet', u'weggeb\xfcrstet'), (u'weggespllllt', u'weggesp\xfclt'), (u'weggesplllltl', u'weggesp\xfclt!'), (u'weggesp\ufb02lt', u'weggesp\xfclt'), (u'wegl', u'weg!'), (u'wegreiflsen', u'wegrei\xdfen'), (u'wegschieBen', u'wegschie\xdfen'), (u'Wegtratan', u'Wegtreten'), (u'wegzuwefien', u'wegzuwerfen'), (u'wei/3', u'wei\xdf'), (u'WeiB', u'Wei\xdf'), (u'weiBe', u'wei\xdfe'), (u'weiBen', u'wei\xdfen'), (u'weiBer', u'wei\xdfer'), (u'weiBes', u'wei\xdfes'), (u'WeiBfresse', u'Wei\xdffresse'), (u'weiBt', u'wei\xdft'), (u'Weif$', u'Wei\xdf'), (u'Weif$t', u'Wei\xdft'), (u'weif2>', u'wei\xdf'), (u'weif3', u'wei\xdf'), (u'weif3>', u'wei\xdf'), (u'Weif3t', u'Wei\xdft'), (u'weif5', u'wei\xdf'), (u'Weifbe', u'Wei\xdfe'), (u'weifbt', u'wei\xdft'), (u'Weifi', u'Wei\xdf'), (u'Weifie', u'Wei\xdfe'), (u'weifies', u'wei\xdfes'), (u'Weifist', u'Wei\xdft'), (u'Weifit', u'Wei\xdft'), (u'weifk', u'wei\xdf'), (u'weifken', u'wei\xdfen'), (u'Weifker', u'Wei\xdfer'), (u'weifkes', u'wei\xdfes'), (u'weifkt', u'wei\xdft'), (u'weifL', u'wei\xdf'), (u'weifLt', u'wei\xdft'), (u'weifl\xbb', u'wei\xdf'), (u'weifS', u'wei\xdf'), (u'WeifSt', u'Wei\xdft'), (u'weifZ>', u'wei\xdf'), (u'WeifZ>t', u'Wei\xdft'), (u'weif\xe9t', u'wei\xdft'), (u'Weihnachtseink\xe9ufe', u'Weihnachtseink\xe4ufe'), (u'Weihnachtsm\xe9nner', u'Weihnachtsm\xe4nner'), (u"weil'5", u'wei\xdf'), (u"weil'5t", u'wei\xdft'), (u'weil3', u'wei\xdf'), (u'Weil3t', u'Wei\xdft'), (u'weil5', u'wei\xdf'), (u'Weil5t', u'Wei\xdft'), (u'weili', u'wei\xdf'), (u'weilit', u'wei\xdft'), (u'weilke', u'wei\xdfe'), (u'Weill', u'Wei\xdf'), (u'weills', u'wei\xdf'), (u'weillst', u'wei\xdft'), (u'weillt', u'weisst'), (u'weilS', u'wei\xdf'), (u'weilSe', u'wei\xdfe'), (u'WeilSglut', u'Wei\xdfglut'), (u'weilZ>', u'wei\xdf'), (u'weilZ~', u'wei\xdf'), (u'weiss', u'wei\xdf'), (u'weissen', u'wei\xdfen'), (u'weisst', u'wei\xdft'), (u'weiterhiipfen', u'weiterh\xfcpfen'), (u'Weiterpessen', u'Weiterpressen'), (u'weitl\xe9ufige', u'weitl\xe4ufige'), (u'weitweg', u'weit weg'), (u'WelBt', u'Wei\xdft'), (u'well', u'weil'), (u'Well', u'Welt'), (u'Wellit', u'Wei\xdft'), (u'welllt', u'wei\xdft'), (u'welt', u'weit'), (u'WELTBEVOLKERUNG', u'WELTBEV\xd6LKERUNG'), (u'Wel\ufb02t', u'Wei\xdft'), (u'Werdja', u'Werd ja'), (u'Werkst\xe9tten', u'Werkst\xe4tten'), (u'Werkzeugg\ufb02rtel', u'Werkzeugg\xfcrtel'), (u'wertschfitzen', u'wertsch\xe4tzen'), (u'Westflilgel', u'Westfl\xfcgel'), (u'Westkilste', u'Westk\xfcste'), (u'Wettk\xe9mpfe', u'Wettk\xe4mpfe'), (u'Wettk\xe9mpfen', u'Wettk\xe4mpfen'), (u'Wettk\xe9mpfer', u'Wettk\xe4mpfer'), (u'Wfinsche', u'W\xfcnsche'), (u'wfinschen', u'w\xfcnschen'), (u'Wfird', u'W\xfcrd'), (u'wfirde', u'w\xfcrde'), (u'Wfirden', u'W\xfcrden'), (u'wfirdest', u'w\xfcrdest'), (u'wfire', u'w\xe4re'), (u'Wfirme', u'W\xe4rme'), (u'Wfisste', u'W\xfcsste'), (u'wfitete', u'w\xfctete'), (u'wfssen', u'wissen'), (u'Widen/v\xe9rtig', u'Widerw\xe4rtig'), (u"widerf'a'hrt", u'widerf\xe4hrt'), (u'widerspriichliche', u'widerspr\xfcchliche'), (u'Widerw\xe9irtig', u'Widerw\xe4rtig'), (u'wiedergew\xe9ihltl', u'wiedergew\xe4hlt'), (u'wiederhaben', u'wieder-haben'), (u'Wiederh\xe9ren', u'Wiederh\xf6ren'), (u'Wieheifiternoch', u'Wiehei\xdfternoch'), (u'Wieheiliternoch', u'Wiehei\xdfternoch'), (u'wihlerisch', u'w\xe4hlerisch'), (u'wihlerlsch', u'w\xe4hlerisch'), (u'wiihlen', u'w\xfchlen'), (u'wiihlte', u'w\xe4hlte'), (u'wiihrend', u'w\xe4hrend'), (u'wiilrdest', u'w\xfcrdest'), (u'Wiinde', u'W\xe4nde'), (u'wiinsch', u'w\xfcnsch'), (u'Wiinsche', u'W\xfcnsche'), (u'Wiinschen', u'W\xfcnschen'), (u'wiinschst', u'w\xfcnschst'), (u'wiinscht', u'w\xfcnscht'), (u'wiinschte', u'w\xfcnschte'), (u'wiirde', u'w\xfcrde'), (u'Wiirden', u'W\xfcrden'), (u'Wiirdest', u'W\xfcrdest'), (u'wiirdet', u'w\xfcrdet'), (u'wiirdigst', u'w\xfcrdigst'), (u'Wiire', u'W\xe4re'), (u'wiiren', u'w\xe4ren'), (u'Wiirfel', u'W\xfcrfel'), (u'wiirfeln', u'w\xfcrfeln'), (u'Wiirfels', u'W\xfcrfels'), (u'wiirs', u"w\xe4r's"), (u'Wiirstchen', u'W\xfcrstchen'), (u'wiischt', u'w\xe4scht'), (u'Wiisste', u'W\xfcsste'), (u'wiissten', u'w\xfcssten'), (u'wiisstest', u'w\xfcsstest'), (u'Wiiste', u'W\xfcste'), (u'wiitenden', u'w\xfctenden'), (u'wijnsche', u'w\xfcnsche'), (u'wijnschen', u'w\xfcnschen'), (u'wijnschte', u'w\xfcnschte'), (u'wijrd', u'w\xfcrd'), (u'wijrde', u'w\xfcrde'), (u'wijrden', u'w\xfcrden'), (u'wijrdest', u'w\xfcrdest'), (u'wijrdiger', u'w\xfcrdiger'), (u'Wijrg', u'W\xfcrg'), (u'wijsste', u'w\xfcsste'), (u'wijtend', u'w\xfctend'), (u'wildl', u'wild!'), (u'wilnsch', u'w\xfcnsch'), (u'wilnsche', u'w\xfcnsche'), (u'wilnschen', u'w\xfcnschen'), (u'wilnscht', u'w\xfcnscht'), (u'wilnschte', u'w\xfcnschte'), (u'wilrd', u'w\xfcrd'), (u'Wilrde', u'W\xfcrde'), (u'Wilrden', u'W\xfcrden'), (u'Wilrdest', u'W\xfcrdest'), (u'wilrdig', u'w\xfcrdig'), (u'Wilrfel', u'W\xfcrfel'), (u'Wilrfelenergie', u'W\xfcrfelenergie'), (u'wilsste', u'w\xfcsste'), (u'wilssten', u'w\xfcssten'), (u'Wilstling', u'W\xfcstling'), (u'wiltend', u'w\xfctend'), (u'Windelhundl', u'Windelhund!'), (u'Windhundk\xe9rper', u'Windhundk\xf6rper'), (u'winner', u'w\xe4rmer'), (u'Wire', u'W\xe4re'), (u'wires', u'wir es'), (u'Wirfangen', u'Wir fangen'), (u'wirja', u'wir ja'), (u'wirje', u'wir je'), (u'wirjede', u'wir jede'), (u'wirjeden', u'wir jeden'), (u'wirjetzt', u'wir jetzt'), (u'Wirnisse', u'Wirrnisse'), (u'Wirsind', u'Wir sind'), (u'wirtragen', u'wir tragen'), (u'Wirtschaftspriifer', u'Wirtschaftspr\xfcfer'), (u'Wirverfolgen', u'Wir verfolgen'), (u'wirvom', u'wir vom'), (u'Wirwaren', u'Wir waren'), (u'Wirwarten', u'Wir warten'), (u'Wirwerden', u'Wir werden'), (u'Wirwissen', u'Wir wissen'), (u'Wirwollen', u'Wir wollen'), (u'Wirwollten', u'Wir wollten'), (u'Wirzeigten', u'Wir zeigten'), (u'wirzu', u'wir zu'), (u'Witzl', u'Witz!'), (u'WKHRENDDESSEN', u'W\xc4HRENDDESSEN'), (u"wL'lrden", u'w\xfcrden'), (u'wle', u'wie'), (u'Wleso', u'Wieso'), (u'Wlhlen', u'W\xe4hlen'), (u'wllinsch', u'w\xfcnsch'), (u'wllinschst', u'w\xfcnschst'), (u'wllinscht', u'w\xfcnscht'), (u'wllirde', u'w\xfcrde'), (u'wllirden', u'w\xfcrden'), (u'wllirdest', u'w\xfcrdest'), (u'wllirdet', u'w\xfcrdet'), (u'Wllirgegriff', u'W\xfcrgegriff'), (u'wllirgen', u'w\xfcrgen'), (u'wllisste', u'w\xfcsste'), (u'wlr', u'wir'), (u'wlrd', u'wird'), (u'wlrkllch', u'wirklich'), (u'Wlrkllchkelt', u'Wirklichkeit'), (u'wlrst', u'wirst'), (u'Wlrwarten', u'Wir warten'), (u'wlrwollen', u'wir wollen'), (u'Wo/f', u'Wolf'), (u'Wochenf\xe9hre', u'Wochenf\xe4hre'), (u'woffir', u'wof\xfcr'), (u'Wofiir', u'Wof\xfcr'), (u'Wofijr', u'Wof\xfcr'), (u'wofilr', u'wof\xfcr'), (u'Wofur', u'Wof\xfcr'), (u'WoherweiB', u'Woher wei\xdf'), (u'WoherweiBt', u'Woher wei\xdft'), (u'Woherweif$t', u'Woher wei\xdft'), (u'wohlfilhlen', u'wohlf\xfchlen'), (u'Wollkn\xe9uel', u'Wollkn\xe4uel'), (u'womiiglich', u'wom\xf6glich'), (u'wom\xe9glich', u'wom\xf6glich'), (u'wom\xe9iglich', u'wom\xf6glich'), (u'Worfiber', u'Wor\xfcber'), (u'woriiber', u'wor\xfcber'), (u'Worijber', u'Wor\xfcber'), (u'Wortgepl\xe9nkel', u'Wortgepl\xe4nkel'), (u'Woruber', u'Wor\xfcber'), (u"wt/'rden", u'w\xfcrden'), (u'wtinsche', u'w\xfcnsche'), (u'wtinschst', u'w\xfcnschst'), (u'wtirde', u'w\xfcrde'), (u'Wtirdest', u'W\xfcrdest'), (u'Wtirfel', u'W\xfcrfel'), (u'Wtmschen', u'W\xfcnschen'), (u"WUl'd\u20ac", u'w\xfcrde'), (u'WUlfelbecher', u'W\xfcrfelbecher'), (u'wullte', u'wusste'), (u'Wundersch6n', u'Wundersch\xf6n'), (u'wunderschfin', u'wundersch\xf6n'), (u'Wunderschiin', u'Wundersch\xf6n'), (u'wunderschiinen', u'wundersch\xf6nen'), (u'wundersch\xe9n', u'wundersch\xf6n'), (u'wundersch\xe9ne', u'wundersch\xf6ne'), (u'Wundersch\xe9nel', u'Wundersch\xf6ne!'), (u'wundersch\xe9nen', u'wundersch\xf6nen'), (u'wundersch\xe9nes', u'wundersch\xf6nes'), (u'wundersoh\xe9n', u'wundersch\xf6n'), (u'wunsche', u'w\xfcnsche'), (u'Wunschen', u'W\xfcnschen'), (u'wunscht', u'w\xfcnscht'), (u'wunschte', u'w\xfcnschte'), (u'WUNSCHTE', u'W\xdcNSCHTE'), (u'wurcle', u'wurde'), (u'wUrde', u'w\xfcrde'), (u'Wurdige', u'W\xfcrdige'), (u'WURGT', u'W\xdcRGT'), (u'Wurmer', u'W\xfcrmer'), (u'Wursfsfulle', u'Wurststulle'), (u'Wuste', u'W\xfcste'), (u'WUSTEN', u'W\xdcSTEN'), (u'wutend', u'w\xfctend'), (u'wu\xdfte', u'wusste'), (u'wu\xdftest', u'wusstest'), (u"w\xa7r's", u"w\xe4r's"), (u'w\xa7re', u'w\xe4re'), (u"W\xa7ren's", u"W\xe4ren's"), (u"w\xe9'hrend", u'w\xe4hrend'), (u'w\xe9chst', u'w\xe4chst'), (u'W\xe9chter', u'W\xe4chter'), (u'w\xe9fs', u"w\xe4r's"), (u'W\xe9g', u'Weg'), (u'w\xe9hle', u'w\xe4hle'), (u'w\xe9hlejetzt', u'w\xe4hle jetzt'), (u'w\xe9hlen', u'w\xe4hlen'), (u'W\xe9hler', u'W\xe4hler'), (u'W\xe9hlern', u'W\xe4hlern'), (u'w\xe9hlt', u'w\xe4hlt'), (u'w\xe9hlte', u'w\xe4hlte'), (u'w\xe9hrend', u'w\xe4hrend'), (u'W\xe9hrung', u'W\xe4hrung'), (u'W\xe9ichter', u'W\xe4chter'), (u'w\xe9ihlen', u'w\xe4hlen'), (u'w\xe9ihrend', u'w\xe4hrend'), (u'w\xe9ir', u'w\xe4r'), (u"w\xe9ir's", u"w\xe4r's"), (u'w\xe9irde', u'w\xfcrde'), (u'W\xe9ire', u'W\xe4re'), (u'w\xe9iren', u'w\xe4ren'), (u'w\xe9irmen', u'w\xe4rmen'), (u'w\xe9irst', u'w\xe4rst'), (u'W\xe9lder', u'W\xe4lder'), (u'W\xe9ldern', u'W\xe4ldern'), (u'W\xe9lfen', u'W\xf6lfen'), (u'W\xe9lkchen', u'W\xf6lkchen'), (u'W\xe9nde', u'W\xe4nde'), (u'W\xe9nden', u'W\xe4nden'), (u'w\xe9r', u'w\xe4r'), (u"w\xe9r's", u"w\xe4r's"), (u'W\xe9re', u'W\xe4re'), (u'W\xe9ren', u'W\xe4ren'), (u'w\xe9ret', u'w\xe4ret'), (u'w\xe9rja', u'w\xe4r ja'), (u'W\xe9rm', u'W\xe4rm'), (u'W\xe9rme', u'W\xe4rme'), (u'w\xe9rmt', u'w\xe4rmt'), (u'W\xe9rst', u'W\xe4rst'), (u'w\xe9rt', u'w\xe4rt'), (u'W\xe9rter', u'W\xf6rter'), (u'W\xe9rterbuch', u'W\xf6rterbuch'), (u'w\xe9rtliche', u'w\xf6rtliche'), (u'W\xe9sche', u'W\xe4sche'), (u'W\xe9scheklammer', u'W\xe4scheklammer'), (u'W\xe9schst', u'W\xe4schst'), (u'w\xe9scht', u'w\xe4scht'), (u'w\ufb02rde', u'w\xfcrde'), (u'w\ufb02rden', u'w\xfcrden'), (u'W\ufb02rfel', u'W\xfcrfel'), (u"z'a'h", u'z\xe4h'), (u'Z/egf', u'liegt'), (u'Z/yarettenb\xe4ume', u'Zigarettenb\xe4ume'), (u'Z05', u'los'), (u'z6gel1e', u'z\xf6gerte'), (u'z6gern', u'z\xf6gern'), (u'zahlenm\xe9\ufb02ig', u'zahlenm\xe4\xdfig'), (u'zappelnl', u'zappeln!'), (u'Zauberspruchen', u'Zauberspr\xfcchen'), (u'Zaubervoodookr\xe9fte', u'Zaubervoodookr\xe4fte'), (u'Zauherpfippchen', u'Zauberp\xfcppchen'), (u'Zefietzende', u'Zerfetzende'), (u'zeitgem5B', u'zeitgem\xe4\xdf'), (u'Zeitgem\xe9\ufb02e', u'Zeitgem\xe4\xdfe'), (u'Zeitgeniissische', u'Zeitgen\xf6ssische'), (u'zeitgeniissischen', u'zeitgen\xf6ssischen'), (u'Zellenschliissel', u'Zellenschl\xfcssel'), (u'zerbeif$en', u'zerbei\xdfen'), (u'zerbeif$t', u'zerbei\xdft'), (u'zerf\xe9llt', u'zerf\xe4llt'), (u'Zermatschger\xe9usch', u'Zermatschger\xe4usch'), (u'zerm\ufb02rben', u'zerm\xfcrben'), (u'zerreifien', u'zerrei\xdfen'), (u'zerreilit', u'zerrei\xdft'), (u'zersfdren', u'zerst\xf6ren'), (u'zerst6rst', u'zerst\xf6rst'), (u'zerst6rt', u'zerst\xf6rt'), (u'zerstdren', u'zerst\xf6ren'), (u'Zerstfiren', u'Zerst\xf6ren'), (u'Zerstfirer', u'Zerst\xf6rer'), (u'Zerstfirungskraft', u'Zerst\xf6rungskraft'), (u'Zerstiickelung', u'Zerst\xfcckelung'), (u'zerstiire', u'zerst\xf6re'), (u'zerstiiren', u'zerst\xf6ren'), (u'Zerstiirer', u'Zerst\xf6rer'), (u'zerstiirt', u'zerst\xf6rt'), (u'zerstiirten', u'zerst\xf6rten'), (u'zerstiirtl', u'zerst\xf6rt!'), (u'Zerstiirungl', u'Zerst\xf6rung!'), (u'zerstoren', u'zerst\xf6ren'), (u'zerst\xe9re', u'zerst\xf6re'), (u'zerst\xe9ren', u'zerst\xf6ren'), (u'Zerst\xe9rer', u'Zerst\xf6rer'), (u'zerst\xe9rt', u'zerst\xf6rt'), (u'Zerst\xe9rung', u'Zerst\xf6rung'), (u'Zerst\xe9rungsfeldzug', u'Zerst\xf6rungsfeldzug'), (u'zertrlllmmert', u'zertr\xfcmmert'), (u'zfihlt', u'z\xe4hlt'), (u'Ziel160m', u'Ziel 160 m'), (u'Zihnelt', u'\xe4hnelt'), (u'ziichtiger', u'z\xfcchtiger'), (u'Ziige', u'Z\xfcge'), (u'Ziindkapseln', u'Z\xfcndkapseln'), (u'Zilnd', u'Z\xfcnd'), (u'Zilnden', u'Z\xfcnden'), (u'Zilndungsenergie', u'Z\xfcndungsenergie'), (u'Zilrich', u'Z\xfcrich'), (u'Zindern', u'\xe4ndern'), (u'Zingstlich', u'\xe4ngstlich'), (u'Ziufierst', u'\xe4u\xdferst'), (u'zleht', u'zieht'), (u'ZLIFUCK', u'zur\xfcck'), (u'Zooschlieliung', u'Zooschlie\xdfung'), (u'Zuckerschn\ufb02tchen', u'Zuckerschn\xfctchen'), (u'zuerstvor', u'zuerst vor'), (u'zuffillig', u'zuf\xe4llig'), (u'zuflligen', u'zuf\xfcgen'), (u'ZUFUCK', u'zur\xfcck'), (u'Zuf\xe9illig', u'Zuf\xe4llig'), (u'Zuf\xe9illigerweise', u'Zuf\xe4lligerweise'), (u'zuf\xe9llig', u'zuf\xe4llig'), (u'Zuf\xe9lligerweise', u'Zuf\xe4lligerweise'), (u"zug'a'nglichen", u'zug\xe4nglichen'), (u'ZUGANGSPRIORITKT', u'ZUGANGSPRIORIT\xc4T'), (u'zugehdrt', u'zugeh\xf6rt'), (u'zugeh\xe9rt', u'zugeh\xf6rt'), (u'zugestofien', u'zugesto\xdfen'), (u'Zugest\xe9ndnis', u'Zugest\xe4ndnis'), (u'Zugest\xe9ndnisse', u'Zugest\xe4ndnisse'), (u'Zugiinge', u'Zug\xe4nge'), (u'zuh6ren', u'zuh\xf6ren'), (u'zuh6rt', u'zuh\xf6rt'), (u'zuhiiren', u'zuh\xf6ren'), (u'zuhiirt', u'zuh\xf6rt'), (u'Zuh\xe9lter', u'Zuh\xe4lter'), (u'Zuh\xe9ren', u'Zuh\xf6ren'), (u'Zuh\xe9rer', u'Zuh\xf6rer'), (u'zukilnftiges', u'zuk\xfcnftiges'), (u'zul', u'zu!'), (u'zundete', u'z\xfcndete'), (u'Zundverteilerkappe', u'Z\xfcndverteilerkappe'), (u'zunjick', u'zur\xfcck'), (u'zun\xe9chst', u'zun\xe4chst'), (u'zun\xe9hen', u'zun\xe4hen'), (u'zun\xe9ihen', u'zun\xe4hen'), (u'Zuokerschntltchen', u'Zuckerschn\xfctchen'), (u'zurfick', u'zur\xfcck'), (u'zurfickblicken', u'zur\xfcckblicken'), (u'zurfickgekommen', u'zur\xfcckgekommen'), (u'zurfickgezogen', u'zur\xfcckgezogen'), (u'zurfickkehren', u'zur\xfcckkehren'), (u'zurfickzufuhren', u'zur\xfcckzuf\xfchren'), (u'zuriick', u'zur\xfcck'), (u'zuriickbleiben', u'zur\xfcckbleiben'), (u'zuriickgeben', u'zur\xfcckgeben'), (u'zuriickgehen', u'zur\xfcckgehen'), (u'zuriickgekommen', u'zur\xfcckgekommen'), (u'zuriickgezogen', u'zur\xfcckgezogen'), (u'zuriickhaben', u'zur\xfcckhaben'), (u'zuriickkehre', u'zur\xfcckkehre'), (u'zuriickkehren', u'zur\xfcckkehren'), (u'zuriickkehrst', u'zur\xfcckkehrst'), (u'zuriickziehen', u'zur\xfcckziehen'), (u'Zurijck', u'Zur\xfcck'), (u'zurijckbringen', u'zur\xfcckbringen'), (u'zurijckfordem', u'zur\xfcckfordern'), (u'zurijckgeholt', u'zur\xfcckgeholt'), (u'zurijckgekehrt', u'zur\xfcckgekehrt'), (u'zurijckgekommen', u'zur\xfcckgekommen'), (u'zurijckgelassen', u'zur\xfcckgelassen'), (u'zurijckgerufen', u'zur\xfcckgerufen'), (u'zurijckkehren', u'zur\xfcckkehren'), (u'zurijcknehmen', u'zur\xfccknehmen'), (u'zurijckstolpern', u'zur\xfcckstolpern'), (u'Zurilck', u'Zur\xfcck'), (u'Zurilckf', u'Zur\xfcck!'), (u'zurilckgeblieben', u'zur\xfcckgeblieben'), (u'zurilckgeholt', u'zur\xfcckgeholt'), (u'zurilckgekehrt', u'zur\xfcckgekehrt'), (u'zurilckhalten', u'zur\xfcckhalten'), (u'zurilckholen', u'zur\xfcckholen'), (u'zurilckkehre', u'zur\xfcckkehre'), (u'zurilckkehren', u'zur\xfcckkehren'), (u'zurilckkehrt', u'zur\xfcckkehrt'), (u'zurilckkommen', u'zur\xfcckkommen'), (u'zurilckkommt', u'zur\xfcckkommt'), (u'zurilcklassen', u'zur\xfccklassen'), (u'zurilckziehen', u'zur\xfcckziehen'), (u'Zurilckziehenl', u'Zur\xfcckziehen!'), (u'zurilckzugeben', u'zur\xfcckzugeben'), (u"zurl'Jck", u'zur\xfcck!'), (u"zurL'lck", u'zur\xfcck'), (u'zurLick', u'zur\xfcck'), (u'zurljckgeben', u'zur\xfcckgeben'), (u'zurllickfallen', u'zur\xfcckfallen'), (u'zurllickgekehrt', u'zur\xfcckgekehrt'), (u'zurllickkehrt', u'zur\xfcckkehrt'), (u'zurllickzukehren', u'zur\xfcckzukehren'), (u'zurlllckgehen', u'zur\xfcckgehen'), (u'zurlllckkomme', u'zur\xfcckkomme'), (u'zurtick', u'zur\xfcck'), (u'zurtickbringe', u'zur\xfcckbringe'), (u'zurtickgezogen', u'zur\xfcckgezogen'), (u'zurtlckgekommen', u'zur\xfcckgekommen'), (u'zurtlckvervvandeln', u'zur\xfcckverwandeln'), (u'Zuruck', u'Zur\xfcck'), (u'ZURUCK', u'ZUR\xdcCK'), (u'zuruckbleiben', u'zur\xfcckbleiben'), (u'zuruckblicken', u'zur\xfcckblicken'), (u'zuruckdenke', u'zur\xfcckdenke'), (u'zuruckfeuern', u'zur\xfcckfeuern'), (u'zuruckgehen', u'zur\xfcckgehen'), (u'zuruckgelegt', u'zur\xfcckgelegt'), (u'zuruckgewiesen', u'zur\xfcckgewiesen'), (u'zuruckgreifen', u'zur\xfcckgreifen'), (u'zuruckhaben', u'zur\xfcckhaben'), (u'zuruckkehren', u'zur\xfcckkehren'), (u'zuruckkehrten', u'zur\xfcckkehrten'), (u'zuruckkomme', u'zur\xfcckkomme'), (u'zuruckkommen', u'zur\xfcckkommen'), (u'zuruckk\xe9mst', u'zur\xfcckk\xe4mst'), (u'zuruckl', u'zur\xfcck!'), (u'zurucklassen', u'zur\xfccklassen'), (u'zurUcklieB', u'zur\xfccklie\xdf'), (u'zuruckl\xe9cheln', u'zur\xfcckl\xe4cheln'), (u'zurucknehmen', u'zur\xfccknehmen'), (u'zuruckverwandeln', u'zur\xfcckverwandeln'), (u'zuruckverwandelt', u'zur\xfcckverwandelt'), (u'zuruckziehen', u'zur\xfcckziehen'), (u'zuruckzukommen', u'zur\xfcckzukommen'), (u'zurverfilgung', u'zur Verf\xfcgung'), (u'zur\xe9ickrufen', u'zur\xfcckrufen'), (u'zur\ufb02ck', u'zur\xfcck'), (u'Zur\ufb02ckbleiben', u'Zur\xfcckbleiben'), (u'zur\ufb02ckfliegen', u'zur\xfcckfliegen'), (u'zur\ufb02ckgeschickt', u'zur\xfcckgeschickt'), (u'zur\ufb02ckgibst', u'zur\xfcckgibst'), (u"zus'a'tzliche", u'zus\xe4tzliche'), (u'zusammenbeilien', u'zusammenbei\xdfen'), (u'zusammenffigen', u'zusammenf\xfcgen'), (u'zusammenfugen', u'zusammenf\xfcgen'), (u'zusammenfuhren', u'zusammenf\xfchren'), (u'zusammenf\xe9illt', u'zusammenf\xe4llt'), (u'zusammenh\xe9ilt', u'zusammenh\xe4lt'), (u'zusammenh\xe9lt', u'zusammenh\xe4lt'), (u'zusammenh\xe9ngen', u'zusammenh\xe4ngen'), (u'zusammenreifien', u'zusammenrei\xdfen'), (u'zusammenzuschweifien', u'zusammenzuschwei\xdfen'), (u'zuschl\xe9gst', u'zuschl\xe4gst'), (u'zust6Bt', u'zust\xf6\xdft'), (u'zustofken', u'zusto\xdfen'), (u'zust\xe9indig', u'zust\xe4ndig'), (u'zust\xe9ncligen', u'zust\xe4ndigen'), (u'zust\xe9ndig', u'zust\xe4ndig'), (u'zust\xe9ndigen', u'zust\xe4ndigen'), (u'zus\xe9tzlich', u'zus\xe4tzlich'), (u'zus\xe9tzliche', u'zus\xe4tzliche'), (u'zuverlfissig', u'zuverl\xe4ssig'), (u'zuverllssig', u'zuverl\xe4ssig'), (u'zuverl\xe9ssig', u'zuverl\xe4ssig'), (u'zuverl\xe9ssiger', u'zuverl\xe4ssiger'), (u'zuviel', u'zu viel'), (u'zuviele', u'zu viele'), (u'zuzuflligen', u'zuzuf\xfcgen'), (u'Zu\ufb02ucht', u'Zuflucht'), (u'zvvei', u'zwei'), (u'Zw6If', u'Zw\xf6lf'), (u'zw6lfmal', u'zw\xf6lfmal'), (u'Zwel', u'Zwei'), (u'Zwickmfihle', u'Zwickm\xfchle'), (u'Zwillingstiichter', u'Zwillingst\xf6chter'), (u'Zwischenf\xe9lle', u'Zwischenf\xe4lle'), (u'zwnlf', u'zw\xf6lf'), (u'Zw\xe9ilften', u'Zw\xf6lften'), (u'zw\xe9lf', u'zw\xf6lf'), (u'z\xe9gerlich', u'z\xf6gerlich'), (u'z\xe9gern', u'z\xf6gern'), (u'Z\xe9gerns', u'Z\xf6gerns'), (u'z\xe9h', u'z\xe4h'), (u'z\xe9he', u'z\xe4he'), (u'z\xe9her', u'z\xe4her'), (u'z\xe9hl', u'z\xe4hl'), (u'z\xe9hle', u'z\xe4hle'), (u'z\xe9hlen', u'z\xe4hlen'), (u'Z\xe9hlerei', u'Z\xe4hlerei'), (u'z\xe9hlt', u'z\xe4hlt'), (u'z\xe9hltl', u'z\xe4hlt!'), (u'Z\xe9hlung', u'Z\xe4hlung'), (u'Z\xe9hne', u'Z\xe4hne'), (u'Z\xe9hnen', u'Z\xe4hnen'), (u'Z\xe9hneputzen', u'Z\xe4hneputzen'), (u'z\xe9ihle', u'z\xe4hle'), (u'z\xe9ihlen', u'z\xe4hlen'), (u'z\xe9ihlt', u'z\xe4hlt'), (u'Z\xe9ihlungen', u'Z\xe4hlungen'), (u'Z\xe9ihne', u'Z\xe4hne'), (u'Z\xe9libat', u'Z\xf6libat'), (u'\\/GFQHUQGH', u'Vergn\xfcgen'), (u'\\/OFVVUFf\u20ac', u'Vorw\xfcrfe'), (u'\\/Vahrheit', u'Wahrheit'), (u'\\/Vir', u'Wir'), (u"\\/\\/i6fUl'1l\u20acfi", u'Wie f\xfchlen'), (u"\\/\\/il'fUl'1I'\u20acl'1", u'Wir f\xfchren'), (u'\\Nynn', u'Wynn'), (u'_', u'-'), (u'\xc4u', u'Au'), (u'\xe9', u'\xe0'), (u'\xe9chzt', u'\xe4chzt'), (u'\xe9ffentlich', u'\xf6ffentlich'), (u'\xe9ffne', u'\xf6ffne'), (u'\xe9ffnen', u'\xf6ffnen'), (u'\xe9ffnet', u'\xf6ffnet'), (u'\xe9fft', u'\xe4fft'), (u'\xe9fter', u'\xf6fter'), (u'\xe9fters', u'\xf6fters'), (u'\xe9h', u'\xe4h'), (u'\xe9hnlich', u'\xe4hnlich'), (u'\xe9hnliche', u'\xe4hnliche'), (u'\xe9hnlicher', u'\xe4hnlicher'), (u'\xe9ih', u'\xe4h'), (u'\xe9ihnlich', u'\xe4hnlich'), (u'\xe9indern', u'\xe4ndern'), (u'\xe9itzend', u'\xe4tzend'), (u'\xe9lter', u'\xe4lter'), (u'\xe9lteste', u'\xe4lteste'), (u'\xe9ltesten', u'\xe4ltesten'), (u'\xe9ndere', u'\xe4ndere'), (u'\xe9ndern', u'\xe4ndern'), (u'\xe9ndert', u'\xe4ndert'), (u'\xe9nderte', u'\xe4nderte'), (u'\xe9nderten', u'\xe4nderten'), (u'\xe9ngstlich', u'\xe4ngstlich'), (u'\xe9rgere', u'\xe4rgere'), (u'\xe9rgern', u'\xe4rgern'), (u'\xe9rztliche', u'\xe4rztliche'), (u'\xe9rztlichen', u'\xe4rztlichen'), (u'\xe9rztlicher', u'\xe4rztlicher'), (u'\xe9sthetisch', u'\xe4sthetisch'), (u'\xe9tzend', u'\xe4tzend'), (u'\xe9ufierst', u'\xe4u\xdferst'), (u'\xe9ufiersten', u'\xe4u\xdfersten'), (u'\xe9uflserst', u'\xe4u\xdferst'), (u'\ufb02atterndem', u'flatterndem'), (u'\ufb02el', u'fiel'), (u'\ufb02iehen', u'fliehen'), (u'\ufb02jr', u'f\xfcr'), (u'\ufb02lhlen', u'f\xfchlen'), (u'\ufb02lllen', u'f\xfcllen'), (u'\ufb02lr', u'f\xfcr'), (u'\ufb02lrchterlich', u'f\xfcrchterlich'), (u'\ufb02ndet', u'findet'), (u'AIle', u'Alle'), (u'AIter', u'Alter'), (u'GI\xfcck', u'Gl\xfcck'), (u'PIaystation', u'Playstation'), (u'AIIes', u'Alles'), (u'AIso', u'Also'), (u'Ouatsch', u'Quatsch'), (u'AIles', u'Alles'), (u'BIeib', u'Bleib'), (u'KIaut', u'Klaut'), (u'AIlah', u'Allah'), (u'PIan', u'Plan'), (u'oderjemand', u'oder jemand'), (u'liestjetzt', u'liest jetzt')]),
+                        'pattern': u"(?um)(\\b|^)(?:\\/a|\\/ch|\\/d\\/of|\\/ebte|\\/eid|\\/hn|\\/hnen|\\/hr|\\/hre|\\/hren|\\/m|\\/mmer|\\/n|\\/ndividuen|\\/nn|\\/oe|\\/sf|\\/sf\\/0\\/1n|\\/ungs|\\/Vfinuten|\\/\\\xe9nger|\\/\\\xe9uft|0\\/1|0\\/me|0\\/vne|00om|100m|120m|13Oj\\\xa7hrie|145m|150m|160m|165m|19m|20m|27m|30m|37m|38m|3km|5\\/ch|5\\/cher|5\\/cherer|5\\/e|5\\/nd|500m|5ulSere|60m|6de|6dere|6ffne|6ffnen|6ffnet|6fter|750m|85m|90m|a\\/\\/em|A\\/\\/es|abbeif\\$en|abdrficken|aBen|abergl\\\xe9iubischen|aberja|aberjemand|Aberjetzt|abf\\\xe9hrt|abf\\\xe9illt|abgef\\\xe9rbt|abgeh\\\xe9ngt|abgeh\\\xe9rt|abgelost|abgesprengli|abgestfirztl|abgestilrzt|abgestofien|abgew\\\xe9hlt|abgew\\\xe9hnen|abgew\\\xe9hnt|abge\\\xe9nderten|abh\\\xe9ingt|abh\\\xe9ngen|abh\\\xe9ngig|abh\\\xe9ngiges|Abh\\\xe9rstationen|Abjetzt|abkfihlen|Abkfirzung|abkommlich|Ablegenl|ablfisen|ablosen|Ablosung|abreif\\$en|Abrijcken|abr\\\xe9umen|Absch\\/ed|abschiefien|abschlief\\$en|abschliefien|abschwiiren|abstoflsend|Abtrijnnige|abwiirgt|abw\\\xe9gen|abzuh\\\xe9ren|abzuschwiiren|abzusfofien|ACh|Achtungl|Achzen|ACHZT|Acic|ADDRESSDATEI|Adi\\\xf6s|Admiralitat|Admiralit\\\xe9it|Admiralit\\\xe9t|Aff\\\xe9re|Aff\\\xe9ren|AFl|aggresivem|Agypten|aher|AI\\/en\\/vichtigste|Ain\\/vays|AIs|Aktivit\\\xe9iten|Aktivit\\\xe9ten|AKTMERT|Alarmsfufe|albem|Albtriiume|ale|alleinl|allejubeln|allern\\\xe9chsten|Allmiichtigerl|Allm\\\xe9chtige|Allm\\\xe9chtiger|allm\\\xe9hlich|Allm\\\xe9ichtiger|Allsparkl|allt\\\xe9iglichen|ALTESTE|Altester|Alzte|Amerx\\'kaner|amfisierst|Amiilsierst|amiisieren|amiisierenl|amiisierte|Amijsant|amlllsant|amlllsiert|amtlsant|Amusanf|amusant|Amusiert|Anderst|Anderung|Anderungen|anfa\\'ngt|Anffihrer|Anffingerl|Anfiihrer|anfijhlt|Anfingerl|Anfuhrer|Anfuhrern|Anf\\\xe9inger|Anf\\\xe9ingergliick|Anf\\\xe9nge|anf\\\xe9ngst|anf\\\xe9ngt|angebrfillt|angebrullt|angefiihrt|ANGEHCHDRIGE|angehfirt|Angehtirigen|angeh\\\xe9ren|angeh\\\xe9rt|angel\\\xe9chelt|angerilhrt|anger\\\ufb02hrt|angeschweifit|angespruht|angetiltert|Angriffspl\\\xe9nen|Angstschweili|anhiiren|Anh\\\xe9inger|anh\\\xe9lt|anh\\\xe9ngen|anh\\\xe9ren|ankijndigen|anliigen|anlugen|anmal3ende|ann\\\xe9hern|anriihrst|anrijuhren|anst\\\xe9indig|anst\\\xe9indiger|anst\\\xe9indiges|anst\\\xe9ndig|anst\\\xe9ndige|anst\\\xe9ndigen|Anst\\\xe9ndiges|Antik\\\xe9rper|Antiquit\\\xe9t|Antistrahlenger\\\xe9t|antwortenl|Anwe\\/sung|Anwe\\/sungen|Anw\\\xe9iltin|Anw\\\xe9lte|Anw\\\xe9ltin|Anzilge|Anztinden|Anzuge|Anzugen|anzuhiiren|anzuhoren|anzundenl|anzupiibeln|An\\\xe9sthesie|An\\\xe9sthesieprofessor|An\\\xe9sthesieteam|An\\\xe9sthesist|An\\\xe9sthesisten|An\\\xe9sthetikum|ARBEITERI|Arbeitsfl\\\ufb02gel|Armeefunkger\\\xe9t|Armel|Arschkichern|Arschliicher|Arschliichern|Arschl\\\xe9cher|Arschl\\\xe9chern|Arzte|Arzten|Arztin|Atemger\\\xe9usche|Atlantikkiiste|Atlantikkuste|ATMOSPHARE|Atmosph\\\xe9re|Atmosph\\\xe9renbereich|Atmosph\\\xe9reneinflugsequenz|Atmosph\\\xe9reneintritt|Attenfaiter|Attent\\\xe9iter|Attent\\\xe9ter|Attent\\\xe9ters|Attraktivit\\\xe9t|auBen|Aubenblick|AuBenbord|AuBenwelt|auBer|AuBerdem|auBerhalb|auc\\/1|auchl|Auf\\$erdem|auf3er|aufAugenh6he|aufblilhende|auff\\'a\\'ngt|Auff\\\xe9lliges|aufgebltiht|aufgeftlhrt|aufgeh\\\xe9ingt|aufgeh\\\xe9rt|aufgekl\\\xe9rt|aufger\\\xe9umt|aufgespiefit|aufgewiihlter|aufgez\\\xe9hlt|Aufh6ren|aufhbren|aufhdrf|aufhfiren|aufhiiren|Aufhoren|Aufh\\\xe9iren|aufh\\\xe9ngen|Aufh\\\xe9ren|aufh\\\xe9renl|aufi|Aufienministerium|aufier|Aufierdem|aufiergew\\\xe9hnliche|aufierhalb|Aufierirdischer|Aufierlich|aufierordentlich|Aufkenposten|aufkisen|aufkl\\\xe9ren|Aufkl\\\xe9rung|aufl|Aufl6sung|aufliisen|auflser|aufl\\\xe9sen|aufmiibeln|aufraumte|aufr\\\xe9umen|aufschlief\\$en|Aufschlull|aufSer|aufSIJBigkeiten|aufspturen|aufstellenl|Aufst\\\xe9ndige|aufTanis|Auftr\\\xe9ge|aufvv\\\xe9ndigen|aufw\\\xe9ichst|aufw\\\xe9rmen|aufZ\\>er|Aufztlge|aufzuhiivren|aufzukl\\\xe9ren|aufzuldsen|aufzur\\\xe9umen|aufz\\\xe9hlen|auf\\\xe9er|auf\\\ufb02iegen|Augenm\\\xe9igen|aul\\'5er|aul3er|Aul3erdem|aul5er|aulier|Aulierdem|auliergewfihnlich|aulierhalb|Aulierirdischen|auller|aullerhalb|AulSer|AulSerdem|ausdriicken|ausdriickt|ausdrijcken|ausdrucklicher|Ausdr\\\ufb02cken|Ausen\\/v\\\xe9hlte|Ausen\\/v\\\xe9hlter|auserw\\\xe9hlt|Ausffillen|ausfijhren|ausfijhrt|ausfuhren|ausfullt|ausgef\\\ufb02llt|ausgeliischt|ausgeliist|ausgel\\\xe9ist|ausgel\\\xe9scht|ausgel\\\xe9st|ausgeriickt|ausgerijstet|AUSGEWAHLT|ausgew\\\xe9hlt|Ausg\\\xe9ngen|aush6hlen|aushiilt|Aushilfspunkerl|aush\\\xe9lt|ausilben|Auskunfte|ausl|Ausl\\\xe9nder|Ausl\\\xe9nderl|ausl\\\xe9schen|ausl\\\xe9sen|Ausl\\\xe9ser|AusmaB|ausprobie\\\ufb02|Ausriistung|ausrusten|Ausrustung|Ausschullware|ausschwinnenl|auszudriicken|auszuschliefien|auszuw\\\xe9hlen|Autorit\\\xe9t|Autoschlilssel|Autoschl\\\ufb02ssel|au\\\ufb02\\/viihlt|Au\\\ufb02ergewiihnlich|Azevedol|A\\\ufb02es|B\\/ick|b\\/olog\\/sch|b\\/sschen|B6se|B6sem|B6ser|Babym\\\xe9dchen|Ballastst\\\xe9ffchen|Ballm\\\xe9dchen|Ballm\\\xe9idchen|Ballonverk\\\xe9ufer|Balzenl|Bankijberfall|Barbarenilberfall|Barenk\\\xe9nig|basfeln|Bastianol|Bastlano|Bauchfellentztmdung|Bauchkr\\\xe9mpfe|bauf\\\xe9llig|bauf\\\xe9llige|Baumst\\\xe9mme|Baupl\\\xe9ne|Bbses|be\\/de|bedecktl|Bedilrfnisse|Bedilrfnissen|Bedllirfnisse|bedrijckt|bedr\\\xe9ngen|bedr\\\xe9ngt|bedr\\\xe9ngten|Beeilungf|Beeilungl|Beerdingungsinsiiiui|Beerdingungsinstitut|Befehll|beffirdert|Beffirderung|befiirchte|befiirchteten|befiirdert|befiirderte|Befiirderung|befilrchtete|befllirchte|befurworte|befurwortet|bef\\\xe9rdere|bef\\\xe9rdert|Bef\\\xe9rderung|beg\\/ng|begl\\\ufb02ckt|begniigt|begrfindetes|Begriiliungsruf|begrijfien|Begrilfiung|Begrilfkung|begrL\\'llZ\\>en|BegrUBungsruf|begrUf\\$t|begrufie|begrufit|Begrundung|Beh6rden|beh\\\xe9lt|Beh\\\xe9lter|beh\\\xe9mmert|beiB|beiBen|beiBt|beif\\$t|beif2\\>en|beifken|beiflsen|beijenen|Beiliring|BEKAMPFEN|bekannf|bekanntermafken|bek\\\xe9me|bek\\\xe9mpfen|Bek\\\xe9mpfung|bel|belde|beliellsen|belm|Beltlftungstunnels|Beluftungstunnel|Beluftungstunnell|bel\\\xe9stigen|Bemiihe|Bemiihen|bemL\\'lhe|bemtuht|bemuhen|bemuhten|Ben\\\xe9tigen|ben\\\xe9tigt|ben\\\xe9tigten|Beobachtar|bereft|bereitf\\\xe9ndet|beriichtigtsten|beriichtlgten|beriihmt|Beriihmtheiten|beriihren|Beriihrend|beriihrt|Beriihrtl|berijhrt|berilhmter|berilhrt|Berilhrung|Berks\\/1\\/re|BerL\\'lhre|berllichtigter|berllihren|berllihrt|berlllhmten|Bern\\/e|beruhrt|beruhrte|ber\\\ufb02hmter|besafi|Besch\\'a\\'ftigt|bescheifien|beschiftigt|beschiiftigt|beschiitzen|beschiitzt|beschiltze|beschiltzen|beschleun\\/gt|beschliefkt|beschlie\\\ufb02tloszuziehen|beschllitzet|beschllitzt|beschr\\\xe9nkt|Beschr\\\xe9nkungen|beschtitze|beschutzen|besch\\\xe9digt|besch\\\xe9ftigen|besch\\\xe9ftigt|besch\\\xe9ftigte|besch\\\xe9ftigten|besch\\\xe9iftige|besch\\\xe9iftigt|Besch\\\xe9imen|besch\\\xe9mendste|besch\\\xe9oligen|besch\\\ufb02tzen|Besch\\\ufb02tzer|Besf\\\xe9f\\/gen|Besitztijmer|BESTATIGE|BESTATIGT|bestenl|bestiirzt|bestiitigen|bestltigt|bestx\\'mmt|best\\\xe9indige|best\\\xe9itigt|Best\\\xe9itigung|Best\\\xe9itigungen|Best\\\xe9tige|Best\\\xe9tigen|best\\\xe9tigt|Best\\\xe9tigung|bes\\\xe9inftigen|bes\\\xe9inftigt|bes\\\xe9nftigen|Betiiubt|betriibt|betriigen|Betriiger|betriigt|betrijgen|Betrijgerl|betrilgen|betrtlgerischer|betr\\\xe9chtliches|Betr\\\xe9ge|betr\\\xe9gt|Bettw\\\xe9ische|Beviilkerung|bevorwir|bev\\\xe9lkern|bewegf|Bew\\\xe9hrungsauflage|bew\\\xe9ihrte|bew\\\xe9iltigen|bew\\\xe9issern|bew\\\xe9lkten|bew\\\xe9ltigen|Bew\\\xe9ltigung|bew\\\xe9ssern|Bew\\\xe9sserungssysteme|Bezirksgelinde|bezuglich|be\\\xe9ingstigende|be\\\xe9ngstigend|be\\\xe9ngstigender|bffnen|Bficher|Bfiro|bfirsten|bfise|bfisen|bfiser|bfises|bfiseste|bfisesten|bgsonderen|BI6de|Bierbfichse|Biicher|Biicherei|Biick|Biiffel|BIiHlt|Biihne|Biilcherei|BIind|Biirger|Biirgerrechte|Biiro|Biiros|Biirotiir|biirsten|Biise|Biisen|biises|Bijchern|Bijhne|Bijndnis|Bijrger|Bijrgermeister|Bijro|Bijrokraten|Bijrzel|Bilchern|Bildseitenverh\\\xe9ltnis|Bilndel|Bilro|BIood|BIQIS|Bischiife|Bischiifen|Bisch\\\xe9fe|bistja|bistjetzt|Bittejetzt|bittersiJl3es|Bittesch\\\xe9n|BIue|bi\\\xdfchen|BL1hne|Bl6cke|bl6d|bl6de|bl6den|bl6der|bl6des|Bl6dian|Bl6dmann|Bl6dsinn|Blauaugel|Blddes|Ble\\/bf|bleibenl|blelbenl|Blfidmann|Blfidsinn|Blfimchen|BLicher|BLihne|Bliid|bliide|bliiden|bliidere|bliides|Bliidmann|Bliidsinn|bliiht|bliirgerlichen|Blijmchen|Bllck|Bllindel|Blllroklammer|bln|bloB|bloBen|bloBstellen|blockiertl|BLODE|blof\\$|blofl|Blol2\\>|blol3|blol3\\>|blol3stellen|bloli|blolistellen|blolls|bls|Blst|bltte|Blumenstr\\\xe9iulichen|Blument\\\xe9pfen|Blutgetr\\\xe4nkte|Blutgetr\\\xe9nkte|blutjungl|blutriinstig|Blutvergiefien|bl\\\xe9d|Bl\\\xe9de|bl\\\xe9den|bl\\\xe9der|Bl\\\xe9des|Bl\\\xe9dheit|Bl\\\xe9dmann|Bl\\\xe9dsinn|Bl\\\xe9iser|Bl\\\xe9ser|bl\\\xe9st|Bnjicke|Bodensch\\\xe9tze|Bogenschiefien|Bogenschiefienl|Bogenschiefiens|Bogenschiitze|Bogenschiitzen|Bogenschijtze|Bogenschijtzen|Bogenschutzen|Bogenschutzenl|BOnjour|bosartige|Bracken|Briicke|Briicken|Briider|Briihe|Briillen|briillt|Brijcke|Brijderlichkeit|brijllen|Brilcke|Brilder|Brilllen|brillltjeden|Brilnette|Brilsten|brilten|BrL\\'lcke|brL\\'lllen|brlliderliche|Brllidern|Brlliste|Broschijre|Broschilren|Broschuren|Brucke|Brucken|Brudern|Bruhe|brullen|brullt|Brutalitiit|Brutzelhtihnchen|Br\\\xe9chtet|Br\\\xe9iutigam|Br\\\xe9sel|Br\\\xe9tchen|br\\\xe9uchte|br\\\xe9uchten|br\\\xe9unen|Br\\\xe9ute|Br\\\ufb02cke|Br\\\ufb02der|Btiro|Btiser|Bucher|Buchern|Budgetkiirzung|BUFO|Bugschutzgerate|Buhnenbild|Bullel|Buml|Bundnis|Burger|Burgerrechtlerin|Buro|BURO|Burol|Burottlr|Busche|B\\\xe9ickchen|B\\\xe9ickerei|B\\\xe9ille|B\\\xe9inder|B\\\xe9ir|B\\\xe9irgermeister|B\\\xe9iro|b\\\xe9ise|B\\\xe9iume|B\\\xe9nder|B\\\xe9r|B\\\xe9ren|B\\\xe9renhasser|B\\\xe9renhunger|B\\\xe9renj\\\xe9ger|B\\\xe9renk\\\xe9nig|B\\\xe9renlaute|B\\\xe9renrolle|B\\\xe9renschnitzereien|B\\\xe9renstimmen|B\\\xe9rin|B\\\xe9risch|B\\\xe9rs|B\\\xe9rte|b\\\xe9s|b\\\xe9se|b\\\xe9sen|B\\\xe9ses|B\\\xe9ume|B\\\xe9umen|B\\\ufb02chern|B\\\ufb02ste|Cafe|Caf\\\xe4|CASAREN|Charakterm\\\xe9ngel|Charakterst\\\xe9rke|Chrlntlna|Ciden|Ciffnet|Cihrchen|Citro\\\xe9n|clamit|class|Clbernimmt|cler|Coimbrasl|CommanderWill|Corenillal|Cowboyscheifi|C\\\xe9sar|D\\/e|d\\/ese|d\\/esem|d\\/esen|D\\/eser|D\\/eses|D\\/sko|dabel|dachfen|daffir|dafiir|Dafijr|Dafijur|Dafilr|dafL\\'lr|dafLir|dafljr|dafllir|Daflllrwar|daftir|dafUr|dafzjir|dajemand|dal|Damenh\\\xe9nde|damitl|damlt|DANEMARK|darfiber|Dariiber|darijber|Darilber|dart\\/\\'ber|dartlber|DARUBER|DarUber|dasjetzt|dasl|Dateniibermittlung|dauem|dauerf|dazugeh\\\xe9ren|Da\\\xdf|Da\\\ufb02lr|Ddrfern|def|Defekf\\/v|deinerZelle|deln|delne|demfiltigen|Demijtigung|demllitige|demllitigen|denkwurdiger|denkw\\\ufb02rdiger|derAbgeordnete|derAusgabe|derAusl6ser|DerjL\\'lngste|derjunge|dermaben|derTyp|derWeg|derWelle|DerWL1rfel|DerZauberer|de\\_\\_n|dfeserr|dffentlichen|dffnen|Dfimonen|dfinn|dichl|diej\\\xfcngste|dienstunfahig|Dieselkapit\\\xe9in|Dieselkapit\\\xe9n|Dieselmotorenl|dieserAufnahme|Dieserjunge|Diiit|diirfe|Diirfen|diirft|diirfte|dijfien|dijnn|dijrfen|Dijrfte|dijstere|dilmmer|dilrfen|dilrft|dilrften|dilrftig|Dine|dirja|dirjemand|dirjetzt|dirJulie|dirl|dirwehzutun|Di\\\xe9t|Di\\\xe9tberaterin|Di\\\xe9tbier|dlch|Dle|dles|Dlese|Dlfit|Dlitplan|dllirfen|dllirft|dllirstet|dlr|doc\\/1|dochl|dolthin|Doppelgfiner|Doppelgfinger|Doppelg\\\xe9inger|Doppelg\\\xe9nger|Doppelzijngig|doppelztmgiger|dor|Dr\\'a\\'ngt|drachengriinen|Drahte|dranl|drau\\/3en|drau\\/Sen|drauBen|drauf\\$en|draufdrilcken|draufgestllirzt|draufg\\\xe9ngerisch|draufien|draufken|drauflsenl|drauf\\\xe9en|drauilen|draul3en|draul5en|draulien|draullen|draulSen|Dreckl\\\xe9chern|Drecksmiihle|Drecks\\\xe9cke|drfiben|Drfick|Drfingeln|drih|driiben|driicken|driickt|drijben|drijber|drijck|drijckt|drilben|drilber|drilcken|drLiber|drlliben|drlllben|Drogenabh\\\xe9ngige|Drticken|druben|drubenl|druber|Druckkn\\\xe9pfe|drunterliegt|Dr\\\xe9nage|dr\\\xe9ngeln|dr\\\xe9ngen|dr\\\xe9ngt|dr\\\ufb02ben|dtirft|dtlrfen|Dudels\\\xe9cken|dUFf\\\u20acl\\'1|dul|dull|Dummk6pfe|Dummkiipfe|Dunnschiss|durchdrficken|durchdr\\\xe9ngen|Durchfiihrung|durchfuhren|durchgefiihlt|durchgefijhrt|durchgefuhrt|durchgef\\\ufb02hrt|Durchg\\\xe9nge|Durchladenl|durchlfichere|durchsetzungsf\\\xe9higer|durchst\\\xe9bern|durchwilhlt|durchzufilhren|durchzufuhren|Durfen|durft|dusterer|D\\\xe9cher|D\\\xe9imon|D\\\xe9imonen|D\\\xe9inemark|D\\\xe9inemarks|D\\\xe9inen|d\\\xe9inisches|d\\\xe9mlich|D\\\xe9mliche|d\\\xe9mlichen|d\\\xe9mlicher|d\\\xe9mlichl|d\\\xe9mmert|D\\\xe9monenb\\\xe9ren|d\\\xe9monischen|D\\\xe9rme|D\\\xe9rrfleisch|D\\\xe9umchen|d\\\ufb02rfen|E\\/\\/e|e\\/n|e\\/ne|e\\/nem|e\\/nen|e\\/ner|e\\/nes|e\\/ns|e\\/nsf|E9YPt|Ea\\/vtes|ebenbfirtig|ebenburtige|Ec\\/vte|echfen|edelm\\\ufb02tig|efn|efwas|Eheminner|Ehem\\\xe9nnern|Ehezerstfirerin|Ehrenbijrger|EHRENBURGERSCHAFT|Ehreng\\\xe9iste|Eichhfirnchen|Eichhiirnchen|Eichh\\\xe9rnchens|eifersfichtig|eifersiichtig|eifers\\\ufb02chtig|eigenh\\\xe9ndig|eigenmlchtig|eigenntltziges|Eihnlich|Eimen\\/veise|Einbruche|eindriicken|Eindring\\/Inge|eindrucken|einejunge|einerfr\\\ufb02hen|einervorfuhrung|einfiihren|Einfiihrung|einfilgen|einfilhlsamsten|einflllgen|Einflusse|einfugen|einfuhrten|Einfuhrung|Einf\\\xe9ltige|eingefiigt|eingef\\\ufb02gt|eingehiillt|eingepr\\\xe9gt|einger\\\xe9iumt|einger\\\xe9umt|eingeschl\\\xe9fert|eingeschr\\\xe9nkt|eingesch\\\xe9itzt|eingesch\\\xe9tzt|eingesturzt|eingieBt|eingschaltet|Einh\\\xe9rnern|einlegenl|einl\\\xe9dt|einl\\\xe9sen|Einsatzfahigkeit|Einschiichterung|Einschliefklich|Einschlielilich|einstellenl|Eins\\\xe9tze|eint\\\xe9nig|Einzelg\\\xe9ngerin|einzusch\\\xe9tzen|Eisstiirme|Elektrizit\\\xe9t|elfenbeingetfinte|elit\\\xe9rer|Eln|Elne|elnem|Elnen|elner|Elnes|empfindungsf\\\xe9higen|Empf\\\xe9inger|empf\\\xe9ngt|Empiirend|Empiirendste|empiirt|emst|en\\/varten|En\\/vartungen|en\\/v\\\xe9hnt|Enchant\\\xe4|endgiiltig|endgultig|endgultigen|endg\\\ufb02ltig|endlichl|ENERIGE|enfternt|Engl\\\xe9nder|Engl\\\xe9nderin|eniillen|entbl6Bte|entbl6f\\$en|entfiihre|entfiihrt|entfiihrte|Entfiihrung|Entftihrung|ENTFUHRUNGSVERDACHTIGER|enthllt|enthUllt|enth\\\xe9lt|entliiften|Entliiftungen|Entlijlftungen|entluften|entl\\\xe9sst|Entreilit|entriistet|entr\\\xe9itseln|Entschlrfen|Entschlull|ENTSCHLUSSELN|Entschlussen|entsch\\\xe9rfen|enttausche|enttiiuscht|Enttluscht|Enttluschungen|entt\\\xe9iuschen|entt\\\xe9uschen|entt\\\xe9uschst|entt\\\xe9uscht|Entv\\\\\\/Urfe|Entwicklungsl\\\xe9ndern|entzllickt|entzllindet|entzuckend|entzundet|enzv\\\xe9rmt|Er6ffnen|erb\\\xe9rml\\/ch|erb\\\xe9rmlich|Erb\\\xe9rmliches|Erdnijsse|erdriickt|erd\\\xe9ihnliche|erfebst|erffillen|erfiffnet|erfiille|erfiillen|erfiillt|erfijllt|erfillle|erfilllen|erfilllt|erfllille|erfllillt|erflllllen|Erfolgl|erfullen|erfullt|erf\\\xe9hrst|erf\\\xe9hrt|erf\\\ufb02llen|ergrllindet|erhalfen|Erhdhe|erhiihter|erhiiren|ERHKLT|erhllt|erh\\\xe9hen|erh\\\xe9ht|erh\\\xe9ilt|erh\\\xe9lt|erh\\\xe9rt|erh\\\xe9rte|eriiffnet|erja|erjetzt|erjung|erkl\\'a\\'ren|erkl\\'air\\'s|erklaren|erklfire|Erklfirung|erklirt|erkllre|erkllrt|erkllrte|erkllrten|Erkllrung|erkl\\\xe9ir|erkl\\\xe9ire|erkl\\\xe9iren|erkl\\\xe9r|erkl\\\xe9r\\'s|erkl\\\xe9rbar|Erkl\\\xe9re|erkl\\\xe9ren|erkl\\\xe9rt|Erkl\\\xe9rung|erk\\\xe9ltest|erlC\\'\\>st|erldse|Erled\\/gen|erlieB|erlnnem|erl\\\xe9scht|erl\\\xe9sen|erl\\\xe9st|Erl\\\xe9sung|ermbglichen|Erm\\\xe9chtige|erm\\\xe9glicht|erm\\\xe9glichte|ernlllchtert|ern\\\xe9hren|Ern\\\xe9hrung|eroffnet|Erpressungsscheilie|err\\\xe9tst|erschieB|erschieBen|erschiefien|erschiefit|erschiefke|erschielie|Erschielit|erschiipft|erschiittert|erschilttert|erschl\\\xe9gt|ERTCHDNT|ERTCNT|ERTGNT|ertiffnen|ertr\\\xe9gst|ertr\\\xe9inken|ert\\\xe9nt|ervvartez|ervvilrgen|ervv\\\xe9hnen|ervv\\\xe9ihnen|ervv\\\xe9ihnt|ervv\\\xe9ihnte|Erv\\\\\\/an|Erv\\\\\\/an\\'s|erw\\'a\\'hnt|Erwar|erwe\\/sen|Erwfirmung|Erwird|Erwtirde|erw\\\xe9gt|Erw\\\xe9gung|Erw\\\xe9hne|erw\\\xe9hnen|erw\\\xe9hnt|erw\\\xe9hnte|Erw\\\xe9hnung|erw\\\xe9ihlt|erw\\\xe9ihnt|erw\\\xe9rmt|erz\\'a\\'hlt|Erzdiiizese|erzfihlen|Erzfihler|erzihlenl|erziihlen|erziihlt|erziirnt|erzilrnt|erzllirnt|erzurnen|erz\\\xe9hl|erz\\\xe9hle|Erz\\\xe9hlen|erz\\\xe9hlerische|erz\\\xe9hlerischen|erz\\\xe9hlerischer|Erz\\\xe9hlkunste|erz\\\xe9hlst|erz\\\xe9hlt|erz\\\xe9hlte|Erz\\\xe9hlung|Erz\\\xe9ihl|Erz\\\xe9ihle|erz\\\xe9ihlen|erz\\\xe9ihlst|erz\\\xe9ihlt|erz\\\xe9ihlte|er\\\xe9ffnen|er\\\xe9ffnet|er\\\xe9ffnete|Er\\\xe9ffnungsaufnahme|Er\\\xe9ffnungssequenz|Er\\\xe9ffnungsszene|Er\\\ufb02lllen|etemity|etvva|euc\\/1|Europ\\\xe9er|europ\\\xe9ische|ex\\'nfac\\'\\/7|Examenspriifungen|Exekutivzust\\\xe9noligkeit|Explosionenl|Extrablattl|F\\/nden|F\\/ugba\\/I|Fahnrich|fahrlissiges|Fairbankverlieh|Fallef|fallengelassen|Fallschirmj\\\xe9gereinheiten|Fam\\/Z\\/e|Fa\\\xdf|FBl|Fe\\/nd|fehlschl\\\xe9gt|Feindberllihrung|Feind\\\xfcbewvachung|feltig|femen|fernh\\\xe9ilt|Festhaltenl|Fettw\\\xe9nste|Feuen\\/vehr|Feuerliischer|Feuervvehrrnann|Feuerwehrl|Feuerwfirmen|Feue\\\ufb02|ff\\'Ul\\'1\\\u20acf\\'\\\u20acl\\'1|Ffiegen|ffihft|ffihren|ffinf|ffir|ffirchte|ffirs|ffittere|FI6he|Fiasenm\\\xe9iher|fibel|fiber|fiberdressierter|fibergezogen|fiberhaupt|fiberholt|fiberlegt|fibernachtet|fiberspannt|fibertreiben|fiberzfichtete|fibrig|Fieferenz|Fieifi|fiffentlichkeit|fiffnen|fiffnest|fifter|Fihigkeit|fihneln|Fihrt|fiihl|fiihle|fiihlen|fiihlst|fiihlt|Fiihlte|Fiihre|Fiihren|Fiihrerin|Fiihrerschein|fiihrfe|fiihrt|fiihrte|Fiihrungsf\\\xe9ihigkeiten|Fiihrungsprogramm|Fiihrungsstil|Fiilcksicht|fiillen|fiinden|fiinf|fiinfhundert|fiinfzehn|fiir|fiirchte|fiirchten|fiirchterlich|fiirchterlichl|fiirchterllches|fiirchtet|fiirchteten|fiirjeden|Fiirmchen|fiirs|Fijgen|fijhl|fijhle|fijhlen|fijhlst|fijhlt|fijhren|Fijhrer|fijhrt|Fijhrungsqualit\\\xe9iten|FiJl3en|Fijlie|fijlr|Fijnf|Fijnfziger|fijr|fijrchte|fijrchten|Fijrjedenl|fijrs|fiJrVorteile|fijttern|fijur|filhl|filhle|filhlen|filhlte|filhre|filhren|Filhrern|Filhrerschein|filhrst|filhrt|filhrte|filhrten|Filhrung|Fillle|Filll\\\xe9en|Filmemachen|Filml|filnf|Filn\\\ufb02|Filr|filr\\'ne|filrchten|filrchterlich|filrs|filter|findem|findenlassen|Fingerabdrijcke|Fingerabdrilcke|Fingerniigeln|Fingern\\\xe9gel|Fingern\\\xe9geln|fingstlich|Fiothaarige|Firmen\\\xe9rzte|Fischk\\\xe9pfe|FIUssigkeitsgleichgewicht|Fiusten|FIynn|fjffnen|fL\\'1\\'r|fL\\'1hle|FL\\'1r|fL\\'ir|fL\\'lr|fL1r|Fl6he|Flclse|fleifkige|fleifkiges|fleil3ig|Fleischb\\\xe9llchen|Fleischkl6l\\'Sen|Flfige|Flfigell|flfistert|Flhigkeiten|Flhnrich|Flhnriche|flieBen|Fliefiband|Fliefiheck|Flieflsb\\\xe9nder|flielit|flielSt|FLif\\$e|fLihlt|fliichtige|Fliigel|flijchtig|Flijgel|Flijgelfedernl|Flilssige|flilstert|fLir|fljhrt|Fljr|flJr\\'n|fllihrst|Fllihrt|fllinf|fllinften|Fllinkchen|Fllir|fllirchte|fllirchten|fllirchterlichen|fllirchtet|Fllirsten|Fllitterungszeitenl|flllgte|flllgten|flllhrten|Flllhrung|Fllligel|flllistern|fllllstert|flllrchte|flllrchten|flllrjede|Flohtransporterl|Floli|Flottenalzt|Flottenstiitzpunkt|Flottenstutzpunkt|Flrma|fltlsterte|Fluchtig|Flughdhe|Flughiihe|Flugh\\\xe9ifen|Flugunf\\\xe9ihig|flugunf\\\xe9ihigen|Flugunf\\\xe9ihigl|Flugzeugl|FLUSSIGER|Flustereffekt|Flustern|FLUSTERT|fl\\\ufb02stern|fl\\\ufb02sterten|Folgendesz|fortgespiilt|fortspiilen|fortw\\\xe9hrend|Fr\\/ed\\/10\\/|Fr5ulein|Fr6hliche|Frachfmodule|Frafi|fragfe|Fral\\'S|fralken|Franzfisisch|Franziisin|franziisische|franziisischen|franziisischer|franziisisches|Franz\\\xe9sisch|franz\\\xe9sische|franz\\\xe9sischen|franz\\\xe9sischer|Franz\\\xe9sisches|FRAULEIN|fre\\/em|freffen|freilieB|freimiitigen|Fressger\\\xe9usche|Frfichtekuchen|frfih|frfiher|Friedh\\\xe9fe|Friichtchen|friih|friihen|friiher|friihere|friihliche|friihlichen|Friihstiick|friilher|friilhesten|Frijchte|frijh|frijher|frijherer|frilh|frilhen|Frilher|frilhere|Frilhst\\\ufb02ck|Fris6r|frL\\'lher|Frljihling|Frllichte|frllih|frlliher|Frllihstiickskiiche|fro\\/1|FROHLICHE|frtih|Frtiher|Frtihliche|Frtihstticksei|Frtlh|FrUh|FRUHE|fruhe|fruhen|Fruher|fruheren|Fruhling|Fruhlingsrolle|FrUhstUck|Fruhstuck|frUhstUcken|fr\\\xe9hliches|fr\\\xe9ihfiches|fr\\\xe9ihlich|Fr\\\xe9iulein|fr\\\xe9nen|Fr\\\xe9sche|Fr\\\xe9ulein|ftihlen|Ftillhorn|Ftir|Ftirs|Ftlhrung|ftlrchte|ftmf|Fu\\/3|FuB|FuBballspieler|FUBen|Fuf\\$|Fufi|Fufiabdrucke|Fufiballtraining|FufL|Fuflsball|Fuflsballszene|fUhl\\'t|fuhle|fuhlst|fUhlt|fUhre|fUhrt|fuhrte|fuhrten|Fuhrung|Fuhrungsf\\\xe9higkeiten|Fuhrungsoffizier|Fuhrungsqualit\\\xe9t|FUI3en|Fuli|Fuliball|Fulisohlen|FUller|fUllten|fumt|Fundbiiro|FUnf|Funftbeste|Funkchen|Funkger\\\xe9it|Funkger\\\xe9ite|Funkger\\\xe9t|funktionstilchtig|FUR|Fur|fUrAusweichmanc\\'\\\xa7ver|furchteinfl6Bend|furchteinfl6Bende|furchten|Furchtest|furchtet|furchteten|fureinander|furjeden|furjemanden|furjudische|furs|FUrWalter|fut|Fu\\\ufb02ballspiel|F\\\xa7hnlein|f\\\xe9\\/\\/t|f\\\xe9hig|F\\\xe9higkeit|F\\\xe9higkeiten|f\\\xe9hnen|F\\\xe9hnens|F\\\xe9hnerei|F\\\xe9hnleinmiitter|F\\\xe9hre|f\\\xe9hrst|f\\\xe9hrt|F\\\xe9ihigkeit|F\\\xe9ihigkeiten|f\\\xe9ihrt|f\\\xe9illst|f\\\xe9illt|F\\\xe9ilschung|F\\\xe9ingt|f\\\xe9ir|F\\\xe9lle|F\\\xe9llen|f\\\xe9lligl|F\\\xe9llt|f\\\xe9llt\\'s|F\\\xe9lschen|F\\\xe9lschung|f\\\xe9nde|F\\\xe9ngst|F\\\xe9ngt|f\\\xe9rben|f\\\xe9rbt|f\\\xe9rdern|f\\\xe9rmlich|F\\\xe9ustlinge|f\\\xfcr\\'ne|f\\\xfcrchlerlichen|f\\\xfcrjede|f\\\xfcrjeden|F\\\ufb02hrungsprogramm|F\\\ufb02hrungsstil|f\\\ufb02llen|f\\\ufb02llt|f\\\ufb02nf|F\\\ufb02r|f\\\ufb02rchte|f\\\ufb02rjeden|g\\/bf|g\\/bsf|G5ste|G6nn|G6t\\'lllche|G6tter|G6ttern|Gamilonl|ganzlich|gardel|Gasbrfiter|gauze|GCJKTEN|ge6lt|gebauf|Gebiez|Gebi\\\xe9ude|gebliebenl|GEBRAUCHTWAGENIPOLIZEIITAXI|Gebr\\\xe9u|gebs|gebuhrend|Geb\\\xe9ick|Geb\\\xe9iude|geb\\\xe9rdet|Geb\\\xe9rmutter|Geb\\\xe9rmutterhals|Geb\\\xe9ude|Geb\\\xe9udedach|Geb\\\xe9uden|Geb\\\xe9udes|gedemiitigt|gedemijtigt|gedemllitigt|gedrtickt|gedr\\\xe9ngt|Ged\\\xe9chtnisverlustes|Ged\\\xe9ichtnis|ged\\\xe9mpft|gef\\'a\\'hrlich|gef\\'a\\'llt|gef5IIt|gefahrdet|gefahrlich|gefallsllichtige|GEFANGNISTECHNOLOGIE|Gefechtsausrustung|Geffihl|geffihrt|geffillt|Gefihrliche|Gefiihl|Gefiihle|Gefiihlen|Gefiihlslebens|gefiihlsmiliigen|gefiihrt|gefiillst|gefiillt|gefiirchtet|Gefijhl|Gefijhle|gefijhlt|gefijllte|Gefilhl|Gefilhle|gefillt|Gefingnis|gefL\\'lllten|Geflilster|gefllihllos|Geflllhlsduselige|GEFLUSTERT|Geftuhle|Gefuhl|Gefuhle|Gefuhlen|gefuhlt|gefuhlvolle|gefurchtet|Gef\\\xe9hrde|gef\\\xe9hrden|gef\\\xe9hrdet|Gef\\\xe9hrdung|gef\\\xe9hrlich|gef\\\xe9hrliche|gef\\\xe9hrlicher|gef\\\xe9hrlicheren|Gef\\\xe9hrliches|Gef\\\xe9hrt|gef\\\xe9ihrden|gef\\\xe9ihrdet|gef\\\xe9ihrlich|Gef\\\xe9ihrte|Gef\\\xe9ihrten|gef\\\xe9illt|Gef\\\xe9illt\\'s|gef\\\xe9llf|gef\\\xe9llfs|gef\\\xe9llig|gef\\\xe9lligst|gef\\\xe9llst|Gef\\\xe9llt|Gef\\\xe9llt\\'s|gef\\\xe9lscht|Gef\\\xe9ngnis|Gef\\\xe9ngnisregeln|Gef\\\xe9ngnisse|Gef\\\xe9ngnissen|Gef\\\xe9ngnisses|Gef\\\xe9ngniswagen|gef\\\ufb02gig|gegenfiber|gegeniiber|gegeniibertritt|gegeniiberzusfehen|gegenijber|gegenlliber|gegenlliberstehen|Gegenstrfimung|Gegenstr\\\xe9mung|Gegensttlck|Gegenst\\\xe9nde|gegenuber|Gegenverschwiirung|gegenw\\\xe9rtigen|gegriindet|gegrijfit|gegrilfit|GegrUl3t|gegrundet|geh6ren|geh6rt|gehdrt|GeheilS|geheilSen|gehejetzt|gehf|gehfiirt|gehfire|gehfiren|gehfirt|gehiipft|Gehiir|gehiire|gehiiren|gehiirst|gehiirt|Gehim|Gehirnsch\\\xe9den|gehlngt|gehore|gehoren|gehort|geht\\'sl|Gehtirt|gehtjetzt|geh\\\xe9irt|Geh\\\xe9iuteten|geh\\\xe9r|geh\\\xe9re|geh\\\xe9ren|geh\\\xe9rst|Geh\\\xe9rt|geh\\\xe9rten|geh\\\xe9rtf|geiiffnet|geilbt|geistesgestort|Gei\\\ufb02blatt|Gei\\\ufb02blattstaude|gekiisst|gekiisstl|gekijndigt|gekijsst|gekilsst|gekimpfl|gekimpft|geklautl|gekliirt|gekllrt|gekl\\\xe9rt|gekriint|gekrijmmt|GEKUHLTER|gekurzt|gek\\\xe9mpft|gelaufenl|gelegf|gelegtwurde|geliist|gelilftet|gelndert|Gelst|Geltungsbedurfnis|GELUBDE|Gel\\\xe9chter|gel\\\xe9hmt|gel\\\xe9ischt|Gel\\\xe9nde|gel\\\xe9nge|gel\\\xe9st|gem|gemafiregelt|Geme|gemfitliches|Gemiise|gemiitlich|Gemijlse|Gemilt|gemiltlicher|GemLise|Gemut|gem\\\xe9fi|Gem\\\xe9fk|gem\\\xe9ht|Gem\\\xe9ili|Gem\\\xe9lde|Gem\\\xe9lden|Genaul|genieBt|genief\\$en|Geniefien|geniefk|genielien|genielken|genie\\\ufb02en|genligen|genlligend|genlligt|genlllgend|genugt|genugte|georfef|gepfluckt|gepriifter|gepruft|Gep\\\xe9ck|gerfit|Geriichte|Geriite|Gerijcht|Gerllicht|gerllistet|gernhaben|gernntgt|ger\\\xe9it|Ger\\\xe9iusch|Ger\\\xe9t|Ger\\\xe9te|Ger\\\xe9tschaften|ger\\\xe9umt|Ger\\\xe9usch|Ger\\\xe9usche|ger\\\xe9uschvoll|geschafff|GESCHAFTSFUHRER|gescha\\\ufb02i|Geschfift|geschfimt|Geschift|Geschifte|Geschiftsleute|Geschiftswelt|geschiidigt|Geschiift|Geschiiftsleben|geschijtzten|Geschiltz|Geschiltze|Geschiltzrohre|Geschiltzturm|geschlijpftl|Geschllitzstellungen|geschnfiffelt|Geschtitz|Geschtltz|Geschutz|Geschutze|Geschwiir|Geschwllir|Geschwur|geschw\\\xe9cht|geschw\\\xe9ingert|Geschw\\\xe9tz|Gesch\\\xe9ft|Gesch\\\xe9fte|Gesch\\\xe9ftige|gesch\\\xe9ftlich|Gesch\\\xe9fts|Gesch\\\xe9ftsleben|Gesch\\\xe9ift|Gesch\\\xe9ifte|gesch\\\xe9iftsm\\\xe9ifiig|gesch\\\xe9itzt|gesch\\\xe9nolet|Gesch\\\ufb02tze|Gesetzeshiiter|Gesichtl|Gesichtsausdrijcke|Gesiiff|gesiindigt|gespiirt|Gesprach|GESPRACH|GESPRACHE|Gespr\\\xe9ch|Gespr\\\xe9che|Gespr\\\xe9iche|Gespr\\\xe9ichsthema|Gespur|gestiirt|gestijrzt|gestijtzte|gestof\\$en|gestolken|Gestriipp|Gestrijpp|GESTURZT|gest\\\xe9irt|Gest\\\xe9ndnis|gest\\\xe9rt|gest\\\ufb02rzt|Gesundheitsbehijrde|Gesundheitsftlrsorge|Ges\\\xe9fitaschel|Ges\\\xe9iffstaschenl|get6tet|Getiise|getiitet|getr\\'a\\'umt|getr\\\xe9umt|get\\\xe9tet|get\\\xe9tetf|get\\\xe9uscht|gev\\\xe9gelt|gew6hnt|GEWACHSHAUS|gewaltt\\\xe9tig|gewarnf|Gewerkschaftsfunktion\\\xe9ren|gewfinscht|Gewiasenskon\\\ufb02ikte|gewiihlt|gewiihnen|gewiihnlich|gewiihnlicher|gewiihnliches|gewiihnt|gewiinscht|gewijhnlichen|gewijnscht|gewissermafien|gewissermallsen|gewlllnscht|Gewohnheitstiter|gewtinscht|gewunscht|gewunschten|Gew\\\xe9chshaus|gew\\\xe9hlt|gew\\\xe9hnen|gew\\\xe9hnlicher|gew\\\xe9hnst|gew\\\xe9hnt|Gew\\\xe9hren|gew\\\xe9hrt|Gew\\\xe9isser|Gew\\\xe9ssern|gezfichtet|gezilndet|gez\\\xe9hlt|gez\\\xe9ihlt|gez\\\xe9ihmt|ge\\\xe9ndert|GF6l\\'1Z6fUf|Gfirtel|Gfirtner|Gfiste|Gfitter|Ghrchen|gibtjede|gibtk|gibts|gieBen|GieBkanne|gief\\$t|giefit|gielit|gignalton|giinstiger|Giire|Giite|giitiger|Giitter|Giittliche|giittlichen|Gijte|Gijtel|Gilrtel|Gilte|Giltiger|Gitarrenkl\\\xe9nge|Gite|GIUck|GIUCKliCl\\'1|GL\\'lte|Glaubwurdigkeit|Glaubwurdigkeitl|glaubw\\\ufb02rdig|glb|glbt|Gle\\/ch|gleichgiiltig|gleichm\\\xe9mig|Glfick|glficklich|Glfickspilz|Gliick|Gliickchen|gliicklich|gliicklicher|Gliicksbringer|Gliickssfr\\\xe9hne|Gliickwunsch|gliilcklich|Glijck|glijcklich|Glilck|glilcklich|Glilckwunsch|Glillck|gllinstig|gllinstigem|gllinstigen|glljcklich|glllicklich|glllickliche|Glllte|Glorifiziertl|glticklich|Gltickszahlen|gltlckliohes|Gluck|glucklich|gluckliche|GLUCKSELIGKEIT|Gluckwunsch|Gluok|gluoklich|Glupsch\\\xe9ugige|glutheilie|gl\\\xe9inzende|gl\\\xe9nzende|gl\\\xe9nzte|Gl\\\xe9ser|gl\\\xe9ubige|Gl\\\xe9ubigen|Gl\\\ufb02ck|Gl\\\ufb02cklich|Gl\\\ufb02ckstag|Gl\\\ufb02ckwilnsche|gnidig|Gnllnden|gn\\\xe9dig|gn\\\xe9dige|gn\\\xe9digen|Gn\\\xe9digste|gn\\\xe9idig|Goff|Golfballweili|gonnst|gottesfllirchtiger|Gottverdammt|Go\\\ufb02|Gr6Be|gr6Ber|gr6Bere|gr6Beren|Gr6Bte|Gr6Bten|gr6Bter|gr6Btes|gr6f\\$te|gr6f\\$ten|gr6f5ten|gr6I3ter|gr6ISten|Gr6l3e|gr6l3ter|Grabst\\\xe9tte|gratulierel|grClf\\$en|grfilieren|Grfiner|griil3e|griiliere|griiliten|griin|Griinde|Griinden|griindlich|Griine|griinen|Griiner|griin\\\xe9iugige|griin\\\xe9iugiges|grii\\\ufb02te|Grijbeln|griJBen|grijn|Grijnde|grijnden|grijndlich|grijnes|Grijnfutter|Grilbelt|grilfken|Grillh\\\xe9hnchen|Grilnde|Grilnden|grilndet|grilndlich|grilndlicherf|grilndlichl|grilne|Grilnschn\\\xe9bel|grim|Grime|grinco|Grllinde|grllinden|grllindlich|grlllnes|Gro\\/3artig|gro\\/3es|gro\\/3zUgig|Gro\\/Bstadt|gro\\/Ken|groB|groBartig|GroBe|GroBes|GroBmutter|GroBteil|groBziJgiger|grof\\$|grof\\$artig|grof\\$artigen|grof\\$e|grof\\$er|grof\\$es|grof3|grof3\\>artige|Grof3e|grof3en|grof3erAlien|grof5es|Grofbvaters|grofi|Grofiangriffs|Grofiartig|grofiartige|grofiartigen|grofiartiger|Grofiartiges|Grofibritannien|Grofidiebstahl|Grofie|grofier|grofies|grofiten|grofk|Grofkartig|grofke|Grofken|Grofker|Grofkvater|grofLe|grofler|groflsartig|groflsartige|Groflse|groflsen|Grofser|grol|grol\\'3\\>en|grol2\\>|grol2\\>en|grol3\\>es|grol3e|grol3er|Grol3raum|groli|Groliartig|groliartige|groliartigen|grolie|grolien|groliherzig|Grolimutter|Grolisegel|Grolkvater|groller|Grollser|grollzugig|grolS|grolSe|GrolSeltern|grolSer|GrolSvater|grolZ\\~|gror\\$er|grorker|grosses|GROSSTE|gro\\\ufb02|gro\\\ufb02e|Gro\\\ufb02stadtkind|Gro\\\ufb02vater|Grtin|Grtmde|GruB|Grubenausg\\\xe9nge|Gruf\\$|grUf\\$en|grufit|Gruli|Grulikarte|Grulikarten|Grun|grundlich|Grundstiick|grunds\\\xe9tzlich|grune|grunen|Gr\\\xe9ben|gr\\\xe9bst|gr\\\xe9fier|gr\\\xe9fkte|gr\\\xe9flserer|Gr\\\xe9ifite|gr\\\xe9illten|gr\\\xe9sslich|Gr\\\xe9uel|gr\\\ufb02ndlich|gr\\\ufb02ne|gull|Gummist\\\xe9psel|Gumml|GUNSTIGSTEN|Gurtell|gutaussehend|gutaussehender|GUte|gutgebaut|gutgehen|Gutmijtigkeit|g\\\xe9be|g\\\xe9ben|g\\\xe9ibe|G\\\xe9ittern|G\\\xe9lisch|G\\\xe9lische|g\\\xe9lisches|G\\\xe9nsehaut|G\\\xe9nsen|G\\\xe9nze|G\\\xe9rfen|G\\\xe9rtnern|G\\\xe9ste|G\\\xe9stezimmer|G\\\xe9tter|G\\\xe9tterspeise|G\\\xe9ttin|G\\\xe9ttliche|g\\\xe9ttlichen|G\\\xe9tze|G\\\u20acfUhl6|G\\\u20acStFUpp|h\\<\\'\\>\\'r\\'t|h\\<\\'5r|h\\'a\\'lt|H\\'a\\'nde|H\\'a\\'nden|H\\'a\\'ttest|H\\/|H\\/er|h\\/nfer|h5tte|H6fe|h6flich|H6fling|H6hen|h6her|h6here|H6HERER|H6hle|H6l1e|H6lle|H6llen|h6lte|H6r|h6re|h6ren|H6rer|H6rner|h6rst|h6rt|h6rte|Ha\\/s|Haarbijrstel|Haarhfirste|Haarl|Haarstr\\\xe9hne|hab\\'jemanden|Hah|halbstlllndiges|halbvervvandelt|halfef|Hallfjchen|hallol|Halsb\\\xe9nder|Halsl|haltenl|Haltjohnny|Hammersch\\\xe9del|Handfl\\\xe9che|Handlungsstr\\\xe9nge|harfe|hartn\\\xe9ickig|Hasenful|Hasenfull|hassq|Hastja|hatjetzt|hatta|Haupfbus|Hauptaktion\\\xe9ire|Hauptaktion\\\xe9irinnen|Hauptkabell|haupts\\\xe9chlich|haupts\\\xe9ichlich|Haupttrib\\\ufb02ne|Hauptverschwiirer|Hauptwasserrohrwar|Hausfirzte|Haush\\\xe9lterin|Hausschlilssel|Haustilr|Hausubervvachung|ha\\\xdft|Hbr|hc\\'5ren|hc\\'\\\xa7r|hdchsfens|Hdchstleistung|hdher|Hdlle|Hdllenfeuer|hdre|hdren|hdrsf|hdrten|He\\/nr\\/ch|hedeutest|hegrfille|heiB|heiBe|heiBen|HeiBer|heiBes|heiBt|heif\\$|heif\\$e|heif\\$es|Heif\\$t|heif3\\>en|heif3t|heif5en|heifie|heifiem|heifien|heifit|heifkt|heifLt|heifZ\\>e|heil\\'\\$|heil\\'\\$en|heil\\'\\$t|heil\\'Se|heil2\\>en|heil2\\>t|heil3en|heil3t|heil5e|heil5t|heili|heilies|heilit|heillst|heilZ\\~|heir\\$|heisst|Helllger|Helzlichen|Hen\\'je|herabstofien|heransttlrmtet|heraush\\\xe9ngendem|herhfiren|herh\\\xe9ren|heriiber|HerrSchmidt|herumf\\\xe9hrt|herumkehren|herumlluft|herumzuwijhlen|Herzrhythmusst\\\xe9rungen|Herzschlielierei|Herzstlllck|Heuta|Hexenhtltte|HeY\\\xb7|Hfibscheste|hfiherer|hfihsch|Hfilfte|Hfille|hfilt|hfiltst|Hfin|hfipft|Hfir|hfiren|hfirst|hfirt|hfitte|hfitten|hie\\/3|hieB|hiefL|hiel3|hiells|hierhergereist|hierherzuriick|hierijber|hierjede|hierjeder|hierl|hierL|hierwar|hierzum|hie\\\ufb02|Hiibsch|Hiibsche|Hiibscher|hiibschl|hiichst|hiichstens|hiichster|hiichstpersiinlich|Hiifen|hiifischen|Hiifling|Hiigel|Hiihe|Hiihepunkt|hiiher|hiihere|Hiihlen|Hiihnchen|Hiihner|Hiihnerkl\\\xe9fkchen|Hiilfte|Hiille|Hiillenstreitmacht|hiillischen|hiipfen|Hiir|hiire|Hiiren|Hiirer|Hiiret|Hiirjetzt|Hiirt|hiirte|hiirtest|Hiissliches|Hiite|Hiiten|hiitet|Hiitte|hiitten|Hiitten|hijbsch|hijbschen|hijbsches|Hijfte|Hijften|Hijgel|Hijgels|Hijpfburgl|hijpfe|hijpfen|hijre|Hijren|Hijrer|hilbsch|hilbsche|hilbschen|hilbscher|Hilfel|HILFSPERSONALI|Hilgel|hillig|Hilt|hil\\\ufb02|Him|Himmell|hineintr\\\xe9umen|hinfijhrt|hingefiihrt|hingehdren|hingehiiren|hinilber|hinreiliend|hinschmeifit|HintenN\\\xe4ldler|Hintergrundl\\\xe9rm|hinterhfiltig|hinterh\\\xe9iltiger|Hinterh\\\xe9iltigl|hinterh\\\xe9ltige|hinterh\\\xe9ltiger|Hinterk\\\xe9pfen|hinterlieBe|hinterl\\\xe9sst|Hintersttlbchen|Hintertur|hinwollen|hinzufuhren|hinzuf\\\ufb02gten|Hirnrnel|hirteste|hisslich|Hi\\\xe9tte|Hler|hler|hllf|hllibsch|Hllindinnen|Hlllpf|hln|Hlnbllck|hltte|Hltten|Hochfrequenzst\\\xe9rungenl|hochl|Hochsicherheitsgef\\\xe9ngnis|Hochstens|Hochzeitskostiime|Hohek|Hohepunkt|hohere|HoHo|Holle|Holzsttlck|hor|Horen|Hosenscheifker|Hosenscheiiker|Hosenschei\\\ufb02er|Hotelg\\\xe9ste|HQHE|htibscher|Htihnchen|Htipfen|Htipfenl|htiren|hubsch|hubsche|hubschen|Hubscher|hubscheres|Hubsches|Huhner|humon\\/oll|Hundchen|Hundebullel|Hunden\\\xe9pfe|Hundescheilie|Hundl|HUNG|hunte|Hurensiihne|Hurensohnl|Huterin|HUtte|Hypoglyk\\\xe9mie|h\\\xe9|H\\\xe9chste|h\\\xe9chsten|H\\\xe9chstens|H\\\xe9chstpers\\\xe9nlich|H\\\xe9fen|h\\\xe9flich|H\\\xe9ftling|H\\\xe9ftlinge|H\\\xe9ftlingsr\\\xe9te|H\\\xe9hef|H\\\xe9hepunkt|h\\\xe9her|h\\\xe9heren|H\\\xe9i|H\\\xe9ifen|H\\\xe9ilften|h\\\xe9iltst|H\\\xe9inde|h\\\xe9ing|h\\\xe9ingen|h\\\xe9ingt|h\\\xe9ir|h\\\xe9irter|h\\\xe9itt|H\\\xe9itte|h\\\xe9itten|h\\\xe9ittest|h\\\xe9iufig|H\\\xe9lfte|H\\\xe9lle|H\\\xe9llen|H\\\xe9llenloch|h\\\xe9llisch|h\\\xe9llische|h\\\xe9lt|H\\\xe9ltst|h\\\xe9lzernes|h\\\xe9misch|H\\\xe9mmer|h\\\xe9mmernde|H\\\xe9moglobin|H\\\xe9morrhoiden|H\\\xe9ndchen|H\\\xe9nde|H\\\xe9ndedruck|H\\\xe9nden|H\\\xe9ndlerin|h\\\xe9ng|h\\\xe9ngen|h\\\xe9ngend|h\\\xe9ngst|h\\\xe9ngt|H\\\xe9r|h\\\xe9re|h\\\xe9ren|H\\\xe9rgesch\\\xe9idigte|h\\\xe9rst|h\\\xe9rt|h\\\xe9rte|h\\\xe9rten|h\\\xe9rter|H\\\xe9rzu|H\\\xe9schen|h\\\xe9sslich|h\\\xe9sslicher|h\\\xe9sslichl|h\\\xe9sslichste|h\\\xe9tt|H\\\xe9tte|h\\\xe9tten|h\\\xe9tten\\'s|h\\\xe9ttest|H\\\xe9ttet|H\\\xe9ufi|h\\\xe9ufig|h\\\xe9ufiger|H\\\xe9ufigkeit|h\\\xe9ufigsten|H\\\xe9user|H\\\xe9usern|h\\\xe9ute|H\\\u20acY|H\\\ufb02geln|i\\'\\\xa7ffne|I\\/egen|I5sst|I5stern|I6sen|Ia\\\xdf|Ia\\\xdft|Icll|identifizieet|IDENTITAT|IE|Iebendigl|Iebenslinglich|Iebtjetzt|Ieck|Iehn|Ieid\\\u201a|Ieinenlose|Ienistische|Ietztendlich|Ifigt|Ihrdllirft|ihrja|ihrjemals|ihrjetzt|ihrjeweiliges|ihrVater|ihrvorstrafenregister|ihrwahres|Ihrwerdet|ihrzwei|iibel|iibemehmen|iiber|iiberall|iiberallhin|iiberdauern|iiberdauerte|iibereinstimmte|iiberfallen|iiberfiel|iibergeben|iiberhaupt|iiberhiirt|iiberholt|iiberholter|iiberkam|iiberlassen|iiberleben|iiberlebt|iiberlegen|iiberlegten|iibernahmen|iibernehme|iibernehmen|iibernimmt|iibernommen|iiberpriife|iiberpriifen|iiberpriift|iiberpriiften|iiberqueren|iiberragen|iiberrascht|iiberraschte|iiberreden|iiberschritten|iibersetzen|iibersetzt|iibersteigt|iibertragen|iibertreffen|iibertreib|iibertreiben|iibertrieben|iiberzeugen|iiberzeugt|iiblich|iibliche|iibrig|IieB|Iiebte|Iief\\'s|Iiehe|Iie\\\ufb02est|iiffentlichen|iiffentliches|iiffnest|iifter|iihnllchkelt|Iisst|ijbel|ijben|ijberall|ijberhaupt|ijberlegene|ijbernehme|ijbernimmst|ijberprijfen|ijberreden|ijbertrage|ijberwunden|ijberzeugen|ijberzogen|Il6her|IleiB|Ill|Illfie|Ilrger|Ilufierste|immerja|immerjung|immerweinen|immerw\\\xe4hrende|immerw\\\xe9hrende|Improvisiation|Impulswellengeschutz|INBRUNSTIGE|instfindig|intramuskul\\\xe9r|INVASIONSFLOTFE|Iosgeliist|Iosgel\\\xe9st|Ioszuliisen|ip|irn|irrefuhren|irrefuhrende|istja|istjedoch|istjemand|istjetzt|istJohnny|istjung|istweg|ITIUSSEFI|ITIUSSGI7|ITTITTRZ|Ivl\\\xe9gliche|I\\\xe9cheln|I\\\xe9cherlich|I\\\xe9cherlichen|I\\\xe9hmt|I\\\xe9iuft|I\\\xe9nger|I\\\xe9sst|I\\\xe9sste|I\\\xe9uft|J0Shua|Jackettkaufen|jahr|jahre|jahren|JAHRIGE|jal|jemandenl|jetztl|jiidisch|Jiingem|jiingerwar|Jiingste|jilnger|Jlllngling|job|Jogglng|john|johnny|journalisten|Jullo|JUNGFRAULICHE|jungfr\\\xe9uliche|jungfr\\\xe9ulichen|jungfr\\\xe9ulicher|Jungfr\\\xe9ulichkeit|Jungsl|Jungste|Jurlgs|Justitzministeriums|J\\\xe9ger|J\\\xe9hrige|j\\\xe9hrigen|j\\\xe9hriger|j\\\xe9hrlich|J\\\xe9iger|j\\\xe9ihrigen|j\\\xe9mmerlich|k\\'a\\'mpfen|K\\/no|K\\/Varte|K\\/Velle|K5NIGIN|K6der|K6ln|K6nig|K6nige|K6nigin|k6nnen|k6nnen\\'s|k6nnest|k6nnt|K6nnte|k6nnte\\'s|k6nnten|k6nntest|K6pfe|K6rper|K6rpers|K6stlich|Kabelm\\\xe9nner|kalf|kaltblijtig|kampfen|Kampfj\\\xe9ger|Kanarienviigeln|kann\\'sja|kannstja|Kan\\\xe9len|Kapitan|Kapitln|Kapitlnen|Kapitlns|Kapit\\\xe9in|Kapit\\\xe9inleutnant|Kapit\\\xe9ins|Kapit\\\xe9n|Kapit\\\xe9nleutnant|Kapit\\\xe9ns|Kapt\\'n|kaputthaust|Kartoffelsch\\\xe9len|Kassettenger\\\xe9it|kbnnen|kbnnten|kdnnen|kdnnfe|kdnnte|ke\\/ne|Kefn|Keh\\/1|Keithl|keln|kelne|Keri|kfime|Kfimmer|kfimmere|kfimmern|kfimmert|kfimpft|kfimpften|Kfinig|Kfinnen|kfinnte|Kfinnten|Kfinntest|Kfiss|Kfisschen|Kfissen|Kfjnnte|Khnlichkeit|KIar|Kifig|Kiiche|Kiichenhelfer|Kiichln|Kiihe|Kiihlbox|kiihler|Kiihlschrank|kiimmem|kiimmer|kiimmere|Kiimmern|kiindigen|Kiinig|Kiinige|Kiinigen|Kiinigin|Kiiniginnen|kiinigliche|kiiniglichen|kiiniglicher|Kiinigreichs|Kiinigs|Kiinigtum|kiinne|kiinnen|kiinnt|Kiinnte|kiinnten|kiinntest|kiinntet|Kiinstler|kiinstlerischen|kiipfen|Kiirper|Kiirperfunktionen|Kiirperhaltung|kiirperliche|Kiirperliches|Kiirpersprache|Kiirperverletzung|kiirzen|kiirzerzutreten|kiirzeste|Kiisschen|Kiissen|Kiisst|Kiiste|kiistlich|Kijche|Kijhlschrank|Kijmmere|kijmmern|kijmmernl|kijmmerst|kijmmerten|kijndigt|kijnnen|kijnnt|kijnnte|kijnnten|Kijnstler|Kijrbis|kijrzlich|kijrzliche|Kijrzungen|kijsst|Kijste|Kilche|Kilchlein|kilhlen|kilhler|Kilhlkreislauf|Kilhlschrank|Kilmmern|Kilmmert|kilndigen|kilnstliche|kilss|kilsse|kilssen|Kinderm\\\xe9dchen|Kinderspiell|Kindsk\\\xe9pfe|kiokflip|KIotz|KL\\'lr|KL\\'lste|Klapsmiihle|Klassem\\\xe9dchen|kle\\/ne|Kleidergr6Be|Kleidergrfilie|Kleinerl|kleinwiichsige|kleinwilchsiges|klijger|klijgsten|klilger|kLinft\\'gen|klirst|kljmmere|Kllirze|kllissen|Klliste|Klllche|klllhnsten|kllllger|Klobtlrsten|klop\\\ufb02l|Klpt\\'n|Klpt\\'nl|Klpt\\'ns|Klse|Klseschnuffelei|Kltigste|Klugschei\\\ufb02er|kl\\\xe9ffen|Kl\\\xe9iren|Kl\\\xe9ranlage|Kl\\\xe9re|kl\\\xe9ren|Kn6pf|Knallttite|Knastwill|Knderung|Knochengrfinde|Knofen|Knuller|Knupf|Knupfe|knupfen|knzjipfe|Kn\\\xe9dell|kn\\\xe9pf|Kn\\\xe9pfe|Kn\\\xe9sten|Kofferraumschliissel|Kohlens\\\xe9ure|Komaf\\\xe9lle|Komaf\\\xe9llen|Kombiise|Kombuse|Komiidie|kommerz\\/ellen|kommjetzt|Kompatibilitfits|Kompatibilit\\\xe9its|Kompatiblit5ts|Kom\\\xe9die|KONIGIN|konne|konnen|konnt|konsen\\/ativ|Kopfabreifimann|Kopfgeldj\\\xe9ger|Kopfgeldj\\\xe9gern|Kopfm\\\xe9fiig|Kopfnijsse|kostengtlnstige|Kostiim|Kostiimdesigner|Kostiimdesignerin|Kostiimdrama|Kostiime|Kostiims|Kostume|Kost\\\ufb02m|kr\\/egen|kr6ne|kr6nen|Kr6ten|Krafte|Kraftwfirfel|Kranf\\\ufb02hrer|Kreativit\\\xe9t|Kreuzverhor|krfiftiger|Krfiutertee|Kriegserkl\\\xe9rungen|Kriegsfuhrung|Kriegsschauplatze|Kriifte|Kriinung|Kriinungsfeier|Krijppel|Krijte|Kronjuwell|KROTE|Krsche|Kr\\\xe9fte|Kr\\\xe9ften|Kr\\\xe9ftigsten|Kr\\\xe9he|kr\\\xe9ht|kr\\\xe9ichzt|Kr\\\xe9ifte|Kr\\\xe9iutertee|Kr\\\xe9mpfe|kr\\\xe9nte|Kr\\\xe9te|Kr\\\xe9tes|Kr\\\xe9utern|Kr\\\xe9utersenf|Ktiche|Ktinige|ktinntest|Ktisschen|ktlmmere|ktznnen|Kuche|KUCHE|Kuckucksger\\\xe9usch|KUl\\'ZSCl\\'1lUSS9|kulz|kummer|Kummere|kummern|kummert|Kumpell|Kunststficke|Kunststticke|Kuriosit\\\xe9ten|kurzeste|kurzte|Kurzwellenfunkger\\\xe9te|Kurzzeitgediichtnis|Kurzzeitged\\\xe9chtnis|KUS1I\\\u20ac|Kuschelhengstl|KUSSE|KUSSGH|kusste|KUSTE|Kuste|K\\\xe9fer|K\\\xe9fig|k\\\xe9ime|k\\\xe9impfen|k\\\xe9impfend|k\\\xe9impft|k\\\xe9impfte|k\\\xe9impften|k\\\xe9impftest|k\\\xe9impfwie|K\\\xe9inguru|k\\\xe9innen|k\\\xe9innte|K\\\xe9irper|K\\\xe9ise|K\\\xe9isebrunnen|K\\\xe9lte|k\\\xe9lter|k\\\xe9lteste|k\\\xe9me|k\\\xe9men|k\\\xe9mpfe|K\\\xe9mpfen|K\\\xe9mpfer|k\\\xe9mpferische|k\\\xe9mpfst|k\\\xe9mpft|k\\\xe9mpfte|k\\\xe9mpften|k\\\xe9mt|K\\\xe9nig|K\\\xe9nige|K\\\xe9nigin|K\\\xe9niginl|K\\\xe9niginnen|k\\\xe9niglich|k\\\xe9nigliche|k\\\xe9niglichen|k\\\xe9nigliches|K\\\xe9nigreich|K\\\xe9nigreichs|K\\\xe9nigs|K\\\xe9nigsfamilie|k\\\xe9nne|k\\\xe9nnen|k\\\xe9nnt|k\\\xe9nnte|K\\\xe9nnten|K\\\xe9nntest|K\\\xe9nntet|K\\\xe9pfchen|K\\\xe9pfe|K\\\xe9pfen|k\\\xe9pft|K\\\xe9pt\\'n|K\\\xe9rbchen|K\\\xe9rbchengr\\\xe9fie|K\\\xe9rben|K\\\xe9rper|K\\\xe9rperfunktionen|k\\\xe9rperlich|k\\\xe9rperliche|K\\\xe9rperproportionen|K\\\xe9rpersprache|K\\\xe9rpertyp|K\\\xe9rperverletzung|K\\\xe9rper\\\xe9ffnungen|K\\\xe9se|K\\\xe9sebrett|K\\\xe9secracker|k\\\xe9stlich|K\\\xe9ter|K\\\xe9tern|K\\\ufb02mmere|k\\\ufb02mmern|L\\'a\\'cherlich|L\\'a\\'ndern|l\\'a\\'sst|l\\'a\\'uft|l\\/chtes|l\\/Vings|L5cheln|L6ffel|L6schen|L6se|l6sen|L6wen|L6win|LADIESMANZ17|Landh\\\xe9user|Landstra\\\ufb02e|Lands\\\xe9iugetier|langl|langweiligl|Lasergestutzte|Laserzielger\\\xe9t|Lattenzaunwei\\\ufb02|Laudal|laufl|Lau\\\ufb02|La\\\xdf|lch|ldee|ldeen|ldelia|ldentifikation|ldentifikationsnummer|ldentifikationssignal|ldentifizierung|ldentit\\'a\\'tsscheibe|ldioten|ldloten|Le\\/d|Lebenl|lebensf\\\xe9hig|lebensl\\\xe9nglich|lebensmijlde|Lebersch\\\xe9den|leergegessen|legend\\\xe9re|legend\\\xe9ren|Legion\\\xe9r|Legion\\\xe9re|Lehe|Leichensch\\\xe9ndung|leichtjemanden|leidl|Leistuljg|Lelbwfichter|Leld|lemen|Lenks\\\xe9ule|lfidt|lfigt|lfinger|lfiuft|Lfiuterung|lgitt|lgnorier|lhm|lhn|lhnen|lhnenl|lhr|lhre|lhrem|lhren|lhrer|lhrerverffigung|lhres|lhrfehlt|lhrjemalsjemanden|lhrVerteidiger|Libel|Libelwollen|Liben|Liber|Liberall|Liberdenken|Liberdrllissig|Liberfallen|Libergebrannt|Liberhaupt|Liberlasst|Liberleben|Liberlegen|Liberlegt|Libernimmt|Liberpriift|Liberreden|Libersteht|Liberstllirzen|Liberwachen|Liberwacht|Liberwinden|Liberw\\\xe9ltigen|Liberw\\\xe9ltigt|Liberzeugt|Lible|Liblich|Libliche|Librig|lie\\/3|lie\\/Se|lieB|lieBe|liebenswilrdig|liebenswurdiger|Liebesgestiindnis|Lieblingsbesch\\\xe9ftigung|Lieblingsrockerl|Lieblingss\\\xe9tze|lief2\\>en|Liefergebiihren|lieflsen|liegenlassen|Liehe|lieli|lielien|Liellen|liells|lien|Liicher|Liige|Liigner|liinger|liischen|liischt|Liisst|liist|Liisung|Liisungen|Liiwen|Lii\\\ufb02ung|lijgen|Lijgner|Lilgner|lilgst|lilgt|Lilterer|LIMOUSINENSERVICE10I06|linger|lke\\'s|lkone|lL\\'lgt|Llberstehen|Llebe|llebt|lllfie|lllfillensstark|lllfillie\\'s|lllfir|Lllignerl|llligtl|lllusionen|llngst|llztlicher|lm|lmbiss|lmmer|lmmigranten|lmpuls|lmpulsantrieb|lndianer|lndianerin|lndianerm\\\xe9dchen|lndianertanz|lndikation|lndividualit\\\xe9t|lndividuen|lndividuum|lnduktion|lneffizienz|lnformationen|lnfos|lngenieur|lngenieure|lnhalt|lnhalte|lnnenraum|lnnenr\\\xe9ume|lnsekt|lnsekten|lnsel|lnserat|lnspektion|lnstinkt|lnstinkte|lnstitut|lnstrumente|lnstrumentenwagen|lnsubordination|lntellektuellste|lntelligenz|lntensivstation|lnteraktion|lnteresse|lnteressen|lnternat|lntrigantin|lntrigantl|lntrigen|lnverness|lnvestition|lnvestoren|lnzucht|lo|Lordk\\\xe9mmerer|losf|losl|losw\\\ufb02rde|Lou\\/e|Loyalit\\\xe9t|lrak|lraner|lren|Lrgendetvvas|lrland|lronhide|lronie|lrre|lrren|lrrenanstalt|lrrenhaus|lrrer|lrrgarten|lrrlicht|lrrlichter|lrrsinn|lrrsinns|lrrtum|lscandar|lscandars|lsolierband|lss|lstja|ltaker|ltakerflossen|ltalo|Ltiffel|ltlgen|Lufijagen|Luftballonsl|Luftjagen|Luftunterst\\\ufb02tzung|LUgen|lvl\\\xe9idchen|lwan|l\\\xa7uft\\'s|L\\\xe9chelmfinderl|l\\\xe9cheln|l\\\xe9chelt|L\\\xe9cher|L\\\xe9cherlich|l\\\xe9cherliches|L\\\xe9chle|l\\\xe9dt|L\\\xe9ffel|l\\\xe9ge|L\\\xe9icheln|L\\\xe9icherlich|l\\\xe9ichle|L\\\xe9indchen|l\\\xe9ingst|l\\\xe9isen|l\\\xe9issig|l\\\xe9isst|L\\\xe9iuft|L\\\xe9jsung|L\\\xe9mmchen|L\\\xe9mmer|L\\\xe9nder|L\\\xe9ndern|L\\\xe9nge|L\\\xe9ngen|l\\\xe9nger|l\\\xe9ngst|l\\\xe9ngste|L\\\xe9rm|L\\\xe9rmbeschwerden|l\\\xe9schen|L\\\xe9se|L\\\xe9segeld|l\\\xe9sst|l\\\xe9st|l\\\xe9ste|l\\\xe9sten|l\\\xe9stig|L\\\xe9sung|l\\\xe9ufig|l\\\xe9ufst|L\\\xe9uft|l\\\xe9uten|l\\\xe9utet|L\\\xe9we|L\\\ufb02gner|M\\'a\\'dchen|m\\/ese|M\\/ffsommernachfsfraum|M\\/r|M0I8KUI|m6belt|m6chte|m6chtest|m6gen|m6glich|m6glichen|m6glicher|m6gt|M6rder|MaB|MaBgabe|mac\\/1e|mac\\/7|machs|Machtiibernahme|madenschw\\\xe9inziger|Mafinahme|Magengeschwiire|Magengeschwilr|Magengeschwtir|Magnolienbliiten|Majesfait|Majest\\\xe9it|Majest\\\xe9t|Majest\\\xe9ten|Mal2\\>en|Mal3en|malf|Malinahme|mall|Mallregelten|Mandverstation|Manfiver|Maniiver|Manikfire|Mannscha\\\ufb02|Mansclle\\\ufb02\\'enkm\\'5pfe|Man\\\xe9iver|Man\\\xe9ver|man\\\xe9vrieren|man\\\xe9vrierf\\\xe9hig|Man\\\xe9vriermodus|Margoliserklfirung|Margoliserkl\\\xe9rung|marsch\\\xe9hnliche|Massagestllihlen|Massenzerst\\\xe9rung|Massenzerst\\\xe9rungswaffen|Mater\\/al|Maxiriicke|Mayonaise|mbglichst|Mdge|mdglichen\\/veise|mdglicherweise|Mdglichkeit|me\\/n|mehrZeit|mein\\'ja|meinerjetzigen|Meinungs\\\xe9ufierung|Meisterbr\\\xe9u|Meisterstijck|meistgehasste|meln|melne|Mend|Menschenh\\\xe9indler|Menstruationsst\\\xe9rungen|Merkwiirdig|Merkwiirdige|merkwiirdiger|merkwilrdig|merkwlllrdige|merkwurdig|merkwurolig|merkw\\\ufb02rdig|Messger\\\xe9t|mfichte|Mfichten|Mfidchen|Mfidchenl|Mfidels|mfigen|Mfigliche|mfiglichen|mfiglicherweise|Mfill|Mfillhalde|Mfinchen|Mfinder|Mfinnern|Mfissen|mfisst|mfisste|Mfjrder|Midchen|Migrane|Migr\\\xe9ne|Migr\\\ufb02ne|miichte|Miichtegern|Miichten|miichtest|miide|Miidels|miides|miige|miigen|miiglich|miigliche|miiglichen|miigliches|Miiglichkeit|Miiglichkeiten|miigt|Miill|Miillhalde|Miilltonnen|miilssen|miirderisch|miisse|Miissen|miisst|miisste|Miiuse|mijchte|Mijcken|Mijhe|Mijnzen|mijssen|mijsst|mijsste|mijsstest|Milchstrafie|Milhe|Milhle|MILITAR|Militiirprogramme|Militir|militlrische|Milit\\\xe9irkodex|Milit\\\xe9r|Milit\\\xe9rakademie|Milit\\\xe9rdienst|milit\\\xe9rischen|Milit\\\xe9rkodex|Milit\\\xe9rluftraum|Milit\\\xe9rnetzwerk|Milit\\\xe9rs|Milit\\\xe9rsystem|Millbilligung|Millefs|Millgeburt|Milliard\\\xe9iren|Million\\\xe9rssohn|Milli\\\xe9quivalent|Millltonne|millverstanden|milssen|milsst|milsste|milssten|Miltter|Minenraumen|Miniriicke|mirglauben|mirja|mirje|mirjeglichen|mirjemals|mirjemand|mirjetzt|mirso|mirvon|mirzu|Miserabell|missf\\\xe9llt|Missverstfindnisl|Missverstiindnis|Missverst\\\xe9ndnis|Missverst\\\xe9ndnissen|Mistkerlel|Mistkiiter|Miststiick|Mistst\\\ufb02cke|Mitbijrger|Mitbilrger|mitfiihlend|mitfiihlender|mitfuhlend|Mitgefiihl|Mitgefuhl|mitgehiirt|mitgez\\\xe9hlt|mitjedem|mitjemandem|mittlen\\/veile|ML\\'1nze|mlch|Mldchen|mLissen|Mljnder|Mllillschlucker|Mllindel|Mllindung|mllissen|mllisst|Mlllhe|Mllllon|Mllllonen|mlllsst|Mllltterjedoch|Mlnnern|mlr|mlrl|mlt|moglich|Moglichkeit|Moglichkeiten|Molekijle|MolekL\\'lle|Mondeinhiirner|Mondeinhiirnerl|Mondeinh\\\xe9irner|Mondk\\\xe9ilber|Monl|MONTONEI|Mordsiiberraschung|Mordverd\\\xe9chtiger|Morsealphabetl|Motorger\\\xe9usch|Motorger\\\xe9usche|Mousset\\\ufb02e\\'s|Mowen|Mtihe|Mtillschlucker|mtissen|mtissenl|Mtitzel|mtlde|mtlsste|muBt|Mucken|mucksm\\\xe9uschenstill|mude|Muhe|MUII|mull|MULL|mullte|Mundl|Mundung|Munzfernsprecher|Muskatnijsse|Muskelkumpelsl|muskul\\\xe9ren|mussen|MUSSEN|mUssen\\'s|muss\\_\\'\\\xa7e|Musterschuler|Mutterja|mutterlich|Mutze|mu\\\xdf|mu\\\xdft|mu\\\xdfte|mx\\'t|Mzlinnern|M\\\xe9bel|m\\\xe9cht|M\\\xe9chte|m\\\xe9chte|M\\\xe9chtegern|m\\\xe9chten|m\\\xe9chtest|m\\\xe9chtet|m\\\xe9chtig|m\\\xe9chtige|m\\\xe9chtigen|m\\\xe9chtiger|m\\\xe9chtiges|m\\\xe9chtigste|m\\\xe9chtigsten|M\\\xe9dchen|M\\\xe9dchenh\\\xe9nden|M\\\xe9dchens|M\\\xe9del|M\\\xe9dels|M\\\xe9delsl|M\\\xe9fiigung|m\\\xe9ge|M\\\xe9gen|M\\\xe9glich|m\\\xe9gliche|M\\\xe9glichen|M\\\xe9gliches|M\\\xe9glichkeit|M\\\xe9glichkeiten|m\\\xe9glichst|m\\\xe9gt|m\\\xe9ichtig|m\\\xe9ichtige|m\\\xe9ichtigen|m\\\xe9ichtiger|M\\\xe9idchen|M\\\xe9idel|M\\\xe9inner|M\\\xe9innl|m\\\xe9innlicher|M\\\xe9irder|M\\\xe9irz|M\\\xe9nnchen|M\\\xe9nnchens|M\\\xe9nner|M\\\xe9nnerfreundschaft|M\\\xe9nnern|M\\\xe9nnersache|m\\\xe9nnlich|m\\\xe9nnliche|M\\\xe9ntel|M\\\xe9olel|M\\\xe9olels|M\\\xe9rchen|M\\\xe9rchenl|M\\\xe9rchenprinzen|M\\\xe9rder|M\\\xe9rtyrer|M\\\xe9rz|M\\\xe9tresse|M\\\xe9uschen|M\\\xe9use|M\\\xe9usehtipfer|M\\\xe9usen|M\\\xe9userennen|m\\\xfc\\\xdft|m\\\ufb02de|m\\\ufb02ssen|n\\'a\\'chste|n\\'a\\'hert|n\\/chfs|n\\/chi|N\\/ck|n\\/e|N6|n6tig|nac\\/1|Nachf|nachllssig|nachl\\\xe9ssig|nachl\\\xe9sst|nachprufen|Nachschlussel|Nachste|NAHERT|NAHERTE|Nat\\/on|natfirlich|Natiilrlich|Natiirlich|Natiirllch|natijrlich|natijrlichen|natilrlich|natilrliche|natL\\'lrlich|Natllirlich|Nattirlich|Nattlrlich|Nattlrliohl|Naturlich|naturlich|naturlichen|naturlichsten|Navajoweifi|ndtige|ne\\/n|Nebengeb\\\xe9ude|Nebengesch\\\xe9ift|neffes|Nehmf|neinl|Neln|nerv6s|Nervens\\\xe9ge|Nervens\\\xe9ige|nerviis|Nerv\\\xe9s|ner\\\\\\/t|Neuankiimmlinge|neuromuskul\\\xe9ren|Neuzug\\\xe9inge|Nfichster|NIANN|nichsten|nichtim|nichtjemand|Nichtjetzt|Nichtsl|nichtzurilckgelassen|nic\\_l\\_1t|niederk\\\xe9mpfen|niederliells|niedlichl|niher|niichsten|niichstes|niirgeln|niitig|niitige|Nijssen|Nijsternl|nijtzlich|nilchtern|niltzen|Nlagnaten|Nlannern|nlchste|nlchsthoheren|nlcht|nle|Nlemalsl|Nlhe|nlir|nllitzen|Nl\\\xe9inner|noc\\/1|Not\\/\\'all|Notfalll|notig|notigen|Notliige|Notziindung|NUFI|Nunja|Nurdich|nureins|nurflustern|Nurjetzt|nurl|nurwunscht|Nurzu|nus|NUSSS|nutzlich|Nx\\'emand|N\\\xe9chste|n\\\xe9chsten|N\\\xe9chster|n\\\xe9chstes|N\\\xe9chte|N\\\xe9chten|n\\\xe9chtlichen|N\\\xe9gel|N\\\xe9h|N\\\xe9he|n\\\xe9henf|n\\\xe9her|n\\\xe9here|N\\\xe9hern|n\\\xe9hernde|n\\\xe9hert|n\\\xe9herte|n\\\xe9hren|n\\\xe9ht|N\\\xe9hten|N\\\xe9ichste|n\\\xe9ichsten|N\\\xe9ichstes|N\\\xe9ihe|n\\\xe9iher|n\\\xe9ihern|n\\\xe9ihert|N\\\xe9ihten|n\\\xe9imlich|n\\\xe9mlich|N\\\xe9pfe|n\\\xe9rdlich|n\\\xe9rgelnde|N\\\xe9rrin|N\\\xe9schen|n\\\xe9tig|n\\\xe9tige|n\\\xe9tiges|O8|obdachlosl|Obefil\\\xe9iche|OBERFLACHENSCHWERKRAFT|Oberfl\\\xe9che|Oberfl\\\xe9chen|oberfl\\\xe9chlich|oberfl\\\xe9chliche|Oberm\\\xe9inner|Ober\\\ufb02fiche|of\\/\\'en|Offenslchtllch|Offentliches|Offentlichkeit|Offne|Offnen|Offnet|ofi|Ofiiziere|Ofiiziers|Oftweg|Of\\\ufb02cer|Ohnejede|ohnm\\\xe9chtig|ohnm\\\xe9ichtig|OI|olas|oles|Oltanks|OO|Orgelt\\\xe9ne|ORTI|Ortl|Ostfltlgel|Paliontologie|pallt|Pal\\\xe9sten|Panfike\\/chen|Papierbl\\\xe9tter|Papiertiite|Papiertilcher|Parfyknaller|Partyhiite|Partyhijte|Passendervveise|Paulgenauso|pa\\\xdf|pa\\\xdft|peinliohl|persdnlich|persfinlich|persiinlich|persiinliche|persiinlicher|Persiinllchkeltsspaltun|persijnliche|personlich|Personlichkeit|pers\\\xe9nlich|pers\\\xe9nliche|pers\\\xe9nlicher|Pers\\\xe9nliches|Pers\\\xe9nlichkeit|pe\\\ufb02g|Pfadfindervvappen|Pfad\\\ufb02ndeml|Pffitzen|Pfiitchen|Pfippchen|pflL\\'lgen|Pfllitze|pflugte|Pfundbijro|ph\\\xe9nomenal|PIatz|Piimpel|Piinlttchenltrawatte|Pijppchen|Pijppchenl|Planetenf|planm\\\xe9fiigen|Plastikfr\\\xe9iuleinl|plattmachen|Plfitzchen|plfitzlich|pliitzlich|pliitzllch|Pllllnderer|plotzlich|pl\\\xe9dieren|Pl\\\xe9ine|Pl\\\xe9inen|Pl\\\xe9itzchen|Pl\\\xe9itze|Pl\\\xe9ne|Pl\\\xe9tzchen|Pl\\\xe9tze|Pl\\\xe9tzel|pl\\\xe9tzlich|pl\\\xe9tzliche|Pofkawoche|Polizistl|pompiise|popul\\\xe9r|potth\\\xe9sslich|prasentleren|prfignant|Prfisentation|Prfisi|priide|Priife|priifen|prijfen|Priorit2a\\'t|PRIORITKT|PRIORITKTSZUGANG|Priorit\\\xe9itszugang|Priorit\\\xe9t|Prisident|Privatgem\\\xe9chern|Privatsph\\\xe9re|Probfeme|Profitinzerinnen|Protege|prude|Pruf|prufen|Prugelei|prugeln|pr\\\xe9chtig|Pr\\\xe9fekt|pr\\\xe9historischer|pr\\\xe9ichtiger|pr\\\xe9ichtiges|Pr\\\xe9imie|pr\\\xe9ipotente|pr\\\xe9isentiert|Pr\\\xe9isidenten|Pr\\\xe9itorianer|Pr\\\xe9mie|Pr\\\xe9operative|pr\\\xe9sentiere|pr\\\xe9sentieren|Pr\\\xe9sentiert|Pr\\\xe9senz|Pr\\\xe9sident|Pr\\\xe9sidenten|Pr\\\xe9sidentin|Pr\\\xe9sidentschaft|Pr\\\xe9torianer|pr\\\xe9zise|pr\\\xe9ziser|Pr\\\ufb02fungen|Pubert\\\xe9it|Publlkuml|PUPPCHEN|PUpst|Purzelb\\\xe9ume|P\\\xe9ckchen|p\\\xe9idagogisch|P\\\xe9irchen|P\\\xe9rchen|p\\\ufb02egen|P\\\ufb02icht|p\\\ufb02ichtbewullt|Qas|Qualit\\\xe9tskontrolle|Quten|qu\\\xe9ilen|qu\\\xe9ilt|Qu\\\xe9l|Qu\\\xe9lt|R\\'a\\'che|R\\/ck|R\\/nge|R6mer|rachsiichtiger|ranghfiheren|rangh\\\xe9heren|ranzukommen|Rasenm\\\xe9herunfall|Rasterllibertragung|Rasterubertragung|Ratschl\\\xe9ige|Rattenf\\\xe9nger|Rauc\\/7|Rauc\\/vender|rauhen|RAUMFAHRE|Raumf\\\xe9hre|Raumsschiff|rausf\\\xe9hrt|rausgeprtigeltl|rausliefien|rauszuschmeifien|rau\\\ufb02|Re\\/se|Realit\\\xe9it|Realit\\\xe9t|Rechtgl\\\xe9ubige|rechtm\\\xe9fkigen|RECHTSANWALTE|rechtsl|Reffer|regelm\\\xe9fiige|Regenh\\\xe9igen|Regenm\\\xe9ntel|Regierungsgehirnw\\\xe9ischesignal|regul\\\xe9re|reiB|reiBt|Reichtfimer|Reichtllimern|reif\\$|reif\\$en|Reifiverschluss|Reil3t|reil5|Reili|reilien|Reilin\\\xe9gel|Reillt|reilZ\\>|reingeh\\\xe9ngt|Reingelegtl|reinhupft|reinl|reinstilrmen|reiohen|REISSVERSCHLUSSGERAUSCH|rei\\\ufb02|rei\\\ufb02en|relch|religi6s|religiiiser|religi\\\xe9s|Rels|Rentenbezuge|Repr\\\xe9sentantin|Rettungsflofi|Rev\\/er|rfiber|rfiberwachsen|Rfickseite|rfihrselige|rfilpse|Rfissel|RGMISCHE|Richer|Riesenhfipfer|Riesenspafi|Riesentijr|riiber|Riicheln|riichelt|Riick|Riickblickend|Riicken|Riickenlage|Riickenwind|riicksichtslos|Riicksichtslosigkeit|Riicksitz|Riickw\\\xe9irts|Riickzug|Riick\\\ufb02ug|riihrt|Riilpsen|riilpst|Riimischen|Riistung|Riiumlichkeiten|Rijbe|rijber|rijckgfingig|rijckw\\\xe9irts|Rijsseltierl|Rilbe|rilber|rilberkommen|Rilckkehr|rilcksichtsloses|rilckw\\\xe9rts|Rillpsen|Riol|Rivalit\\\xe9t|rL\\'lber|RL\\'lhr|rllicken|rllickt|Rlllckgrat|Rlnge|Rlumgerate|ROMISCHE|ROMISCHEN|rosa\\\xe9ugiges|rotiugiger|Rotk\\\xe9ppchen|Rott\\\xe9nen|Routinetlberprijfung|Rticken|rticksichtslos|rtlber|Rtlckseite|ruber|Ruberrutschen|Ruckblende|Ruckblick|Rucken|Ruckenlage|Ruckenwind|Ruckfall|Ruckfrage|Ruckgriff|Ruckkehr|Rucksitz|Ruckzugl|ruhlg|ruhrenl|Ruhrt|Rul3|Rumgebrfillel|rumhingen|rumh\\\xe9ngen|rumh\\\xe9ngst|ruml\\\xe9uft|rumwuhlen|rumzuf\\\ufb02hren|rum\\\xe9rgern|runterffihrt|runtergespillt|runtergesp\\\ufb02lt|Runterl|runterspillen|runterspllllen|runtersp\\\xfclt|runtervverfen|Rupem|Rustung|r\\\xe9che|r\\\xe9chen|R\\\xe9cher|r\\\xe9cht|R\\\xe9der|R\\\xe9dern|R\\\xe9hre|R\\\xe9idern|R\\\xe9itsel|r\\\xe9itseln|r\\\xe9itst|R\\\xe9iume|R\\\xe9mern|r\\\xe9mische|r\\\xe9mischen|r\\\xe9mischer|R\\\xe9nder|R\\\xe9nke|R\\\xe9nken|R\\\xe9ntgenaufnahme|R\\\xe9ntgenbild|R\\\xe9son|r\\\xe9t|R\\\xe9tsel|r\\\xe9tselhaft|R\\\xe9tselhaftes|R\\\xe9ume|R\\\xe9umen|R\\\xe9umlichkeiten|R\\\xe9umt|r\\\xe9uspert|R\\\ufb02be|r\\\ufb02bergeguckt|R\\\ufb02ckkehr|S\\/e|s\\/nd|S5tze|S6hne|saB|Sachverstlndiger|sagf|sagfen|Sammlerstiicken|Sands\\\xe9cke|Sanftmiltigen|Sanierungsbeh\\\xe9rde|Sanit\\\xe9ter|Sargn\\\xe9gel|sari|Satellitenschijssel|Satellitenschusseln|Satellitenuberwachung|Saugf\\\ufb02flsen|sc\\/10\\/1|sc\\/16\\/1|sch\\/cken|Sch\\/ffe|sch6n|Schadeniiberpriifung|Schadenuberprtlfung|Scharfschijtze|schbn|schc\\'\\\xa7n|Schdn|schdnen|Schecksl|ScheiB|ScheiBe|scheiBegal|Scheif\\$e|scheiffsel|Scheifi|Scheifiding|scheifie|Scheifiel|Scheifier|Scheifihelm|Scheifiloch|Scheifipascha|Scheifisofa|Scheifiweiber|Scheifle|Scheiiislangweilig|Scheil\\'\\$e|Scheil3\\>er|Scheil3e|Scheili|Scheilie|scheilien|Scheille|Scheillel|ScheilSe|ScheilZ\\>|Scheir\\$oling|scheissegal|Scheisskarre|Schei\\\ufb02e|scheme|scheuf\\$lich|Scheulilich|schfichtern|schfimen|schfin|Schfine|schfinen|Schfines|schfirfer|Schfissel|Schfitzchen|schfjnes|Schideln|schief\\$en|Schief3\\>en|Schiefien|schiefit|schiefZ\\>t|schiel\\'5|Schiel3t|schiellen|Schielmbung|schie\\\ufb02en|schie\\\ufb02t|Schiffs\\\xe9rzte|Schiffzerstfiren|Schifies|Schiidel|schiilzen|schiin|schiine|Schiinen|Schiiner|schiines|Schiinheit|Schiipfer|Schiipfung|Schiisse|Schiitt|Schiittelfrost|schiitten|schiittet|schiitze|schiitzen|schiitzt|schijn|Schijnes|schijng|Schijssel|schijttelt|Schijtze|schijtzen|Schildkr\\\xe9te|Schilrze|Schilsse|schiltten|schiltzen|schimte|Schizophrenia|Schi\\\xe9tze|Schlachtgetllimmels|Schlachtschifl|schlafenl|Schlafk\\\xe9fern|Schlafmiitzenl|Schlafm\\\ufb02tzel|Schlangeng\\\xe9ttin|Schlappschw\\\xe9nze|Schlaumeierl|schlechf|Schlelistiinde|Schlellen|Schle\\\ufb02t|Schlfilsselparty|Schlfisse|SchlieBe|schlieBen|schlieBIich|schlieBlich|SchlieBt|schlief\\$en|Schlief\\$lich|schlief2\\>lich|schlief3t|Schliefie|schliefien|Schliefilich|schlieflslich|schliel3en|schliel3lich|Schliel5t|schlielie|schlielien|schlielilich|schliellsen|SchlielSt|Schliissel|Schliissell|Schliisselmoment|Schliisseln|Schlijsse|Schlijssel|Schlijsselloch|Schlilssel|Schlilssell|Schlilsselparty|schlimmsterAlbtraum|Schlle\\\ufb02en|Schllisse|schllitze|schllitzen|Schlllissell|Schlull|Schlupfern|Schlusselmoment|Schlusselszenen|Schlusselw\\\xe9rter|Schlussl|Schlu\\\xdf|Schl\\\xe9chter|schl\\\xe9fst|Schl\\\xe9ft|Schl\\\xe9ge|Schl\\\xe9ger|Schl\\\xe9gerei|schl\\\xe9gt|schl\\\xe9ift|schl\\\xe9igst|Schl\\\ufb02ssel|Schmatzger\\\xe9usche|SchmeiBt|Schmeif\\$|Schmeif\\$t|Schmeifien|schmeifit|Schmeilit|Schmei\\\ufb02|Schmier\\\xe9l|schmiicken|schmilztl|schmi\\\ufb02|Schmuckk\\\xe9stchen|Schmuckstiick|Schnappschijsse|Schnauzel|Schneegest\\\xe9ber|Schneidez\\\xe9hnen|Schneidez\\\xe9ihne|schnellf|Schnfiffeln|schnfiffelnl|schnfiffelst|Schnfirsenkel|schniiffele|schnijffelt|Schnilffeln|schnilrt|Schnitzereigesch\\\xe9ft|Schniuzer|Schnuoki|Schn\\\xe9ppchen|SchoB|Schofk|ScholShund|Schones|schonl|schopferische|scho\\\xdf|Schrankw\\\xe9nde|Schraubenschlijssel|schrecklichl|Schriftist|Schriftstijcks|schr\\\xe9ge|Schr\\\xe9ges|Schr\\\xe9nke|Schr\\\xe9nken|schtin|schtine|Schtisse|schuchtern|Schuchterne|Schuhl|Schuldgeftihlen|Schulterl|Schutzen|Schutzr\\\xe9ume|SCHUTZT|Schw6r\\'s|Schwachkop\\\ufb02|Schwanzlutscherl|Schwarzh\\\xe9ndler|Schwarzweills|schwei\\\ufb02durchnisst|schwerh\\\xe9rig|schwiicht|schwiire|schwiiren|Schwimmanziige|schwi\\\xe9rmten|schwnre|Schw\\\xe9che|Schw\\\xe9chen|schw\\\xe9cher|schw\\\xe9cheren|schw\\\xe9chsten|Schw\\\xe9icheanfall|Schw\\\xe9ichen|schw\\\xe9icher|Schw\\\xe9ichling|Schw\\\xe9irmerei|schw\\\xe9irzeste|Schw\\\xe9mme|schw\\\xe9re|schw\\\xe9ren|Schw\\\xe9rme|schw\\\xe9rmt|schw\\\xe9rmte|Schw\\\xe9tzer|sch\\\xe9biger|Sch\\\xe9del|Sch\\\xe9den|Sch\\\xe9inder|sch\\\xe9ine|sch\\\xe9inen|Sch\\\xe9iner|sch\\\xe9irfen|sch\\\xe9le|sch\\\xe9me|Sch\\\xe9n|sch\\\xe9ne|Sch\\\xe9nen|Sch\\\xe9ner|Sch\\\xe9nes|Sch\\\xe9nheit|sch\\\xe9nl|sch\\\xe9nste|sch\\\xe9nsten|sch\\\xe9nstes|Sch\\\xe9tzchen|Sch\\\xe9tze|sch\\\xe9tzen|sch\\\xe9tzt|Sch\\\xe9tzung|Sch\\\xe9umen|sch\\\ufb02chtern|SCl\\'1lUSS6l|Scllrift|scmoss|se\\/n|Se\\/wen|sehenl|Sehenswlllrdigkeiten|Sehnsilchte|sehrangespannt|sehrjung|Sehrwohl|sehrzufrieden|sehtjetzt|Seidenglattl|seidjetzt|Seitwann|SEKRETARIN|Sekretiir|Sekretir|Sekret\\\xe9irin|Sekret\\\xe9rin|sel\\/g|selbstl|selbststiindig|selbstsuchtige|selbstverstindlich|Selbstverstlndlich|Selbstverst\\\xe9indlich|Selbstverst\\\xe9ndlich|seld|selhst|SeligerVater|seln|Selt|sentimalen|seri\\\xe9ser|Sexualit\\\xe9t|Sfe|Sfidamerikas|Sfidwind|Sfifies|Sfihne|Sfildner|Sfilie|Sfilieste|Sfi\\\ufb02igkeiten|sfnd|SICHERHEITSBEHORDE|Sicherheitsgrijnden|Sichtubervvachung|Sichtunterstutzung|Sieja|Sifihnchen|Signalst\\\xe9rke|Siiden|Siidfrankreich|siidliche|siil\\$|siili|Siilie|siilier|SIim\\'s|Siinde|Siinden|Siinder|siindigen|sii\\\ufb02en|siJB|SiJBe|siJchtige|sijlien|sijliesten|Sijsser|Sildtunnel|Silfie|Silfier|Silfies|silfker|Silnden|Silndenbock|sindja|Sirl|Sj\\_r|Skilaufen|skrupelloserAnw\\\xe9lte|sL\\'lf\\$e|sL1B|slch|sle|slebe|sLif\\$|SLif\\$e|SLif\\$er|sLif\\$es|SLilSe|Slliden|Sllinde|sllindigen|Slnd|Slr|Slrs|SoBen|sofortl|soh\\\xe9nen|Solien|sollenl|SONDERMULL|sorgf\\\xe9iltig|sorgf\\\xe9ltig|souver\\\xe9ine|souver\\\xe9inen|souver\\\xe9ner|sp\\'a\\'ter|sp\\/elen|SpaB|Spaf\\$|Spaf2\\>|Spaffs|Spafi|Spafls|SpafS|Spal\\'5|Spal2\\>|Spal3|Spali|Spall|Spass|spat|spektakular|Spell|Spells|Spell\\\xbb|Spezialit\\\xe9t|spfit|SpieB|spief\\$ig|Spielzeuggeschfiftn|spiilte|spiiren|spiirt|spiit|spijre|spijren|spijrt|Spillmeier|spilre|spilren|spit|Spitzenfriihstiick|spLir\\'s|splliren|splter|Sportilbertragung|Sportsfraund|Sprachpijppchen|SPRACHPUPPCHEN|Spriichlein|Sprilht|spr\\\xe9che|spr\\\xe9chen|spr\\\xe9chet|Spr\\\ufb02che|spr\\\ufb02ht|spUl|spUr|spurbare|spUrt|sp\\\xa7ter|Sp\\\xe4\\\xdf|sp\\\xe9it|sp\\\xe9iter|sp\\\xe9t|Sp\\\xe9ter|Sp\\\xe9tzchen|Sp\\\xe9tzchenl|ssh|st6Bt|st6hnt|st6lSt|St6rt|ST\\@HNT|Staatsaff\\\xe9ren|staatsbllirgerliches|Staatsgesch\\\xe9fte|Standardan\\\xe9sthesie|standig|STARSCREAMI|station\\\xe9r|Statusmeldungl|stdrte|stecktjede|Stehenbleiben|Stehvermiigen|Steigbilgeldinger|Steinh\\\xe9user|Sternenkijsse|Steuererkl\\\xe9rung|Steuererkl\\\xe9rungen|Steuerprtifer|Steuerprtifung|Steuersiitzen|stfipseln|stfiren|stfirker|Stfirt|stfirzt|stieB|Stiefbriider|Stiicke|Stiihle|Stiihlen|stiihnt|Stiillen|Stiire|stiiren|Stiirme|stiirmischen|Stiirsignale|stiirt|Stiirung|stiirzen|Stiitzpunkt|Stijck|Stijckchen|Stijcke|stijhle|stijrme|stijrzen|Stilck|Stilcke|Stillckchen|Stillst\\\xe9nde|Stilvolll|stinden|Stldseite|stleg|Stllihle|Stllirmen|stllirzt|stlllrzen|Stl\\\ufb02|sto\\/3en|StoB|stoBe|stof\\$en|Stofi|STOHNT|Stol3zahn|Stol3zeit|stolie|Storung|Str6men|str6mt|StraBe|StraBen|StraBenk6tern|Straf\\$e|Strafiengang|Strafienratten|Strafienschlacht|Straflsenecke|Straflsenmaler|Straflsenschilder|Straft\\\xe9ter|Strahlenschutzger\\\xe9t|Strahlungsintensit\\\xe9t|Stral3en|Stral5e|Stralie|Straliengang|Stralienk\\\xe9ter|Straliensperre|Streitkr\\\xe9fte|Streitkr\\\xe9ften|Streit\\\xe9xte|strfimten|Striimen|Striimungen|Stromschliige|Stromschnellenl|Stromung|Strullerl|Str\\\xe9mung|Str\\\xe9mungen|sturzte|STUTZPUNKT|St\\\xe9be|st\\\xe9hnt|st\\\xe9hnte|St\\\xe9idtchen|St\\\xe9idte|st\\\xe9indig|St\\\xe9irke|st\\\xe9irker|St\\\xe9irkeres|st\\\xe9llst|St\\\xe9ndchen|St\\\xe9nder|St\\\xe9ndig|st\\\xe9pseln|st\\\xe9ren|St\\\xe9rke|St\\\xe9rken|st\\\xe9rker|St\\\xe9rkere|st\\\xe9rkeres|st\\\xe9rkste|st\\\xe9rst|st\\\xe9rt|St\\\xe9rung|St\\\xe9tten|St\\\ufb02ck|St\\\ufb02hlen|sUB|sUBe|Suchfeam|SUden|Sudseite|Sudwest|sUf\\$|SUf\\$e|suMM\\\u2020|Suohet|Superkr\\\xe9fte|superl\\\xe9cherlich|s\\\xa2\\'il3|S\\\xe9cke|S\\\xe9ge|s\\\xe9he|S\\\xe9hne|S\\\xe9hnen|S\\\xe9icke|S\\\xe9inger|S\\\xe9iulen|S\\\xe9ldner|s\\\xe9mfl\\/che|s\\\xe9mtliche|s\\\xe9mtlichen|S\\\xe9nger|S\\\xe9ngerin|s\\\xe9ubern|s\\\xe9uft|s\\\xe9ugen|S\\\xe9ulen|S\\\xe9urewannen|S\\\ufb02dh\\\xe9ingen|T6chter|T6pfchen|T6rn|T6rtchen|t6te|T6ten|t6tet|TANZERINNEN|Tater|tats\\\xe9chlich|tats\\\xe9chliche|tats\\\xe9ichlich|Tatverd\\\xe9ichtigen|Tauchg\\\xe9inge|Tauchg\\\xe9nge|Tauschgesch\\\xe9fte|Tauschgesch\\\xe9\\\ufb02e|Tbrn|tbten|tdten|tdtete|Telefongespr\\\xe9che|Tempelsch\\\xe9nderf|TemPO|TESTGELANDE|Testvorf\\\ufb02hrungen|tfidlich|tfiitet|Tfir|tfirkischen|Tfite|Theaterstfick|Therapiel|Thermalger\\\xe9t|Thronr\\\xe9uber|Thronr\\\xe9uberin|Tiefkilhlung|Tiefktih\\/system|Tiefktihleind\\\xe9mmung|TIEFKUHL|Tiefkuhlstasis|Tiefkuhlung|tiglich|tiichtige|tiint|Tiipfchen|Tiipfchennummer|Tiir|Tiiren|Tiirl|Tiirme|tiite|Tiite|tiiten|tiitet|tiitete|TiJr|Tijrme|Tilr|Tilrglocke|Tilrklingel|Tilr\\\xe9ffner|Tippger\\\xe9usch|Tischlenuerkstatt|TL\\'lr|tlglich|Tllir|Tllirkei|Tlllpfelchen|TOILETTENSPULUNG|Tonl|Toreroabs\\\xe9tze|Tortenb\\\xe9ickerin|Tragfidie|Tragiidie|Trag\\\xe9die|Trainingsijbung|TRAUMKCRPER|treffan|trfiumen|Tribiinen|trif\\'f\\'t|trigt|Triibsal|Triimmem|triistllch|Triistungen|Triiume|Trilmmer|triume|Trockenger\\\xe9ite|Trockenger\\\xe9te|Tropfsteinhiihle|Trottell|Trubsal|tr\\\xe9ge|Tr\\\xe9gerschiff|tr\\\xe9gt|Tr\\\xe9igerschiff|tr\\\xe9igt|tr\\\xe9ium|tr\\\xe9iume|tr\\\xe9iumen|tr\\\xe9iumt|tr\\\xe9llert|Tr\\\xe9ne|Tr\\\xe9nen|Tr\\\xe9um|tr\\\xe9ume|Tr\\\xe9umen|Tr\\\xe9umer|tr\\\xe9umst|Tr\\\xe9umt|Tschiiss|Tschiissl|tschijss|Tschtiss|tsch\\\xfc\\\xdf|Tsch\\\ufb02s|Ttir|ttlckisch|Ttlte|tubul\\\xe9re|Tupperschiissel|TUR|TUr|Turen|TURKEI|Turmwiichter|tutjetzt|typlschl|T\\\xe9chter|t\\\xe9d\\/ichen|t\\\xe9dlich|t\\\xe9dliche|t\\\xe9dlichen|t\\\xe9glich|t\\\xe9glichen|t\\\xe9iglich|t\\\xe9itowieren|t\\\xe9itowierte|T\\\xe9itowierung|t\\\xe9iuschen|T\\\xe9ler|T\\\xe9lpell|T\\\xe9nze|T\\\xe9nzerin|T\\\xe9pfchen|T\\\xe9pfchenquatsch|T\\\xe9pfchensache|t\\\xe9te|T\\\xe9ten|t\\\xe9test|t\\\xe9tet|t\\\xe9tete|t\\\xe9towieren|t\\\xe9towierte|T\\\xe9towierung|T\\\xe9towierungen|t\\\xe9uschen|t\\\xe9uscht|T\\\xe9uschung|T\\\xe9uschungsman\\\xe9ver|Ub6FpFUfl\\'T1al|Ub6l\\'pl\\'Uf\\\u20ac|Ube|Ubel|Ubelkeit|Ubelt\\\xe9ter|Uben|Uben\\/vachen|Uben\\/vacher|Uben\\/vacht|Uben\\/vachungen|Uben\\/vachungsgesetz|Uben\\/vinden|Uber|UBER|Uberall|Uberanstrenge|Uberanstrengung|Uberarbeiten|UberAuf\\$erirdische|Uberaus|Uberbleibsel|Uberblick|Uberbringe|Uberdauern|Uberdecken|Ubereinstimmung|Uberfahren|Uberfall|Uberflilssig|Ubergabe|Ubergaben|Ubergabepunkt|Ubergangen|Ubergangsweise|Ubergeben|Ubergehen|Uberhaupt|Uberholt|Uberholter|Uberh\\\xe9rt|Uberjemanden|Uberlagerungs|Uberlandleitungen|Uberlass|Uberlasse|Uberlassen|Uberlassenl|Uberlasteten|Uberleben|Uberlebende|Uberlebenden|Uberlebenschancen|Uberlebenswichtigen|Uberlebt|Uberleg|Uberlegen|Uberlegenheit|uberlegt|Uberlegten|Uberleiten|Uberleitung|Uberlieferungen|Uberl\\\xe9sst|Uberm|Ubermorgen|Ubernachtungsgast|Ubernahm|Ubernahme|Ubernahmen|Ubernehme|Ubernehmen|Ubernimmst|ubernimmt|Ubernommen|Uberpriifen|Uberprilfen|Uberprliifen|Uberprufe|Uberprufen|Uberpruft|Uberraschend|Uberrascht|Uberraschte|Uberraschter|Uberraschung|Uberraschungen|Uberraschungl|Uberreagiert|Uberreden|Uberredet|Uberreste|Uberrumpeln|Uberrumple|Ubers|Uberschl\\\xe9gt|Uberschreiten|Uberschritten|Uberschwemmung|Ubersehen|Ubersensibilit\\\xe9t|Ubersetzung|Uberspannte|Uberspielt|Uberstehen|Ubersteigerten|Ubersteigt|Uberstunden|Ubertraf|UBERTRAGEN|Ubertragen|UBERTRAGUNG|ubertreibe|Ubertreiben|Ubertrieben|Ubertriebene|ubertriebener|Ubertrifft|Ubervvachen|Ubervvacht|Ubervvachung|Ubervvachungs|Ubervvachungsstaat|Ubervvachungsstaats|Ubervvachungsvideos|Ubervv\\\xe9iltigend|Uberwachen|Uberwacher|Uberwachung|Uberzeuge|Uberzeugen|Uberzeugend|Uberzeugt|Uberzeugung|Uberzeugungen|Uberziehen|Uberzuleiten|ublem|Ubler|Ubles|Ublich|Ubliche|ublichen|Ubrig|Ubrige|Ubrigen|Ubrigens|Ubrlgens|Ubrllccol|Ubung|Ubungsbedingungen|Ubungsschiisse|Ubungsschusse|Ub\\\u20acf\\'pf\\'Uf\\\u20acl\\'1|Uher|ultrakiistlichl|umgeriistet|umg\\\xe9nglich|umhdren|umh\\\xe9ngt|Umschlfigen|umschlieBt|Umst\\\xe9inden|Umst\\\xe9nde|Umst\\\xe9nden|umst\\\xe9ndlich|umweltsch\\\xe9dlich|unabhiingiges|unabh\\\xe9ingig|unabh\\\xe9ngig|unabl\\\xe9ssig|Unauff\\\xe9lligeres|unaufhalfsam|unaufhiirlich|unaufh\\\xe9rlich|unaufi\\\xe9llig|unberijhrbar|unberllihrten|unbesch\\\xe9digt|Uncl|undja|undjeder|undjemand|undjetzt|undlassenihn|undlhnen|undurchfuhrbar|uneingeschr\\\xe9nkten|unergrilndliche|unerhort|unerhorte|unerkl\\\xe9rliche|unerkl\\\xe9rlichen|unertr\\\xe9glich|unf\\'a\\'hig|Unfahigkeit|unfersfellen|unfiirmigen|unf\\\xe9hig|unf\\\xe9higste|unf\\\xe9ihigste|Unf\\\xe9ille|Unf\\\xe9lle|ungef\\\xe9hr|ungef\\\xe9hre|Ungef\\\xe9ihr|ungef\\\xe9ihrlich|ungemutlich|ungenugend|ungestbrt|ungewfihnliche|Ungewfjhnliches|ungewiihnlich|Ungewijhnliches|ungew\\\xe9hnlich|ungew\\\xe9hnliche|ungew\\\xe9hnlichste|ungfinstigen|ungiiltig|ungilnstig|Unglaubliohl|unglaubwurdig|Unglfiubige|Ungliicklicherweise|Unglilck|Ungll\\'Jcklichervveise|Unglllick|unglllicklich|ungllllckliche|unglucklich|Ungl\\\xe9ubiger|ungultig|ungunstigen|unheimlichl|UNHORBARES|unh\\\xe9flich|Universitlt|Universit\\\xe9t|unlfisbare|unm6glich|unmfiglich|Unmiiglich|Unmiigliche|unmijglich|unmissverst\\\xe9ndlich|unmoglich|Unmtioglich|Unm\\\xe9glich|unm\\\xe9glioh|unnatiirliche|unnaturliche|unnfitigen|unniitig|unnllitz|unn\\\xe9tig|unn\\\xe9tigen|unol|unp\\\xe9sslich|UNREGELMASSIG|Unregelm\\\xe9fiigkeiten|unschliissig|unserejungen|unsererAnw\\\xe9lte|unsererjungfr\\\xe9ulichen|unsjede|uns\\\xe9glich|Untenuelt|unterdriickten|Unterdrilckung|unterdrtlckte|Unterdr\\\ufb02ckung|Unterhaltskostenl|Unterhaltungsm\\\xe9fiig|unterhfilt|unterh\\\xe9lt|unterschitzt|untersch\\\xe9tzte|unterstiitzt|Unterstiitzung|unterstijtzt|Unterstiltzung|Unterstllitzung|unterstutzen|unterstutzt|Unterstutzten|Unterstutzung|Untersuchungsausschijsse|Unterw\\\xe9sche|untr\\\xe9stlich|Unt\\\xe9tigkeit|unumg\\\xe9nglich|unverm\\\xe9hlt|Unverschfimtheitl|unversch\\\xe9mte|Unversch\\\xe9mtheitl|UNVERSTANDLICH|UNVERSTANDLICHE|UNVERSTANDLICHER|UNVERSTANDLICHES|Unverst\\\xe9ndliche|unverst\\\xe9ndlichen|unverst\\\xe9ndliches|unverzlliglich|unver\\\xe9ndert|Unzerbrechliohen|unzurechnungsfahig|unzuverlassiger|Unzuverl\\\xe9ssiger|unzuverl\\\xe9ssiges|unz\\\xe9hlige|unz\\\xe9hligen|unz\\\xe9ihlige|Urgrofivaters|Urlaubsuberschreitung|Ursprijnglich|ursprtmglich|Ursprunglich|Ururgrofivater|v\\/el|v\\/er|v\\/erfe|v\\/erfes|V6gel|v6IIig|V6lker|V6llig|v6lllg|vdllig|Ve\\/Teidigungskr\\\xe9fte|Velzeih|Velzeihung|velzichte|Ven\\/vandter|ven\\/v\\\xe9hntl|Ventilationsfiffnung|Ventilatorsch\\\xe9chte|VERACHTLICH|verandert|Verbiindeten|Verbilndeter|verbliidet|Verbliidung|verbllirgen|verbrachfe|Verbrec\\/ver|Verbtmdeter|Verbundeten|Verb\\\ufb02nolete|verdiichtigen|verdiinnt|verdllistern|verdr\\\ufb02ckt|verdunnt|verd\\\xe9chtig|Verd\\\xe9chtigen|verd\\\xe9chtiger|verffilgbares|Verfiigung|verfiihren|verfiihrt|verfiittem|Verfijgung|verfilgst|verfilgte|Verfilgung|Verfilhrungskilnste|verflligen|verfllihrt|Verflllgung|verfolgf|verfolgtl|VERFUGBAR|verfugt|vergafk|Vergniigen|Vergniigens|Vergniigungsausflug|Vergnijgen|Vergnilgen|Vergnlligen|Vergntigen|Vergnugen|vergnugt|vergnugte|Vergnugungsausflug|vergr6Bern|vergr\\\xe9fiern|Vergr\\\xe9fierung|verg\\\xe9nglich|verhiirt|Verhiitung|Verhor|verhort|verhorten|verh\\\xe9ilt|verh\\\xe9lt|Verh\\\xe9ltnis|Verh\\\xe9ltnisse|verh\\\xe9ltst|veriindert|Verinderungen|verkilnden|verkilndet|verkniipft|verknUpf\\'t|verkunde|verkunden|verkundet|VERKUNDIGUNG|Verk\\\xe9ufer|verletztl|verlieB|verlielien|verlorenl|verl\\\xe9ingert|Verl\\\xe9ingerungskabel|verl\\\xe9isst|verl\\\xe9sst|verl\\\xe9uft|verm\\'aihlen|verm\\/ssf|vermiibelt|Vermiigt|Verm\\\xe9gen|verm\\\xe9hle|verm\\\xe9hlen|verm\\\xe9hlt|Verm\\\xe9ihlung|vernachl\\\xe9ssigt|Vernachl\\\xe9ssigung|vernfinftig|vernfinftige|vernilnftig|vernllmftigsten|verntmftige|vernunftig|vernunftigsten|vern\\\ufb02nftig|verpa\\\xdft|verpesfefe|verprilgle|verprugeln|Verp\\\ufb02ichtungen|verrat|verrfickter|verriickt|Verriickte|Verriickten|Verriickter|verriicktes|verrijckt|verrijckte|verrilckt|Verrilckte|Verrilckter|Verrilcktes|verrL\\'lckt|verrljckt|verrllickt|Verrllickte|Verrllickter|verrlllckte|verrtickt|verrUckt|Verruckte|verruckten|Verruckter|Verr\\\xe9iter|verr\\\xe9itst|verr\\\xe9t|Verr\\\xe9ter|Verr\\\xe9terin|verr\\\xe9terisch|verr\\\xe9terischen|verr\\\ufb02ckt|versaumt|Verscheifier|verschiichtert|verschiitten|verschlucktl|VERSCHLUSSELN|VERSCHLUSSELT|Verschlusselung|Verschnauferst|Verschwdrung|verschweilit|Verschwiirer|verschwiirerisch|Verschwiirern|Verschwiirung|Verschwiirungen|Verschw\\\xe9rer|Verschw\\\xe9rung|Verschw\\\xe9rungstheoretiker|versch\\\xe9rft|versfanden|Versfehen|versiihnlich|Versiihnung|verslumte|Verspfitung|verspiire|verspilre|verspiten|versprijht|verst0I3en|verst6Bt|Verst6ISt|verst6l3t|verstehejetzt|Verstiindnis|verstiirkt|Verstiirkung|verstilmmelst|verstoBen|verstofken|verstolien|verstummelt|verstunde|verstundest|verst\\\xe9fkt|verst\\\xe9indlich|Verst\\\xe9irkung|Verst\\\xe9ndigen|Verst\\\xe9ndigt|verst\\\xe9ndlich|Verst\\\xe9ndnis|verst\\\xe9rken|verst\\\xe9rkt|verst\\\xe9rkte|verst\\\xe9rkter|Verst\\\xe9rkung|verst\\\xe9rt|vers\\\xe9hnen|vers\\\xe9hnt|vers\\\xe9umen|vers\\\xe9umt|VERTRAGSLANGE|vertrauenswiirdig|vertrauenswtlrdig|vertrauenswtlrdigen|vertr\\\xe9umte|vervvanzt|verwiistete|verwllisten|verwustet|verw\\\xe9hnten|verw\\\xe9ihnen|verw\\\xe9ssert|verz\\\xe9gere|Verz\\\xe9gerte|Verz\\\xe9gerung|ver\\\xe9ffentliche|ver\\\xe9ffentlichen|ver\\\xe9ffentlicht|ver\\\xe9indert|Ver\\\xe9inderung|ver\\\xe9ndern|ver\\\xe9ndert|ver\\\xe9nderte|ver\\\xe9nderten|Ver\\\xe9nderung|Ver\\\xe9nderungen|ver\\\xe9ngstigtes|ver\\\xe9ppelt|ver\\\xe9rgert|vewvendet|vfillig|VGFKUFZGH|VI\\/illkommen|VI\\/itwicky|vial|Videoiiben\\/vachung|Vie\\/e|Vielfrafi|vielf\\\xe9ltig|Vielleichtja|vielversprechend|Vieraugengespr\\\xe9ch|vieriunge|vierj\\\xe9hriges|vierk\\\xe9pfige|Viigel|viillig|viilliges|Viterchen|Vizepr\\\xe9isident|vlel|Vlellelcht|Vogelscheifke|Vogelscheilie|Volksm\\\xe9rchen|vollerjeder|vollmachen|vollst\\\xe9ndig|vollst\\\xe9ndige|Volltrefferl|vollz\\\xe9hlig|Volumenl|von\\/vagten|von\\/v\\\xe9irts|vonn6ten|Vonn\\\xe9irts|Vordertiir|Vorderturl|vordr\\\xe9ngelnl|vorfibergehend|Vorfuhrungen|vorgef\\\ufb02hrt|Vorgiinge|Vorg\\\xe9nger|Vorg\\\xe9ngern|Vorh\\\xe9nge|vorijbergehend|vorilber|vorilbergehende|vorkniipfen|Vorl\\\xe9ufer|Vorl\\\xe9ufig|Vorraus|Vorschl\\\xe9ge|vorschriftsm\\\xe9fiig|vorschriftsm\\\xe9iliig|Vorsichtsmaflnahme|Vorstellungsgespr\\\xe9ch|Vorstellungsgespr\\\xe9che|Vorstof\\$|Vortlbergehende|vort\\\xe9uschen|vorubergehend|vorvv\\\xe9rts|Vorwfirts|vorw\\\xe9rts|vorzfiglichl|vor\\\ufb02ber|Vor\\\ufb02bergehend|VVACHMANN|Vvaffen|Vvagen|VVarte|VVeif3\\>t|VVeil\\'2\\>t|VVir|VVM|v\\\\\\/as|V\\\\\\/e|V\\\xe9gel|v\\\xe9geln|v\\\xe9gelt|v\\\xe9llig|w\\/\\'r|W\\/e|w\\/eder|W\\/nkel|w\\/r|w\\/rd|w\\/rkl\\/ch|W0|w5r|w5r\\'s|W6lfe|W6lfen|W99|Waffenschr\\\xe9nke|wafs|wahrend|WAHRENDDESSEN|Wahrheitl|wail|Walbl|Walsinghaml|wankelmiltig|ware|WAREST|Warfe|warja|Waschbrettb\\\xe9uche|Waschb\\\xe9ir|Waschb\\\xe9iren|Wasseranschlljssen|Wattekn\\\xe9uel|Wattest\\\xe9bchen|we\\'re|We\\'ro|we\\/B|We\\/Bf|we\\/fere|Wechsell|weggebfirstet|weggespllllt|weggesplllltl|weggesp\\\ufb02lt|wegl|wegreiflsen|wegschieBen|Wegtratan|wegzuwefien|wei\\/3|WeiB|weiBe|weiBen|weiBer|weiBes|WeiBfresse|weiBt|Weif\\$|Weif\\$t|weif2\\>|weif3|weif3\\>|Weif3t|weif5|Weifbe|weifbt|Weifi|Weifie|weifies|Weifist|Weifit|weifk|weifken|Weifker|weifkes|weifkt|weifL|weifLt|weifl\\\xbb|weifS|WeifSt|weifZ\\>|WeifZ\\>t|weif\\\xe9t|Weihnachtseink\\\xe9ufe|Weihnachtsm\\\xe9nner|weil\\'5|weil\\'5t|weil3|Weil3t|weil5|Weil5t|weili|weilit|weilke|Weill|weills|weillst|weillt|weilS|weilSe|WeilSglut|weilZ\\>|weilZ\\~|weiss|weissen|weisst|weiterhiipfen|Weiterpessen|weitl\\\xe9ufige|weitweg|WelBt|well|Well|Wellit|welllt|welt|WELTBEVOLKERUNG|Wel\\\ufb02t|Werdja|Werkst\\\xe9tten|Werkzeugg\\\ufb02rtel|wertschfitzen|Westflilgel|Westkilste|Wettk\\\xe9mpfe|Wettk\\\xe9mpfen|Wettk\\\xe9mpfer|Wfinsche|wfinschen|Wfird|wfirde|Wfirden|wfirdest|wfire|Wfirme|Wfisste|wfitete|wfssen|Widen\\/v\\\xe9rtig|widerf\\'a\\'hrt|widerspriichliche|Widerw\\\xe9irtig|wiedergew\\\xe9ihltl|wiederhaben|Wiederh\\\xe9ren|Wieheifiternoch|Wieheiliternoch|wihlerisch|wihlerlsch|wiihlen|wiihlte|wiihrend|wiilrdest|Wiinde|wiinsch|Wiinsche|Wiinschen|wiinschst|wiinscht|wiinschte|wiirde|Wiirden|Wiirdest|wiirdet|wiirdigst|Wiire|wiiren|Wiirfel|wiirfeln|Wiirfels|wiirs|Wiirstchen|wiischt|Wiisste|wiissten|wiisstest|Wiiste|wiitenden|wijnsche|wijnschen|wijnschte|wijrd|wijrde|wijrden|wijrdest|wijrdiger|Wijrg|wijsste|wijtend|wildl|wilnsch|wilnsche|wilnschen|wilnscht|wilnschte|wilrd|Wilrde|Wilrden|Wilrdest|wilrdig|Wilrfel|Wilrfelenergie|wilsste|wilssten|Wilstling|wiltend|Windelhundl|Windhundk\\\xe9rper|winner|Wire|wires|Wirfangen|wirja|wirje|wirjede|wirjeden|wirjetzt|Wirnisse|Wirsind|wirtragen|Wirtschaftspriifer|Wirverfolgen|wirvom|Wirwaren|Wirwarten|Wirwerden|Wirwissen|Wirwollen|Wirwollten|Wirzeigten|wirzu|Witzl|WKHRENDDESSEN|wL\\'lrden|wle|Wleso|Wlhlen|wllinsch|wllinschst|wllinscht|wllirde|wllirden|wllirdest|wllirdet|Wllirgegriff|wllirgen|wllisste|wlr|wlrd|wlrkllch|Wlrkllchkelt|wlrst|Wlrwarten|wlrwollen|Wo\\/f|Wochenf\\\xe9hre|woffir|Wofiir|Wofijr|wofilr|Wofur|WoherweiB|WoherweiBt|Woherweif\\$t|wohlfilhlen|Wollkn\\\xe9uel|womiiglich|wom\\\xe9glich|wom\\\xe9iglich|Worfiber|woriiber|Worijber|Wortgepl\\\xe9nkel|Woruber|wt\\/\\'rden|wtinsche|wtinschst|wtirde|Wtirdest|Wtirfel|Wtmschen|WUl\\'d\\\u20ac|WUlfelbecher|wullte|Wundersch6n|wunderschfin|Wunderschiin|wunderschiinen|wundersch\\\xe9n|wundersch\\\xe9ne|Wundersch\\\xe9nel|wundersch\\\xe9nen|wundersch\\\xe9nes|wundersoh\\\xe9n|wunsche|Wunschen|wunscht|wunschte|WUNSCHTE|wurcle|wUrde|Wurdige|WURGT|Wurmer|Wursfsfulle|Wuste|WUSTEN|wutend|wu\\\xdfte|wu\\\xdftest|w\\\xa7r\\'s|w\\\xa7re|W\\\xa7ren\\'s|w\\\xe9\\'hrend|w\\\xe9chst|W\\\xe9chter|w\\\xe9fs|W\\\xe9g|w\\\xe9hle|w\\\xe9hlejetzt|w\\\xe9hlen|W\\\xe9hler|W\\\xe9hlern|w\\\xe9hlt|w\\\xe9hlte|w\\\xe9hrend|W\\\xe9hrung|W\\\xe9ichter|w\\\xe9ihlen|w\\\xe9ihrend|w\\\xe9ir|w\\\xe9ir\\'s|w\\\xe9irde|W\\\xe9ire|w\\\xe9iren|w\\\xe9irmen|w\\\xe9irst|W\\\xe9lder|W\\\xe9ldern|W\\\xe9lfen|W\\\xe9lkchen|W\\\xe9nde|W\\\xe9nden|w\\\xe9r|w\\\xe9r\\'s|W\\\xe9re|W\\\xe9ren|w\\\xe9ret|w\\\xe9rja|W\\\xe9rm|W\\\xe9rme|w\\\xe9rmt|W\\\xe9rst|w\\\xe9rt|W\\\xe9rter|W\\\xe9rterbuch|w\\\xe9rtliche|W\\\xe9sche|W\\\xe9scheklammer|W\\\xe9schst|w\\\xe9scht|w\\\ufb02rde|w\\\ufb02rden|W\\\ufb02rfel|z\\'a\\'h|Z\\/egf|Z\\/yarettenb\\\xe4ume|Z05|z6gel1e|z6gern|zahlenm\\\xe9\\\ufb02ig|zappelnl|Zauberspruchen|Zaubervoodookr\\\xe9fte|Zauherpfippchen|Zefietzende|zeitgem5B|Zeitgem\\\xe9\\\ufb02e|Zeitgeniissische|zeitgeniissischen|Zellenschliissel|zerbeif\\$en|zerbeif\\$t|zerf\\\xe9llt|Zermatschger\\\xe9usch|zerm\\\ufb02rben|zerreifien|zerreilit|zersfdren|zerst6rst|zerst6rt|zerstdren|Zerstfiren|Zerstfirer|Zerstfirungskraft|Zerstiickelung|zerstiire|zerstiiren|Zerstiirer|zerstiirt|zerstiirten|zerstiirtl|Zerstiirungl|zerstoren|zerst\\\xe9re|zerst\\\xe9ren|Zerst\\\xe9rer|zerst\\\xe9rt|Zerst\\\xe9rung|Zerst\\\xe9rungsfeldzug|zertrlllmmert|zfihlt|Ziel160m|Zihnelt|ziichtiger|Ziige|Ziindkapseln|Zilnd|Zilnden|Zilndungsenergie|Zilrich|Zindern|Zingstlich|Ziufierst|zleht|ZLIFUCK|Zooschlieliung|Zuckerschn\\\ufb02tchen|zuerstvor|zuffillig|zuflligen|ZUFUCK|Zuf\\\xe9illig|Zuf\\\xe9illigerweise|zuf\\\xe9llig|Zuf\\\xe9lligerweise|zug\\'a\\'nglichen|ZUGANGSPRIORITKT|zugehdrt|zugeh\\\xe9rt|zugestofien|Zugest\\\xe9ndnis|Zugest\\\xe9ndnisse|Zugiinge|zuh6ren|zuh6rt|zuhiiren|zuhiirt|Zuh\\\xe9lter|Zuh\\\xe9ren|Zuh\\\xe9rer|zukilnftiges|zul|zundete|Zundverteilerkappe|zunjick|zun\\\xe9chst|zun\\\xe9hen|zun\\\xe9ihen|Zuokerschntltchen|zurfick|zurfickblicken|zurfickgekommen|zurfickgezogen|zurfickkehren|zurfickzufuhren|zuriick|zuriickbleiben|zuriickgeben|zuriickgehen|zuriickgekommen|zuriickgezogen|zuriickhaben|zuriickkehre|zuriickkehren|zuriickkehrst|zuriickziehen|Zurijck|zurijckbringen|zurijckfordem|zurijckgeholt|zurijckgekehrt|zurijckgekommen|zurijckgelassen|zurijckgerufen|zurijckkehren|zurijcknehmen|zurijckstolpern|Zurilck|Zurilckf|zurilckgeblieben|zurilckgeholt|zurilckgekehrt|zurilckhalten|zurilckholen|zurilckkehre|zurilckkehren|zurilckkehrt|zurilckkommen|zurilckkommt|zurilcklassen|zurilckziehen|Zurilckziehenl|zurilckzugeben|zurl\\'Jck|zurL\\'lck|zurLick|zurljckgeben|zurllickfallen|zurllickgekehrt|zurllickkehrt|zurllickzukehren|zurlllckgehen|zurlllckkomme|zurtick|zurtickbringe|zurtickgezogen|zurtlckgekommen|zurtlckvervvandeln|Zuruck|ZURUCK|zuruckbleiben|zuruckblicken|zuruckdenke|zuruckfeuern|zuruckgehen|zuruckgelegt|zuruckgewiesen|zuruckgreifen|zuruckhaben|zuruckkehren|zuruckkehrten|zuruckkomme|zuruckkommen|zuruckk\\\xe9mst|zuruckl|zurucklassen|zurUcklieB|zuruckl\\\xe9cheln|zurucknehmen|zuruckverwandeln|zuruckverwandelt|zuruckziehen|zuruckzukommen|zurverfilgung|zur\\\xe9ickrufen|zur\\\ufb02ck|Zur\\\ufb02ckbleiben|zur\\\ufb02ckfliegen|zur\\\ufb02ckgeschickt|zur\\\ufb02ckgibst|zus\\'a\\'tzliche|zusammenbeilien|zusammenffigen|zusammenfugen|zusammenfuhren|zusammenf\\\xe9illt|zusammenh\\\xe9ilt|zusammenh\\\xe9lt|zusammenh\\\xe9ngen|zusammenreifien|zusammenzuschweifien|zuschl\\\xe9gst|zust6Bt|zustofken|zust\\\xe9indig|zust\\\xe9ncligen|zust\\\xe9ndig|zust\\\xe9ndigen|zus\\\xe9tzlich|zus\\\xe9tzliche|zuverlfissig|zuverllssig|zuverl\\\xe9ssig|zuverl\\\xe9ssiger|zuviel|zuviele|zuzuflligen|Zu\\\ufb02ucht|zvvei|Zw6If|zw6lfmal|Zwel|Zwickmfihle|Zwillingstiichter|Zwischenf\\\xe9lle|zwnlf|Zw\\\xe9ilften|zw\\\xe9lf|z\\\xe9gerlich|z\\\xe9gern|Z\\\xe9gerns|z\\\xe9h|z\\\xe9he|z\\\xe9her|z\\\xe9hl|z\\\xe9hle|z\\\xe9hlen|Z\\\xe9hlerei|z\\\xe9hlt|z\\\xe9hltl|Z\\\xe9hlung|Z\\\xe9hne|Z\\\xe9hnen|Z\\\xe9hneputzen|z\\\xe9ihle|z\\\xe9ihlen|z\\\xe9ihlt|Z\\\xe9ihlungen|Z\\\xe9ihne|Z\\\xe9libat|\\\\\\/GFQHUQGH|\\\\\\/OFVVUFf\\\u20ac|\\\\\\/Vahrheit|\\\\\\/Vir|\\\\\\/\\\\\\/i6fUl\\'1l\\\u20acfi|\\\\\\/\\\\\\/il\\'fUl\\'1I\\'\\\u20acl\\'1|\\\\Nynn|\\_|\\\xc4u|\\\xe9|\\\xe9chzt|\\\xe9ffentlich|\\\xe9ffne|\\\xe9ffnen|\\\xe9ffnet|\\\xe9fft|\\\xe9fter|\\\xe9fters|\\\xe9h|\\\xe9hnlich|\\\xe9hnliche|\\\xe9hnlicher|\\\xe9ih|\\\xe9ihnlich|\\\xe9indern|\\\xe9itzend|\\\xe9lter|\\\xe9lteste|\\\xe9ltesten|\\\xe9ndere|\\\xe9ndern|\\\xe9ndert|\\\xe9nderte|\\\xe9nderten|\\\xe9ngstlich|\\\xe9rgere|\\\xe9rgern|\\\xe9rztliche|\\\xe9rztlichen|\\\xe9rztlicher|\\\xe9sthetisch|\\\xe9tzend|\\\xe9ufierst|\\\xe9ufiersten|\\\xe9uflserst|\\\ufb02atterndem|\\\ufb02el|\\\ufb02iehen|\\\ufb02jr|\\\ufb02lhlen|\\\ufb02lllen|\\\ufb02lr|\\\ufb02lrchterlich|\\\ufb02ndet|AIle|AIter|GI\\\xfcck|PIaystation|AIIes|AIso|Ouatsch|AIles|BIeib|KIaut|AIlah|PIan|oderjemand|liestjetzt)(\\b|$)"}},
+ 'eng': {'BeginLines': {'data': OrderedDict([(u'lgot it', u'I got it'), (u'Don,t ', u"Don't "), (u'Can,t ', u"Can't "), (u'Let,s ', u"Let's "), (u'He,s ', u"He's "), (u'I,m ', u"I'm "), (u'I,ve ', u"I've "), (u'I,ll ', u"I'll "), (u'You,ll ', u"You'll "), (u'T hey ', u'They '), (u'T here ', u'There '), (u'W here ', u'Where '), (u'M aybe ', u'Maybe '), (u'S hould ', u'Should '), (u'|was', u'I was'), (u'|am ', u'I am'), (u'No w, ', u'Now, '), (u'l... I ', u'I... I '), (u'L... I ', u'I... I '), (u'lrn gonna', u"I'm gonna"), (u"-l don't", u"-I don't"), (u"l don't", u"I don't"), (u'L ', u'I '), (u'-L ', u'-I '), (u'- L ', u'- I '), (u'-l ', u'-I '), (u'- l ', u'- I '), (u'G0', u'Go'), (u'GO get', u'Go get'), (u'GO to', u'Go to'), (u'GO for', u'Go for'), (u'Ifl', u'If I'), (u"lt'll", u"It'll"), (u"Lt'll", u"It'll"), (u'IVIa', u'Ma'), (u'IVIu', u'Mu'), (u'0ne', u'One'), (u'0nly', u'Only'), (u'0n ', u'On '), (u'lt ', u'It '), (u'Lt ', u'It '), (u"lt's ", u"It's "), (u"Lt's ", u"It's "), (u'ln ', u'In '), (u'Ln ', u'In '), (u'l-in ', u'I-in '), (u'l-impossible', u'I-impossible'), (u'l- impossible', u'I-impossible'), (u'L- impossible', u'I-impossible'), (u"l-isn't ", u"I-isn't "), (u"L-isn't ", u"I-isn't "), (u"l- isn't ", u"I-isn't "), (u"L- isn't ", u"I-isn't "), (u'l- l ', u'I-I '), (u'L- l ', u'I-I '), (u'l- it ', u'I-it '), (u'L- it ', u'I-it '), (u'Ls it ', u'Is it '), (u'Ls there ', u'Is there '), (u'Ls he ', u'Is he '), (u'Ls she ', u'Is she '), (u'L can', u'I can'), (u'l can', u'I can'), (u"L'm ", u"I'm "), (u"L' m ", u"I'm "), (u"Lt' s ", u"It's "), (u"I']I ", u"I'll "), (u'...ls ', u'...Is '), (u'- ls ', u'- Is '), (u'...l ', u'...I '), (u'Ill ', u"I'll "), (u'L hope ', u'I hope '), (u"|\u2019E'$ ", u"It's "), (u"The y're ", u"They're "), (u'<i>/ ', u'<i>I '), (u'/ ', u'I '), (u'<i>/n ', u'<i>In '), (u'/n ', u'In '), (u'<i>Ana\u2019 ', u'<i>And '), (u"<i>Ana' ", u'<i>And '), (u'~ ', u'- '), (u"<i>A'|'|'EN BOROUGH:", u'<i>ATTENBOROUGH:'), (u"A'|'|'EN BOROUGH:", u'ATTENBOROUGH:'), (u"DAVID A'|'|'EN BOROUGH:", u'DAVID ATTENBOROUGH:'), (u"AT|'EN BOROUGH:", u'ATTENBOROUGH:'), (u"DAVID AT|'EN BOROUGH:", u'DAVID ATTENBOROUGH:'), (u"<i>AT|'EN BOROUGH:", u'<i>ATTENBOROUGH:'), (u'TH REE ', u'THREE '), (u'NARRA TOR', u'NARRATOR'), (u'<i>NARRA TOR', u'<i>NARRATOR'), (u"lt'syour", u"It's your"), (u"It'syour", u"It's your"), (u'Ls ', u'Is '), (u'I ve ', u"I've "), (u'I ii ', u"I'll "), (u'I m ', u"I'm "), (u'Why d ', u"Why'd "), (u'why d ', u"Why'd "), (u'Couldn t ', u"Couldn't "), (u'couldn t ', u"Couldn't "), (u'That s ', u"That's "), (u'that s ', u"That's "), (u'l ', u'I ')]),
+                        'pattern': u"(?um)^(?:lgot\\ it|Don\\,t\\ |Can\\,t\\ |Let\\,s\\ |He\\,s\\ |I\\,m\\ |I\\,ve\\ |I\\,ll\\ |You\\,ll\\ |T\\ hey\\ |T\\ here\\ |W\\ here\\ |M\\ aybe\\ |S\\ hould\\ |\\|was|\\|am\\ |No\\ w\\,\\ |l\\.\\.\\.\\ I\\ |L\\.\\.\\.\\ I\\ |lrn\\ gonna|\\-l\\ don\\'t|l\\ don\\'t|L\\ |\\-L\\ |\\-\\ L\\ |\\-l\\ |\\-\\ l\\ |G0|GO\\ get|GO\\ to|GO\\ for|Ifl|lt\\'ll|Lt\\'ll|IVIa|IVIu|0ne|0nly|0n\\ |lt\\ |Lt\\ |lt\\'s\\ |Lt\\'s\\ |ln\\ |Ln\\ |l\\-in\\ |l\\-impossible|l\\-\\ impossible|L\\-\\ impossible|l\\-isn\\'t\\ |L\\-isn\\'t\\ |l\\-\\ isn\\'t\\ |L\\-\\ isn\\'t\\ |l\\-\\ l\\ |L\\-\\ l\\ |l\\-\\ it\\ |L\\-\\ it\\ |Ls\\ it\\ |Ls\\ there\\ |Ls\\ he\\ |Ls\\ she\\ |L\\ can|l\\ can|L\\'m\\ |L\\'\\ m\\ |Lt\\'\\ s\\ |I\\'\\]I\\ |\\.\\.\\.ls\\ |\\-\\ ls\\ |\\.\\.\\.l\\ |Ill\\ |L\\ hope\\ |\\|\\\u2019E\\'\\$\\ |The\\ y\\'re\\ |\\<i\\>\\/\\ |\\/\\ |\\<i\\>\\/n\\ |\\/n\\ |\\<i\\>Ana\\\u2019\\ |\\<i\\>Ana\\'\\ |\\~\\ |\\<i\\>A\\'\\|\\'\\|\\'EN\\ BOROUGH\\:|A\\'\\|\\'\\|\\'EN\\ BOROUGH\\:|DAVID\\ A\\'\\|\\'\\|\\'EN\\ BOROUGH\\:|AT\\|\\'EN\\ BOROUGH\\:|DAVID\\ AT\\|\\'EN\\ BOROUGH\\:|\\<i\\>AT\\|\\'EN\\ BOROUGH\\:|TH\\ REE\\ |NARRA\\ TOR|\\<i\\>NARRA\\ TOR|lt\\'syour|It\\'syour|Ls\\ |I\\ ve\\ |I\\ ii\\ |I\\ m\\ |Why\\ d\\ |why\\ d\\ |Couldn\\ t\\ |couldn\\ t\\ |That\\ s\\ |that\\ s\\ |l\\ )"},
+         'EndLines': {'data': OrderedDict([(u', sin', u', sir.'), (u' mothen', u' mother.'), (u" can't_", u" can't."), (u' openiL', u' open it.'), (u' of\ufb02', u' off!'), (u'pshycol', u'psycho!'), (u' i...', u' I...'), (u' L.', u' I.')]),
+                      'pattern': u"(?um)(?:\\,\\ sin|\\ mothen|\\ can\\'t\\_|\\ openiL|\\ of\\\ufb02|pshycol|\\ i\\.\\.\\.|\\ L\\.)$"},
+         'PartialLines': {'data': OrderedDict([(u' /be ', u' I be '), (u" aren '1'", u" aren't"), (u" aren'tyou", u" aren't you"), (u" doesn '1'", u" doesn't"), (u" fr/eno'", u' friend'), (u" fr/eno'.", u' friend.'), (u" haven 'z' ", u" haven't "), (u" haven 'z'.", u" haven't."), (u' I ha ve ', u' I have '), (u" I']I ", u" I'll "), (u' L am', u' I am'), (u' L can', u' I can'), (u" L don't ", u" I don't "), (u' L hate ', u' I hate '), (u' L have ', u' I have '), (u' L like ', u' I like '), (u' L will', u' I will'), (u' L would', u' I would'), (u" L'll ", u" I'll "), (u" L've ", u" I've "), (u' m y family', u' my family'), (u" 's ", u"'s "), (u" shou/dn '1 ", u" shouldn't "), (u" won 'z' ", u" won't "), (u" won 'z'.", u" won't."), (u" wou/c/n 'z' ", u" wouldn't "), (u" wou/c/n 'z'.", u" wouldn't."), (u" wou/dn 'z' ", u" wouldn't "), (u" wou/dn 'z'.", u" wouldn't."), (u'/ did', u'I did'), (u'/ have ', u'I have '), (u'/ just ', u'I just '), (u'/ loved ', u'I loved '), (u'/ need', u'I need'), (u'|was11', u'I was 11'), (u'at Hrst', u'at first'), (u"B ullshiz'", u'Bullshit'), (u'big lunk', u'love you'), (u"can 't", u"can't"), (u"can' t ", u"can't "), (u"can 't ", u"can't "), (u'CHA TTERING', u'CHATTERING'), (u'come 0n', u'come on'), (u'Come 0n', u'Come on'), (u"couldn 't", u"couldn't"), (u"couldn' t ", u"couldn't "), (u"couldn 't ", u"couldn't "), (u"Destin y's", u"Destiny's"), (u"didn 't", u"didn't"), (u"didn' t ", u"didn't "), (u"didn 't ", u"didn't "), (u"Doesn '1'", u"Doesn't"), (u"doesn '1' ", u"doesn't "), (u"doesn '1\u2018 ", u"doesn't "), (u"doesn 't", u"doesn't"), (u"doesn'1' ", u"doesn't "), (u"doesn'1\u2018 ", u"doesn't "), (u"don '1' ", u"don't "), (u"don '1\u2018 ", u"don't "), (u"don '2' ", u"don't "), (u" aren '2'", u" aren't"), (u"aren '2' ", u"aren't "), (u"don '2\u2018 ", u"don't "), (u"don 't", u"don't"), (u"Don' t ", u"Don't "), (u"Don 't ", u"Don't "), (u"don'1' ", u"don't "), (u"don'1\u2018 ", u"don't "), (u"there '5 ", u"there's "), (u'E very', u'Every'), (u'get 0n', u'get on'), (u'go 0n', u'go on'), (u'Go 0n', u'Go on'), (u"H3993' birthday", u'Happy birthday'), (u"hadn 't", u"hadn't"), (u"he 's", u"he's"), (u"He 's", u"He's"), (u'He y', u'Hey'), (u'he)/', u'hey'), (u'He)/', u'Hey'), (u'HEA VY', u'HEAVY'), (u'Henry ll', u'Henry II'), (u'Henry lll', u'Henry III'), (u'Henry Vlll', u'Henry VIII'), (u'Henry Vll', u'Henry VII'), (u'Henry Vl', u'Henry VI'), (u'Hold 0n', u'Hold on'), (u'I am. ls', u'I am. Is'), (u'I d0', u'I do'), (u"I 'm", u"I'm"), (u"I 'rn ", u"I'm "), (u"I 've", u"I've"), (u'I0 ve her', u'love her'), (u'I0 ve you', u'love you'), (u"I02'", u'lot'), (u"I'm sony", u"I'm sorry"), (u"isn' t ", u"isn't "), (u"isn 't ", u"isn't "), (u'K)/le', u'Kyle'), (u'L ook', u'Look'), (u'let me 90', u'let me go'), (u'Let me 90', u'Let me go'), (u"let's 90", u"let's go"), (u"Let's 90", u"Let's go"), (u'lfl had', u'If I had'), (u'lova you', u'love you'), (u'Lova you', u'love you'), (u'lovo you', u'love you'), (u'Lovo you', u'love you'), (u'ls anyone', u'Is anyone'), (u'ls he', u'Is he'), (u'-ls he', u'- Is he'), (u'ls it', u'Is it'), (u'-ls it', u'- Is it'), (u'ls she', u'Is she'), (u'-ls she', u'- Is she'), (u'ls that', u'Is that'), (u'-ls that', u'- Is that'), (u'ls this', u'Is this'), (u'-ls this', u'- Is this'), (u'Maze] tov', u'Mazel tov'), (u"N02' ", u'Not '), (u' of 0ur ', u' of our '), (u' ot mine ', u' of mine '), (u'PLA YING', u'PLAYING'), (u'REPEA TING ', u'REPEATING '), (u'Sa y', u'Say'), (u"she 's", u"she's"), (u"She 's", u"She's"), (u"shouldn 't", u"shouldn't"), (u'sta y', u'stay'), (u'Sta y', u'Stay'), (u'SWO rd', u'Sword'), (u'taka care', u'take care'), (u'Taka care', u'Take care'), (u'the Hrst', u'the first'), (u'toc late', u'too late'), (u'uf me', u'of me'), (u'uf our', u'of our'), (u'wa y', u'way'), (u'Wal-I\\/Iart', u'Wal-Mart'), (u"wasn '1' ", u"wasn't "), (u"Wasn '1' ", u"Wasn't "), (u"wasn '1\u2018 ", u"wasn't "), (u"Wasn '1\u2018 ", u"Wasn't "), (u"wasn 't", u"wasn't"), (u"Wasn 't", u"Wasn't"), (u"we 've", u"we've"), (u"We 've", u"We've"), (u"wem' off", u'went off'), (u"weren 't", u"weren't"), (u"who 's", u"who's"), (u"won 't", u"won't"), (u'would ha ve', u'would have '), (u"wouldn 't", u"wouldn't"), (u"Wouldn 't", u"Wouldn't"), (u'y()u', u'you'), (u'you QUYS', u'you guys'), (u"you' re ", u"you're "), (u"you 're ", u"you're "), (u"you 've", u"you've"), (u"You 've", u"You've"), (u"you' ve ", u"you've "), (u"you 've ", u"you've "), (u'aftera while', u'after a while'), (u'Aftera while', u'After a while'), (u'THUN DERCLAPS', u'THUNDERCLAPS'), (u'(BUZZI N G)', u'(BUZZING)'), (u'[BUZZI N G]', u'[BUZZING]'), (u'(G RU NTING', u'(GRUNTING'), (u'[G RU NTING', u'[GRUNTING'), (u'(G ROWLING', u'(GROWLING'), (u'[G ROWLING', u'[GROWLING'), (u' WAI LS)', u'WAILS)'), (u' WAI LS]', u'WAILS]'), (u'(scu RRYING)', u'(SCURRYING)'), (u'[scu RRYING]', u'[SCURRYING]'), (u'(GRUNT5)', u'(GRUNTS)'), (u'[GRUNT5]', u'[GRUNTS]'), (u'NARRA TOR:', u'NARRATOR:'), (u'(GROAN ING', u'(GROANING'), (u'[GROAN ING', u'[GROANING'), (u'GROAN ING)', u'GROANING)'), (u'GROAN ING]', u'GROANING]'), (u'(LAUGH ING', u'(LAUGHING'), (u'[LAUGH ING', u'[LAUGHING'), (u'LAUGH ING)', u'LAUGHING)'), (u'LAUGH ING]', u'LAUGHING]'), (u'(BU BBLING', u'(BUBBLING'), (u'[BU BBLING', u'[BUBBLING'), (u'BU BBLING)', u'BUBBLING)'), (u'BU BBLING]', u'BUBBLING]'), (u'(SH USHING', u'(SHUSHING'), (u'[SH USHING', u'[SHUSHING'), (u'SH USHING)', u'SHUSHING)'), (u'SH USHING]', u'SHUSHING]'), (u'(CH ILDREN', u'(CHILDREN'), (u'[CH ILDREN', u'[CHILDREN'), (u'CH ILDREN)', u'CHILDREN)'), (u'CH ILDREN]', u'CHILDREN]'), (u'(MURMU RING', u'(MURMURING'), (u'[MURMU RING', u'[MURMURING'), (u'MURMU RING)', u'MURMURING)'), (u'MURMU RING]', u'MURMURING]'), (u'(GU N ', u'(GUN '), (u'[GU N ', u'[GUN '), (u'GU N)', u'GUN)'), (u'GU N]', u'GUN]'), (u'CH ILDREN:', u'CHILDREN:'), (u'STU DENTS:', u'STUDENTS:'), (u'(WH ISTLE', u'(WHISTLE'), (u'[WH ISTLE', u'[WHISTLE'), (u'WH ISTLE)', u'WHISTLE)'), (u'WH ISTLE]', u'WHISTLE]'), (u'U LU LATING', u'ULULATING'), (u'AU DIENCE:', u'AUDIENCE:'), (u'HA WAIIAN', u'HAWAIIAN'), (u'(ARTH UR', u'(ARTHUR'), (u'[ARTH UR', u'[ARTHUR'), (u'ARTH UR)', u'ARTHUR)'), (u'ARTH UR]', u'ARTHUR]'), (u'J EREMY:', u'JEREMY:'), (u'(ELEVA TOR', u'(ELEVATOR'), (u'[ELEVA TOR', u'[ELEVATOR'), (u'ELEVA TOR)', u'ELEVATOR)'), (u'ELEVA TOR]', u'ELEVATOR]'), (u'CONTIN U ES', u'CONTINUES'), (u'WIN D HOWLING', u'WIND HOWLING'), (u'telis me', u'tells me'), (u'Telis me', u'Tells me'), (u'. Ls ', u'. Is '), (u'! Ls ', u'! Is '), (u'? Ls ', u'? Is '), (u'. Lt ', u'. It '), (u'! Lt ', u'! It '), (u'? Lt ', u'? It '), (u'SQMEWH ERE ELSE', u'SOMEWHERE ELSE'), (u' I,m ', u" I'm "), (u' I,ve ', u" I've "), (u' you,re ', u" you're "), (u' you,ll ', u" you'll "), (u' doesn,t ', u" doesn't "), (u' let,s ', u" let's "), (u' he,s ', u" he's "), (u' it,s ', u" it's "), (u' can,t ', u" can't "), (u' Can,t ', u" Can't "), (u' don,t ', u" don't "), (u' Don,t ', u" Don't "), (u"wouldn 'tyou", u"wouldn't you"), (u' lgot it', u' I got it'), (u' you,ve ', u" you've "), (u' I ve ', u" I've "), (u' I ii ', u" I'll "), (u' I m ', u" I'm "), (u' why d ', u" why'd "), (u' couldn t ', u" couldn't "), (u' that s ', u" that's "), (u' i... ', u' I... '), (u"L don't", u"I don't"), (u"L won't", u"I won't"), (u'L should', u'I should'), (u'L had', u'I had'), (u'L happen', u'I happen'), (u"L wasn't", u"I wasnt't"), (u'H i', u'Hi'), (u"L didn't", u"I didn't"), (u'L do', u'I do'), (u'L could', u'I could'), (u'L will', u'I will'), (u'L suggest', u'I suggest'), (u'L reckon', u'I reckon'), (u'L am', u'I am'), (u"L couldn't", u"I couldn't"), (u'L might', u'I might'), (u'L would', u'I would'), (u'L was', u'I was'), (u'L know', u'I know'), (u'L think', u'I think'), (u"L haven't", u"I haven't"), (u'L have ', u'I have'), (u'L want', u'I want'), (u'L can', u'I can'), (u'L love', u'I love'), (u'L like', u'I like')]),
+                          'pattern': u"(?um)(?:(?<=\\s)|(?<=^)|(?<=\\b))(?:\\ \\/be\\ |\\ aren\\ \\'1\\'|\\ aren\\'tyou|\\ doesn\\ \\'1\\'|\\ fr\\/eno\\'|\\ fr\\/eno\\'\\.|\\ haven\\ \\'z\\'\\ |\\ haven\\ \\'z\\'\\.|\\ I\\ ha\\ ve\\ |\\ I\\'\\]I\\ |\\ L\\ am|\\ L\\ can|\\ L\\ don\\'t\\ |\\ L\\ hate\\ |\\ L\\ have\\ |\\ L\\ like\\ |\\ L\\ will|\\ L\\ would|\\ L\\'ll\\ |\\ L\\'ve\\ |\\ m\\ y\\ family|\\ \\'s\\ |\\ shou\\/dn\\ \\'1\\ |\\ won\\ \\'z\\'\\ |\\ won\\ \\'z\\'\\.|\\ wou\\/c\\/n\\ \\'z\\'\\ |\\ wou\\/c\\/n\\ \\'z\\'\\.|\\ wou\\/dn\\ \\'z\\'\\ |\\ wou\\/dn\\ \\'z\\'\\.|\\/\\ did|\\/\\ have\\ |\\/\\ just\\ |\\/\\ loved\\ |\\/\\ need|\\|was11|at\\ Hrst|B\\ ullshiz\\'|big\\ lunk|can\\ \\'t|can\\'\\ t\\ |can\\ \\'t\\ |CHA\\ TTERING|come\\ 0n|Come\\ 0n|couldn\\ \\'t|couldn\\'\\ t\\ |couldn\\ \\'t\\ |Destin\\ y\\'s|didn\\ \\'t|didn\\'\\ t\\ |didn\\ \\'t\\ |Doesn\\ \\'1\\'|doesn\\ \\'1\\'\\ |doesn\\ \\'1\\\u2018\\ |doesn\\ \\'t|doesn\\'1\\'\\ |doesn\\'1\\\u2018\\ |don\\ \\'1\\'\\ |don\\ \\'1\\\u2018\\ |don\\ \\'2\\'\\ |\\ aren\\ \\'2\\'|aren\\ \\'2\\'\\ |don\\ \\'2\\\u2018\\ |don\\ \\'t|Don\\'\\ t\\ |Don\\ \\'t\\ |don\\'1\\'\\ |don\\'1\\\u2018\\ |there\\ \\'5\\ |E\\ very|get\\ 0n|go\\ 0n|Go\\ 0n|H3993\\'\\ birthday|hadn\\ \\'t|he\\ \\'s|He\\ \\'s|He\\ y|he\\)\\/|He\\)\\/|HEA\\ VY|Henry\\ ll|Henry\\ lll|Henry\\ Vlll|Henry\\ Vll|Henry\\ Vl|Hold\\ 0n|I\\ am\\.\\ ls|I\\ d0|I\\ \\'m|I\\ \\'rn\\ |I\\ \\'ve|I0\\ ve\\ her|I0\\ ve\\ you|I02\\'|I\\'m\\ sony|isn\\'\\ t\\ |isn\\ \\'t\\ |K\\)\\/le|L\\ ook|let\\ me\\ 90|Let\\ me\\ 90|let\\'s\\ 90|Let\\'s\\ 90|lfl\\ had|lova\\ you|Lova\\ you|lovo\\ you|Lovo\\ you|ls\\ anyone|ls\\ he|\\-ls\\ he|ls\\ it|\\-ls\\ it|ls\\ she|\\-ls\\ she|ls\\ that|\\-ls\\ that|ls\\ this|\\-ls\\ this|Maze\\]\\ tov|N02\\'\\ |\\ of\\ 0ur\\ |\\ ot\\ mine\\ |PLA\\ YING|REPEA\\ TING\\ |Sa\\ y|she\\ \\'s|She\\ \\'s|shouldn\\ \\'t|sta\\ y|Sta\\ y|SWO\\ rd|taka\\ care|Taka\\ care|the\\ Hrst|toc\\ late|uf\\ me|uf\\ our|wa\\ y|Wal\\-I\\\\\\/Iart|wasn\\ \\'1\\'\\ |Wasn\\ \\'1\\'\\ |wasn\\ \\'1\\\u2018\\ |Wasn\\ \\'1\\\u2018\\ |wasn\\ \\'t|Wasn\\ \\'t|we\\ \\'ve|We\\ \\'ve|wem\\'\\ off|weren\\ \\'t|who\\ \\'s|won\\ \\'t|would\\ ha\\ ve|wouldn\\ \\'t|Wouldn\\ \\'t|y\\(\\)u|you\\ QUYS|you\\'\\ re\\ |you\\ \\'re\\ |you\\ \\'ve|You\\ \\'ve|you\\'\\ ve\\ |you\\ \\'ve\\ |aftera\\ while|Aftera\\ while|THUN\\ DERCLAPS|\\(BUZZI\\ N\\ G\\)|\\[BUZZI\\ N\\ G\\]|\\(G\\ RU\\ NTING|\\[G\\ RU\\ NTING|\\(G\\ ROWLING|\\[G\\ ROWLING|\\ WAI\\ LS\\)|\\ WAI\\ LS\\]|\\(scu\\ RRYING\\)|\\[scu\\ RRYING\\]|\\(GRUNT5\\)|\\[GRUNT5\\]|NARRA\\ TOR\\:|\\(GROAN\\ ING|\\[GROAN\\ ING|GROAN\\ ING\\)|GROAN\\ ING\\]|\\(LAUGH\\ ING|\\[LAUGH\\ ING|LAUGH\\ ING\\)|LAUGH\\ ING\\]|\\(BU\\ BBLING|\\[BU\\ BBLING|BU\\ BBLING\\)|BU\\ BBLING\\]|\\(SH\\ USHING|\\[SH\\ USHING|SH\\ USHING\\)|SH\\ USHING\\]|\\(CH\\ ILDREN|\\[CH\\ ILDREN|CH\\ ILDREN\\)|CH\\ ILDREN\\]|\\(MURMU\\ RING|\\[MURMU\\ RING|MURMU\\ RING\\)|MURMU\\ RING\\]|\\(GU\\ N\\ |\\[GU\\ N\\ |GU\\ N\\)|GU\\ N\\]|CH\\ ILDREN\\:|STU\\ DENTS\\:|\\(WH\\ ISTLE|\\[WH\\ ISTLE|WH\\ ISTLE\\)|WH\\ ISTLE\\]|U\\ LU\\ LATING|AU\\ DIENCE\\:|HA\\ WAIIAN|\\(ARTH\\ UR|\\[ARTH\\ UR|ARTH\\ UR\\)|ARTH\\ UR\\]|J\\ EREMY\\:|\\(ELEVA\\ TOR|\\[ELEVA\\ TOR|ELEVA\\ TOR\\)|ELEVA\\ TOR\\]|CONTIN\\ U\\ ES|WIN\\ D\\ HOWLING|telis\\ me|Telis\\ me|\\.\\ Ls\\ |\\!\\ Ls\\ |\\?\\ Ls\\ |\\.\\ Lt\\ |\\!\\ Lt\\ |\\?\\ Lt\\ |SQMEWH\\ ERE\\ ELSE|\\ I\\,m\\ |\\ I\\,ve\\ |\\ you\\,re\\ |\\ you\\,ll\\ |\\ doesn\\,t\\ |\\ let\\,s\\ |\\ he\\,s\\ |\\ it\\,s\\ |\\ can\\,t\\ |\\ Can\\,t\\ |\\ don\\,t\\ |\\ Don\\,t\\ |wouldn\\ \\'tyou|\\ lgot\\ it|\\ you\\,ve\\ |\\ I\\ ve\\ |\\ I\\ ii\\ |\\ I\\ m\\ |\\ why\\ d\\ |\\ couldn\\ t\\ |\\ that\\ s\\ |\\ i\\.\\.\\.\\ |L\\ don\\'t|L\\ won\\'t|L\\ should|L\\ had|L\\ happen|L\\ wasn\\'t|H\\ i|L\\ didn\\'t|L\\ do|L\\ could|L\\ will|L\\ suggest|L\\ reckon|L\\ am|L\\ couldn\\'t|L\\ might|L\\ would|L\\ was|L\\ know|L\\ think|L\\ haven\\'t|L\\ have\\ |L\\ want|L\\ can|L\\ love|L\\ like)(?:(?=\\s)|(?=$)|(?=\\b))"},
+         'PartialWordsAlways': {'data': OrderedDict([(u'\xa4', u'o'), (u'lVI', u'M'), (u'IVl', u'M'), (u'lVl', u'M'), (u'I\\/I', u'M'), (u'l\\/I', u'M'), (u'I\\/l', u'M'), (u'l\\/l', u'M'), (u'IVIa', u'Ma'), (u'IVIe', u'Me'), (u'IVIi', u'Mi'), (u'IVIo', u'Mo'), (u'IVIu', u'Mu'), (u'IVIy', u'My'), (u' l ', u' I '), (u'l/an', u'lian'), (u'\xb0x\xb0', u'%'), (u'\xc3\xc2s', u"'s"), (u'at/on', u'ation'), (u'lljust', u'll just'), (u"'sjust", u"'s just"), (u'compiete', u'complete'), (u' L ', u' I '), (u'a/ion', u'ation'), (u'\xc2s', u"'s"), (u"'tjust", u"'t just"), (u'\xb6\xb6', u'\u266b'), (u'\xb6', u'\u266a')]),
+                                'pattern': None},
+         'WholeLines': {'data': OrderedDict([(u'H ey.', u'Hey.'), (u'He)\u2019-', u'Hey.'), (u'N0.', u'No.'), (u'-N0.', u'-No.'), (u'Noll', u'No!!'), (u'(G ROANS)', u'(GROANS)'), (u'[G ROANS]', u'[GROANS]'), (u'(M EOWS)', u'(MEOWS)'), (u'[M EOWS]', u'[MEOWS]'), (u'Uaughs]', u'[laughs]'), (u'[chitte rs]', u'[chitters]'), (u'Hil\u2018 it!', u'Hit it!'), (u'<i>Hil\u2018 it!</i>', u'<i>Hit it!</i>'), (u'ISIGHS]', u'[SIGHS]')]),
+                        'pattern': None},
+         'WholeWords': {'data': OrderedDict([(u'$COff$', u'scoffs'), (u'$ergei', u'Sergei'), (u"$'llOp", u'Stop'), (u"/'//", u"I'll"), (u"/'/I", u"I'll"), (u'/ennifer', u'Jennifer'), (u'/got', u'I got'), (u'/have', u'I have'), (u'/hope', u'I hope'), (u'/just', u'I just'), (u'/love', u'I love'), (u"/'m", u"I'm"), (u'/mmerse', u'immerse'), (u'/nsu/ts', u'Insults'), (u'/ong', u'long'), (u'/ook', u'look'), (u"/t's", u"It's"), (u"/'ve", u"I've"), (u"\\/\\/e'd", u"We'd"), (u"\\/\\/e're", u"We're"), (u"\\/\\/e've", u"We've"), (u'\\/\\/hat', u'What'), (u"\\/\\/here'd", u"Where'd"), (u'\\/\\/hoo', u'Whoo'), (u'\\/\\/hy', u'Why'), (u"\\/\\/hy'd", u"Why'd"), (u"\\/\\le're", u"We're"), (u'\\/Ve', u'We'), (u"\\Ne're", u"We're"), (u"\\Nhat's", u"What's"), (u"\\Nhere's", u"Where's"), (u"|'mjust", u"I'm just"), (u'\xa4ff', u'off'), (u'\xa4Id', u'old'), (u'\xa4Ids', u'olds'), (u'\xa4n', u'on'), (u'\xa4ne', u'one'), (u'\xa4nly', u'only'), (u'\xa4pen', u'open'), (u'\xa4r', u'or'), (u'\xa4rder', u'order'), (u'\xa4ther', u'other'), (u'\xa4ur', u'our'), (u'\xa4ut', u'out'), (u'\xa4ver', u'over'), (u'\xa4wn', u'own'), (u"\u20acV\u20acI'y", u'every'), (u"0'clock", u"o'clock"), (u'0f', u'of'), (u'0fEngland', u'of England'), (u'0fft0', u'off to'), (u'0l/er', u'over'), (u'0n', u'on'), (u'0ne', u'one'), (u"0ne's", u"one's"), (u'0r', u'or'), (u'0rders', u'orders'), (u"0thers'", u"others'"), (u'0ut', u'out'), (u"0utlaw's", u"outlaw's"), (u"0utlaws'", u"outlaws'"), (u'0ver', u'over'), (u'13oos', u'1300s'), (u'18oos', u'1800s'), (u'195os', u'1950s'), (u"1et's", u"let's"), (u'1o', u'10'), (u'1oo', u'100'), (u'1ooth', u'100th'), (u'1oth', u'10th'), (u'2E_', u'2E.'), (u"2'IST", u'21ST'), (u"2'Ist_", u"2'1st."), (u'2o', u'20'), (u'2oth', u'20th'), (u'3o', u'30'), (u'3oth', u'30th'), (u'4o', u'40'), (u'4os', u'40s'), (u'4oth', u'40th'), (u'50rry', u'sorry'), (u'5o', u'50'), (u'5oth', u'50th'), (u'6o', u'60'), (u'6os', u'60s'), (u"'6os", u"'60s"), (u'6oth', u'60th'), (u'7o', u'70'), (u"'7os", u"'70s"), (u'7oth', u'70th'), (u'8o', u'80'), (u"'8os", u"'80s"), (u'8oth', u'80th'), (u'9/aim', u'alarm'), (u'9o', u'90'), (u'9oth', u'90th'), (u'9UnShQt', u'gunshot'), (u'a//', u'all'), (u'a/bum', u'album'), (u'a/so', u'also'), (u'A/ways', u'Always'), (u'abcut', u'about'), (u'aboutjoining', u'about joining'), (u'aboutposh', u'about posh'), (u'aboutus', u'about us'), (u'aboutyou', u'about you'), (u'accldent', u'accident'), (u'Acool', u'A cool'), (u'afier', u'after'), (u'affraid', u'afraid'), (u'Afriend', u'A friend'), (u'afterall', u'after all'), (u'afterthe', u'after the'), (u'afulcrum', u'a fulcrum'), (u'Afunny', u'A funny'), (u'aga/nst', u'against'), (u'ahsolutes', u'absolutes'), (u'AI_I_', u'ALL'), (u'AIien', u'Alien'), (u'AIex', u'Alex'), (u'AII', u'All'), (u'AIIan', u'Allan'), (u'AIIow', u'Allow'), (u'AIive', u'Alive'), (u"ain'tgotno", u"ain't got no"), (u"Ain'tgotno", u"Ain't got no"), (u'airstrike', u'air strike'), (u'AIVIBULANCE', u'AMBULANCE'), (u'ajob', u'a job'), (u'ajockey_', u'a jockey.'), (u'ajoke', u'a joke'), (u'Ajoke', u'A joke'), (u'ajoking', u'a joking'), (u'al/', u'all'), (u'al/en', u'alien'), (u'alittle', u'a little'), (u'allgasp', u'all gasp'), (u'alljustforshow', u'all just for show'), (u"aln't", u"ain't"), (u'alot', u'a lot'), (u'Alot', u'A lot'), (u'An5wer', u'Answer'), (u'Andit', u'And it'), (u"Andit's", u"And it's"), (u'andl', u'and I'), (u'andlaughs', u'and laughs'), (u'andleave', u'and leave'), (u'andthe', u'and the'), (u'andyou', u'and you'), (u'Andyou', u'And you'), (u'ANNOUNC/NG', u'ANNOUNCING'), (u'anotherstep', u'another step'), (u'ANSWER/NG', u'ANSWERING'), (u'answerwhat', u'answer what'), (u'antiquejoke', u'antique joke'), (u"anyhcdy's", u"anybody's"), (u'Anyidea', u'Any idea'), (u"anyone's_", u"anyone's."), (u'apejust', u'ape just'), (u'ARABlc', u'ARABIC'), (u"aren't_", u"aren't."), (u"arerl't", u"aren't"), (u"Arnsteln's", u"Arnstein's"), (u'atleast', u'at least'), (u'Atough', u'A tough'), (u'Awhole', u'A whole'), (u'awoman', u'a woman'), (u'Awoman', u'A woman'), (u'barelytalked', u'barely talked'), (u'bcat', u'boat'), (u'Bcllvla', u'Bolivia'), (u'bcmb', u'bomb'), (u'bcmbs', u'bombs'), (u'be//y', u'belly'), (u'becuase', u'because'), (u"Beep/'ng", u'Beeping'), (u'bejumpy', u'be jumpy'), (u'besldes', u'besides'), (u'bestfriend', u'best friend'), (u'bestguy', u'best guy'), (u'bestjob', u'best job'), (u'BIack', u'Black'), (u'BIess', u'Bless'), (u'bigos___', u'bigos...'), (u'BIame', u'Blame'), (u'BIind', u'Blind'), (u'BIood', u'Blood'), (u'BIue', u'Blue'), (u'BLOVVS', u'BLOWS'), (u'blowholel', u'blowhole!'), (u'blt', u'bit'), (u'Bo99', u'Bogg'), (u'bodiedyoung', u'bodied young'), (u'breakf\xe9wtl', u'breakfast!'), (u'bulldozlng', u'bulldozing'), (u'butjust', u'but just'), (u'butl', u'but I'), (u'Butl', u'But I'), (u'butljust', u'but I just'), (u"Butljustcan'tgetenough", u"But I just can't get enough"), (u"Butyou're", u"But you're"), (u'buythem', u'buy them'), (u'buyyou', u'buy you'), (u'byjust', u'by just'), (u'bythe', u'by the'), (u"C/latter/'/7g", u'Chattering'), (u'ca///ng', u'calling'), (u'ca/I', u'call'), (u'call/ng', u'calling'), (u'callyou', u'call you'), (u'can*t', u"can't"), (u"can'i", u"can't"), (u"can'I", u"can't"), (u'canlgetyou', u'canI get you'), (u'cannotchange', u'cannot change'), (u'cannut', u'cannot'), (u"can'T", u"can't"), (u"can't_", u'Crucially'), (u"can'tjust", u"can't just"), (u"can'tletgo", u"can't let go"), (u'Car0l', u'Carol'), (u'Carhorn', u'Car horn'), (u'carrled', u'carried'), (u'Ccug', u'Coug'), (u'Ccugs', u'Cougs'), (u'Ccver', u'Cover'), (u'cellularchange', u'cellular change'), (u'cff', u'off'), (u'cfycu', u'of you'), (u'cfycur', u'of your'), (u'Ch/rping', u'Chirping'), (u'chaletgirl', u'chalet girl'), (u'changejobs', u'change jobs'), (u'Charliejust', u'Charlie just'), (u"Chatter/'rtg", u'Chattering'), (u'CHATTERWG', u'CHATTERING'), (u'Chequeredlove', u'Chequered love'), (u'cHIRPINcs', u'CHIRPING'), (u'chjldishness', u'childishness'), (u'chlldrcn', u'children'), (u'chlldren', u'children'), (u'chocolatte', u'chocolate'), (u'Cho/r', u'Choir'), (u'cHucKl_Es', u'CHUCKLES'), (u'CIark', u'Clark'), (u'CIear', u'Clear'), (u'circumcised_', u'circumcised.'), (u'ckay', u'okay'), (u'cl_osEs', u'CLOSES'), (u'CLATTERWG', u'CLATTERING'), (u'cn', u'on'), (u'cne', u'one'), (u'cnes', u'ones'), (u'Coincidenta//y', u'Coincidentally'), (u'COm\u20ac', u'Come'), (u'comp/etey', u'completely'), (u'complainingabout', u'complaining about'), (u'coms', u'come'), (u'cond/lion', u'condition'), (u'confdence', u'confidence'), (u'conhrmed', u'confirmed'), (u'connrm', u'confirm'), (u'Consecutivelyl', u'Consecutively!'), (u'COUGH5', u'COUGHS'), (u'CouGHING', u'COUGHING'), (u"couIdn't", u"couldn't"), (u'couldjust', u'could just'), (u"couldn'T", u"couldn't"), (u"couldn'tjust", u"couldn't just"), (u'Couldyou', u'Could you'), (u'crappyjob', u'crappy job'), (u'CRAsHING', u'CRASHING'), (u'crder', u'order'), (u'Crowdcheers', u'Crowd cheers'), (u'Cruoially', u'Crucially'), (u'cther', u'other'), (u'cuuld', u'could'), (u'cver', u'over'), (u"d/'dn't", u"didn't"), (u'd/squietude', u'disquietude'), (u"D\xa4esn't", u"Doesn't"), (u"d\xa4n'i", u"don't"), (u"d\xa4n't", u"don't"), (u'd\xb09', u'dog'), (u'd0', u'do'), (u'D0', u'Do'), (u"D0asn't", u"Doesn't"), (u"Dad'//", u"Dad'll"), (u'dairyjust', u'dairy just'), (u'Dar//ng', u'Darling'), (u'dc', u'do'), (u'Dcbby', u'Dobby'), (u"dccsn't", u"doesn't"), (u'dcctcr', u'doctor'), (u'Dces', u'Does'), (u'dcgs', u'dogs'), (u'dcing', u'doing'), (u"dcn'I", u"don't"), (u"dcn't", u"don't"), (u"Dcn't", u"Don't"), (u'dcughnut', u'doughnut'), (u'declslons', u'decisions'), (u'deedhas', u'deed has'), (u'Dehnitely', u'Definitely'), (u'desewes', u'deserves'), (u'desperate/\xbby', u'desperately'), (u'D\ufb02nk', u'Drink'), (u'DIAl_lNcs', u'DIALING'), (u"didn'!", u"didn't"), (u'didnt', u"didn't"), (u"didn'T", u"didn't"), (u"dIdn't", u"didn't"), (u"didn't_", u"didn't."), (u'didrft', u"didn't"), (u"didrl't", u"didn't"), (u'didyou', u'did you'), (u'divorcing_', u'divorcing.'), (u'dld', u'did'), (u"dldn't", u"didn't"), (u'dlfflcull', u'difficult'), (u'dlg', u'dig'), (u'dlsobeyed', u'disobeyed'), (u"doasn't", u"doesn't"), (u"Doasn't", u"Doesn't"), (u'doctoh', u'doctor'), (u'Doctor___tell', u'Doctor... tell'), (u'doesnt', u"doesn't"), (u"doesn'T", u"doesn't"), (u"doesri't", u"doesnt't"), (u'doesrt', u"doesn't"), (u'Doesrt', u"Doesn't"), (u'doit', u'do it'), (u'dojust', u'do just'), (u'don*t', u"don't"), (u'donejobs', u'done jobs'), (u"don'i", u"don't"), (u"don'l", u"don't"), (u"Don'l", u"Don't"), (u'Donllook', u"Don't look"), (u'dont', u"don't"), (u"don'T", u"don't"), (u"don'tcare", u"don't care"), (u"don'tjoke", u"don't joke"), (u"Don'tjudge", u"Don't judge"), (u"don'tjust", u"don't just"), (u"Don'tjust", u"Don't just"), (u"Don'tlet", u"Don't let"), (u"don'tlhink", u"don't think"), (u"don'tpush", u"don't push"), (u"Don'tyou", u"Don't you"), (u'DonWlook', u"Don't look"), (u'Dooropens', u'Door opens'), (u'doorshuts', u'door shuts'), (u'dothat', u'do that'), (u'dothis', u'do this'), (u'Drinkthis', u'Drink this'), (u'dumbass', u'dumb-ass'), (u'dumbto', u'dumb to'), (u"dun't", u"don't"), (u'E//e', u'Elle'), (u'E9YPt', u'Egypt'), (u"ea/'t/7", u'earth'), (u'eart/7', u'earth'), (u"efi'/'c/'ent", u'efficient'), (u'EN<3LlsH', u'ENGLISH'), (u'Enjoythe', u'Enjoy the'), (u'Erv\\/an', u'Erwan'), (u"Erv\\/an's", u"Erwan's"), (u'etemity', u'eternity'), (u'ev/I', u'evil'), (u'eve/yone', u'everyone'), (u"even/body's", u"everybody's"), (u'eversay', u'ever say'), (u'Everymonth', u'Every month'), (u'everythings', u"everything's"), (u"Everythirlg's", u'Everything\u2019s'), (u"Everythlng's", u"Everything's"), (u'Everytime', u'Every time'), (u'Exac\ufb02y', u'Exactly'), (u'ExacUy_', u'Exactly.'), (u'excitedshrieking', u'excited shrieking'), (u'ExcLAllvls', u'EXCLAIMS'), (u'exploatation', u'exploitation'), (u'expreusion', u'expression'), (u'fairthat', u'fair that'), (u'Fathef', u'Father'), (u'fatherfigure', u'father figure'), (u'FBl', u'FBI'), (u'fcrebcdlng', u'foreboding'), (u'fcreverjudges', u'forever judges'), (u'fcund', u'found'), (u'feeleverything', u'feel everything'), (u'feelsweet', u'feel sweet'), (u"fiam/'/y", u'family'), (u'\ufb01ngernail', u'fingernail'), (u'finishedjunior', u'finished junior'), (u'FIynn', u'Flynn'), (u'flll', u'fill'), (u'flra', u'fira'), (u'Flylng', u'Flying'), (u'Fnends', u'Fiends'), (u'fo/low', u'follow'), (u'fonzvard', u'forward'), (u'fora', u'for a'), (u'Fora', u'For a'), (u'forajob', u'for a job'), (u'forAmerica', u'for America'), (u'forNew', u'for New'), (u'forone', u'for one'), (u'forso', u'for so'), (u'Forsuch', u'For such'), (u'forsunburns', u'for sunburns'), (u'forthe', u'for the'), (u'Foryears', u'For years'), (u'foryou', u'for you'), (u'Foudeen', u'Fouteen'), (u'Fou\ufb02een', u'Fourteen'), (u'FourSeasons', u'Four Seasons'), (u'fr/ends', u'friends'), (u'freezerfood', u'freezer food'), (u'F\xfchrerfeels', u'F\xfchrer feels'), (u'furthernotice', u'further notice'), (u'furyou', u'for you'), (u'G0', u'Go'), (u'g0in9', u'going'), (u'gamlenias', u'gardenias'), (u'GAsPING', u'GASPING'), (u'gc', u'go'), (u'gcing', u'going'), (u'gcnna', u'gonna'), (u'Gcnna', u'Gonna'), (u'gct', u'get'), (u'Gct', u'Got'), (u'genercsity', u'generosity'), (u'generosityn', u'generosity"'), (u'getjust', u'get just'), (u'g\ufb02ing', u'going'), (u'gi\ufb02friend', u'girlfriend'), (u'gir/', u'girl'), (u"gir/s'boarding", u"girls' boarding"), (u'giris', u'girls'), (u'gLlyS', u'guys'), (u'glum_', u'glum.'), (u'gnyone', u'anyone'), (u'golng', u'going'), (u'goodboyand', u'good boy and'), (u'goodjob', u'good job'), (u'gOt', u'got'), (u'gotjumped', u'got jumped'), (u'gotmyfirstinterview', u'got my first interview'), (u'grandjury', u'grand jury'), (u'greatjob', u'great job'), (u'Greatjobl', u'Great job!'), (u'grinco', u'gringo'), (u'GRoANING', u'GROANING'), (u'GRUNUNG', u'GRUNTING'), (u'gu', u'go'), (u'gunna', u'gonna'), (u'guyjumped', u'guy jumped'), (u'guyjust', u'guy just'), (u'gUyS', u'guys'), (u'_H6Y-', u'- Hey!'), (u'H\u20acY', u'Hey'), (u'H0we\xb7ver', u'However'), (u'halftheir', u'half their'), (u'hapPY', u'happy'), (u'hasrt', u"hasn't"), (u'Hasrt', u"Hasn't"), (u"haven'tspokerl", u"haven't spoken"), (u'hcle', u'hole'), (u'hcme', u'home'), (u'hcmes', u'homes'), (u'hcpe', u'hope'), (u'hctel', u'hotel'), (u'hcurs', u'hours'), (u'Hcw', u'How'), (u'he/ps', u'helps'), (u'hearjokestonight', u'hear jokes tonight'), (u'hearme', u'hear me'), (u'Hefell', u'He fell'), (u"he'II", u"he'll"), (u"He'II", u"He'll"), (u'HeII0', u'Hello'), (u"He'Il", u"He'll"), (u'Hejust', u'He just'), (u"He'lI", u"He'll"), (u'HelIo', u'Hello'), (u'hellc', u'hello'), (u'HellO', u'Hello'), (u'herboyfr/end', u'her boyfriend'), (u'herflesh', u'her flesh'), (u'herfollov\\/ed', u'her followed'), (u'herjob_', u'her job.'), (u'HerrSchmidt', u'Herr Schmidt'), (u'herwith', u'her with'), (u'HeY\xb7', u'Hey.'), (u'HeyJennifer', u'Hey Jennifer'), (u'hiddsn', u'hidden'), (u'hisjunk', u'his junk'), (u'Hitlershare', u'Hitler share'), (u'Hlneed', u"I'll need"), (u'Hnally', u'finally'), (u'Hnishing', u'finishing'), (u'HOId', u'Hold'), (u'hOIes', u'holes'), (u'HONMNG', u'HONKING'), (u'honorthe', u'honor the'), (u'honoryou', u'honor you'), (u'honoryour', u'honor your'), (u"Hov\\/'s", u"How's"), (u"Hov\\/'S", u"How's"), (u'HovvLING', u'HOWLING'), (u'howit', u'how it'), (u"HoW's", u"How's"), (u'howto', u'how to'), (u"Hs's", u"He's"), (u'hurtyou', u'hurt you'), (u'I/erilj/', u'verify'), (u'I/fe', u'life'), (u'I\\/I', u'M'), (u'I\\/Ian', u'Man'), (u'I\\/Iathies', u'Mathies'), (u'I\\/Ie', u'Me'), (u'I\\/Iommy', u'Mommy'), (u'I\\/Ir', u'Mr'), (u'I\\/Ir.', u'Mr.'), (u'I\\/ly', u'My'), (u'I3EEPING', u'BEEPING'), (u'I3LARING', u'BLARING'), (u'Iacings', u'lacings'), (u'Iaid', u'laid'), (u'Iam', u'I am'), (u'Iand', u'land'), (u'Ianding', u'landing'), (u'Iast', u'last'), (u'Iate', u'late'), (u'Icad', u'load'), (u'Icading', u'loading'), (u'Ican', u'I can'), (u'Iccked', u'locked'), (u'Icng', u'long'), (u'Icsing', u'losing'), (u'Icslng', u'losing'), (u'Idid', u'I did'), (u"Ididn't", u"I didn't"), (u'Ido', u'I do'), (u"Idon'i", u"I don't"), (u"Idon't", u"I don't"), (u"Idon'tthink", u"I don't think"), (u"I'E'$", u"It's"), (u'Ieamed', u'learned'), (u'Ieapt', u'leapt'), (u'Iearned', u'learned'), (u'Ieast', u'least'), (u'Ieave', u'leave'), (u'Ied', u'led'), (u'Ieft', u'left'), (u"Ieg's", u"leg's"), (u'Iess', u'less'), (u'Iet', u'let'), (u"Iet's", u"let's"), (u"Iet'sjust", u"let's just"), (u'if/just', u'if I just'), (u'Ifear', u'I fear'), (u'Ifeared', u'I feared'), (u'Ifeel', u'I feel'), (u"ifI'||", u"if I'll"), (u"ifI'd", u"if I'd"), (u"ifI'II", u"if I'll"), (u"ifI'll", u"if I'll"), (u"ifI'm", u"if I'm"), (u'Ifinally', u'I finally'), (u"ifI've", u"if I've"), (u'ifl', u'if I'), (u'Iforgot', u'I forgot'), (u'Ifound', u'I found'), (u'ifshe', u'if she'), (u"ifthat's", u"if that's"), (u'ifthe', u'if the'), (u'Ifthe', u'If the'), (u"ifthere's", u"if there's"), (u'Ifthey', u'If they'), (u'ifwe', u'if we'), (u'Ifwe', u'If we'), (u'Ifycu', u'If you'), (u'ifyou', u'if you'), (u'Ifyou', u'If you'), (u'ifyuu', u'if you'), (u'Iget', u'I get'), (u'Igot', u'I got'), (u'Igotta', u'I gotta'), (u'Igotyou', u'I got you'), (u'Iguess', u'I guess'), (u'Iguessljust', u'I guess I just'), (u'Ihad', u'I had'), (u"Ihat's", u"that's"), (u'Ihave', u'I have'), (u'Iheard', u'I heard'), (u"ihere's", u"there's"), (u"ihey've", u"they've"), (u'Ihope', u'I hope'), (u'ii/Iary', u'Mary'), (u'ii/Ir', u'Mr'), (u'ii/Ir.', u'Mr.'), (u'ii/love', u'Move'), (u'Iife', u'life'), (u"I'II", u"I'll"), (u'Iike', u'like'), (u"I'Il", u"I'll"), (u'Iine', u'line'), (u'iirst', u'first'), (u"ii's", u"it's"), (u"Ii's", u"It's"), (u'Iiterallyjumped', u'literally jumped'), (u'Ijoined', u'I joined'), (u'Ijust', u'I just'), (u'Iknew', u'I knew'), (u'Iknow', u'I know'), (u'Ile', u'lie'), (u'Ileft', u'I left'), (u"I'lldo", u"I'll do"), (u"I'llmake", u"I'll make"), (u'Ilons', u'lions'), (u'Ilove', u'I love'), (u"I'mjust", u"I'm just"), (u'Inconceivablel', u'Inconceivable!'), (u'infact', u'in fact'), (u'Infact', u'In fact'), (u'in\ufb02uence', u'influence'), (u'infront', u'in front'), (u'injust', u'in just'), (u'insc\ufb01p\ufb01ons', u'inscriptions'), (u'insolencel', u'insolence!'), (u'intc', u'into'), (u'internationaljudges', u'international judges'), (u'inthe', u'in the'), (u'Iockdown', u'lockdown'), (u'Iong', u'long'), (u'Iongships', u'longships'), (u'Iook', u'look'), (u'Iookjust', u'look just'), (u'Iooklng', u'looking'), (u'Iooks', u'looks'), (u'Ioose', u'loose'), (u"Iord's", u"lord's"), (u'Iose', u'lose'), (u'Ioser', u'loser'), (u'Ioss', u'loss'), (u'Iost', u'lost'), (u'Iot', u'lot'), (u"Iot's", u"lot's"), (u'Iousyjob', u'lousy job'), (u'Iove', u'love'), (u'Ioves', u'loves'), (u'Iowlife', u'lowlife'), (u'Ipaid', u'I paid'), (u'Iquit', u'I quit'), (u'Ireallythinkthis', u'I really think this'), (u"I'rn", u"I'm"), (u'Isaw', u'I saw'), (u'Isayt/1e', u'I say the'), (u'isjust', u'is just'), (u"isn'i", u"isn't"), (u"isn't_", u"isn't."), (u'Isthis', u'Is this'), (u'Istill', u'I still'), (u'Istumblod', u'I stumbled'), (u'Itake', u'I take'), (u'itdown', u'it down'), (u'Iteach', u'I teach'), (u'Itfeels', u'It feels'), (u'ithave', u'it have'), (u'Ithink', u'I think'), (u'Ithinkthat', u'I think that'), (u'Ithinkthis', u'I think this'), (u"Ithinkyou're", u"I think you're"), (u'Ithlnk', u'I think'), (u'Ithoguht', u'I thought'), (u'Ithought', u'I thought'), (u'Ithoughtl', u'I thought I'), (u"it'II", u"it'll"), (u"It'II", u"It'll"), (u"it'Il", u"it'll"), (u"It'Il", u"It'll"), (u'itin', u'it in'), (u'itjust', u'it just'), (u'Itjust', u'It just'), (u"it'lI", u"it'll"), (u"It'lI", u"It'll"), (u"It'llhappen", u"It'll happen"), (u"it'lljust", u"it'll just"), (u'Itold', u'I told'), (u'Itook', u'I took'), (u'itout', u'it out'), (u"it'S", u"it's"), (u"it'sjinxed", u"it's jinxed"), (u"it'sjust", u"it's just"), (u"It'sjust", u"It's just"), (u'itso', u'it so'), (u'Ittends', u'It tends'), (u"Itwasn't", u"It wasn't"), (u'Iuckier', u'luckier'), (u'IV|oney', u'Money'), (u"IV|oney's", u"Money's"), (u"I'va", u"I've"), (u"I'Ve", u"I've"), (u'IVIan', u'Man'), (u'IVIAN', u'MAN'), (u'IVIarch', u'March'), (u"IVIarci's", u"Marci's"), (u'IVIarko', u'Marko'), (u'IVIe', u'Me'), (u"IVIine's", u"Mine's"), (u'IVImm', u'Mmm'), (u'IVIoney', u'Money'), (u'IVIr.', u'Mr.'), (u'IVIrs', u'Mrs'), (u'IVIuch', u'Much'), (u'IVIust', u'Must'), (u'IVIy', u'My'), (u'IVlacArthur', u'MacArthur'), (u"IVlacArthur's", u"MacArthur's"), (u'IVlcBride', u'McBride'), (u'IVlore', u'More'), (u'IVlotherfucker_', u'Motherfucker.'), (u'IVlr', u'Mr'), (u'IVlr.', u'Mr.'), (u'IVlr_', u'Mr.'), (u'IVlust', u'Must'), (u'IVly', u'My'), (u'Iwake', u'I wake'), (u'Iwant', u'I want'), (u'Iwanted', u'I wanted'), (u'Iwas', u'I was'), (u'Iwasjust', u'I was just'), (u'Iwasjustu', u'I was just...'), (u'Iwill', u'I will'), (u'Iwish', u'I wish'), (u"Iwon't", u"I won't"), (u'Iworked', u'I worked'), (u'Iwould', u'I would'), (u'jalapeno', u'jalape\xf1o'), (u'Jaokson', u'Jackson'), (u'Jascn', u'Jason'), (u'jcke', u'joke'), (u'jennifer', u'Jennifer'), (u'joseph', u'Joseph'), (u'jsut', u'just'), (u'Jumpthem', u'Jump them'), (u'jusi', u'just'), (u'jusl', u'just'), (u'justjudge', u'just judge'), (u'justleave', u'just leave'), (u'Justletgo', u'Just let go'), (u'kidsjumped', u'kids jumped'), (u'kiokflip', u'kickflip'), (u'knowjust', u'know just'), (u'knowthat', u'know that'), (u'knowthis', u'know this'), (u'knowwhat', u'know what'), (u'knowyet', u'know yet'), (u'knowyourlove', u'know your love'), (u'korean', u'Korean'), (u'L/ght', u'Light'), (u'L/kes', u'Likes'), (u'L\\/Ianuela', u'Manuela'), (u'L\\/Ianuelal', u'Manuela!'), (u'l\\/Iauzard', u'Mauzard'), (u'l\\/I\xe9lanie', u'M\xe9lanie'), (u'L\\/I\xe9lanie', u'M\xe9lanie'), (u'l\\/Iom', u'Mom'), (u'l\\/Iommy', u'Mommy'), (u'l\\/Ir', u'Mr'), (u'l\\/Ir.', u'Mr.'), (u'l\\/Is', u'Ms'), (u'l\\/ly', u'My'), (u'l_AuGHING', u'LAUGHING'), (u'l\u2018m', u"I'm"), (u'Laml6', u'I am l6'), (u'Lcad', u'Load'), (u'lcan', u'I can'), (u"lcan't", u"I can't"), (u"lcarl't_", u"I can't."), (u'Lcve', u'Love'), (u"l'd", u"I'd"), (u"L'd", u"I'd"), (u'ldid', u'I did'), (u'Ldid', u'I did'), (u'ldiot', u'Idiot'), (u"L'djump", u"I'd jump"), (u"ldon't", u"I don't"), (u"Ldon't", u"I don't"), (u'Lefs', u"Let's"), (u"Let'sjust", u"Let's just"), (u'lf', u'if'), (u'Lf', u'If'), (u'lfeelonelung', u'I feel one lung'), (u'lfthey', u'if they'), (u'lfyou', u'If you'), (u'Lfyou', u'If you'), (u"lfyou're", u"If you're"), (u'lget', u'I get'), (u'lgive', u'I give'), (u'Li/0/Academy', u'Lilly Academy'), (u'li/lr.', u'Mr.'), (u'ligature___', u'ligature...'), (u"l'II", u"I'll"), (u"l'Il", u"I'll"), (u'ljust', u'I just'), (u'Ljust', u'I just'), (u"ll/Iommy's", u"Mommy's"), (u'll/lajor', u'Major'), (u'Ll/lajor', u'Major'), (u'll/layans', u'Mayans'), (u"l'lI", u"I'll"), (u"l'll", u"I'll"), (u"L'll", u"I'll"), (u"l'lljust", u"I'll just"), (u"L'lltake", u"I'll take"), (u'llte', u'lite'), (u"l'm", u"I'm"), (u"L'm", u"I'm"), (u'Lmean', u'I mean'), (u"l'mjust", u"I'm just"), (u'ln', u'In'), (u'lN', u'IN'), (u'lNAuDll3LE', u'INAUDIBLE'), (u'LNAuDll3LE', u'INAUDIBLE'), (u'LNDlsTINcT', u'INDISTINCT'), (u'lneed', u'I need'), (u'lostyou', u'lost you'), (u'Loudmusic', u'Loud music'), (u'lraq', u'Iraq'), (u"lRA's", u"IRA's"), (u'Lrenka', u'Irenka'), (u'Lrn', u"I'm"), (u'lRS', u'IRS'), (u'lsabella', u'Isabella'), (u"lsn't", u"isn't"), (u"Lsn't", u"Isn't"), (u"Lst's", u"Let's"), (u'lsuppose', u'I suppose'), (u'lt', u'It'), (u'ltake', u'I take'), (u'ltell', u'I tell'), (u'lthink', u'I think'), (u'Lthink', u'I think'), (u'lthink___', u'I think...'), (u"lt'II", u"It'll"), (u"lt'Il", u"It'll"), (u'ltjammed_', u'It jammed.'), (u"lt'll", u"It'll"), (u'ltold', u'I told'), (u"lt's", u"It's"), (u"lT'S", u"IT'S"), (u"Lt'S", u"It's"), (u"Lt'sjust", u"It's just"), (u"lv\\/asn't", u"I wasn't"), (u"l've", u"I've"), (u"L've", u"I've"), (u'lVIan', u'Man'), (u'lVIcHenry', u'McHenry'), (u'lVIr.', u'Mr.'), (u'lVlacArthur', u'MacArthur'), (u'LVlore', u'More'), (u'lVlr', u'Mr'), (u'lVlr.', u'Mr.'), (u'lvluslc', u'MUSIC'), (u'lVlust', u'Must'), (u'LVly', u'Lily'), (u'lwaited', u'I waited'), (u'lwamoto', u'Iwamoto'), (u'lwant', u'I want'), (u'lwanted', u'I wanted'), (u'lwas', u'I was'), (u'lwill', u'I will'), (u"lwon't", u"I won't"), (u'lworked', u'I worked'), (u'lwould', u'I would'), (u"lwould've", u"I would've"), (u'lx/Iorning', u'Morning'), (u'M/dd/e', u'Middle'), (u'm/g/7ty', u'mighty'), (u'MACH/NE', u'MACHINE'), (u'MacKenz/e', u'MacKenzie'), (u'majorjackpot', u'major jackpot'), (u'majormuscle', u'major muscle'), (u'Manuela_', u'Manuela.'), (u'maste/y', u'mastery'), (u'Masturhate', u'Masturbate'), (u'Mattei_', u'Mattei.'), (u'mayjust', u'may just'), (u'mbecause', u'"because'), (u'McCa/Iister', u'McCallister'), (u'McCallisler', u'McCallister'), (u'Mccallister', u'McCallister'), (u'Mccallisters', u'McCallisters'), (u"mcm's", u"mom's"), (u'mcney', u'money'), (u'mcral', u'moral'), (u'mcre', u'more'), (u'mcve', u'move'), (u'mejust', u'me just'), (u'Mexioo', u'Mexico'), (u'mi//<', u'milk'), (u'misfartune', u'misfortune'), (u'Ml6', u'MI6'), (u'Mlnd', u'Mind'), (u"Mock/'ngbl'rd", u'Mockingbird'), (u"mOI'\u20ac", u'more'), (u'Mom_', u'Mom.'), (u'monkeyback', u'monkey back'), (u'move___l', u'move... I'), (u'moveto', u'move to'), (u'mustknock', u'must knock'), (u'Myheart', u'My heart'), (u'myjch', u'my job'), (u'myjet', u'my jet'), (u'myjob', u'my job'), (u'Myjob', u'My job'), (u"myjob's", u"my job's"), (u'mylife', u'my life'), (u'Mynew', u'My new'), (u'myown', u'my own'), (u'mypants', u'my pants'), (u'myselli', u'myself'), (u'Myshoes', u'My shoes'), (u'mysong', u'my song'), (u'mytemper', u'my temper'), (u'mythumb', u'my thumb'), (u'Myworld', u'My world'), (u'N0', u'No'), (u'narne', u'name'), (u'Natians', u'Nations'), (u'naTve', u'naive'), (u'nc', u'no'), (u'Nc', u'No'), (u'ncne', u'none'), (u'Ncrth', u'North'), (u'ncw', u'new'), (u'Ncw', u'Now'), (u'needyou', u'need you'), (u'neighboun', u'neighbour'), (u'neverfound', u'never found'), (u'neverthere', u'never there'), (u'neverv\\/ill_', u'never will.'), (u'NewJersey', u'New Jersey'), (u'newjob', u'new job'), (u'newjobs', u'new jobs'), (u'nextdoor', u'next door'), (u'Nighw', u'Nighty'), (u'nilios', u'ni\xf1os'), (u'Nlagnificence', u'Magnificence'), (u'Nlakes', u'Makes'), (u'Nlalina', u'Malina'), (u'Nlan', u'Man'), (u'Nlarch', u'March'), (u'Nlarine', u'Marine'), (u'Nlarion', u'Marion'), (u'Nlarry', u'Marry'), (u'Nlars', u'Mars'), (u'Nlarty', u'Marty'), (u'Nle', u'Me'), (u'Nleet', u'Meet'), (u'Nlen', u'Men'), (u'Nlom', u'Mom'), (u'Nlore', u'More'), (u'Nlornin', u'Mornin'), (u'Nlother', u'Mother'), (u'Nlr', u'Mr'), (u'Nlr.', u'Mr.'), (u'Nlrs', u'Mrs'), (u'Nluch', u'Much'), (u'nojurisdiction', u'no jurisdiction'), (u'noone', u'no one'), (u'Noone', u'No one'), (u'not judging', u'not judging'), (u'notgoing', u'not going'), (u'notjunk', u'not junk'), (u'Notjunk', u'Not junk'), (u'notjust', u'not just'), (u'notsure', u'not sure'), (u'novv', u'now'), (u'Nowjust', u'Now just'), (u"Nowthat's", u"Now that's"), (u'Numbertwo', u'Number two'), (u"oan't", u"can't"), (u"oan'tjust", u"can't just"), (u'objecl', u'object'), (u'occultpowerand', u'occult power and'), (u'Ocps', u'Oops'), (u'ofa', u'of a'), (u'ofajudge', u'of a judge'), (u'ofall', u'of all'), (u'Ofall', u'Of all'), (u'ofBedford', u'of Bedford'), (u'ofcourse', u'of course'), (u'Ofcourse', u'Of course'), (u'ofeach', u'of each'), (u'ofeither', u'of either'), (u"Offioer's", u"Officer's"), (u'ofFrance', u'of France'), (u'offreedom', u'of freedom'), (u'offthe', u'off the'), (u'offthis', u'off this'), (u'offto', u'off to'), (u'offun', u'of fun'), (u'ofguy', u'of guy'), (u'Ofhce', u'Office'), (u'ofhis', u'of his'), (u'ofHis', u'of His'), (u'ofhoneybees', u'of honeybees'), (u'ofit', u'of it'), (u'ofjam', u'of jam'), (u'OFJOAN', u'OF JOAN'), (u'ofjoy', u'of joy'), (u'ofjunior', u'of junior'), (u'ofme', u'of me'), (u'ofmead', u'of mead'), (u'ofmicroinjections', u'of microinjections'), (u'ofmy', u'of my'), (u'ofNew', u'of New'), (u"ofNorris'", u"of Norris'"), (u'ofopinions', u'of opinions'), (u'ofour', u'of our'), (u'ofpeopla', u'of people'), (u'ofthat', u'of that'), (u'ofthe', u'of the'), (u'Ofthe', u'Of the'), (u'oftheir', u'of their'), (u'ofthem', u'of them'), (u"ofthem's", u"of them's"), (u'ofthemselves', u'of themselves'), (u'ofthere', u'of there'), (u'ofthese', u'of these'), (u'ofthings', u'of things'), (u'ofthis', u'of this'), (u'ofthlngs', u'of things'), (u'ofthose', u'of those'), (u'ofuse', u'of use'), (u'ofwashington', u'of Washington'), (u'ofyou', u'of you'), (u'ofyour', u'of your'), (u'OId', u'Old'), (u'OIsson', u'Olsson'), (u'Ok3Y', u'Okay'), (u'okaY', u'okay'), (u'OkaY', u'Okay'), (u'OKaY', u'Okay'), (u'OKGY', u'Okay'), (u'Ol<', u'Ole'), (u'oldAdolfon', u'old Adolf on'), (u'onboard', u'on board'), (u'onIy', u'only'), (u'onIything', u'only thing'), (u'onJanuaw', u'on January'), (u'onlyjust', u'only just'), (u'Onyinal', u'Original'), (u'oomprise', u'comprise'), (u'oonstitution', u'constitution'), (u"oouldn't", u"couldn't"), (u"oould've", u"could've"), (u"oousin's", u"cousin's"), (u'opiimistically', u'optimistically'), (u'ora', u'or a'), (u'orfall', u'or fall'), (u'orglory', u'or glory'), (u'orjust', u'or just'), (u'Orjust', u'Or just'), (u'Orthat', u'Or that'), (u'orwould', u'or would'), (u'Orwould', u'Or would'), (u'Othenzvise', u'Otherwise'), (u'our joumey', u'our journey'), (u'ourbrave', u'our brave'), (u'ourfathers', u'our fathers'), (u'ourgirlon', u'our girl on'), (u'Ourgoal', u'Our goal'), (u'Ourguy', u'Our guy'), (u"ourj0b's", u"our job's"), (u"Ourj0b's", u"Our job's"), (u'ourjobs', u'our jobs'), (u"ourjob's", u"our job's"), (u"Ourjob's", u"Our job's"), (u'ourjoumey', u'our journey'), (u'ourphotos', u'our photos'), (u'ourv\\/ay', u'our way'), (u"outlool<'s", u"outlook's"), (u'overme', u'over me'), (u'overthe', u'over the'), (u'overthere', u'over there'), (u'p/ace', u'place'), (u'P/ease', u'Please'), (u'p_m_', u'p.m.'), (u'P\xb0P$', u'Pops'), (u'PANUNG', u'PANTING'), (u'pclnt', u'point'), (u'pclnts', u'points'), (u'pe0pIe', u'people'), (u'Perrut_', u'Perrut.'), (u'Persona/4/', u'Personally'), (u'Persona/y', u'Personally'), (u'persors', u"person's"), (u'PIain', u'Plain'), (u'PIease', u'Please'), (u'PIeasure', u'Pleasure'), (u'PIus', u'Plus'), (u'pleasurlng', u'pleasuring'), (u'POIe', u'Pole'), (u'Polynes/ans', u'Polynesians'), (u'poorshowing', u'poor showing'), (u'popsicle', u'Popsicle'), (u'Presidenfs', u"President's"), (u'probablyjust', u'probably just'), (u'puIIing', u'pulling'), (u'Putyourhand', u'Put your hand'), (u'Qh', u'Oh'), (u'QkaY', u'Okay'), (u'Qpen', u'Open'), (u'QUYS', u'GUYS'), (u'_QW', u'Aw'), (u'r/ght', u'right'), (u'ralnbow', u'rainbow'), (u'ratherjump', u'rather jump'), (u'ratherjust', u'rather just'), (u'Rcque', u'Roque'), (u'rcscucd', u'rescued'), (u'rea/', u'real'), (u'readytolaunchu', u'ready to launch...'), (u'reaHy', u'really'), (u'ReaHy', u'Really'), (u'reallyjust', u'really just'), (u'reallymiss', u'really miss'), (u'reallytalked', u'really talked'), (u'reallythink', u'really think'), (u'reallythinkthis', u'really think this'), (u'rememberthem', u'remember them'), (u'reoalibrated', u'recalibrated'), (u'retum', u'return'), (u'rhfluence', u'influence'), (u'rightdown', u'right down'), (u'roadyou', u'road you'), (u'RUMBUNG', u'RUMBLING'), (u's/uggikh', u'sluggish'), (u'S0', u'So'), (u'S1oW1y', u'Slowly'), (u'saidyou', u'said you'), (u"sayeverything's", u"say everything's"), (u'saynothing', u'say nothing'), (u'saythat', u'say that'), (u'sc', u'so'), (u'scientihc', u'scientific'), (u'SCREAIVHNG', u'SCREAMING'), (u'sCREAlvllNG', u'SCREAMING'), (u'SCREAlvllNG', u'SCREAMING'), (u'scund', u'sound'), (u"S'EOp", u'Stop'), (u'severa/parents', u'several parents'), (u'sfill', u'still'), (u'S\ufb02ence', u'Silence'), (u'shallrise', u'shall rise'), (u'sHATTERING', u'SHATTERING'), (u'shcws', u'shows'), (u'Shdsjust', u"She's just"), (u'She`s', u"She's"), (u'She\u2018II', u"She'll"), (u"she'II", u"she'll"), (u"She'II", u"She'll"), (u"she'Il", u"she'll"), (u'Shejust', u'She just'), (u"she'lI", u"she'll"), (u'Shoofing', u'Shooting'), (u'ShOp', u'shop'), (u'shortyears', u'short years'), (u'shou/dn', u'shouldn\u2019t'), (u'shou\ufb01ng', u'shouting'), (u'Shou\ufb02ng', u'Shouting'), (u'shouldnt', u"shouldn't"), (u'Shouldrt', u"Shouldn't"), (u'shouldrt', u"shouldn't"), (u"Shs's", u"She's"), (u'SHUDDERWG', u'SHUDDERING'), (u'Shutup', u'Shut up'), (u'SIGH$', u'SIGHS'), (u'signifcance', u'significance'), (u'Sincc', u'Since'), (u'sistervvill', u'sister will'), (u'Skarsg\xe9rd', u'Skarsg\xe5rd'), (u'slcsHs', u'SIGHS'), (u'slGHINcs', u'SIGHING'), (u'slGHING', u'SIGHING'), (u'slNGING', u'SINGING'), (u'slzzLING', u'SIZZLING'), (u'smarfest', u'smartest'), (u'Smiih', u'Smith'), (u'so/id', u'solid'), (u'SoBl3lNG', u'SOBBING'), (u'soemtimes', u'sometimes'), (u'Sojust', u'So just'), (u'soldierl', u'soldier!'), (u'somethlng', u'something'), (u"somethlng's", u"something's"), (u"somez'/7/ng", u'something'), (u'somthing', u'something'), (u'sumthing', u'something'), (u'sou/', u'soul'), (u'SoundofMusic', u'Sound of Music'), (u'SP/ash', u'Splash'), (u'SPEAK/NG', u'SPEAKING'), (u'speII', u'spell'), (u"speII's", u"spell's"), (u'Spendourtime', u'Spend our time'), (u'sQUA\\/\\/KING', u'SQUAWKING'), (u'StAnton', u'St Anton'), (u'stealsjeans', u'steals jeans'), (u'StilI', u'Still'), (u'Stilldesperatelyseeking', u'Still desperately seeking'), (u'stlll', u'still'), (u'sToPs', u'STOPS'), (u'storyl', u'story!'), (u'Stubbom', u'Stubborn'), (u'su/faces', u'surfaces'), (u'suffocaiing', u'suffocating'), (u'summerjob', u'summer job'), (u'Summerjust', u'Summer just'), (u'sun/ive', u'survive'), (u'superiorman', u'superior man'), (u'sur\ufb02aces', u'surfaces'), (u't/ying', u'trying'), (u'T0', u'To'), (u'T00', u'Too'), (u'ta/ks', u'talks'), (u'taiked', u'talked'), (u'talkto', u'talk to'), (u'Talkto', u'Talk to'), (u'talktonight', u'talk tonight'), (u'tampax', u'Tampax'), (u'tc', u'to'), (u'tcday', u'today'), (u'tcrturing', u'torturing'), (u'tcuch', u'touch'), (u'te//', u'tell'), (u'tearjust', u'tear just'), (u'tellsjokes', u'tells jokes'), (u'tellyou', u'tell you'), (u'terriers_', u'terriers.'), (u'th/nk', u'think'), (u'THEPASSION', u'THE PASSION'), (u'thafs', u"that's"), (u'Thafs', u"That's"), (u"Thai's", u"That's"), (u"Thal's", u"That's"), (u'thankyou', u'thank you'), (u'Thankyou', u'Thank you'), (u'thatconverts', u'that converts'), (u'thatgoes', u'that goes'), (u"that'II", u"that'll"), (u"That'II", u"That'll"), (u'thatjob', u'that job'), (u'thatjunk', u'that junk'), (u'thatjust', u'that just'), (u'thatleads', u'that leads'), (u"Thatl'm", u"That I'm"), (u"that's just", u"that's just"), (u'Thatsand', u'That sand'), (u"that'sjust", u"that's just"), (u"That'sjust", u"That's just"), (u'Thc', u'The'), (u'theirface', u'their face'), (u'theirfeet', u'their feet'), (u'theirfury', u'their fury'), (u'thejaw', u'the jaw'), (u'thejoint', u'the joint'), (u'thejudge', u'the judge'), (u'thejudges', u'the judges'), (u'Thejudges', u'The judges'), (u'thejury', u'the jury'), (u'Thelook', u'The look'), (u'Therds', u"There's"), (u"There'II", u"There'll"), (u"There'Il", u"There'll"), (u"There'lI", u"There'll"), (u"They'/'e", u"They're"), (u"they/'II", u"they'll"), (u'They/re', u"They're"), (u"They/'re", u"They're"), (u"they'II", u"they'll"), (u"they'Il", u"they'll"), (u'theyjust', u'they just'), (u'Theyjust', u'They just'), (u"they'lI", u"they'll"), (u"They'lI", u"They'll"), (u'theyre', u"they're"), (u'theysay', u'they say'), (u'thinkthat', u'think that'), (u"this'II", u"this'll"), (u'thlngs', u'things'), (u'Thlnkthls', u'Think this'), (u'thls', u'this'), (u"thore's", u"there's"), (u"Thore's", u"There's"), (u'Thorjust', u'Thor just'), (u"thoughtl'dletyou", u"thought I'd let you"), (u'tnatjust', u'that just'), (u"tnat's", u"that's"), (u"Tnat's", u"That's"), (u"Tnere'll", u"There'll"), (u'to//et', u'toilet'), (u'To//S', u'Tolls'), (u"todayl'd", u"today I'd"), (u'togelher', u'together'), (u'togethen', u'together'), (u'tojoin', u'to join'), (u'tojudge', u'to judge'), (u'toldyou', u'told you'), (u'tomorrovv', u'tomorrow'), (u'Tonighfsjust', u"Tonight's just"), (u'totake', u'to take'), (u'totalk', u'to talk'), (u'tothat', u'to that'), (u'tothe', u'to the'), (u'Towef', u'Tower'), (u'Tr/ck/ing', u'Trickling'), (u'Traitur', u'Traitor'), (u'tv\\/o', u'two'), (u'tvvelve', u'twelve'), (u'Tvvelve', u'Twelve'), (u'tvventy', u'tvventy'), (u'Tvventy', u'Tvventy'), (u'tvvo', u'two'), (u'Tvvo', u'Two'), (u'twc', u'two'), (u'unconhrmed', u'unconfirmed'), (u'underthat', u'under that'), (u'underthe', u'under the'), (u'underthese', u'under these'), (u'underyour', u'under your'), (u'unfilyou', u'until you'), (u"Unfon'unate/y", u'Unfortunately'), (u'Uninnabited', u'Uninhabited'), (u'untilApril', u'until April'), (u'untilyou', u'until you'), (u'upthinking', u'up thinking'), (u'upto', u'up to'), (u'V\\/ait___', u'Wait...'), (u'v\\/as', u'was'), (u'V\\/as', u'Was'), (u'V\\/e', u'We'), (u"v\\/eek's", u"week's"), (u'V\\/eird_', u'Weird.'), (u'V\\/ell', u'Well'), (u'V\\/hat', u'what'), (u"V\\/hen'll", u"When'll"), (u'V\\/ho', u'Who'), (u"v\\/ho'll", u"who'll"), (u'v\\/Hoops', u'Whoops'), (u"v\\/ho's", u"who's"), (u"V\\/ho's", u"Who's"), (u'V\\/hy', u'Why'), (u'v\\/ith', u'with'), (u"v\\/on't", u"won't"), (u'V\\fith', u'With'), (u'V\\fithin', u'Within'), (u'valedictolian', u'valedictorian'), (u'vcice', u'voice'), (u've/y', u'very'), (u'veiy', u'very'), (u'V\xe9ry', u'Very'), (u'versioin', u'version'), (u'vi/ay', u'way'), (u'visitjails', u'visit jails'), (u"Viva/di's", u"Vivaldi's"), (u'vlll', u'vill'), (u'Voil\xe1', u'Voil\xe0'), (u'Voil\xe9', u'Voil\xe0'), (u'vvasjust', u'was just'), (u"VVasn't", u"Wasn't"), (u'vvay', u'way'), (u'VVe', u'We'), (u"VVe'II", u"We'll"), (u"VVe'll", u"We'll"), (u'Vvelooked', u'We looked'), (u"VVe're", u"We're"), (u"VVe've", u"We've"), (u'VVhat', u'What'), (u"VVhat's", u"What's"), (u"VVhat'S", u"What's"), (u'VVhen', u'When'), (u"'v'Vhere's", u"Where's"), (u'VVhip', u'Whip'), (u'vvHooPING', u'WHOOPING'), (u'VvHooPING', u'WHOOPING'), (u'VVhy', u'Why'), (u'VVill', u'Will'), (u'VVinters', u'Winters'), (u'vvlND', u'WIND'), (u"w\xa4n't", u"won't"), (u'W9', u'We'), (u'waht', u'want'), (u'waierfall', u'waterfall'), (u'walkjust', u'walk just'), (u'wallplant', u'wall plant'), (u'wannajump', u'wanna jump'), (u'wantyou', u'want you'), (u'Warcontinues', u'War continues'), (u'wasjennifer', u'was Jennifer'), (u'wasjust', u'was just'), (u'wasrt', u"wasn't"), (u'Wasrt', u"Wasn't"), (u'wayl', u'way I'), (u'wayround', u'way round'), (u'wclf', u'wolf'), (u'wcman', u'woman'), (u'wcmen', u'women'), (u"wcn't", u"won't"), (u'wcrse', u'worse'), (u'wculd', u'would'), (u'We//', u'Well'), (u'We/came', u'Welcome'), (u'we/come', u'welcome'), (u'We/come', u'Welcome'), (u'We/I', u'Well'), (u'weekendjust', u'weekend just'), (u'werert', u"weren't"), (u'Werert', u"Weren't"), (u"we'II", u"we'll"), (u"We'II", u"We'll"), (u"we'Il", u"we'll"), (u"We'Il", u"We'll"), (u'wejust', u'we just'), (u"we'lI", u"we'll"), (u"We'rejust", u"We're just"), (u"We'ro", u"We're"), (u"We'Ve", u"We've"), (u'wh/p', u'whip'), (u'Wh\xb0ops', u'Whoops'), (u'Whafs', u"What's"), (u'Whatam', u'What am'), (u'Whatare', u'What are'), (u'Whateverwe', u'Whatever we'), (u"What'II", u"What'll"), (u'Whatis', u'What is'), (u'whatjust', u'what just'), (u'Whatl', u'What I'), (u'whatshe', u'what she'), (u'whatwe', u'what we'), (u"Whc's", u"Who's"), (u'Whcse', u'Whose'), (u'wHlsPERs', u'WHISPERS'), (u'wi//', u'will'), (u'wil/', u'will'), (u'Wil/', u'Will'), (u'wilI', u'will'), (u'willbe', u'will be'), (u'willhire', u'will hire'), (u'willneverknow', u'will never know'), (u'willyou', u'will you'), (u'wlfe', u'wife'), (u"wlfe's", u"wife's"), (u'wlth', u'with'), (u"wnat's", u"what's"), (u'Wno', u'Who'), (u'Wo/f', u'Wolf'), (u'wo\ufb02d', u'world'), (u"WOI'1't", u"won't"), (u'wondernobody', u'wonder nobody'), (u"won'T", u"won't"), (u"won'tanswerme", u"won't answer me"), (u"won'tforget", u"won't forget"), (u"won'tletitbring", u"won't let it bring"), (u"Wo're", u"We're"), (u'worfd', u'world'), (u"won'th", u'worth'), (u"won'thwhile", u'worthwhile'), (u'workyou', u'work you'), (u"wouIdn't", u"wouldn't"), (u"wouldn'!", u"wouldn't"), (u'Wouldrt', u"Wouldn't"), (u"wr/'2'/ng", u'writing'), (u'writign', u'writing'), (u'wrcng', u'wrong'), (u'wuuld', u'would'), (u'_Yay', u'Yay'), (u"Y\xa4u'II", u"You'll"), (u"Y\xa4u'll", u"You'll"), (u"y\xa4u're", u"you're"), (u"Y\xa4u're", u"You're"), (u"y\xa4u've", u"you've"), (u'Y0', u'Yo'), (u'y0LI', u'you'), (u"y0u'II", u"you'll"), (u"Y0u'rc", u"You're"), (u"Y0u're", u"You're"), (u"Y0u've", u"You've"), (u'yaming', u'yarning'), (u'yaurparents', u'your parents'), (u'ycu', u'you'), (u"ycu'd", u"you'd"), (u'ycur', u'your'), (u"Ycu're", u"You're"), (u'Ycursins', u'Your sins'), (u'YEI_I_', u'YELL'), (u'YELL$', u'YELLS'), (u'yigg/mg', u'giggling'), (u'Yigg/mg', u'giggling'), (u'yoLI', u'you'), (u'yOu', u'you'), (u'yOU', u'you'), (u'you`re', u"you're"), (u"you'II", u"you'll"), (u"You'II", u"You'll"), (u"You'Il", u"You'll"), (u'youjack', u'you jack'), (u'youjoin', u'you join'), (u'Youjoin', u'You join'), (u'youjust', u'you just'), (u"You'lI", u"You'll"), (u'youngsterlike', u'youngster like'), (u'youpick', u'you pick'), (u"you'ra", u"you're"), (u'Yourattention', u'Your attention'), (u'yourautomobile', u'your automobile'), (u"You'rejustjealous", u"You're just jealous"), (u'yourextra', u'your extra'), (u'yourfather', u'your father'), (u'yourhand', u'your hand'), (u'yourhusband', u'your husband'), (u'yourjewelry', u'your jewelry'), (u'yourjob', u'your job'), (u'Yourjob', u'Your job'), (u'yourjob_', u'your job.'), (u'yourjockey', u'your jockey'), (u'yourjury', u'your jury'), (u'yourname', u'your name'), (u'Yourpackage', u'Your package'), (u'yourpackage', u'your package'), (u"you'ro", u"you're"), (u'yourpoorleg', u'your poor leg'), (u'yourvveak', u'your weak'), (u"you'va", u"you've"), (u"You'va", u"You've"), (u'youWlneversee', u"you'll never see"), (u'yQu', u'you'), (u'YQu', u'You'), (u"yQu'_7", u'you?'), (u'yummY', u'yummy'), (u'yuu', u'you'), (u'Yuu', u'You'), (u"Yuu've", u"You've"), (u"z'housand", u'thousand'), (u'zlPPING', u'ZIPPING'), (u'Ifslocked', u"It's locked"), (u'nightjust', u'night just'), (u'dayjourney', u'day journey'), (u'Ourjob', u'Our job'), (u'IunCh', u'lunch'), (u'nieCe', u'niece'), (u'giVes', u'gives'), (u'wantto', u'want to'), (u'besttoday', u'best today'), (u'NiCe', u'Nice'), (u'oftravelling', u'of travelling'), (u'oftwo', u'of two'), (u'ALl', u'ALI'), (u'afterparty', u'after-party'), (u'welL', u'well.'), (u'theirjob', u'their job'), (u"lfhe's", u"If he's"), (u'babyjesus', u'baby Jesus'), (u'shithousejohn', u'shithouse John'), (u'jesus', u'Jesus'), (u'withjesus', u'with Jesus'), (u'Gojoin', u'Go join'), (u'Adaughter', u'A daughter'), (u'talkwith', u'talk with'), (u'anyjournals', u'any journals'), (u"L'mjewish", u"I'm Jewish"), (u'arejust', u'are just'), (u'soundjust', u'sound just'), (u"ifl'm", u"if I'm"), (u'askyou', u'ask you'), (u'ordinarywoman', u'ordinary woman'), (u'andjunkies', u'and junkies'), (u'isjack', u'is Jack'), (u'helpyou', u'help you'), (u'thinkyou', u'think you'), (u'Lordjesus', u'Lord Jesus'), (u'injuvy', u'in juvy'), (u'thejets', u'the jets'), (u'ifGod', u'if God'), (u'againstjewish', u'against Jewish'), (u'ajunkie', u'a junkie'), (u'dearjesus', u'dear Jesus'), (u'hearyour', u'hear your'), (u'takeyears', u'take years'), (u'friendjean', u'friend Jean'), (u'Fatherjohn', u'Father John'), (u'youjean', u'you Jean'), (u'hearyou', u'hear you'), (u'Ifshe', u'If she'), (u"didn'tjust", u"didn't just"), (u'IfGod', u'If God'), (u'notjudge', u'not judge'), (u'andjudge', u'and judge'), (u'OKBY', u'Okay'), (u'myjourney', u'my journey'), (u'yourpremium', u'your premium'), (u"we'rejust", u"we're just"), (u'Iittlejokes', u'little jokes'), (u'Iifejust', u'life just'), (u'Andjust', u'And just'), (u'ofThe', u'of The'), (u'lifejust', u'life just'), (u'AIice', u'Alice'), (u'lnternationalAirport', u'International Airport'), (u'yourbody', u'your body'), (u'DollarBaby', u'Dollar Baby'), (u'ofjonesing', u'of jonesing'), (u'yourpanties', u'your panties'), (u'offforme', u'off for me'), (u'pantyparty', u'panty party'), (u'everhit', u'ever hit'), (u'theirhomes', u'their homes'), (u'AirForce', u'Air Force'), (u'yourhead', u'your head'), (u'betterbe', u'better be'), (u'myparty', u'my party'), (u'disasterlockdown', u'disaster lockdown'), (u"Ifpot's", u"If pot's"), (u'ifmy', u'if my'), (u'yourmoney', u'your money'), (u'Potterfan', u'Potter fan'), (u'Hermionejust', u'Hermione just'), (u'ofourshit', u'of our shit'), (u'showyou', u'show you'), (u'answernow', u'answer now'), (u'theirsjust', u'theirs just'), (u'BIackie', u'Blackie'), (u'SIeep', u'Sleep'), (u'foryour', u'for your'), (u'oryour', u'or your'), (u'forArthur', u'for Arthur'), (u'CIamp', u'Clamp'), (u'CIass', u'Class'), (u'CIose', u'Close'), (u'GIove', u'Glove'), (u'EIIen', u'Ellen'), (u'PIay', u'Play'), (u'PIace', u'Place'), (u'EIgyn', u'Elgyn'), (u'AIert', u'Alert'), (u'CIaus', u'Claus'), (u'CIimb', u'Climb'), (u"military'II", u"military'll"), (u'anylonget', u'any longer'), (u'yourlife', u'your life'), (u"Yourbitch'IIgetyou", u"Your bitch'll get you"), (u'yourdick', u'your dick'), (u'Tellyourbitch', u'Tell your bitch'), (u'rememberyou', u'remember you'), (u'newface', u'new face'), (u'Butyou', u'But you'), (u"don'tyou", u"don't you"), (u'yourlives', u'your lives'), (u'Iovedher', u'loved her'), (u'reallydid', u'really did'), (u'firstperson', u'first person'), (u'mybest', u'my best'), (u'Justgive', u'Just give'), (u'AIong', u'Along'), (u'atyourbody', u'at your body'), (u'myhands', u'my hands'), (u'sayhe', u'say he'), (u'mybooty', u'my booty'), (u'yourbooty', u'your booty'), (u'yourgirl', u'your girl'), (u'yourlegs', u'your legs'), (u'betterifthey', u'better if they'), (u'manybeautiful', u'many beautiful'), (u'contactpolice', u'contact police'), (u'numberbelow', u'number below'), (u'biggestproblem', u'biggest problem'), (u'Itgave', u'It gave'), (u'everybodykind', u'everybody kind'), (u'theyhad', u'they had'), (u'knowherlast', u'know her last'), (u'herhearing', u'her hearing'), (u'othermembers', u'other members'), (u'BIing', u'Bling'), (u'CIyde', u'Clyde'), (u'foundguilty', u'found guilty'), (u'fouryears', u'four years'), (u'countyjail', u'county jail'), (u'yearin', u'year in'), (u'theirrole', u'their role'), (u'manybottles', u'many bottles'), (u"can'tpronounce", u"can't pronounce"), (u'manybowls', u'many bowls'), (u'ofthatgreen', u'of that green'), (u'manyjoyrides', u'many joyrides'), (u'Superrich', u'Super rich'), (u'Iprefer', u'I prefer'), (u'Theymust', u'They must'), (u'whatyou', u'what you'), (u"I'IIjump", u"I'll jump"), (u'nobodyknow', u'nobody know'), (u'neverknew', u'never knew'), (u'EIectronica', u'Electronica'), (u'AIarm', u'Alarm'), (u'getyourman', u'get your man'), (u'sayyou', u'say you'), (u'getyour', u'get your'), (u'Fuckyou', u'Fuck you'), (u'Whyyou', u'Why you'), (u'butyoujust', u'but you just'), (u'forgetyourname', u'forget your name'), (u'Whatyou', u'What you'), (u"Co/'ncidenta//y", u'Coincidentally'), (u'GIad', u'Glad'), (u'RachelMarron', u'Rachel Marron'), (u"She'llgive", u"She'll give"), (u'presidentialsuite', u'presidential suite'), (u'andgentlemen', u'and gentlemen'), (u'willnot', u'will not'), (u'ourproducers', u'our producers'), (u"Ifshe's", u"If she's"), (u'CIock', u'Clock'), (u'Ishould', u'I should'), (u"I'llgo", u"I'll go"), (u'maypass', u'may pass'), (u'andprotecting', u'and protecting'), (u'BIessed', u'Blessed'), (u'CIean', u'Clean'), (u'SIave', u'Slave'), (u'AIi', u'Ali'), (u'AIIah', u'Allah'), (u'AIIahu', u'Allahu'), (u'CIick', u'Click'), (u'BIast', u'Blast'), (u'AIlah', u'Allah'), (u'SIow', u'Slow'), (u'theirpolicies', u'their policies'), (u'Orperhaps', u'Or perhaps'), (u'ofsex', u'of sex'), (u'forpleasure', u'for pleasure'), (u'ourpower', u'our power'), (u'Yourpiece', u'Your piece'), (u'Offioers', u'Officers'), (u'oondesoended', u'condescended'), (u'myseif', u'myself'), (u"let'sjust", u'let\u2019s just'), (u'yourway', u'your way'), (u'An9TY', u'Angry'), (u'ourjourney', u'our journey'), (u'LuCY', u'Lucy'), (u"\\'m", u'I\u2019m'), (u'CEDR/C', u'CEDRIC'), (u'lsaac', u'Isaac'), (u'FIy', u'Fly'), (u'Ionger', u'longer'), (u'Iousy', u'lousy'), (u'Iosing', u'losing'), (u"They'II", u"They'll"), (u'yourpaws', u'your paws'), (u'littie', u'little'), (u"It'lljust", u"It'll just"), (u'AIso', u'Also'), (u'Iisten', u'listen'), (u'suPPosed', u'supposed'), (u'somePIace', u'someplace'), (u'exPIain', u'explain'), (u'Iittle', u'little'), (u'StoP', u'Stop'), (u'AIways', u'Always'), (u'Iectures', u'lectures'), (u'Iow', u'low'), (u'Ieaving', u'leaving'), (u'Ietting', u'letting'), (u'Iistening', u'listening'), (u'Iecture', u'lecture'), (u'Iicking', u'licking'), (u'Iosses', u'losses'), (u'PIeased', u'Pleased'), (u'ofburglaries', u'of burglaries'), (u"He'sjust", u"He's just"), (u'mytrucktoo', u'my truck too'), (u'nowwhat', u'now what'), (u'yourfire', u'your fire'), (u"herwhat's", u"her what's"), (u'hearthat', u'hear that'), (u'oryou', u'or you'), (u'preferjournalist', u'prefer journalist'), (u'CIaw', u'Claw'), (u'Ifour', u'If our'), (u'lron', u'Iron'), (u"It'syour", u"It's your"), (u'lfstill', u'If still'), (u'forjoining', u'for joining'), (u'foryears', u'for years'), (u'Ifit', u'If it'), (u'notjump', u'not jump'), (u'ourproblem', u'our problem'), (u'yourprofile', u'your profile'), (u'ifJanine', u'if Janine'), (u'forpreventative', u'for preventative'), (u'whetherprotest', u'whether protest'), (u'Ifnot', u'If not'), (u'ourpeople', u'our people'), (u'offmy', u'off my'), (u'forproviding', u'for providing'), (u'hadjust', u'had just'), (u'nearyou', u'near you'), (u'whateveryou', u'whatever you'), (u'hourputs', u'hour puts'), (u'timejob', u'time job'), (u'overyour', u'over your'), (u'orpermanent', u'or permanent'), (u'createjobs', u'create jobs'), (u"I'vejust", u"I've just"), (u'peoplejobs', u'people jobs'), (u'dinnerpail', u'dinner pail'), (u'hasjumped', u'has jumped'), (u'theirprivacy', u'their privacy'), (u'AIl', u'All'), (u'ofserious', u'of serious'), (u'yourprofessional', u'your professional'), (u'poiitical', u'political'), (u'tojump', u'to jump'), (u'iives', u'lives'), (u'eiections', u'elections'), (u'militaryjuntas', u'military juntas'), (u'nojoke', u'no joke'), (u'yourpresidency', u'your presidency'), (u'ofmilitaryjuntas', u'of military juntas'), (u'Ourproposal', u'Our proposal'), (u'LeBIanc', u'LeBlanc'), (u'KIaus', u'Klaus'), (u'yourpussy', u'your pussy'), (u'lNTERVIEWER', u'INTERVIEWER'), (u'lNAUDIBLE', u'INAUDIBLE'), (u'SImpsons', u'Simpsons'), (u'anotherjob', u'another job'), (u'lfthere', u'If there'), (u'descentinto', u'descent into'), (u'ofthathere', u'of that here'), (u'ofway', u'of way'), (u'yourseat', u'your seat'), (u'allyou', u'all you'), (u'Allyou', u'All you'), (u'yourass', u'your ass'), (u'Yourbutt', u'Your butt'), (u'iustiiggle', u'just jiggle'), (u'iust', u'just'), (u'CSi', u'CSI'), (u'affernoon', u'afternoon'), (u'orpersecution', u'or persecution'), (u'theirpetty', u'their petty'), (u'Fourpercent', u'Four percent'), (u'fourpercent', u'four percent'), (u'willjust', u'will just'), (u"Ifyou're", u"If you're"), (u'ourplanet', u'our planet'), (u'lsolation', u'Isolation'), (u'yourprimitive', u'your primitive'), (u'yourplanet', u'your planet'), (u'matteryour', u'matter your'), (u'Yourplace', u'Your place'), (u'andjustice', u'and justice'), (u'anotherpart', u'another part'), (u'confiict', u'conflict'), (u'growingjeopardy', u'growing jeopardy'), (u'hasjust', u'has just'), (u'havejust', u'have just'), (u'herselfinto', u'herself into'), (u'ifnecessary', u'if necessary'), (u"we'vejust", u"we've just"), (u'tojust', u'to just'), (u'yourjudgment', u'your judgment'), (u'yourjeans', u'your jeans'), (u'Youjust', u'You just'), (u'ajanitor', u'a janitor'), (u'FIattery', u'Flattery'), (u'myjournal', u'my journal'), (u'myjudgment', u'my judgment'), (u'offofmy', u'off of my'), (u'offyour', u'off your'), (u'ofgood', u'of good'), (u'ofguilty', u'of guilty'), (u'ofhaving', u'of having'), (u'ofheart', u'of heart'), (u'ofhonor', u'of honor'), (u'oflove', u'of love'), (u'ofmankind', u'of mankind'), (u'ofmany', u'of many'), (u'ofnormal', u'of normal'), (u'ofpeople', u'of people'), (u'ofpower', u'of power'), (u'ofsuch', u'of such'), (u'peoplejust', u'people just'), (u"They'rejust", u"They're just"), (u'tojeopardize', u'to jeopardize'), (u'Yourplaces', u'Your places'), (u'yourposition', u'your position'), (u'yourselfa', u'yourself a'), (u'yourselfright', u'yourself right'), (u'thejob', u'the job'), (u'thejanitors', u'the janitors'), (u'alljust', u'all just'), (u"forAmerica's", u"for America's"), (u'Forpencils', u'For pencils'), (u'forpondering', u'for pondering'), (u'handwrittenjournals', u'handwritten journals'), (u'herpursuit', u'her pursuit'), (u'ofjust', u'of just'), (u'oflanding', u'of landing'), (u'oflife', u'of life'), (u'outjust', u'out just'), (u'Thejoke', u'The joke'), (u'ourpatient', u'our patient'), (u"oryou're", u"or you're"), (u'ofyourself', u'of yourself'), (u'poweryour', u'power your'), (u'Ofmy', u'Of my'), (u'EIlen', u'Ellen'), (u"Don'tget", u"Don't get"), (u'tellme', u'tell me'), (u'ofdecision', u'of decision'), (u'itgoing', u'it going'), (u'artificialgravity', u'artificial gravity'), (u'shouldknow', u'should know'), (u"Hasn'tgot", u"Hasn't got"), (u'thirdjunction', u'third junction'), (u'somebodypicks', u'somebody picks'), (u'Willyou', u'Will you'), (u"can'tget", u"can't get"), (u'BuZZes', u'Buzzes'), (u"wouldn'tyou", u"wouldn't you"), (u'Wellbelow', u'Well below'), (u"What'dyou", u"What'd you"), (u'decipheredpart', u'deciphered part'), (u"they'llknow", u"they'll know"), (u"ifit's", u"if it's"), (u'ornot', u'or not'), (u'myposition', u'my position'), (u'lndistinct', u'Indistinct'), (u'anybiscuits', u'any biscuits'), (u'Andifyou', u'And if you'), (u'lfwe', u'If we'), (u'yourarm', u'your arm'), (u'lnteresting', u'Interesting'), (u'findit', u'find it'), (u"it'llstart", u"it'll start"), (u'holdit', u'hold it'), (u'ofkilling', u'of killing'), (u'Howyou', u'How you'), (u'lnhales', u'Inhales'), (u'lgot', u'I got'), (u'CIip', u'Clip'), (u"what'II", u"what'll"), (u"road'II", u"road'll"), (u'girI', u'girl'), (u'LIoyd', u'Lloyd'), (u'BIake', u'Blake'), (u'reaI', u'real'), (u'Foryour', u'For your'), (u'yourpublic', u'your public'), (u'LAst', u'Last'), (u'h is', u'his'), (u'He)\u2019', u'Hey'), (u'Ls', u'Is'), (u"al'", u'at'), (u"wail'", u'wait'), (u"III'll", u"I'll"), (u'forthis', u'for this'), (u'Yea h', u'Yeah'), (u'a re', u'are'), (u'He)"', u'Hey'), (u"pan'", u'part'), (u'yea h', u'yeah'), (u'Tun', u'Run'), (u"He)'", u'Hey'), (u"he)'", u'hey'), (u"I'11", u"I'll"), (u'he)"', u'hey'), (u" 're ", u"'re ")]),
+                        'pattern': u'(?um)(\\b|^)(?:\\$COff\\$|\\$ergei|\\$\\\'llOp|\\/\\\'\\/\\/|\\/\\\'\\/I|\\/ennifer|\\/got|\\/have|\\/hope|\\/just|\\/love|\\/\\\'m|\\/mmerse|\\/nsu\\/ts|\\/ong|\\/ook|\\/t\\\'s|\\/\\\'ve|\\\\\\/\\\\\\/e\\\'d|\\\\\\/\\\\\\/e\\\'re|\\\\\\/\\\\\\/e\\\'ve|\\\\\\/\\\\\\/hat|\\\\\\/\\\\\\/here\\\'d|\\\\\\/\\\\\\/hoo|\\\\\\/\\\\\\/hy|\\\\\\/\\\\\\/hy\\\'d|\\\\\\/\\\\le\\\'re|\\\\\\/Ve|\\\\Ne\\\'re|\\\\Nhat\\\'s|\\\\Nhere\\\'s|\\|\\\'mjust|\\\xa4ff|\\\xa4Id|\\\xa4Ids|\\\xa4n|\\\xa4ne|\\\xa4nly|\\\xa4pen|\\\xa4r|\\\xa4rder|\\\xa4ther|\\\xa4ur|\\\xa4ut|\\\xa4ver|\\\xa4wn|\\\u20acV\\\u20acI\\\'y|0\\\'clock|0f|0fEngland|0fft0|0l\\/er|0n|0ne|0ne\\\'s|0r|0rders|0thers\\\'|0ut|0utlaw\\\'s|0utlaws\\\'|0ver|13oos|18oos|195os|1et\\\'s|1o|1oo|1ooth|1oth|2E\\_|2\\\'IST|2\\\'Ist\\_|2o|2oth|3o|3oth|4o|4os|4oth|50rry|5o|5oth|6o|6os|\\\'6os|6oth|7o|\\\'7os|7oth|8o|\\\'8os|8oth|9\\/aim|9o|9oth|9UnShQt|a\\/\\/|a\\/bum|a\\/so|A\\/ways|abcut|aboutjoining|aboutposh|aboutus|aboutyou|accldent|Acool|afier|affraid|Afriend|afterall|afterthe|afulcrum|Afunny|aga\\/nst|ahsolutes|AI\\_I\\_|AIien|AIex|AII|AIIan|AIIow|AIive|ain\\\'tgotno|Ain\\\'tgotno|airstrike|AIVIBULANCE|ajob|ajockey\\_|ajoke|Ajoke|ajoking|al\\/|al\\/en|alittle|allgasp|alljustforshow|aln\\\'t|alot|Alot|An5wer|Andit|Andit\\\'s|andl|andlaughs|andleave|andthe|andyou|Andyou|ANNOUNC\\/NG|anotherstep|ANSWER\\/NG|answerwhat|antiquejoke|anyhcdy\\\'s|Anyidea|anyone\\\'s\\_|apejust|ARABlc|aren\\\'t\\_|arerl\\\'t|Arnsteln\\\'s|atleast|Atough|Awhole|awoman|Awoman|barelytalked|bcat|Bcllvla|bcmb|bcmbs|be\\/\\/y|becuase|Beep\\/\\\'ng|bejumpy|besldes|bestfriend|bestguy|bestjob|BIack|BIess|bigos\\_\\_\\_|BIame|BIind|BIood|BIue|BLOVVS|blowholel|blt|Bo99|bodiedyoung|breakf\\\xe9wtl|bulldozlng|butjust|butl|Butl|butljust|Butljustcan\\\'tgetenough|Butyou\\\'re|buythem|buyyou|byjust|bythe|C\\/latter\\/\\\'\\/7g|ca\\/\\/\\/ng|ca\\/I|call\\/ng|callyou|can\\*t|can\\\'i|can\\\'I|canlgetyou|cannotchange|cannut|can\\\'T|can\\\'t\\_|can\\\'tjust|can\\\'tletgo|Car0l|Carhorn|carrled|Ccug|Ccugs|Ccver|cellularchange|cff|cfycu|cfycur|Ch\\/rping|chaletgirl|changejobs|Charliejust|Chatter\\/\\\'rtg|CHATTERWG|Chequeredlove|cHIRPINcs|chjldishness|chlldrcn|chlldren|chocolatte|Cho\\/r|cHucKl\\_Es|CIark|CIear|circumcised\\_|ckay|cl\\_osEs|CLATTERWG|cn|cne|cnes|Coincidenta\\/\\/y|COm\\\u20ac|comp\\/etey|complainingabout|coms|cond\\/lion|confdence|conhrmed|connrm|Consecutivelyl|COUGH5|CouGHING|couIdn\\\'t|couldjust|couldn\\\'T|couldn\\\'tjust|Couldyou|crappyjob|CRAsHING|crder|Crowdcheers|Cruoially|cther|cuuld|cver|d\\/\\\'dn\\\'t|d\\/squietude|D\\\xa4esn\\\'t|d\\\xa4n\\\'i|d\\\xa4n\\\'t|d\\\xb09|d0|D0|D0asn\\\'t|Dad\\\'\\/\\/|dairyjust|Dar\\/\\/ng|dc|Dcbby|dccsn\\\'t|dcctcr|Dces|dcgs|dcing|dcn\\\'I|dcn\\\'t|Dcn\\\'t|dcughnut|declslons|deedhas|Dehnitely|desewes|desperate\\/\\\xbby|D\\\ufb02nk|DIAl\\_lNcs|didn\\\'\\!|didnt|didn\\\'T|dIdn\\\'t|didn\\\'t\\_|didrft|didrl\\\'t|didyou|divorcing\\_|dld|dldn\\\'t|dlfflcull|dlg|dlsobeyed|doasn\\\'t|Doasn\\\'t|doctoh|Doctor\\_\\_\\_tell|doesnt|doesn\\\'T|doesri\\\'t|doesrt|Doesrt|doit|dojust|don\\*t|donejobs|don\\\'i|don\\\'l|Don\\\'l|Donllook|dont|don\\\'T|don\\\'tcare|don\\\'tjoke|Don\\\'tjudge|don\\\'tjust|Don\\\'tjust|Don\\\'tlet|don\\\'tlhink|don\\\'tpush|Don\\\'tyou|DonWlook|Dooropens|doorshuts|dothat|dothis|Drinkthis|dumbass|dumbto|dun\\\'t|E\\/\\/e|E9YPt|ea\\/\\\'t\\/7|eart\\/7|efi\\\'\\/\\\'c\\/\\\'ent|EN\\<3LlsH|Enjoythe|Erv\\\\\\/an|Erv\\\\\\/an\\\'s|etemity|ev\\/I|eve\\/yone|even\\/body\\\'s|eversay|Everymonth|everythings|Everythirlg\\\'s|Everythlng\\\'s|Everytime|Exac\\\ufb02y|ExacUy\\_|excitedshrieking|ExcLAllvls|exploatation|expreusion|fairthat|Fathef|fatherfigure|FBl|fcrebcdlng|fcreverjudges|fcund|feeleverything|feelsweet|fiam\\/\\\'\\/y|\\\ufb01ngernail|finishedjunior|FIynn|flll|flra|Flylng|Fnends|fo\\/low|fonzvard|fora|Fora|forajob|forAmerica|forNew|forone|forso|Forsuch|forsunburns|forthe|Foryears|foryou|Foudeen|Fou\\\ufb02een|FourSeasons|fr\\/ends|freezerfood|F\\\xfchrerfeels|furthernotice|furyou|G0|g0in9|gamlenias|GAsPING|gc|gcing|gcnna|Gcnna|gct|Gct|genercsity|generosityn|getjust|g\\\ufb02ing|gi\\\ufb02friend|gir\\/|gir\\/s\\\'boarding|giris|gLlyS|glum\\_|gnyone|golng|goodboyand|goodjob|gOt|gotjumped|gotmyfirstinterview|grandjury|greatjob|Greatjobl|grinco|GRoANING|GRUNUNG|gu|gunna|guyjumped|guyjust|gUyS|\\_H6Y\\-|H\\\u20acY|H0we\\\xb7ver|halftheir|hapPY|hasrt|Hasrt|haven\\\'tspokerl|hcle|hcme|hcmes|hcpe|hctel|hcurs|Hcw|he\\/ps|hearjokestonight|hearme|Hefell|he\\\'II|He\\\'II|HeII0|He\\\'Il|Hejust|He\\\'lI|HelIo|hellc|HellO|herboyfr\\/end|herflesh|herfollov\\\\\\/ed|herjob\\_|HerrSchmidt|herwith|HeY\\\xb7|HeyJennifer|hiddsn|hisjunk|Hitlershare|Hlneed|Hnally|Hnishing|HOId|hOIes|HONMNG|honorthe|honoryou|honoryour|Hov\\\\\\/\\\'s|Hov\\\\\\/\\\'S|HovvLING|howit|HoW\\\'s|howto|Hs\\\'s|hurtyou|I\\/erilj\\/|I\\/fe|I\\\\\\/I|I\\\\\\/Ian|I\\\\\\/Iathies|I\\\\\\/Ie|I\\\\\\/Iommy|I\\\\\\/Ir|I\\\\\\/Ir\\.|I\\\\\\/ly|I3EEPING|I3LARING|Iacings|Iaid|Iam|Iand|Ianding|Iast|Iate|Icad|Icading|Ican|Iccked|Icng|Icsing|Icslng|Idid|Ididn\\\'t|Ido|Idon\\\'i|Idon\\\'t|Idon\\\'tthink|I\\\'E\\\'\\$|Ieamed|Ieapt|Iearned|Ieast|Ieave|Ied|Ieft|Ieg\\\'s|Iess|Iet|Iet\\\'s|Iet\\\'sjust|if\\/just|Ifear|Ifeared|Ifeel|ifI\\\'\\|\\||ifI\\\'d|ifI\\\'II|ifI\\\'ll|ifI\\\'m|Ifinally|ifI\\\'ve|ifl|Iforgot|Ifound|ifshe|ifthat\\\'s|ifthe|Ifthe|ifthere\\\'s|Ifthey|ifwe|Ifwe|Ifycu|ifyou|Ifyou|ifyuu|Iget|Igot|Igotta|Igotyou|Iguess|Iguessljust|Ihad|Ihat\\\'s|Ihave|Iheard|ihere\\\'s|ihey\\\'ve|Ihope|ii\\/Iary|ii\\/Ir|ii\\/Ir\\.|ii\\/love|Iife|I\\\'II|Iike|I\\\'Il|Iine|iirst|ii\\\'s|Ii\\\'s|Iiterallyjumped|Ijoined|Ijust|Iknew|Iknow|Ile|Ileft|I\\\'lldo|I\\\'llmake|Ilons|Ilove|I\\\'mjust|Inconceivablel|infact|Infact|in\\\ufb02uence|infront|injust|insc\\\ufb01p\\\ufb01ons|insolencel|intc|internationaljudges|inthe|Iockdown|Iong|Iongships|Iook|Iookjust|Iooklng|Iooks|Ioose|Iord\\\'s|Iose|Ioser|Ioss|Iost|Iot|Iot\\\'s|Iousyjob|Iove|Ioves|Iowlife|Ipaid|Iquit|Ireallythinkthis|I\\\'rn|Isaw|Isayt\\/1e|isjust|isn\\\'i|isn\\\'t\\_|Isthis|Istill|Istumblod|Itake|itdown|Iteach|Itfeels|ithave|Ithink|Ithinkthat|Ithinkthis|Ithinkyou\\\'re|Ithlnk|Ithoguht|Ithought|Ithoughtl|it\\\'II|It\\\'II|it\\\'Il|It\\\'Il|itin|itjust|Itjust|it\\\'lI|It\\\'lI|It\\\'llhappen|it\\\'lljust|Itold|Itook|itout|it\\\'S|it\\\'sjinxed|it\\\'sjust|It\\\'sjust|itso|Ittends|Itwasn\\\'t|Iuckier|IV\\|oney|IV\\|oney\\\'s|I\\\'va|I\\\'Ve|IVIan|IVIAN|IVIarch|IVIarci\\\'s|IVIarko|IVIe|IVIine\\\'s|IVImm|IVIoney|IVIr\\.|IVIrs|IVIuch|IVIust|IVIy|IVlacArthur|IVlacArthur\\\'s|IVlcBride|IVlore|IVlotherfucker\\_|IVlr|IVlr\\.|IVlr\\_|IVlust|IVly|Iwake|Iwant|Iwanted|Iwas|Iwasjust|Iwasjustu|Iwill|Iwish|Iwon\\\'t|Iworked|Iwould|jalapeno|Jaokson|Jascn|jcke|jennifer|joseph|jsut|Jumpthem|jusi|jusl|justjudge|justleave|Justletgo|kidsjumped|kiokflip|knowjust|knowthat|knowthis|knowwhat|knowyet|knowyourlove|korean|L\\/ght|L\\/kes|L\\\\\\/Ianuela|L\\\\\\/Ianuelal|l\\\\\\/Iauzard|l\\\\\\/I\\\xe9lanie|L\\\\\\/I\\\xe9lanie|l\\\\\\/Iom|l\\\\\\/Iommy|l\\\\\\/Ir|l\\\\\\/Ir\\.|l\\\\\\/Is|l\\\\\\/ly|l\\_AuGHING|l\\\u2018m|Laml6|Lcad|lcan|lcan\\\'t|lcarl\\\'t\\_|Lcve|l\\\'d|L\\\'d|ldid|Ldid|ldiot|L\\\'djump|ldon\\\'t|Ldon\\\'t|Lefs|Let\\\'sjust|lf|Lf|lfeelonelung|lfthey|lfyou|Lfyou|lfyou\\\'re|lget|lgive|Li\\/0\\/Academy|li\\/lr\\.|ligature\\_\\_\\_|l\\\'II|l\\\'Il|ljust|Ljust|ll\\/Iommy\\\'s|ll\\/lajor|Ll\\/lajor|ll\\/layans|l\\\'lI|l\\\'ll|L\\\'ll|l\\\'lljust|L\\\'lltake|llte|l\\\'m|L\\\'m|Lmean|l\\\'mjust|ln|lN|lNAuDll3LE|LNAuDll3LE|LNDlsTINcT|lneed|lostyou|Loudmusic|lraq|lRA\\\'s|Lrenka|Lrn|lRS|lsabella|lsn\\\'t|Lsn\\\'t|Lst\\\'s|lsuppose|lt|ltake|ltell|lthink|Lthink|lthink\\_\\_\\_|lt\\\'II|lt\\\'Il|ltjammed\\_|lt\\\'ll|ltold|lt\\\'s|lT\\\'S|Lt\\\'S|Lt\\\'sjust|lv\\\\\\/asn\\\'t|l\\\'ve|L\\\'ve|lVIan|lVIcHenry|lVIr\\.|lVlacArthur|LVlore|lVlr|lVlr\\.|lvluslc|lVlust|LVly|lwaited|lwamoto|lwant|lwanted|lwas|lwill|lwon\\\'t|lworked|lwould|lwould\\\'ve|lx\\/Iorning|M\\/dd\\/e|m\\/g\\/7ty|MACH\\/NE|MacKenz\\/e|majorjackpot|majormuscle|Manuela\\_|maste\\/y|Masturhate|Mattei\\_|mayjust|mbecause|McCa\\/Iister|McCallisler|Mccallister|Mccallisters|mcm\\\'s|mcney|mcral|mcre|mcve|mejust|Mexioo|mi\\/\\/\\<|misfartune|Ml6|Mlnd|Mock\\/\\\'ngbl\\\'rd|mOI\\\'\\\u20ac|Mom\\_|monkeyback|move\\_\\_\\_l|moveto|mustknock|Myheart|myjch|myjet|myjob|Myjob|myjob\\\'s|mylife|Mynew|myown|mypants|myselli|Myshoes|mysong|mytemper|mythumb|Myworld|N0|narne|Natians|naTve|nc|Nc|ncne|Ncrth|ncw|Ncw|needyou|neighboun|neverfound|neverthere|neverv\\\\\\/ill\\_|NewJersey|newjob|newjobs|nextdoor|Nighw|nilios|Nlagnificence|Nlakes|Nlalina|Nlan|Nlarch|Nlarine|Nlarion|Nlarry|Nlars|Nlarty|Nle|Nleet|Nlen|Nlom|Nlore|Nlornin|Nlother|Nlr|Nlr\\.|Nlrs|Nluch|nojurisdiction|noone|Noone|not\\ judging|notgoing|notjunk|Notjunk|notjust|notsure|novv|Nowjust|Nowthat\\\'s|Numbertwo|oan\\\'t|oan\\\'tjust|objecl|occultpowerand|Ocps|ofa|ofajudge|ofall|Ofall|ofBedford|ofcourse|Ofcourse|ofeach|ofeither|Offioer\\\'s|ofFrance|offreedom|offthe|offthis|offto|offun|ofguy|Ofhce|ofhis|ofHis|ofhoneybees|ofit|ofjam|OFJOAN|ofjoy|ofjunior|ofme|ofmead|ofmicroinjections|ofmy|ofNew|ofNorris\\\'|ofopinions|ofour|ofpeopla|ofthat|ofthe|Ofthe|oftheir|ofthem|ofthem\\\'s|ofthemselves|ofthere|ofthese|ofthings|ofthis|ofthlngs|ofthose|ofuse|ofwashington|ofyou|ofyour|OId|OIsson|Ok3Y|okaY|OkaY|OKaY|OKGY|Ol\\<|oldAdolfon|onboard|onIy|onIything|onJanuaw|onlyjust|Onyinal|oomprise|oonstitution|oouldn\\\'t|oould\\\'ve|oousin\\\'s|opiimistically|ora|orfall|orglory|orjust|Orjust|Orthat|orwould|Orwould|Othenzvise|our\\ joumey|ourbrave|ourfathers|ourgirlon|Ourgoal|Ourguy|ourj0b\\\'s|Ourj0b\\\'s|ourjobs|ourjob\\\'s|Ourjob\\\'s|ourjoumey|ourphotos|ourv\\\\\\/ay|outlool\\<\\\'s|overme|overthe|overthere|p\\/ace|P\\/ease|p\\_m\\_|P\\\xb0P\\$|PANUNG|pclnt|pclnts|pe0pIe|Perrut\\_|Persona\\/4\\/|Persona\\/y|persors|PIain|PIease|PIeasure|PIus|pleasurlng|POIe|Polynes\\/ans|poorshowing|popsicle|Presidenfs|probablyjust|puIIing|Putyourhand|Qh|QkaY|Qpen|QUYS|\\_QW|r\\/ght|ralnbow|ratherjump|ratherjust|Rcque|rcscucd|rea\\/|readytolaunchu|reaHy|ReaHy|reallyjust|reallymiss|reallytalked|reallythink|reallythinkthis|rememberthem|reoalibrated|retum|rhfluence|rightdown|roadyou|RUMBUNG|s\\/uggikh|S0|S1oW1y|saidyou|sayeverything\\\'s|saynothing|saythat|sc|scientihc|SCREAIVHNG|sCREAlvllNG|SCREAlvllNG|scund|S\\\'EOp|severa\\/parents|sfill|S\\\ufb02ence|shallrise|sHATTERING|shcws|Shdsjust|She\\`s|She\\\u2018II|she\\\'II|She\\\'II|she\\\'Il|Shejust|she\\\'lI|Shoofing|ShOp|shortyears|shou\\/dn|shou\\\ufb01ng|Shou\\\ufb02ng|shouldnt|Shouldrt|shouldrt|Shs\\\'s|SHUDDERWG|Shutup|SIGH\\$|signifcance|Sincc|sistervvill|Skarsg\\\xe9rd|slcsHs|slGHINcs|slGHING|slNGING|slzzLING|smarfest|Smiih|so\\/id|SoBl3lNG|soemtimes|Sojust|soldierl|somethlng|somethlng\\\'s|somez\\\'\\/7\\/ng|somthing|sumthing|sou\\/|SoundofMusic|SP\\/ash|SPEAK\\/NG|speII|speII\\\'s|Spendourtime|sQUA\\\\\\/\\\\\\/KING|StAnton|stealsjeans|StilI|Stilldesperatelyseeking|stlll|sToPs|storyl|Stubbom|su\\/faces|suffocaiing|summerjob|Summerjust|sun\\/ive|superiorman|sur\\\ufb02aces|t\\/ying|T0|T00|ta\\/ks|taiked|talkto|Talkto|talktonight|tampax|tc|tcday|tcrturing|tcuch|te\\/\\/|tearjust|tellsjokes|tellyou|terriers\\_|th\\/nk|THEPASSION|thafs|Thafs|Thai\\\'s|Thal\\\'s|thankyou|Thankyou|thatconverts|thatgoes|that\\\'II|That\\\'II|thatjob|thatjunk|thatjust|thatleads|Thatl\\\'m|that\\\'s\\ just|Thatsand|that\\\'sjust|That\\\'sjust|Thc|theirface|theirfeet|theirfury|thejaw|thejoint|thejudge|thejudges|Thejudges|thejury|Thelook|Therds|There\\\'II|There\\\'Il|There\\\'lI|They\\\'\\/\\\'e|they\\/\\\'II|They\\/re|They\\/\\\'re|they\\\'II|they\\\'Il|theyjust|Theyjust|they\\\'lI|They\\\'lI|theyre|theysay|thinkthat|this\\\'II|thlngs|Thlnkthls|thls|thore\\\'s|Thore\\\'s|Thorjust|thoughtl\\\'dletyou|tnatjust|tnat\\\'s|Tnat\\\'s|Tnere\\\'ll|to\\/\\/et|To\\/\\/S|todayl\\\'d|togelher|togethen|tojoin|tojudge|toldyou|tomorrovv|Tonighfsjust|totake|totalk|tothat|tothe|Towef|Tr\\/ck\\/ing|Traitur|tv\\\\\\/o|tvvelve|Tvvelve|tvventy|Tvventy|tvvo|Tvvo|twc|unconhrmed|underthat|underthe|underthese|underyour|unfilyou|Unfon\\\'unate\\/y|Uninnabited|untilApril|untilyou|upthinking|upto|V\\\\\\/ait\\_\\_\\_|v\\\\\\/as|V\\\\\\/as|V\\\\\\/e|v\\\\\\/eek\\\'s|V\\\\\\/eird\\_|V\\\\\\/ell|V\\\\\\/hat|V\\\\\\/hen\\\'ll|V\\\\\\/ho|v\\\\\\/ho\\\'ll|v\\\\\\/Hoops|v\\\\\\/ho\\\'s|V\\\\\\/ho\\\'s|V\\\\\\/hy|v\\\\\\/ith|v\\\\\\/on\\\'t|V\\\\fith|V\\\\fithin|valedictolian|vcice|ve\\/y|veiy|V\\\xe9ry|versioin|vi\\/ay|visitjails|Viva\\/di\\\'s|vlll|Voil\\\xe1|Voil\\\xe9|vvasjust|VVasn\\\'t|vvay|VVe|VVe\\\'II|VVe\\\'ll|Vvelooked|VVe\\\'re|VVe\\\'ve|VVhat|VVhat\\\'s|VVhat\\\'S|VVhen|\\\'v\\\'Vhere\\\'s|VVhip|vvHooPING|VvHooPING|VVhy|VVill|VVinters|vvlND|w\\\xa4n\\\'t|W9|waht|waierfall|walkjust|wallplant|wannajump|wantyou|Warcontinues|wasjennifer|wasjust|wasrt|Wasrt|wayl|wayround|wclf|wcman|wcmen|wcn\\\'t|wcrse|wculd|We\\/\\/|We\\/came|we\\/come|We\\/come|We\\/I|weekendjust|werert|Werert|we\\\'II|We\\\'II|we\\\'Il|We\\\'Il|wejust|we\\\'lI|We\\\'rejust|We\\\'ro|We\\\'Ve|wh\\/p|Wh\\\xb0ops|Whafs|Whatam|Whatare|Whateverwe|What\\\'II|Whatis|whatjust|Whatl|whatshe|whatwe|Whc\\\'s|Whcse|wHlsPERs|wi\\/\\/|wil\\/|Wil\\/|wilI|willbe|willhire|willneverknow|willyou|wlfe|wlfe\\\'s|wlth|wnat\\\'s|Wno|Wo\\/f|wo\\\ufb02d|WOI\\\'1\\\'t|wondernobody|won\\\'T|won\\\'tanswerme|won\\\'tforget|won\\\'tletitbring|Wo\\\'re|worfd|won\\\'th|won\\\'thwhile|workyou|wouIdn\\\'t|wouldn\\\'\\!|Wouldrt|wr\\/\\\'2\\\'\\/ng|writign|wrcng|wuuld|\\_Yay|Y\\\xa4u\\\'II|Y\\\xa4u\\\'ll|y\\\xa4u\\\'re|Y\\\xa4u\\\'re|y\\\xa4u\\\'ve|Y0|y0LI|y0u\\\'II|Y0u\\\'rc|Y0u\\\'re|Y0u\\\'ve|yaming|yaurparents|ycu|ycu\\\'d|ycur|Ycu\\\'re|Ycursins|YEI\\_I\\_|YELL\\$|yigg\\/mg|Yigg\\/mg|yoLI|yOu|yOU|you\\`re|you\\\'II|You\\\'II|You\\\'Il|youjack|youjoin|Youjoin|youjust|You\\\'lI|youngsterlike|youpick|you\\\'ra|Yourattention|yourautomobile|You\\\'rejustjealous|yourextra|yourfather|yourhand|yourhusband|yourjewelry|yourjob|Yourjob|yourjob\\_|yourjockey|yourjury|yourname|Yourpackage|yourpackage|you\\\'ro|yourpoorleg|yourvveak|you\\\'va|You\\\'va|youWlneversee|yQu|YQu|yQu\\\'\\_7|yummY|yuu|Yuu|Yuu\\\'ve|z\\\'housand|zlPPING|Ifslocked|nightjust|dayjourney|Ourjob|IunCh|nieCe|giVes|wantto|besttoday|NiCe|oftravelling|oftwo|ALl|afterparty|welL|theirjob|lfhe\\\'s|babyjesus|shithousejohn|jesus|withjesus|Gojoin|Adaughter|talkwith|anyjournals|L\\\'mjewish|arejust|soundjust|ifl\\\'m|askyou|ordinarywoman|andjunkies|isjack|helpyou|thinkyou|Lordjesus|injuvy|thejets|ifGod|againstjewish|ajunkie|dearjesus|hearyour|takeyears|friendjean|Fatherjohn|youjean|hearyou|Ifshe|didn\\\'tjust|IfGod|notjudge|andjudge|OKBY|myjourney|yourpremium|we\\\'rejust|Iittlejokes|Iifejust|Andjust|ofThe|lifejust|AIice|lnternationalAirport|yourbody|DollarBaby|ofjonesing|yourpanties|offforme|pantyparty|everhit|theirhomes|AirForce|yourhead|betterbe|myparty|disasterlockdown|Ifpot\\\'s|ifmy|yourmoney|Potterfan|Hermionejust|ofourshit|showyou|answernow|theirsjust|BIackie|SIeep|foryour|oryour|forArthur|CIamp|CIass|CIose|GIove|EIIen|PIay|PIace|EIgyn|AIert|CIaus|CIimb|military\\\'II|anylonget|yourlife|Yourbitch\\\'IIgetyou|yourdick|Tellyourbitch|rememberyou|newface|Butyou|don\\\'tyou|yourlives|Iovedher|reallydid|firstperson|mybest|Justgive|AIong|atyourbody|myhands|sayhe|mybooty|yourbooty|yourgirl|yourlegs|betterifthey|manybeautiful|contactpolice|numberbelow|biggestproblem|Itgave|everybodykind|theyhad|knowherlast|herhearing|othermembers|BIing|CIyde|foundguilty|fouryears|countyjail|yearin|theirrole|manybottles|can\\\'tpronounce|manybowls|ofthatgreen|manyjoyrides|Superrich|Iprefer|Theymust|whatyou|I\\\'IIjump|nobodyknow|neverknew|EIectronica|AIarm|getyourman|sayyou|getyour|Fuckyou|Whyyou|butyoujust|forgetyourname|Whatyou|Co\\/\\\'ncidenta\\/\\/y|GIad|RachelMarron|She\\\'llgive|presidentialsuite|andgentlemen|willnot|ourproducers|Ifshe\\\'s|CIock|Ishould|I\\\'llgo|maypass|andprotecting|BIessed|CIean|SIave|AIi|AIIah|AIIahu|CIick|BIast|AIlah|SIow|theirpolicies|Orperhaps|ofsex|forpleasure|ourpower|Yourpiece|Offioers|oondesoended|myseif|let\\\'sjust|yourway|An9TY|ourjourney|LuCY|\\\\\\\'m|CEDR\\/C|lsaac|FIy|Ionger|Iousy|Iosing|They\\\'II|yourpaws|littie|It\\\'lljust|AIso|Iisten|suPPosed|somePIace|exPIain|Iittle|StoP|AIways|Iectures|Iow|Ieaving|Ietting|Iistening|Iecture|Iicking|Iosses|PIeased|ofburglaries|He\\\'sjust|mytrucktoo|nowwhat|yourfire|herwhat\\\'s|hearthat|oryou|preferjournalist|CIaw|Ifour|lron|It\\\'syour|lfstill|forjoining|foryears|Ifit|notjump|ourproblem|yourprofile|ifJanine|forpreventative|whetherprotest|Ifnot|ourpeople|offmy|forproviding|hadjust|nearyou|whateveryou|hourputs|timejob|overyour|orpermanent|createjobs|I\\\'vejust|peoplejobs|dinnerpail|hasjumped|theirprivacy|AIl|ofserious|yourprofessional|poiitical|tojump|iives|eiections|militaryjuntas|nojoke|yourpresidency|ofmilitaryjuntas|Ourproposal|LeBIanc|KIaus|yourpussy|lNTERVIEWER|lNAUDIBLE|SImpsons|anotherjob|lfthere|descentinto|ofthathere|ofway|yourseat|allyou|Allyou|yourass|Yourbutt|iustiiggle|iust|CSi|affernoon|orpersecution|theirpetty|Fourpercent|fourpercent|willjust|Ifyou\\\'re|ourplanet|lsolation|yourprimitive|yourplanet|matteryour|Yourplace|andjustice|anotherpart|confiict|growingjeopardy|hasjust|havejust|herselfinto|ifnecessary|we\\\'vejust|tojust|yourjudgment|yourjeans|Youjust|ajanitor|FIattery|myjournal|myjudgment|offofmy|offyour|ofgood|ofguilty|ofhaving|ofheart|ofhonor|oflove|ofmankind|ofmany|ofnormal|ofpeople|ofpower|ofsuch|peoplejust|They\\\'rejust|tojeopardize|Yourplaces|yourposition|yourselfa|yourselfright|thejob|thejanitors|alljust|forAmerica\\\'s|Forpencils|forpondering|handwrittenjournals|herpursuit|ofjust|oflanding|oflife|outjust|Thejoke|ourpatient|oryou\\\'re|ofyourself|poweryour|Ofmy|EIlen|Don\\\'tget|tellme|ofdecision|itgoing|artificialgravity|shouldknow|Hasn\\\'tgot|thirdjunction|somebodypicks|Willyou|can\\\'tget|BuZZes|wouldn\\\'tyou|Wellbelow|What\\\'dyou|decipheredpart|they\\\'llknow|ifit\\\'s|ornot|myposition|lndistinct|anybiscuits|Andifyou|lfwe|yourarm|lnteresting|findit|it\\\'llstart|holdit|ofkilling|Howyou|lnhales|lgot|CIip|what\\\'II|road\\\'II|girI|LIoyd|BIake|reaI|Foryour|yourpublic|LAst|h\\ is|He\\)\\\u2019|Ls|al\\\'|wail\\\'|III\\\'ll|forthis|Yea\\ h|a\\ re|He\\)\\"|pan\\\'|yea\\ h|Tun|He\\)\\\'|he\\)\\\'|I\\\'11|he\\)\\"|\\ \\\'re\\ )(\\b|$)'}},
+ 'fin': {'BeginLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'EndLines': {'data': OrderedDict(),
+                      'pattern': None},
+         'PartialLines': {'data': OrderedDict(),
+                          'pattern': None},
+         'PartialWordsAlways': {'data': OrderedDict([(u'\xb6\xb6', u'\u266b'), (u'\xb6', u'\u266a')]),
+                                'pattern': None},
+         'WholeLines': {'data': OrderedDict([(u'Katsokaa pa.', u'Katsokaapa.'), (u'Mik!\r\n""e\u201c9ir\xe4\u0131', u'Mik!\r\n-Hengit\xe4!'), (u'Tu lta!', u'Tulta!'), (u'...0I1...', u'...on...'), (u'Ken g\xe4n nauh oja?', u'Keng\xe4nnauhoja?'), (u'k\xe3mmott\xe3V\xe3ll\xe3 mUiStoll\xe3.', u'kammottavana muistona.'), (u'H\xe4n n\xe4ki naisen menev\xe4n\r\nkellarikerroksen ksen asun to o ns\xe4.', u'H\xe4n n\xe4ki naisen menev\xe4n\r\nkellarikerroksen asuntoonsa.'), (u'Min\xe4 etsin k\xe4siini miehen, joka\r\non aurtanutiestradea ja minua:', u'Min\xe4 etsin k\xe4siini miehen, joka\r\non auttanut Lestradea ja minua:'), (u'Huomaa erityisesti\r\npunaisella merkitty "kitoris.', u'Huomaa erityisesti\r\npunaisella merkitty "klitoris".'), (u'Tulkaa, meill\xe4 on\r\nHa va\u0131ji-bileet suihkussa', u'Tulkaa, meill\xe4 on\r\nHavaiji-bileet suihkussa'), (u'Ta rkoitatko ett\xe4\r\nh\xe4net myrkytettiin?', u'Tarkoitatko ett\xe4\r\nh\xe4net myrkytettiin?'), (u'Odotta kaa soittoani\r\nIev\xe4hdyspaikalla.', u'Odottakaa soittoani\r\nlev\xe4hdyspaikalla.'), (u'Nyt kuuntelet, perska rva.', u'Nyt kuuntelet, perskarva.'), (u'Ta patko h\xe4net sitten?', u'Tapatko h\xe4net sitten?'), (u'Seuraa vissa va/oissa.', u'Seuraavissa valoissa.'), (u'A\u0131o\u0131t rapattaa minut.\r\n- En.', u'Aioit tapattaa minut.\r\n- En.'), (u'Todella vaku uttavaa.', u'Todella vakuuttavaa.'), (u'I-le ovat tuolla alhaalla', u'He ovat tuolla alhaalla'), (u'Nainen kuuluu minulle.\r\n- I-I\xe0ivy siit\xe4, ylikasvuinen hyttynen!', u'Nainen kuuluu minulle.\r\n- H\xe4ivy siit\xe4, ylikasvuinen hyttynen!'), (u'I-Ialuatte k\xe4ytt\xe4\xe4 pyh\xe0\xe0 kive\xe4\r\ndynastian aarteen l\xf6yt\xe4miseksi.', u'Haluatte k\xe4ytt\xe4\xe4 pyh\xe0\xe0 kive\xe4\r\ndynastian aarteen l\xf6yt\xe4miseksi.'), (u'Mit\xe4f?', u'Mit\xe4.. ?'), (u'Kuuluuko Hiru ko-klaanista mit\xe4\xe4n?\r\n- Ninjasoturit ovat edell\xe4mme.', u'Kuuluuko Hiruko-klaanista mit\xe4\xe4n?\r\n- Ninjasoturit ovat edell\xe4mme.'), (u'Anteeks\u0131} painoin kai... -', u'Anteeksi, painoin kai... -'), (u'ja Rea! Ho usew\xedves.', u'ja Real Housewives.'), (u'Et halu n n ut Julkkistansseihinkaan.', u'Et halunnut Julkkistansseihinkaan.'), (u'Laard i k\xe4si?', u'Laardik\xe4si?'), (u'Varo kaa!', u'Varokaa!'), (u'N\xe4ytt\xe4v\xe4t k\xf6 tyt\xf6t v\xe4h \xe4n\r\nh uorahtavi m m i lta?', u'N\xe4ytt\xe4v\xe4tk\xf6 tyt\xf6t v\xe4h\xe4n\r\nhuorahtavimmilta?'), (u'Stif... Ier.', u'Stif... ler.'), (u'J u mantsu kka! M it\xe4?', u'Jumantsukka! Mit\xe4?'), (u'Varasin Ch u m bawam ban,', u'Varasin Chumbawamban,'), (u'J u malavita!', u'Jumalavita!'), (u'S', u'Isi...'), (u'Haluan kertoa jotai n', u'Haluan kertoa jotain'), (u'I-Ialuatte', u'Haluatte')]),
+                        'pattern': None},
+         'WholeWords': {'data': OrderedDict([(u'kellojo', u'kello jo'), (u'onjo', u'on jo'), (u'senj\xe4lkeen', u'sen j\xe4lkeen'), (u'Ts\xe4u', u'Tsau'), (u'hydraulinenjousitus', u'hydraulinen jousitus'), (u'Kevyetja', u'Kevyet ja'), (u'Oleijo', u'Olet jo'), (u'viimeinenjuna', u'viimeinen juna'), (u'n\xe4ytt\xe4\xe4jotenkin', u'n\xe4ytt\xe4\xe4 jotenkin'), (u'onjoku', u'on joku'), (u'Iapsuuteen', u'Lapsuuteen'), (u'Ieikitjunill\xe4', u'leikit junilla'), (u'Sfiy', u'Stig'), (u'Iukulasejani', u'Lukulasejani'), (u'Ieikkiminen', u'Leikkiminen'), (u'K\xe4\xe4lik\xe4\xe4rylepizz\xe4', u'Kaalik\xe4\xe4rylepizza'), (u'sukl\xe4\xe4k\xe4stikkeen', u'suklaakastikkeen'), (u'p\xe4istetun', u'paistetun'), (u'b\xe4n\xe4\xe4nin', u'banaanin'), (u'pifi', u'piti'), (u'a\u0131keasfaan', u'oikeastaan'), (u'Stg', u'Stig'), (u'sikain\ufb02uenssatja', u'sikainfluenssat ja'), (u'Hienojuna', u'Hieno juna'), (u'kiinnostuajunista', u'kiinnostua junista'), (u'h\xe4y\u0131yvetu\u0131\xedn', u'h\xf6yryveturin'), (u'pienaismalli', u'pienoismalli'), (u'ena', u'eno'), (u'racfios\xe3hk\xe4ff\xe1j\xe3n\xe3', u'radios\xe4hk\xf6tt\xe4j\xe4n\xe4'), (u'Amenkan', u'Amerikan'), (u'laiva/la', u'laivalla'), (u'0/in', u'Olin'), (u'Junaha\u0131rasfus', u'Junaharrastus'), (u'enasfa', u'enosta'), (u'/V\u0131\xedn', u'Niin'), (u'Oliivarmasii', u'Olit varmasti'), (u'Internetist\xe4juuri', u'Internetist\xe4 juuri'), (u'hu\u0131janj\xe3nniff\xe5v\xe3\xe0l', u'hurjan j\xe4nnitt\xe4v\xe4\xe4.'), (u'Vaikkajunat', u'Vaikka junat'), (u'k\xe4\xe4ntyija', u'k\xe4\xe4ntyi ja'), (u'osaajotain', u'osaa jotain'), (u'Ieikill\xe4mme', u'leikill\xe4mme'), (u'Bellinjuna', u'Beltin juna'), (u't\xe4st\xe4johtolangasta', u't\xe4st\xe4 johtolangasta'), (u'tuntisijonkun', u'tuntisi jonkun'), (u'Olgajotain', u'Olga jotain'), (u'tulokseivuodesia', u'tulokset vuodesta'), (u'tuloksetvuodesta', u'tulokset vuodesta'), (u'Vainjalkapallo', u'Vain jalkapallo'), (u'lloveyou', u'I love you'), (u'po\ufb02\u2039aisi', u'potkaisi'), (u'minufulos', u'minut ulos'), (u'Ieiv\xe4npaahdinl', u'leiv\xe4npaahdin!'), (u'Ieiv\xe4npaahdinta', u'leiv\xe4npaahdinta'), (u'asuajossain', u'asua jossain'), (u'Koiratjuoksentelivat', u'Koirat juoksentelivat'), (u'tiet\xe4\xe4jotain', u'tiet\xe4\xe4 jotain'), (u'osaatjuna', u'osaat juna'), (u'va/as', u'valas'), (u'va/asperhe', u'valasperhe'), (u'koskeejotain', u'koskee jotain'), (u'I\xe4\xe4kkeens\xe4', u'l\xe4\xe4kkeens\xe4'), (u'Iaulavan', u'laulavan'), (u'Kuulitj\xe4\xe4n', u'Kuulit j\xe4\xe4n'), (u'Ievolle', u'levolle'), (u'Va/aa//e', u'Valaalle'), (u'va/aa//a', u'valaalla'), (u'I\xe4hdenkin', u'l\xe4hdenkin'), (u'Iakkiin', u'lakkiin'), (u'Iohik\xe4\xe4rmeell\xe4', u'lohik\xe4\xe4rmeell\xe4'), (u'Mik\u0131', u'Mik!'), (u'Iukossa', u'lukossa'), (u'Va/aan', u'Valaan'), (u's\xe4ve/m\xe4', u's\xe4velm\xe4'), (u'j\xe4//een', u'j\xe4lleen'), (u'P\xf6\xf6\u0131', u'P\xf6\xf6!'), (u'Hnjaa', u'Hiljaa'), (u'Iiftasin', u'liftasin'), (u'Jute//aan', u'Jutellaan'), (u'Iohduttamaan', u'lohduttamaan'), (u"L'lYP\xe4f\xe4\xe4n", u'Hyp\xe4t\xe4\xe4n'), (u'\xc4\u0131r\u0131\u0131', u'\xc4iti!'), (u'F\u0131\u0131\u0131p\u0131', u'Filip!'), (u'Yr\u203ar\u203a\xe4\xe4\u0131', u'Hypp\xe4\xe4!'), (u'Miki', u'Mik!'), (u'Heng\u0131r\xe4\u0131', u'Hengit\xe4!'), (u'Va/as', u'Valas'), (u'Ko///is', u'Koillis'), (u'Audieja', u'Audie ja'), (u'I/man', u'Ilman'), (u'/entotukia/ukse/ta', u'lentotukialukselta'), (u'/aivastosta', u'laivastosta'), (u'/entotukikohtaan', u'lentotukikohtaan'), (u'tu/ee', u'tulee'), (u'akse/iva//at', u'akselivallat'), (u'a\u0131\u0131ek\u0131rjo\u0131rerr\u0131\u0131n', u'allekirjoitettiin'), (u'Iitkua', u'litkua'), (u'0li', u'Oli'), (u'Iaskuvarjojoukkoihin', u'laskuvarjojoukkoihin'), (u'Iaskuvarjojoukoissa', u'laskuvarjojoukoissa'), (u'Tarvitsetjotain', u'Tarvitset jotain'), (u'Ieukaremmi', u'leukaremmi'), (u'Iainaatko', u'lainaatko'), (u'p\xe4\xe4llik\xf6lleja', u'p\xe4\xe4llik\xf6lle ja'), (u'I\xe4hell\xe4ni', u'l\xe4hell\xe4ni'), (u'Soti/aan', u'Sotilaan'), (u'va//attava', u'vallattava'), (u'viho//ise/ta', u'viholliselta'), (u'/iittoutuneet', u'liittoutuneet'), (u'voitjohtaa', u'voit johtaa'), (u'pohditkojotain', u'pohditko jotain'), (u'viho//ista', u'vihollista'), (u'sej\xe4isi', u'se j\xe4isi'), (u'Ient\xe4jill\xe4', u'lent\xe4jill\xe4'), (u'Soltutl', u'Soltut!'), (u'Iaulustamme', u'laulustamme'), (u'Iakkiani', u'lakkiani'), (u'Iiemeen', u'liemeen'), (u'kanadala\u0131\u0161ia', u'kanadalaisia'), (u'si//anp\xe4\xe4asema', u'sillanp\xe4\xe4asema'), (u'vahv\u0131\u0161tettiin', u'vahv\u0131stettiin'), (u'tu/ituki', u'tulituki'), (u'eliitt\u0131joukkoa', u'eliittijoukkoa'), (u'pa\u0131ka\u0131\u0131as\u0131\u0131', u'paikallasi!'), (u'Ieikkinyt', u'leikkinyt'), (u'Iujitettu', u'lujitettu'), (u'Ete/\xe4', u'Etel\xe4'), (u'viho//isranna//e', u'vihollisrannalle'), (u'sivusta/ta', u'sivustalta'), (u'/oppuisi', u'loppuisi'), (u'Iaskuvarjojoukkojen', u'laskuvarjojoukkojen'), (u'p\xe4\xe4tt\xe4nytj\xe4\xe4d\xe4', u'p\xe4\xe4tt\xe4nyt j\xe4\xe4d\xe4'), (u'Iuutnanteille', u'luutnanteille'), (u'I\xe4ht\xf6valmiiksi', u'l\xe4ht\xf6valmiiksi'), (u'Iokoisat', u'lokoisat'), (u'Korjaus/ukemat', u'Korjauslukemat'), (u'tanke///e', u'tankeille'), (u'ky\u0131\u0131\xe4\u0131', u'kyll\xe4!'), (u'Iisti\xe4', u'listi\xe4'), (u'Kunniamita/in', u'Kunniamitalin'), (u'Vemon', u'Vernon'), (u'fied\xe3n', u'Tied\xe4n'), (u'Ei\u0131is', u'Elvis'), (u'Inlem\xe4tion\xe4', u'International'), (u'holelfss\xe4', u'hotellissa'), (u'Han\u0131ey', u'Harvey'), (u'peikk\xe4', u'pelkk\xe4'), (u'Ehisl\xe3', u'Elvist\xe4'), (u'Y\ufb02\xe3ll\xe3v\xe3', u'Yll\xe4tt\xe4v\xe4'), (u'mahdolisuus', u'mahdollisuus'), (u'loisteiaan', u'loisteliaan'), (u'aku', u'alku'), (u'Garonilie', u'Garonille'), (u'Iikainen', u'likainen'), (u'vaiehtelijoita', u'valehtelijoita'), (u'puutari\u0131aasi', u'puutarhaasi'), (u'Garunin', u'Garonin'), (u'oravaietti\xe4', u'oravaletti\xe4'), (u'paijon', u'paljon'), (u'sutja', u'sut ja'), (u'gospeikvartetissa', u'gospelkvartetissa'), (u'Iauiajaksi', u'laulajaksi'), (u'viihdylt\xe4j\xe4', u'viihdytt\xe4j\xe4'), (u'hannaala', u'harmaata'), (u'Iaulajalta', u'laulajalta'), (u'saatjotain', u'saat jotain'), (u'L\xf6yd\xe4njonkun', u'L\xf6yd\xe4n jonkun'), (u'py\xfcr\xedyi', u'py\xf6rtyi'), (u'Cn\u0131dupia', u'Crudupia'), (u'Iiikaa', u'liikaa'), (u'ke\u0131taa', u'kertaa'), (u'Thafs', u"That's"), (u'Kappaietta', u'Kappaletta'), (u'soijoka', u'soi joka'), (u'Levytl\xe4', u'Levyll\xe4'), (u'paiaamista', u'palaamista'), (u'kuonnunn', u'kuormurin'), (u'Tytt\xfcyst\xe4v\xe4t', u'Tytt\xf6yst\xe4v\xe4t'), (u'k\xe3p\xe3l\xf6ifiin', u'k\xe4p\xe4l\xf6itiin'), (u'Oiko', u'Oliko'), (u'tuipalo', u'tulipalo'), (u'hebofiavaa', u'helpottavaa'), (u'ongeina', u'ongelma'), (u'ongeimia', u'ongelmia'), (u'Ajateikaa', u'Ajatelkaa'), (u'ku\u0131ki', u'kurki'), (u'lhailen', u'Ihailen'), (u'L\xe4ht\xfcsi', u'L\xe4ht\xf6si'), (u'yhti\xf6ile', u'yhti\xf6lle'), (u'eitoimi', u'ei toimi'), (u'voij\xe4\xe4d\xe4', u'voi j\xe4\xe4d\xe4'), (u'Pomkat', u'Porukat'), (u'kon\u0131ata', u'korvata'), (u'konsentien', u'konserttien'), (u'Sep\xe3', u'Sep\xe4'), (u'hebolus', u'helpotus'), (u'k\xfcyryss\xe4', u'k\xf6yryss\xe4'), (u'repiat', u'replat'), (u'kuikee', u'kulkee'), (u'pon\u0131koita', u'porukoita'), (u'naisetja', u'naiset ja'), (u'ten\u0131etuileeksi', u'tervetulleeksi'), (u'yl\xe4puolelia', u'yl\xe4puolella'), (u'kuullut180', u'kuullut 180'), (u'Iapsellista', u'lapsellista'), (u'esiinnytja', u'esiinnyt ja'), (u'Iaulat', u'laulat'), (u'Henanjestas', u'Herranjestas'), (u'teilie', u'teille'), (u'IIe', u'lle'), (u't\xe4ilaisia', u't\xe4llaisia'), (u'Varu', u'Varo'), (u'nimeli\xe4\xe4n', u'nimell\xe4\xe4n'), (u'anneijaan', u'armeijaan'), (u'pen\u0131staa', u'perustaa'), (u'minkkitu\u0131kkia', u'minkkiturkkia'), (u'minkkituiiiilla', u'minkkiturkilla'), (u'Ten\u0131etuioa', u'Tervetuloa'), (u'kuitalevy\xe4', u'kultalevy\xe4'), (u'ei\xe4m\xe4ss\xe4', u'el\xe4m\xe4ss\xe4'), (u'jutkaisua', u'julkaisua'), (u'Fo\u0131t', u'Fort'), (u'oien', u'olen'), (u'asioilie', u'asioille'), (u'Eitarvitsekaan', u'Ei tarvitsekaan'), (u'p\xf6kenyin', u'p\xf6kerryin'), (u'yll\xe4iiyy', u'yll\xe4ttyy'), (u'komeaita', u'komealta'), (u'Chadie', u'Charlie'), (u'laulaisilteko', u'laulaisitteko'), (u'Iaittaa', u'laittaa'), (u'iytt\xe4renne', u'tytt\xe4renne'), (u'pikkutytt\xfcn\xe4', u'pikkutytt\xf6n\xe4'), (u'tytt\xfckulta', u'tytt\xf6kulta'), (u'vimuilua', u'virnuilua'), (u'reporitereita', u'reporttereita'), (u'vime', u'virne'), (u'eijohdu', u'ei johdu'), (u'eriiainen', u'erilainen'), (u'Iasketa', u'lasketa'), (u'kem\u0131ttu', u'kerrottu'), (u'Manyja', u'Marty ja'), (u'etteijutusta', u'ettei jutusta'), (u'Katifomiassa', u'Kaliforniassa'), (u'sun\xb0filaudan', u'surffilaudan'), (u'bn\u0131netti', u'brunetti'), (u'vaimiina', u'valmiina'), (u'yiim\xe4\xe4r\xe4iset', u'ylim\xe4\xe4r\xe4iset'), (u'leffatj\xe4\xe4', u'leffat j\xe4\xe4'), (u"koin'lle", u'koirille'), (u'T\xe4ilaisen', u'T\xe4llaisen'), (u'antanutjo', u'antanut jo'), (u'Cha\u0131lien', u'Charlien'), (u'ymp\xe4riliesi', u'ymp\xe4rillesi'), (u'Iy\xfc', u'ly\xf6'), (u"lopan't", u'loparit'), (u'h\u0131isi', u'tulisi'), (u'kuuiuvanijonnekin', u'kuuluvani jonnekin'), (u'juh\u0131n', u'jutun'), (u'miefkseni', u'mielikseni'), (u'Tuisitko', u'Tulisitko'), (u'I\u0131on\xe4ni', u'luonani'), (u'\xe4k\xe4\xe4', u'alkaa'), (u'yi', u'yli'), (u'rupallelemaan', u'rupattelemaan'), (u'Priscilialla', u'Priscillalla'), (u'Hemmoltelet', u'Hemmotelet'), (u'Hearlbreak', u'Heartbreak'), (u'Holelia', u'Hotelia'), (u'Nyton', u'Nyt on'), (u'kiertueeile', u'kiertueelle'), (u'Elvist\xe3', u'Elvist\xe4'), (u'puoleila', u'puolella'), (u'\xc4\u0131\xe4', u'\xc4l\xe4'), (u'lnlemalional', u'International'), (u'Iuottamustanne', u'luottamustanne'), (u'Mycroft\xedsta', u'Mycroftista'), (u'Iopettako', u'lopettako'), (u'Ielukauppa', u'lelukauppa'), (u'Iomamatkalle', u'lomamatkalle'), (u'Iyhyelle', u'lyhyelle'), (u'Alk\xe4\xe4', u'\xc4lk\xe4\xe4'), (u'K_uka', u'Kuka'), (u'IIa', u'lla'), (u'Aitinne', u'\xc4itinne'), (u'V\xe4/ikohtaus', u'V\xe4likohtaus'), (u'kuo//aan', u'kuollaan'), (u'n\xe4/k\xe4\xe4n', u'n\xe4lk\xe4\xe4n'), (u'Su/je', u'Sulje'), (u'I\xe4im\xe4ytit', u'l\xe4im\xe4ytit'), (u'I\xe4hetyst\xf6ss\xe4', u'l\xe4hetyst\xf6ss\xe4'), (u'I\xe4hetyst\xf6\xf6n', u'l\xe4hetyst\xf6\xf6n'), (u'Iaosilainen', u'laosilainen'), (u'Iiiketarjous', u'liiketarjous'), (u'kaappavat', u'kaappaavat'), (u'Ieiviss\xe4\xe4n', u'leiviss\xe4\xe4n'), (u'EriC', u'Eric'), (u'Voi/\xe0', u'Voil\xe0'), (u'Crawley\u0131', u'Crawley!'), (u'Iihaksiaan', u'lihaksiaan'), (u'Iuenkaan', u'luenkaan'), (u'Olemma', u'Olemme'), (u'I\xe4htisitte', u'l\xe4htisitte'), (u'jot\xe2in', u'jotain'), (u'Eversi', u'Eversti'), (u'Ieiriyty\xe4', u'leiriyty\xe4'), (u'Iiikutte', u'liikutte'), (u'I\xe4\xe4ketiedett\xe4', u'l\xe4\xe4ketiedett\xe4'), (u'Iivet\xe4', u'livet\xe4'), (u'Iapsetkin', u'lapsetkin'), (u'I\xe4\xe4keluettelo', u'l\xe4\xe4keluettelo'), (u'Iaatiko', u'laatikko'), (u'hyvih', u'hyvin'), (u'Ieukakuoppa', u'leukakuoppa'), (u'Ient\xe4j\xe4ni', u'lent\xe4j\xe4ni'), (u'Ieikkisi', u'leikkisi'), (u'Iupaamastaan', u'lupaamastaan'), (u'ku/taseni', u'kultaseni'), (u'tu/en', u'tulen'), (u'Iautalle', u'lautalle'), (u'100_vuotiaaksi', u'100 vuotiaaksi'), (u'_', u''), (u'Viilt\xe4j\xe3_Jackin', u'Viilt\xe4j\xe4 Jackin'), (u'keff\xe4rfkerro', u'kellarikerroksen'), (u'tan/itsi', u'tarvitsi'), (u'_Aivan', u'Aivan'), (u'_Valosta', u'Valosta'), (u'_Teemmek\xf6', u'Teemmek\xf6'), (u'Viilt\xe4j\xe4_Jack', u'Viilt\xe4j\xe4 Jack'), (u'_Voi', u'Voi'), (u'_Tied\xe4tte', u'Tied\xe4tte'), (u'kulunutjo', u'kulunut jo'), (u'Vuokra_auto', u'Vuokra-auto'), (u'_Tuokaa', u'Tuokaa'), (u'_Tunnetteko', u'Tunnetteko'), (u'_Tied\xe4mme', u'Tied\xe4mme'), (u'toissay\xf6n', u'toissa y\xf6n'), (u'_Toki', u'Toki'), (u'_Ammuttu', u'Ammuttu'), (u'_Jahtasit', u'Jahtasit'), (u'_Tunnenko', u'Tunnenko'), (u'_Joku', u'Joku'), (u'_Taivahan', u'Taivahan'), (u'Kuorma_auto', u'Kuorma-auto'), (u'_Vain', u'Vain'), (u'Mesmer_klubille', u'Mesmer klubille'), (u"0nslow'IIe", u"Onslow'lle"), (u'Mesmer_klubi', u'Mesmer klubi'), (u'_Anteeksi', u'Anteeksi'), (u'Schrenk_Notzing', u'Schrenk Notzing'), (u'_Tapoin', u'Tapoin'), (u'_AIk\xe4\xe4', u'\xc4lk\xe4\xe4'), (u'0dotan', u'Odotan'), (u'Iuonteenlu', u'luonteenlu'), (u'Iempikaupunkini', u'lempikaupunkini'), (u'Iavasta', u'lavasta'), (u'I\xe4mmittelij\xe4t', u'l\xe4mmittelij\xe4t'), (u'Iaastaria', u'laastaria'), (u'Riiu\xe4\xe4', u'Riitt\xe4\xe4'), (u'K\xe4yu\xe4v\xe4tk\xf6', u'K\xe4ytt\xe4v\xe4tk\xf6'), (u'I\xe4hestyk\xf6', u'l\xe4hestyk\xf6'), (u'Ieikekirja', u'leikekirja'), (u'Ievyj\xe4\xe4n', u'levyj\xe4\xe4n'), (u'Iahjoitamme', u'lahjoitamme'), (u'L\xe4pp\xe4\xe4tuohon', u'L\xe4pp\xe4\xe4 tuohon'), (u'CIawdy', u'Clawdy'), (u'mita', u'mit\xe4'), (u'jalkeen', u'j\xe4lkeen'), (u'Cannabisjaponica', u'Cannabis japonica'), (u'Ieningin', u'leningin'), (u'ki\u0131joitatte', u'kirjoitatte'), (u'ki\u0131joitetuksi', u'kirjoitetuksi'), (u'kuluttuu', u'kuluttaa'), (u'Iuvulta', u'luvulta'), (u'Ieipomiskilpailuun', u'leipomiskilpailuun'), (u'Maclntire', u'MacIntire'), (u'Iehteemme', u'lehteemme'), (u'Al\xe4', u'\xc4l\xe4'), (u'kysesss\xe4', u'kyseess\xe4'), (u'Itsepuolustustal', u'Itsepuolustusta!'), (u'Iiipasimesta', u'liipasimesta'), (u'Iuutani', u'luutani'), (u'Iahjansa', u'lahjansa'), (u'I\xe4himm\xe4isemme', u'l\xe4himm\xe4isemme'), (u'Iuhistuu', u'luhistuu'), (u'\u0131\xf6yhk\xe4', u'l\xf6yhk\xe4'), (u'Iehtileikkeleit\xe4', u'lehtileikkeleit\xe4'), (u'vefieni', u'veljeni'), (u'Iapselleni', u'lapselleni'), (u'ep\xe4normaalinal', u'ep\xe4normaalina!'), (u'Iuurankoja', u'luurankoja'), (u'Iuurangoista', u'luurangoista'), (u'p\xe4\xe4tiellel', u'p\xe4\xe4tielle!'), (u'Valonneitsytta', u'Valonneitsytt\xe4'), (u'Iohik\xe1\xe1rmekuula', u'lohik\xe4\xe4rmekuula'), (u'yhdella', u'yhdell\xe4'), (u'Tasta', u'T\xe4st\xe4'), (u'__', u''), (u'Alk\xe1\xe4', u'\xc4lk\xe4\xe4'), (u'etta', u'ett\xe4'), (u'pitaa', u'pit\xe4\xe4'), (u'n\xe4lk\xe1isi\xe4', u'n\xe4lk\xe4isi\xe4'), (u'Hyva', u'Hyv\xe4'), (u'hyvasta', u'hyv\xe4st\xe4'), (u'ruoastaja', u'ruoasta ja'), (u'K\xe1sivarteni', u'K\xe4sivarteni'), (u'k\xe4ikki', u'kaikki'), (u'Mozukust\xe4', u'Mozukusta'), (u'Etsiv\xe1tk\xf6', u'Etsiv\xe4tk\xf6'), (u'Iohik\xe1\xe1rmekuulaa', u'lohik\xe4\xe4rmekuulaa'), (u'Valonneitsytt\xe1', u'Valonneitsytt\xe4'), (u'taalla', u't\xe4\xe4ll\xe4'), (u'siemeni\xe1\xe1n', u'siemeni\xe4\xe4n'), (u'kunh\xe4n', u'kunhan'), (u'\xe4j\xe4ttelen', u'ajattelen'), (u'pelkuril', u'pelkuri!'), (u'kyla', u'kyl\xe4'), (u'hy\xf6kk\xe1ykselt\xe4', u'hy\xf6kk\xe4ykselt\xe4'), (u'hy\xf6kk\xe1isi', u'hy\xf6kk\xe4isi'), (u'hy\xf6kataan', u'hy\xf6k\xe4t\xe4\xe4n'), (u'Voitjuoda', u'Voit juoda'), (u'Iittaamisesta', u'littaamisesta'), (u'Iahtenyt', u'l\xe4htenyt'), (u'kylasta', u'kyl\xe4st\xe4'), (u'Etjuurik\xe4\xe4n', u'Et juurikaan'), (u's\xe4m\xe4lt\xe4', u'samalta'), (u'k\xe4ikki\xe4ll\xe4', u'kaikkialla'), (u'ehka', u'ehk\xe4'), (u'tiennytkaan', u'tiennytk\xe4\xe4n'), (u'taistelenl', u'taistelen!'), (u'Iiikkeita', u'liikkeit\xe4'), (u'Taistellaanl', u'Taistellaan!'), (u'Odott\xe4m\xe4ttom\xe4t', u'Odottamattomat'), (u'n\xe4utinnot', u'nautinnot'), (u'rikk\xe4\xe4n', u'rikkaan'), (u'Iuotettavalta', u'luotettavalta'), (u'elaa', u'el\xe4\xe4'), (u'pekki\xe3', u'pelkki\xe4'), (u'j\xe3keen', u'j\xe4lkeen'), (u'n\xf6rttej\xe3', u'n\xf6rttej\xe4'), (u'pen\u0131skursseja', u'peruskursseja'), (u'Suorititjo', u'Suoritit jo'), (u'sein\xe4il\xe4', u'sein\xe4ll\xe4'), (u'Iaiteta', u'laiteta'), (u'hennostu', u'hermostu'), (u'Coiumbiassa', u'Columbiassa'), (u'Pen\u0131erssi\xe4', u'Perverssej\xe4'), (u'sukupuoieimisl\xe3', u'sukupuolielimist\xe4'), (u'ep\xe3iooginen', u'ep\xe4looginen'), (u'oisin', u'olisin'), (u'iittoni', u'liittoni'), (u'oisi', u'olisi'), (u'asuntoia', u'asuntola'), (u'p\xe4\xe4sittejatkoseminaariini', u'p\xe4\xe4sitte jatkoseminaariini'), (u'An\u0131atkaapa', u'Arvatkaapa'), (u'Iopussa', u'lopussa'), (u'Oletjo', u'Olet jo'), (u'Haiuan', u'Haluan'), (u'luennoilie', u'luennoille'), (u'Iintsata', u'lintsata'), (u'oletjuuri', u'olet juuri'), (u'Iuuietko', u'luuletko'), (u'kylvyss\xe3', u'kylvyss\xe4'), (u'v\xe3l\xe3hti', u'v\xe4l\xe4hti'), (u'Miettik\xe3\xe3', u'Miettik\xe4\xe4'), (u'insin\xf6\xfcn', u'insin\xf6\xf6ri'), (u'Menithalpaan', u'Menit halpaan'), (u'Tukaa', u'Tulkaa'), (u'Aarun', u'Aaron'), (u'Kieleil\xe4si', u'Kielell\xe4si'), (u'pystytjohonkin', u'pystyt johonkin'), (u'K\xe4mppikseniWilliam', u'K\xe4mppikseni William'), (u'Iuolamies', u'luolamies'), (u'keskian\u0131on', u'keskiarvon'), (u'kananosta', u'kartanosta'), (u'p\xe4iv\xe4lliselie', u'p\xe4iv\xe4lliselle'), (u'Iasagnea', u'lasagnea'), (u'voitehota', u'voi tehota'), (u'0lisit', u'Olisit'), (u'menijuuri', u'meni juuri'), (u'tapasivatjo', u'tapasivat jo'), (u'kn\u0131unukoriiiliiset', u'kruunukorkilliset'), (u'eijuo', u'ei juo'), (u'N\xe4yt\xe4tuupuneeita', u'N\xe4yt\xe4t uupuneelta'), (u'Etan\u0131aakaan', u'Et arvaakaan'), (u'lhanko', u'Ihanko'), (u'y\ufb02t\xe4k\xe4\xe4n', u'yrit\xe4k\xe4\xe4n'), (u'serkkuniWinn', u'serkkuni Winn'), (u'voijatkua', u'voi jatkua'), (u'miehetja', u'miehet ja'), (u'v\xedesfin\xed', u'viestini'), (u'kuull\u0131lsinusla', u'kuullut sinusta'), (u'T\xe3m\xe3', u'T\xe4m\xe4'), (u'kel\xe3\xe3n', u'ket\xe4\xe4n'), (u'vedess\xe3k\xe3veij\xe3', u'vedess\xe4k\xe4velij\xe4'), (u'/abrassa', u'labrassa'), (u'akaa', u'alkaa'), (u'Iiinaa', u'liinaa'), (u'kan\u0131ainen', u'karvainen'), (u'oten', u'olen'), (u'kallaisesi', u'kaltaisesi'), (u'pmffa', u'proffa'), (u'tulitt\xe4nne', u'tulit t\xe4nne'), (u'Alalteko', u'Alatteko'), (u'luuiisit', u'luulisit'), (u'Pys\xe3hdy', u'Pys\xe4hdy'), (u'Paskath\xe4nest\xe4', u'Paskat h\xe4nest\xe4'), (u'Pys\xe3hdyheti', u'Pys\xe4hdy heti'), (u'Heivetti', u'Helvetti'), (u'Pid\xe3l\xe3n', u'Pid\xe4t\xe4n'), (u'V\ufb02ru', u'Varo'), (u'huolissasijostain', u'huolissasi jostain'), (u'hurmaavatpuhelusi', u'hurmaavat puhelusi'), (u'yst\xe4vysiyin', u'yst\xe4vystyin'), (u'Cunya', u'Currya'), (u'cunya', u'currya'), (u'kohdaliani', u'kohdallani'), (u'an\u0131oista', u'arvoista'), (u'Loputn\xe4kev\xe4tn\xe4lk\xe4\xe4', u'Loput n\xe4kev\xe4t n\xe4lk\xe4\xe4'), (u'oletollut', u'olet ollut'), (u'j\xe4ikin\u0131oan', u'j\xe4lkiruoan'), (u'Saath\xe4net', u'Saat h\xe4net'), (u'Kem\u0131n', u'Kerron'), (u'kappaieiksi', u'kappaleiksi'), (u'vuok\u0131anja', u'vuokran ja'), (u'iyperys', u'typerys'), (u'mmanltisella', u'romanttisella'), (u'\u0131akastellut', u'rakastellut'), (u'jutteiimme', u'juttelimme'), (u'vesimittann', u'vesimittarin'), (u'kuikevat', u'kulkevat'), (u'tavaratja', u'tavarat ja'), (u'piiltaal', u'piittaat'), (u'etehk\xe4', u'et ehk\xe4'), (u'Lapsenvahtisituli', u'Lapsenvahtisi tuli'), (u'Ymm\xe4n\xe4lk\xf6', u'Ymm\xe4rr\xe4tk\xf6'), (u'iyii\xe3resi', u'tytt\xe4resi'), (u'my\xf6h\xe3', u'my\xf6h\xe4'), (u'n\xe4hnytAaron', u'n\xe4hnyt Aaron'), (u'haiunnut', u'halunnut'), (u'Olitoikeassa', u'Olit oikeassa'), (u'itseenijuuri', u'itseeni juuri'), (u'lempin\u0131okaani', u'lempiruokaani'), (u'Iupaamaan', u'lupaamaan'), (u'Teetsoimun', u'Teet solmun'), (u'Sen\u0131ice', u'Service'), (u'Iasini', u'lasini'), (u'Ieuassa', u'leuassa'), (u'Iiikekumppaninsa', u'liikekumppaninsa'), (u'Iiikekumppani', u'liikekumppani'), (u'Iausuttiinkaan', u'lausuttiinkaan'), (u'Iastauslaiturille', u'lastauslaiturille'), (u'Oleko', u'Oletko'), (u'tie/t\xe4', u'tielt\xe4'), (u"Mayhew'IIe", u"Mayhew'lle"), (u'Iakiasiaintoimisto', u'lakiasiaintoimisto'), (u'Iakimiest\xe4', u'lakimiest\xe4'), (u'ne//eens\xe4', u'nelleens\xe4'), (u'ha//ituksiin', u'hallituksiin'), (u'soti/aa//isiin', u'sotilaallisiin'), (u'Iahtasit', u'lahtasit'), (u'Tiestik\xf6', u'Tiesitk\xf6'), (u'Iakimiehi\xe4', u'lakimiehi\xe4'), (u'\xc4l\xe4k\xe4\xe4', u'\xc4lk\xe4\xe4'), (u'O/en', u'Olen'), (u'minsta', u'minusta'), (u'Iuennosta', u'luennosta'), (u'Iakimiehest\xe4', u'lakimiehest\xe4'), (u'Iopetatte', u'lopetatte'), (u'0/it', u'0lit'), (u'tu/it', u'tulit'), (u"Mayhew'Ita", u"Mayhew'lta"), (u'I\xe4hiet\xe4isyydell\xe4', u'l\xe4hiet\xe4isyydell\xe4'), (u'ennenkuin', u'ennen kuin'), (u'nukku\xe4', u'nukkua'), (u'ihmisia', u'ihmisi\xe4'), (u'eloss\xe4', u'elossa'), (u'tiedett\xe4v\xe1', u'tiedett\xe4v\xe4'), (u'Etsik\xe1\xe1', u'Etsik\xe4\xe4'), (u'A\u0131ja\u0131', u'Aijai'), (u'V\xe4lonneitsyen', u'Valonneitsyen'), (u'Iup\xe4ust\xe4si', u'lupaustasi'), (u'Y\xe4mikugyo', u'Yamikugyo'), (u'ep\xe4onnistumisi\xe4', u'ep\xe4onnistumisia'), (u'Ymm\xe1rr\xe4tk\xf6', u'Ymm\xe4rr\xe4tk\xf6'), (u'Iohik\xe4\xe4rmekuula', u'lohik\xe4\xe4rmekuula'), (u'tasta', u't\xe4st\xe4'), (u'taynna', u't\xe4ynn\xe4'), (u'mina', u'min\xe4'), (u'tata', u't\xe4t\xe4'), (u'tyhmaa', u'tyhm\xe4\xe4'), (u'enemman', u'enemm\xe4n'), (u'p\xe1tev\xf6ity', u'p\xe4tev\xf6ity'), (u'kylla', u'kyll\xe4'), (u'\xe4rvok\xe4st\xe4', u'arvokasta'), (u'selviytyj\xe1ksi', u'selviytyj\xe4ksi'), (u'myyda', u'myyd\xe4'), (u'hanet', u'h\xe4net'), (u'\xe4pu\xe4si', u'apuasi'), (u'Kuk\xe4', u'Kuka'), (u's\xe4noi', u'sanoi'), (u'\xe4ut\xe4n', u'autan'), (u'\xc4la', u'\xc4l\xe4'), (u'Han', u'H\xe4n'), (u'Mita', u'Mit\xe4'), (u'tama', u't\xe4m\xe4'), (u'Olettiellamme', u'Olet tiell\xe4mme'), (u'Kylani', u'Kyl\xe4ni'), (u'Iahdemme', u'l\xe4hdemme'), (u'viela', u'viel\xe4'), (u'yhdeksan', u'yhdeks\xe4n'), (u'Nasaviisaudet', u'N\xe4s\xe4viisaudet'), (u'L\xe1hemp\xe4n\xe4', u'L\xe4hemp\xe4n\xe4'), (u'tietaa', u'tiet\xe4\xe4'), (u'mentava', u'ment\xe4v\xe4'), (u'onk\xe4\xe4n', u'onkaan'), (u'tekemista', u'tekemist\xe4'), (u'Sina', u'Sin\xe4'), (u'sina', u'sin\xe4'), (u'kiitett\xe4v\xe1', u'kiitett\xe4v\xe4'), (u'edell\xe1mme', u'edell\xe4mme'), (u'eika', u'eik\xe4'), (u'Takanas\ufb02', u'Takanasi!'), (u'Iankaan', u'lankaan'), (u'v\xe4lloillens\xe4', u'valloillensa'), (u'siita', u'siit\xe4'), (u'Iohikaarmekuulan', u'lohik\xe4\xe4rmekuulan'), (u'Keta', u'Ket\xe4'), (u'nama', u'n\xe4m\xe4'), (u'ajateltavaal', u'ajateltavaa!'), (u'oll\xe4kseni', u'ollakseni'), (u'v\xe4rm\xe4', u'varma'), (u'hanta', u'h\xe4nt\xe4'), (u'hanelle', u'h\xe4nelle'), (u'Os\xe4\xe4tko', u'Osaatko'), (u'rajahteita', u'r\xe4j\xe4hteit\xe4'), (u'Jyashil', u'Jyashi!'), (u'Nama', u'N\xe4m\xe4'), (u'sita', u'sit\xe4'), (u'kosk\xe4\xe4n', u'koskaan'), (u'Viek\xe1\xe1', u'Viek\xe4\xe4'), (u'Pid\xe1tt\xe4k\xe4\xe4', u'Pid\xe4tt\xe4k\xe4\xe4'), (u'Oclottakaal', u'Odottakaa!'), (u'pelk\xe1\xe4m\xe1', u'pelk\xe4\xe4m\xe4'), (u'ost\xe4v\xe4nne', u'ostavanne'), (u'rovoill\xe4nne', u'rovoillanne'), (u'Jon\xe4in', u'Jonain'), (u"piit'taa", u'piittaa'), (u'>', u''), (u't\xe1ysikuu', u't\xe4ysikuu'), (u'sinutt\xe4nne', u'sinut t\xe4nne'), (u'Iahtea', u'l\xe4hte\xe4'), (u'Paastaksemme', u'P\xe4\xe4st\xe4ksemme'), (u'P\xe1rj\xe1\xe4mme', u'P\xe4rj\xe4\xe4mme'), (u'h\xe4nsk\xe4ss\xe4', u'hanskassa'), (u'Tama', u'T\xe4m\xe4'), (u'Menkaa', u'Menk\xe4\xe4'), (u'H\xe4ipyk\xe1\xe1', u'H\xe4ipyk\xe4\xe4'), (u'kasin', u'k\xe4sin'), (u'Tata', u'T\xe4t\xe4'), (u'Hylkaatk\xf6', u'Hylk\xe4\xe4tk\xf6'), (u'Paasta', u'P\xe4\xe4st\xe4'), (u'ry\xf6st\xe4\xe1', u'ry\xf6st\xe4\xe4'), (u'Iivist\xe4', u'livist\xe4'), (u'viivyt\xe1t', u'viivyt\xe4t'), (u'Pys\xe4htyk\xe1\xe4', u'Pys\xe4htyk\xe4\xe4'), (u'k\xe4nnoilt\xe4', u'kannoilta'), (u'k\xe1sken', u'k\xe4sken'), (u'Pys\xe4htyk\xe1\xe1', u'Pys\xe4htyk\xe4\xe4'), (u'huonoj\xe1tk\xe4', u'huono j\xe4tk\xe4'), (u'k\xe1tyrini', u'k\xe4tyrini'), (u'mitaan', u'mit\xe4\xe4n'), (u'Missa', u'Miss\xe4'), (u'kynt\xe4v\xe1n', u'kynt\xe4v\xe4n'), (u'p\xe4rj\xe1nneet', u'p\xe4rj\xe4nneet'), (u'ruok\xe4\xe4', u'ruokaa'), (u'm\xe4rjoj\xe4', u'marjoja'), (u'kuink\xe4', u'kuinka'), (u'oll\xe4', u'olla'), (u'missa', u'miss\xe4'), (u'Per\xe1\xe4nny', u'Per\xe4\xe4nny'), (u'Pysyk\xe1\xe4', u'Pysyk\xe4\xe4'), (u'Vetel\xe0t', u'Vetel\xe4t'), (u't\xe4pp\xe4\xe4', u'tappaa'), (u'ketaan', u'ket\xe4\xe4n'), (u'pelkaamaan', u'pelk\xe4\xe4m\xe4\xe4n'), (u'ovatja', u'ovat ja'), (u'ymmarra', u'ymm\xe4rr\xe4'), (u'ystv\xe4ni', u'yst\xe4v\xe4ni'), (u'K\xe4rp\xe1si\xe4k\xf6', u'K\xe4rp\xe4si\xe4k\xf6'), (u'mets\xe1st\xe4t', u'mets\xe4st\xe4t'), (u'Iiittya', u'liitty\xe4'), (u'Al\xe1', u'\xc4l\xe4'), (u'py\xf6rty\xe1', u'py\xf6rty\xe4'), (u'n\xe4l\xe4st\xe1', u'n\xe4l\xe4st\xe4'), (u'hyva', u'hyv\xe4'), (u'sy\xf6maan', u'sy\xf6m\xe4\xe4n'), (u'katyreita', u'k\xe4tyreit\xe4'), (u'Ep\xe1reilua', u'Ep\xe4reilua'), (u'L\xe4utt\xe4', u'Lautta'), (u'ilt\xe4n\xe4', u'iltana'), (u'T\xe4isimme', u'Taisimme'), (u'Voih\xe4n', u'Voihan'), (u'hittol\xe4inen', u'hittolainen'), (u'J\xe4', u'Ja'), (u'Iohik\xe1\xe1rmekivi', u'lohik\xe4\xe4rmekivi'), (u'siina', u'siin\xe4'), (u'Iaake', u'l\xe4\xe4ke'), (u'purrutjokin', u'purrut jokin'), (u'tahan', u't\xe4h\xe4n'), (u'paasseet', u'p\xe4\xe4sseet'), (u'Iaakkeen', u'l\xe4\xe4kkeen'), (u'Ieposija', u'leposija'), (u'Kylla', u'Kyll\xe4'), (u'pitkalta', u'pitk\xe4lt\xe4'), (u'eivat', u'eiv\xe4t'), (u'tanne', u't\xe4nne'), (u'taman', u't\xe4m\xe4n'), (u'Ehka', u'Ehk\xe4'), (u'han', u'h\xe4n'), (u'mista', u'mist\xe4'), (u'pidat', u'pid\xe4t'), (u'Joutuk\xe4\xe4', u'Joutukaa'), (u'Hanen', u'H\xe4nen'), (u'sisallaan', u'sis\xe4ll\xe4\xe4n'), (u'Pysyk\xe1\xe1', u'Pysyk\xe4\xe4'), (u'L\xe4htek\xe4\xe1', u'L\xe4htek\xe4\xe4'), (u'til\xe4\xe4n', u'tilaan'), (u'paatella', u'p\xe4\xe4tell\xe4'), (u'isani', u'is\xe4ni'), (u'paasemme', u'p\xe4\xe4semme'), (u'haipyivat', u'h\xe4ipyiv\xe4t'), (u'Teh\xe1n', u'Teh\xe4n'), (u'Hy\xf6kk\xe1\xe4tte', u'Hy\xf6kk\xe4\xe4tte'), (u'Iiikahdattekaan', u'liikahdattekaan'), (u'j\xe4', u'ja'), (u'v\xe4lmist\xe4uduin', u'valmistauduin'), (u'Hikavvassa', u'Hikawassa'), (u'Kuolel', u'Kuole!'), (u'hanen', u'h\xe4nen'), (u'yhta', u'yht\xe4'), (u'Sisalla', u'Sis\xe4ll\xe4'), (u'ruumiiss\xe4', u'ruumiissa'), (u'minka', u'mink\xe4'), (u'Iih\xe4\xe4', u'lihaa'), (u'Iuut\xe4', u'luuta'), (u'Sis\xe0ll\xe0mme', u'Sis\xe4ll\xe4mme'), (u'Tottelel', u'Tottele!'), (u'\xc4l\xe4j\xe4t\xe4', u'\xc4l\xe4 j\xe4t\xe4'), (u'aitisi', u'\xe4itisi'), (u'Mina', u'Min\xe4'), (u'ymmartamaan', u'ymm\xe4rt\xe4m\xe4\xe4n'), (u'sy\xf6daan', u'sy\xf6d\xe4\xe4n'), (u'p\xe4h\xe4lt\xe4', u'pahalta'), (u'D\xe4ku\xe4n', u'Dakuan'), (u'sirkutahti', u'sirkust\xe4hti'), (u'Iapiota', u'lapiota'), (u'mieltasi', u'mielt\xe4si'), (u'pitaisi', u'pit\xe4isi'), (u'vieda', u'vied\xe4'), (u't\xe1\xe1ll\xe4k\xe4\xe1n', u't\xe4\xe4ll\xe4k\xe4\xe4n'), (u'taytyy', u't\xe4ytyy'), (u'kivesta', u'kivest\xe4'), (u'etsia', u'etsi\xe4'), (u'Poikatyt\xf6st\xe0', u'Poikatyt\xf6st\xe4'), (u'hy\xf6kkasi', u'hy\xf6kk\xe4si'), (u'takaapain', u'takaap\xe4in'), (u'I\xe4skee', u'laskee'), (u'haipya', u'h\xe4ipy\xe4'), (u'tehcl\xe1kseni', u'tehd\xe4kseni'), (u'pi\xe4n', u'pian'), (u'tyrkytt\xe4\xe1', u'tyrkytt\xe4\xe4'), (u'minu\xe4', u'minua'), (u'n\xe1lk\xe1inen', u'n\xe4lk\xe4inen'), (u'Sydamet\xf6n', u'Syd\xe4met\xf6n'), (u'hylata', u'hyl\xe4t\xe4'), (u'yha', u'yh\xe4'), (u'k\xe4uniisti', u'kauniisti'), (u'ihmisverest\xe1', u'ihmisverest\xe4'), (u'Siii\xe4', u'Sin\xe4'), (u'h\xe4lu\xe4t', u'haluat'), (u'Iahemmin', u'l\xe4hemmin'), (u'kayttaa', u'k\xe4ytt\xe4\xe4'), (u'hyvaksi', u'hyv\xe4ksi'), (u'paase', u'p\xe4\xe4se'), (u'siivilla', u'siivill\xe4'), (u'j\xe4lkel\xe4is\xe1', u'j\xe4lkel\xe4isi\xe4'), (u'syista', u'syist\xe4'), (u'pyh\xe1\xe4', u'pyh\xe4\xe4'), (u'Tyhmat', u'Tyhm\xe4t'), (u'pyytavat', u'pyyt\xe4v\xe4t'), (u'H\xf6lynp\xf6ly\xe4l', u'H\xf6lynp\xf6ly\xe4!'), (u'Nakivat', u'N\xe4kiv\xe4t'), (u'kannissa', u'k\xe4nniss\xe4'), (u'kasivarren', u'k\xe4sivarren'), (u'h\xe1nenlaisensa', u'h\xe4nenlaisensa'), (u'sol\xe4\xe4', u'solaa'), (u'Iiioitella', u'liioitella'), (u'Iiioittele', u'liioittele'), (u'Tiedathan', u'Tied\xe4th\xe4n'), (u'pyh\xe1st\xe4', u'pyh\xe4st\xe4'), (u'Iohik\xe1\xe1rmekivest\xe4', u'lohik\xe4\xe4rmekivest\xe4'), (u'Ymm\xe1rr\xe1t', u'Ymm\xe4rr\xe4t'), (u'\xe4rmonne', u'armonne'), (u'n\xe4isten', u'naisten'), (u'Iup\xe4ukseni', u'lupaukseni'), (u'kekseli\xe1isyytesi', u'kekseli\xe4isyytesi'), (u'Iaudalta', u'laudalta'), (u'kest\xe1vyytesi', u'kest\xe4vyytesi'), (u'taiclakaan', u'taidakaan'), (u'tytt\xf6ystava', u'tytt\xf6yst\xe4v\xe4'), (u'sormiss\xe4ni', u'sormissani'), (u'r\xe4ivois\xe4n', u'raivoisan'), (u'k\xe4rhun', u'karhun'), (u'helvetista', u'helvetist\xe4'), (u'v\xe4i', u'vai'), (u'poiss\xe4', u'poissa'), (u'elamani', u'el\xe4m\xe4ni'), (u'pitk\xe1tjalkasi', u'pitk\xe4t jalkasi'), (u'Kadet', u'K\xe4det'), (u'niita', u'niit\xe4'), (u'Kaske', u'K\xe4ske'), (u'paastaa', u'p\xe4\xe4st\xe4\xe4'), (u'Pida', u'Pid\xe4'), (u'Iohikaarmekivi', u'lohik\xe4\xe4rmekivi'), (u'sinust\xe4', u'sinusta'), (u'sy\xf6ksyyjo', u'sy\xf6ksyy jo'), (u'veljeasi', u'velje\xe4si'), (u'Odot\xe4', u'Odota'), (u'Pys\xe1hdy', u'Pys\xe4hdy'), (u'kivea', u'kive\xe4'), (u'Missaan', u'Miss\xe4\xe4n'), (u'tihe\xe1mpi', u'tihe\xe4mpi'), (u'Iuulitkaan', u'luulitkaan'), (u'kaarmekuula', u'k\xe4\xe4rmekuula'), (u'muttaj\xe4t\xe4n', u'mutta j\xe4t\xe4n'), (u'kuoletl', u'kuolet!'), (u'Iohikaarmekuula', u'lohik\xe4\xe4rmekuula'), (u'kieltava', u'kielt\xe4v\xe4'), (u'L\xe1htek\xe1\xe1', u'L\xe4htek\xe4\xe4'), (u'Iohik\xe1\xe4rmekuulaa', u'lohik\xe4\xe4rmekuulaa'), (u'hereilla', u'hereill\xe4'), (u'kaljupaa', u'kaljup\xe4\xe4'), (u'\xe4nt\xe4m\xe4ll\xe4', u'antamalla'), (u'kuul\xe4n', u'kuulan'), (u't\xe4k\xe4isin', u'takaisin'), (u'puolikk\xe4\xe4n', u'puolikkaan'), (u'pohjoisessaja', u'pohjoisessa ja'), (u'metsasta', u'mets\xe4st\xe4'), (u'Iohik\xe4\xe4rmekuul\xe4lle', u'lohik\xe4\xe4rmekuulalle'), (u'teita', u'teit\xe4'), (u'Linnutk\xe4\xe4n', u'Linnutkaan'), (u'Puolikk\xe4\xe4n', u'Puolikkaan'), (u'\xe4nt\xe4nut', u'antanut'), (u'tiedan', u'tied\xe4n'), (u'her\xe1tt\xe1m\xe1ss\xe1', u'her\xe4tt\xe4m\xe4ss\xe4'), (u'I\xe4sin', u'lasin'), (u'h\xe4t\xe1n\xe4', u'h\xe4t\xe4n\xe4'), (u'I\xf6ysitte', u'l\xf6ysitte'), (u"a//\u0131'gaal'tor\u0131h", u'alligaattorin'), (u'Tyttbparka', u'tytt\xf6parka'), (u'b\xe4n\xe3\xe4', u'b\xe4n\xe4\xe4'), (u'Co/en', u'Colen'), (u'Iapsiko\u0131fin', u'lapsikortin'), (u'rauhallisemminl', u'rauhallisemmin!'), (u'Iahjasi', u'lahjasi'), (u'Ruokih\xe4net', u'Ruoki h\xe4net'), (u'I\xf6ystymist\xe4', u'l\xf6ystymist\xe4'), (u'Iapsestaan', u'lapsestaan'), (u'Iaatuaikaa', u'laatuaikaa'), (u'Ioukkaannuit', u'loukkaannuit'), (u'Ioistojuttu', u'loistojuttu'), (u'Ioukkaavaa', u'loukkaavaa'), (u'Ioukkaan', u'loukkaan'), (u"l'\u0131ed\xe4n", u'Tied\xe4n'), (u'Iy\xf6m\xe4st\xe4', u'ly\xf6m\xe4st\xe4'), (u'C/\u0131\xe2teauneuf', u'Ch\xe2teauneuf'), (u'Iikaisten', u'likaisten'), (u'Iapsenlapseton', u'lapsenlapseton'), (u'Ieukani', u'leukani'), (u'Ientokonetta', u'lentokonetta'), (u'Iorrainea', u'lorrainea'), (u'Iastentarhaan', u'lastentarhaan'), (u'Iupaavin', u'lupaavin'), (u'Iastenhoitaja', u'lastenhoitaja'), (u'Kegeleit\xe3', u'Kegeleit\xe4'), (u'helkkaril', u'helkkari!'), (u'Ieukaani', u'leukaani'), (u'Iaihtuneen', u'laihtuneen'), (u'Iahjoittamaan', u'lahjoittamaan'), (u'tref\ufb02t', u'treffit'), (u'I\xf6ysyys', u'l\xf6ysyys'), (u'Diggleri\xe3', u'Diggleri\xe4'), (u'Ku\u0131fi//a', u'Kurtilla'), (u'pys\xe3hdell\xe4', u'pys\xe4hdell\xe4'), (u'Iomaasi', u'lomaasi'), (u'Iastattu', u'lastattu'), (u'Iasinne', u'lasinne'), (u'Iuihin', u'luihin'), (u'Iastensuojelujuttuun', u'lastensuojelujuttuun'), (u'Ieffaan', u'leffaan'), (u'mulkkul', u'mulkku!'), (u'Iapsenvahtia', u'lapsenvahtia'), (u'I\xe4hell\xe4si', u'l\xe4hell\xe4si'), (u'st\xe3', u'st\xe4'), (u'TOSi', u'Tosi'), (u'Ioistoidea', u'loistoidea'), (u'Ty\u0131si\xe4', u'Tylsi\xe4'), (u'lsi', u'Isi'), (u'Iaastarin', u'laastarin'), (u'Viewjatkuu', u'View jatkuu'), (u'lnStylen', u'InStylen'), (u'k\xf6ril\xe4sl', u'k\xf6ril\xe4s!'), (u'Ieffoissa', u'leffoissa'), (u'Ieffaseuraksi', u'leffaseuraksi'), (u'Iueskelemaan', u'lueskelemaan'), (u'Mit\xe4j\xe4tk\xe4', u'Mit\xe4 j\xe4tk\xe4'), (u'Iaukesitkaan', u'laukesitkaan'), (u'Kiit\xe3', u'Kiit\xe4'), (u'\xc4\xe3Ii\xf6', u'\xc4\xe4li\xf6'), (u'Iyhytp\xf6ksy', u'lyhytp\xf6ksy'), (u'Iacrosse', u'lacrosse'), (u'I\xf6yt\xe3m\xe3tt\xe3', u'l\xf6yt\xe4m\xe4tt\xe4'), (u'samojajuttuja', u'samoja juttuja'), (u'J\xe4rvellel', u'J\xe4rvelle!'), (u'Talouspaperitl', u'Talouspaperit!'), (u'\xc4lk\xe4\xe3s', u'\xc4lk\xe4\xe4s'), (u'pillunaamal', u'pillunaama!'), (u'poikayst\xe4v\xe4ns\xe3', u'poikayst\xe4v\xe4ns\xe4'), (u'Iapsenvahti', u'lapsenvahti'), (u'Nykist\xe3', u'Nykist\xe4'), (u'Iaatuaikamme', u'laatuaikamme'), (u'K\xe4\xe3nsin', u'K\xe4\xe4nsin'), (u'Iatinaksi', u'latinaksi'), (u'yleens\xe4juo', u'yleens\xe4 juo'), (u'kreisej\xe3juttuja', u'kreisej\xe4 juttuja'), (u'Iiitostasi', u'liitostasi'), (u'Mit\xe4jos', u'Mit\xe4 jos'), (u'Sinullaja', u'Sinulla ja'), (u'Iempparini', u'lempparini'), (u'Iienetkin', u'lienetkin'), (u'Iuokkajuhla', u'luokkajuhla'), (u'Iuokkakokouksesta', u'luokkakokouksesta'), (u'Iukuteeman', u'lukuteeman'), (u'Menejo', u'Mene jo'), (u'Sin\xe3j\xe4tit', u'Sin\xe4 j\xe4tit'), (u'I\xe4ht\xf6\xe3si', u'l\xe4ht\xf6\xe4si'), (u'I\xe3\xe4kikseen', u'l\xe4\xe4kikseen'), (u'puhuajostain', u'puhua jostain'), (u'tavatajoku', u'tavata joku'), (u'Iookia', u'lookia'), (u'Iapsiyst\xe4v\xe4llisemp\xe3n\xe3', u'lapsiyst\xe4v\xe4llisemp\xe4n\xe4'), (u'is\xe3nn\xe4lle', u'is\xe4nn\xe4lle'), (u't\xe3', u't\xe4'), (u'Ieidi', u'leidi'), (u'K\xe3visik\xf6', u'K\xe4visik\xf6'), (u'maris\xe3tk\xe4', u'maris\xe4tk\xe4'), (u'k\xe4nniss\xe4j\xe4rveen', u'k\xe4nniss\xe4 j\xe4rveen'), (u'sinullajotain', u'sinulla jotain'), (u'Iuntun', u'luntun'), (u'Iunttu', u'lunttu'), (u'Iukitsin', u'lukitsin'), (u'jyyst\xe3\xe4', u'jyyst\xe4\xe4'), (u'Iuokkajuhlaan', u'luokkajuhlaan'), (u'Michellest\xe3', u'Michellest\xe4'), (u'Iuokkakokous', u'luokkakokous'), (u'sin\xe4ja', u'sin\xe4 ja'), (u'Sin\xe3ja', u'Sin\xe4 ja'), (u'Sill\xe3joskus', u'Sill\xe4 joskus'), (u'Iopetimme', u'lopetimme'), (u'Ymm\xe3rr\xe3tk\xf6', u'Ymm\xe4rr\xe4tk\xf6'), (u'kanssajoka', u'kanssa joka'), (u'Iiioitellusti', u'liioitellusti'), (u'Iaihalta', u'laihalta'), (u'Miaja', u'Mia ja'), (u'Mietit\xe3\xe4np\xe3', u'Mietit\xe4\xe4np\xe4'), (u'Ky\u0131\u0131\xe4', u'Kyll\xe4'), (u'Pid\xe3ttelel', u'Pid\xe4ttele!'), (u'ymm\xe4rt\xe3misest\xe4', u'ymm\xe4rt\xe4misest\xe4'), (u'jaj\xe4\xe4n', u'ja j\xe4\xe4n'), (u'Selenaja', u'Selena ja'), (u'Iuokkakokousta', u'luokkakokousta'), (u'\xe1k\xe1pussi', u'\xe4k\xe4pussi'), (u'karkoituksen', u'karkotuksen')]),
+                        'pattern': u"(?um)(\\b|^)(?:kellojo|onjo|senj\\\xe4lkeen|Ts\\\xe4u|hydraulinenjousitus|Kevyetja|Oleijo|viimeinenjuna|n\\\xe4ytt\\\xe4\\\xe4jotenkin|onjoku|Iapsuuteen|Ieikitjunill\\\xe4|Sfiy|Iukulasejani|Ieikkiminen|K\\\xe4\\\xe4lik\\\xe4\\\xe4rylepizz\\\xe4|sukl\\\xe4\\\xe4k\\\xe4stikkeen|p\\\xe4istetun|b\\\xe4n\\\xe4\\\xe4nin|pifi|a\\\u0131keasfaan|Stg|sikain\\\ufb02uenssatja|Hienojuna|kiinnostuajunista|h\\\xe4y\\\u0131yvetu\\\u0131\\\xedn|pienaismalli|ena|racfios\\\xe3hk\\\xe4ff\\\xe1j\\\xe3n\\\xe3|Amenkan|laiva\\/la|0\\/in|Junaha\\\u0131rasfus|enasfa|\\/V\\\u0131\\\xedn|Oliivarmasii|Internetist\\\xe4juuri|hu\\\u0131janj\\\xe3nniff\\\xe5v\\\xe3\\\xe0l|Vaikkajunat|k\\\xe4\\\xe4ntyija|osaajotain|Ieikill\\\xe4mme|Bellinjuna|t\\\xe4st\\\xe4johtolangasta|tuntisijonkun|Olgajotain|tulokseivuodesia|tuloksetvuodesta|Vainjalkapallo|lloveyou|po\\\ufb02\\\u2039aisi|minufulos|Ieiv\\\xe4npaahdinl|Ieiv\\\xe4npaahdinta|asuajossain|Koiratjuoksentelivat|tiet\\\xe4\\\xe4jotain|osaatjuna|va\\/as|va\\/asperhe|koskeejotain|I\\\xe4\\\xe4kkeens\\\xe4|Iaulavan|Kuulitj\\\xe4\\\xe4n|Ievolle|Va\\/aa\\/\\/e|va\\/aa\\/\\/a|I\\\xe4hdenkin|Iakkiin|Iohik\\\xe4\\\xe4rmeell\\\xe4|Mik\\\u0131|Iukossa|Va\\/aan|s\\\xe4ve\\/m\\\xe4|j\\\xe4\\/\\/een|P\\\xf6\\\xf6\\\u0131|Hnjaa|Iiftasin|Jute\\/\\/aan|Iohduttamaan|L\\'lYP\\\xe4f\\\xe4\\\xe4n|\\\xc4\\\u0131r\\\u0131\\\u0131|F\\\u0131\\\u0131\\\u0131p\\\u0131|Yr\\\u203ar\\\u203a\\\xe4\\\xe4\\\u0131|Miki|Heng\\\u0131r\\\xe4\\\u0131|Va\\/as|Ko\\/\\/\\/is|Audieja|I\\/man|\\/entotukia\\/ukse\\/ta|\\/aivastosta|\\/entotukikohtaan|tu\\/ee|akse\\/iva\\/\\/at|a\\\u0131\\\u0131ek\\\u0131rjo\\\u0131rerr\\\u0131\\\u0131n|Iitkua|0li|Iaskuvarjojoukkoihin|Iaskuvarjojoukoissa|Tarvitsetjotain|Ieukaremmi|Iainaatko|p\\\xe4\\\xe4llik\\\xf6lleja|I\\\xe4hell\\\xe4ni|Soti\\/aan|va\\/\\/attava|viho\\/\\/ise\\/ta|\\/iittoutuneet|voitjohtaa|pohditkojotain|viho\\/\\/ista|sej\\\xe4isi|Ient\\\xe4jill\\\xe4|Soltutl|Iaulustamme|Iakkiani|Iiemeen|kanadala\\\u0131\\\u0161ia|si\\/\\/anp\\\xe4\\\xe4asema|vahv\\\u0131\\\u0161tettiin|tu\\/ituki|eliitt\\\u0131joukkoa|pa\\\u0131ka\\\u0131\\\u0131as\\\u0131\\\u0131|Ieikkinyt|Iujitettu|Ete\\/\\\xe4|viho\\/\\/isranna\\/\\/e|sivusta\\/ta|\\/oppuisi|Iaskuvarjojoukkojen|p\\\xe4\\\xe4tt\\\xe4nytj\\\xe4\\\xe4d\\\xe4|Iuutnanteille|I\\\xe4ht\\\xf6valmiiksi|Iokoisat|Korjaus\\/ukemat|tanke\\/\\/\\/e|ky\\\u0131\\\u0131\\\xe4\\\u0131|Iisti\\\xe4|Kunniamita\\/in|Vemon|fied\\\xe3n|Ei\\\u0131is|Inlem\\\xe4tion\\\xe4|holelfss\\\xe4|Han\\\u0131ey|peikk\\\xe4|Ehisl\\\xe3|Y\\\ufb02\\\xe3ll\\\xe3v\\\xe3|mahdolisuus|loisteiaan|aku|Garonilie|Iikainen|vaiehtelijoita|puutari\\\u0131aasi|Garunin|oravaietti\\\xe4|paijon|sutja|gospeikvartetissa|Iauiajaksi|viihdylt\\\xe4j\\\xe4|hannaala|Iaulajalta|saatjotain|L\\\xf6yd\\\xe4njonkun|py\\\xfcr\\\xedyi|Cn\\\u0131dupia|Iiikaa|ke\\\u0131taa|Thafs|Kappaietta|soijoka|Levytl\\\xe4|paiaamista|kuonnunn|Tytt\\\xfcyst\\\xe4v\\\xe4t|k\\\xe3p\\\xe3l\\\xf6ifiin|Oiko|tuipalo|hebofiavaa|ongeina|ongeimia|Ajateikaa|ku\\\u0131ki|lhailen|L\\\xe4ht\\\xfcsi|yhti\\\xf6ile|eitoimi|voij\\\xe4\\\xe4d\\\xe4|Pomkat|kon\\\u0131ata|konsentien|Sep\\\xe3|hebolus|k\\\xfcyryss\\\xe4|repiat|kuikee|pon\\\u0131koita|naisetja|ten\\\u0131etuileeksi|yl\\\xe4puolelia|kuullut180|Iapsellista|esiinnytja|Iaulat|Henanjestas|teilie|IIe|t\\\xe4ilaisia|Varu|nimeli\\\xe4\\\xe4n|anneijaan|pen\\\u0131staa|minkkitu\\\u0131kkia|minkkituiiiilla|Ten\\\u0131etuioa|kuitalevy\\\xe4|ei\\\xe4m\\\xe4ss\\\xe4|jutkaisua|Fo\\\u0131t|oien|asioilie|Eitarvitsekaan|p\\\xf6kenyin|yll\\\xe4iiyy|komeaita|Chadie|laulaisilteko|Iaittaa|iytt\\\xe4renne|pikkutytt\\\xfcn\\\xe4|tytt\\\xfckulta|vimuilua|reporitereita|vime|eijohdu|eriiainen|Iasketa|kem\\\u0131ttu|Manyja|etteijutusta|Katifomiassa|sun\\\xb0filaudan|bn\\\u0131netti|vaimiina|yiim\\\xe4\\\xe4r\\\xe4iset|leffatj\\\xe4\\\xe4|koin\\'lle|T\\\xe4ilaisen|antanutjo|Cha\\\u0131lien|ymp\\\xe4riliesi|Iy\\\xfc|lopan\\'t|h\\\u0131isi|kuuiuvanijonnekin|juh\\\u0131n|miefkseni|Tuisitko|I\\\u0131on\\\xe4ni|\\\xe4k\\\xe4\\\xe4|yi|rupallelemaan|Priscilialla|Hemmoltelet|Hearlbreak|Holelia|Nyton|kiertueeile|Elvist\\\xe3|puoleila|\\\xc4\\\u0131\\\xe4|lnlemalional|Iuottamustanne|Mycroft\\\xedsta|Iopettako|Ielukauppa|Iomamatkalle|Iyhyelle|Alk\\\xe4\\\xe4|K\\_uka|IIa|Aitinne|V\\\xe4\\/ikohtaus|kuo\\/\\/aan|n\\\xe4\\/k\\\xe4\\\xe4n|Su\\/je|I\\\xe4im\\\xe4ytit|I\\\xe4hetyst\\\xf6ss\\\xe4|I\\\xe4hetyst\\\xf6\\\xf6n|Iaosilainen|Iiiketarjous|kaappavat|Ieiviss\\\xe4\\\xe4n|EriC|Voi\\/\\\xe0|Crawley\\\u0131|Iihaksiaan|Iuenkaan|Olemma|I\\\xe4htisitte|jot\\\xe2in|Eversi|Ieiriyty\\\xe4|Iiikutte|I\\\xe4\\\xe4ketiedett\\\xe4|Iivet\\\xe4|Iapsetkin|I\\\xe4\\\xe4keluettelo|Iaatiko|hyvih|Ieukakuoppa|Ient\\\xe4j\\\xe4ni|Ieikkisi|Iupaamastaan|ku\\/taseni|tu\\/en|Iautalle|100\\_vuotiaaksi|\\_|Viilt\\\xe4j\\\xe3\\_Jackin|keff\\\xe4rfkerro|tan\\/itsi|\\_Aivan|\\_Valosta|\\_Teemmek\\\xf6|Viilt\\\xe4j\\\xe4\\_Jack|\\_Voi|\\_Tied\\\xe4tte|kulunutjo|Vuokra\\_auto|\\_Tuokaa|\\_Tunnetteko|\\_Tied\\\xe4mme|toissay\\\xf6n|\\_Toki|\\_Ammuttu|\\_Jahtasit|\\_Tunnenko|\\_Joku|\\_Taivahan|Kuorma\\_auto|\\_Vain|Mesmer\\_klubille|0nslow\\'IIe|Mesmer\\_klubi|\\_Anteeksi|Schrenk\\_Notzing|\\_Tapoin|\\_AIk\\\xe4\\\xe4|0dotan|Iuonteenlu|Iempikaupunkini|Iavasta|I\\\xe4mmittelij\\\xe4t|Iaastaria|Riiu\\\xe4\\\xe4|K\\\xe4yu\\\xe4v\\\xe4tk\\\xf6|I\\\xe4hestyk\\\xf6|Ieikekirja|Ievyj\\\xe4\\\xe4n|Iahjoitamme|L\\\xe4pp\\\xe4\\\xe4tuohon|CIawdy|mita|jalkeen|Cannabisjaponica|Ieningin|ki\\\u0131joitatte|ki\\\u0131joitetuksi|kuluttuu|Iuvulta|Ieipomiskilpailuun|Maclntire|Iehteemme|Al\\\xe4|kysesss\\\xe4|Itsepuolustustal|Iiipasimesta|Iuutani|Iahjansa|I\\\xe4himm\\\xe4isemme|Iuhistuu|\\\u0131\\\xf6yhk\\\xe4|Iehtileikkeleit\\\xe4|vefieni|Iapselleni|ep\\\xe4normaalinal|Iuurankoja|Iuurangoista|p\\\xe4\\\xe4tiellel|Valonneitsytta|Iohik\\\xe1\\\xe1rmekuula|yhdella|Tasta|\\_\\_|Alk\\\xe1\\\xe4|etta|pitaa|n\\\xe4lk\\\xe1isi\\\xe4|Hyva|hyvasta|ruoastaja|K\\\xe1sivarteni|k\\\xe4ikki|Mozukust\\\xe4|Etsiv\\\xe1tk\\\xf6|Iohik\\\xe1\\\xe1rmekuulaa|Valonneitsytt\\\xe1|taalla|siemeni\\\xe1\\\xe1n|kunh\\\xe4n|\\\xe4j\\\xe4ttelen|pelkuril|kyla|hy\\\xf6kk\\\xe1ykselt\\\xe4|hy\\\xf6kk\\\xe1isi|hy\\\xf6kataan|Voitjuoda|Iittaamisesta|Iahtenyt|kylasta|Etjuurik\\\xe4\\\xe4n|s\\\xe4m\\\xe4lt\\\xe4|k\\\xe4ikki\\\xe4ll\\\xe4|ehka|tiennytkaan|taistelenl|Iiikkeita|Taistellaanl|Odott\\\xe4m\\\xe4ttom\\\xe4t|n\\\xe4utinnot|rikk\\\xe4\\\xe4n|Iuotettavalta|elaa|pekki\\\xe3|j\\\xe3keen|n\\\xf6rttej\\\xe3|pen\\\u0131skursseja|Suorititjo|sein\\\xe4il\\\xe4|Iaiteta|hennostu|Coiumbiassa|Pen\\\u0131erssi\\\xe4|sukupuoieimisl\\\xe3|ep\\\xe3iooginen|oisin|iittoni|oisi|asuntoia|p\\\xe4\\\xe4sittejatkoseminaariini|An\\\u0131atkaapa|Iopussa|Oletjo|Haiuan|luennoilie|Iintsata|oletjuuri|Iuuietko|kylvyss\\\xe3|v\\\xe3l\\\xe3hti|Miettik\\\xe3\\\xe3|insin\\\xf6\\\xfcn|Menithalpaan|Tukaa|Aarun|Kieleil\\\xe4si|pystytjohonkin|K\\\xe4mppikseniWilliam|Iuolamies|keskian\\\u0131on|kananosta|p\\\xe4iv\\\xe4lliselie|Iasagnea|voitehota|0lisit|menijuuri|tapasivatjo|kn\\\u0131unukoriiiliiset|eijuo|N\\\xe4yt\\\xe4tuupuneeita|Etan\\\u0131aakaan|lhanko|y\\\ufb02t\\\xe4k\\\xe4\\\xe4n|serkkuniWinn|voijatkua|miehetja|v\\\xedesfin\\\xed|kuull\\\u0131lsinusla|T\\\xe3m\\\xe3|kel\\\xe3\\\xe3n|vedess\\\xe3k\\\xe3veij\\\xe3|\\/abrassa|akaa|Iiinaa|kan\\\u0131ainen|oten|kallaisesi|pmffa|tulitt\\\xe4nne|Alalteko|luuiisit|Pys\\\xe3hdy|Paskath\\\xe4nest\\\xe4|Pys\\\xe3hdyheti|Heivetti|Pid\\\xe3l\\\xe3n|V\\\ufb02ru|huolissasijostain|hurmaavatpuhelusi|yst\\\xe4vysiyin|Cunya|cunya|kohdaliani|an\\\u0131oista|Loputn\\\xe4kev\\\xe4tn\\\xe4lk\\\xe4\\\xe4|oletollut|j\\\xe4ikin\\\u0131oan|Saath\\\xe4net|Kem\\\u0131n|kappaieiksi|vuok\\\u0131anja|iyperys|mmanltisella|\\\u0131akastellut|jutteiimme|vesimittann|kuikevat|tavaratja|piiltaal|etehk\\\xe4|Lapsenvahtisituli|Ymm\\\xe4n\\\xe4lk\\\xf6|iyii\\\xe3resi|my\\\xf6h\\\xe3|n\\\xe4hnytAaron|haiunnut|Olitoikeassa|itseenijuuri|lempin\\\u0131okaani|Iupaamaan|Teetsoimun|Sen\\\u0131ice|Iasini|Ieuassa|Iiikekumppaninsa|Iiikekumppani|Iausuttiinkaan|Iastauslaiturille|Oleko|tie\\/t\\\xe4|Mayhew\\'IIe|Iakiasiaintoimisto|Iakimiest\\\xe4|ne\\/\\/eens\\\xe4|ha\\/\\/ituksiin|soti\\/aa\\/\\/isiin|Iahtasit|Tiestik\\\xf6|Iakimiehi\\\xe4|\\\xc4l\\\xe4k\\\xe4\\\xe4|O\\/en|minsta|Iuennosta|Iakimiehest\\\xe4|Iopetatte|0\\/it|tu\\/it|Mayhew\\'Ita|I\\\xe4hiet\\\xe4isyydell\\\xe4|ennenkuin|nukku\\\xe4|ihmisia|eloss\\\xe4|tiedett\\\xe4v\\\xe1|Etsik\\\xe1\\\xe1|A\\\u0131ja\\\u0131|V\\\xe4lonneitsyen|Iup\\\xe4ust\\\xe4si|Y\\\xe4mikugyo|ep\\\xe4onnistumisi\\\xe4|Ymm\\\xe1rr\\\xe4tk\\\xf6|Iohik\\\xe4\\\xe4rmekuula|tasta|taynna|mina|tata|tyhmaa|enemman|p\\\xe1tev\\\xf6ity|kylla|\\\xe4rvok\\\xe4st\\\xe4|selviytyj\\\xe1ksi|myyda|hanet|\\\xe4pu\\\xe4si|Kuk\\\xe4|s\\\xe4noi|\\\xe4ut\\\xe4n|\\\xc4la|Han|Mita|tama|Olettiellamme|Kylani|Iahdemme|viela|yhdeksan|Nasaviisaudet|L\\\xe1hemp\\\xe4n\\\xe4|tietaa|mentava|onk\\\xe4\\\xe4n|tekemista|Sina|sina|kiitett\\\xe4v\\\xe1|edell\\\xe1mme|eika|Takanas\\\ufb02|Iankaan|v\\\xe4lloillens\\\xe4|siita|Iohikaarmekuulan|Keta|nama|ajateltavaal|oll\\\xe4kseni|v\\\xe4rm\\\xe4|hanta|hanelle|Os\\\xe4\\\xe4tko|rajahteita|Jyashil|Nama|sita|kosk\\\xe4\\\xe4n|Viek\\\xe1\\\xe1|Pid\\\xe1tt\\\xe4k\\\xe4\\\xe4|Oclottakaal|pelk\\\xe1\\\xe4m\\\xe1|ost\\\xe4v\\\xe4nne|rovoill\\\xe4nne|Jon\\\xe4in|piit\\'taa|\\>|t\\\xe1ysikuu|sinutt\\\xe4nne|Iahtea|Paastaksemme|P\\\xe1rj\\\xe1\\\xe4mme|h\\\xe4nsk\\\xe4ss\\\xe4|Tama|Menkaa|H\\\xe4ipyk\\\xe1\\\xe1|kasin|Tata|Hylkaatk\\\xf6|Paasta|ry\\\xf6st\\\xe4\\\xe1|Iivist\\\xe4|viivyt\\\xe1t|Pys\\\xe4htyk\\\xe1\\\xe4|k\\\xe4nnoilt\\\xe4|k\\\xe1sken|Pys\\\xe4htyk\\\xe1\\\xe1|huonoj\\\xe1tk\\\xe4|k\\\xe1tyrini|mitaan|Missa|kynt\\\xe4v\\\xe1n|p\\\xe4rj\\\xe1nneet|ruok\\\xe4\\\xe4|m\\\xe4rjoj\\\xe4|kuink\\\xe4|oll\\\xe4|missa|Per\\\xe1\\\xe4nny|Pysyk\\\xe1\\\xe4|Vetel\\\xe0t|t\\\xe4pp\\\xe4\\\xe4|ketaan|pelkaamaan|ovatja|ymmarra|ystv\\\xe4ni|K\\\xe4rp\\\xe1si\\\xe4k\\\xf6|mets\\\xe1st\\\xe4t|Iiittya|Al\\\xe1|py\\\xf6rty\\\xe1|n\\\xe4l\\\xe4st\\\xe1|hyva|sy\\\xf6maan|katyreita|Ep\\\xe1reilua|L\\\xe4utt\\\xe4|ilt\\\xe4n\\\xe4|T\\\xe4isimme|Voih\\\xe4n|hittol\\\xe4inen|J\\\xe4|Iohik\\\xe1\\\xe1rmekivi|siina|Iaake|purrutjokin|tahan|paasseet|Iaakkeen|Ieposija|Kylla|pitkalta|eivat|tanne|taman|Ehka|han|mista|pidat|Joutuk\\\xe4\\\xe4|Hanen|sisallaan|Pysyk\\\xe1\\\xe1|L\\\xe4htek\\\xe4\\\xe1|til\\\xe4\\\xe4n|paatella|isani|paasemme|haipyivat|Teh\\\xe1n|Hy\\\xf6kk\\\xe1\\\xe4tte|Iiikahdattekaan|j\\\xe4|v\\\xe4lmist\\\xe4uduin|Hikavvassa|Kuolel|hanen|yhta|Sisalla|ruumiiss\\\xe4|minka|Iih\\\xe4\\\xe4|Iuut\\\xe4|Sis\\\xe0ll\\\xe0mme|Tottelel|\\\xc4l\\\xe4j\\\xe4t\\\xe4|aitisi|Mina|ymmartamaan|sy\\\xf6daan|p\\\xe4h\\\xe4lt\\\xe4|D\\\xe4ku\\\xe4n|sirkutahti|Iapiota|mieltasi|pitaisi|vieda|t\\\xe1\\\xe1ll\\\xe4k\\\xe4\\\xe1n|taytyy|kivesta|etsia|Poikatyt\\\xf6st\\\xe0|hy\\\xf6kkasi|takaapain|I\\\xe4skee|haipya|tehcl\\\xe1kseni|pi\\\xe4n|tyrkytt\\\xe4\\\xe1|minu\\\xe4|n\\\xe1lk\\\xe1inen|Sydamet\\\xf6n|hylata|yha|k\\\xe4uniisti|ihmisverest\\\xe1|Siii\\\xe4|h\\\xe4lu\\\xe4t|Iahemmin|kayttaa|hyvaksi|paase|siivilla|j\\\xe4lkel\\\xe4is\\\xe1|syista|pyh\\\xe1\\\xe4|Tyhmat|pyytavat|H\\\xf6lynp\\\xf6ly\\\xe4l|Nakivat|kannissa|kasivarren|h\\\xe1nenlaisensa|sol\\\xe4\\\xe4|Iiioitella|Iiioittele|Tiedathan|pyh\\\xe1st\\\xe4|Iohik\\\xe1\\\xe1rmekivest\\\xe4|Ymm\\\xe1rr\\\xe1t|\\\xe4rmonne|n\\\xe4isten|Iup\\\xe4ukseni|kekseli\\\xe1isyytesi|Iaudalta|kest\\\xe1vyytesi|taiclakaan|tytt\\\xf6ystava|sormiss\\\xe4ni|r\\\xe4ivois\\\xe4n|k\\\xe4rhun|helvetista|v\\\xe4i|poiss\\\xe4|elamani|pitk\\\xe1tjalkasi|Kadet|niita|Kaske|paastaa|Pida|Iohikaarmekivi|sinust\\\xe4|sy\\\xf6ksyyjo|veljeasi|Odot\\\xe4|Pys\\\xe1hdy|kivea|Missaan|tihe\\\xe1mpi|Iuulitkaan|kaarmekuula|muttaj\\\xe4t\\\xe4n|kuoletl|Iohikaarmekuula|kieltava|L\\\xe1htek\\\xe1\\\xe1|Iohik\\\xe1\\\xe4rmekuulaa|hereilla|kaljupaa|\\\xe4nt\\\xe4m\\\xe4ll\\\xe4|kuul\\\xe4n|t\\\xe4k\\\xe4isin|puolikk\\\xe4\\\xe4n|pohjoisessaja|metsasta|Iohik\\\xe4\\\xe4rmekuul\\\xe4lle|teita|Linnutk\\\xe4\\\xe4n|Puolikk\\\xe4\\\xe4n|\\\xe4nt\\\xe4nut|tiedan|her\\\xe1tt\\\xe1m\\\xe1ss\\\xe1|I\\\xe4sin|h\\\xe4t\\\xe1n\\\xe4|I\\\xf6ysitte|a\\/\\/\\\u0131\\'gaal\\'tor\\\u0131h|Tyttbparka|b\\\xe4n\\\xe3\\\xe4|Co\\/en|Iapsiko\\\u0131fin|rauhallisemminl|Iahjasi|Ruokih\\\xe4net|I\\\xf6ystymist\\\xe4|Iapsestaan|Iaatuaikaa|Ioukkaannuit|Ioistojuttu|Ioukkaavaa|Ioukkaan|l\\'\\\u0131ed\\\xe4n|Iy\\\xf6m\\\xe4st\\\xe4|C\\/\\\u0131\\\xe2teauneuf|Iikaisten|Iapsenlapseton|Ieukani|Ientokonetta|Iorrainea|Iastentarhaan|Iupaavin|Iastenhoitaja|Kegeleit\\\xe3|helkkaril|Ieukaani|Iaihtuneen|Iahjoittamaan|tref\\\ufb02t|I\\\xf6ysyys|Diggleri\\\xe3|Ku\\\u0131fi\\/\\/a|pys\\\xe3hdell\\\xe4|Iomaasi|Iastattu|Iasinne|Iuihin|Iastensuojelujuttuun|Ieffaan|mulkkul|Iapsenvahtia|I\\\xe4hell\\\xe4si|st\\\xe3|TOSi|Ioistoidea|Ty\\\u0131si\\\xe4|lsi|Iaastarin|Viewjatkuu|lnStylen|k\\\xf6ril\\\xe4sl|Ieffoissa|Ieffaseuraksi|Iueskelemaan|Mit\\\xe4j\\\xe4tk\\\xe4|Iaukesitkaan|Kiit\\\xe3|\\\xc4\\\xe3Ii\\\xf6|Iyhytp\\\xf6ksy|Iacrosse|I\\\xf6yt\\\xe3m\\\xe3tt\\\xe3|samojajuttuja|J\\\xe4rvellel|Talouspaperitl|\\\xc4lk\\\xe4\\\xe3s|pillunaamal|poikayst\\\xe4v\\\xe4ns\\\xe3|Iapsenvahti|Nykist\\\xe3|Iaatuaikamme|K\\\xe4\\\xe3nsin|Iatinaksi|yleens\\\xe4juo|kreisej\\\xe3juttuja|Iiitostasi|Mit\\\xe4jos|Sinullaja|Iempparini|Iienetkin|Iuokkajuhla|Iuokkakokouksesta|Iukuteeman|Menejo|Sin\\\xe3j\\\xe4tit|I\\\xe4ht\\\xf6\\\xe3si|I\\\xe3\\\xe4kikseen|puhuajostain|tavatajoku|Iookia|Iapsiyst\\\xe4v\\\xe4llisemp\\\xe3n\\\xe3|is\\\xe3nn\\\xe4lle|t\\\xe3|Ieidi|K\\\xe3visik\\\xf6|maris\\\xe3tk\\\xe4|k\\\xe4nniss\\\xe4j\\\xe4rveen|sinullajotain|Iuntun|Iunttu|Iukitsin|jyyst\\\xe3\\\xe4|Iuokkajuhlaan|Michellest\\\xe3|Iuokkakokous|sin\\\xe4ja|Sin\\\xe3ja|Sill\\\xe3joskus|Iopetimme|Ymm\\\xe3rr\\\xe3tk\\\xf6|kanssajoka|Iiioitellusti|Iaihalta|Miaja|Mietit\\\xe3\\\xe4np\\\xe3|Ky\\\u0131\\\u0131\\\xe4|Pid\\\xe3ttelel|ymm\\\xe4rt\\\xe3misest\\\xe4|jaj\\\xe4\\\xe4n|Selenaja|Iuokkakokousta|\\\xe1k\\\xe1pussi|karkoituksen)(\\b|$)"}},
+ 'fra': {'BeginLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'EndLines': {'data': OrderedDict(),
+                      'pattern': None},
+         'PartialLines': {'data': OrderedDict([(u" I'", u" l'"), (u" |'", u" l'")]),
+                          'pattern': u"(?um)(?:(?<=\\s)|(?<=^)|(?<=\\b))(?:\\ I\\'|\\ \\|\\')(?:(?=\\s)|(?=$)|(?=\\b))"},
+         'PartialWordsAlways': {'data': OrderedDict([(u'\xb6\xb6', u'\u266b'), (u'\xb6', u'\u266a')]),
+                                'pattern': None},
+         'WholeLines': {'data': OrderedDict([(u'"D\'ac:c:ord."', u'"D\'accord."'), (u'\u201ci QU\xce gagne, qui perd,', u'ni qui gagne, qui perd,'), (u"L'ac:c:ent est mis \r\n \r\n sur son trajet jusqu'en Suisse.", u"L'accent est mis \r\n \r\n sur son trajet jusqu'en Suisse."), (u"C'est la plus gentille chose \r\n \r\n qu'Hitchc:oc:k m'ait jamais dite.", u"C'est la plus gentille chose \r\n \r\n qu'Hitchcock m'ait jamais dite."), (u"Tout le monde, en revanche, qualifie \r\n \r\n Goldfinger d'aventu re structur\xe9e,", u"Tout le monde, en revanche, qualifie \r\n \r\n Goldfinger d'aventure structur\xe9e,"), (u'et le film Shadow of a man \r\n \r\n a lanc\xe9 sa carri\xe8re au cin\xe9ma.', u'et le film <i>Shadow of a man</i> \r\n \r\n a lanc\xe9 sa carri\xe8re au cin\xe9ma.'), (u'En 1948, Young est pass\xe9 \xe0 la r\xe9alisation \r\n \r\n avec One night with you.', u'En 1948, Young est pass\xe9 \xe0 la r\xe9alisation \r\n \r\n avec <i>One night with you</i>.'), (u'Il a construit tous ces v\xe9hicules \r\n \r\n \xe0 C)c:ala, en Floride.', u'Il a construit tous ces v\xe9hicules \r\n \r\n \xe0 Ocala, en Floride.'), (u'Tokyo Pop et A Taxing Woman? Return.', u"Tokyo Pop et A Taxing Woman's Return."), (u'Peter H u nt.', u'Peter Hunt.'), (u'"C\'est bien mieux dans Peau. \r\n \r\n On peut s\ufb02\xe9clabousser, faire du bruit."', u'"C\'est bien mieux dans l\'eau. \r\n \r\n On peut s\'\xe9clabousser, faire du bruit."')]),
+                        'pattern': None},
+         'WholeWords': {'data': OrderedDict([(u'@immatriculation', u"d'immatriculation"), (u'acquer', u'acqu\xe9r'), (u'acteurjoue', u'acteur joue'), (u'aerien', u'a\xe9rien'), (u'agreable', u'agr\xe9able'), (u'aientjamais', u'aient jamais'), (u'AII', u'All'), (u'aitjamais', u'ait jamais'), (u'aitjus', u'ait jus'), (u'alle', u'all\xe9'), (u'alles', u'all\xe9s'), (u'appele', u'appel\xe9'), (u'apres', u'apr\xe8s'), (u'aujourdhui', u"aujourd'hui"), (u'aupres', u'aupr\xe8s'), (u'beaute', u'beaut\xe9'), (u'cabossee', u'caboss\xe9e'), (u"carj'", u"car j'"), (u"Carj'", u"Car j'"), (u'carla', u'car la'), (u'CEdipe', u'\u0152dipe'), (u'Cest', u"C'est"), (u"c'etaient", u"c'\xe9taient"), (u'C\xe9taient', u"C'\xe9taient"), (u"c'etait", u"c'\xe9tait"), (u"C'etait", u"C'\xe9tait"), (u'C\xe9tait', u"C'\xe9tait"), (u'choregraphiee', u'chor\xe9graphi\xe9e'), (u'cinema', u'cin\xe9ma'), (u"cl'AIcatraz", u"d'Alcatraz"), (u'cles', u'cl\xe9s'), (u'c\u0153urjoie', u'c\u0153ur-joie'), (u'completer', u'compl\xe9ter'), (u'costumiere', u'costumi\xe8re'), (u'cree', u'cr\xe9\xe9'), (u'daccord', u"d'accord"), (u"d'AIbert", u"d'Albert"), (u"d'AIdous", u"d'Aldous"), (u"d'AIec", u"d'Alec"), (u'danniversaire', u"d'anniversaire"), (u"d'Arra'bida", u"d'Arrabida"), (u"d'autod\xe9rision", u"d'auto-d\xe9rision"), (u'dautres', u"d'autres"), (u'debattait', u'd\xe9battait'), (u'decor', u'd\xe9cor'), (u'decorateurs', u'd\xe9corateurs'), (u'decors', u'd\xe9cors'), (u'defi', u'd\xe9fi'), (u'dej\xe0', u'd\xe9j\xe0'), (u'd\xe9j\xe0m', u'd\xe9j\xe0...'), (u'dejeunait', u'd\xe9jeunait'), (u'dengager', u"d'engager"), (u'd\xe9quipement', u"d'\xe9quipement"), (u'd\xe9rni\xe8r\xe9', u'derni\xe8re'), (u'Desole', u'D\xe9sol\xe9'), (u'dessayage', u"d'essayage"), (u'dessence', u"d'essence"), (u'd\xe9taient', u"c'\xe9taient"), (u'detail', u'd\xe9tail'), (u'dexcellents', u"d'excellents"), (u'dexp\xe9rience', u"d'exp\xe9rience"), (u'dexp\xe9riences', u"d'exp\xe9riences"), (u"d'h\xe9ro'l'ne", u"d'h\xe9ro\xefne"), (u"d'idees", u"d'id\xe9es"), (u"d'intensite", u"d'intensit\xe9"), (u'dontj', u'dont j'), (u'doublaitAlfo', u'doublait Alfo'), (u'DrNo', u'Dr No'), (u"e'", u'\xe9'), (u'ecrit', u'\xe9crit'), (u'elegant', u'\xe9l\xe9gant'), (u'Ell\xe9', u'Elle'), (u'\xe9n', u'en'), (u'equipe', u'\xe9quipe'), (u'erjus', u'er jus'), (u'estjamais', u'est jamais'), (u'\xe9t', u'et'), (u'etaient', u'\xe9taient'), (u'etait', u'\xe9tait'), (u'ete', u'\xe9t\xe9'), (u'etiez', u'\xe9tiez'), (u"etj'", u"et j'"), (u"Etj'", u"Et j'"), (u'etje', u'et je'), (u'Etje', u'Et je'), (u'EtsouvenL', u'Et souvent'), (u'eviter', u'\xe9viter'), (u'Fabsence', u"l'absence"), (u'fadapter', u"t'adapter"), (u'fadore', u"j'adore"), (u'F\xe2ge', u"l'\xe2ge"), (u'Fagent', u"l'agent"), (u'faiessay\xe9', u"j'ai essay\xe9"), (u'Failure', u"l'alllure"), (u'Fambiance', u"l'ambiance"), (u'Famener', u"l'amener"), (u'Fanniversaire', u"l'anniversaire"), (u'Fapparence', u"l'apparence"), (u'Fapres', u"l'apres"), (u'Fapr\xe8s', u"l'apr\xe8s"), (u'Farm\xe9e', u"l'arm\xe9e"), (u'Farri\xe8re', u"l'arri\xe8re"), (u'Farriv\xe9e', u"l'arriv\xe9e"), (u'Fascenseur', u"l'ascenseur"), (u'Fascension', u"l'ascension"), (u'Fassaut', u"l'assaut"), (u'Fassomme', u"l'assomme"), (u'Fatmosph\xe8re', u"l'atmosph\xe8re"), (u'Fattention', u"l'attention"), (u'Favalanche', u"l'avalanche"), (u'F\xe9clairage', u"l'\xe9clairage"), (u'F\xe9cran', u"l'\xe9cran"), (u'F\xe9motion', u"l'\xe9motion"), (u'Femplacement', u"l'emplacement"), (u'Fendroit', u"l'endroit"), (u'Fenseigne', u"l'enseigne"), (u'Fensemble', u"l'ensemble"), (u'Fentouraient', u"l'entouraient"), (u'Fentr\xe9e', u"l'entr\xe9e"), (u'F\xe9paisseur', u"l'\xe9paisseur"), (u'F\xe9poque', u"l'\xe9poque"), (u'F\xe9quipe', u'\xc9quipe'), (u'Fespace', u"l'espace"), (u'fesp\xe9rais', u"j'esp\xe9rais"), (u'Fesp\xe8re', u"l'esp\xe8re"), (u'Festh\xe9tique', u"l'esth\xe9tique"), (u'Fetranger', u"l'etranger"), (u'F\xe9vasion', u"l'\xe9vasion"), (u'F\xe9voque', u"l'\xe9voque"), (u'Fexp\xe9rience', u"l'exp\xe9rience"), (u'Fexplique', u"l'explique"), (u'Fexplosion', u"l'explosion"), (u'Fext\xe9rieur', u"l'ext\xe9rieur"), (u'Fhabituelle', u"l'habituelle"), (u'Fh\xe9licopt\xe8re', u"l'h\xe9licopt\xe8re"), (u'Fh\xe9liport', u"l'h\xe9liport"), (u'Fh\xe9listation', u"l'h\xe9listation"), (u'Fhonneur', u"l'honneur"), (u'Fhorloge', u"l'horloge"), (u'Fid\xe9e', u"l'id\xe9e"), (u'Fimage', u"l'image"), (u'Fimportance', u"l'importance"), (u'Fimpression', u"l'impression"), (u'Finfluence', u"l'influence"), (u'Finscription', u"l'inscription"), (u'Fint\xe9rieur', u"l'int\xe9rieur"), (u'Fintrigue', u"l'intrigue"), (u'Fobjectif', u"l'objectif"), (u'Foccasion', u"l'occasion"), (u'Fordre', u"l'ordre"), (u'Forigine', u"l'origine"), (u'fr\xeare', u'fr\xe8re'), (u'gaylns', u'gaijins'), (u'general', u'g\xe9n\xe9ral'), (u'hawa\xefennel', u'hawa\xefenne'), (u"hawa'l'en", u'hawa\xefen'), (u'Ia', u'la'), (u'I\xe0', u'l\xe0'), (u'Iaryngotomie', u'laryngotomie'), (u'idee', u'id\xe9e'), (u'idees', u'id\xe9es'), (u'Ie', u'le'), (u'Ies', u'les'), (u'Iester', u'Lester'), (u'II', u'Il'), (u'Iimit', u'limit'), (u'IIs', u'Ils'), (u'immediatement', u'imm\xe9diatement'), (u'insufflee', u'insuffl\xe9e'), (u'integrer', u'int\xe9grer'), (u'interessante', u'int\xe9ressante'), (u'Iogions', u'logions'), (u'Iorsqu', u'lorsqu'), (u'isee', u'is\xe9e'), (u'Iumiere', u'lumiere'), (u'Iynchage', u'lynchage'), (u"J'espere", u"J'esp\xe8re"), (u'Jessaie', u"J'essaie"), (u"j'etais", u"j'\xe9tais"), (u"J'etais", u"J'\xe9tais"), (u'lat\xe9ral\xe9m\xe9nt', u'lat\xe9ralement'), (u'lci', u'Ici'), (u'Lci', u'Ici'), (u'l\xe9-', u'l\xe0-'), (u'lepidopteres', u'l\xe9pidopt\xe8res'), (u'litteraire', u'litt\xe9raire'), (u'll', u'il'), (u'Ll', u'Il'), (u'lls', u'ils'), (u'Lls', u'Ils'), (u'maintenanu', u'maintenant'), (u'maniere', u'mani\xe8re'), (u'mariee', u'mari\xe9e'), (u'Mayer/ing', u'Mayerling'), (u'meilleurjour', u'meilleur jour'), (u'melange', u'm\xe9lange'), (u"n'avai\xe9nt", u"n'avaient"), (u"n'etait", u"n'\xe9tait"), (u'oitjamais', u'oit jamais'), (u'oitjus', u'oit jus'), (u'ontete', u'ont \xe9t\xe9'), (u'operateur', u'op\xe9rateur'), (u'ouv\xe9rt\xe9', u'ouverte'), (u'P\xe9preuve', u"l'\xe9preuve"), (u'pere', u'p\xe8re'), (u'plateforme', u'plate-forme'), (u'pourjouer', u'pour jouer'), (u'precipice', u'pr\xe9cipice'), (u'preferes', u'pr\xe9f\xe9r\xe9s'), (u'premierjour', u'premier jour'), (u'presenter', u'pr\xe9senter'), (u'prevu', u'pr\xe9vu'), (u'prevue', u'pr\xe9vue'), (u'propriete', u'propri\xe9t\xe9'), (u'prot\xe8geraient', u'prot\xe9geraient'), (u'qu\xe9', u'que'), (u'qwangoiss\xe9', u"qu'angoiss\xe9"), (u'realisateur', u'r\xe9alisateur'), (u'reception', u'r\xe9ception'), (u're\xe9valu', u'r\xe9\xe9valu'), (u'repute', u'r\xe9put\xe9'), (u'reussi', u'r\xe9ussi'), (u"s'arr\xe9tait", u"s'arr\xeatait"), (u"s'ave'rer", u"s'av\xe9rer"), (u'scenario', u'sc\xe9nario'), (u'scene', u'sc\xe8ne'), (u'scenes', u'sc\xe8nes'), (u'seances', u's\xe9ances'), (u'sequence', u's\xe9quence'), (u's\ufb02\xe9crasa', u"s'\xe9crasa"), (u'speciale', u'sp\xe9ciale'), (u'Supen', u'Super'), (u'torturee', u'tortur\xe9e'), (u'Uadmirable', u"L'admirable"), (u'Uensemblier', u"L'ensemblier"), (u'Uexplosion', u"L'explosion"), (u'Uouvre', u"L'ouvre"), (u'Vaise', u"l'aise"), (u'vecu', u'v\xe9cu'), (u'vehicules', u'v\xe9hicules'), (u'\u0178appr\xe9ciais', u"J'appr\xe9ciais"), (u'\u0178esp\xe8re', u"J'esp\xe8re"), (u'\xff\xe9trangle', u"s'\xe9trangle")]),
+                        'pattern': u"(?um)(\\b|^)(?:\\@immatriculation|acquer|acteurjoue|aerien|agreable|aientjamais|AII|aitjamais|aitjus|alle|alles|appele|apres|aujourdhui|aupres|beaute|cabossee|carj\\'|Carj\\'|carla|CEdipe|Cest|c\\'etaient|C\\\xe9taient|c\\'etait|C\\'etait|C\\\xe9tait|choregraphiee|cinema|cl\\'AIcatraz|cles|c\\\u0153urjoie|completer|costumiere|cree|daccord|d\\'AIbert|d\\'AIdous|d\\'AIec|danniversaire|d\\'Arra\\'bida|d\\'autod\\\xe9rision|dautres|debattait|decor|decorateurs|decors|defi|dej\\\xe0|d\\\xe9j\\\xe0m|dejeunait|dengager|d\\\xe9quipement|d\\\xe9rni\\\xe8r\\\xe9|Desole|dessayage|dessence|d\\\xe9taient|detail|dexcellents|dexp\\\xe9rience|dexp\\\xe9riences|d\\'h\\\xe9ro\\'l\\'ne|d\\'idees|d\\'intensite|dontj|doublaitAlfo|DrNo|e\\'|ecrit|elegant|Ell\\\xe9|\\\xe9n|equipe|erjus|estjamais|\\\xe9t|etaient|etait|ete|etiez|etj\\'|Etj\\'|etje|Etje|EtsouvenL|eviter|Fabsence|fadapter|fadore|F\\\xe2ge|Fagent|faiessay\\\xe9|Failure|Fambiance|Famener|Fanniversaire|Fapparence|Fapres|Fapr\\\xe8s|Farm\\\xe9e|Farri\\\xe8re|Farriv\\\xe9e|Fascenseur|Fascension|Fassaut|Fassomme|Fatmosph\\\xe8re|Fattention|Favalanche|F\\\xe9clairage|F\\\xe9cran|F\\\xe9motion|Femplacement|Fendroit|Fenseigne|Fensemble|Fentouraient|Fentr\\\xe9e|F\\\xe9paisseur|F\\\xe9poque|F\\\xe9quipe|Fespace|fesp\\\xe9rais|Fesp\\\xe8re|Festh\\\xe9tique|Fetranger|F\\\xe9vasion|F\\\xe9voque|Fexp\\\xe9rience|Fexplique|Fexplosion|Fext\\\xe9rieur|Fhabituelle|Fh\\\xe9licopt\\\xe8re|Fh\\\xe9liport|Fh\\\xe9listation|Fhonneur|Fhorloge|Fid\\\xe9e|Fimage|Fimportance|Fimpression|Finfluence|Finscription|Fint\\\xe9rieur|Fintrigue|Fobjectif|Foccasion|Fordre|Forigine|fr\\\xeare|gaylns|general|hawa\\\xefennel|hawa\\'l\\'en|Ia|I\\\xe0|Iaryngotomie|idee|idees|Ie|Ies|Iester|II|Iimit|IIs|immediatement|insufflee|integrer|interessante|Iogions|Iorsqu|isee|Iumiere|Iynchage|J\\'espere|Jessaie|j\\'etais|J\\'etais|lat\\\xe9ral\\\xe9m\\\xe9nt|lci|Lci|l\\\xe9\\-|lepidopteres|litteraire|ll|Ll|lls|Lls|maintenanu|maniere|mariee|Mayer\\/ing|meilleurjour|melange|n\\'avai\\\xe9nt|n\\'etait|oitjamais|oitjus|ontete|operateur|ouv\\\xe9rt\\\xe9|P\\\xe9preuve|pere|plateforme|pourjouer|precipice|preferes|premierjour|presenter|prevu|prevue|propriete|prot\\\xe8geraient|qu\\\xe9|qwangoiss\\\xe9|realisateur|reception|re\\\xe9valu|repute|reussi|s\\'arr\\\xe9tait|s\\'ave\\'rer|scenario|scene|scenes|seances|sequence|s\\\ufb02\\\xe9crasa|speciale|Supen|torturee|Uadmirable|Uensemblier|Uexplosion|Uouvre|Vaise|vecu|vehicules|\\\u0178appr\\\xe9ciais|\\\u0178esp\\\xe8re|\\\xff\\\xe9trangle)(\\b|$)"}},
+ 'hrv': {'BeginLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'EndLines': {'data': OrderedDict(),
+                      'pattern': None},
+         'PartialLines': {'data': OrderedDict([(u'Ako ej', u'Ako je'), (u'ako ej', u'ako je'), (u'bez svesti', u'bez svijesti'), (u'Bi\u0107u uz', u'Bit \u0107u uz'), (u'bi ja', u'bih ja'), (u'bi la', u'bila'), (u'biti uredu', u'biti u redu'), (u'bi da bude', u'bi biti'), (u'Bi ste', u'Biste'), (u'Bilo ko', u'Bilo tko'), (u'bilo ko', u'bilo tko'), (u'\u0107e da do\u0111e', u'\u0107e do\u0107i'), (u'Da li \u0107e', u'Ho\u0107e li'), (u'Da li \u0107emo', u'Ho\u0107emo li'), (u'Da li \u0107u', u'Ho\u0107u li'), (u'da li \u0107u', u'ho\u0107u li'), (u'dali \u0107u', u'ho\u0107u li'), (u'Da li je', u'Je li'), (u'da li je', u'je li'), (u'dali je', u'je li'), (u'Da li ste', u'Jeste li'), (u'Da li si', u'Jesi li'), (u'dali si', u'jesi li'), (u'da li \u0107e', u'ho\u0107e li'), (u'dali \u0107e', u'ho\u0107e li'), (u'do srede', u'do srijede'), (u'Dobro ve\u010de', u'Dobra ve\u010der'), (u'Dobro ve\u010der', u'Dobra ve\u010der'), (u'Dobar ve\u010der', u'Dobra ve\u010der'), (u'gdje ide\u0161', u'kamo ide\u0161'), (u'Gdje ide\u0161', u'Kamo ide\u0161'), (u'Gdje sada', u'Kamo sada'), (u'gle ko', u'gle tko'), (u'ho\u0107u da budem', u'\u017eelim biti'), (u'Ho\u0107u da budem', u'\u017delim biti'), (u'ho\u0107u da ka\u017eem', u'\u017eelim re\u0107i'), (u'ho\u0107e\u0161 da ka\u017ee\u0161', u'\u017eeli\u0161 re\u0107i'), (u'ho\u0107e da ka\u017ee', u'\u017eeli re\u0107i'), (u'ho\u0107u da \u017eivim', u'\u017eelim \u017eivjeti'), (u'Izvini se', u'Ispri\u010daj se'), (u'izvini se', u'ispri\u010daj se'), (u'Izvinite me', u'Ispri\u010dajte me'), (u'Izvinite nas', u'Ispri\u010dajte nas'), (u'izvinite nas', u'ispri\u010dajte nas'), (u'Izvinjavamo se', u'Ispri\u010davamo se'), (u'ja bi', u'ja bih'), (u'Ja bi', u'Ja bih'), (u'Jel sam ti', u'Jesam li ti'), (u'Jeli se', u'Je li se'), (u'Jeli sve', u'Je li sve'), (u'Jeli ti', u'Je li ti'), (u'ko je', u'tko je'), (u'ko si', u'tko si'), (u'ko ti je', u'tko ti je'), (u'ko te je', u'tko te je'), (u'ko zna', u'tko zna'), (u'mo\u0107i da idemo', u'mo\u0107i i\u0107i'), (u'moglo da bude', u'moglo biti'), (u'moje sau\u010de\u0161\u0107e', u'moja su\u0107ut'), (u'mora da bude', u'mora biti'), (u'moram da budem', u'moram biti'), (u'Moram da idem', u'Moram i\u0107i'), (u'moram da idem', u'moram i\u0107i'), (u'Mora\u0161 da ide\u0161', u'Mora\u0161 i\u0107i'), (u'Moramo da idemo', u'Moramo i\u0107i'), (u'moram da vidim', u'moram vidjeti'), (u'moram da zaboravim', u'moram zaboraviti'), (u'mora\u0161 da zaboravi\u0161', u'mora\u0161 zaboraviti'), (u'mora da zna', u'mora znati'), (u'moram da znam', u'moram znati'), (u'Moram da znam', u'Moram znati'), (u'mora\u0161 da zna\u0161', u'mora\u0161 znati'), (u'mora\u0161 da ide\u0161', u'mora\u0161 i\u0107i'), (u'mo\u017ee da bude', u'mo\u017ee biti'), (u'mo\u017ee\u0161 da bude\u0161', u'mo\u017ee\u0161 biti'), (u'mo\u017ee da di\u0161e', u'mo\u017ee disati'), (u'mo\u017ee\u0161 da dobije\u0161', u'mo\u017ee\u0161 dobiti'), (u'mo\u017eemo da imamo', u'mo\u017eemo imati'), (u'na ve\u010der', u'nave\u010der'), (u'Na ve\u010der', u'Nave\u010der'), (u'ne\u0107e da bude', u'ne\u0107e biti'), (u'ne\u0107e\u0161 da bude\u0161', u'ne\u0107e\u0161 biti'), (u'ne\u0107e\u0161 da po\u017eali\u0161', u'ne\u0107e\u0161 po\u017ealiti'), (u'Neko ko', u'Netko tko'), (u'neko ko', u'netko tko'), (u'neko ne\u0161to', u'netko ne\u0161to'), (u'nedjelju dana', u'tjedan dana'), (u'Ne mogu da verujem', u'Ne mogu vjerovati'), (u'new yor\u0161ki', u'njujor\u0161ki'), (u'nju jor\u0161ki', u'njujor\u0161ki'), (u'od kako', u'otkako'), (u'Pla\u0161im se', u'Bojim se'), (u'pla\u0161im se', u'bojim se'), (u'pravo u o\u010di', u'ravno u o\u010di'), (u'sa njim', u's njim'), (u'sa njima', u's njima'), (u'sa njom', u's njom'), (u'sa tim', u's tim'), (u'sa tom', u's tom'), (u'sa tobom', u's tobom'), (u'sa vama', u's vama'), (u'sam da budem', u'sam biti'), (u'si\u0107i dolje', u'si\u0107i'), (u'Si dobro', u'Jesi li dobro'), (u'Svako ko', u'Svatko tko'), (u'Svo vreme', u'Sve vrijeme'), (u'Svo vrijeme', u'Sve vrijeme'), (u'smeo da', u'smio'), (u'smeli da', u'smjeli'), (u'\u0160to ej', u'\u0160to je'), (u'\u0161to ej', u'\u0161to je'), (u'to j', u'to je'), (u'to ej', u'to je'), (u'To ej', u'To je'), (u'tamo natrag', u'tamo iza'), (u'tamo je natrag', u'tamo je iza'), (u'Tamo je natrag', u'Tamo je iza'), (u'treba da bude', u'treba biti'), (u'u jutro', u'ujutro'), (u'u\u0107i unutra', u'u\u0107i'), (u'vas je lagao', u'vam je lagao'), (u'za uvijek', u'zauvijek'), (u'zato sto', u'zato \u0161to'), (u'zna da bude', u'zna biti'), (u'zna ko', u'zna tko'), (u'znati ko', u'znati tko'), (u'\u017eele da budu', u'\u017eele biti'), (u'\u017eeli da bude', u'\u017eeli biti'), (u'\u017eelio da budem', u'\u017eelio biti'), (u'\u017eelim da budem', u'\u017eelim biti'), (u'\u017delim da budem', u'\u017delim biti'), (u'\u017eeli\u0161 da bude\u0161', u'\u017eeli\u0161 biti'), (u'\u017eelim da idem', u'\u017eelim i\u0107i'), (u'\u017eelim da odem', u'\u017eelim oti\u0107i'), (u'\u017eeli\u0161 da ode\u0161', u'\u017eeli\u0161 oti\u0107i'), (u'\u017eeli\u0161 da u\u0111e\u0161', u'\u017eeli\u0161 u\u0107i'), (u'\u017eelim da umrem', u'\u017eelim umrijeti'), (u'\u017delim da znam', u'\u017delim znati'), (u'\u017eelim da znam', u'\u017eelim znati'), (u'\u017eeli\u0161 da zna\u0161', u'\u017eeli\u0161 znati')]),
+                          'pattern': u'(?um)(?:(?<=\\s)|(?<=^)|(?<=\\b))(?:Ako\\ ej|ako\\ ej|bez\\ svesti|Bi\\\u0107u\\ uz|bi\\ ja|bi\\ la|biti\\ uredu|bi\\ da\\ bude|Bi\\ ste|Bilo\\ ko|bilo\\ ko|\\\u0107e\\ da\\ do\\\u0111e|Da\\ li\\ \\\u0107e|Da\\ li\\ \\\u0107emo|Da\\ li\\ \\\u0107u|da\\ li\\ \\\u0107u|dali\\ \\\u0107u|Da\\ li\\ je|da\\ li\\ je|dali\\ je|Da\\ li\\ ste|Da\\ li\\ si|dali\\ si|da\\ li\\ \\\u0107e|dali\\ \\\u0107e|do\\ srede|Dobro\\ ve\\\u010de|Dobro\\ ve\\\u010der|Dobar\\ ve\\\u010der|gdje\\ ide\\\u0161|Gdje\\ ide\\\u0161|Gdje\\ sada|gle\\ ko|ho\\\u0107u\\ da\\ budem|Ho\\\u0107u\\ da\\ budem|ho\\\u0107u\\ da\\ ka\\\u017eem|ho\\\u0107e\\\u0161\\ da\\ ka\\\u017ee\\\u0161|ho\\\u0107e\\ da\\ ka\\\u017ee|ho\\\u0107u\\ da\\ \\\u017eivim|Izvini\\ se|izvini\\ se|Izvinite\\ me|Izvinite\\ nas|izvinite\\ nas|Izvinjavamo\\ se|ja\\ bi|Ja\\ bi|Jel\\ sam\\ ti|Jeli\\ se|Jeli\\ sve|Jeli\\ ti|ko\\ je|ko\\ si|ko\\ ti\\ je|ko\\ te\\ je|ko\\ zna|mo\\\u0107i\\ da\\ idemo|moglo\\ da\\ bude|moje\\ sau\\\u010de\\\u0161\\\u0107e|mora\\ da\\ bude|moram\\ da\\ budem|Moram\\ da\\ idem|moram\\ da\\ idem|Mora\\\u0161\\ da\\ ide\\\u0161|Moramo\\ da\\ idemo|moram\\ da\\ vidim|moram\\ da\\ zaboravim|mora\\\u0161\\ da\\ zaboravi\\\u0161|mora\\ da\\ zna|moram\\ da\\ znam|Moram\\ da\\ znam|mora\\\u0161\\ da\\ zna\\\u0161|mora\\\u0161\\ da\\ ide\\\u0161|mo\\\u017ee\\ da\\ bude|mo\\\u017ee\\\u0161\\ da\\ bude\\\u0161|mo\\\u017ee\\ da\\ di\\\u0161e|mo\\\u017ee\\\u0161\\ da\\ dobije\\\u0161|mo\\\u017eemo\\ da\\ imamo|na\\ ve\\\u010der|Na\\ ve\\\u010der|ne\\\u0107e\\ da\\ bude|ne\\\u0107e\\\u0161\\ da\\ bude\\\u0161|ne\\\u0107e\\\u0161\\ da\\ po\\\u017eali\\\u0161|Neko\\ ko|neko\\ ko|neko\\ ne\\\u0161to|nedjelju\\ dana|Ne\\ mogu\\ da\\ verujem|new\\ yor\\\u0161ki|nju\\ jor\\\u0161ki|od\\ kako|Pla\\\u0161im\\ se|pla\\\u0161im\\ se|pravo\\ u\\ o\\\u010di|sa\\ njim|sa\\ njima|sa\\ njom|sa\\ tim|sa\\ tom|sa\\ tobom|sa\\ vama|sam\\ da\\ budem|si\\\u0107i\\ dolje|Si\\ dobro|Svako\\ ko|Svo\\ vreme|Svo\\ vrijeme|smeo\\ da|smeli\\ da|\\\u0160to\\ ej|\\\u0161to\\ ej|to\\ j|to\\ ej|To\\ ej|tamo\\ natrag|tamo\\ je\\ natrag|Tamo\\ je\\ natrag|treba\\ da\\ bude|u\\ jutro|u\\\u0107i\\ unutra|vas\\ je\\ lagao|za\\ uvijek|zato\\ sto|zna\\ da\\ bude|zna\\ ko|znati\\ ko|\\\u017eele\\ da\\ budu|\\\u017eeli\\ da\\ bude|\\\u017eelio\\ da\\ budem|\\\u017eelim\\ da\\ budem|\\\u017delim\\ da\\ budem|\\\u017eeli\\\u0161\\ da\\ bude\\\u0161|\\\u017eelim\\ da\\ idem|\\\u017eelim\\ da\\ odem|\\\u017eeli\\\u0161\\ da\\ ode\\\u0161|\\\u017eeli\\\u0161\\ da\\ u\\\u0111e\\\u0161|\\\u017eelim\\ da\\ umrem|\\\u017delim\\ da\\ znam|\\\u017eelim\\ da\\ znam|\\\u017eeli\\\u0161\\ da\\ zna\\\u0161)(?:(?=\\s)|(?=$)|(?=\\b))'},
+         'PartialWordsAlways': {'data': OrderedDict([(u'\xb6\xb6', u'\u266b'), (u'\xb6', u'\u266a')]),
+                                'pattern': None},
+         'WholeLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'WholeWords': {'data': OrderedDict([(u'advokati', u'odvjetnici'), (u'Advokati', u'Odvjetnici'), (u'advokatima', u'odvjetnicima'), (u'Advokatima', u'Odvjetnicima'), (u'afirmi\u0161e', u'afirmira'), (u'akcenat', u'naglasak'), (u'akcionara', u'dioni\u010dara'), (u'akvarijum', u'akvarij'), (u'akvarijumu', u'akvariju'), (u'amin', u'amen'), (u'Amin', u'Amen'), (u'ans', u'nas'), (u'apsorbovanje', u'apsorbiranje'), (u'apsorbuje', u'apsorbira'), (u'azot', u'du\u0161ik'), (u'ba\u0161ta', u'vrt'), (u'Ba\u0161ta', u'Vrt'), (u'ba\u0161te', u'vrtovi'), (u'Ba\u0161te', u'Vrtovi'), (u'ba\u0161ti', u'vrtu'), (u'ba\u0161tu', u'vrt'), (u'Ba\u0161tu', u'Vrt'), (u'ba\u0161tom', u'vrtom'), (u'bedan', u'bijedan'), (u'bede', u'bijede'), (u'bedi', u'bijedi'), (u'bejah', u'bijah'), (u'bejahu', u'bijahu'), (u'bele\u0161ci', u'bilje\u0161ci'), (u'be\u0161ike', u'mjehure'), (u'bebisiterka', u'dadilja'), (u'beg', u'bijeg'), (u'begu', u'bijegu'), (u'begstva', u'bijega'), (u'beja\u0161e', u'bija\u0161e'), (u'bekstvo', u'bijeg'), (u'bekstvu', u'bijegu'), (u'begstvu', u'bijegu'), (u'bes', u'bijes'), (u'besa', u'bijesa'), (u'besan', u'bijesan'), (u'besom', u'bijesom'), (u'besu', u'bijesu'), (u'be\u0161e', u'bje\u0161e'), (u'bimso', u'bismo'), (u'blije\u0111i', u'blje\u0111i'), (u'bioje', u'bio je'), (u'bi smo', u'bismo'), (u'bi ste', u'biste'), (u'bioskop', u'kino'), (u'bioskopi', u'kina'), (u'bitci', u'bitki'), (u'bled', u'blijed'), (u'blede', u'blijede'), (u'boksuje\u0161', u'boksa\u0161'), (u'bolesan', u'bolestan'), (u'bolila', u'boljela'), (u'bori\u0107e\u0161', u'borit \u0107e\u0161'), (u'Bori\u0107e\u0161', u'Borit \u0107e\u0161'), (u'braon', u'sme\u0111a'), (u'bregu', u'brijegu'), (u'bti', u'biti'), (u'cedilu', u'cjedilu'), (u'ceo', u'cijeli'), (u'Ceo', u'Cijeli'), (u'cepa', u'cijepa'), (u'cev', u'cijev'), (u'cevi', u'cijevi'), (u'cjevi', u'cijevi'), (u'cevima', u'cijevima'), (u'Cevi', u'Cijevi'), (u'Cjevi', u'Cijevi'), (u'Cevima', u'Cijevima'), (u'Cjevima', u'Cijevima'), (u'cev\u010dica', u'cjev\u010dica'), (u'cev\u010dicu', u'cjev\u010dicu'), (u'cutanje', u'\u0161utnja'), (u'\u010dutanje', u'\u0161utnja'), (u'\u0107utanje', u'\u0161utnja'), (u'Cutanje', u'\u0160utnja'), (u'\u010cutanje', u'\u0160utnja'), (u'\u0106utanje', u'\u0160utnja'), (u'cutanjem', u'\u0161utnjom'), (u'\u010dutanjem', u'\u0161utnjom'), (u'\u0107utanjem', u'\u0161utnjom'), (u'Cutanjem', u'\u0160utnjom'), (u'\u010cutanjem', u'\u0160utnjom'), (u'\u0106utanjem', u'\u0160utnjom'), (u'cvetaju', u'cvjetaju'), (u'cvetove', u'cvjetove'), (u'cvetu', u'cvijetu'), (u'cvjetu', u'cvijetu'), (u'cvetalo', u'cvjetalo'), (u'cvjetom', u'cvijetom'), (u'\u010cakom', u'Chuckom'), (u'\u010dar\u0161av', u'plahta'), (u'\u010dar\u0161ave', u'plahte'), (u'\u010dar\u0161avi', u'plahte'), (u'\u010dar\u0161avima', u'plahtama'), (u'\u010das', u'sat'), (u'\u010detvoro', u'\u010detvero'), (u'\u010cita\u0107u', u'\u010citat \u0107u'), (u'\u010derku', u'k\u0107er'), (u'\u010cerku', u'K\u0107er'), (u'\u0107erku', u'k\u0107er'), (u'\u0106erku', u'K\u0107er'), (u'\u0107erkama', u'k\u0107erima'), (u'\u010derkama', u'k\u0107erima'), (u'\u0107erkom', u'k\u0107eri'), (u'\u010derkom', u'k\u0107eri'), (u'k\u0107erkom', u'k\u0107eri'), (u'k\u010derkom', u'k\u0107eri'), (u'\u010cu', u'\u0106u'), (u'\u010ce\u0161', u'\u0106e\u0161'), (u'\u010ce', u'\u0106e'), (u'\u010cemo', u'\u0106emo'), (u'\u010cete', u'\u0106ete'), (u'\u010du', u'\u0107u'), (u'\u010de\u0161', u'\u0107e\u0161'), (u'\u010de', u'\u0107e'), (u'\u010demo', u'\u0107emo'), (u'\u010dete', u'\u0107ete'), (u'\u0107ebe', u'deku'), (u'\u0107ebetu', u'deki'), (u'\u010dk', u'\u010dak'), (u'\u0107\u0161', u'\u0107e\u0161'), (u'\u0107ale', u'tata'), (u'\u0107aletom', u'ocem'), (u'\u0107aleta', u'oca'), (u'\u0107aletu', u'ocu'), (u'\u0107orsokak', u'slijepa ulica'), (u'\u0107orsokaku', u'slijepoj ulici'), (u'\u0107o\u0161ak', u'ugao'), (u'\u0107o\u0161ku', u'uglu'), (u'\u0107erka', u'k\u0107i'), (u'\u0106erka', u'K\u0107i'), (u'\u0107mo', u'\u0107emo'), (u'\u0107te', u'\u0107ete'), (u'\u010du\u0107e', u'\u010dut \u0107e'), (u'\u010du\u0107emo', u'\u010dut \u0107emo'), (u'\u010cu\u0107emo', u'\u010cut \u0107emo'), (u'\u010cu\u0107ete', u'\u010cut \u0107ete'), (u'\u010cu\u0107e', u'\u010cut \u0107e'), (u'\u0107uo', u'\u010duo'), (u'\u0107utao', u'\u0161utio'), (u'\u0106utao', u'\u0160utio'), (u'\u0107ute', u'\u0161ute'), (u'\u0106ute', u'\u0160ute'), (u'cvetova', u'cvjetova'), (u'daga', u'da ga'), (u'damas', u'danas'), (u'date', u'dane'), (u'deda', u'djed'), (u'Deda', u'Djed'), (u'dede', u'djeda'), (u'dedi', u'djedu'), (u'dedom', u'djedom'), (u'defini\u0161e', u'definira'), (u'dejstvo', u'djelovanje'), (u'Dejstvo', u'Djelovanje'), (u'dejstvom', u'djelovanjem'), (u'Dejstvom', u'Djelovanjem'), (u'dele\u0107i', u'dijele\u0107i'), (u'deo', u'dio'), (u'Deo', u'Dio'), (u'de\u0161ava', u'doga\u0111a'), (u'dete', u'dijete'), (u'Dete', u'Dijete'), (u'diluje', u'dila'), (u'diluju', u'dilaju'), (u'diskutuje', u'raspravlja'), (u'Diskutuje', u'Raspravlja'), (u'diskutujemo', u'raspravljamo'), (u'Diskutujemo', u'Raspravljamo'), (u'djete', u'dijete'), (u'Djete', u'Dijete'), (u'detektuje', u'detektira'), (u'dodju', u'do\u0111u'), (u'dole', u'dolje'), (u'Dole', u'Dolje'), (u'donijeo', u'donio'), (u'Donijeo', u'Donio'), (u'Donije\u0107u', u'Donijet \u0107u'), (u'dosledan', u'dosljedan'), (u'dospeo', u'dospio'), (u'dospeju', u'dospiju'), (u'do\u0111avola', u'dovraga'), (u'Do\u0111avola', u'Dovraga'), (u'drug', u'prijatelj'), (u'drugari', u'prijatelji'), (u'drugare', u'prijatelje'), (u'drug\u010diji', u'druga\u010diji'), (u'drugde', u'drugdje'), (u'duuga', u'd\xfaga'), (u'duvana', u'duhana'), (u'dve', u'dvije'), (u'Dve', u'Dvije'), (u'dvema', u'dvjema'), (u'\u0111avo', u'vrag'), (u'\u0111avola', u'vraga'), (u'\u0111emper', u'd\u017eemper'), (u'd\u017eanki', u'ovisnik'), (u'd\u017eelat', u'krvnik'), (u'\u0111ubre', u'sme\u0107e'), (u'efekat', u'efekt'), (u'eksperata', u'stru\u010dnjaka'), (u'eksperti', u'stru\u010dnjaci'), (u'Eksperti', u'Stru\u010dnjaci'), (u'ekspertima', u'stru\u010dnjacima'), (u'en', u'ne'), (u'emitovao', u'emitirao'), (u'emitovati', u'emitirati'), (u'emituje', u'emitira'), (u'emitujem', u'emitiram'), (u'Emitujem', u'Emitiram'), (u'emituju', u'emitiraju'), (u'evra', u'eura'), (u'familija', u'obitelj'), (u'Familija', u'Obitelj'), (u'familiju', u'obitelj'), (u'Familiju', u'Obitelj'), (u'familijama', u'obiteljima'), (u'familiji', u'obitelji'), (u'flertuje', u'o\u010dijuka'), (u'foka', u'tuljan'), (u'foku', u'tuljana'), (u'foke', u'tuljani'), (u'fokama', u'tuljanima'), (u'fotografi\u0161u', u'fotografiraju'), (u'gasova', u'plinova'), (u'gde', u'gdje'), (u'Gde', u'Gdje'), (u'gluhonem', u'gluhonijem'), (u'gre\u0161e', u'grije\u0161e'), (u'grje\u0161e', u'grije\u0161e'), (u'gre\u0161i', u'grije\u0161i'), (u'grje\u0161i', u'grije\u0161i'), (u'gre\u0161ki', u'gre\u0161ci'), (u'grijehova', u'grijeha'), (u'grijehove', u'grijehe'), (u'hipnotisao', u'hipnotizirao'), (u'hipnotisana', u'hipnotizirana'), (u'hipnoti\u0161e', u'hipnotizira'), (u'Historija', u'Povijest'), (u'Historiju', u'Povijest'), (u'Historije', u'Povijesti'), (u'Historiji', u'Povijesti'), (u'Istorija', u'Povijest'), (u'Istoriju', u'Povijest'), (u'Istorije', u'Povijesti'), (u'Istoriji', u'Povijesti'), (u'historije', u'povijesti'), (u'historiji', u'povijesti'), (u'istorije', u'povijesti'), (u'istoriji', u'povijesti'), (u'istorijom', u'povije\u0161\u0107u'), (u'hakuje', u'hakira'), (u'Hakuje', u'Hakira'), (u'hakujemo', u'hakiramo'), (u'Hakujemo', u'Hakiramo'), (u'Hakuju', u'Hakiraju'), (u'hakuju', u'hakiraju'), (u'ho\u010du', u'ho\u0107u'), (u'Ho\u010du', u'Ho\u0107u'), (u'hte\u0107e', u'htjet \u0107e'), (u'htedoh', u'htjedoh'), (u'Htjeo', u'Htio'), (u'Hteo', u'Htio'), (u'htjeo', u'htio'), (u'hteo', u'htio'), (u'i\u010di', u'i\u0107i'), (u'I\u010di', u'I\u0107i'), (u'iko', u'itko'), (u'ignori\u0161i', u'ignoriraj'), (u'Ignori\u0161i', u'Ignoriraj'), (u'ignori\u0161ite', u'ignorirajte'), (u'Ignori\u0161ite', u'Ignorirajte'), (u'ignori\u0161u', u'ignoriraju'), (u'ilustruju', u'ilustriraju'), (u'inspirisao', u'inspirirao'), (u'interesantan', u'zanimljiv'), (u'Interesantan', u'Zanimljiv'), (u'interesuje', u'zanima'), (u'Interesuje', u'Zanima'), (u'interesujemo', u'zanimamo'), (u'Interesujemo', u'Zanimamo'), (u'interesujete', u'zanimate'), (u'Interesujete', u'Zanimate'), (u'Interesuju', u'Zanimaju'), (u'interesuju', u'zanimaju'), (u'isekao', u'izrezao'), (u'isterao', u'istjerao'), (u'istera\u0161', u'istjera\u0161'), (u'Istera\u0161', u'Istjera\u0161'), (u'istrebi', u'istrijebi'), (u'istrebiti', u'istrijebiti'), (u'isuvi\u0161e', u'previ\u0161e'), (u'ivica', u'rub'), (u'ivice', u'ruba'), (u'ivici', u'rubu'), (u'ivicu', u'rub'), (u'izduvaj', u'ispu\u0161i'), (u'izduvamo', u'ispu\u0161emo'), (u'izoluje', u'izolira'), (u'izolujemo', u'izoliramo'), (u'izoluje\u0161', u'izolira\u0161'), (u'Izolujete', u'Izolirate'), (u'Izolujte', u'Izolirajte'), (u'izolujte', u'izolirajte'), (u'izgladneo', u'izgladnio'), (u'izmeriti', u'izmjeriti'), (u'izmerio', u'izmjerio'), (u'izme\u0161ane', u'izmije\u0161ane'), (u'izneo', u'iznio'), (u'izneti', u'iznijeti'), (u'izvestan', u'izvjestan'), (u'izvinem', u'ispri\u010dam'), (u'izvine\u0161', u'ispri\u010da\u0161'), (u'Izvinem', u'Ispri\u010dam'), (u'Izvine\u0161', u'Ispri\u010da\u0161'), (u'izvinim', u'ispri\u010dam'), (u'izvini\u0161', u'ispri\u010da\u0161'), (u'izviniti', u'ispri\u010dati'), (u'izvinjenje', u'isprika'), (u'izvinjenja', u'isprike'), (u'izvinjenju', u'isprici'), (u'jedamput', u'jedanput'), (u'jelda', u"jel' da"), (u'Je\u0161\u0107emo', u'Jest \u0107emo'), (u'Je\u0161\u0107e\u0161', u'Jest \u0107e\u0161'), (u'je\u0161\u0107e', u'jest \u0107e'), (u'je\u0161\u0107u', u'jest \u0107u'), (u'Je\u0161\u0107u', u'Jest \u0107u'), (u'je\u0161\u0107e\u0161', u'jest \u0107e\u0161'), (u'je\u0161\u0107emo', u'jest \u0107emo'), (u'ju\u010de', u'ju\u010der'), (u'Ju\u010de', u'Ju\u010der'), (u'kakava', u'kakva'), (u'kampovao', u'kampirao'), (u'kampuje', u'kampira'), (u'kampujemo', u'kampiramo'), (u'kampuju', u'kampiraju'), (u'kancelarija', u'ured'), (u'kancelarijama', u'uredima'), (u'kancelariju', u'ured'), (u'Kancelarija', u'Ured'), (u'Kancelariju', u'Ured'), (u'kancelariji', u'uredu'), (u'kancelarije', u'ureda'), (u'kancelarijom', u'uredom'), (u'kancera', u'raka'), (u'kandidovati', u'kandidirati'), (u'kandidujem', u'kandidiram'), (u'kapar', u'kopar'), (u'kapra', u'kopra'), (u'karmin', u'ru\u017e'), (u'karminom', u'ru\u017eem'), (u'k\u0107erci', u'k\u0107eri'), (u'k\u0107erka', u'k\u0107i'), (u'k\u010derka', u'k\u0107i'), (u'K\u0107erka', u'K\u0107i'), (u'K\u010derka', u'K\u0107i'), (u'k\u0107erkama', u'k\u0107erima'), (u'ker', u'pas'), (u'Ker', u'Pas'), (u'kerova', u'pasa'), (u'kidnapovan', u'otet'), (u'Kidnapovan', u'Otet'), (u'kiji', u'koji'), (u'kijim', u'kojim'), (u'klasifikuju', u'klasificiraju'), (u'kle\u0161ta', u'klije\u0161ta'), (u'klje\u0161ta', u'klije\u0161ta'), (u'Ko', u'Tko'), (u'koa', u'kao'), (u'koaj', u'koja'), (u'kola', u'auto'), (u'kolima', u'autu'), (u'komandni', u'zapovjedni'), (u'kombinuju', u'kombiniraju'), (u'kompanija', u'tvrtka'), (u'komponovao', u'skladao'), (u'kom\u0161ija', u'susjed'), (u'kom\u0161iji', u'susjedu'), (u'kom\u0161iju', u'susjeda'), (u'kom\u0161iluk', u'susjedstvo'), (u'kom\u0161iluka', u'susjedstva'), (u'kom\u0161iluku', u'susjedstvu'), (u'kom\u0161ije', u'susjedi'), (u'kom\u0161ijama', u'susjedima'), (u'kom\u0161inica', u'susjeda'), (u'kom\u0161inicu', u'susjedu'), (u'konektovan', u'spojen'), (u'konektovati', u'spojiti'), (u'kontroli\u0161u', u'kontroliraju'), (u'Kontroli\u0161u', u'Kontroliraju'), (u'Kontroli\u0161i', u'Kontroliraj'), (u'kontroli\u0161i', u'kontroliraj'), (u'Kontroli\u0161ite', u'Kontrolirajte'), (u'kontroli\u0161ite', u'kontrolirajte'), (u'korpu', u'ko\u0161aru'), (u'kritikuju', u'kritiziraju'), (u'krsta', u'kri\u017ea'), (u'krsta\u0161i', u'kri\u017eari'), (u'krstu', u'kri\u017eu'), (u'krsti\u0107a', u'kri\u017ei\u0107a'), (u'krsti\u0107u', u'kri\u017ei\u0107u'), (u'Krsta', u'Kri\u017ea'), (u'Krstu', u'Kri\u017eu'), (u'Krsti\u0107a', u'Kri\u017ei\u0107a'), (u'Krsti\u0107u', u'Kri\u017ei\u0107u'), (u'krstom', u'kri\u017eem'), (u'krstove', u'kri\u017eeve'), (u'Krstove', u'Kri\u017eeve'), (u'krstovima', u'kri\u017eevima'), (u'Krstovima', u'Kri\u017eevima'), (u'kri\u017eom', u'kri\u017eem'), (u'kupatilo', u'kupaona'), (u'kupatilu', u'kupaoni'), (u'kvalifikuju', u'kvalificiraju'), (u'la\u017eeju', u'la\u017eu'), (u'La\u017eov', u'La\u017eljivac'), (u'la\u017eov', u'la\u017eljivac'), (u'la\u017eovi', u'la\u017eljivci'), (u'la\u017eovu', u'la\u017eljivcu'), (u'la\u017eovima', u'la\u017eljivcima'), (u'la\u017eovom', u'la\u017eljivcem'), (u'lebdeo', u'lebdio'), (u'le\u010di', u'lije\u010di'), (u'le\u010de', u'lije\u010de'), (u'lje\u010di', u'lije\u010di'), (u'Le\u010di', u'Lije\u010di'), (u'Lje\u010di', u'Lije\u010di'), (u'Lejn', u'Lane'), (u'Lenja', u'Lijena'), (u'lenji', u'lijeni'), (u'lenja', u'lijena'), (u'le\u0161nik', u'lje\u0161njak'), (u'Leta', u'Ljeta'), (u'leto', u'ljeto'), (u'Leto', u'Ljeto'), (u'letos', u'ljetos'), (u'letiti', u'letjeti'), (u'leve', u'lijeve'), (u'lo\u017ei', u'pali'), (u'lza', u'Iza'), (u'ljepiti', u'lijepiti'), (u'ljepili', u'lijepili'), (u'magnezijuma', u'magnezija'), (u'magnezijumu', u'magneziju'), (u'maja', u'svibnja'), (u'maju', u'svibnju'), (u'majem', u'svibnjem'), (u'majca', u'majica'), (u'majce', u'majice'), (u'majcu', u'majicu'), (u'majcom', u'majicom'), (u'Malopre', u'Malo prije'), (u'malopre', u'malo prije'), (u'maloprije', u'malo prije'), (u'manifestuje', u'manifestira'), (u'manifestuju', u'manifestiraju'), (u'marta', u'o\u017eujka'), (u'martu', u'o\u017eujku'), (u'martom', u'o\u017eujkom'), (u'mehur', u'mjehur'), (u'menom', u'mnom'), (u'mera\u010d', u'mjera\u010d'), (u'meri', u'mjeri'), (u'mere', u'mjere'), (u'merdevine', u'ljestve'), (u'merdevinama', u'ljestvama'), (u'merljivo', u'mjerljivo'), (u'me\u0161ane', u'mije\u0161ane'), (u'me\u0161avina', u'mje\u0161avina'), (u'me\u0161avine', u'mje\u0161avine'), (u'me\u0161avinu', u'mje\u0161avinu'), (u'minut', u'minutu'), (u'mleo', u'mljeo'), (u'mo\u010d', u'mo\u0107'), (u'mofu', u'mogu'), (u'momenat', u'trenutak'), (u'momenta', u'trena'), (u'muzejem', u'muzejom'), (u'muzici', u'glazbi'), (u'muzika', u'glazba'), (u'muzike', u'glazbe'), (u'muzikom', u'glazbom'), (u'Muzika', u'Glazba'), (u'Muzike', u'Glazbe'), (u'Muzikom', u'Glazbom'), (u'na\u010di', u'na\u0107i'), (u'nadevati', u'nadijevati'), (u'naduvan', u'napu\u0161en'), (u'najpre', u'najprije'), (u'Najpre', u'Najprije'), (u'najzad', u'napokon'), (u'nanev\u0161i', u'nanjev\u0161i'), (u'nanjeli', u'nanijeli'), (u'napastvuje', u'napastuje'), (u'Napolje', u'Van'), (u'napolje', u'van'), (u'Napolju', u'Vani'), (u'napolju', u'vani'), (u'nauka', u'znanost'), (u'Nauka', u'Znanost'), (u'nauci', u'znanosti'), (u'nazad', u'natrag'), (u'Nazad', u'Natrag'), (u'napred', u'naprijed'), (u'Napred', u'Naprijed'), (u'naprimjer', u'na primjer'), (u'naseo', u'nasjeo'), (u'nasesti', u'nasjesti'), (u'nasre\u0107u', u'na sre\u0107u'), (u'nebi', u'ne bi'), (u'nebih', u'ne bih'), (u'Nebi', u'Ne bi'), (u'Nebih', u'Ne bih'), (u'nebismo', u'ne bismo'), (u'Nebismo', u'Ne bismo'), (u'nebiste', u'ne biste'), (u'Nebiste', u'Ne biste'), (u'nedaj', u'ne daj'), (u'negde', u'negdje'), (u'Negde', u'Negdje'), (u'neguje', u'njeguje'), (u'neguju', u'njeguju'), (u'nekto', u'netko'), (u'nemi', u'nijemi'), (u'nemrem', u'ne mogu'), (u'nemogu', u'ne mogu'), (u'Nemogu', u'Ne mogu'), (u'nemora', u'ne mora'), (u'Nemora', u'Ne mora'), (u'nene', u'njene'), (u'ne\u0161o', u'ne\u0161to'), (u'nevesta', u'nevjesta'), (u'nevreme', u'nevrijeme'), (u'nezi', u'njezi'), (u'niasm', u'nisam'), (u'nigde', u'nigdje'), (u'Nigde', u'Nigdje'), (u'nikakave', u'nikakve'), (u'niko', u'nitko'), (u'Niko', u'Nitko'), (u'nisma', u'nisam'), (u'Nisma', u'Nisam'), (u'ne\u0107\u0161', u'ne\u0107e\u0161'), (u'nejde', u'ne ide'), (u'Nejde', u'Ne ide'), (u'neda', u'ne da'), (u'nedam', u'ne dam'), (u'negujem', u'njegujem'), (u'njegi', u'njezi'), (u'ne\u017eeli', u'ne \u017eeli'), (u'niej', u'nije'), (u'nili', u'niti'), (u'njie', u'nije'), (u'njem', u'nijem'), (u'njeme', u'njene'), (u'nominovan', u'nominiran'), (u'nsiam', u'nisam'), (u'nteko', u'netko'), (u'obe', u'obje'), (u'Obe', u'Obje'), (u'obema', u'objema'), (u'Obezbe\u0111uju', u'Osiguravaju'), (u'obezbe\u0111uju', u'osiguravaju'), (u'objekat', u'objekt'), (u'oblast', u'podru\u010dje'), (u'oblastima', u'podru\u010djima'), (u'oblasti', u'podru\u010dj*'), (u'obolelu', u'oboljelu'), (u'obo\u017eavalac', u'obo\u017eavatelj'), (u'obu\u010di', u'obu\u0107i'), (u'obuhvata', u'obuhva\u0107a'), (u'odandje', u'odande'), (u'odavdje', u'odavde'), (u'Odavdje', u'Odavde'), (u'odbi\u0107e\u0161', u'odbit \u0107e\u0161'), (u'odbi\u0107emo', u'odbit \u0107emo'), (u'odela', u'odjela'), (u'odelu', u'odjelu'), (u'odelenja', u'odjela'), (u'odelenje', u'odjel'), (u'odelenju', u'odjelu'), (u'odeljak', u'odjeljak'), (u'odeljenje', u'odjel'), (u'Odeljenje', u'Odjel'), (u'odjeljenje', u'odjel'), (u'Odjeljenje', u'Odjel'), (u'odeljenjem', u'odjelom'), (u'odma', u'odmah'), (u'Odne\u0107u', u'Odnijet \u0107u'), (u'odne\u0107u', u'odnijet \u0107u'), (u'odne\u0107e', u'odnijet \u0107e'), (u'odoliti', u'odoljeti'), (u'odneti', u'odnijeti'), (u'odseo', u'odsjeo'), (u'odsela', u'odsjela'), (u'odsesti', u'odsjesti'), (u'odupreti', u'oduprijeti'), (u'oduvek', u'oduvijek'), (u'Oduvek', u'Oduvijek'), (u'oduvjek', u'oduvijek'), (u'Oduvjek', u'Oduvijek'), (u'ogladneo', u'ogladnio'), (u'okoreli', u'okorjeli'), (u'organizuju', u'organiziraju'), (u'Organizuju', u'Organiziraju'), (u'osje\u0107anja', u'osje\u0107aje'), (u'osmehe', u'osmijehe'), (u'osmehne', u'osmjehne'), (u'osmehnu', u'osmjehnu'), (u'osobenosti', u'osobnosti'), (u'ostareli', u'ostarjeli'), (u'ostrva', u'otoka'), (u'ostrvu', u'otoku'), (u'ostrvom', u'otokom'), (u'Ostrva', u'Otoka'), (u'Ostrvu', u'Otoku'), (u'Ostrvom', u'Otokom'), (u'ostrvima', u'otocima'), (u'osete', u'osjete'), (u'ostrvo', u'otok'), (u'Ostrvo', u'Otok'), (u'osvjetljen', u'osvijetljen'), (u'ovde', u'ovdje'), (u'Ovde', u'Ovdje'), (u'ovdej', u'ovdje'), (u'ovdije', u'ovdje'), (u'Ovdije', u'Ovdje'), (u'ovjde', u'ovdje'), (u'Ovjde', u'Ovdje'), (u'pakuje', u'pakira'), (u'Pakuje', u'Pakira'), (u'Pakuju', u'Pakiraju'), (u'pakuju', u'pakiraju'), (u'palatama', u'pala\u010dama'), (u'palate', u'pala\u010de'), (u'palatu', u'pala\u010du'), (u'palati', u'pala\u010di'), (u'pantalone', u'hla\u010de'), (u'Pantalone', u'Hla\u010de'), (u'pantalona', u'hla\u010da'), (u'pantalonama', u'hla\u010dama'), (u'par\u010de', u'komadi\u0107'), (u'par\u010deta', u'komadi\u0107a'), (u'par\u010detu', u'komadi\u0107u'), (u'par\u010detom', u'komadi\u0107em'), (u'parampar\u010dad', u'komadi\u0107i'), (u'pastuv', u'pastuh'), (u'pastuva', u'pastuha'), (u'pastuvu', u'pastuhu'), (u'pd', u'od'), (u'pemzija', u'penzija'), (u'pemziju', u'penziju'), (u'penzionerski', u'umirovljeni\u010dki'), (u'Penzionerski', u'Umirovljeni\u010dki'), (u'pertle', u'\u017enirance'), (u'pesama', u'pjesama'), (u'pesnicima', u'pjesnicima'), (u'pe\u0161ice', u'pje\u0161ice'), (u'Pe\u0161ice', u'Pje\u0161ice'), (u'pe\u0161ke', u'pje\u0161ke'), (u'plata', u'pla\u0107a'), (u'pla\u010da', u'pla\u0107a'), (u'platom', u'pla\u0107om'), (u'platu', u'pla\u0107u'), (u'pla\u010danje', u'pla\u0107anje'), (u'pla\u010danjem', u'pla\u0107anjem'), (u'pla\u0107e\u0161', u'pla\u010de\u0161'), (u'plen', u'plijen'), (u'Plen', u'Plijen'), (u'pljen', u'plijen'), (u'Pljen', u'Plijen'), (u'po\u010de\u0107u', u'po\u010det \u0107u'), (u'podjelimo', u'podijelimo'), (u'podnesti', u'podnijeti'), (u'podstreka\u010d', u'poticatelj'), (u'podsete', u'podsjete'), (u'poen', u'bod'), (u'poena', u'boda'), (u'poene', u'bodove'), (u'poeni', u'bodovi'), (u'Poeni', u'Bodovi'), (u'poenima', u'bodovima'), (u'poludili', u'poludjeli'), (u'poma\u0107i', u'pomaknuti'), (u'pomaknim', u'pomaknem'), (u'pomaknio', u'pomaknuo'), (u'pomakni\u0161', u'pomakne\u0161'), (u'pomakniti', u'pomaknuti'), (u'pomenu', u'spomenu'), (u'Pomera', u'Mi\u010de'), (u'pomera', u'mi\u010de'), (u'pomjera', u'pomi\u010de'), (u'pomerajte', u'mi\u010dite'), (u'pomjeri', u'pomakni'), (u'pomeraj', u'mi\u010di'), (u'pomjeraj', u'mi\u010di'), (u'pomeraju', u'mi\u010du'), (u'pomerala', u'micala'), (u'pomjerala', u'pomicala'), (u'pomjeraju', u'pomi\u010du'), (u'pomeranja', u'pomicanja'), (u'pomerati', u'micati'), (u'pomjerati', u'pomicati'), (u'pomeri\u0161', u'pomakne\u0161'), (u'ponaosob', u'osobno'), (u'ponesla', u'ponijela'), (u'Ponesla', u'Ponijela'), (u'pore\u0111enje', u'usporedba'), (u'pore\u0111enju', u'usporedbi'), (u'porekla', u'podrijetla'), (u'poreklo', u'podrijetlo'), (u'poreklu', u'podrijetlu'), (u'Porodica', u'Obitelj'), (u'Porodice', u'Obitelji'), (u'porodica', u'obitelj'), (u'porodice', u'obitelji'), (u'porodici', u'obitelji'), (u'porodicama', u'obiteljima'), (u'porodicom', u'obitelji'), (u'porodicu', u'obitelj'), (u'poslata', u'poslana'), (u'posle', u'poslije'), (u'Posle', u'Poslije'), (u'poslje', u'poslije'), (u'posredi', u'posrijedi'), (u'postara', u'pobrine'), (u'Postara\u0107u', u'Pobrinut \u0107u'), (u'postara\u0107u', u'pobrinut \u0107u'), (u'postaraj', u'pobrini'), (u'Postaraj', u'Pobrini'), (u'Postaraju', u'Pobrinu'), (u'postaraju', u'pobrinu'), (u'postarajmo', u'pobrinimo'), (u'postaramo', u'pobrinemo'), (u'postara\u0161', u'pobrine\u0161'), (u'povesne', u'povijesne'), (u'Povinuju', u'Pokoravaju'), (u'povinuju', u'pokoravaju'), (u'pozadi', u'iza'), (u'po\u017eeleo', u'po\u017eelio'), (u'Po\u017eeleo', u'Po\u017eelio'), (u'Po\u017eeljeo', u'Po\u017eelio'), (u'po\u017eeljeo', u'po\u017eelio'), (u'praktikuj', u'prakticiraj'), (u'praktikuju', u'prakticiraju'), (u'praktikovala', u'prakticirala'), (u'praktikovati', u'prakticirati'), (u'pre', u'prije'), (u'Pre', u'Prije'), (u'predela', u'predjela'), (u'predelu', u'predjelu'), (u'Pre\u0107i', u'Prije\u0107i'), (u'pre\u0107i', u'prije\u0107i'), (u'pre\u0107utkuje', u'pre\u0161u\u0107uje'), (u'predame', u'preda me'), (u'predamnom', u'preda mnom'), (u'Predamnom', u'Preda mnom'), (u'preformuli\u0161i', u'preformuliraj'), (u'preklo', u'porijeklo'), (u'preloma', u'prijeloma'), (u'Prene\u0107u', u'Prenijet \u0107u'), (u'prene\u0107u', u'prenijet \u0107u'), (u'prenos', u'prijenos'), (u'prenosa', u'prijenosa'), (u'prenosom', u'prijenosom'), (u'prenosu', u'prijenosu'), (u'preneo', u'prenio'), (u'Preneo', u'Prenio'), (u'prenela', u'prenijela'), (u'prenjela', u'prenijela'), (u'preneli', u'prenijeli'), (u'prenjeli', u'prenijeli'), (u'preneti', u'prenijeti'), (u'preporu\u010da', u'preporu\u010duje'), (u'prese\u0107i', u'presje\u0107i'), (u'preti', u'prijeti'), (u'prete', u'prijete'), (u'Prete', u'Prijete'), (u'prjeti', u'prijeti'), (u'prjete', u'prijete'), (u'prete\u0107im', u'prijete\u0107im'), (u'prete\u0107ih', u'prijete\u0107ih'), (u'pretrpeo', u'pretrpio'), (u'prevod', u'prijevod'), (u'Prevod', u'Prijevod'), (u'prezentovati', u'prezentirati'), (u'prezentovane', u'prezentirane'), (u'prezentovan', u'prezentiran'), (u'prezentovani', u'prezentirani'), (u'prezentovano', u'prezentirano'), (u'pridonjeti', u'pridonijeti'), (u'prijatan', u'ugodan'), (u'prime\u0107ivao', u'primje\u0107ivao'), (u'primedbi', u'primjedbi'), (u'primjete', u'primijete'), (u'prisetim', u'prisjetim'), (u'prisetio', u'prisjetio'), (u'prisetite', u'prisjetite'), (u'pritiskam', u'priti\u0161\u0107em'), (u'prmda', u'iako'), (u'procenat', u'postotak'), (u'procent', u'postotak'), (u'procenta', u'postotka'), (u'procenata', u'postotaka'), (u'procenti', u'postoci'), (u'Procenti', u'Postoci'), (u'procente', u'postotke'), (u'Procente', u'Postotke'), (u'procentu', u'postotku'), (u'Procentu', u'Postotku'), (u'procentima', u'postocima'), (u'prodato', u'prodano'), (u'prohte', u'prohtije'), (u'projekat', u'projekt'), (u'Projekat', u'Projekt'), (u'promijena', u'promjena'), (u'prosledili', u'proslijedili'), (u'protestvovat', u'protestirat'), (u'Protestvovat', u'Protestirat'), (u'Protestvujem', u'Protestiram'), (u'protestvujem', u'protestiram'), (u'protestvuju', u'protestiraju'), (u'protestuju\u0107i', u'protestiraju\u0107i'), (u'psihi\u0107ki', u'psihi\u010dki'), (u'pto', u'\u0161to'), (u'ptom', u'potom'), (u'punoletan', u'punoljetan'), (u'Punoletan', u'Punoljetan'), (u'ra\u010dunari', u'ra\u010dunala'), (u'ra\u010dunare', u'ra\u010dunala'), (u'radijo', u'radio'), (u'ra\u0111e', u'radije'), (u'ranac', u'ruksak'), (u'rancu', u'ruksaku'), (u'rascep', u'rascjep'), (u'rasejan', u'rastresen'), (u'rasejana', u'rastresena'), (u'raspust', u'odmor'), (u'razbi\u0107u', u'razbit \u0107u'), (u'razbijesneo', u'razbjesnio'), (u'ra\u0161\u0107e', u'rast \u0107e'), (u'Razbi\u0107u', u'Razbit \u0107u'), (u'razdevi\u010de', u'razdjevi\u010de'), (u'razgovrati', u'razgovarati'), (u'razre\u0161i', u'razrije\u0161i'), (u'razume', u'razumije'), (u'razumeju', u'razumiju'), (u're\u010dju', u'rije\u010dju'), (u'Re\u010dju', u'Rije\u010dju'), (u'rje\u010dju', u'rije\u010dju'), (u'Rje\u010dju', u'Rije\u010dju'), (u'reagujte', u'reagirajte'), (u'redov', u'vojnik'), (u'redovu', u'vojniku'), (u're\u0111e', u'rje\u0111e'), (u're\u0111i', u'rje\u0111i'), (u'rejv', u'rave'), (u'rejvu', u'raveu'), (u'reko', u'rekao'), (u'rengen', u'rendgen'), (u'repuje\u0161', u'repa\u0161'), (u'resetuje', u'resetira'), (u'resetujte', u'resetirajte'), (u'Resetujte', u'Resetirajte'), (u'rije\u0111i', u'rje\u0111i'), (u'Rizikuj', u'Riskiraj'), (u'rizikuju', u'riskiraju'), (u'rizikuje', u'riskira'), (u'rizikujte', u'riskirajte'), (u'rje\u0161io', u'rije\u0161io'), (u'rokenrol', u"rock'n'roll"), (u'ronioc', u'ronilac'), (u'savije\u0161\u0107u', u'savje\u0161\u0107u'), (u'save\u0161\u0107u', u'savje\u0161\u0107u'), (u'secka', u'sjecka'), (u'seckam', u'sjeckam'), (u'sede\u0107e\u0161', u'sjedit \u0107e\u0161'), (u'sedeli', u'sjedili'), (u'sedi\u0161ta', u'sjedala'), (u'sedi\u0161te', u'sjedalo'), (u'sedi\u0161tu', u'sjedalu'), (u'sedni', u'sjedni'), (u'Sedni', u'Sjedni'), (u'sedi', u'sjedi'), (u'Sedi', u'Sjedi'), (u'sedite', u'sjedite'), (u'sesti', u'sjesti'), (u'sekire', u'sjekire'), (u'sekiraj', u'brini'), (u'sekiram', u'brinem'), (u'sekiramo', u'brinemo'), (u'sekira\u0161', u'brine\u0161'), (u'sekirate', u'brinete'), (u'sekirajte', u'brinite'), (u'seme', u'sjeme'), (u'sertan', u'sretan'), (u'Se\u0161\u0107u', u'Sjest \u0107u'), (u'se\u0161\u0107u', u'sjest \u0107u'), (u'sje\u0161\u0107emo', u'sjest \u0107emo'), (u'seta', u'sjeta'), (u'sigruno', u'sigurno'), (u'siguan', u'siguran'), (u'sija', u'sja'), (u'sijaju', u'sjaju'), (u'sir\u0107e', u'ocat'), (u'sir\u0107eta', u'octa'), (u'sir\u0107etu', u'octu'), (u'sje\u0161\u0107u', u'sjest \u0107u'), (u'sje\u0161\u0107e', u'sjest \u0107e'), (u'sle\u0107e', u'slije\u0107e'), (u'sle\u0107u', u'slije\u0107u'), (u'sle\u0107emo', u'slije\u0107emo'), (u'sleva', u'slijeva'), (u'se\u0107anjima', u'sje\u0107anjima'), (u'seo', u'sjeo'), (u'Seo', u'Sjeo'), (u'sem', u'osim'), (u'sma', u'sam'), (u'smao', u'samo'), (u'Smao', u'Samo'), (u'sme', u'smije'), (u'Sme', u'Smije'), (u'sme\u0107pm', u'sme\u0107em'), (u'smej', u'smij'), (u'Smejte', u'Smijte'), (u'smejte', u'smijte'), (u'smesta', u'smjesta'), (u'Smesta', u'Smjesta'), (u'smeste', u'smjeste'), (u'sme\u0161ak', u'smje\u0161ak'), (u'sme\u0161i', u'smije\u0161i'), (u'Sme\u0161i', u'Smije\u0161i'), (u'sme\u0161io', u'smije\u0161io'), (u'sme\u0161i\u0161', u'smije\u0161i\u0161'), (u'sme\u0161kom', u'smje\u0161kom'), (u'smjeo', u'smio'), (u'smrdeo', u'smrdio'), (u'sintersajzer', u'synthesizer'), (u'sitnisajzer', u'synthesizer'), (u'skelet', u'kostur'), (u'so\u010diva', u'le\u0107e'), (u'so\u010divima', u'le\u0107ama'), (u'so\u010divo', u'le\u0107a'), (u'so\u010divom', u'le\u0107om'), (u'so\u010divu', u'le\u0107i'), (u'Spakuj', u'Spakiraj'), (u'Spakujte', u'Spakirajte'), (u'spakujte', u'spakirajte'), (u'spasao', u'spasio'), (u'Spasao', u'Spasio'), (u'spasen', u'spa\u0161en'), (u'spasla', u'spasila'), (u'spasli', u'spasili'), (u'speluje', u'sri\u010de'), (u'speluju', u'sri\u010du'), (u'spoji\u0107e', u'spojit \u0107e'), (u'spolja', u'izvana'), (u'Sredi\u0107e', u'Sredit \u0107e'), (u'Sredi\u0107u', u'Sredit \u0107u'), (u'stabilizuju', u'stabiliziraju'), (u'starao', u'brinuo'), (u'starati', u'brinuti'), (u'Starati', u'Brinuti'), (u'steni', u'stijeni'), (u'stepen', u'stupanj'), (u'stepena', u'stupnjeva'), (u'stepeni', u'stupnjeva'), (u'stepenu', u'stupnju'), (u'sticati', u'stjecati'), (u'stiditi', u'stidjeti'), (u'streljamo', u'strijeljamo'), (u'streljati', u'strijeljati'), (u'stole\u0107a', u'stolje\u0107a'), (u'stobom', u's tobom'), (u'stvrano', u'stvarno'), (u'Stupi\u0107u', u'Stupit \u0107u'), (u'stupi\u0107u', u'stupit \u0107u'), (u'subjekat', u'subjekt'), (u'sudija', u'sudac'), (u'Sudija', u'Sudac'), (u'sudije', u'suca'), (u'sudiji', u'sucu'), (u'sudijo', u'su\u010de'), (u'sudiju', u'suca'), (u'sudijom', u'sucem'), (u'sudijskog', u'sudskog'), (u'sugeri\u0161u', u'predla\u017eu'), (u'sugeri\u0161e', u'predla\u017ee'), (u'supa', u'juha'), (u'supe', u'juhe'), (u'supi', u'juhi'), (u'supu', u'juhu'), (u'supom', u'juhom'), (u'supama', u'juhama'), (u'Supa', u'Juha'), (u'Supe', u'Juhe'), (u'Supi', u'Juhi'), (u'Supu', u'Juhu'), (u'Supom', u'Juhom'), (u'Supama', u'Juhama'), (u'surfuje', u'surfa'), (u'surfuje\u0161', u'surfa\u0161'), (u'surfuju', u'surfaju'), (u'su\u0161tina', u'bit'), (u'su\u0161tinski', u'bitni'), (u'suvom', u'suhom'), (u'suvog', u'suhog'), (u'suvoj', u'suhoj'), (u'Suvom', u'Suhom'), (u'Suvog', u'Suhog'), (u'Suvoj', u'Suhoj'), (u'suvim', u'suhim'), (u'Suvim', u'Suhim'), (u'svestan', u'svjestan'), (u'svjest', u'svijest'), (u'Svjest', u'Svijest'), (u'svjesti', u'svijesti'), (u'Svjesti', u'Svijesti'), (u'svetova', u'svjetova'), (u'svetove', u'svjetove'), (u'svugde', u'svugdje'), (u'\u0161olja', u'\u0161alica'), (u'\u0161olju', u'\u0161alicu'), (u'\u0160ta', u'\u0160to'), (u'\u0161tagod', u'\u0161to god'), (u'\u0161ta', u'\u0161to'), (u'\u0161tp', u'\u0161to'), (u'\u0161tampa', u'tisak'), (u'\u0161tampu', u'tisak'), (u'\u0161tampom', u'tiskom'), (u'\u0161tampi', u'tisku'), (u'\u0161tampati', u'tiskati'), (u'\u0160utje\u0107e', u'\u0160utjet \u0107e'), (u'tablu', u'plo\u010du'), (u'taguje', u'tagira'), (u'tako\u0111e', u'tako\u0111er'), (u'Tako\u0111e', u'Tako\u0111er'), (u'talas', u'val'), (u'Talas', u'Val'), (u'talasa', u'valova'), (u'talase', u'valove'), (u'talasi', u'valovi'), (u'Talasi', u'Valovi'), (u'talasima', u'valovima'), (u'Talasima', u'Valovima'), (u'te\u010dnost', u'teku\u0107ina'), (u'te\u010dnosti', u'teku\u0107ine'), (u'te\u010dno\u0161\u0107u', u'teku\u0107inom'), (u'tek\u0161o', u'te\u0161ko'), (u'Tek\u0161o', u'Te\u0161ko'), (u'terajte', u'tjerajte'), (u'te\u0161io', u'tje\u0161io'), (u'te\u0161i\u0161', u'tje\u0161i\u0161'), (u'tki', u'tko'), (u'to\u010dak', u'kota\u010d'), (u'To\u010dak', u'Kota\u010d'), (u'toha', u'toga'), (u'tovj', u'tvoj'), (u'trabam', u'trebam'), (u'trkanje', u'utrkivanje'), (u'trkanja', u'utrkivanja'), (u'trkao', u'utrkivao'), (u'trougao', u'trokut'), (u'trougla', u'trokuta'), (u'trouglu', u'trokutu'), (u'trouglove', u'trokute'), (u'trpeo', u'trpio'), (u'Trpeo', u'Trpio'), (u'tugi', u'tuzi'), (u'tvrtci', u'tvrtki'), (u'ubede', u'uvjere'), (u'Ube\u0111ivao', u'Uvjeravao'), (u'ube\u0111ivati', u'uvjeravati'), (u'ubje\u0111ivati', u'uvjeravati'), (u'ube\u0111uje', u'uvjerava'), (u'ube\u0111uje\u0161', u'uvjerava\u0161'), (u'ube\u0111uju', u'uvjeravaju'), (u'ubjediti', u'uvjeriti'), (u'u\u010dtivo', u'uljudno'), (u'u\u010dtivost', u'uljudnost'), (u'u\u010dtivo\u0161\u0107u', u'uljudno\u0161\u0107u'), (u'udata', u'udana'), (u'Udata', u'Udana'), (u'udatoj', u'udanoj'), (u'udeo', u'udio'), (u'ugljenik', u'ugljik'), (u'uliva', u'ulijeva'), (u'ulivali', u'ulijevali'), (u'ulivate', u'ulijevate'), (u'uljeva', u'ulijeva'), (u'ujutru', u'ujutro'), (u'Ukoliko', u'Ako'), (u'ukoliko', u'ako'), (u'ume', u'zna'), (u'umem', u'umijem'), (u'ume\u0161', u'umije\u0161'), (u'umesto', u'umjesto'), (u'Umesto', u'umjesto'), (u'umete', u'znate'), (u'umijesto', u'umjesto'), (u'Umijesto', u'Umjesto'), (u'umetninama', u'umjetninama'), (u'umreti', u'umrijeti'), (u'Umret', u'Umrijet'), (u'umrije\u0107e\u0161', u'umrijet \u0107e\u0161'), (u'umrije\u0107ete', u'umrijet \u0107ete'), (u'Une\u0107u', u'Unijet \u0107u'), (u'univerzitet', u'sveu\u010dili\u0161te'), (u'univerzitetu', u'sveu\u010dili\u0161tu'), (u'Uop\u0161te', u'Uop\u0107e'), (u'uop\u0161te', u'uop\u0107e'), (u'uop\u010de', u'uop\u0107e'), (u'upustva', u'uputstva'), (u'uprkos', u'usprkos'), (u'Uprkos', u'Usprkos'), (u'uradio', u'u\u010dinio'), (u'Uredu', u'U redu'), (u'uspe', u'uspije'), (u'Uspe', u'Uspije'), (u'uspeo', u'uspio'), (u'Uspeo', u'Uspio'), (u'uspe\u0107e\u0161', u'uspjet \u0107e\u0161'), (u'uspje\u0107e\u0161', u'uspjet \u0107e\u0161'), (u'uspe\u0107emo', u'uspjet \u0107emo'), (u'uspe\u0161', u'uspije\u0161'), (u'uspeju', u'uspiju'), (u'uspjevala', u'uspijevala'), (u'uspijo', u'uspio'), (u'u sred', u'usred'), (u'usled', u'uslijed'), (u'Usled', u'Uslijed'), (u'usledila', u'uslijedila'), (u'usljed', u'uslijed'), (u'Usljed', u'Uslijed'), (u'u\u0161unjate', u'u\u0161uljate'), (u'utehe', u'utjehe'), (u'uve\u010de', u'nave\u010der'), (u'uvek', u'uvijek'), (u'Uvek', u'Uvijek'), (u'uvjek', u'uvijek'), (u'Uvjek', u'Uvijek'), (u'uvijet', u'uvjet'), (u'uvijeti', u'uvjeti'), (u'uvijetima', u'uvjetima'), (u'uva', u'uha'), (u'Uva', u'Uha'), (u'uvo', u'uho'), (u'Uvo', u'Uho'), (u'uvom', u'uhom'), (u'Uvom', u'Uhom'), (u'uvu', u'uhu'), (u'Uvu', u'Uhu'), (u'vaistinu', u'uistinu'), (u'Vaistinu', u'Uistinu'), (u'vajar', u'kipar'), (u'vakcini\u0161e', u'cijepi'), (u'varnica', u'iskra'), (u'varnicu', u'iskru'), (u'vaspitala', u'odgojila'), (u'vaspitavan', u'odgajan'), (u'vaspitavanju', u'odgoju'), (u'va\u0161ljivi', u'u\u0161ljivi'), (u'va\u017ei', u'vrijedi'), (u've\u010dan', u'vje\u010dan'), (u've\u0107ati', u'vije\u0107ati'), (u'vek', u'stolje\u0107e'), (u'veka', u'stolje\u0107a'), (u'veke', u'vijeke'), (u'vekova', u'stolje\u0107a'), (u'venca', u'vijenca'), (u've\u010dnost', u'vje\u010dnost'), (u'veoma', u'vrlo'), (u'Veoma', u'Vrlo'), (u'vera', u'vjera'), (u'vere', u'vjere'), (u'veri', u'vjeri'), (u'verom', u'vjerom'), (u'veru', u'vjeru'), (u'veran', u'vjeran'), (u'verama', u'vjerama'), (u'Vera', u'Vjera'), (u'Vere', u'Vjere'), (u'Veri', u'Vjeri'), (u'Verom', u'Vjerom'), (u'Veru', u'Vjeru'), (u'Veran', u'Vjeran'), (u'Verama', u'Vjerama'), (u'veren', u'zaru\u010den'), (u'Veren', u'Zaru\u010den'), (u'verena', u'zaru\u010dena'), (u'vereni', u'zaru\u010deni'), (u'verimo', u'zaru\u010dimo'), (u'vest', u'vijest'), (u'Vest', u'Vijest'), (u'vesti', u'vijesti'), (u'Vesti', u'Vijesti'), (u'Vjesti', u'Vijesti'), (u'vjesti', u'vijesti'), (u'vestima', u'vijestima'), (u'Vestima', u'Vijestima'), (u'vjestima', u'vijestima'), (u'Vjestima', u'Vijestima'), (u've\u0161ala', u'vje\u0161ala'), (u've\u0161\u0107u', u'vije\u0161\u0107u'), (u've\u0161u', u'rublju'), (u'vide\u0161e', u'vidje\u0161e'), (u'vidjeo', u'vidio'), (u'Vidjeo', u'Vidio'), (u'vjerojatno\u0107a', u'vjerojatnost'), (u'vje\u0161\u0107u', u'vije\u0161\u0107u'), (u'vlo', u'vrlo'), (u'Vodi\u0107e', u'Vodit \u0107e'), (u'Vodi\u0107u', u'Vodit \u0107u'), (u'voliti', u'voljeti'), (u'vredelo', u'vrijedilo'), (u'vrednom', u'vrijednom'), (u'vrednog', u'vrijednog'), (u'vreme', u'vrijeme'), (u'Vreme', u'Vrijeme'), (u'vrjeme', u'vrijeme'), (u'Vrjeme', u'Vrijeme'), (u'vrteo', u'vrtio'), (u'vrvela', u'vrvjela'), (u'whiskey', u'viski'), (u'zaceljivanje', u'zacjeljivanje'), (u'zagreva', u'zagrijava'), (u'Zagreva', u'Zagrijava'), (u'Zagrevate', u'Zagrijavate'), (u'zagrevanje', u'zagrijavanje'), (u'zakunio', u'zakleo'), (u'zalepili', u'zalijepili'), (u'zalepiti', u'zalijepiti'), (u'zaliv', u'zaljev'), (u'zalivu', u'zaljevu'), (u'zanm', u'znam'), (u'zanma', u'zanima'), (u'zaplena', u'zapljena'), (u'zapleni', u'zaplijeni'), (u'zaplenu', u'zapljenu'), (u'zaspem', u'zaspim'), (u'zastareo', u'zastario'), (u'zauvek', u'zauvijek'), (u'Zauvek', u'Zauvijek'), (u'zauvjek', u'zauvijek'), (u'Zauvjek', u'Zauvijek'), (u'zavera', u'zavjera'), (u'zahtev', u'zahtjev'), (u'Zahtev', u'Zahtjev'), (u'zasede', u'zasjede'), (u'zasedi', u'zasjedi'), (u'zasedu', u'zasjedu'), (u'zatp', u'zato'), (u'Zatp', u'Zato'), (u'za\u017eeleo', u'za\u017eelio'), (u'Za\u017eeleo', u'Za\u017eelio'), (u'Za\u017eeljeo', u'Za\u017eelio'), (u'za\u017eeljeo', u'za\u017eelio'), (u'zbg', u'zbog'), (u'zdrvo', u'zdravo'), (u'Zdrvo', u'Zdravo'), (u'zlodela', u'zlodjela'), (u'zna\u0107i', u'zna\u010di'), (u'zvani\u010dan', u'slu\u017eben'), (u'zvezdom', u'zvijezdom'), (u'\u017eemo', u'\u0107emo'), (u'\u017eeleo', u'\u017eelio'), (u'\u017deleo', u'\u017delio'), (u'\u017deljeo', u'\u017delio'), (u'\u017eeljeo', u'\u017eelio'), (u'\u017diveo', u'\u017divio'), (u'\u017eiveo', u'\u017eivio'), (u'\u017emureo', u'\u017emirio'), (u'Abi', u'Abby'), (u'Alis', u'Alice'), (u'Ajk', u'Ike'), (u'Ajku', u'Ikeu'), (u'Ajrin', u'Irene'), (u'Ajris', u'Iris'), (u'Ajron', u'Iron'), (u'Ajvi', u'Ivy'), (u'An\u0111eles', u'Angeles'), (u'An\u0111elesa', u'Angelesa'), (u'An\u0111elesu', u'Angelesu'), (u'An\u0111elesom', u'Angelesom'), (u'Antoni', u'Anthony'), (u'Antoniju', u'Anthonyju'), (u'Ar\u010di', u'Archie'), (u'Beverli', u'Beverly'), (u'Bejker', u'Baker'), (u'Bitls', u'Beatles'), (u'Bitlsi', u'Beatlesi'), (u'Brid\u017eit', u'Bridget'), (u'Bri\u017eit', u'Brigitte'), (u'Bruks', u'Brooks'), (u'Dablin', u'Dublin'), (u'Dablina', u'Dublina'), (u'Dablinu', u'Dublinu'), (u'Dag', u'Doug'), (u'Darvin', u'Darwin'), (u'Darvina', u'Darwina'), (u'Darvinu', u'Darwinu'), (u'Darvinom', u'Darwinom'), (u'Dejv', u'Dave'), (u'Dejvi', u'Davie'), (u'Dejva', u'Davea'), (u'Dejvu', u'Daveu'), (u'Dejvom', u'Daveom'), (u'Den', u'Dan'), (u'Deril', u'Daryl'), (u'Dijaz', u'Diaz'), (u'Dru', u'Drew'), (u'\u0110eni', u'Jenny'), (u'\u0110o\u0161ua', u'Joshua'), (u'D\u017eejmi', u'Jamie'), (u'D\u017ead', u'Jude'), (u'D\u017eeri', u'Jerry'), (u'D\u017eerija', u'Jerryja'), (u'D\u017eo', u'Joe'), (u'D\u017eoel', u'Joel'), (u'D\u017eoelu', u'Joelu'), (u'D\u017eo\u0161', u'Josh'), (u'D\u017eo\u0161u', u'Joshu'), (u'D\u017eosi', u'Josie'), (u'D\u017eozi', u'Josie'), (u'D\u017ees', u'Jess'), (u'D\u017een', u'Jen'), (u'D\u017eej', u'Jay'), (u'D\u017eejn', u'Jane'), (u'D\u017eil', u'Jill'), (u'D\u017eodi', u'Jody'), (u'D\u017eud', u'Jude'), (u'D\u017euli', u'Julie'), (u'Ebi', u'Abby'), (u'Ejb', u'Abe'), (u'Ejba', u'Abea'), (u'Ejmi', u'Amy'), (u'Ejpril', u'April'), (u'Empajer', u'Empire'), (u'En\u0111el', u'Angel'), (u'End\u017ei', u'Angie'), (u'Entoni', u'Anthony'), (u'E\u0161ford', u'Ashford'), (u'E\u0161forda', u'Ashforda'), (u'E\u0161li', u'Ashley'), (u'Fibi', u'Phoebe'), (u'Filovo', u'Philovo'), (u'Flober', u'Flaubert'), (u'Fokner', u'Faulkner'), (u'Fren', u'Fran'), (u'Gre\u010den', u'Gretchen'), (u'Grejs', u'Grace'), (u'Hadson', u'Hudson'), (u'Hadsonu', u'Hudsonu'), (u'Hant', u'Hunt'), (u'Hemingvej', u'Hemingway'), (u'Henk', u'Hank'), (u'Hejstings', u'Hastings'), (u'Hju', u'Hugh'), (u'Hjua', u'Hugha'), (u'Hjuz', u'Hughes'), (u'Hjuza', u'Hughesa'), (u'Hjuston', u'Houston'), (u'Hjustonu', u'Houstonu'), (u'Igo', u'Hugo'), (u'Ilejn', u'Elaine'), (u'\u017didovin', u'\u017didov'), (u'Johni', u'Johnny'), (u'Jud\u017ein', u'Eugene'), (u'Kasl', u'Castle'), (u'Kejd\u017e', u'Cage'), (u'Kejn', u'Kane'), (u'Kejsi', u'Casey'), (u'Kejti', u'Katie'), (u'Keren', u'Karen'), (u'Kerol', u'Carol'), (u'Kerolajn', u'Caroline'), (u'Klajv', u'Clive'), (u'Klajva', u'Clivea'), (u'Klajve', u'Clive'), (u'Klajvu', u'Cliveu'), (u'Klarens', u'Clarence'), (u'Kler', u'Claire'), (u'Kloi', u'Chloe'), (u'Klod', u'Claude'), (u'Klode', u'Claude'), (u'Kol', u'Cole'), (u'Kolins', u'Collins'), (u'Kortni', u'Courtney'), (u'Krej?g', u'Craig'), (u'Kristi', u'Christie'), (u'Lajf', u'Life'), (u'Lajl', u'Lile'), (u'Lejk', u'Lake'), (u'Lorejn', u'Loraine'), (u'Lorens', u'Lawrence'), (u'Lusi', u'Lucy'), (u'Majk', u'Mike'), (u'Majkeve', u'Mikeove'), (u'Majlo', u'Milo'), (u'Maslou', u'Maslow'), (u'Medlin', u'Madelaine'), (u'Medelin', u'Madeline'), (u'Mejbel', u'Mabel'), (u'Mejn', u'Maine'), (u'Mejna', u'Mainea'), (u'Mejnu', u'Maineu'), (u'Mejnom', u'Maineom'), (u'Mejpls', u'Maples'), (u'Mejsi', u'Maisy'), (u'Mek', u'Mac'), (u'Merilend', u'Maryland'), (u'Mi\u010del', u'Mitchell'), (u'Nensi', u'Nancy'), (u'Ni\u010de', u'Nietzsche'), (u'Ni\u010dea', u'Nietzschea'), (u'Ni\u010deu', u'Nietzscheu'), (u'Ni\u010deom', u'Nietzscheom'), (u'Odri', u'Audrey'), (u'Ohajo', u'Ohio'), (u'Ohaja', u'Ohia'), (u'Ohaju', u'Ohiu'), (u'Olbrajt', u'Albright'), (u"O'Nil", u"O'Neal"), (u'Orlins', u'Orleans'), (u'Orlinsa', u'Orleansa'), (u'Orlinsu', u'Orleansu'), (u'Pem', u'Pam'), (u'Pejd\u017e', u'Paige'), (u'Red\u017ei', u'Reggie'), (u'Red\u017einald', u'Reginald'), (u'Rej', u'Ray'), (u'Rej\u010del', u'Rachel'), (u'Ri\u010d', u'Rich'), (u'Rouz', u'Rose'), (u'Sendi', u'Sandy'), (u'Sidnej', u'Sidney'), (u'Sindi', u'Cindy'), (u'Sojer', u'Sawyer'), (u'Sojeru', u'Sawyeru'), (u'Sole', u'Saule'), (u'Stejsi', u'Stacy'), (u'Stoun', u'Stone'), (u'\u0160eron', u'Sharon'), (u'\u0160eril', u'Cheryl'), (u'\u0160irli', u'Shirley'), (u'\u0160paniji', u'\u0160panjolskoj'), (u'Tajms', u'Times'), (u'Tejlor', u'Taylor'), (u'Vajlder', u'Wilder'), (u'Val\u0161', u'Walsh'), (u'Vins', u'Vince'), (u'Voren', u'Warren'), (u'Vud', u'Wood'), (u'\u017dak', u'Jacques'), (u'\u017dil', u'Jules'), (u'januar', u'sije\u010danj'), (u'Januar', u'Sije\u010danj'), (u'februar', u'velja\u010da'), (u'februara', u'velja\u010de'), (u'februaru', u'velja\u010di'), (u'Februar', u'Velja\u010da'), (u'Februara', u'Velja\u010de'), (u'Februaru', u'Velja\u010di'), (u'mart', u'o\u017eujak'), (u'Mart', u'O\u017eujak'), (u'april', u'travanj'), (u'April', u'Travanj'), (u'maj', u'svibanj'), (u'Maj', u'Svibanj'), (u'svibnjom', u'svibnjem'), (u'jun', u'lipanj'), (u'juna', u'lipnja'), (u'junu', u'lipnju'), (u'Jun', u'Lipanj'), (u'Juni', u'Lipanj'), (u'juli', u'srpanj'), (u'jula', u'srpnja'), (u'julu', u'srpnju'), (u'Juli', u'Srpanj'), (u'septembar', u'rujan'), (u'Septembar', u'Rujan'), (u'oktobar', u'listopad'), (u'Oktobar', u'Listopad'), (u'oktobra', u'listopada'), (u'oktobru', u'listopadu'), (u'novembar', u'studeni'), (u'november', u'studeni'), (u'novembra', u'studenog'), (u'novembru', u'studenom'), (u'Novembar', u'Studeni'), (u'November', u'Studeni'), (u'Novembra', u'Studenog'), (u'Novembru', u'Studenom'), (u'decembar', u'prosinac'), (u'Decembar', u'Prosinac')]),
+                        'pattern': u"(?um)(\\b|^)(?:advokati|Advokati|advokatima|Advokatima|afirmi\\\u0161e|akcenat|akcionara|akvarijum|akvarijumu|amin|Amin|ans|apsorbovanje|apsorbuje|azot|ba\\\u0161ta|Ba\\\u0161ta|ba\\\u0161te|Ba\\\u0161te|ba\\\u0161ti|ba\\\u0161tu|Ba\\\u0161tu|ba\\\u0161tom|bedan|bede|bedi|bejah|bejahu|bele\\\u0161ci|be\\\u0161ike|bebisiterka|beg|begu|begstva|beja\\\u0161e|bekstvo|bekstvu|begstvu|bes|besa|besan|besom|besu|be\\\u0161e|bimso|blije\\\u0111i|bioje|bi\\ smo|bi\\ ste|bioskop|bioskopi|bitci|bled|blede|boksuje\\\u0161|bolesan|bolila|bori\\\u0107e\\\u0161|Bori\\\u0107e\\\u0161|braon|bregu|bti|cedilu|ceo|Ceo|cepa|cev|cevi|cjevi|cevima|Cevi|Cjevi|Cevima|Cjevima|cev\\\u010dica|cev\\\u010dicu|cutanje|\\\u010dutanje|\\\u0107utanje|Cutanje|\\\u010cutanje|\\\u0106utanje|cutanjem|\\\u010dutanjem|\\\u0107utanjem|Cutanjem|\\\u010cutanjem|\\\u0106utanjem|cvetaju|cvetove|cvetu|cvjetu|cvetalo|cvjetom|\\\u010cakom|\\\u010dar\\\u0161av|\\\u010dar\\\u0161ave|\\\u010dar\\\u0161avi|\\\u010dar\\\u0161avima|\\\u010das|\\\u010detvoro|\\\u010cita\\\u0107u|\\\u010derku|\\\u010cerku|\\\u0107erku|\\\u0106erku|\\\u0107erkama|\\\u010derkama|\\\u0107erkom|\\\u010derkom|k\\\u0107erkom|k\\\u010derkom|\\\u010cu|\\\u010ce\\\u0161|\\\u010ce|\\\u010cemo|\\\u010cete|\\\u010du|\\\u010de\\\u0161|\\\u010de|\\\u010demo|\\\u010dete|\\\u0107ebe|\\\u0107ebetu|\\\u010dk|\\\u0107\\\u0161|\\\u0107ale|\\\u0107aletom|\\\u0107aleta|\\\u0107aletu|\\\u0107orsokak|\\\u0107orsokaku|\\\u0107o\\\u0161ak|\\\u0107o\\\u0161ku|\\\u0107erka|\\\u0106erka|\\\u0107mo|\\\u0107te|\\\u010du\\\u0107e|\\\u010du\\\u0107emo|\\\u010cu\\\u0107emo|\\\u010cu\\\u0107ete|\\\u010cu\\\u0107e|\\\u0107uo|\\\u0107utao|\\\u0106utao|\\\u0107ute|\\\u0106ute|cvetova|daga|damas|date|deda|Deda|dede|dedi|dedom|defini\\\u0161e|dejstvo|Dejstvo|dejstvom|Dejstvom|dele\\\u0107i|deo|Deo|de\\\u0161ava|dete|Dete|diluje|diluju|diskutuje|Diskutuje|diskutujemo|Diskutujemo|djete|Djete|detektuje|dodju|dole|Dole|donijeo|Donijeo|Donije\\\u0107u|dosledan|dospeo|dospeju|do\\\u0111avola|Do\\\u0111avola|drug|drugari|drugare|drug\\\u010diji|drugde|duuga|duvana|dve|Dve|dvema|\\\u0111avo|\\\u0111avola|\\\u0111emper|d\\\u017eanki|d\\\u017eelat|\\\u0111ubre|efekat|eksperata|eksperti|Eksperti|ekspertima|en|emitovao|emitovati|emituje|emitujem|Emitujem|emituju|evra|familija|Familija|familiju|Familiju|familijama|familiji|flertuje|foka|foku|foke|fokama|fotografi\\\u0161u|gasova|gde|Gde|gluhonem|gre\\\u0161e|grje\\\u0161e|gre\\\u0161i|grje\\\u0161i|gre\\\u0161ki|grijehova|grijehove|hipnotisao|hipnotisana|hipnoti\\\u0161e|Historija|Historiju|Historije|Historiji|Istorija|Istoriju|Istorije|Istoriji|historije|historiji|istorije|istoriji|istorijom|hakuje|Hakuje|hakujemo|Hakujemo|Hakuju|hakuju|ho\\\u010du|Ho\\\u010du|hte\\\u0107e|htedoh|Htjeo|Hteo|htjeo|hteo|i\\\u010di|I\\\u010di|iko|ignori\\\u0161i|Ignori\\\u0161i|ignori\\\u0161ite|Ignori\\\u0161ite|ignori\\\u0161u|ilustruju|inspirisao|interesantan|Interesantan|interesuje|Interesuje|interesujemo|Interesujemo|interesujete|Interesujete|Interesuju|interesuju|isekao|isterao|istera\\\u0161|Istera\\\u0161|istrebi|istrebiti|isuvi\\\u0161e|ivica|ivice|ivici|ivicu|izduvaj|izduvamo|izoluje|izolujemo|izoluje\\\u0161|Izolujete|Izolujte|izolujte|izgladneo|izmeriti|izmerio|izme\\\u0161ane|izneo|izneti|izvestan|izvinem|izvine\\\u0161|Izvinem|Izvine\\\u0161|izvinim|izvini\\\u0161|izviniti|izvinjenje|izvinjenja|izvinjenju|jedamput|jelda|Je\\\u0161\\\u0107emo|Je\\\u0161\\\u0107e\\\u0161|je\\\u0161\\\u0107e|je\\\u0161\\\u0107u|Je\\\u0161\\\u0107u|je\\\u0161\\\u0107e\\\u0161|je\\\u0161\\\u0107emo|ju\\\u010de|Ju\\\u010de|kakava|kampovao|kampuje|kampujemo|kampuju|kancelarija|kancelarijama|kancelariju|Kancelarija|Kancelariju|kancelariji|kancelarije|kancelarijom|kancera|kandidovati|kandidujem|kapar|kapra|karmin|karminom|k\\\u0107erci|k\\\u0107erka|k\\\u010derka|K\\\u0107erka|K\\\u010derka|k\\\u0107erkama|ker|Ker|kerova|kidnapovan|Kidnapovan|kiji|kijim|klasifikuju|kle\\\u0161ta|klje\\\u0161ta|Ko|koa|koaj|kola|kolima|komandni|kombinuju|kompanija|komponovao|kom\\\u0161ija|kom\\\u0161iji|kom\\\u0161iju|kom\\\u0161iluk|kom\\\u0161iluka|kom\\\u0161iluku|kom\\\u0161ije|kom\\\u0161ijama|kom\\\u0161inica|kom\\\u0161inicu|konektovan|konektovati|kontroli\\\u0161u|Kontroli\\\u0161u|Kontroli\\\u0161i|kontroli\\\u0161i|Kontroli\\\u0161ite|kontroli\\\u0161ite|korpu|kritikuju|krsta|krsta\\\u0161i|krstu|krsti\\\u0107a|krsti\\\u0107u|Krsta|Krstu|Krsti\\\u0107a|Krsti\\\u0107u|krstom|krstove|Krstove|krstovima|Krstovima|kri\\\u017eom|kupatilo|kupatilu|kvalifikuju|la\\\u017eeju|La\\\u017eov|la\\\u017eov|la\\\u017eovi|la\\\u017eovu|la\\\u017eovima|la\\\u017eovom|lebdeo|le\\\u010di|le\\\u010de|lje\\\u010di|Le\\\u010di|Lje\\\u010di|Lejn|Lenja|lenji|lenja|le\\\u0161nik|Leta|leto|Leto|letos|letiti|leve|lo\\\u017ei|lza|ljepiti|ljepili|magnezijuma|magnezijumu|maja|maju|majem|majca|majce|majcu|majcom|Malopre|malopre|maloprije|manifestuje|manifestuju|marta|martu|martom|mehur|menom|mera\\\u010d|meri|mere|merdevine|merdevinama|merljivo|me\\\u0161ane|me\\\u0161avina|me\\\u0161avine|me\\\u0161avinu|minut|mleo|mo\\\u010d|mofu|momenat|momenta|muzejem|muzici|muzika|muzike|muzikom|Muzika|Muzike|Muzikom|na\\\u010di|nadevati|naduvan|najpre|Najpre|najzad|nanev\\\u0161i|nanjeli|napastvuje|Napolje|napolje|Napolju|napolju|nauka|Nauka|nauci|nazad|Nazad|napred|Napred|naprimjer|naseo|nasesti|nasre\\\u0107u|nebi|nebih|Nebi|Nebih|nebismo|Nebismo|nebiste|Nebiste|nedaj|negde|Negde|neguje|neguju|nekto|nemi|nemrem|nemogu|Nemogu|nemora|Nemora|nene|ne\\\u0161o|nevesta|nevreme|nezi|niasm|nigde|Nigde|nikakave|niko|Niko|nisma|Nisma|ne\\\u0107\\\u0161|nejde|Nejde|neda|nedam|negujem|njegi|ne\\\u017eeli|niej|nili|njie|njem|njeme|nominovan|nsiam|nteko|obe|Obe|obema|Obezbe\\\u0111uju|obezbe\\\u0111uju|objekat|oblast|oblastima|oblasti|obolelu|obo\\\u017eavalac|obu\\\u010di|obuhvata|odandje|odavdje|Odavdje|odbi\\\u0107e\\\u0161|odbi\\\u0107emo|odela|odelu|odelenja|odelenje|odelenju|odeljak|odeljenje|Odeljenje|odjeljenje|Odjeljenje|odeljenjem|odma|Odne\\\u0107u|odne\\\u0107u|odne\\\u0107e|odoliti|odneti|odseo|odsela|odsesti|odupreti|oduvek|Oduvek|oduvjek|Oduvjek|ogladneo|okoreli|organizuju|Organizuju|osje\\\u0107anja|osmehe|osmehne|osmehnu|osobenosti|ostareli|ostrva|ostrvu|ostrvom|Ostrva|Ostrvu|Ostrvom|ostrvima|osete|ostrvo|Ostrvo|osvjetljen|ovde|Ovde|ovdej|ovdije|Ovdije|ovjde|Ovjde|pakuje|Pakuje|Pakuju|pakuju|palatama|palate|palatu|palati|pantalone|Pantalone|pantalona|pantalonama|par\\\u010de|par\\\u010deta|par\\\u010detu|par\\\u010detom|parampar\\\u010dad|pastuv|pastuva|pastuvu|pd|pemzija|pemziju|penzionerski|Penzionerski|pertle|pesama|pesnicima|pe\\\u0161ice|Pe\\\u0161ice|pe\\\u0161ke|plata|pla\\\u010da|platom|platu|pla\\\u010danje|pla\\\u010danjem|pla\\\u0107e\\\u0161|plen|Plen|pljen|Pljen|po\\\u010de\\\u0107u|podjelimo|podnesti|podstreka\\\u010d|podsete|poen|poena|poene|poeni|Poeni|poenima|poludili|poma\\\u0107i|pomaknim|pomaknio|pomakni\\\u0161|pomakniti|pomenu|Pomera|pomera|pomjera|pomerajte|pomjeri|pomeraj|pomjeraj|pomeraju|pomerala|pomjerala|pomjeraju|pomeranja|pomerati|pomjerati|pomeri\\\u0161|ponaosob|ponesla|Ponesla|pore\\\u0111enje|pore\\\u0111enju|porekla|poreklo|poreklu|Porodica|Porodice|porodica|porodice|porodici|porodicama|porodicom|porodicu|poslata|posle|Posle|poslje|posredi|postara|Postara\\\u0107u|postara\\\u0107u|postaraj|Postaraj|Postaraju|postaraju|postarajmo|postaramo|postara\\\u0161|povesne|Povinuju|povinuju|pozadi|po\\\u017eeleo|Po\\\u017eeleo|Po\\\u017eeljeo|po\\\u017eeljeo|praktikuj|praktikuju|praktikovala|praktikovati|pre|Pre|predela|predelu|Pre\\\u0107i|pre\\\u0107i|pre\\\u0107utkuje|predame|predamnom|Predamnom|preformuli\\\u0161i|preklo|preloma|Prene\\\u0107u|prene\\\u0107u|prenos|prenosa|prenosom|prenosu|preneo|Preneo|prenela|prenjela|preneli|prenjeli|preneti|preporu\\\u010da|prese\\\u0107i|preti|prete|Prete|prjeti|prjete|prete\\\u0107im|prete\\\u0107ih|pretrpeo|prevod|Prevod|prezentovati|prezentovane|prezentovan|prezentovani|prezentovano|pridonjeti|prijatan|prime\\\u0107ivao|primedbi|primjete|prisetim|prisetio|prisetite|pritiskam|prmda|procenat|procent|procenta|procenata|procenti|Procenti|procente|Procente|procentu|Procentu|procentima|prodato|prohte|projekat|Projekat|promijena|prosledili|protestvovat|Protestvovat|Protestvujem|protestvujem|protestvuju|protestuju\\\u0107i|psihi\\\u0107ki|pto|ptom|punoletan|Punoletan|ra\\\u010dunari|ra\\\u010dunare|radijo|ra\\\u0111e|ranac|rancu|rascep|rasejan|rasejana|raspust|razbi\\\u0107u|razbijesneo|ra\\\u0161\\\u0107e|Razbi\\\u0107u|razdevi\\\u010de|razgovrati|razre\\\u0161i|razume|razumeju|re\\\u010dju|Re\\\u010dju|rje\\\u010dju|Rje\\\u010dju|reagujte|redov|redovu|re\\\u0111e|re\\\u0111i|rejv|rejvu|reko|rengen|repuje\\\u0161|resetuje|resetujte|Resetujte|rije\\\u0111i|Rizikuj|rizikuju|rizikuje|rizikujte|rje\\\u0161io|rokenrol|ronioc|savije\\\u0161\\\u0107u|save\\\u0161\\\u0107u|secka|seckam|sede\\\u0107e\\\u0161|sedeli|sedi\\\u0161ta|sedi\\\u0161te|sedi\\\u0161tu|sedni|Sedni|sedi|Sedi|sedite|sesti|sekire|sekiraj|sekiram|sekiramo|sekira\\\u0161|sekirate|sekirajte|seme|sertan|Se\\\u0161\\\u0107u|se\\\u0161\\\u0107u|sje\\\u0161\\\u0107emo|seta|sigruno|siguan|sija|sijaju|sir\\\u0107e|sir\\\u0107eta|sir\\\u0107etu|sje\\\u0161\\\u0107u|sje\\\u0161\\\u0107e|sle\\\u0107e|sle\\\u0107u|sle\\\u0107emo|sleva|se\\\u0107anjima|seo|Seo|sem|sma|smao|Smao|sme|Sme|sme\\\u0107pm|smej|Smejte|smejte|smesta|Smesta|smeste|sme\\\u0161ak|sme\\\u0161i|Sme\\\u0161i|sme\\\u0161io|sme\\\u0161i\\\u0161|sme\\\u0161kom|smjeo|smrdeo|sintersajzer|sitnisajzer|skelet|so\\\u010diva|so\\\u010divima|so\\\u010divo|so\\\u010divom|so\\\u010divu|Spakuj|Spakujte|spakujte|spasao|Spasao|spasen|spasla|spasli|speluje|speluju|spoji\\\u0107e|spolja|Sredi\\\u0107e|Sredi\\\u0107u|stabilizuju|starao|starati|Starati|steni|stepen|stepena|stepeni|stepenu|sticati|stiditi|streljamo|streljati|stole\\\u0107a|stobom|stvrano|Stupi\\\u0107u|stupi\\\u0107u|subjekat|sudija|Sudija|sudije|sudiji|sudijo|sudiju|sudijom|sudijskog|sugeri\\\u0161u|sugeri\\\u0161e|supa|supe|supi|supu|supom|supama|Supa|Supe|Supi|Supu|Supom|Supama|surfuje|surfuje\\\u0161|surfuju|su\\\u0161tina|su\\\u0161tinski|suvom|suvog|suvoj|Suvom|Suvog|Suvoj|suvim|Suvim|svestan|svjest|Svjest|svjesti|Svjesti|svetova|svetove|svugde|\\\u0161olja|\\\u0161olju|\\\u0160ta|\\\u0161tagod|\\\u0161ta|\\\u0161tp|\\\u0161tampa|\\\u0161tampu|\\\u0161tampom|\\\u0161tampi|\\\u0161tampati|\\\u0160utje\\\u0107e|tablu|taguje|tako\\\u0111e|Tako\\\u0111e|talas|Talas|talasa|talase|talasi|Talasi|talasima|Talasima|te\\\u010dnost|te\\\u010dnosti|te\\\u010dno\\\u0161\\\u0107u|tek\\\u0161o|Tek\\\u0161o|terajte|te\\\u0161io|te\\\u0161i\\\u0161|tki|to\\\u010dak|To\\\u010dak|toha|tovj|trabam|trkanje|trkanja|trkao|trougao|trougla|trouglu|trouglove|trpeo|Trpeo|tugi|tvrtci|ubede|Ube\\\u0111ivao|ube\\\u0111ivati|ubje\\\u0111ivati|ube\\\u0111uje|ube\\\u0111uje\\\u0161|ube\\\u0111uju|ubjediti|u\\\u010dtivo|u\\\u010dtivost|u\\\u010dtivo\\\u0161\\\u0107u|udata|Udata|udatoj|udeo|ugljenik|uliva|ulivali|ulivate|uljeva|ujutru|Ukoliko|ukoliko|ume|umem|ume\\\u0161|umesto|Umesto|umete|umijesto|Umijesto|umetninama|umreti|Umret|umrije\\\u0107e\\\u0161|umrije\\\u0107ete|Une\\\u0107u|univerzitet|univerzitetu|Uop\\\u0161te|uop\\\u0161te|uop\\\u010de|upustva|uprkos|Uprkos|uradio|Uredu|uspe|Uspe|uspeo|Uspeo|uspe\\\u0107e\\\u0161|uspje\\\u0107e\\\u0161|uspe\\\u0107emo|uspe\\\u0161|uspeju|uspjevala|uspijo|u\\ sred|usled|Usled|usledila|usljed|Usljed|u\\\u0161unjate|utehe|uve\\\u010de|uvek|Uvek|uvjek|Uvjek|uvijet|uvijeti|uvijetima|uva|Uva|uvo|Uvo|uvom|Uvom|uvu|Uvu|vaistinu|Vaistinu|vajar|vakcini\\\u0161e|varnica|varnicu|vaspitala|vaspitavan|vaspitavanju|va\\\u0161ljivi|va\\\u017ei|ve\\\u010dan|ve\\\u0107ati|vek|veka|veke|vekova|venca|ve\\\u010dnost|veoma|Veoma|vera|vere|veri|verom|veru|veran|verama|Vera|Vere|Veri|Verom|Veru|Veran|Verama|veren|Veren|verena|vereni|verimo|vest|Vest|vesti|Vesti|Vjesti|vjesti|vestima|Vestima|vjestima|Vjestima|ve\\\u0161ala|ve\\\u0161\\\u0107u|ve\\\u0161u|vide\\\u0161e|vidjeo|Vidjeo|vjerojatno\\\u0107a|vje\\\u0161\\\u0107u|vlo|Vodi\\\u0107e|Vodi\\\u0107u|voliti|vredelo|vrednom|vrednog|vreme|Vreme|vrjeme|Vrjeme|vrteo|vrvela|whiskey|zaceljivanje|zagreva|Zagreva|Zagrevate|zagrevanje|zakunio|zalepili|zalepiti|zaliv|zalivu|zanm|zanma|zaplena|zapleni|zaplenu|zaspem|zastareo|zauvek|Zauvek|zauvjek|Zauvjek|zavera|zahtev|Zahtev|zasede|zasedi|zasedu|zatp|Zatp|za\\\u017eeleo|Za\\\u017eeleo|Za\\\u017eeljeo|za\\\u017eeljeo|zbg|zdrvo|Zdrvo|zlodela|zna\\\u0107i|zvani\\\u010dan|zvezdom|\\\u017eemo|\\\u017eeleo|\\\u017deleo|\\\u017deljeo|\\\u017eeljeo|\\\u017diveo|\\\u017eiveo|\\\u017emureo|Abi|Alis|Ajk|Ajku|Ajrin|Ajris|Ajron|Ajvi|An\\\u0111eles|An\\\u0111elesa|An\\\u0111elesu|An\\\u0111elesom|Antoni|Antoniju|Ar\\\u010di|Beverli|Bejker|Bitls|Bitlsi|Brid\\\u017eit|Bri\\\u017eit|Bruks|Dablin|Dablina|Dablinu|Dag|Darvin|Darvina|Darvinu|Darvinom|Dejv|Dejvi|Dejva|Dejvu|Dejvom|Den|Deril|Dijaz|Dru|\\\u0110eni|\\\u0110o\\\u0161ua|D\\\u017eejmi|D\\\u017ead|D\\\u017eeri|D\\\u017eerija|D\\\u017eo|D\\\u017eoel|D\\\u017eoelu|D\\\u017eo\\\u0161|D\\\u017eo\\\u0161u|D\\\u017eosi|D\\\u017eozi|D\\\u017ees|D\\\u017een|D\\\u017eej|D\\\u017eejn|D\\\u017eil|D\\\u017eodi|D\\\u017eud|D\\\u017euli|Ebi|Ejb|Ejba|Ejmi|Ejpril|Empajer|En\\\u0111el|End\\\u017ei|Entoni|E\\\u0161ford|E\\\u0161forda|E\\\u0161li|Fibi|Filovo|Flober|Fokner|Fren|Gre\\\u010den|Grejs|Hadson|Hadsonu|Hant|Hemingvej|Henk|Hejstings|Hju|Hjua|Hjuz|Hjuza|Hjuston|Hjustonu|Igo|Ilejn|\\\u017didovin|Johni|Jud\\\u017ein|Kasl|Kejd\\\u017e|Kejn|Kejsi|Kejti|Keren|Kerol|Kerolajn|Klajv|Klajva|Klajve|Klajvu|Klarens|Kler|Kloi|Klod|Klode|Kol|Kolins|Kortni|Krej\\?g|Kristi|Lajf|Lajl|Lejk|Lorejn|Lorens|Lusi|Majk|Majkeve|Majlo|Maslou|Medlin|Medelin|Mejbel|Mejn|Mejna|Mejnu|Mejnom|Mejpls|Mejsi|Mek|Merilend|Mi\\\u010del|Nensi|Ni\\\u010de|Ni\\\u010dea|Ni\\\u010deu|Ni\\\u010deom|Odri|Ohajo|Ohaja|Ohaju|Olbrajt|O\\'Nil|Orlins|Orlinsa|Orlinsu|Pem|Pejd\\\u017e|Red\\\u017ei|Red\\\u017einald|Rej|Rej\\\u010del|Ri\\\u010d|Rouz|Sendi|Sidnej|Sindi|Sojer|Sojeru|Sole|Stejsi|Stoun|\\\u0160eron|\\\u0160eril|\\\u0160irli|\\\u0160paniji|Tajms|Tejlor|Vajlder|Val\\\u0161|Vins|Voren|Vud|\\\u017dak|\\\u017dil|januar|Januar|februar|februara|februaru|Februar|Februara|Februaru|mart|Mart|april|April|maj|Maj|svibnjom|jun|juna|junu|Jun|Juni|juli|jula|julu|Juli|septembar|Septembar|oktobar|Oktobar|oktobra|oktobru|novembar|november|novembra|novembru|Novembar|November|Novembra|Novembru|decembar|Decembar)(\\b|$)"}},
+ 'hun': {'BeginLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'EndLines': {'data': OrderedDict(),
+                      'pattern': None},
+         'PartialLines': {'data': OrderedDict(),
+                          'pattern': None},
+         'PartialWordsAlways': {'data': OrderedDict([(u'\xb6\xb6', u'\u266b'), (u'\xb6', u'\u266a')]),
+                                'pattern': None},
+         'WholeLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'WholeWords': {'data': OrderedDict(),
+                        'pattern': None}},
+ 'nld': {'BeginLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'EndLines': {'data': OrderedDict(),
+                      'pattern': None},
+         'PartialLines': {'data': OrderedDict(),
+                          'pattern': None},
+         'PartialWordsAlways': {'data': OrderedDict([(u'\u010d', u'\xe8'), (u'I\u05bb', u'I'), (u'\u05d0', u'\xe0'), (u'\u05d9', u'\xe9'), (u'\u05d8', u'\xe8'), (u'\u05db', u'\xeb'), (u'\u05dd', u'i'), (u'\u05df', u'\xef'), (u'\u05e3', u'\xf3'), (u'\u05e4', u'o'), (u'\u05e6', u'\xeb'), (u'\xb6\xb6', u'\u266b'), (u'\xb6', u'\u266a')]),
+                                'pattern': None},
+         'WholeLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'WholeWords': {'data': OrderedDict([(u'ls', u'Is'), (u'ln', u'In'), (u'lk', u'Ik'), (u'ledereen', u'Iedereen'), (u'ledere', u'Iedere'), (u'lemand', u'Iemand')]),
+                        'pattern': u'(?um)(\\b|^)(?:ls|ln|lk|ledereen|ledere|lemand)(\\b|$)'}},
+ 'nob': {'BeginLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'EndLines': {'data': OrderedDict(),
+                      'pattern': None},
+         'PartialLines': {'data': OrderedDict(),
+                          'pattern': None},
+         'PartialWordsAlways': {'data': OrderedDict([(u'\xb6\xb6', u'\u266b'), (u'\xb6', u'\u266a')]),
+                                'pattern': None},
+         'WholeLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'WholeWords': {'data': OrderedDict([(u'varjeg', u'var jeg'), (u'omjeg', u'om jeg'), (u'menjeg', u'men jeg'), (u'noejeg', u'noe jeg'), (u'f\xf8rjeg', u'f\xf8r jeg'), (u'harjobbet', u'har jobbet'), (u'Kunnejeg', u'Kunne jeg'), (u'haddejeg', u'hadde jeg'), (u'p\xe5jorden', u'p\xe5 jorden'), (u'n\xe5rjeg', u'n\xe5r jeg'), (u'tenkerjeg', u'tenker jeg'), (u'helejorden', u'hele jorden'), (u'menjorden', u'men jorden'), (u'rundtjorden', u'rundt jorden'), (u'forjorden', u'for jorden'), (u'avjordens', u'av jordens')]),
+                        'pattern': u'(?um)(\\b|^)(?:varjeg|omjeg|menjeg|noejeg|f\\\xf8rjeg|harjobbet|Kunnejeg|haddejeg|p\\\xe5jorden|n\\\xe5rjeg|tenkerjeg|helejorden|menjorden|rundtjorden|forjorden|avjordens)(\\b|$)'}},
+ 'nor': {'BeginLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'EndLines': {'data': OrderedDict(),
+                      'pattern': None},
+         'PartialLines': {'data': OrderedDict(),
+                          'pattern': None},
+         'PartialWordsAlways': {'data': OrderedDict([(u'\xb6\xb6', u'\u266b'), (u'\xb6', u'\u266a')]),
+                                'pattern': None},
+         'WholeLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'WholeWords': {'data': OrderedDict(),
+                        'pattern': None}},
+ 'por': {'BeginLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'EndLines': {'data': OrderedDict(),
+                      'pattern': None},
+         'PartialLines': {'data': OrderedDict([(u'IN 6-E', u'N 6 E'), (u'in tegrar-se', u'integrar-se'), (u'in teresse', u'interesse'), (u'in testinos', u'intestinos'), (u'indica \xe7\xe3o', u'indica\xe7\xe3o'), (u'inte tino', u'intestino'), (u'intes tinos', u'intestinos'), (u'L da', u'Lda'), (u'mal estar', u'mal-estar'), (u'mastiga \xe7\xe1o', u'mastiga\xe7\xe3o'), (u'm\xe9di cas', u'm\xe9dicas'), (u'mineo rais', u'minerais'), (u'mola res', u'molares'), (u'movi mentos', u'movimentos'), (u'movimen to', u'movimento'), (u'N 5-Estendido', u'N\xba 5 Estendido'), (u'oxig\xe9 nio', u'oxig\xe9nio'), (u'pod mos', u'podemos'), (u'poder-se ia', u'poder-se-ia'), (u'pos sibilidade', u'possibilidade'), (u'possibi lidades', u'possibilidades'), (u'pro duto', u'produto'), (u'procu rar', u'procurar'), (u'Q u e', u'Que'), (u'qualifi cam', u'qualificam'), (u'R egi\xe3o', u'Regi\xe3o'), (u'unsuficien temente', u'insuficientemente')]),
+                          'pattern': u'(?um)(?:(?<=\\s)|(?<=^)|(?<=\\b))(?:IN\\ 6\\-E|in\\ tegrar\\-se|in\\ teresse|in\\ testinos|indica\\ \\\xe7\\\xe3o|inte\\ tino|intes\\ tinos|L\\ da|mal\\ estar|mastiga\\ \\\xe7\\\xe1o|m\\\xe9di\\ cas|mineo\\ rais|mola\\ res|movi\\ mentos|movimen\\ to|N\\ 5\\-Estendido|oxig\\\xe9\\ nio|pod\\ mos|poder\\-se\\ ia|pos\\ sibilidade|possibi\\ lidades|pro\\ duto|procu\\ rar|Q\\ u\\ e|qualifi\\ cam|R\\ egi\\\xe3o|unsuficien\\ temente)(?:(?=\\s)|(?=$)|(?=\\b))'},
+         'PartialWordsAlways': {'data': OrderedDict([(u'\xb6\xb6', u'\u266b'), (u'\xb6', u'\u266a')]),
+                                'pattern': None},
+         'WholeLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'WholeWords': {'data': OrderedDict([(u'abitual', u'habitual'), (u'\xe0cerca', u'acerca'), (u'acessor', u'assessor'), (u'ac\xf3lico', u'ac\xf3lito'), (u'a\xe7oreano', u'a\xe7oriano'), (u'actuacao', u'actua\xe7\xe3o'), (u'acucar', u'a\xe7\xfacar'), (u'a\xe7ucar', u'a\xe7\xfacar'), (u'advinhar', u'adivinhar'), (u'africa', u'\xc1frica'), (u'ajuisar', u'ajuizar'), (u'album', u'\xe1lbum'), (u'alcool\xe9mia', u'alcoolemia'), (u'aldi\xe3o', u'alde\xe3o'), (u'algerino', u'argelino'), (u'ameixeal', u'ameixial'), (u'amia\xe7a', u'amea\xe7a'), (u'analizar', u'analisar'), (u'and\xe1ste', u'andaste'), (u'anemona', u'an\xe9mona'), (u'antartico', u'ant\xe1rctico'), (u'ant\xe1rtico', u'ant\xe1rctico'), (u'antep\xf4r', u'antepor'), (u'ap\xe1rte', u'aparte'), (u'apiadeiro', u'apeadeiro'), (u'apiar', u'apear'), (u'apreciacao', u'aprecia\xe7\xe3o'), (u'arctico', u'\xe1rctico'), (u'arrazar', u'arrasar'), (u'\xe1rtico', u'\xe1rctico'), (u'artifice', u'art\xedfice'), (u'artif\xedcial', u'artificial'), (u'ascen\xe7\xe3o', u'ascens\xe3o'), (u'ass\xfacar', u'a\xe7\xfacar'), (u'aste', u'haste'), (u'aster\xedstico', u'asterisco'), (u'aver\xe7\xe3o', u'avers\xe3o'), (u'avizar', u'avisar'), (u'avulsso', u'avulso'), (u'ba\xednha', u'bainha'), (u'banca-rota', u'bancarrota'), (u'bandeija', u'bandeja'), (u'b\xe9b\xe9', u'beb\xe9'), (u'beige', u'bege'), (u'ben\xe7\xe3o', u'b\xean\xe7\xe3o'), (u'benefici\xeancia', u'benefic\xeancia'), (u'beneficiente', u'beneficente'), (u'benvinda', u'bem-vinda'), (u'benvindo', u'bem-vindo'), (u'boasvindas', u'boas-vindas'), (u'borborinho', u'burburinho'), (u'Brazil', u'Brasil'), (u'bussula', u'b\xfassola'), (u'cabo-verdeano', u'cabo-verdiano'), (u'caimbras', u'c\xe3ibras'), (u'calc\xe1reo', u'calc\xe1rio'), (u'calsado', u'cal\xe7ado'), (u'calv\xedce', u'calv\xedcie'), (u'camoneano', u'camoniano'), (u'campi\xe3o', u'campe\xe3o'), (u'can\xe7acos', u'cansa\xe7os'), (u'caracter', u'car\xe1cter'), (u'caract\xe9res', u'caracteres'), (u'catequeze', u'catequese'), (u'catequisador', u'catequizador'), (u'catequisar', u'catequizar'), (u'ch\xedcara', u'x\xedcara'), (u'ciclano', u'sicrano'), (u'cicrano', u'sicrano'), (u'cidad\xe3es', u'cidad\xe3os'), (u'cidad\xf5es', u'cidad\xe3os'), (u'cincoenta', u'cinquenta'), (u'cinseiro', u'cinzeiro'), (u'cinsero', u'sincero'), (u'citacoes', u'cita\xe7\xf5es'), (u'coaliz\xe3o', u'colis\xe3o'), (u'c\xf4dia', u'c\xf4dea'), (u'comb\xf3io', u'comboio'), (u'comp\xf4r', u'compor'), (u'concerteza', u'com certeza'), (u'constituia', u'constitu\xeda'), (u'constitu\xedu', u'constituiu'), (u'contato', u'contacto'), (u'contens\xe3o', u'conten\xe7\xe3o'), (u'contribuicoes', u'contribui\xe7\xf5es'), (u'c\xf4r', u'cor'), (u'corass\xe3o', u'cora\xe7\xe3o'), (u'cor\xe7ario', u'cors\xe1rio'), (u'cor\xe7\xe1rio', u'cors\xe1rio'), (u'cornprimidosinbo', u'comprimidozinho'), (u'cr\xe2neo', u'cr\xe2nio'), (u'dE', u'de'), (u'defeni\xe7\xe3o', u'defini\xe7\xe3o'), (u'defenido', u'definido'), (u'defenir', u'definir'), (u'deficite', u'd\xe9fice'), (u'degladiar', u'digladiar'), (u'deiche', u'deixe'), (u'desinteria', u'disenteria'), (u'despendio', u'disp\xeandio'), (u'desp\xeandio', u'disp\xeandio'), (u'desplic\xeancia', u'displic\xeancia'), (u'dificulidade', u'dificuldade'), (u'dispender', u'despender'), (u'dispendio', u'disp\xeandio'), (u'distribuido', u'distribu\xeddo'), (u'dru\xedda', u'druida'), (u'\xe9cr\xe3', u'ecr\xe3'), (u'ecran', u'ecr\xe3'), (u'\xe9cran', u'ecr\xe3'), (u'\xeale', u'ele'), (u'elice', u'h\xe9lice'), (u'\xe9lice', u'h\xe9lice'), (u'emiratos', u'emirados'), (u'engolis-te', u'engoliste'), (u'engulir', u'engolir'), (u'enguliste', u'engoliste'), (u'entertido', u'entretido'), (u'entitular', u'intitular'), (u'entreterimento', u'entretenimento'), (u'entreti-me', u'entretive-me'), (u'env\xf3lucro', u'inv\xf3lucro'), (u'er\xf3i', u'her\xf3i'), (u'escluir', u'excluir'), (u'esclus\xe3o', u'exclus\xe3o'), (u'escriv\xf5es', u'escriv\xe3es'), (u'esqueiro', u'isqueiro'), (u'esquesito', u'esquisito'), (u'estacoes', u'esta\xe7\xf5es'), (u'esteje', u'esteja'), (u'excava\xe7\xe3o', u'escava\xe7\xe3o'), (u'excavar', u'escavar'), (u'exdr\xfaxula', u'esdr\xfaxula'), (u'exdr\xfaxulas', u'esdr\xfaxulas'), (u'exitar', u'hesitar'), (u'explicacoes', u'explica\xe7\xf5es'), (u'exquisito', u'esquisito'), (u'extende', u'estende'), (u'extender', u'estender'), (u'f\xe0cilmenfe', u'facilmente'), (u'f\xe0cilmente', u'facilmente'), (u'fariam-lhe', u'far-lhe-iam'), (u'FARM\xc1ClAS', u'FARM\xc1CIAS'), (u'farmec\xeautico', u'farmac\xeautico'), (u'fassa', u'fa\xe7a'), (u'f\xe9bre', u'febre'), (u'fecula', u'f\xe9cula'), (u'f\xe9mea', u'f\xeamea'), (u'femenino', u'feminino'), (u'femininismo', u'feminismo'), (u'f\xedsiologista', u'fisiologista'), (u'fiz\xe9mos', u'fizemos'), (u'fizes-te', u'fizeste'), (u'fl\xf4r', u'flor'), (u'for\xe3o', u'foram'), (u'formalisar', u'formalizar'), (u'f\xf4ro', u'foro'), (u'fos-te', u'foste'), (u'frag\xe2ncia', u'fragr\xe2ncia'), (u'fran\xe7\xeas', u'franc\xeas'), (u'frasqutnho', u'frasquinho'), (u'frustado', u'frustrado'), (u'fur\xe1', u'furar'), (u'gaz', u'g\xe1s'), (u'g\xe1z', u'g\xe1s'), (u'geito', u'jeito'), (u'geneceu', u'gineceu'), (u'geropiga', u'jeropiga'), (u'glic\xe9mia', u'glicemia'), (u'gorgeta', u'gorjeta'), (u'grangear', u'granjear'), (u'guizar', u'guisar'), (u'hectar', u'hectare'), (u'herm\xe9ticamente', u'hermeticamente'), (u'hernia', u'h\xe9rnia'), (u'higi\xe9ne', u'higiene'), (u'hilariedade', u'hilaridade'), (u'hiperac\xeddez', u'hiperacidez'), (u'hontem', u'ontem'), (u'igiene', u'higiene'), (u'igienico', u'higi\xe9nico'), (u'igi\xe9nico', u'higi\xe9nico'), (u'igreija', u'igreja'), (u'iguasu', u'igua\xe7u'), (u'ilac\xe7\xe3o', u'ila\xe7\xe3o'), (u'imbigo', u'umbigo'), (u'impecilho', u'empecilho'), (u'\xedncas', u'incas'), (u'inc\xeasto', u'incesto'), (u'inclusiv\xe9', u'inclusive'), (u'inc\xf4modos', u'inc\xf3modos'), (u'incontest\xe1velmente', u'incontestavelmente'), (u'incontest\xe0velmente', u'incontestavelmente'), (u'indespens\xe1veis', u'indispens\xe1veis'), (u'indespens\xe1vel', u'indispens\xe1vel'), (u'India', u'\xcdndia'), (u'indiguina\xe7\xe3o', u'indigna\xe7\xe3o'), (u'indiguinado', u'indignado'), (u'indiguinar', u'indignar'), (u'inflac\xe7\xe3o', u'infla\xe7\xe3o'), (u'ingreja', u'igreja'), (u'INSCRICOES', u'INSCRI\xc7\xd5ES'), (u'intens\xe3o', u'inten\xe7\xe3o'), (u'intertido', u'entretido'), (u'intoxica', u'Intoxica'), (u'intrega', u'entrega'), (u'inveros\xedmel', u'inveros\xedmil'), (u'iorgute', u'iogurte'), (u'ipop\xf3tamo', u'hipop\xf3tamo'), (u'ipsilon', u'\xedpsilon'), (u'ipslon', u'\xedpsilon'), (u'isquesito', u'esquisito'), (u'ju\xedz', u'juiz'), (u'juiza', u'ju\xedza'), (u'j\xfaniores', u'juniores'), (u'justanzente', u'justamente'), (u'juz', u'jus'), (u'kilo', u'quilo'), (u'laborat\xf3rio-porque', u'laborat\xf3rio porque'), (u'ladravaz', u'ladrava'), (u'lament\xe0velmente', u'lamentavelmente'), (u'lampe\xe3o', u'lampi\xe3o'), (u'largartixa', u'lagartixa'), (u'largarto', u'lagarto'), (u'l\xeam', u'l\xeaem'), (u'leuc\xe9mia', u'leucemia'), (u'licensa', u'licen\xe7a'), (u'lingu\xedsta', u'linguista'), (u'lisongear', u'lisonjear'), (u'logista', u'lojista'), (u'ma\xe7ajar', u'massajar'), (u'Macfadden-o', u'Macfadden o'), (u'mae', u'm\xe3e'), (u'magestade', u'majestade'), (u'm\xe3gua', u'm\xe1goa'), (u'mangerico', u'manjerico'), (u'mangerona', u'manjerona'), (u'manteem-se', u'mant\xeam-se'), (u'mantega', u'manteiga'), (u'mantem-se', u'mant\xe9m-se'), (u'massi\xe7o', u'maci\xe7o'), (u'massisso', u'maci\xe7o'), (u'm\xe9dica-Rio', u'm\xe9dica Rio'), (u'menistro', u'ministro'), (u'merciaria', u'mercearia'), (u'metrelhadora', u'metralhadora'), (u'miscegena\xe7\xe3o', u'miscigena\xe7\xe3o'), (u'misogenia', u'misoginia'), (u'misogeno', u'mis\xf3gino'), (u'mis\xf3geno', u'mis\xf3gino'), (u'm\xba', u'\xba'), (u'm\xf4lho', u'molho'), (u'monument\xe2nea', u'moment\xe2nea'), (u'mortandela', u'mortadela'), (u'morteIa', u'mortela'), (u'muinto', u'muito'), (u'nasaias', u'nasais'), (u'n\xeale', u'nele'), (u'nest', u'neste'), (u'Nivea', u'N\xedvea'), (u'nonagessimo', u'nonag\xe9simo'), (u'nonag\xe9ssimo', u'nonag\xe9simo'), (u'nornal', u'normal'), (u'not\xe0velmente', u'notavelmente'), (u'obcess\xe3o', u'obsess\xe3o'), (u'obesidae', u'obesidade'), (u'\xf3bviamente', u'obviamente'), (u'\xf2bviamente', u'obviamente'), (u'ofecina', u'oficina'), (u'oje', u'hoje'), (u'omem', u'homem'), (u'opcoes', u'op\xe7\xf5es'), (u'op\xf3brio', u'opr\xf3brio'), (u'opr\xf3bio', u'opr\xf3brio'), (u'orf\xe3o', u'\xf3rf\xe3o'), (u'organigrama', u'organograma'), (u'organisar', u'organizar'), (u'org\xe3o', u'\xf3rg\xe3o'), (u'orta', u'horta'), (u'\xf3tima', u'\xf3ptima'), (u'\xf3timos', u'\xf3ptimos'), (u'paraliza\xe7\xe3o', u'paralisa\xe7\xe3o'), (u'paralizado', u'paralisado'), (u'paralizar', u'paralisar'), (u'par\xe1ste', u'paraste'), (u'P\xe1tria', u'p\xe1tria'), (u'pa\xfal', u'Paul'), (u'pecal\xe7o', u'percal\xe7o'), (u'p\xeaga', u'pega'), (u'periodo', u'per\xedodo'), (u'pertubar', u'perturbar'), (u'per\xfa', u'peru'), (u'piqueno', u'pequeno'), (u'pirin\xe9us', u'Piren\xe9us'), (u'poblema', u'problema'), (u'pobrema', u'problema'), (u'poden', u'podem'), (u'poder-mos', u'pudermos'), (u'ponteagudo', u'pontiagudo'), (u'pontuacoes', u'pontua\xe7\xf5es'), (u'prazeiroso', u'prazeroso'), (u'precaridade', u'precariedade'), (u'precizar', u'precisar'), (u'preserveran\xe7a', u'perseveran\xe7a'), (u'previl\xe9gio', u'privil\xe9gio'), (u'prim\xe1ria-que', u'prim\xe1ria que'), (u'pri\xfado', u'per\xedodo'), (u'probalidade', u'probabilidade'), (u'progreso', u'progresso'), (u'proib\xeddo', u'proibido'), (u'pro\xedbido', u'proibido'), (u'pr\xf3pia', u'pr\xf3pria'), (u'propiedade', u'propriedade'), (u'propio', u'pr\xf3prio'), (u'pr\xf3pio', u'pr\xf3prio'), (u'provocacoes', u'provoca\xe7\xf5es'), (u'prsen\xe7a', u'presen\xe7a'), (u'prustituta', u'prostituta'), (u'pud\xe9rmos', u'pudermos'), (u'p\xfalico', u'p\xfablico'), (u'p\xfas', u'pus'), (u'pus\xe9mos', u'pusemos'), (u'quadricomia', u'quadricromia'), (u'quadriplicado', u'quadruplicado'), (u'quaisqueres', u'quaisquer'), (u'quer-a', u'quere-a'), (u'quere-se', u'quer-se'), (u'quer-o', u'quere-o'), (u'qu\xedmco', u'qu\xedmico'), (u'quises-te', u'quiseste'), (u'quizer', u'quiser'), (u'quizeram', u'quiseram'), (u'quizesse', u'quisesse'), (u'quizessem', u'quisessem'), (u'ra\xednha', u'rainha'), (u'ra\xedz', u'raiz'), (u'raizes', u'ra\xedzes'), (u'ratato', u'retrato'), (u'ra\xfal', u'raul'), (u'razar', u'rasar'), (u'rectaguarda', u'retaguarda'), (u'r\xe9dia', u'r\xe9dea'), (u'reestabelecer', u'restabelecer'), (u'refeicoes', u'refei\xe7\xf5es'), (u'ref\xearencia', u'refer\xeancia'), (u'regeitar', u'rejeitar'), (u'regurjitar', u'regurgitar'), (u'reinvidica\xe7\xe3o', u'reivindica\xe7\xe3o'), (u'reinvidicar', u'reivindicar'), (u'requer-a', u'requere-a'), (u'requere-se', u'requer-se'), (u'requer-o', u'requere-o'), (u'requesito', u'requisito'), (u'requisicoes', u'requisi\xe7\xf5es'), (u'RESIDENCIA', u'RESID\xcaNCIA'), (u'respira\xe7\xe1o', u'respira\xe7\xe3o'), (u'restablecer', u'restabelecer'), (u'r\xe9stea', u'r\xe9stia'), (u'ruborisar', u'ruborizar'), (u'r\xfabrica', u'rubrica'), (u's\xe0dia', u'sadia'), (u'saiem', u'saem'), (u'salchicha', u'salsicha'), (u'salchichas', u'salsichas'), (u'saloice', u'saloiice'), (u'salv\xe9', u'salve'), (u'salve-ra\xednha', u'salve-rainha'), (u'salv\xe9-rainha', u'salve-rainha'), (u'salv\xe9-ra\xednha', u'salve-rainha'), (u'sao', u's\xe3o'), (u'sargeta', u'sarjeta'), (u'se\xe7\xf5es', u'sec\xe7\xf5es'), (u'seija', u'seja'), (u'seissentos', u'seiscentos'), (u'seje', u'seja'), (u'semiar', u'semear'), (u's\xe9niores', u'seniores'), (u'sensibilidadc', u'sensibilidade'), (u'sens\xedvelmente', u'sensivelmente'), (u'setessentos', u'setecentos'), (u'siclano', u'sicrano'), (u'Sifilis', u'S\xedfilis'), (u'sif\xedlis', u's\xedfilis'), (u'sin\xe3o', u'sen\xe3o'), (u'sinmtoma', u'sintoma'), (u'sint\xe9ticamente', u'sinteticamente'), (u'sintetisa', u'sintetiza'), (u'S\xd3', u's\xf3'), (u's\xf4fra', u'sofra'), (u's\xf4fregamente', u'sofregamente'), (u'som\xe1ste', u'somaste'), (u'sombracelha', u'sobrancelha'), (u'sombrancelha', u'sobrancelha'), (u'sombrancelhas', u'sobrancelhas'), (u'suavisar', u'suavizar'), (u'substituido', u'substitu\xeddo'), (u'suburbio', u'sub\xfarbio'), (u'suI', u'sul'), (u'Sui\xe7a', u'Su\xed\xe7a'), (u'sui\xe7as', u'su\xed\xe7as'), (u'sui\xe7o', u'su\xed\xe7o'), (u'sui\xe7os', u'su\xed\xe7os'), (u'sup\xf4r', u'supor'), (u'tabeli\xf5es', u'tabeli\xe3es'), (u'ta\xednha', u'tainha'), (u'tava', u'estava'), (u't\xeaem', u't\xeam'), (u'telemovel', u'telem\xf3vel'), (u'tel\xe9movel', u'telem\xf3vel'), (u'terminacoes', u'termina\xe7\xf5es'), (u'tor\xe1xico', u'tor\xe1cico'), (u'tou', u'estou'), (u'transp\xf4r', u'transpor'), (u'trasnporte', u'transporte'), (u'tumors', u'tumores'), (u'\xfamida', u'h\xfamida'), (u'umidade', u'unidade'), (u'vai-vem', u'vaiv\xe9m'), (u'vegil\xe2ncia', u'vigil\xe2ncia'), (u'vegilante', u'vigilante'), (u'vento\xednha', u'ventoinha'), (u'veros\xedmel', u'veros\xedmil'), (u'video', u'v\xeddeo'), (u'virus', u'v\xedrus'), (u'visiense', u'viseense'), (u'vo\xe7e', u'voc\xea'), (u'vo\xe7\xea', u'voc\xea'), (u'v\xf4o', u'voo'), (u'xadr\xeas', u'xadrez'), (u'xafariz', u'chafariz'), (u'x\xe9x\xe9', u'xex\xe9'), (u'xilindr\xf3', u'chilindr\xf3'), (u'za\xedre', u'Zaire'), (u'zepelin', u'zepelim'), (u'zig-zag', u'ziguezague'), (u'zo\xf4', u'zoo'), (u'z\xf4o', u'zoo'), (u'zuar', u'zoar'), (u'zum-zum', u'zunzum')]),
+                        'pattern': u'(?um)(\\b|^)(?:abitual|\\\xe0cerca|acessor|ac\\\xf3lico|a\\\xe7oreano|actuacao|acucar|a\\\xe7ucar|advinhar|africa|ajuisar|album|alcool\\\xe9mia|aldi\\\xe3o|algerino|ameixeal|amia\\\xe7a|analizar|and\\\xe1ste|anemona|antartico|ant\\\xe1rtico|antep\\\xf4r|ap\\\xe1rte|apiadeiro|apiar|apreciacao|arctico|arrazar|\\\xe1rtico|artifice|artif\\\xedcial|ascen\\\xe7\\\xe3o|ass\\\xfacar|aste|aster\\\xedstico|aver\\\xe7\\\xe3o|avizar|avulsso|ba\\\xednha|banca\\-rota|bandeija|b\\\xe9b\\\xe9|beige|ben\\\xe7\\\xe3o|benefici\\\xeancia|beneficiente|benvinda|benvindo|boasvindas|borborinho|Brazil|bussula|cabo\\-verdeano|caimbras|calc\\\xe1reo|calsado|calv\\\xedce|camoneano|campi\\\xe3o|can\\\xe7acos|caracter|caract\\\xe9res|catequeze|catequisador|catequisar|ch\\\xedcara|ciclano|cicrano|cidad\\\xe3es|cidad\\\xf5es|cincoenta|cinseiro|cinsero|citacoes|coaliz\\\xe3o|c\\\xf4dia|comb\\\xf3io|comp\\\xf4r|concerteza|constituia|constitu\\\xedu|contato|contens\\\xe3o|contribuicoes|c\\\xf4r|corass\\\xe3o|cor\\\xe7ario|cor\\\xe7\\\xe1rio|cornprimidosinbo|cr\\\xe2neo|dE|defeni\\\xe7\\\xe3o|defenido|defenir|deficite|degladiar|deiche|desinteria|despendio|desp\\\xeandio|desplic\\\xeancia|dificulidade|dispender|dispendio|distribuido|dru\\\xedda|\\\xe9cr\\\xe3|ecran|\\\xe9cran|\\\xeale|elice|\\\xe9lice|emiratos|engolis\\-te|engulir|enguliste|entertido|entitular|entreterimento|entreti\\-me|env\\\xf3lucro|er\\\xf3i|escluir|esclus\\\xe3o|escriv\\\xf5es|esqueiro|esquesito|estacoes|esteje|excava\\\xe7\\\xe3o|excavar|exdr\\\xfaxula|exdr\\\xfaxulas|exitar|explicacoes|exquisito|extende|extender|f\\\xe0cilmenfe|f\\\xe0cilmente|fariam\\-lhe|FARM\\\xc1ClAS|farmec\\\xeautico|fassa|f\\\xe9bre|fecula|f\\\xe9mea|femenino|femininismo|f\\\xedsiologista|fiz\\\xe9mos|fizes\\-te|fl\\\xf4r|for\\\xe3o|formalisar|f\\\xf4ro|fos\\-te|frag\\\xe2ncia|fran\\\xe7\\\xeas|frasqutnho|frustado|fur\\\xe1|gaz|g\\\xe1z|geito|geneceu|geropiga|glic\\\xe9mia|gorgeta|grangear|guizar|hectar|herm\\\xe9ticamente|hernia|higi\\\xe9ne|hilariedade|hiperac\\\xeddez|hontem|igiene|igienico|igi\\\xe9nico|igreija|iguasu|ilac\\\xe7\\\xe3o|imbigo|impecilho|\\\xedncas|inc\\\xeasto|inclusiv\\\xe9|inc\\\xf4modos|incontest\\\xe1velmente|incontest\\\xe0velmente|indespens\\\xe1veis|indespens\\\xe1vel|India|indiguina\\\xe7\\\xe3o|indiguinado|indiguinar|inflac\\\xe7\\\xe3o|ingreja|INSCRICOES|intens\\\xe3o|intertido|intoxica|intrega|inveros\\\xedmel|iorgute|ipop\\\xf3tamo|ipsilon|ipslon|isquesito|ju\\\xedz|juiza|j\\\xfaniores|justanzente|juz|kilo|laborat\\\xf3rio\\-porque|ladravaz|lament\\\xe0velmente|lampe\\\xe3o|largartixa|largarto|l\\\xeam|leuc\\\xe9mia|licensa|lingu\\\xedsta|lisongear|logista|ma\\\xe7ajar|Macfadden\\-o|mae|magestade|m\\\xe3gua|mangerico|mangerona|manteem\\-se|mantega|mantem\\-se|massi\\\xe7o|massisso|m\\\xe9dica\\-Rio|menistro|merciaria|metrelhadora|miscegena\\\xe7\\\xe3o|misogenia|misogeno|mis\\\xf3geno|m\\\xba|m\\\xf4lho|monument\\\xe2nea|mortandela|morteIa|muinto|nasaias|n\\\xeale|nest|Nivea|nonagessimo|nonag\\\xe9ssimo|nornal|not\\\xe0velmente|obcess\\\xe3o|obesidae|\\\xf3bviamente|\\\xf2bviamente|ofecina|oje|omem|opcoes|op\\\xf3brio|opr\\\xf3bio|orf\\\xe3o|organigrama|organisar|org\\\xe3o|orta|\\\xf3tima|\\\xf3timos|paraliza\\\xe7\\\xe3o|paralizado|paralizar|par\\\xe1ste|P\\\xe1tria|pa\\\xfal|pecal\\\xe7o|p\\\xeaga|periodo|pertubar|per\\\xfa|piqueno|pirin\\\xe9us|poblema|pobrema|poden|poder\\-mos|ponteagudo|pontuacoes|prazeiroso|precaridade|precizar|preserveran\\\xe7a|previl\\\xe9gio|prim\\\xe1ria\\-que|pri\\\xfado|probalidade|progreso|proib\\\xeddo|pro\\\xedbido|pr\\\xf3pia|propiedade|propio|pr\\\xf3pio|provocacoes|prsen\\\xe7a|prustituta|pud\\\xe9rmos|p\\\xfalico|p\\\xfas|pus\\\xe9mos|quadricomia|quadriplicado|quaisqueres|quer\\-a|quere\\-se|quer\\-o|qu\\\xedmco|quises\\-te|quizer|quizeram|quizesse|quizessem|ra\\\xednha|ra\\\xedz|raizes|ratato|ra\\\xfal|razar|rectaguarda|r\\\xe9dia|reestabelecer|refeicoes|ref\\\xearencia|regeitar|regurjitar|reinvidica\\\xe7\\\xe3o|reinvidicar|requer\\-a|requere\\-se|requer\\-o|requesito|requisicoes|RESIDENCIA|respira\\\xe7\\\xe1o|restablecer|r\\\xe9stea|ruborisar|r\\\xfabrica|s\\\xe0dia|saiem|salchicha|salchichas|saloice|salv\\\xe9|salve\\-ra\\\xednha|salv\\\xe9\\-rainha|salv\\\xe9\\-ra\\\xednha|sao|sargeta|se\\\xe7\\\xf5es|seija|seissentos|seje|semiar|s\\\xe9niores|sensibilidadc|sens\\\xedvelmente|setessentos|siclano|Sifilis|sif\\\xedlis|sin\\\xe3o|sinmtoma|sint\\\xe9ticamente|sintetisa|S\\\xd3|s\\\xf4fra|s\\\xf4fregamente|som\\\xe1ste|sombracelha|sombrancelha|sombrancelhas|suavisar|substituido|suburbio|suI|Sui\\\xe7a|sui\\\xe7as|sui\\\xe7o|sui\\\xe7os|sup\\\xf4r|tabeli\\\xf5es|ta\\\xednha|tava|t\\\xeaem|telemovel|tel\\\xe9movel|terminacoes|tor\\\xe1xico|tou|transp\\\xf4r|trasnporte|tumors|\\\xfamida|umidade|vai\\-vem|vegil\\\xe2ncia|vegilante|vento\\\xednha|veros\\\xedmel|video|virus|visiense|vo\\\xe7e|vo\\\xe7\\\xea|v\\\xf4o|xadr\\\xeas|xafariz|x\\\xe9x\\\xe9|xilindr\\\xf3|za\\\xedre|zepelin|zig\\-zag|zo\\\xf4|z\\\xf4o|zuar|zum\\-zum)(\\b|$)'}},
+ 'rus': {'BeginLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'EndLines': {'data': OrderedDict(),
+                      'pattern': None},
+         'PartialLines': {'data': OrderedDict(),
+                          'pattern': None},
+         'PartialWordsAlways': {'data': OrderedDict([(u'\xb6\xb6', u'\u266b'), (u'\xb6', u'\u266a')]),
+                                'pattern': None},
+         'WholeLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'WholeWords': {'data': OrderedDict([(u'\u041d\u0404\u0419', u'\u041d\u0415\u0419'), (u'\u041e\u0420\u0413\u0417\u041d\u0418\u0417\u041c\u041e\u0411', u'\u041e\u0420\u0413\u0410\u041d\u0418\u0417\u041c\u0410'), (u'\u0427\u04570', u'\u0427\u0422\u041e'), (u'\u041d\u042d', u'\u041d\u0410'), (u'\u0421\u041e\u0421\u0404\u0414\u041d\u042e\u042e', u'\u0421\u041e\u0421\u0415\u0414\u041d\u042e\u042e'), (u'\u041f\u041b\u0417\u041d\u0404\u0422\u0423', u'\u041f\u041b\u0410\u041d\u0415\u0422\u0423'), (u'\u0417\u0417\u0413\u042d\u0414\u041e\u041a', u'\u0417\u0410\u0413\u0410\u0414\u041e\u041a'), (u'\u0421\u041e\u0422\u0412\u041e\u0420\u0404\u041d\u0418\u042f', u'\u0421\u041e\u0422\u0412\u041e\u0420\u0415\u041d\u0418\u042f'), (u'\u041c\u0418\u0420\u042d', u'\u041c\u0418\u0420\u0410'), (u'\u041f\u041e\u042f\u0411\u041b\u0404\u041d\u0418\u042f', u'\u041f\u041e\u042f\u0412\u041b\u0415\u041d\u0418\u042f'), (u'\u0417\u0404\u041c\u041b\u0404', u'\u0417\u0415\u041c\u041b\u0415'), (u'\u0404\u0429\u0404', u'\u0415\u0429\u0401'), (u'\u0422\u0404\u041c\u041d\u042c\u0406\u0425', u'\u0422\u0415\u041c\u041d\u042b\u0425'), (u'\u0421\u0404\u0420\u042c\u0404\u0417\u041d\u042c\u0406\u041c', u'\u0421\u0415\u0420\u042c\u0415\u0417\u041d\u042b\u041c'), (u'\u041f\u041e\u0428\u0406\u04060', u'\u041f\u041e\u0428\u041b\u041e'), (u'\u041f\u04400\u0418\u04170\u0428\u0404\u041b', u'\u041f\u0420\u041e\u0418\u0417\u041e\u0428\u0415\u041b'), (u'\u0421\u0404\u041a\u0420\u0404\u0422\u042d\u041c\u0418', u'\u0421\u0415\u041a\u0420\u0415\u0422\u0410\u041c\u0418'), (u'\u041c\u042d\u0422\u0404\u0420\u0418\u0417\u041b\u042c\u0406', u'\u041c\u0410\u0422\u0415\u0420\u0418\u0410\u041b\u042b'), (u'\u041f\u042f\u0422\u0404\u041d', u'\u041f\u042f\u0422\u0415\u041d'), (u'\u041f\u041b\u0430\u041d\u0404\u0457\u0404', u'\u041f\u041b\u0410\u041d\u0415\u0422\u0415'), (u'\u041a\u0417\u0422\u042d\u041a\u041b\u0418\u0417\u041c', u'\u041a\u0410\u0422\u0410\u041a\u041b\u0418\u0417\u041c'), (u'\u041e\u041a\u0417\u0417\u0417\u041b\u0421\u042f', u'\u041e\u041a\u0410\u0417\u0410\u041b\u0421\u042f'), (u'\u0414\u042d\u041b\u042c\u0428\u0415', u'\u0414\u0410\u041b\u042c\u0428\u0415'), (u'\u0422\u0412\u041a', u'\u0422\u0410\u041a'), (u'\u041f\u041b\u0417\u041d\u0404\u0422\u0417', u'\u041f\u041b\u0410\u041d\u0415\u0422\u0410'), (u'\u0427\u0404\u0413\u041e', u'\u0427\u0415\u0413\u041e'), (u'\u0423\u0417\u041d\u042d\u0422\u042c', u'\u0423\u0417\u041d\u0410\u0422\u042c'), (u'\u041f\u041b\u042d\u041d\u0404\u0422\u0404', u'\u041f\u041b\u0410\u041d\u0415\u0422\u0415'), (u'\u041d\u0404\u041c', u'\u041d\u0415\u041c'), (u'\u0411\u041e\u0417\u041c\u041e\u0416\u041d\u0417', u'\u0412\u041e\u0417\u041c\u041e\u0416\u041d\u0410'), (u'\u0421\u041e\u0411\u0404\u0420\u0428\u0404\u041d\u041d\u041e', u'\u0421\u041e\u0412\u0415\u0420\u0428\u0415\u041d\u041d\u041e'), (u'\u0418\u041d\u042d\u0427\u0404', u'\u0418\u041d\u0410\u0427\u0415'), (u'\u0411\u0421\u0404', u'\u0412\u0421\u0415'), (u'\u041d\u0415\u0414\u041e\u0421\u0422\u0417\u0422\u041a\u0418', u'\u041d\u0415\u0414\u041e\u0421\u0422\u0410\u0422\u041a\u0418'), (u'\u041d\u041e\u0412\u042c\u0406\u0404', u'\u041d\u041e\u0412\u042b\u0415'), (u'\u0412\u0404\u041b\u0418\u041a\u041e\u041b\u0404\u041f\u041d\u042d\u042f', u'\u0412\u0415\u041b\u0418\u041a\u041e\u041b\u0415\u041f\u041d\u0410\u042f'), (u'\u041e\u0421\u0422\u042d\u0406\u0406\u041e\u0421\u042c', u'\u041e\u0421\u0422\u0410\u041b\u041e\u0421\u042c'), (u'\u041d\u0417\u041b\u0418\u0427\u0418\u0404', u'\u041d\u0410\u041b\u0418\u0427\u0418\u0415'), (u'\u0431\u042b', u'\u0431\u044b'), (u'\u041f\u0420\u041e\u0426\u0412\u0415\u0422\u0412\u0422\u042c', u'\u041f\u0420\u041e\u0426\u0412\u0415\u0422\u0410\u0422\u042c'), (u'\u041a\u0417\u041a', u'\u041a\u0410\u041a'), (u'\u0412\u041e\u0414\u0417', u'\u0412\u041e\u0414\u0410'), (u'\u041d\u0417\u0428\u0415\u041b', u'\u041d\u0410\u0428\u0415\u041b'), (u'\u041d\u0404', u'\u041d\u0415'), (u'\u0422\u041e\u0416\u0404', u'\u0422\u041e\u0416\u0415'), (u'\u0412\u0423\u041b\u041a\u042d\u041d\u0418\u0427\u0404\u0421\u041a\u041e\u0419', u'\u0412\u0423\u041b\u041a\u0410\u041d\u0418\u0427\u0415\u0421\u041a\u041e\u0419'), (u'\u042d\u041a\u0422\u0418\u0411\u041d\u041e\u0421\u0422\u0418', u'\u0410\u041a\u0422\u0418\u0412\u041d\u041e\u0421\u0422\u0418'), (u'\u041f\u041e\u042f\u0412\u0418\u041b\u0417\u0421\u042c', u'\u041f\u041e\u042f\u0412\u0418\u041b\u0410\u0421\u042c'), (u'\u041d\u041e\u0412\u0417\u042f', u'\u041d\u041e\u0412\u0410\u042f'), (u'\u0421\u0422\u0420\u042d\u0422\u0404\u0413\u0418\u042f', u'\u0421\u0422\u0420\u0410\u0422\u0415\u0413\u0418\u042f'), (u'\u0423\u0421\u041f\u0404\u0428\u041d0', u'\u0423\u0421\u041f\u0415\u0428\u041d\u041e'), (u'\u041f\u041e\u0421\u0417\u0414\u041a\u0423', u'\u041f\u041e\u0421\u0410\u0414\u041a\u0423'), (u'\u0413\u041e\u0422\u041e\u0411\u042b', u'\u0413\u041e\u0422\u041e\u0412\u042b'), (u'\u041d\u0417\u0427\u0417\u0422\u042c', u'\u041d\u0410\u0427\u0410\u0422\u042c'), (u'\u041e\u0425\u041e\u0422\u042d', u'\u041e\u0425\u041e\u0422\u0410'), (u'\u041f\u0420\u0418\u0417\u041d\u0417\u041a\u0417\u041c\u0418', u'\u041f\u0420\u0418\u0417\u041d\u0410\u041a\u0410\u041c\u0418'), (u'\u041f\u04400\u0428\u041b\u041e\u041c', u'\u041f\u0420\u041e\u0428\u041b\u041e\u041c'), (u'\u041d\u042d\u0421\u0422\u041e\u042f\u0429\u0404\u041c', u'\u041d\u0410\u0421\u0422\u041e\u042f\u0429\u0415\u041c'), (u'\u041f\u0423\u0421\u0422\u041e\u0422\u0417\u0425', u'\u041f\u0423\u0421\u0422\u041e\u0422\u0410\u0425'), (u'\u0411\u041b\u0417\u0416\u041d\u041e\u0419', u'\u0412\u041b\u0410\u0416\u041d\u041e\u0419'), (u'\u041f\u041e\u0427\u0411\u0404', u'\u041f\u041e\u0427\u0412\u0415'), (u'\u041c\u042c\u0406', u'\u041c\u042b'), (u'\u0421\u0404\u0419\u0427\u0417\u0421', u'\u0421\u0415\u0419\u0427\u0410\u0421'), (u'\u0404\u0421\u041b\u0418', u'\u0415\u0421\u041b\u0418'), (u'\u0417\u0417\u0422\u0420\u041e\u041d\u0415\u041c', u'\u0417\u0410\u0422\u0420\u041e\u041d\u0415\u041c'), (u'\u041e\u041f\u0417\u0421\u0417\u0404\u041c\u0421\u042f', u'\u041e\u041f\u0410\u0421\u0410\u0415\u041c\u0421\u042f'), (u'\u0421\u0418\u041b\u042c\u041d0', u'\u0421\u0418\u041b\u042c\u041d\u041e'), (u'\u041e\u0422\u041b\u0418\u0427\u0417\u0404\u0422\u0421\u042f', u'\u041e\u0422\u041b\u0418\u0427\u0410\u0415\u0422\u0421\u042f'), (u'\u0420\u042d\u041d\u042c\u0428\u0404', u'\u0420\u0410\u041d\u042c\u0428\u0415'), (u'\u041d\u0417\u0417\u042c\u0406\u0412\u0417\u042e\u0422', u'\u041d\u0410\u0417\u042b\u0412\u0410\u042e\u0422'), (u'\u0422\u0404\u041a\u041b3', u'\u0422\u0415\u041a\u041b\u0410'), (u'\u041e\u0421\u0417\u0414\u041e\u0427\u041d\u042b\u041c\u0418', u'\u041e\u0421\u0410\u0414\u041e\u0427\u041d\u042b\u041c\u0418'), (u'\u041f\u041e\u0421\u0422\u0404\u041f\u0404\u041d\u041d0', u'\u041f\u041e\u0421\u0422\u0415\u041f\u0415\u041d\u041d\u041e'), (u'\u0418\u0421\u041f\u042d\u0420\u042f\u041b\u0417\u0421\u042c', u'\u0418\u0421\u041f\u0410\u0420\u042f\u041b\u0410\u0421\u042c'), (u'\u0404\u041e\u041b\u042c\u0428\u041e\u0404', u'\u0411\u041e\u041b\u042c\u0428\u041e\u0415'), (u'\u041a\u041e\u041b\u0418\u0427\u0404\u0421\u0422\u0411\u041e', u'\u041a\u041e\u041b\u0418\u0427\u0415\u0421\u0422\u0412\u041e'), (u'\u0413\u0404\u041c\u0417\u0422\u0418\u0422\u0415', u'\u0413\u0415\u041c\u0410\u0422\u0418\u0422\u0410'), (u'\u041f\u041e\u041b\u0423\u0427\u042d\u0404\u0422', u'\u041f\u041e\u041b\u0423\u0427\u0410\u0415\u0422'), (u'\u041d\u0404\u0414\u041e\u0421\u0422\u0417\u0427\u041d0', u'\u041d\u0415\u0414\u041e\u0421\u0422\u0410\u0422\u041e\u0427\u041d\u041e'), (u'\u041f\u0418\u0422\u042d\u041d\u0418\u042f', u'\u041f\u0418\u0422\u0410\u041d\u0418\u042f'), (u'\u041f\u041e\u041a\u0417', u'\u041f\u041e\u041a\u0410'), (u'\u0411\u042c\u0406\u0425\u041e\u0414\u0418\u041b\u0418', u'\u0412\u042b\u0425\u041e\u0414\u0418\u041b\u0418'), (u'\u0417\u0404\u041c\u0406\u0406\u0404', u'\u0417\u0415\u041c\u041b\u0415'), (u'\u0412\u0404\u0421\u042c\u0406\u0418\u0417', u'\u0412\u0415\u0421\u042c\u041c\u0410'), (u'\u0417\u0404\u041c\u041b\u0418', u'\u0417\u0415\u041c\u041b\u0418'), (u'\u0431\u042c\u0406\u041b\u041e', u'\u0411\u042b\u041b\u041e'), (u'\u041a\u0418\u0417\u041d\u0418', u'\u0416\u0418\u0417\u041d\u0418'), (u'\u0421\u0422\u0417\u041d\u041e\u0412\u0418\u041b\u0417\u0421\u042c', u'\u0421\u0422\u0410\u041d\u041e\u0412\u0418\u041b\u0410\u0421\u042c'), (u'\u0421\u041e\u041b\u0404\u041d\u0404\u0404', u'\u0421\u041e\u041b\u0401\u041d\u0415\u0415'), (u'\u041c\u042d\u0413\u041d\u0418\u0422\u041d\u042b\u041c', u'\u041c\u0410\u0413\u041d\u0418\u0422\u041d\u042b\u041c'), (u'\u0427\u0422\u041e\u0431\u042c\u0406', u'\u0427\u0422\u041e\u0411\u042b'), (u'\u0421\u041e\u0417\u0414\u0415\u0422\u042c', u'\u0421\u041e\u0417\u0414\u0410\u0422\u042c'), (u'\u041c\u0417\u0413\u041d\u0418\u0422\u041d\u041e\u0404', u'\u041c\u0410\u0413\u041d\u0418\u0422\u041d\u041e\u0415'), (u'\u041a\u042d\u0416\u0423\u0422\u0421\u042f', u'\u041a\u0410\u0416\u0423\u0422\u0421\u042f'), (u'\u041e\u0417\u041d\u0417\u0427\u0417\u0404\u0422', u'\u041e\u0417\u041d\u0410\u0427\u0410\u0415\u0422'), (u'\u041c\u041e\u0413\u041b\u0417', u'\u041c\u041e\u0413\u041b\u0410'), (u'\u0418\u041c\u0404\u0422\u042c', u'\u0418\u041c\u0415\u0422\u042c'), (u'\u041a\u041e\u0421\u041c\u041e\u0421\u042d', u'\u041a\u041e\u0421\u041c\u041e\u0421\u0410'), (u'\u0421\u041e\u041b\u041d\u0404\u0427\u041d\u0417\u042f', u'\u0421\u041e\u041b\u041d\u0415\u0427\u041d\u0410\u042f'), (u'\u0421\u0418\u0421\u0422\u0404\u041c\u0417', u'\u0421\u0418\u0421\u0422\u0415\u041c\u0410'), (u'\u041f\u041e\u0421\u0406\u0406\u0423\u0416\u0418\u041b\u041e', u'\u041f\u041e\u0421\u041b\u0423\u0416\u0418\u041b\u041e'), (u'\u041c\u0417\u0413\u041d\u0418\u0422\u041d\u041e\u0413\u041e', u'\u041c\u0410\u0413\u041d\u0418\u0422\u041d\u041e\u0413\u041e'), (u'\u041f\u041b\u0412\u041d\u0404\u0422\u042b', u'\u041f\u041b\u0410\u041d\u0415\u0422\u042b'), (u'\u041b\u041e\u041a\u0417\u041b\u042c\u041d\u042c\u0406\u0425', u'\u041b\u041e\u041a\u0410\u041b\u042c\u041d\u042b\u0425'), (u'\u041f\u041e\u041b\u0404\u0419', u'\u041f\u041e\u041b\u0415\u0419'), (u'\u041a\u0417\u0416\u0423\u0422\u0421\u042f', u'\u041a\u0410\u0416\u0423\u0422\u0421\u042f'), (u'\u041a\u0417\u041a\u041e\u0413\u041e', u'\u041a\u0410\u041a\u041e\u0413\u041e'), (u'\u0421\u0422\u0420\u0417\u0428\u041d\u041e\u0413\u041e', u'\u0421\u0422\u0420\u0410\u0428\u041d\u041e\u0413\u041e'), (u'\u0421\u0422\u041e\u041b\u041a\u041d\u041e\u0415\u0404\u041d\u0418\u042f', u'\u0421\u0422\u041e\u041b\u041a\u041d\u041e\u0412\u0415\u041d\u0418\u042f'), (u'\u041c\u0415\u0421\u0422\u0417\u041c\u0418', u'\u041c\u0415\u0421\u0422\u0410\u041c\u0418'), (u'\u0421\u0414\u0404\u041b\u0417\u0422\u042c', u'\u0421\u0414\u0415\u041b\u0410\u0422\u042c'), (u'\u0421\u0422\u0417\u041b\u041e', u'\u0421\u0422\u0410\u041b\u041e'), (u'\u041c\u042d\u0413\u041d\u0418\u0422\u041d\u041e\u0413\u041e', u'\u041c\u0410\u0413\u041d\u0418\u0422\u041d\u041e\u0413\u041e'), (u'\u0417\u0417\u041a\u041b\u042e\u0427\u0417\u0412\u0428\u0404\u0419\u0421\u042f', u'\u0417\u0410\u041a\u041b\u042e\u0427\u0410\u0412\u0428\u0415\u0419\u0421\u042f'), (u'\u0404\u0413\u041e', u'\u0415\u0413\u041e'), (u'\u042f\u0414\u0420\u0404', u'\u042f\u0414\u0420\u0415'), (u'\u041d\u0417', u'\u041d\u0410'), (u'\u0418\u0421\u0427\u0404\u0417\u041b3', u'\u0418\u0421\u0427\u0415\u0417\u041b\u0410'), (u'\u0421\u0427\u0418\u0422\u0417\u042e', u'\u0421\u0427\u0418\u0422\u0410\u042e'), (u'\u0428\u042d\u041d\u0421\u042b', u'\u0428\u0410\u041d\u0421\u042b'), (u'\u0418\u041d\u0417\u0427\u0404', u'\u0418\u041d\u0410\u0427\u0415'), (u'\u0421\u0422\u0417\u041b', u'\u0421\u0422\u0410\u041b'), (u'\u0422\u0420\u0417\u0422\u0418\u0422\u042c', u'\u0422\u0420\u0410\u0422\u0418\u0422\u042c'), (u'\u041d\u0417\u041f\u0420\u0417\u0412\u041b\u042f\u0404\u0422\u0421\u042f', u'\u041d\u0410\u041f\u0420\u0410\u0412\u041b\u042f\u0415\u0422\u0421\u042f'), (u'\u041e\u0411\u041b\u042d\u0421\u0422\u0418', u'\u041e\u0411\u041b\u0410\u0421\u0422\u0418'), (u'\u042f\u0412\u041b\u042f\u0406\u041e\u0422\u0421\u042f', u'\u042f\u0412\u041b\u042f\u042e\u0422\u0421\u042f'), (u'\u0413\u041b\u042d\u0412\u041d\u041e\u0419', u'\u0413\u041b\u0410\u0412\u041d\u041e\u0419'), (u'\u0414\u041e\u041a\u0417\u0417\u0417\u0422\u0404\u041b\u042c\u0421\u0422\u0412', u'\u0414\u041e\u041a\u0410\u0417\u0410\u0422\u0415\u041b\u042c\u0421\u0422\u0412'), (u'\u041a\u0418\u0421\u041b\u041e\u0422\u042d\u041c\u0418', u'\u041a\u0418\u0421\u041b\u041e\u0422\u0410\u041c\u0418'), (u'\u041e\u041d\u042d', u'\u041e\u041d\u0410'), (u'\u041f\u0420\u0417\u041a\u0422\u0418\u0427\u0404\u0421\u041a\u0418', u'\u041f\u0420\u0410\u041a\u0422\u0418\u0427\u0415\u0421\u041a\u0418'), (u'\u041b\u0404\u0421\u0423', u'\u041b\u0415\u0421\u0423'), (u'\u0423\u0421\u041b\u041e\u0411\u0418\u042f\u041c', u'\u0423\u0421\u041b\u041e\u0412\u0418\u042f\u041c'), (u'\u0421\u041f\u0417\u0421\u0422\u0418\u0421\u042c', u'\u0421\u041f\u0410\u0421\u0422\u0418\u0421\u042c'), (u'\u0420\u0417\u0417\u0412\u0418\u0412\u0417\u042e\u0429\u0418\u0404\u0421\u042f', u'\u0420\u0410\u0417\u0412\u0418\u0412\u0410\u042e\u0429\u0418\u0415\u0421\u042f'), (u'\u0428\u042d\u041f\u041a\u0418', u'\u0428\u0410\u041f\u041a\u0418'), (u'\u0417\u041d\u0417\u0404\u041c', u'\u0417\u041d\u0410\u0415\u041c'), (u'\u0421\u041e\u041e\u0418\u0420\u042d\u0404\u041c\u0421\u042f', u'\u0421\u041e\u0411\u0418\u0420\u0410\u0415\u041c\u0421\u042f'), (u'\u0411\u042b\u042f\u0421\u041d\u0418\u0422\u042c', u'\u0412\u042b\u042f\u0421\u041d\u0418\u0422\u042c'), (u'\u0421\u0417\u041c', u'\u0421\u0410\u041c'), (u'\u0420\u0417\u0421\u041f\u041e\u0417\u041d\u0417\u0422\u042c', u'\u0420\u0410\u0421\u041f\u041e\u0417\u041d\u0410\u0422\u042c'), (u'\u0423\u0417\u041d\u0417\u0422\u042c', u'\u0423\u0417\u041d\u0410\u0422\u042c'), (u'\u041a\u042d\u0416\u0404\u0422\u0421\u042f', u'\u041a\u0410\u0416\u0415\u0422\u0421\u042f'), (u'\u041e\u0420\u0404\u0418\u0422\u0417\u041b\u042c\u041d\u042c\u0406\u0404', u'\u041e\u0420\u0411\u0418\u0422\u0410\u041b\u042c\u041d\u042b\u0415'), (u'\u041b\u0404\u0422\u042d\u0422\u0404\u041b\u042c\u041d\u042c\u0406\u0404', u'\u041b\u0415\u0422\u0410\u0422\u0415\u041b\u042c\u041d\u042b\u0415'), (u'\u0417\u041f\u041f\u0417\u0420\u0415\u0422\u042c\u0406', u'\u0410\u041f\u041f\u0410\u0420\u0410\u0422\u042b'), (u'\u0416\u0404', u'\u0416\u0415'), (u'\u0422\u0417\u041a\u0417\u042f', u'\u0422\u0410\u041a\u0410\u042f'), (u'\u041c\u0417\u041b\u0404\u041d\u042c\u041a\u0417\u042f', u'\u041c\u0410\u041b\u0415\u041d\u042c\u041a\u0410\u042f'), (u'\u041f\u041b\u042d\u041d\u0404\u0422\u0417', u'\u041f\u041b\u0410\u041d\u0415\u0422\u0410'), (u'\u0421\u041f\u0417\u0406\u0406\u042c\u041a\u041e', u'\u0421\u0422\u041e\u041b\u042c\u041a\u041e'), (u'\u0431\u042c\u0406\u041b3', u'\u0411\u042b\u041b\u0410'), (u'\u0401\u0415\u0421\u0427\u0418\u0421\u041b\u0404\u041d\u041d\u041e\u0404', u'\u0411\u0415\u0421\u0427\u0418\u0421\u041b\u0415\u041d\u041d\u041e\u0415'), (u'\u041c\u0417\u0413\u041d\u0418\u0457\u041d\u042c\u0406\u0425', u'\u041c\u0410\u0413\u041d\u0418\u0422\u041d\u042b\u0425'), (u'\u041f\u041e\u0421\u0422\u0440\u0430\u04143\u041b', u'\u041f\u041e\u0421\u0422\u0420\u0410\u0414\u0410\u041b'), (u'\u0414\u0417\u0416\u0404', u'\u0414\u0410\u0416\u0415'), (u'\u0420\u0417\u0417\u041d\u042c\u0406\u041c\u0418', u'\u0420\u0410\u0417\u041d\u042b\u041c\u0418'), (u'\u0421\u0423\u0429\u0404\u0421\u0422\u0411\u041e\u0412\u042d\u041d\u0418\u0404', u'\u0421\u0423\u0429\u0415\u0421\u0422\u0412\u041e\u0412\u0410\u041d\u0418\u0415'), (u'\u041f\u041b\u0430\u041d\u0404\u0457\u042c\u0406', u'\u041f\u041b\u0410\u041d\u0415\u0422\u042b'), (u'\u041f\u041e\u0414\u0412\u0404\u0420\u0413\u041b\u0417\u0421\u042c', u'\u041f\u041e\u0414\u0412\u0415\u0420\u0413\u041b\u0410\u0421\u042c'), (u'\u041e\u041f\u0417\u0421\u0406-\u0406\u041e\u0421\u0422\u0418', u'\u041e\u041f\u0410\u0421\u041d\u041e\u0421\u0422\u0418'), (u'\u041f\u041b\u0417\u041d\u0404\u0422\u0404', u'\u041f\u041b\u0410\u041d\u0415\u0422\u0415'), (u'\u041d0', u'\u041d\u041e'), (u'\u0431\u042c\u0406', u'\u0411\u042b'), (u'\u041e\u0422\u0414\u0417\u041b\u0404\u041d\u041d\u042b\u0404', u'\u041e\u0422\u0414\u0410\u041b\u0401\u041d\u041d\u042b\u0415'), (u'\u041f\u041e\u041b\u042f\u0420\u041d\u042c\u0406\u0404', u'\u041f\u041e\u041b\u042f\u0420\u041d\u042b\u0415'), (u'\u0426\u0404\u041b\u042c\u0406-\u041e', u'\u0426\u0415\u041b\u042c\u042e'), (u'\u041f\u0404\u0429\u0404\u0420\u0417\u0425', u'\u041f\u0415\u0429\u0415\u0420\u0410\u0425'), (u'\u041d\u0417\u041f\u041e\u041b\u041d\u0404\u041d\u041d\u042c\u0406\u0425', u'\u041d\u0410\u041f\u041e\u041b\u041d\u0415\u041d\u041d\u042b\u0425'), (u'\u0418\u0421\u041f\u0417\u0420\u0404\u041d\u0418\u042f\u041c\u0418', u'\u0418\u0421\u041f\u0410\u0420\u0415\u041d\u0418\u042f\u041c\u0418'), (u'\u041c\u0418\u041d\u0418\u0417\u0422\u042e\u0420\u041d\u042c\u0406\u0404', u'\u041c\u0418\u041d\u0418\u0410\u0422\u042e\u0420\u041d\u042b\u0415'), (u'\u0422\u042d\u041a\u0417\u042f', u'\u0422\u0410\u041a\u0410\u042f'), (u'\u041f\u0440\u0418\u0421\u041f0\u0421\u041e\u0431\u0418\u0422\u042c\u0421\u042f', u'\u041f\u0420\u0418\u0421\u041f\u041e\u0421\u041e\u0411\u0418\u0422\u042c\u0421\u042f'), (u'\u041d\u0404\u041e\u0404\u0425\u041e\u0414\u0418\u041c\u042c\u0406\u0404', u'\u041d\u0415\u041e\u0411\u0425\u041e\u0414\u0418\u041c\u042b\u0415'), (u'\u041e\u0420\u0413\u0412\u041d\u0418\u0427\u0404\u0421\u041a\u0418\u0404', u'\u041e\u0420\u0413\u0410\u041d\u0418\u0427\u0415\u0421\u041a\u0418\u0415'), (u'\u041c\u0417\u0420\u0421\u0418\u0417\u041d\u0421\u041a\u0418\u0404', u'\u041c\u0410\u0420\u0421\u0418\u0410\u041d\u0421\u041a\u0418\u0415'), (u'\u041c\u0404\u0421\u0422\u0404', u'\u041c\u0415\u0421\u0422\u0415'), (u'\u0406\\/\u0406\u0410\u041a\u041a\u0415\u0419\u0428', u'\u041c\u0410\u041a\u041a\u0415\u0419\u041d'), (u'\u041d\u0417\u0425\u041e\u0414\u042f\u0429\u0418\u0404\u0421\u042f', u'\u041d\u0410\u0425\u041e\u0414\u042f\u0429\u0418\u0415\u0421\u042f'), (u'\u041d\u0404\u0417\u041a\u0422\u0418\u0412\u041d\u041e\u041c', u'\u041d\u0415\u0410\u041a\u0422\u0418\u0412\u041d\u041e\u041c'), (u'\u0417\u042d\u0421\u041d\u042f\u0422\u042c', u'\u0417\u0410\u0421\u041d\u042f\u0422\u042c'), (u'\u041e\u0420\u0413\u0417\u041d\u0418\u0417\u041c\u042c\u0406', u'\u041e\u0420\u0413\u0410\u041d\u0418\u0417\u041c\u042b'), (u'\u0412\u0417\u0415\u0418\u041c\u041e\u0414\u0404\u0419\u0421\u0422\u0412\u041e\u0412\u0415\u0422\u042c', u'\u0412\u0417\u0410\u0418\u041c\u041e\u0414\u0415\u0419\u0421\u0422\u0412\u041e\u0412\u0410\u0422\u042c'), (u'\u041f\u0423\u0422\u0404\u0428\u0404\u0421\u0422\u0411\u0418\u0404', u'\u041f\u0423\u0422\u0415\u0428\u0415\u0421\u0422\u0412\u0418\u0415'), (u'\u041f\u0443\u0421\u0457\u042c\u0406\u041d\u041d\u042b\u0425', u'\u041f\u0423\u0421\u0422\u042b\u041d\u041d\u042b\u0425'), (u'\u0422\u0417\u041a\u0418\u0425', u'\u0422\u0410\u041a\u0418\u0425'), (u'\u041f\u0404\u0420\u0404\u0422\u0417\u0421\u041a\u0418\u0412\u0417\u0404\u041c', u'\u041f\u0415\u0420\u0415\u0422\u0410\u0421\u041a\u0418\u0412\u0410\u0415\u041c'), (u'\u0427\u04220', u'\u0427\u0422\u041e'), (u'\u0412\u0404\u0421\u042c\u041c\u0417', u'\u0412\u0415\u0421\u042c\u041c\u0410'), (u'\u041f\u041e\u041b\u041e\u0421\u0417\u041c\u0418', u'\u041f\u041e\u041b\u041e\u0421\u0410\u041c\u0418'), (u'\u041e\u0440\u0457\u042d\u041d\u0418\u0417\u041c\u042c\u0406', u'\u041e\u0420\u0413\u0410\u041d\u0418\u0417\u041c\u042b'), (u'\u041e\u0401\u041b\u0417\u0421\u0422\u0418', u'\u041e\u0411\u041b\u0410\u0421\u0422\u0418'), (u'\u042f\u0411\u041b\u042f\u042e\u0422\u0421\u042f', u'\u042f\u0412\u041b\u042f\u042e\u0422\u0421\u042f'), (u'\u0426\u0404\u041b\u042c\u042e', u'\u0426\u0415\u041b\u042c\u042e'), (u'\u041f\u041e\u0418\u0421\u041a\u041e\u0411', u'\u041f\u041e\u0418\u0421\u041a\u041e\u0412'), (u'\u0414\u041e\u041a\u0417\u0417\u0417\u0422\u0404\u0406\u0406\u042c\u0421\u0422\u0412', u'\u0414\u041e\u041a\u0410\u0417\u0410\u0422\u0415\u041b\u042c\u0421\u0422\u0412'), (u'\u041c\u041e\u0416\u0404\u0422', u'\u041c\u041e\u0416\u0415\u0422'), (u'\u041d\u042d\u0425\u041e\u0414\u0418\u0422\u042c\u0421\u042f', u'\u041d\u0410\u0425\u041e\u0414\u0418\u0422\u042c\u0421\u042f'), (u'\u041e\u0427\u0404\u041d\u042c', u'\u041e\u0427\u0415\u041d\u042c'), (u'\u0421\u0420\u0417\u0412\u041d\u0418\u0422\u042c', u'\u0421\u0420\u0410\u0412\u041d\u0418\u0422\u042c'), (u'\u041e\u0404\u041d\u0417\u0420\u0423\u0416\u0418\u041b', u'\u041e\u0411\u041d\u0410\u0420\u0423\u0416\u0418\u041b'), (u'\u041b\u042c\u0414\u0417', u'\u041b\u042c\u0414\u0410'), (u'\u041f\u041e\u0422\u0404\u041f\u041b\u0404\u041d\u0418\u0404\u0406\u0418', u'\u041f\u041e\u0422\u0415\u041f\u041b\u0415\u041d\u0418\u0415\u041c'), (u'\u041f\u041e\u0425\u041e\u041b\u041e\u0414\u0417\u041d\u0418\u0404\u0411\u0414', u'\u041f\u041e\u0425\u041e\u041b\u041e\u0414\u0410\u041d\u0418\u0415\u041c'), (u'\u041a\u042d\u041a', u'\u041a\u0410\u041a'), (u'\u0422\u0404\u041b\u041e', u'\u0422\u0415\u041b\u041e'), (u'\u0431\u041e\u041b\u042c\u0428\u0404', u'\u0411\u041e\u041b\u042c\u0428\u0415'), (u'\u041d\u042d\u041a\u041b\u041e\u041d\u042f\u0404\u0422\u0421\u042f', u'\u041d\u0410\u041a\u041b\u041e\u041d\u042f\u0415\u0422\u0421\u042f'), (u'\u0421\u041e\u0406\u0406\u041d\u0426\u0423', u'\u0421\u041e\u041b\u041d\u0426\u0423'), (u'\u0421\u04223\u0431\u0418\u041b\u0418\u0417\u0418\u0440\u041e\u0411\u0417\u0422\u042c', u'\u0421\u0422\u0410\u0411\u0418\u041b\u0418\u0417\u0418\u0420\u041e\u0412\u0410\u0422\u042c'), (u'\u0421\u0422\u042d\u0411\u0418\u041b\u042c\u041d\u042d', u'\u0421\u0422\u0410\u0411\u0418\u041b\u042c\u041d\u0410'), (u'\u041c\u0418\u041b\u0406\u0406\u0418\u041e\u041d\u041e\u0412', u'\u041c\u0418\u041b\u041b\u0418\u041e\u041d\u041e\u0412'), (u'\u041d\u0417\u0417\u042d\u0414', u'\u041d\u0410\u0417\u0410\u0414'), (u'\u0422\u0404\u041f\u041b0', u'\u0422\u0415\u041f\u041b\u041e'), (u'\u041f\u041e\u0406\u0406\u042f\u0420\u041d\u042b\u0425', u'\u041f\u041e\u041b\u042f\u0420\u041d\u042b\u0425'), (u'\u0421\u041e\u0406\u0406\u0415\u041d\u042b\u041c\u0418', u'\u0421\u041e\u041b\u0415\u041d\u042b\u041c\u0418'), (u'\u041a\u0415\u041a\u0418\u041c\u0418', u'\u041a\u0410\u041a\u0418\u041c\u0418'), (u'\u043a\u0438\u0441\u043b\u044e\u0442\u043d\u044e\u0441\u0433\u0433\u044c', u'\u043a\u0438\u0441\u043b\u043e\u0442\u043d\u043e\u0441\u0442\u044c'), (u'\u0422\u0417\u041c', u'\u0422\u0410\u041c'), (u'\u041e\u0420\u0413\u0417\u041d\u0418\u0417\u041c\u042b', u'\u041e\u0420\u0413\u0410\u041d\u0418\u0417\u041c\u042b'), (u'\u0421\u0423\u0429\u0404\u0421\u0422\u0412\u041e\u0412\u0404\u0422\u042c', u'\u0421\u0423\u0429\u0415\u0421\u0422\u0412\u041e\u0412\u0410\u0422\u042c'), (u'\u0412\u041d\u0418\u041c\u0417\u041d\u0418\u0404', u'\u0412\u041d\u0418\u041c\u0410\u041d\u0418\u0415'), (u'\u0421\u0414\u0404\u041b\u0417\u0404\u0422', u'\u0421\u0414\u0415\u041b\u0410\u0415\u0422'), (u'\u041f\u041e\u0417\u041d\u042d\u041a\u041e\u041c\u0418\u0422\u042c\u0421\u042f', u'\u041f\u041e\u0417\u041d\u0410\u041a\u041e\u041c\u0418\u0422\u042c\u0421\u042f'), (u'\u041d\u042d\u0428\u0418\u041c', u'\u041d\u0410\u0428\u0418\u041c'), (u'\u0414\u041e\u041a\u0417\u0417\u042d\u0422\u0404\u041b\u042c\u0421\u0422\u0411\u041e', u'\u0414\u041e\u041a\u0410\u0417\u0410\u0422\u0415\u041b\u042c\u0421\u0422\u0412\u041e'), (u'\u0429\u0417\u0417\u0429\u0404\u041d\u0418\u042f', u'\u0412\u0420\u0410\u0429\u0415\u041d\u0418\u042f'), (u'\u0431\u042c\u0406\u041b0', u'\u0411\u042b\u041b\u041e'), (u'\u041e\u0404\u041b\u0415\u0421\u0422\u042f\u0425', u'\u041e\u0411\u041b\u0410\u0421\u0422\u042f\u0425'), (u'\u0431\u042c\u0406\u041b\u0418', u'\u0411\u042b\u041b\u0418'), (u'\u0420\u042d\u0417\u041c\u042c\u0406\u0428\u041b\u042f\u0406\u0406\u0418', u'\u0420\u0410\u0417\u041c\u042b\u0428\u041b\u042f\u041b\u0418'), (u'\u041a\u041e\u041b\u0418\u0427\u0404\u0421\u0422\u0411\u0404', u'\u041a\u041e\u041b\u0418\u0427\u0415\u0421\u0422\u0412\u0415'), (u'\u0429\u0404\u0406\u0406\u041e\u0427\u041d\u042b\u0404', u'\u0429\u0415\u041b\u041e\u0427\u041d\u042b\u0415'), (u'\u041d\u0404\u041a\u041e\u0422\u0429\u0417\u042c\u0406\u0404', u'\u041d\u0415\u041a\u041e\u0422\u041e\u0420\u042b\u0415'), (u'\u041f\u0440\u0418\u0411\u04061\u0415\u041a\u0443\u0457', u'\u041f\u0420\u0418\u0412\u041b\u0415\u041a\u0423\u0422'), (u'\u041d\u0417\u0417\u042c\u0406\u0412\u042d\u0404\u041c\u042b\u0404', u'\u041d\u0410\u0417\u042b\u0412\u0410\u0415\u041c\u042b\u0415'), (u'\u0427\u045706\u042b', u'\u0427\u0422\u041e\u0411\u042b')]),
+                        'pattern': u'(?um)(\\b|^)(?:\\\u041d\\\u0404\\\u0419|\\\u041e\\\u0420\\\u0413\\\u0417\\\u041d\\\u0418\\\u0417\\\u041c\\\u041e\\\u0411|\\\u0427\\\u04570|\\\u041d\\\u042d|\\\u0421\\\u041e\\\u0421\\\u0404\\\u0414\\\u041d\\\u042e\\\u042e|\\\u041f\\\u041b\\\u0417\\\u041d\\\u0404\\\u0422\\\u0423|\\\u0417\\\u0417\\\u0413\\\u042d\\\u0414\\\u041e\\\u041a|\\\u0421\\\u041e\\\u0422\\\u0412\\\u041e\\\u0420\\\u0404\\\u041d\\\u0418\\\u042f|\\\u041c\\\u0418\\\u0420\\\u042d|\\\u041f\\\u041e\\\u042f\\\u0411\\\u041b\\\u0404\\\u041d\\\u0418\\\u042f|\\\u0417\\\u0404\\\u041c\\\u041b\\\u0404|\\\u0404\\\u0429\\\u0404|\\\u0422\\\u0404\\\u041c\\\u041d\\\u042c\\\u0406\\\u0425|\\\u0421\\\u0404\\\u0420\\\u042c\\\u0404\\\u0417\\\u041d\\\u042c\\\u0406\\\u041c|\\\u041f\\\u041e\\\u0428\\\u0406\\\u04060|\\\u041f\\\u04400\\\u0418\\\u04170\\\u0428\\\u0404\\\u041b|\\\u0421\\\u0404\\\u041a\\\u0420\\\u0404\\\u0422\\\u042d\\\u041c\\\u0418|\\\u041c\\\u042d\\\u0422\\\u0404\\\u0420\\\u0418\\\u0417\\\u041b\\\u042c\\\u0406|\\\u041f\\\u042f\\\u0422\\\u0404\\\u041d|\\\u041f\\\u041b\\\u0430\\\u041d\\\u0404\\\u0457\\\u0404|\\\u041a\\\u0417\\\u0422\\\u042d\\\u041a\\\u041b\\\u0418\\\u0417\\\u041c|\\\u041e\\\u041a\\\u0417\\\u0417\\\u0417\\\u041b\\\u0421\\\u042f|\\\u0414\\\u042d\\\u041b\\\u042c\\\u0428\\\u0415|\\\u0422\\\u0412\\\u041a|\\\u041f\\\u041b\\\u0417\\\u041d\\\u0404\\\u0422\\\u0417|\\\u0427\\\u0404\\\u0413\\\u041e|\\\u0423\\\u0417\\\u041d\\\u042d\\\u0422\\\u042c|\\\u041f\\\u041b\\\u042d\\\u041d\\\u0404\\\u0422\\\u0404|\\\u041d\\\u0404\\\u041c|\\\u0411\\\u041e\\\u0417\\\u041c\\\u041e\\\u0416\\\u041d\\\u0417|\\\u0421\\\u041e\\\u0411\\\u0404\\\u0420\\\u0428\\\u0404\\\u041d\\\u041d\\\u041e|\\\u0418\\\u041d\\\u042d\\\u0427\\\u0404|\\\u0411\\\u0421\\\u0404|\\\u041d\\\u0415\\\u0414\\\u041e\\\u0421\\\u0422\\\u0417\\\u0422\\\u041a\\\u0418|\\\u041d\\\u041e\\\u0412\\\u042c\\\u0406\\\u0404|\\\u0412\\\u0404\\\u041b\\\u0418\\\u041a\\\u041e\\\u041b\\\u0404\\\u041f\\\u041d\\\u042d\\\u042f|\\\u041e\\\u0421\\\u0422\\\u042d\\\u0406\\\u0406\\\u041e\\\u0421\\\u042c|\\\u041d\\\u0417\\\u041b\\\u0418\\\u0427\\\u0418\\\u0404|\\\u0431\\\u042b|\\\u041f\\\u0420\\\u041e\\\u0426\\\u0412\\\u0415\\\u0422\\\u0412\\\u0422\\\u042c|\\\u041a\\\u0417\\\u041a|\\\u0412\\\u041e\\\u0414\\\u0417|\\\u041d\\\u0417\\\u0428\\\u0415\\\u041b|\\\u041d\\\u0404|\\\u0422\\\u041e\\\u0416\\\u0404|\\\u0412\\\u0423\\\u041b\\\u041a\\\u042d\\\u041d\\\u0418\\\u0427\\\u0404\\\u0421\\\u041a\\\u041e\\\u0419|\\\u042d\\\u041a\\\u0422\\\u0418\\\u0411\\\u041d\\\u041e\\\u0421\\\u0422\\\u0418|\\\u041f\\\u041e\\\u042f\\\u0412\\\u0418\\\u041b\\\u0417\\\u0421\\\u042c|\\\u041d\\\u041e\\\u0412\\\u0417\\\u042f|\\\u0421\\\u0422\\\u0420\\\u042d\\\u0422\\\u0404\\\u0413\\\u0418\\\u042f|\\\u0423\\\u0421\\\u041f\\\u0404\\\u0428\\\u041d0|\\\u041f\\\u041e\\\u0421\\\u0417\\\u0414\\\u041a\\\u0423|\\\u0413\\\u041e\\\u0422\\\u041e\\\u0411\\\u042b|\\\u041d\\\u0417\\\u0427\\\u0417\\\u0422\\\u042c|\\\u041e\\\u0425\\\u041e\\\u0422\\\u042d|\\\u041f\\\u0420\\\u0418\\\u0417\\\u041d\\\u0417\\\u041a\\\u0417\\\u041c\\\u0418|\\\u041f\\\u04400\\\u0428\\\u041b\\\u041e\\\u041c|\\\u041d\\\u042d\\\u0421\\\u0422\\\u041e\\\u042f\\\u0429\\\u0404\\\u041c|\\\u041f\\\u0423\\\u0421\\\u0422\\\u041e\\\u0422\\\u0417\\\u0425|\\\u0411\\\u041b\\\u0417\\\u0416\\\u041d\\\u041e\\\u0419|\\\u041f\\\u041e\\\u0427\\\u0411\\\u0404|\\\u041c\\\u042c\\\u0406|\\\u0421\\\u0404\\\u0419\\\u0427\\\u0417\\\u0421|\\\u0404\\\u0421\\\u041b\\\u0418|\\\u0417\\\u0417\\\u0422\\\u0420\\\u041e\\\u041d\\\u0415\\\u041c|\\\u041e\\\u041f\\\u0417\\\u0421\\\u0417\\\u0404\\\u041c\\\u0421\\\u042f|\\\u0421\\\u0418\\\u041b\\\u042c\\\u041d0|\\\u041e\\\u0422\\\u041b\\\u0418\\\u0427\\\u0417\\\u0404\\\u0422\\\u0421\\\u042f|\\\u0420\\\u042d\\\u041d\\\u042c\\\u0428\\\u0404|\\\u041d\\\u0417\\\u0417\\\u042c\\\u0406\\\u0412\\\u0417\\\u042e\\\u0422|\\\u0422\\\u0404\\\u041a\\\u041b3|\\\u041e\\\u0421\\\u0417\\\u0414\\\u041e\\\u0427\\\u041d\\\u042b\\\u041c\\\u0418|\\\u041f\\\u041e\\\u0421\\\u0422\\\u0404\\\u041f\\\u0404\\\u041d\\\u041d0|\\\u0418\\\u0421\\\u041f\\\u042d\\\u0420\\\u042f\\\u041b\\\u0417\\\u0421\\\u042c|\\\u0404\\\u041e\\\u041b\\\u042c\\\u0428\\\u041e\\\u0404|\\\u041a\\\u041e\\\u041b\\\u0418\\\u0427\\\u0404\\\u0421\\\u0422\\\u0411\\\u041e|\\\u0413\\\u0404\\\u041c\\\u0417\\\u0422\\\u0418\\\u0422\\\u0415|\\\u041f\\\u041e\\\u041b\\\u0423\\\u0427\\\u042d\\\u0404\\\u0422|\\\u041d\\\u0404\\\u0414\\\u041e\\\u0421\\\u0422\\\u0417\\\u0427\\\u041d0|\\\u041f\\\u0418\\\u0422\\\u042d\\\u041d\\\u0418\\\u042f|\\\u041f\\\u041e\\\u041a\\\u0417|\\\u0411\\\u042c\\\u0406\\\u0425\\\u041e\\\u0414\\\u0418\\\u041b\\\u0418|\\\u0417\\\u0404\\\u041c\\\u0406\\\u0406\\\u0404|\\\u0412\\\u0404\\\u0421\\\u042c\\\u0406\\\u0418\\\u0417|\\\u0417\\\u0404\\\u041c\\\u041b\\\u0418|\\\u0431\\\u042c\\\u0406\\\u041b\\\u041e|\\\u041a\\\u0418\\\u0417\\\u041d\\\u0418|\\\u0421\\\u0422\\\u0417\\\u041d\\\u041e\\\u0412\\\u0418\\\u041b\\\u0417\\\u0421\\\u042c|\\\u0421\\\u041e\\\u041b\\\u0404\\\u041d\\\u0404\\\u0404|\\\u041c\\\u042d\\\u0413\\\u041d\\\u0418\\\u0422\\\u041d\\\u042b\\\u041c|\\\u0427\\\u0422\\\u041e\\\u0431\\\u042c\\\u0406|\\\u0421\\\u041e\\\u0417\\\u0414\\\u0415\\\u0422\\\u042c|\\\u041c\\\u0417\\\u0413\\\u041d\\\u0418\\\u0422\\\u041d\\\u041e\\\u0404|\\\u041a\\\u042d\\\u0416\\\u0423\\\u0422\\\u0421\\\u042f|\\\u041e\\\u0417\\\u041d\\\u0417\\\u0427\\\u0417\\\u0404\\\u0422|\\\u041c\\\u041e\\\u0413\\\u041b\\\u0417|\\\u0418\\\u041c\\\u0404\\\u0422\\\u042c|\\\u041a\\\u041e\\\u0421\\\u041c\\\u041e\\\u0421\\\u042d|\\\u0421\\\u041e\\\u041b\\\u041d\\\u0404\\\u0427\\\u041d\\\u0417\\\u042f|\\\u0421\\\u0418\\\u0421\\\u0422\\\u0404\\\u041c\\\u0417|\\\u041f\\\u041e\\\u0421\\\u0406\\\u0406\\\u0423\\\u0416\\\u0418\\\u041b\\\u041e|\\\u041c\\\u0417\\\u0413\\\u041d\\\u0418\\\u0422\\\u041d\\\u041e\\\u0413\\\u041e|\\\u041f\\\u041b\\\u0412\\\u041d\\\u0404\\\u0422\\\u042b|\\\u041b\\\u041e\\\u041a\\\u0417\\\u041b\\\u042c\\\u041d\\\u042c\\\u0406\\\u0425|\\\u041f\\\u041e\\\u041b\\\u0404\\\u0419|\\\u041a\\\u0417\\\u0416\\\u0423\\\u0422\\\u0421\\\u042f|\\\u041a\\\u0417\\\u041a\\\u041e\\\u0413\\\u041e|\\\u0421\\\u0422\\\u0420\\\u0417\\\u0428\\\u041d\\\u041e\\\u0413\\\u041e|\\\u0421\\\u0422\\\u041e\\\u041b\\\u041a\\\u041d\\\u041e\\\u0415\\\u0404\\\u041d\\\u0418\\\u042f|\\\u041c\\\u0415\\\u0421\\\u0422\\\u0417\\\u041c\\\u0418|\\\u0421\\\u0414\\\u0404\\\u041b\\\u0417\\\u0422\\\u042c|\\\u0421\\\u0422\\\u0417\\\u041b\\\u041e|\\\u041c\\\u042d\\\u0413\\\u041d\\\u0418\\\u0422\\\u041d\\\u041e\\\u0413\\\u041e|\\\u0417\\\u0417\\\u041a\\\u041b\\\u042e\\\u0427\\\u0417\\\u0412\\\u0428\\\u0404\\\u0419\\\u0421\\\u042f|\\\u0404\\\u0413\\\u041e|\\\u042f\\\u0414\\\u0420\\\u0404|\\\u041d\\\u0417|\\\u0418\\\u0421\\\u0427\\\u0404\\\u0417\\\u041b3|\\\u0421\\\u0427\\\u0418\\\u0422\\\u0417\\\u042e|\\\u0428\\\u042d\\\u041d\\\u0421\\\u042b|\\\u0418\\\u041d\\\u0417\\\u0427\\\u0404|\\\u0421\\\u0422\\\u0417\\\u041b|\\\u0422\\\u0420\\\u0417\\\u0422\\\u0418\\\u0422\\\u042c|\\\u041d\\\u0417\\\u041f\\\u0420\\\u0417\\\u0412\\\u041b\\\u042f\\\u0404\\\u0422\\\u0421\\\u042f|\\\u041e\\\u0411\\\u041b\\\u042d\\\u0421\\\u0422\\\u0418|\\\u042f\\\u0412\\\u041b\\\u042f\\\u0406\\\u041e\\\u0422\\\u0421\\\u042f|\\\u0413\\\u041b\\\u042d\\\u0412\\\u041d\\\u041e\\\u0419|\\\u0414\\\u041e\\\u041a\\\u0417\\\u0417\\\u0417\\\u0422\\\u0404\\\u041b\\\u042c\\\u0421\\\u0422\\\u0412|\\\u041a\\\u0418\\\u0421\\\u041b\\\u041e\\\u0422\\\u042d\\\u041c\\\u0418|\\\u041e\\\u041d\\\u042d|\\\u041f\\\u0420\\\u0417\\\u041a\\\u0422\\\u0418\\\u0427\\\u0404\\\u0421\\\u041a\\\u0418|\\\u041b\\\u0404\\\u0421\\\u0423|\\\u0423\\\u0421\\\u041b\\\u041e\\\u0411\\\u0418\\\u042f\\\u041c|\\\u0421\\\u041f\\\u0417\\\u0421\\\u0422\\\u0418\\\u0421\\\u042c|\\\u0420\\\u0417\\\u0417\\\u0412\\\u0418\\\u0412\\\u0417\\\u042e\\\u0429\\\u0418\\\u0404\\\u0421\\\u042f|\\\u0428\\\u042d\\\u041f\\\u041a\\\u0418|\\\u0417\\\u041d\\\u0417\\\u0404\\\u041c|\\\u0421\\\u041e\\\u041e\\\u0418\\\u0420\\\u042d\\\u0404\\\u041c\\\u0421\\\u042f|\\\u0411\\\u042b\\\u042f\\\u0421\\\u041d\\\u0418\\\u0422\\\u042c|\\\u0421\\\u0417\\\u041c|\\\u0420\\\u0417\\\u0421\\\u041f\\\u041e\\\u0417\\\u041d\\\u0417\\\u0422\\\u042c|\\\u0423\\\u0417\\\u041d\\\u0417\\\u0422\\\u042c|\\\u041a\\\u042d\\\u0416\\\u0404\\\u0422\\\u0421\\\u042f|\\\u041e\\\u0420\\\u0404\\\u0418\\\u0422\\\u0417\\\u041b\\\u042c\\\u041d\\\u042c\\\u0406\\\u0404|\\\u041b\\\u0404\\\u0422\\\u042d\\\u0422\\\u0404\\\u041b\\\u042c\\\u041d\\\u042c\\\u0406\\\u0404|\\\u0417\\\u041f\\\u041f\\\u0417\\\u0420\\\u0415\\\u0422\\\u042c\\\u0406|\\\u0416\\\u0404|\\\u0422\\\u0417\\\u041a\\\u0417\\\u042f|\\\u041c\\\u0417\\\u041b\\\u0404\\\u041d\\\u042c\\\u041a\\\u0417\\\u042f|\\\u041f\\\u041b\\\u042d\\\u041d\\\u0404\\\u0422\\\u0417|\\\u0421\\\u041f\\\u0417\\\u0406\\\u0406\\\u042c\\\u041a\\\u041e|\\\u0431\\\u042c\\\u0406\\\u041b3|\\\u0401\\\u0415\\\u0421\\\u0427\\\u0418\\\u0421\\\u041b\\\u0404\\\u041d\\\u041d\\\u041e\\\u0404|\\\u041c\\\u0417\\\u0413\\\u041d\\\u0418\\\u0457\\\u041d\\\u042c\\\u0406\\\u0425|\\\u041f\\\u041e\\\u0421\\\u0422\\\u0440\\\u0430\\\u04143\\\u041b|\\\u0414\\\u0417\\\u0416\\\u0404|\\\u0420\\\u0417\\\u0417\\\u041d\\\u042c\\\u0406\\\u041c\\\u0418|\\\u0421\\\u0423\\\u0429\\\u0404\\\u0421\\\u0422\\\u0411\\\u041e\\\u0412\\\u042d\\\u041d\\\u0418\\\u0404|\\\u041f\\\u041b\\\u0430\\\u041d\\\u0404\\\u0457\\\u042c\\\u0406|\\\u041f\\\u041e\\\u0414\\\u0412\\\u0404\\\u0420\\\u0413\\\u041b\\\u0417\\\u0421\\\u042c|\\\u041e\\\u041f\\\u0417\\\u0421\\\u0406\\-\\\u0406\\\u041e\\\u0421\\\u0422\\\u0418|\\\u041f\\\u041b\\\u0417\\\u041d\\\u0404\\\u0422\\\u0404|\\\u041d0|\\\u0431\\\u042c\\\u0406|\\\u041e\\\u0422\\\u0414\\\u0417\\\u041b\\\u0404\\\u041d\\\u041d\\\u042b\\\u0404|\\\u041f\\\u041e\\\u041b\\\u042f\\\u0420\\\u041d\\\u042c\\\u0406\\\u0404|\\\u0426\\\u0404\\\u041b\\\u042c\\\u0406\\-\\\u041e|\\\u041f\\\u0404\\\u0429\\\u0404\\\u0420\\\u0417\\\u0425|\\\u041d\\\u0417\\\u041f\\\u041e\\\u041b\\\u041d\\\u0404\\\u041d\\\u041d\\\u042c\\\u0406\\\u0425|\\\u0418\\\u0421\\\u041f\\\u0417\\\u0420\\\u0404\\\u041d\\\u0418\\\u042f\\\u041c\\\u0418|\\\u041c\\\u0418\\\u041d\\\u0418\\\u0417\\\u0422\\\u042e\\\u0420\\\u041d\\\u042c\\\u0406\\\u0404|\\\u0422\\\u042d\\\u041a\\\u0417\\\u042f|\\\u041f\\\u0440\\\u0418\\\u0421\\\u041f0\\\u0421\\\u041e\\\u0431\\\u0418\\\u0422\\\u042c\\\u0421\\\u042f|\\\u041d\\\u0404\\\u041e\\\u0404\\\u0425\\\u041e\\\u0414\\\u0418\\\u041c\\\u042c\\\u0406\\\u0404|\\\u041e\\\u0420\\\u0413\\\u0412\\\u041d\\\u0418\\\u0427\\\u0404\\\u0421\\\u041a\\\u0418\\\u0404|\\\u041c\\\u0417\\\u0420\\\u0421\\\u0418\\\u0417\\\u041d\\\u0421\\\u041a\\\u0418\\\u0404|\\\u041c\\\u0404\\\u0421\\\u0422\\\u0404|\\\u0406\\\\\\/\\\u0406\\\u0410\\\u041a\\\u041a\\\u0415\\\u0419\\\u0428|\\\u041d\\\u0417\\\u0425\\\u041e\\\u0414\\\u042f\\\u0429\\\u0418\\\u0404\\\u0421\\\u042f|\\\u041d\\\u0404\\\u0417\\\u041a\\\u0422\\\u0418\\\u0412\\\u041d\\\u041e\\\u041c|\\\u0417\\\u042d\\\u0421\\\u041d\\\u042f\\\u0422\\\u042c|\\\u041e\\\u0420\\\u0413\\\u0417\\\u041d\\\u0418\\\u0417\\\u041c\\\u042c\\\u0406|\\\u0412\\\u0417\\\u0415\\\u0418\\\u041c\\\u041e\\\u0414\\\u0404\\\u0419\\\u0421\\\u0422\\\u0412\\\u041e\\\u0412\\\u0415\\\u0422\\\u042c|\\\u041f\\\u0423\\\u0422\\\u0404\\\u0428\\\u0404\\\u0421\\\u0422\\\u0411\\\u0418\\\u0404|\\\u041f\\\u0443\\\u0421\\\u0457\\\u042c\\\u0406\\\u041d\\\u041d\\\u042b\\\u0425|\\\u0422\\\u0417\\\u041a\\\u0418\\\u0425|\\\u041f\\\u0404\\\u0420\\\u0404\\\u0422\\\u0417\\\u0421\\\u041a\\\u0418\\\u0412\\\u0417\\\u0404\\\u041c|\\\u0427\\\u04220|\\\u0412\\\u0404\\\u0421\\\u042c\\\u041c\\\u0417|\\\u041f\\\u041e\\\u041b\\\u041e\\\u0421\\\u0417\\\u041c\\\u0418|\\\u041e\\\u0440\\\u0457\\\u042d\\\u041d\\\u0418\\\u0417\\\u041c\\\u042c\\\u0406|\\\u041e\\\u0401\\\u041b\\\u0417\\\u0421\\\u0422\\\u0418|\\\u042f\\\u0411\\\u041b\\\u042f\\\u042e\\\u0422\\\u0421\\\u042f|\\\u0426\\\u0404\\\u041b\\\u042c\\\u042e|\\\u041f\\\u041e\\\u0418\\\u0421\\\u041a\\\u041e\\\u0411|\\\u0414\\\u041e\\\u041a\\\u0417\\\u0417\\\u0417\\\u0422\\\u0404\\\u0406\\\u0406\\\u042c\\\u0421\\\u0422\\\u0412|\\\u041c\\\u041e\\\u0416\\\u0404\\\u0422|\\\u041d\\\u042d\\\u0425\\\u041e\\\u0414\\\u0418\\\u0422\\\u042c\\\u0421\\\u042f|\\\u041e\\\u0427\\\u0404\\\u041d\\\u042c|\\\u0421\\\u0420\\\u0417\\\u0412\\\u041d\\\u0418\\\u0422\\\u042c|\\\u041e\\\u0404\\\u041d\\\u0417\\\u0420\\\u0423\\\u0416\\\u0418\\\u041b|\\\u041b\\\u042c\\\u0414\\\u0417|\\\u041f\\\u041e\\\u0422\\\u0404\\\u041f\\\u041b\\\u0404\\\u041d\\\u0418\\\u0404\\\u0406\\\u0418|\\\u041f\\\u041e\\\u0425\\\u041e\\\u041b\\\u041e\\\u0414\\\u0417\\\u041d\\\u0418\\\u0404\\\u0411\\\u0414|\\\u041a\\\u042d\\\u041a|\\\u0422\\\u0404\\\u041b\\\u041e|\\\u0431\\\u041e\\\u041b\\\u042c\\\u0428\\\u0404|\\\u041d\\\u042d\\\u041a\\\u041b\\\u041e\\\u041d\\\u042f\\\u0404\\\u0422\\\u0421\\\u042f|\\\u0421\\\u041e\\\u0406\\\u0406\\\u041d\\\u0426\\\u0423|\\\u0421\\\u04223\\\u0431\\\u0418\\\u041b\\\u0418\\\u0417\\\u0418\\\u0440\\\u041e\\\u0411\\\u0417\\\u0422\\\u042c|\\\u0421\\\u0422\\\u042d\\\u0411\\\u0418\\\u041b\\\u042c\\\u041d\\\u042d|\\\u041c\\\u0418\\\u041b\\\u0406\\\u0406\\\u0418\\\u041e\\\u041d\\\u041e\\\u0412|\\\u041d\\\u0417\\\u0417\\\u042d\\\u0414|\\\u0422\\\u0404\\\u041f\\\u041b0|\\\u041f\\\u041e\\\u0406\\\u0406\\\u042f\\\u0420\\\u041d\\\u042b\\\u0425|\\\u0421\\\u041e\\\u0406\\\u0406\\\u0415\\\u041d\\\u042b\\\u041c\\\u0418|\\\u041a\\\u0415\\\u041a\\\u0418\\\u041c\\\u0418|\\\u043a\\\u0438\\\u0441\\\u043b\\\u044e\\\u0442\\\u043d\\\u044e\\\u0441\\\u0433\\\u0433\\\u044c|\\\u0422\\\u0417\\\u041c|\\\u041e\\\u0420\\\u0413\\\u0417\\\u041d\\\u0418\\\u0417\\\u041c\\\u042b|\\\u0421\\\u0423\\\u0429\\\u0404\\\u0421\\\u0422\\\u0412\\\u041e\\\u0412\\\u0404\\\u0422\\\u042c|\\\u0412\\\u041d\\\u0418\\\u041c\\\u0417\\\u041d\\\u0418\\\u0404|\\\u0421\\\u0414\\\u0404\\\u041b\\\u0417\\\u0404\\\u0422|\\\u041f\\\u041e\\\u0417\\\u041d\\\u042d\\\u041a\\\u041e\\\u041c\\\u0418\\\u0422\\\u042c\\\u0421\\\u042f|\\\u041d\\\u042d\\\u0428\\\u0418\\\u041c|\\\u0414\\\u041e\\\u041a\\\u0417\\\u0417\\\u042d\\\u0422\\\u0404\\\u041b\\\u042c\\\u0421\\\u0422\\\u0411\\\u041e|\\\u0429\\\u0417\\\u0417\\\u0429\\\u0404\\\u041d\\\u0418\\\u042f|\\\u0431\\\u042c\\\u0406\\\u041b0|\\\u041e\\\u0404\\\u041b\\\u0415\\\u0421\\\u0422\\\u042f\\\u0425|\\\u0431\\\u042c\\\u0406\\\u041b\\\u0418|\\\u0420\\\u042d\\\u0417\\\u041c\\\u042c\\\u0406\\\u0428\\\u041b\\\u042f\\\u0406\\\u0406\\\u0418|\\\u041a\\\u041e\\\u041b\\\u0418\\\u0427\\\u0404\\\u0421\\\u0422\\\u0411\\\u0404|\\\u0429\\\u0404\\\u0406\\\u0406\\\u041e\\\u0427\\\u041d\\\u042b\\\u0404|\\\u041d\\\u0404\\\u041a\\\u041e\\\u0422\\\u0429\\\u0417\\\u042c\\\u0406\\\u0404|\\\u041f\\\u0440\\\u0418\\\u0411\\\u04061\\\u0415\\\u041a\\\u0443\\\u0457|\\\u041d\\\u0417\\\u0417\\\u042c\\\u0406\\\u0412\\\u042d\\\u0404\\\u041c\\\u042b\\\u0404|\\\u0427\\\u045706\\\u042b)(\\b|$)'}},
+ 'spa': {'BeginLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'EndLines': {'data': OrderedDict([(u'.\xbb.', u'\xbb.')]),
+                      'pattern': u'(?um)(?:\\.\\\xbb\\.)$'},
+         'PartialLines': {'data': OrderedDict([(u'de gratis', u'gratis'), (u'si quiera', u'siquiera'), (u'Cada una de los', u'Cada uno de los'), (u'Cada uno de las', u'Cada una de las'), (u'haber que', u'a ver qu\xe9'), (u'haber qu\xe9', u'a ver qu\xe9'), (u'Haber si', u'A ver si'), (u' que hora', u' qu\xe9 hora'), (u'yo que se', u'yo qu\xe9 s\xe9'), (u'Yo que se', u'Yo qu\xe9 s\xe9'), (u' tu!', u' t\xfa!'), (u' si!', u' s\xed!'), (u' mi!', u' m\xed!'), (u' el!', u' \xe9l!'), (u' tu?', u' t\xfa?'), (u' si?', u' s\xed?'), (u' mi?', u' m\xed?'), (u' el?', u' \xe9l?'), (u' aun?', u' a\xfan?'), (u' mas?', u' m\xe1s?'), (u' que?', u' qu\xe9?'), (u' paso?', u' pas\xf3?'), (u' cuando?', u' cu\xe1ndo?'), (u' cuanto?', u' cu\xe1nto?'), (u' cuanta?', u' cu\xe1nta?'), (u' cuantas?', u' cu\xe1ntas?'), (u' cuantos?', u' cu\xe1ntos?'), (u' donde?', u' d\xf3nde?'), (u' quien?', u' qui\xe9n?'), (u' como?', u' c\xf3mo?'), (u' adonde?', u' ad\xf3nde?'), (u' cual?', u' cu\xe1l?'), (u'\xbfSi?', u'\xbfS\xed?'), (u'\xbfesta bien?', u'\xbfest\xe1 bien?'), (u'\xbfPero qu\xe9 haces?', u'\xa1\xbfPero qu\xe9 haces?!'), (u'\xbfpero qu\xe9 haces?', u'\xa1\xbfpero qu\xe9 haces?!'), (u'\xbfEs que no me has escuchado?', u'\xa1\xbfEs que no me has escuchado?!'), (u'\xa1\xbfes que no me has escuchado?!', u'\xa1\xbfes que no me has escuchado?!'), (u'\xbfaun', u'\xbfa\xfan'), (u'\xbftu ', u'\xbft\xfa '), (u'\xbfque ', u'\xbfqu\xe9 '), (u'\xbfsabes que', u'\xbfsabes qu\xe9'), (u'\xbfsabes adonde', u'\xbfsabes ad\xf3nde'), (u'\xbfsabes cual', u'\xbfsabes cu\xe1l'), (u'\xbfsabes quien', u'\xbfsabes qui\xe9n'), (u'\xbfsabes como', u'\xbfsabes c\xf3mo'), (u'\xbfsabes cuan', u'\xbfsabes cu\xe1n'), (u'\xbfsabes cuanto', u'\xbfsabes cu\xe1nto'), (u'\xbfsabes cuanta', u'\xbfsabes cu\xe1nta'), (u'\xbfsabes cuantos', u'\xbfsabes cu\xe1ntos'), (u'\xbfsabes cuantas', u'\xbfsabes cu\xe1ntas'), (u'\xbfsabes cuando', u'\xbfsabes cu\xe1ndo'), (u'\xbfsabes donde', u'\xbfsabes d\xf3nde'), (u'\xbfsabe que', u'\xbfsabe qu\xe9'), (u'\xbfsabe adonde', u'\xbfsabe ad\xf3nde'), (u'\xbfsabe cual', u'\xbfsabe cu\xe1l'), (u'\xbfsabe quien', u'\xbfsabe qui\xe9n'), (u'\xbfsabe como', u'\xbfsabe c\xf3mo'), (u'\xbfsabe cuan', u'\xbfsabe cu\xe1n'), (u'\xbfsabe cuanto', u'\xbfsabe cu\xe1nto'), (u'\xbfsabe cuanta', u'\xbfsabe cu\xe1nta'), (u'\xbfsabe cuantos', u'\xbfsabe cu\xe1ntos'), (u'\xbfsabe cuantas', u'\xbfsabe cu\xe1ntas'), (u'\xbfsabe cuando', u'\xbfsabe cu\xe1ndo'), (u'\xbfsabe donde', u'\xbfsabe d\xf3nde'), (u'\xbfsaben que', u'\xbfsaben qu\xe9'), (u'\xbfsaben adonde', u'\xbfsaben ad\xf3nde'), (u'\xbfsaben cual', u'\xbfsaben cu\xe1l'), (u'\xbfsaben quien', u'\xbfsaben qui\xe9n'), (u'\xbfsaben como', u'\xbfsaben c\xf3mo'), (u'\xbfsaben cuan', u'\xbfsaben cu\xe1n'), (u'\xbfsaben cuanto', u'\xbfsaben cu\xe1nto'), (u'\xbfsaben cuanta', u'\xbfsaben cu\xe1nta'), (u'\xbfsaben cuantos', u'\xbfsaben cu\xe1ntos'), (u'\xbfsaben cuantas', u'\xbfsaben cu\xe1ntas'), (u'\xbfsaben cuando', u'\xbfsaben cu\xe1ndo'), (u'\xbfsaben donde', u'\xbfsaben d\xf3nde'), (u'\xbfde que', u'\xbfde qu\xe9'), (u'\xbfde donde', u'\xbfde d\xf3nde'), (u'\xbfde cual', u'\xbfde cu\xe1l'), (u'\xbfde quien', u'\xbfde qui\xe9n'), (u'\xbfde cuanto', u'\xbfde cu\xe1nto'), (u'\xbfde cuanta', u'\xbfde cu\xe1nta'), (u'\xbfde cuantos', u'\xbfde cu\xe1ntos'), (u'\xbfde cuantas', u'\xbfde cu\xe1ntas'), (u'\xbfde cuando', u'\xbfde cu\xe1ndo'), (u'\xbfsobre que', u'\xbfsobre qu\xe9'), (u'\xbfcomo ', u'\xbfc\xf3mo '), (u'\xbfcual ', u'\xbfcu\xe1l '), (u'\xbfen cual', u'\xbfen cu\xe1l'), (u'\xbfcuando', u'\xbfcu\xe1ndo'), (u'\xbfhasta cual', u'\xbfhasta cu\xe1l'), (u'\xbfhasta quien', u'\xbfhasta qui\xe9n'), (u'\xbfhasta cuanto', u'\xbfhasta cu\xe1nto'), (u'\xbfhasta cuantas', u'\xbfhasta cu\xe1ntas'), (u'\xbfhasta cuantos', u'\xbfhasta cu\xe1ntos'), (u'\xbfhasta cuando', u'\xbfhasta cu\xe1ndo'), (u'\xbfhasta donde', u'\xbfhasta d\xf3nde'), (u'\xbfhasta que', u'\xbfhasta qu\xe9'), (u'\xbfhasta adonde', u'\xbfhasta ad\xf3nde'), (u'\xbfdesde que', u'\xbfdesde qu\xe9'), (u'\xbfdesde cuando', u'\xbfdesde cu\xe1ndo'), (u'\xbfdesde quien', u'\xbfdesde qui\xe9n'), (u'\xbfdesde donde', u'\xbfdesde d\xf3nde'), (u'\xbfcuanto', u'\xbfcu\xe1nto'), (u'\xbfcuantos', u'\xbfcu\xe1ntos'), (u'\xbfdonde', u'\xbfd\xf3nde'), (u'\xbfadonde', u'\xbfad\xf3nde'), (u'\xbfcon que', u'\xbfcon qu\xe9'), (u'\xbfcon cual', u'\xbfcon cu\xe1l'), (u'\xbfcon quien', u'\xbfcon qui\xe9n'), (u'\xbfcon cuantos', u'\xbfcon cu\xe1ntos'), (u'\xbfcon cuantas', u'\xbfcon cu\xe1ntas'), (u'\xbfcon cuanta', u'\xbfcon cu\xe1nta'), (u'\xbfcon cuanto', u'\xbfcon cu\xe1nto'), (u'\xbfpara donde', u'\xbfpara d\xf3nde'), (u'\xbfpara adonde', u'\xbfpara ad\xf3nde'), (u'\xbfpara cuando', u'\xbfpara cu\xe1ndo'), (u'\xbfpara que', u'\xbfpara qu\xe9'), (u'\xbfpara quien', u'\xbfpara qui\xe9n'), (u'\xbfpara cuanto', u'\xbfpara cu\xe1nto'), (u'\xbfpara cuanta', u'\xbfpara cu\xe1nta'), (u'\xbfpara cuantos', u'\xbfpara cu\xe1ntos'), (u'\xbfpara cuantas', u'\xbfpara cu\xe1ntas'), (u'\xbfa donde', u'\xbfa d\xf3nde'), (u'\xbfa que', u'\xbfa qu\xe9'), (u'\xbfa cual', u'\xbfa cu\xe1l'), (u'\xbfa quien', u'\xbfa quien'), (u'\xbfa como', u'\xbfa c\xf3mo'), (u'\xbfa cuanto', u'\xbfa cu\xe1nto'), (u'\xbfa cuanta', u'\xbfa cu\xe1nta'), (u'\xbfa cuantos', u'\xbfa cu\xe1ntos'), (u'\xbfa cuantas', u'\xbfa cu\xe1ntas'), (u'\xbfpor que', u'\xbfpor qu\xe9'), (u'\xbfpor cual', u'\xbfpor cu\xe1l'), (u'\xbfpor quien', u'\xbfpor qui\xe9n'), (u'\xbfpor cuanto', u'\xbfpor cu\xe1nto'), (u'\xbfpor cuanta', u'\xbfpor cu\xe1nta'), (u'\xbfpor cuantos', u'\xbfpor cu\xe1ntos'), (u'\xbfpor cuantas', u'\xbfpor cu\xe1ntas'), (u'\xbfpor donde', u'\xbfpor d\xf3nde'), (u'\xbfporque', u'\xbfpor qu\xe9'), (u'\xbfporqu\xe9', u'\xbfpor qu\xe9'), (u'\xbfy que', u'\xbfy qu\xe9'), (u'\xbfy como', u'\xbfy c\xf3mo'), (u'\xbfy cuando', u'\xbfy cu\xe1ndo'), (u'\xbfy cual', u'\xbfy cu\xe1l'), (u'\xbfy quien', u'\xbfy qui\xe9n'), (u'\xbfy cuanto', u'\xbfy cu\xe1nto'), (u'\xbfy cuanta', u'\xbfy cu\xe1nta'), (u'\xbfy cuantos', u'\xbfy cu\xe1ntos'), (u'\xbfy cuantas', u'\xbfy cu\xe1ntas'), (u'\xbfy donde', u'\xbfy d\xf3nde'), (u'\xbfy adonde', u'\xbfy ad\xf3nde'), (u'\xbfquien ', u'\xbfqui\xe9n '), (u'\xbfesta ', u'\xbfest\xe1 '), (u'\xbfestas ', u'\xbfest\xe1s '), (u'\xbfAun', u'\xbfA\xfan'), (u'\xbfQue ', u'\xbfQu\xe9 '), (u'\xbfSabes que', u'\xbfSabes qu\xe9'), (u'\xbfSabes adonde', u'\xbfSabes ad\xf3nde'), (u'\xbfSabes cual', u'\xbfSabes cu\xe1l'), (u'\xbfSabes quien', u'\xbfSabes qui\xe9n'), (u'\xbfSabes como', u'\xbfSabes c\xf3mo'), (u'\xbfSabes cuan', u'\xbfSabes cu\xe1n'), (u'\xbfSabes cuanto', u'\xbfSabes cu\xe1nto'), (u'\xbfSabes cuanta', u'\xbfSabes cu\xe1nta'), (u'\xbfSabes cuantos', u'\xbfSabes cu\xe1ntos'), (u'\xbfSabes cuantas', u'\xbfSabes cu\xe1ntas'), (u'\xbfSabes cuando', u'\xbfSabes cu\xe1ndo'), (u'\xbfSabes donde', u'\xbfSabes d\xf3nde'), (u'\xbfSabe que', u'\xbfSabe qu\xe9'), (u'\xbfSabe adonde', u'\xbfSabe ad\xf3nde'), (u'\xbfSabe cual', u'\xbfSabe cu\xe1l'), (u'\xbfSabe quien', u'\xbfSabe qui\xe9n'), (u'\xbfSabe como', u'\xbfSabe c\xf3mo'), (u'\xbfSabe cuan', u'\xbfSabe cu\xe1n'), (u'\xbfSabe cuanto', u'\xbfSabe cu\xe1nto'), (u'\xbfSabe cuanta', u'\xbfSabe cu\xe1nta'), (u'\xbfSabe cuantos', u'\xbfSabe cu\xe1ntos'), (u'\xbfSabe cuantas', u'\xbfSabe cu\xe1ntas'), (u'\xbfSabe cuando', u'\xbfSabe cu\xe1ndo'), (u'\xbfSabe donde', u'\xbfSabe d\xf3nde'), (u'\xbfSaben que', u'\xbfSaben qu\xe9'), (u'\xbfSaben adonde', u'\xbfSaben ad\xf3nde'), (u'\xbfSaben cual', u'\xbfSaben cu\xe1l'), (u'\xbfSaben quien', u'\xbfSaben qui\xe9n'), (u'\xbfSaben como', u'\xbfSaben c\xf3mo'), (u'\xbfSaben cuan', u'\xbfSaben cu\xe1n'), (u'\xbfSaben cuanto', u'\xbfSaben cu\xe1nto'), (u'\xbfSaben cuanta', u'\xbfSaben cu\xe1nta'), (u'\xbfSaben cuantos', u'\xbfSaben cu\xe1ntos'), (u'\xbfSaben cuantas', u'\xbfSaben cu\xe1ntas'), (u'\xbfSaben cuando', u'\xbfSaben cu\xe1ndo'), (u'\xbfSaben donde', u'\xbfSaben d\xf3nde'), (u'\xbfDe que', u'\xbfDe qu\xe9'), (u'\xbfDe donde', u'\xbfDe d\xf3nde'), (u'\xbfDe cual', u'\xbfDe cu\xe1l'), (u'\xbfDe quien', u'\xbfDe qui\xe9n'), (u'\xbfDe cuanto', u'\xbfDe cu\xe1nto'), (u'\xbfDe cuanta', u'\xbfDe cu\xe1nta'), (u'\xbfDe cuantos', u'\xbfDe cu\xe1ntos'), (u'\xbfDe cuantas', u'\xbfDe cu\xe1ntas'), (u'\xbfDe cuando', u'\xbfDe cu\xe1ndo'), (u'\xbfDesde que', u'\xbfDesde qu\xe9'), (u'\xbfDesde cuando', u'\xbfDesde cu\xe1ndo'), (u'\xbfDesde quien', u'\xbfDesde qui\xe9n'), (u'\xbfDesde donde', u'\xbfDesde d\xf3nde'), (u'\xbfSobre que', u'\xbfSobre qu\xe9'), (u'\xbfComo ', u'\xbfC\xf3mo '), (u'\xbfCual ', u'\xbfCu\xe1l '), (u'\xbfEn cual', u'\xbfEn cu\xe1l'), (u'\xbfCuando', u'\xbfCu\xe1ndo'), (u'\xbfHasta cual', u'\xbfHasta cu\xe1l'), (u'\xbfHasta quien', u'\xbfHasta qui\xe9n'), (u'\xbfHasta cuanto', u'\xbfHasta cu\xe1nto'), (u'\xbfHasta cuantas', u'\xbfHasta cu\xe1ntas'), (u'\xbfHasta cuantos', u'\xbfHasta cu\xe1ntos'), (u'\xbfHasta cuando', u'\xbfHasta cu\xe1ndo'), (u'\xbfHasta donde', u'\xbfHasta d\xf3nde'), (u'\xbfHasta que', u'\xbfHasta qu\xe9'), (u'\xbfHasta adonde', u'\xbfHasta ad\xf3nde'), (u'\xbfCuanto', u'\xbfCu\xe1nto'), (u'\xbfCuantos', u'\xbfCu\xe1ntos'), (u'\xbfDonde', u'\xbfD\xf3nde'), (u'\xbfAdonde', u'\xbfAd\xf3nde'), (u'\xbfCon que', u'\xbfCon qu\xe9'), (u'\xbfCon cual', u'\xbfCon cu\xe1l'), (u'\xbfCon quien', u'\xbfCon qui\xe9n'), (u'\xbfCon cuantos', u'\xbfCon cu\xe1ntos'), (u'\xbfCon cuanta', u'\xbfCon cu\xe1nta'), (u'\xbfCon cuanto', u'\xbfCon cu\xe1nto'), (u'\xbfPara donde', u'\xbfPara d\xf3nde'), (u'\xbfPara adonde', u'\xbfPara ad\xf3nde'), (u'\xbfPara cuando', u'\xbfPara cu\xe1ndo'), (u'\xbfPara que', u'\xbfPara qu\xe9'), (u'\xbfPara quien', u'\xbfPara qui\xe9n'), (u'\xbfPara cuanto', u'\xbfPara cu\xe1nto'), (u'\xbfPara cuanta', u'\xbfPara cu\xe1nta'), (u'\xbfPara cuantos', u'\xbfPara cu\xe1ntos'), (u'\xbfPara cuantas', u'\xbfPara cu\xe1ntas'), (u'\xbfA donde', u'\xbfA d\xf3nde'), (u'\xbfA que', u'\xbfA qu\xe9'), (u'\xbfA cual', u'\xbfA cu\xe1l'), (u'\xbfA quien', u'\xbfA quien'), (u'\xbfA como', u'\xbfA c\xf3mo'), (u'\xbfA cuanto', u'\xbfA cu\xe1nto'), (u'\xbfA cuanta', u'\xbfA cu\xe1nta'), (u'\xbfA cuantos', u'\xbfA cu\xe1ntos'), (u'\xbfA cuantas', u'\xbfA cu\xe1ntas'), (u'\xbfPor que', u'\xbfPor qu\xe9'), (u'\xbfPor cual', u'\xbfPor cu\xe1l'), (u'\xbfPor quien', u'\xbfPor qui\xe9n'), (u'\xbfPor cuanto', u'\xbfPor cu\xe1nto'), (u'\xbfPor cuanta', u'\xbfPor cu\xe1nta'), (u'\xbfPor cuantos', u'\xbfPor cu\xe1ntos'), (u'\xbfPor cuantas', u'\xbfPor cu\xe1ntas'), (u'\xbfPor donde', u'\xbfPor d\xf3nde'), (u'\xbfPorque', u'\xbfPor qu\xe9'), (u'\xbfPorqu\xe9', u'\xbfPor qu\xe9'), (u'\xbfY que', u'\xbfY qu\xe9'), (u'\xbfY como', u'\xbfY c\xf3mo'), (u'\xbfY cuando', u'\xbfY cu\xe1ndo'), (u'\xbfY cual', u'\xbfY cu\xe1l'), (u'\xbfY quien', u'\xbfY qui\xe9n'), (u'\xbfY cuanto', u'\xbfY cu\xe1nto'), (u'\xbfY cuanta', u'\xbfY cu\xe1nta'), (u'\xbfY cuantos', u'\xbfY cu\xe1ntos'), (u'\xbfY cuantas', u'\xbfY cu\xe1ntas'), (u'\xbfY donde', u'\xbfY d\xf3nde'), (u'\xbfY adonde', u'\xbfY ad\xf3nde'), (u'\xbfQuien ', u'\xbfQui\xe9n '), (u'\xbfEsta ', u'\xbfEst\xe1 '), (u'el porque', u'el porqu\xe9'), (u'su porque', u'su porqu\xe9'), (u'los porqu\xe9s', u'los porqu\xe9s'), (u'aun,', u'a\xfan,'), (u'aun no', u'a\xfan no'), (u' de y ', u' d\xe9 y '), (u' nos de ', u' nos d\xe9 '), (u' tu ya ', u' t\xfa ya '), (u'Tu ya ', u'T\xfa ya '), (u' de, ', u' d\xe9,'), (u' mi, ', u' m\xed,'), (u' tu, ', u' t\xfa,'), (u' el, ', u' \xe9l,'), (u' te, ', u' t\xe9,'), (u' mas, ', u' m\xe1s,'), (u' quien, ', u' qui\xe9n,'), (u' cual,', u' cu\xe1l,'), (u'porque, ', u'porqu\xe9,'), (u'cuanto, ', u'cu\xe1nto,'), (u'cuando, ', u'cu\xe1ndo,'), (u' se,', u' s\xe9,'), (u'se donde', u's\xe9 d\xf3nde'), (u'se cuando', u's\xe9 cu\xe1ndo'), (u'se adonde', u's\xe9 ad\xf3nde'), (u'se como', u's\xe9 c\xf3mo'), (u'se cual', u's\xe9 cu\xe1l'), (u'se quien', u's\xe9 qui\xe9n'), (u'se cuanto', u's\xe9 cu\xe1nto'), (u'se cuanta', u's\xe9 cu\xe1nta'), (u'se cuantos', u's\xe9 cu\xe1ntos'), (u'se cuantas', u's\xe9 cu\xe1ntas'), (u'se cuan', u's\xe9 cu\xe1n'), (u' el si ', u' el s\xed '), (u'si mismo', u's\xed mismo'), (u'si misma', u's\xed misma'), (u' llegal', u' ilegal'), (u' lluminar', u' iluminar'), (u'sllbato', u'silbato'), (u'sllenclo', u'silencio'), (u'clemencla', u'clemencia'), (u'socledad', u'sociedad'), (u'tlene', u'tiene'), (u'tlempo', u'tiempo'), (u'equlvocaba', u'equivocaba'), (u'qulnce', u'quince'), (u'comlen', u'comien'), (u'historl', u'histori'), (u'misterl', u'misteri'), (u'vivencl', u'vivenci')]),
+                          'pattern': u'(?um)(?:(?<=\\s)|(?<=^)|(?<=\\b))(?:de\\ gratis|si\\ quiera|Cada\\ una\\ de\\ los|Cada\\ uno\\ de\\ las|haber\\ que|haber\\ qu\\\xe9|Haber\\ si|\\ que\\ hora|yo\\ que\\ se|Yo\\ que\\ se|\\ tu\\!|\\ si\\!|\\ mi\\!|\\ el\\!|\\ tu\\?|\\ si\\?|\\ mi\\?|\\ el\\?|\\ aun\\?|\\ mas\\?|\\ que\\?|\\ paso\\?|\\ cuando\\?|\\ cuanto\\?|\\ cuanta\\?|\\ cuantas\\?|\\ cuantos\\?|\\ donde\\?|\\ quien\\?|\\ como\\?|\\ adonde\\?|\\ cual\\?|\\\xbfSi\\?|\\\xbfesta\\ bien\\?|\\\xbfPero\\ qu\\\xe9\\ haces\\?|\\\xbfpero\\ qu\\\xe9\\ haces\\?|\\\xbfEs\\ que\\ no\\ me\\ has\\ escuchado\\?|\\\xa1\\\xbfes\\ que\\ no\\ me\\ has\\ escuchado\\?\\!|\\\xbfaun|\\\xbftu\\ |\\\xbfque\\ |\\\xbfsabes\\ que|\\\xbfsabes\\ adonde|\\\xbfsabes\\ cual|\\\xbfsabes\\ quien|\\\xbfsabes\\ como|\\\xbfsabes\\ cuan|\\\xbfsabes\\ cuanto|\\\xbfsabes\\ cuanta|\\\xbfsabes\\ cuantos|\\\xbfsabes\\ cuantas|\\\xbfsabes\\ cuando|\\\xbfsabes\\ donde|\\\xbfsabe\\ que|\\\xbfsabe\\ adonde|\\\xbfsabe\\ cual|\\\xbfsabe\\ quien|\\\xbfsabe\\ como|\\\xbfsabe\\ cuan|\\\xbfsabe\\ cuanto|\\\xbfsabe\\ cuanta|\\\xbfsabe\\ cuantos|\\\xbfsabe\\ cuantas|\\\xbfsabe\\ cuando|\\\xbfsabe\\ donde|\\\xbfsaben\\ que|\\\xbfsaben\\ adonde|\\\xbfsaben\\ cual|\\\xbfsaben\\ quien|\\\xbfsaben\\ como|\\\xbfsaben\\ cuan|\\\xbfsaben\\ cuanto|\\\xbfsaben\\ cuanta|\\\xbfsaben\\ cuantos|\\\xbfsaben\\ cuantas|\\\xbfsaben\\ cuando|\\\xbfsaben\\ donde|\\\xbfde\\ que|\\\xbfde\\ donde|\\\xbfde\\ cual|\\\xbfde\\ quien|\\\xbfde\\ cuanto|\\\xbfde\\ cuanta|\\\xbfde\\ cuantos|\\\xbfde\\ cuantas|\\\xbfde\\ cuando|\\\xbfsobre\\ que|\\\xbfcomo\\ |\\\xbfcual\\ |\\\xbfen\\ cual|\\\xbfcuando|\\\xbfhasta\\ cual|\\\xbfhasta\\ quien|\\\xbfhasta\\ cuanto|\\\xbfhasta\\ cuantas|\\\xbfhasta\\ cuantos|\\\xbfhasta\\ cuando|\\\xbfhasta\\ donde|\\\xbfhasta\\ que|\\\xbfhasta\\ adonde|\\\xbfdesde\\ que|\\\xbfdesde\\ cuando|\\\xbfdesde\\ quien|\\\xbfdesde\\ donde|\\\xbfcuanto|\\\xbfcuantos|\\\xbfdonde|\\\xbfadonde|\\\xbfcon\\ que|\\\xbfcon\\ cual|\\\xbfcon\\ quien|\\\xbfcon\\ cuantos|\\\xbfcon\\ cuantas|\\\xbfcon\\ cuanta|\\\xbfcon\\ cuanto|\\\xbfpara\\ donde|\\\xbfpara\\ adonde|\\\xbfpara\\ cuando|\\\xbfpara\\ que|\\\xbfpara\\ quien|\\\xbfpara\\ cuanto|\\\xbfpara\\ cuanta|\\\xbfpara\\ cuantos|\\\xbfpara\\ cuantas|\\\xbfa\\ donde|\\\xbfa\\ que|\\\xbfa\\ cual|\\\xbfa\\ quien|\\\xbfa\\ como|\\\xbfa\\ cuanto|\\\xbfa\\ cuanta|\\\xbfa\\ cuantos|\\\xbfa\\ cuantas|\\\xbfpor\\ que|\\\xbfpor\\ cual|\\\xbfpor\\ quien|\\\xbfpor\\ cuanto|\\\xbfpor\\ cuanta|\\\xbfpor\\ cuantos|\\\xbfpor\\ cuantas|\\\xbfpor\\ donde|\\\xbfporque|\\\xbfporqu\\\xe9|\\\xbfy\\ que|\\\xbfy\\ como|\\\xbfy\\ cuando|\\\xbfy\\ cual|\\\xbfy\\ quien|\\\xbfy\\ cuanto|\\\xbfy\\ cuanta|\\\xbfy\\ cuantos|\\\xbfy\\ cuantas|\\\xbfy\\ donde|\\\xbfy\\ adonde|\\\xbfquien\\ |\\\xbfesta\\ |\\\xbfestas\\ |\\\xbfAun|\\\xbfQue\\ |\\\xbfSabes\\ que|\\\xbfSabes\\ adonde|\\\xbfSabes\\ cual|\\\xbfSabes\\ quien|\\\xbfSabes\\ como|\\\xbfSabes\\ cuan|\\\xbfSabes\\ cuanto|\\\xbfSabes\\ cuanta|\\\xbfSabes\\ cuantos|\\\xbfSabes\\ cuantas|\\\xbfSabes\\ cuando|\\\xbfSabes\\ donde|\\\xbfSabe\\ que|\\\xbfSabe\\ adonde|\\\xbfSabe\\ cual|\\\xbfSabe\\ quien|\\\xbfSabe\\ como|\\\xbfSabe\\ cuan|\\\xbfSabe\\ cuanto|\\\xbfSabe\\ cuanta|\\\xbfSabe\\ cuantos|\\\xbfSabe\\ cuantas|\\\xbfSabe\\ cuando|\\\xbfSabe\\ donde|\\\xbfSaben\\ que|\\\xbfSaben\\ adonde|\\\xbfSaben\\ cual|\\\xbfSaben\\ quien|\\\xbfSaben\\ como|\\\xbfSaben\\ cuan|\\\xbfSaben\\ cuanto|\\\xbfSaben\\ cuanta|\\\xbfSaben\\ cuantos|\\\xbfSaben\\ cuantas|\\\xbfSaben\\ cuando|\\\xbfSaben\\ donde|\\\xbfDe\\ que|\\\xbfDe\\ donde|\\\xbfDe\\ cual|\\\xbfDe\\ quien|\\\xbfDe\\ cuanto|\\\xbfDe\\ cuanta|\\\xbfDe\\ cuantos|\\\xbfDe\\ cuantas|\\\xbfDe\\ cuando|\\\xbfDesde\\ que|\\\xbfDesde\\ cuando|\\\xbfDesde\\ quien|\\\xbfDesde\\ donde|\\\xbfSobre\\ que|\\\xbfComo\\ |\\\xbfCual\\ |\\\xbfEn\\ cual|\\\xbfCuando|\\\xbfHasta\\ cual|\\\xbfHasta\\ quien|\\\xbfHasta\\ cuanto|\\\xbfHasta\\ cuantas|\\\xbfHasta\\ cuantos|\\\xbfHasta\\ cuando|\\\xbfHasta\\ donde|\\\xbfHasta\\ que|\\\xbfHasta\\ adonde|\\\xbfCuanto|\\\xbfCuantos|\\\xbfDonde|\\\xbfAdonde|\\\xbfCon\\ que|\\\xbfCon\\ cual|\\\xbfCon\\ quien|\\\xbfCon\\ cuantos|\\\xbfCon\\ cuanta|\\\xbfCon\\ cuanto|\\\xbfPara\\ donde|\\\xbfPara\\ adonde|\\\xbfPara\\ cuando|\\\xbfPara\\ que|\\\xbfPara\\ quien|\\\xbfPara\\ cuanto|\\\xbfPara\\ cuanta|\\\xbfPara\\ cuantos|\\\xbfPara\\ cuantas|\\\xbfA\\ donde|\\\xbfA\\ que|\\\xbfA\\ cual|\\\xbfA\\ quien|\\\xbfA\\ como|\\\xbfA\\ cuanto|\\\xbfA\\ cuanta|\\\xbfA\\ cuantos|\\\xbfA\\ cuantas|\\\xbfPor\\ que|\\\xbfPor\\ cual|\\\xbfPor\\ quien|\\\xbfPor\\ cuanto|\\\xbfPor\\ cuanta|\\\xbfPor\\ cuantos|\\\xbfPor\\ cuantas|\\\xbfPor\\ donde|\\\xbfPorque|\\\xbfPorqu\\\xe9|\\\xbfY\\ que|\\\xbfY\\ como|\\\xbfY\\ cuando|\\\xbfY\\ cual|\\\xbfY\\ quien|\\\xbfY\\ cuanto|\\\xbfY\\ cuanta|\\\xbfY\\ cuantos|\\\xbfY\\ cuantas|\\\xbfY\\ donde|\\\xbfY\\ adonde|\\\xbfQuien\\ |\\\xbfEsta\\ |el\\ porque|su\\ porque|los\\ porqu\\\xe9s|aun\\,|aun\\ no|\\ de\\ y\\ |\\ nos\\ de\\ |\\ tu\\ ya\\ |Tu\\ ya\\ |\\ de\\,\\ |\\ mi\\,\\ |\\ tu\\,\\ |\\ el\\,\\ |\\ te\\,\\ |\\ mas\\,\\ |\\ quien\\,\\ |\\ cual\\,|porque\\,\\ |cuanto\\,\\ |cuando\\,\\ |\\ se\\,|se\\ donde|se\\ cuando|se\\ adonde|se\\ como|se\\ cual|se\\ quien|se\\ cuanto|se\\ cuanta|se\\ cuantos|se\\ cuantas|se\\ cuan|\\ el\\ si\\ |si\\ mismo|si\\ misma|\\ llegal|\\ lluminar|sllbato|sllenclo|clemencla|socledad|tlene|tlempo|equlvocaba|qulnce|comlen|historl|misterl|vivencl)(?:(?=\\s)|(?=$)|(?=\\b))'},
+         'PartialWordsAlways': {'data': OrderedDict([(u'\xb6\xb6', u'\u266b'), (u'\xb6', u'\u266a')]),
+                                'pattern': None},
+         'WholeLines': {'data': OrderedDict([(u'No', u'No.')]),
+                        'pattern': None},
+         'WholeWords': {'data': OrderedDict([(u'KBs', u'kB'), (u'Vd', u'Ud'), (u'N\xb0', u'N.\xb0'), (u'n\xb0', u'n.\xb0'), (u'nro.', u'n.\xb0'), (u'Nro.', u'N.\xb0'), (u'aca', u'ac\xe1'), (u'actuas', u'act\xfaas'), (u'actues', u'act\xfaes'), (u'adios', u'adi\xf3s'), (u'agarrenla', u'ag\xe1rrenla'), (u'agarrenlo', u'ag\xe1rrenlo'), (u'agarrandose', u'agarr\xe1ndose'), (u'algun', u'alg\xfan'), (u'alli', u'all\xed'), (u'alla', u'all\xe1'), (u'alejate', u'al\xe9jate'), (u'ahi', u'ah\xed'), (u'angel', u'\xe1ngel'), (u'angeles', u'\xe1ngeles'), (u'ansian', u'ans\xedan'), (u'apagala', u'ap\xe1gala'), (u'aqui', u'aqu\xed'), (u'asi', u'as\xed'), (u'bahia', u'bah\xeda'), (u'busqueda', u'b\xfasqueda'), (u'busquedas', u'b\xfasquedas'), (u'callate', u'c\xe1llate'), (u'carcel', u'c\xe1rcel'), (u'camara', u'c\xe1mara'), (u'caido', u'ca\xeddo'), (u'cabron', u'cabr\xf3n'), (u'camion', u'cami\xf3n'), (u'codigo', u'c\xf3digo'), (u'codigos', u'c\xf3digos'), (u'comence', u'comenc\xe9'), (u'comprate', u'c\xf3mprate'), (u'consegui', u'consegu\xed'), (u'confias', u'conf\xedas'), (u'convertira', u'convertir\xe1'), (u'corazon', u'coraz\xf3n'), (u'crei', u'cre\xed'), (u'creia', u'cre\xeda'), (u'creido', u'cre\xeddo'), (u'creiste', u'cre\xedste'), (u'cubrenos', u'c\xfabrenos'), (u'comio', u'comi\xf3'), (u'dara', u'dar\xe1'), (u'dia', u'd\xeda'), (u'dias', u'd\xedas'), (u'debio', u'debi\xf3'), (u'demelo', u'd\xe9melo'), (u'dimelo', u'd\xedmelo'), (u'denoslo', u'd\xe9noslo'), (u'deselo', u'd\xe9selo'), (u'decia', u'dec\xeda'), (u'decian', u'dec\xedan'), (u'detras', u'detr\xe1s'), (u'deberia', u'deber\xeda'), (u'deberas', u'deber\xe1s'), (u'deberias', u'deber\xedas'), (u'deberian', u'deber\xedan'), (u'deberiamos', u'deber\xedamos'), (u'dejame', u'd\xe9jame'), (u'dejate', u'd\xe9jate'), (u'dejalo', u'd\xe9jalo'), (u'dejarian', u'dejar\xedan'), (u'damela', u'd\xe1mela'), (u'despues', u'despu\xe9s'), (u'diciendome', u'dici\xe9ndome'), (u'dificil', u'dif\xedcil'), (u'dificiles', u'dif\xedciles'), (u'disculpate', u'disc\xfalpate'), (u'dolares', u'd\xf3lares'), (u'hechar', u'echar'), (u'examenes', u'ex\xe1menes'), (u'empezo', u'empez\xf3'), (u'empujon', u'empuj\xf3n'), (u'empujalo', u'emp\xfajalo'), (u'energia', u'energ\xeda'), (u'enfrian', u'enfr\xedan'), (u'escondanme', u'esc\xf3ndanme'), (u'esperame', u'esp\xe9rame'), (u'estara', u'estar\xe1'), (u'estare', u'estar\xe9'), (u'estaria', u'estar\xeda'), (u'estan', u'est\xe1n'), (u'estaran', u'estar\xe1n'), (u'estabamos', u'est\xe1bamos'), (u'estuvieramos', u'estuvi\xe9ramos'), (u'exito', u'\xe9xito'), (u'facil', u'f\xe1cil'), (u'fiscalia', u'fiscal\xeda'), (u'fragil', u'fr\xe1gil'), (u'fragiles', u'fr\xe1giles'), (u'frances', u'franc\xe9s'), (u'gustaria', u'gustar\xeda'), (u'habia', u'hab\xeda'), (u'habias', u'hab\xedas'), (u'habian', u'hab\xedan'), (u'habrian', u'habr\xedan'), (u'habrias', u'habr\xedas'), (u'hagalo', u'h\xe1galo'), (u'haria', u'har\xeda'), (u'increible', u'incre\xedble'), (u'incredulo', u'incr\xe9dulo'), (u'intentalo', u'int\xe9ntalo'), (u'ire', u'ir\xe9'), (u'jovenes', u'j\xf3venes'), (u'ladron', u'ladr\xf3n'), (u'linea', u'l\xednea'), (u'llamame', u'll\xe1mame'), (u'llevalo', u'll\xe9valo'), (u'mama', u'mam\xe1'), (u'maricon', u'maric\xf3n'), (u'mayoria', u'mayor\xeda'), (u'metodo', u'm\xe9todo'), (u'metodos', u'm\xe9todos'), (u'mio', u'm\xedo'), (u'mostro', u'mostr\xf3'), (u'morira', u'morir\xe1'), (u'muevete', u'mu\xe9vete'), (u'murio', u'muri\xf3'), (u'numero', u'n\xfamero'), (u'numeros', u'n\xfameros'), (u'ningun', u'ning\xfan'), (u'oido', u'o\xeddo'), (u'oidos', u'o\xeddos'), (u'oimos', u'o\xedmos'), (u'oiste', u'o\xedste'), (u'pasale', u'p\xe1sale'), (u'pasame', u'p\xe1same'), (u'paraiso', u'para\xedso'), (u'parate', u'p\xe1rate'), (u'pense', u'pens\xe9'), (u'peluqueria', u'peluquer\xeda'), (u'platano', u'pl\xe1tano'), (u'plastico', u'pl\xe1stico'), (u'plasticos', u'pl\xe1sticos'), (u'policia', u'polic\xeda'), (u'policias', u'polic\xedas'), (u'poster', u'p\xf3ster'), (u'podia', u'pod\xeda'), (u'podias', u'pod\xedas'), (u'podria', u'podr\xeda'), (u'podrian', u'podr\xedan'), (u'podrias', u'podr\xedas'), (u'podriamos', u'podr\xedamos'), (u'prometio', u'prometi\xf3'), (u'proposito', u'prop\xf3sito'), (u'pideselo', u'p\xeddeselo'), (u'ponganse', u'p\xf3nganse'), (u'prometeme', u'prom\xe9teme'), (u'publico', u'p\xfablico'), (u'publicos', u'p\xfablicos'), (u'publicamente', u'p\xfablicamente'), (u'quedate', u'qu\xe9date'), (u'queria', u'quer\xeda'), (u'querrias', u'querr\xedas'), (u'querian', u'quer\xedan'), (u'rapido', u'r\xe1pido'), (u'rapidamente', u'r\xe1pidamente'), (u'razon', u'raz\xf3n'), (u'rehusen', u'reh\xfasen'), (u'rie', u'r\xede'), (u'rias', u'r\xedas'), (u'rindete', u'r\xedndete'), (u'sacame', u's\xe1came'), (u'sentian', u'sent\xedan'), (u'sientate', u'si\xe9ntate'), (u'sera', u'ser\xe1'), (u'soplon', u'sopl\xf3n'), (u'sueltalo', u'su\xe9ltalo'), (u'tambien', u'tambi\xe9n'), (u'teoria', u'teor\xeda'), (u'tendra', u'tendr\xe1'), (u'telefono', u'tel\xe9fono'), (u'tipica', u't\xedpica'), (u'todavia', u'todav\xeda'), (u'tomalo', u't\xf3malo'), (u'tonterias', u'tonter\xedas'), (u'torci', u'torc\xed'), (u'traelos', u'tr\xe1elos'), (u'traiganlo', u'tr\xe1iganlo'), (u'traiganlos', u'tr\xe1iganlos'), (u'trio', u'tr\xedo'), (u'tuvieramos', u'tuvi\xe9ramos'), (u'union', u'uni\xf3n'), (u'ultimo', u'\xfaltimo'), (u'ultima', u'\xfaltima'), (u'ultimos', u'\xfaltimos'), (u'ultimas', u'\xfaltimas'), (u'unica', u'\xfanica'), (u'unico', u'\xfanico'), (u'vamonos', u'v\xe1monos'), (u'vayanse', u'v\xe1yanse'), (u'victima', u'v\xedctima'), (u'vivira', u'vivir\xe1'), (u'volvio', u'volvi\xf3'), (u'volvia', u'volv\xeda'), (u'volvian', u'volv\xedan'), (u'reir', u're\xedr'), (u'freir', u'fre\xedr'), (u'sonreir', u'sonre\xedr'), (u'hazmerreir', u'hazmerre\xedr'), (u'oir', u'o\xedr'), (u'oirlo', u'o\xedrlo'), (u'oirte', u'o\xedrte'), (u'oirse', u'o\xedrse'), (u'oirme', u'o\xedrme'), (u'oirle', u'o\xedrle'), (u'oirla', u'o\xedrla'), (u'oirles', u'o\xedrles'), (u'oirnos', u'o\xedrnos'), (u'oirlas', u'o\xedrlas'), (u'bi\xe9n', u'bien'), (u'cr\xedmen', u'crimen'), (u'fu\xe9', u'fue'), (u'fu\xed', u'fui'), (u'qui\xe9res', u'quieres'), (u't\xed', u'ti'), (u'd\xed', u'di'), (u'v\xe1', u'va'), (u'v\xe9', u've'), (u'v\xed', u'vi'), (u'vi\xf3', u'vio'), (u'\xf3', u'o'), (u'cl\xf3n', u'clon'), (u'di\xf3', u'dio'), (u'gui\xf3n', u'guion'), (u'd\xf3n', u'don'), (u'f\xe9', u'fe'), (u'\xe1quel', u'aquel'), (u'\xe9ste', u'este'), (u'\xe9sta', u'esta'), (u'\xe9stos', u'estos'), (u'\xe9stas', u'estas'), (u'\xe9se', u'ese'), (u'\xe9sa', u'esa'), (u'\xe9sos', u'esos'), (u'\xe9sas', u'esas'), (u's\xf3lo', u'solo'), (u'coktel', u'c\xf3ctel'), (u'cocktel', u'c\xf3ctel'), (u'conciente', u'consciente'), (u'comenz\xe9', u'comenc\xe9'), (u'desilucionarte', u'desilusionarte'), (u'dijieron', u'dijeron'), (u'empez\xe9', u'empec\xe9'), (u'hize', u'hice'), (u'ilucionarte', u'ilusionarte'), (u'inconciente', u'inconsciente'), (u'quize', u'quise'), (u'quizo', u'quiso'), (u'verguenza', u'verg\xfcenza'), (u'Nu\xf1ez', u'N\xfa\xf1ez'), (u'Ivan', u'Iv\xe1n'), (u'Japon', u'Jap\xf3n'), (u'Monica', u'M\xf3nica'), (u'Maria', u'Mar\xeda'), (u'Jose', u'Jos\xe9'), (u'Ramon', u'Ram\xf3n'), (u'Garcia', u'Garc\xeda'), (u'Gonzalez', u'Gonz\xe1lez'), (u'Jesus', u'Jes\xfas'), (u'Alvarez', u'\xc1lvarez'), (u'Damian', u'Dami\xe1n'), (u'Rene', u'Ren\xe9'), (u'Nicolas', u'Nicol\xe1s'), (u'Jonas', u'Jon\xe1s'), (u'Lopez', u'L\xf3pez'), (u'Hernandez', u'Hern\xe1ndez'), (u'Bermudez', u'Berm\xfadez'), (u'Fernandez', u'Fern\xe1ndez'), (u'Suarez', u'Su\xe1rez'), (u'Sofia', u'Sof\xeda'), (u'Seneca', u'S\xe9neca'), (u'Tokyo', u'Tokio'), (u'Canada', u'Canad\xe1'), (u'Paris', u'Par\xeds'), (u'Turquia', u'Turqu\xeda'), (u'Mexico', u'M\xe9xico'), (u'Mejico', u'M\xe9xico'), (u'Matias', u'Mat\xedas'), (u'Valentin', u'Valent\xedn'), (u'mejicano', u'mexicano'), (u'mejicanos', u'mexicanos'), (u'mejicana', u'mexicana'), (u'mejicanas', u'mexicanas'), (u'io', u'lo'), (u'ia', u'la'), (u'ie', u'le'), (u'Io', u'lo'), (u'Ia', u'la'), (u'AI', u'Al'), (u'Ie', u'le'), (u'EI', u'El'), (u'suba\ufb02uente', u'subafluente'), (u'a\ufb02\xf3jalo', u'afl\xf3jalo'), (u'A\ufb02\xf3jalo', u'Afl\xf3jalo'), (u'perdi', u'perd\xed'), (u'Podria', u'Podr\xeda'), (u'confia', u'conf\xeda'), (u'pasaria', u'pasar\xeda'), (u'Podias', u'Pod\xedas'), (u'responsabke', u'responsable'), (u'Todavia', u'Todav\xeda'), (u'envien', u'env\xeden'), (u'Queria', u'Quer\xeda'), (u'tio', u't\xedo'), (u'traido', u'tra\xeddo'), (u'Asi', u'As\xed'), (u'elegi', u'eleg\xed'), (u'habria', u'habr\xeda'), (u'encantaria', u'encantar\xeda'), (u'leido', u'le\xeddo'), (u'conocias', u'conoc\xedas'), (u'harias', u'har\xedas'), (u'Aqui', u'Aqu\xed'), (u'decidi', u'decid\xed'), (u'mia', u'm\xeda'), (u'Crei', u'Cre\xed'), (u'podiamos', u'pod\xedamos'), (u'avisame', u'av\xedsame'), (u'debia', u'deb\xeda'), (u'pensarias', u'pensar\xedas'), (u'reuniamos', u'reun\xedamos'), (u'PO\xcf', u'por'), (u'vendria', u'vendr\xeda'), (u'caida', u'ca\xedda'), (u'venian', u'ven\xedan'), (u'compa\xf1ias', u'compa\xf1\xedas'), (u'leiste', u'le\xedste'), (u'Leiste', u'Le\xedste'), (u'fiaria', u'fiar\xeda'), (u'Hungria', u'Hungr\xeda'), (u'fotografia', u'fotograf\xeda'), (u'cafeteria', u'cafeter\xeda'), (u'Digame', u'D\xedgame'), (u'debias', u'deb\xedas'), (u'tendria', u'tendr\xeda'), (u'C\xcfGO', u'creo'), (u'anteg', u'antes'), (u'S\xf3Io', u'Solo'), (u'Ilam\xe1ndola', u'llam\xe1ndola'), (u'C\xe1\ufb02at\xe9', u'C\xe1llate'), (u'Ilamaste', u'llamaste'), (u'daria', u'dar\xeda'), (u'Iargaba', u'largaba'), (u'Yati', u'Y a ti'), (u'querias', u'quer\xedas'), (u'Iimpiarlo', u'limpiarlo'), (u'Iargado', u'largado'), (u'galeria', u'galer\xeda'), (u'Bartomeu', u'Bertomeu'), (u'Iocalizarlo', u'localizarlo'), (u'Il\xe1mame', u'll\xe1mame')]),
+                        'pattern': u'(?um)(\\b|^)(?:KBs|Vd|N\\\xb0|n\\\xb0|nro\\.|Nro\\.|aca|actuas|actues|adios|agarrenla|agarrenlo|agarrandose|algun|alli|alla|alejate|ahi|angel|angeles|ansian|apagala|aqui|asi|bahia|busqueda|busquedas|callate|carcel|camara|caido|cabron|camion|codigo|codigos|comence|comprate|consegui|confias|convertira|corazon|crei|creia|creido|creiste|cubrenos|comio|dara|dia|dias|debio|demelo|dimelo|denoslo|deselo|decia|decian|detras|deberia|deberas|deberias|deberian|deberiamos|dejame|dejate|dejalo|dejarian|damela|despues|diciendome|dificil|dificiles|disculpate|dolares|hechar|examenes|empezo|empujon|empujalo|energia|enfrian|escondanme|esperame|estara|estare|estaria|estan|estaran|estabamos|estuvieramos|exito|facil|fiscalia|fragil|fragiles|frances|gustaria|habia|habias|habian|habrian|habrias|hagalo|haria|increible|incredulo|intentalo|ire|jovenes|ladron|linea|llamame|llevalo|mama|maricon|mayoria|metodo|metodos|mio|mostro|morira|muevete|murio|numero|numeros|ningun|oido|oidos|oimos|oiste|pasale|pasame|paraiso|parate|pense|peluqueria|platano|plastico|plasticos|policia|policias|poster|podia|podias|podria|podrian|podrias|podriamos|prometio|proposito|pideselo|ponganse|prometeme|publico|publicos|publicamente|quedate|queria|querrias|querian|rapido|rapidamente|razon|rehusen|rie|rias|rindete|sacame|sentian|sientate|sera|soplon|sueltalo|tambien|teoria|tendra|telefono|tipica|todavia|tomalo|tonterias|torci|traelos|traiganlo|traiganlos|trio|tuvieramos|union|ultimo|ultima|ultimos|ultimas|unica|unico|vamonos|vayanse|victima|vivira|volvio|volvia|volvian|reir|freir|sonreir|hazmerreir|oir|oirlo|oirte|oirse|oirme|oirle|oirla|oirles|oirnos|oirlas|bi\\\xe9n|cr\\\xedmen|fu\\\xe9|fu\\\xed|qui\\\xe9res|t\\\xed|d\\\xed|v\\\xe1|v\\\xe9|v\\\xed|vi\\\xf3|\\\xf3|cl\\\xf3n|di\\\xf3|gui\\\xf3n|d\\\xf3n|f\\\xe9|\\\xe1quel|\\\xe9ste|\\\xe9sta|\\\xe9stos|\\\xe9stas|\\\xe9se|\\\xe9sa|\\\xe9sos|\\\xe9sas|s\\\xf3lo|coktel|cocktel|conciente|comenz\\\xe9|desilucionarte|dijieron|empez\\\xe9|hize|ilucionarte|inconciente|quize|quizo|verguenza|Nu\\\xf1ez|Ivan|Japon|Monica|Maria|Jose|Ramon|Garcia|Gonzalez|Jesus|Alvarez|Damian|Rene|Nicolas|Jonas|Lopez|Hernandez|Bermudez|Fernandez|Suarez|Sofia|Seneca|Tokyo|Canada|Paris|Turquia|Mexico|Mejico|Matias|Valentin|mejicano|mejicanos|mejicana|mejicanas|io|ia|ie|Io|Ia|AI|Ie|EI|suba\\\ufb02uente|a\\\ufb02\\\xf3jalo|A\\\ufb02\\\xf3jalo|perdi|Podria|confia|pasaria|Podias|responsabke|Todavia|envien|Queria|tio|traido|Asi|elegi|habria|encantaria|leido|conocias|harias|Aqui|decidi|mia|Crei|podiamos|avisame|debia|pensarias|reuniamos|PO\\\xcf|vendria|caida|venian|compa\\\xf1ias|leiste|Leiste|fiaria|Hungria|fotografia|cafeteria|Digame|debias|tendria|C\\\xcfGO|anteg|S\\\xf3Io|Ilam\\\xe1ndola|C\\\xe1\\\ufb02at\\\xe9|Ilamaste|daria|Iargaba|Yati|querias|Iimpiarlo|Iargado|galeria|Bartomeu|Iocalizarlo|Il\\\xe1mame)(\\b|$)'}},
+ 'srp': {'BeginLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'EndLines': {'data': OrderedDict(),
+                      'pattern': None},
+         'PartialLines': {'data': OrderedDict([(u'bi smo', u'bismo'), (u'dali je', u'da li je'), (u'dali si', u'da li si'), (u'Dali si', u'Da li si'), (u'Jel sam ti', u'Jesam li ti'), (u'Jel si', u'Jesi li'), (u"Jel' si", u'Jesi li'), (u"Je I'", u'Jesi li'), (u'Jel si to', u'Jesi li to'), (u"Jel' si to", u'Da li si to'), (u'jel si to', u'da li si to'), (u"jel' si to", u'jesi li to'), (u'Jel si ti', u'Da li si ti'), (u"Jel' si ti", u'Da li si ti'), (u'jel si ti', u'da li si ti'), (u"jel' si ti", u'da li si ti'), (u'jel ste ', u'jeste li '), (u'Jel ste', u'Jeste li'), (u"jel' ste ", u'jeste li '), (u"Jel' ste ", u'Jeste li '), (u'Jel su ', u'Jesu li '), (u'Jel da ', u'Zar ne'), (u'jel da ', u'zar ne'), (u"jel'da ", u'zar ne'), (u'Jeli sve ', u'Je li sve'), (u'Jeli on ', u'Je li on'), (u'Jeli ti ', u'Je li ti'), (u'jeli ti ', u'je li ti'), (u'Jeli to ', u'Je li to'), (u'Nebrini', u'Ne brini'), (u'ne \u0107u', u'ne\u0107u'), (u'od kako', u'otkako'), (u'Si dobro', u'Jesi li dobro'), (u'Svo vreme', u'Sve vrijeme'), (u'Svo vrijeme', u'Sve vrijeme'), (u'Cijelo vrijeme', u'Sve vrijeme')]),
+                          'pattern': u"(?um)(?:(?<=\\s)|(?<=^)|(?<=\\b))(?:bi\\ smo|dali\\ je|dali\\ si|Dali\\ si|Jel\\ sam\\ ti|Jel\\ si|Jel\\'\\ si|Je\\ I\\'|Jel\\ si\\ to|Jel\\'\\ si\\ to|jel\\ si\\ to|jel\\'\\ si\\ to|Jel\\ si\\ ti|Jel\\'\\ si\\ ti|jel\\ si\\ ti|jel\\'\\ si\\ ti|jel\\ ste\\ |Jel\\ ste|jel\\'\\ ste\\ |Jel\\'\\ ste\\ |Jel\\ su\\ |Jel\\ da\\ |jel\\ da\\ |jel\\'da\\ |Jeli\\ sve\\ |Jeli\\ on\\ |Jeli\\ ti\\ |jeli\\ ti\\ |Jeli\\ to\\ |Nebrini|ne\\ \\\u0107u|od\\ kako|Si\\ dobro|Svo\\ vreme|Svo\\ vrijeme|Cijelo\\ vrijeme)(?:(?=\\s)|(?=$)|(?=\\b))"},
+         'PartialWordsAlways': {'data': OrderedDict([(u'\xb6\xb6', u'\u266b'), (u'\xb6', u'\u266a')]),
+                                'pattern': None},
+         'WholeLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'WholeWords': {'data': OrderedDict([(u'\u010du', u'\u0107u'), (u'\u010de\u0161', u'\u0107e\u0161'), (u'\u010de', u'\u0107e'), (u'\u0107\u0161', u'\u0107e\u0161'), (u'\u0107mo', u'\u0107emo'), (u'\u0107te', u'\u0107ete'), (u'\u010demo', u'\u0107emo'), (u'\u010dete', u'\u0107ete'), (u'djete', u'dijete'), (u'Hey', u'Hej'), (u'hey', u'hej'), (u'htjeo', u'htio'), (u'i\u010di', u'i\u0107i'), (u'jel', u"je l'"), (u'Jel', u"Je l'"), (u'Nebi', u'Ne bi'), (u'Nebih', u'Ne bih'), (u'nebi', u'ne bi'), (u'nebih', u'ne bih'), (u'nedaj', u'ne daj'), (u'Nedaj', u'Ne daj'), (u'nedam', u'ne dam'), (u'Nedam', u'Ne dam'), (u'neda\u0161', u'ne da\u0161'), (u'Neda\u0161', u'Ne da\u0161'), (u'nemogu', u'ne mogu'), (u'Nemogu', u'Ne mogu'), (u'nemora', u'ne mora'), (u'Nemora', u'Ne mora'), (u'nemora\u0161', u'ne mora\u0161'), (u'Nemora\u0161', u'Ne mora\u0161'), (u'predamnom', u'preda mnom'), (u'Predamnom', u'Preda mnom'), (u'Rje\u0161it', u'Rije\u0161it'), (u'samnom', u'sa mnom'), (u'Samnom', u'Sa mnom'), (u'smjeo', u'smio'), (u'uop\u010de', u'uop\u0107e'), (u'Uop\u010de', u'Uop\u0107e'), (u'umijesto', u'umjesto'), (u'Umijesto', u'Umjesto'), (u'uspije\u0161an', u'uspje\u0161an'), (u'uvjek', u'uvijek'), (u'Uvjek', u'Uvijek'), (u'valda', u'valjda'), (u'zamnom', u'za mnom'), (u'Zamnom', u'Za mnom'), (u'\u017eelila', u'\u017eeljela')]),
+                        'pattern': u'(?um)(\\b|^)(?:\\\u010du|\\\u010de\\\u0161|\\\u010de|\\\u0107\\\u0161|\\\u0107mo|\\\u0107te|\\\u010demo|\\\u010dete|djete|Hey|hey|htjeo|i\\\u010di|jel|Jel|Nebi|Nebih|nebi|nebih|nedaj|Nedaj|nedam|Nedam|neda\\\u0161|Neda\\\u0161|nemogu|Nemogu|nemora|Nemora|nemora\\\u0161|Nemora\\\u0161|predamnom|Predamnom|Rje\\\u0161it|samnom|Samnom|smjeo|uop\\\u010de|Uop\\\u010de|umijesto|Umijesto|uspije\\\u0161an|uvjek|Uvjek|valda|zamnom|Zamnom|\\\u017eelila)(\\b|$)'}},
+ 'swe': {'BeginLines': {'data': OrderedDict([(u'Ln ', u'In '), (u'U ppfattat', u'Uppfattat')]),
+                        'pattern': u'(?um)^(?:Ln\\ |U\\ ppfattat)'},
+         'EndLines': {'data': OrderedDict(),
+                      'pattern': None},
+         'PartialLines': {'data': OrderedDict(),
+                          'pattern': None},
+         'PartialWordsAlways': {'data': OrderedDict([(u'\u0139', u'\xc5'), (u'\u013a', u'\xe5'), (u'\xb6\xb6', u'\u266b'), (u'\xb6', u'\u266a')]),
+                                'pattern': None},
+         'WholeLines': {'data': OrderedDict(),
+                        'pattern': None},
+         'WholeWords': {'data': OrderedDict([(u'l\xe2rt', u'l\xe4rt'), (u'hederv\xe5rda', u'hederv\xe4rda'), (u'storm\xe2stare', u'storm\xe4stare'), (u'Avf\xe2rd', u'Avf\xe4rd'), (u't\xe2lten', u't\xe4lten'), (u'\xe2rjag', u'\xe4r jag'), (u'\xe4rjag', u'\xe4r jag'), (u'j\xe2mlikar', u'j\xe4mlikar'), (u'Riskako\ufb02', u'Riskakor'), (u'Karamellen/', u'Karamellen'), (u'Lngen\xfcng', u'Ingenting'), (u'\xe4rju', u'\xe4r ju'), (u'S\xe1', u'S\xe5'), (u'n\xe4rjag', u'n\xe4r jag'), (u'alltjag', u'allt jag'), (u'g\xf6rjag', u'g\xf6r jag'), (u'trorjag', u'tror jag'), (u'varju', u'var ju'), (u'g\xf6rju', u'g\xf6r ju'), (u'kanju', u'kan ju'), (u'blirjag', u'blir jag'), (u's\xe4gerjag', u's\xe4ger jag'), (u'beh\xe5llerjag', u'beh\xe5ller jag'), (u'pr\xf8blem', u'problem'), (u'r\xe4ddadeju', u'r\xe4ddade ju'), (u'hon\xf8m', u'honom'), (u'Ln', u'In'), (u'sv\xe5r\ufb02\xf6rtad', u'sv\xe5rfl\xf6rtad'), (u'\xf8ch', u'och'), (u'\ufb02\xf6rtar', u'fl\xf6rtar'), (u'k\xe4nnerjag', u'k\xe4nner jag'), (u'\ufb02ickan', u'flickan'), (u'sn\xf8', u'sn\xf6'), (u'gerju', u'ger ju'), (u'k\xf8ntakter', u'kontakter'), (u'\xf8lycka', u'olycka'), (u'n\xf8lla', u'nolla'), (u'sinnenajublar', u'sinnena jublar'), (u'ijobbet', u'i jobbet'), (u'F\xe5rjag', u'F\xe5r jag'), (u'Ar', u'\xc4r'), (u'liggerju', u'ligger ju'), (u'um', u'om'), (u'lbland', u'Ibland'), (u'skjuterjag', u'skjuter jag'), (u'Vadd\xe5', u'Vad d\xe5'), (u'pratarj\xe4mt', u'pratar j\xe4mt'), (u'harju', u'har ju'), (u'sitterjag', u'sitter jag'), (u'h\xe4\ufb02a', u'h\xe4rja'), (u's\ufb01\xe4l', u'stj\xe4l'), (u'F\xd6U', u'F\xf6lj'), (u'varf\xf6rjag', u'varf\xf6r jag'), (u's\ufb01\xe4rna', u'stj\xe4rna'), (u'b\xf6\ufb02ar', u'b\xf6rjar'), (u'b\xf6\ufb02an', u'b\xf6rjan'), (u'st\xe4ri', u'st\xe5r'), (u'p\xe4', u'p\xe5'), (u'harjag', u'har jag'), (u'attjag', u'att jag'), (u'Verkarjag', u'Verkar jag'), (u'K\xe4nnerjag', u'K\xe4nner jag'), (u'd\xe4rjag', u'd\xe4r jag'), (u'tu\ufb01', u'tuff'), (u'lurarjag', u'lurar jag'), (u'varj\xe4ttebra', u'var j\xe4ttebra'), (u'allvan', u'allvar'), (u'deth\xe4r', u'det h\xe4r'), (u'va\ufb02e', u'varje'), (u'F\xf6Uer', u'F\xf6ljer'), (u'personalm\xf6tetl', u'personalm\xf6tet!'), (u'harjust', u'har just'), (u'\xe4rj\xe4tteduktig', u'\xe4r j\xe4tteduktig'), (u'd\xe4rja', u'd\xe4r ja'), (u'lngen\xfcng', u'lngenting'), (u'iluften', u'i luften'), (u'\xf6sen', u'\xf6ser'), (u'tv\xe2', u'tv\xe5'), (u'Uejerna', u'Tjejerna'), (u'h\xe5n*', u'h\xe5rt'), (u'\xc4rjag', u'\xc4r jag'), (u'keL', u'Okej'), (u'F\xf6rjag', u'F\xf6r jag'), (u'varj\xe4ttekul', u'var j\xe4ttekul'), (u'k\xe4mpan', u'k\xe4mpar'), (u'mycketjobb', u'mycket jobb'), (u'Uus', u'ljus'), (u'serjag', u'ser jag'), (u'vetjag', u'vet jag'), (u'f\xe5rjag', u'f\xe5r jag'), (u'hurjag', u'hur jag'), (u'f\xf6rs\xf6kerjag', u'f\xf6rs\xf6ker jag'), (u't\xe1nagel', u't\xe5nagel'), (u'va\xfce', u'varje'), (u'Uudet', u'ljudet'), (u'amhopa', u'allihopa'), (u'V\xe4\xfc', u'V\xe4lj'), (u'g\xe4ri', u'g\xe5r'), (u'r\xf6d\xfcus', u'r\xf6dljus'), (u'Uuset', u'ljuset'), (u'Rid\xe0n', u'Rid\xe5n'), (u'vi\xfca', u'vilja'), (u'g\xe5ri', u'g\xe5r i'), (u'Hurd\xe5', u'Hur d\xe5'), (u'inter\\/juar', u'intervjuar'), (u'menarjag', u'menar jag'), (u'spyrjag', u'spyr jag'), (u'bri\xfcera', u'briljera'), (u'N\xe4rjag', u'N\xe4r jag'), (u'ner\\/\xf6s', u'nerv\xf6s'), (u'ilivets', u'i livets'), (u'n\xe4got', u'n\xe5got'), (u'p\xe0', u'p\xe5'), (u'Lnnan', u'Innan'), (u'Uf', u'Ut'), (u'lnnan', u'Innan'), (u'D\xe0ren', u'D\xe5ren'), (u'F\xe0rjag', u'F\xe5r jag'), (u'Vad\xe4rdetd\xe4L', u'Vad \xe4r det d\xe4r'), (u'sm\xe0tjuv', u'sm\xe5tjuv'), (u't\xe0gr\xe5nare', u't\xe5gr\xe5nare'), (u'dit\xe0t', u'dit\xe5t'), (u's\xe4', u's\xe5'), (u'v\xe0rdsl\xf6sa', u'v\xe5rdsl\xf6sa'), (u'n\xe0n', u'n\xe5n'), (u'kommerjag', u'kommer jag'), (u'\xe4rj\xe4ttebra', u'\xe4r j\xe4ttebra'), (u'\xe4rj\xe4vligt', u'\xe4r j\xe4vligt'), (u'\xe0kerjag', u'\xe5ker jag'), (u'ellerjapaner', u'eller japaner'), (u'attjaga', u'att jaga'), (u'eften', u'efter'), (u'h\xe4stan', u'h\xe4star'), (u'Lntensivare', u'Intensivare'), (u'fr\xe0garjag', u'fr\xe5gar jag'), (u'pen/ers', u'pervers'), (u'r\xe0barkade', u'r\xe5barkade'), (u'styrkon', u'styrkor'), (u'Dif\xe5f', u'Dit\xe5t'), (u'h\xe4nden', u'h\xe4nder'), (u'f\xf6\ufb01a', u'f\xf6lja'), (u'Idioten/', u'Idioter!'), (u'Varf\xf6rjagade', u'Varf\xf6r jagade'), (u'd\xe4rf\xf6rjag', u'd\xe4rf\xf6r jag'), (u'forjag', u'for jag'), (u'Iivsgladje', u'livsgl\xe4dje'), (u'narjag', u'n\xe4r jag'), (u'sajag', u'sa jag'), (u'genastja', u'genast ja'), (u'rockument\xe0ren', u'rockument\xe4ren'), (u'turne', u'turn\xe9'), (u'fickjag', u'fick jag'), (u'sager', u's\xe4ger'), (u'Ijush\xe5rig', u'ljush\xe5rig'), (u'tradg\xe5rdsolycka', u'tr\xe4dg\xe5rdsolycka'), (u'kvavdes', u'kv\xe4vdes'), (u'd\xe0rja', u'd\xe4r ja'), (u'hedersgaster', u'hedersg\xe4ster'), (u'Nar', u'N\xe4r'), (u'smaki\xf6sa', u'smakl\xf6sa'), (u'lan', u'Ian'), (u'Lan', u'Ian'), (u'eri', u'er i'), (u'universitetsamne', u'universitets\xe4mne'), (u'garna', u'g\xe4rna'), (u'ar', u'\xe4r'), (u'baltdjur', u'b\xe4ltdjur'), (u'varjag', u'var jag'), (u'\xe0r', u'\xe4r'), (u'f\xf6rf\xf6rst\xe0rkare', u'f\xf6rf\xf6rst\xe4rkare'), (u'arjattespeciell', u'\xe4r j\xe4ttespeciell'), (u'h\xe0rg\xe5r', u'h\xe4r g\xe5r'), (u'Ia', u'la'), (u'Iimousinen', u'limousinen'), (u'krickettra', u'krickettr\xe4'), (u'h\xe5rdrockv\xe0rlden', u'h\xe5rdrockv\xe4rlden'), (u'tr\xe0bit', u'tr\xe4bit'), (u'Mellanvastern', u'Mellanv\xe4stern'), (u'arju', u'\xe4r ju'), (u'turnen', u'turn\xe9n'), (u'kanns', u'k\xe4nns'), (u'battre', u'b\xe4ttre'), (u'v\xe0rldsturne', u'v\xe4rldsturne'), (u'dar', u'd\xe4r'), (u'sj\xe0lvant\xe0nder', u'sj\xe4lvant\xe4nder'), (u'jattelange', u'j\xe4ttel\xe4nge'), (u'berattade', u'ber\xe4ttade'), (u'S\xe4', u'S\xe5'), (u'vandpunkten', u'v\xe4ndpunkten'), (u'N\xe0rjag', u'N\xe4r jag'), (u'lasa', u'l\xe4sa'), (u'skitl\xe0skigt', u'skitl\xe4skigt'), (u'sambandsv\xe0g', u'sambandsv\xe4g'), (u'valdigt', u'v\xe4ldigt'), (u'Stamga\ufb01el', u'St\xe4mgaffel'), (u'\xe0rjag', u'\xe4r jag'), (u'tajming', u'tajmning'), (u'utg\xe4ng', u'utg\xe5ng'), (u'H\xe0r\xe5t', u'H\xe4r\xe5t'), (u'h\xe0r\xe5t', u'h\xe4r\xe5t'), (u'anvander', u'anv\xe4nder'), (u'harjobbat', u'har jobbat'), (u'imageide', u'imageid\xe9'), (u'kla\ufb01en', u'klaffen'), (u'sjalv', u'sj\xe4lv'), (u'dvarg', u'dv\xe4rg'), (u'detjag', u'det jag'), (u'dvargarna', u'dv\xe4rgarna'), (u'fantasiv\xe0rld', u'fantasiv\xe4rld'), (u'\ufb01olliga', u'Fjolliga'), (u'mandoiinstr\xe0ngar', u'mandollnstr\xe4ngar'), (u'mittjobb', u'mitt jobb'), (u'Skajag', u'Ska jag'), (u'landari', u'landar i'), (u'gang', u'g\xe4ng'), (u'Detjag', u'Det jag'), (u'Narmre', u'N\xe4rmre'), (u'I\xe5tjavelni', u'l\xe5tj\xe4veln'), (u'H\xe5llerjag', u'H\xe5ller jag'), (u'visionarer', u'vision\xe4rer'), (u'T\xfclvad', u'Till vad'), (u'milit\xe0rbas', u'milit\xe4rbas'), (u'jattegiada', u'j\xe4tteglada'), (u'Fastjag', u'Fast jag'), (u's\xe5jag', u's\xe5 jag'), (u'rockvarlden', u'rockv\xe4rlden'), (u'saknarjag', u'saknar jag'), (u'allafall', u'alla fall'), (u'\ufb01anta', u'fjanta'), (u'Kr\xe0ma', u'Kr\xe4ma'), (u'stammer', u'st\xe4mmer'), (u'budb\xe0rare', u'budb\xe4rare'), (u'Iivsfiiosofi', u'livsfiiosofi'), (u'f\xf6rj\xe4mnan', u'f\xf6r j\xe4mnan'), (u'gillarjag', u'gillar jag'), (u'Iarvat', u'larvat'), (u'klararjag', u'klarar jag'), (u"hatta\ufb01'\xe0r", u'hattaff\xe4r'), (u'D\xe0', u'D\xe5'), (u'upp\ufb01nna', u'uppfinna'), (u'R\xe0ttf\xe5glar', u'R\xe5ttf\xe5glar'), (u'Sv\xe4\xfcboda', u'Sv\xe4ljboda'), (u'P\xe5b\xf6\ufb02ar', u'P\xe5b\xf6rjar'), (u'slutarju', u'slutar ju'), (u'ni\ufb01skebu\xfcken', u'i fiskebutiken'), (u'h\xe4rj\xe4keln', u'h\xe4r j\xe4keln'), (u'H\xdfppa', u'Hoppa'), (u'f\xf6rst\xf6rds', u'f\xf6rst\xf6rdes'), (u'varj\xe4ttegoda', u'var j\xe4ttegoda'), (u'Kor\\/', u'Korv'), (u'br\xfcl\xe9el', u'br\xfcl\xe9e!'), (u'Hei', u'Hej'), (u'\xe4lskarjordgubbsglass', u'\xe4lskar jordgubbsglass'), (u'Sn\xf6bom', u'Sn\xf6boll'), (u'Sn\xf6boH', u'Sn\xf6boll'), (u'Sn\xf6bol', u'Sn\xf6boll'), (u'sn\xf6boH', u'sn\xf6boll'), (u'L\xe4ggerp\xe5', u'L\xe4gger p\xe5'), (u'lnge\ufb02', u'lnget!'), (u'S\xe4gerj\xe4ttesmarta', u'S\xe4ger j\xe4ttesmarta'), (u'dopplen/\xe4derradar', u'dopplerv\xe4derradar'), (u's\xe4kertj\xe4ttefin', u's\xe4kert j\xe4ttefin'), (u'\xe4rj\xe4ttefin', u'\xe4r j\xe4ttefin'), (u'verkarju', u'verkar ju'), (u'blirju', u'blir ju'), (u'kor\\/', u'korv'), (u'naturkatastro\ufb01', u'naturkatastrof!'), (u'stickerjag', u'stickerj ag'), (u'j\xe4ttebu\ufb01\xe9', u'j\xe4ttebuff\xe9'), (u'be\ufb01nner', u'befinner'), (u'Sp\ufb02ng', u'Spring'), (u'trec\ufb01e', u'tredje'), (u'ryckerjag', u'rycker jag'), (u'skullejag', u'skulle jag'), (u'vetju', u'vet ju'), (u'a\ufb02jag', u'att jag'), (u'\ufb02nns', u'finns'), (u'\xe4rl\xe5ng', u'\xe4r l\xe5ng'), (u'k\xe5ra', u'k\xe4ra'), (u'\xe4r\ufb01na', u'\xe4r \ufb01na'), (u'\xe4ri', u'\xe4r i'), (u'h\xf6rden', u'h\xf6r den'), (u'\xe4ttj\xe4g', u'att j\xe4g'), (u'g\xe4r', u'g\xe5r'), (u'f\xf6ri', u'f\xf6r i'), (u'Hurvisste', u'Hur visste'), (u'\ufb01ck', u'fick'), (u'\ufb01nns', u'finns'), (u'\ufb01n', u'fin'), (u'Fa', u'Bra.'), (u'bori', u'bor i'), (u'fiendeplanl', u'fiendeplan!'), (u'if\xf6rnamn', u'i f\xf6rnamn'), (u'detju', u'det ju'), (u'N\xfcd', u'Niki'), (u'hatarjag', u'hatar jag'), (u'Klararjag', u'Klarar jag'), (u'deta\ufb01er', u'detaljer'), (u'v\xe4/', u'v\xe4l'), (u'smakarju', u'smakar ju'), (u'Teache\ufb02', u'Teacher!'), (u'imorse', u'i morse'), (u'drickerjag', u'dricker jag'), (u'st\xe5ri', u'st\xe5r i'), (u'Harjag', u'Har jag'), (u'Talarjag', u'Talar jag'), (u'undrarjag', u'undrar jag'), (u'\xe5lderjag', u'\xe5lder jag'), (u'va\ufb01e', u'varje'), (u'f\xf6rfalskningl', u'f\xf6rfalskning!'), (u'Vi\ufb01iiiam', u'William'), (u'V\\\ufb01lliams', u'Williams'), (u'attjobba', u'att jobba'), (u'intei', u'inte i'), (u'n\xe4rV\\\ufb01lliam', u'n\xe4r William'), (u'V\\\ufb01lliam', u'William'), (u'E\ufb01ersom', u'Eftersom'), (u'Vl\ufb01lliam', u'William'), (u'I\xe4ngejag', u'l\xe4nge jag'), (u"'\ufb01digare", u'Tidigare'), (u'b\xf6rjadei', u'b\xf6rjade i'), (u'merjust', u'mer just'), (u'e\ufb01er\xe5t', u'efter\xe5t'), (u'gjordejag', u'gjorde jag'), (u'hadeju', u'hade ju'), (u'g\xe5rvi', u'g\xe5r vi'), (u'k\xf6perjag', u'k\xf6per jag'), (u'M\xe5stejag', u'M\xe5ste jag'), (u'k\xe4nnerju', u'k\xe4nner ju'), (u'\ufb02n', u'fin'), (u'treviig', u'trevlig'), (u'Grattisl', u'Grattis!'), (u'kande', u'k\xe4nde'), (u"'llden", u'Tiden'), (u'sakjag', u'sak jag'), (u'klartjag', u'klart jag'), (u'h\xe4\ufb01igt', u'h\xe4ftigt'), (u'I\xe4mnarjag', u'l\xe4mnar jag'), (u'gickju', u'gick ju'), (u'skajag', u'ska jag'), (u'G\xf6rjag', u'G\xf6r jag'), (u'm\xe5stejag', u'm\xe5ste jag'), (u'gra\\/iditet', u'graviditet'), (u'hittadqdin', u'hittade din'), (u'\xe4rjobbigt', u'\xe4r jobbigt'), (u'Overdrivet', u'\xd6verdrivet'), (u'hOgtidlig', u'h\xf6gtidlig'), (u'Overtyga', u'\xd6vertyga'), (u'SKILSMASSA', u'SKILSM\xc4SSA'), (u'brukarju', u'brukar ju'), (u'lsabel', u'Isabel'), (u'kundejag', u'kunde jag'), (u'\xe4rl\xe4get', u'\xe4r l\xe4get'), (u'blirinte', u'blir inte'), (u'ijakt', u'i jakt'), (u'avjordens', u'av jordens'), (u'90000O', u'900000'), (u'9O0', u'900'), (u'\xe4rp\xe5', u'\xe4r p\xe5'), (u'\xe4rproteserna', u'\xe4r proteserna'), (u'\xe4rytterst', u'\xe4r ytterst'), (u'beborjorden', u'bebor jorden'), (u'filmjag', u'film jag'), (u'fokuserarp\xe5', u'fokuserar p\xe5'), (u'folkjag', u'folk jag'), (u'f\xf6rest\xe4lldejag', u'f\xf6rest\xe4llde jag'), (u'f\xf6rpubliken', u'f\xf6r publiken'), (u'gilladejag', u'gillade jag'), (u'h\xe5llerp\xe5', u'h\xe5ller p\xe5'), (u'harp\xe5', u'har p\xe5'), (u'harplaner', u'har planer'), (u'harprylar', u'har prylar'), (u'kommerpubliken', u'kommer publiken'), (u'kostymerp\xe5', u'kostymer p\xe5'), (u'litarp\xe5', u'litar p\xe5'), (u'lngen', u'Ingen'), (u'lnom', u'Inom'), (u'lnte', u'Inte'), (u'ochjag', u'och jag'), (u'Ochjag', u'Och jag'), (u'ochjorden', u'och jorden'), (u'omjag', u'om jag'), (u'Omjag', u'Om jag'), (u'passarperfekt', u'passar perfekt'), (u's\xe4ttetjag', u's\xe4ttet jag'), (u'silverp\xe5', u'silver p\xe5'), (u'skruvarjag', u'skruvar jag'), (u'somjag', u'som jag'), (u'Somjag', u'Som jag'), (u'talarp\xe5', u'talar p\xe5'), (u't\xe4nktejag', u't\xe4nkte jag'), (u'tapparjag', u'tappar jag'), (u'tittarp\xe5', u'tittar p\xe5'), (u'visstejag', u'visste jag'), (u'medjetpacks', u'med jetpacks'), (u's\xe4tterp\xe5', u's\xe4tter p\xe5'), (u'st\xe5rp\xe5', u'st\xe5r p\xe5'), (u'tillh\xf6rp\xe5', u'tillh\xf6r p\xe5')]),
+                        'pattern': u"(?um)(\\b|^)(?:l\\\xe2rt|hederv\\\xe5rda|storm\\\xe2stare|Avf\\\xe2rd|t\\\xe2lten|\\\xe2rjag|\\\xe4rjag|j\\\xe2mlikar|Riskako\\\ufb02|Karamellen\\/|Lngen\\\xfcng|\\\xe4rju|S\\\xe1|n\\\xe4rjag|alltjag|g\\\xf6rjag|trorjag|varju|g\\\xf6rju|kanju|blirjag|s\\\xe4gerjag|beh\\\xe5llerjag|pr\\\xf8blem|r\\\xe4ddadeju|hon\\\xf8m|Ln|sv\\\xe5r\\\ufb02\\\xf6rtad|\\\xf8ch|\\\ufb02\\\xf6rtar|k\\\xe4nnerjag|\\\ufb02ickan|sn\\\xf8|gerju|k\\\xf8ntakter|\\\xf8lycka|n\\\xf8lla|sinnenajublar|ijobbet|F\\\xe5rjag|Ar|liggerju|um|lbland|skjuterjag|Vadd\\\xe5|pratarj\\\xe4mt|harju|sitterjag|h\\\xe4\\\ufb02a|s\\\ufb01\\\xe4l|F\\\xd6U|varf\\\xf6rjag|s\\\ufb01\\\xe4rna|b\\\xf6\\\ufb02ar|b\\\xf6\\\ufb02an|st\\\xe4ri|p\\\xe4|harjag|attjag|Verkarjag|K\\\xe4nnerjag|d\\\xe4rjag|tu\\\ufb01|lurarjag|varj\\\xe4ttebra|allvan|deth\\\xe4r|va\\\ufb02e|F\\\xf6Uer|personalm\\\xf6tetl|harjust|\\\xe4rj\\\xe4tteduktig|d\\\xe4rja|lngen\\\xfcng|iluften|\\\xf6sen|tv\\\xe2|Uejerna|h\\\xe5n\\*|\\\xc4rjag|keL|F\\\xf6rjag|varj\\\xe4ttekul|k\\\xe4mpan|mycketjobb|Uus|serjag|vetjag|f\\\xe5rjag|hurjag|f\\\xf6rs\\\xf6kerjag|t\\\xe1nagel|va\\\xfce|Uudet|amhopa|V\\\xe4\\\xfc|g\\\xe4ri|r\\\xf6d\\\xfcus|Uuset|Rid\\\xe0n|vi\\\xfca|g\\\xe5ri|Hurd\\\xe5|inter\\\\\\/juar|menarjag|spyrjag|bri\\\xfcera|N\\\xe4rjag|ner\\\\\\/\\\xf6s|ilivets|n\\\xe4got|p\\\xe0|Lnnan|Uf|lnnan|D\\\xe0ren|F\\\xe0rjag|Vad\\\xe4rdetd\\\xe4L|sm\\\xe0tjuv|t\\\xe0gr\\\xe5nare|dit\\\xe0t|s\\\xe4|v\\\xe0rdsl\\\xf6sa|n\\\xe0n|kommerjag|\\\xe4rj\\\xe4ttebra|\\\xe4rj\\\xe4vligt|\\\xe0kerjag|ellerjapaner|attjaga|eften|h\\\xe4stan|Lntensivare|fr\\\xe0garjag|pen\\/ers|r\\\xe0barkade|styrkon|Dif\\\xe5f|h\\\xe4nden|f\\\xf6\\\ufb01a|Idioten\\/|Varf\\\xf6rjagade|d\\\xe4rf\\\xf6rjag|forjag|Iivsgladje|narjag|sajag|genastja|rockument\\\xe0ren|turne|fickjag|sager|Ijush\\\xe5rig|tradg\\\xe5rdsolycka|kvavdes|d\\\xe0rja|hedersgaster|Nar|smaki\\\xf6sa|lan|Lan|eri|universitetsamne|garna|ar|baltdjur|varjag|\\\xe0r|f\\\xf6rf\\\xf6rst\\\xe0rkare|arjattespeciell|h\\\xe0rg\\\xe5r|Ia|Iimousinen|krickettra|h\\\xe5rdrockv\\\xe0rlden|tr\\\xe0bit|Mellanvastern|arju|turnen|kanns|battre|v\\\xe0rldsturne|dar|sj\\\xe0lvant\\\xe0nder|jattelange|berattade|S\\\xe4|vandpunkten|N\\\xe0rjag|lasa|skitl\\\xe0skigt|sambandsv\\\xe0g|valdigt|Stamga\\\ufb01el|\\\xe0rjag|tajming|utg\\\xe4ng|H\\\xe0r\\\xe5t|h\\\xe0r\\\xe5t|anvander|harjobbat|imageide|kla\\\ufb01en|sjalv|dvarg|detjag|dvargarna|fantasiv\\\xe0rld|\\\ufb01olliga|mandoiinstr\\\xe0ngar|mittjobb|Skajag|landari|gang|Detjag|Narmre|I\\\xe5tjavelni|H\\\xe5llerjag|visionarer|T\\\xfclvad|milit\\\xe0rbas|jattegiada|Fastjag|s\\\xe5jag|rockvarlden|saknarjag|allafall|\\\ufb01anta|Kr\\\xe0ma|stammer|budb\\\xe0rare|Iivsfiiosofi|f\\\xf6rj\\\xe4mnan|gillarjag|Iarvat|klararjag|hatta\\\ufb01\\'\\\xe0r|D\\\xe0|upp\\\ufb01nna|R\\\xe0ttf\\\xe5glar|Sv\\\xe4\\\xfcboda|P\\\xe5b\\\xf6\\\ufb02ar|slutarju|ni\\\ufb01skebu\\\xfcken|h\\\xe4rj\\\xe4keln|H\\\xdfppa|f\\\xf6rst\\\xf6rds|varj\\\xe4ttegoda|Kor\\\\\\/|br\\\xfcl\\\xe9el|Hei|\\\xe4lskarjordgubbsglass|Sn\\\xf6bom|Sn\\\xf6boH|Sn\\\xf6bol|sn\\\xf6boH|L\\\xe4ggerp\\\xe5|lnge\\\ufb02|S\\\xe4gerj\\\xe4ttesmarta|dopplen\\/\\\xe4derradar|s\\\xe4kertj\\\xe4ttefin|\\\xe4rj\\\xe4ttefin|verkarju|blirju|kor\\\\\\/|naturkatastro\\\ufb01|stickerjag|j\\\xe4ttebu\\\ufb01\\\xe9|be\\\ufb01nner|Sp\\\ufb02ng|trec\\\ufb01e|ryckerjag|skullejag|vetju|a\\\ufb02jag|\\\ufb02nns|\\\xe4rl\\\xe5ng|k\\\xe5ra|\\\xe4r\\\ufb01na|\\\xe4ri|h\\\xf6rden|\\\xe4ttj\\\xe4g|g\\\xe4r|f\\\xf6ri|Hurvisste|\\\ufb01ck|\\\ufb01nns|\\\ufb01n|Fa|bori|fiendeplanl|if\\\xf6rnamn|detju|N\\\xfcd|hatarjag|Klararjag|deta\\\ufb01er|v\\\xe4\\/|smakarju|Teache\\\ufb02|imorse|drickerjag|st\\\xe5ri|Harjag|Talarjag|undrarjag|\\\xe5lderjag|va\\\ufb01e|f\\\xf6rfalskningl|Vi\\\ufb01iiiam|V\\\\\\\ufb01lliams|attjobba|intei|n\\\xe4rV\\\\\\\ufb01lliam|V\\\\\\\ufb01lliam|E\\\ufb01ersom|Vl\\\ufb01lliam|I\\\xe4ngejag|\\'\\\ufb01digare|b\\\xf6rjadei|merjust|e\\\ufb01er\\\xe5t|gjordejag|hadeju|g\\\xe5rvi|k\\\xf6perjag|M\\\xe5stejag|k\\\xe4nnerju|\\\ufb02n|treviig|Grattisl|kande|\\'llden|sakjag|klartjag|h\\\xe4\\\ufb01igt|I\\\xe4mnarjag|gickju|skajag|G\\\xf6rjag|m\\\xe5stejag|gra\\\\\\/iditet|hittadqdin|\\\xe4rjobbigt|Overdrivet|hOgtidlig|Overtyga|SKILSMASSA|brukarju|lsabel|kundejag|\\\xe4rl\\\xe4get|blirinte|ijakt|avjordens|90000O|9O0|\\\xe4rp\\\xe5|\\\xe4rproteserna|\\\xe4rytterst|beborjorden|filmjag|fokuserarp\\\xe5|folkjag|f\\\xf6rest\\\xe4lldejag|f\\\xf6rpubliken|gilladejag|h\\\xe5llerp\\\xe5|harp\\\xe5|harplaner|harprylar|kommerpubliken|kostymerp\\\xe5|litarp\\\xe5|lngen|lnom|lnte|ochjag|Ochjag|ochjorden|omjag|Omjag|passarperfekt|s\\\xe4ttetjag|silverp\\\xe5|skruvarjag|somjag|Somjag|talarp\\\xe5|t\\\xe4nktejag|tapparjag|tittarp\\\xe5|visstejag|medjetpacks|s\\\xe4tterp\\\xe5|st\\\xe5rp\\\xe5|tillh\\\xf6rp\\\xe5)(\\b|$)"}}}
+for lang, grps in data.iteritems():
+    for grp in grps.iterkeys():
+        if data[lang][grp]["pattern"]:
+            data[lang][grp]["pattern"] = re.compile(data[lang][grp]["pattern"])
diff --git a/libs/subzero/modification/dictionaries/make_data.py b/libs/subzero/modification/dictionaries/make_data.py
new file mode 100644
index 000000000..1ac99b6e6
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/make_data.py
@@ -0,0 +1,174 @@
+# coding=utf-8
+
+import re
+import os
+import pprint
+from collections import OrderedDict
+
+from bs4 import BeautifulSoup
+
+TEMPLATE = """\
+import re
+from collections import OrderedDict
+data = """
+
+TEMPLATE_END = """\
+
+for lang, grps in data.iteritems():
+    for grp in grps.iterkeys():
+        if data[lang][grp]["pattern"]:
+            data[lang][grp]["pattern"] = re.compile(data[lang][grp]["pattern"])
+"""
+
+
+SZ_FIX_DATA = {
+    "eng": {
+        "PartialWordsAlways": {
+            u"°x°": u"%",
+            u"compiete": u"complete",
+            u"Âs": u"'s",
+            u"ÃÂs": u"'s",
+            u"a/ion": u"ation",
+            u"at/on": u"ation",
+            u"l/an": u"lian",
+            u"lljust": u"ll just",
+            u" L ": u" I ",
+            u" l ": u" I ",
+            u"'sjust": u"'s just",
+            u"'tjust": u"'t just",
+        },
+        "WholeWords": {
+            u"I'11": u"I'll",
+            u"III'll": u"I'll",
+            u"Tun": u"Run",
+            u"pan'": u"part",
+            u"al'": u"at",
+            u"a re": u"are",
+            u"wail'": u"wait",
+            u"he)'": u"hey",
+            u"he)\"": u"hey",
+            u"He)'": u"Hey",
+            u"He)\"": u"Hey",
+            u"He)’": u"Hey",
+            u"Yea h": u"Yeah",
+            u"yea h": u"yeah",
+            u"h is": u"his",
+            u" 're ": u"'re ",
+            u"LAst": u"Last",
+            u"forthis": u"for this",
+            u"Ls": u"Is",
+            u"Iam": u"I am",
+            u"Ican": u"I can",
+        },
+        "PartialLines": {
+            u"L know": u"I know",
+            u"L should": u"I should",
+            u"L do": u"I do",
+            u"L would": u"I would",
+            u"L could": u"I could",
+            u"L can": u"I can",
+            u"L happen": u"I happen",
+            u"L might": u"I might",
+            u"L have ": u"I have",
+            u"L had": u"I had",
+            u"L want": u"I want",
+            u"L was": u"I was",
+            u"L am": u"I am",
+            u"L will": u"I will",
+            u"L suggest": u"I suggest",
+            u"L think": u"I think",
+            u"L reckon": u"I reckon",
+            u"L like": u"I like",
+            u"L love": u"I love",
+            u"L don't": u"I don't",
+            u"L didn't": u"I didn't",
+            u"L wasn't": u"I wasnt't",
+            u"L haven't": u"I haven't",
+            u"L couldn't": u"I couldn't",
+            u"L won't": u"I won't",
+            u"H i": u"Hi",
+        },
+        "BeginLines": {
+            u"l ": u"I ",
+            u"L ": u"I ",
+        }
+    },
+    "nld": {
+        "PartialWordsAlways": {
+            u"ט": u"è",
+            u"י": u"é",
+            u"כ": u"ë",
+            u"צ": u"ë",
+            u"ן": u"ï",
+            u"ף": u"ó",
+            u"א": u"à",
+            u"Iֻ": u"I",
+            u"č": u"è",
+            u"פ": u"o",
+            u"ם": u"i",
+        },
+    },
+    "swe": {
+        "PartialWordsAlways": {
+            u"ĺ": u"å",
+            u"Ĺ": u"Å",
+        }
+    }
+}
+
+SZ_FIX_DATA_GLOBAL = {
+    "PartialWordsAlways": {
+        u"¶¶": u"♫",
+        u"¶": u"♪"
+    }
+}
+
+if __name__ == "__main__":
+    cur_dir = os.path.dirname(os.path.realpath(__file__))
+    xml_dir = os.path.join(cur_dir, "xml")
+    file_list = os.listdir(xml_dir)
+
+    data = {}
+
+    for fn in file_list:
+        if fn.endswith("_OCRFixReplaceList.xml"):
+            lang = fn.split("_")[0]
+            soup = BeautifulSoup(open(os.path.join(xml_dir, fn)), "xml")
+
+            fetch_data = (
+                    # group, item_name, pattern
+                    ("WholeLines", "Line", None),
+                    ("WholeWords", "Word", lambda d: (ur"(?um)(\b|^)(?:" + u"|".join([re.escape(k) for k in d.keys()])
+                                                      + ur')(\b|$)') if d else None),
+                    ("PartialWordsAlways", "WordPart", None),
+                    ("PartialLines", "LinePart", lambda d: (ur"(?um)(?:(?<=\s)|(?<=^)|(?<=\b))(?:" +
+                                                            u"|".join([re.escape(k) for k in d.keys()]) +
+                                                            ur")(?:(?=\s)|(?=$)|(?=\b))") if d else None),
+                    ("BeginLines", "Beginning", lambda d: (ur"(?um)^(?:"+u"|".join([re.escape(k) for k in d.keys()])
+                                                           + ur')') if d else None),
+                    ("EndLines", "Ending", lambda d: (ur"(?um)(?:" + u"|".join([re.escape(k) for k in d.keys()]) +
+                                                      ur")$") if d else None,),
+            )
+
+            data[lang] = dict((grp, {"data": OrderedDict(), "pattern": None}) for grp, item_name, pattern in fetch_data)
+
+            for grp, item_name, pattern in fetch_data:
+                for grp_data in soup.find_all(grp):
+                    for line in grp_data.find_all(item_name):
+                        data[lang][grp]["data"][line["from"]] = line["to"]
+
+                # add our own dictionaries
+                if lang in SZ_FIX_DATA and grp in SZ_FIX_DATA[lang]:
+                    data[lang][grp]["data"].update(SZ_FIX_DATA[lang][grp])
+
+                if grp in SZ_FIX_DATA_GLOBAL:
+                    data[lang][grp]["data"].update(SZ_FIX_DATA_GLOBAL[grp])
+
+                if pattern:
+                    data[lang][grp]["pattern"] = pattern(data[lang][grp]["data"])
+
+    f = open(os.path.join(cur_dir, "data.py"), "w+")
+    f.write(TEMPLATE)
+    f.write(pprint.pformat(data, width=1))
+    f.write(TEMPLATE_END)
+    f.close()
diff --git a/libs/subzero/modification/dictionaries/test_data.py b/libs/subzero/modification/dictionaries/test_data.py
new file mode 100644
index 000000000..538c99fc0
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/test_data.py
@@ -0,0 +1,10 @@
+# coding=utf-8
+
+from subzero.language import Language
+from data import data
+
+#for lang, data in data.iteritems():
+#    print Language.fromietf(lang).alpha2
+
+for find, rep in data["dan"].iteritems():
+    print find, rep
\ No newline at end of file
diff --git a/libs/subzero/modification/dictionaries/xml/bos_OCRFixReplaceList.xml b/libs/subzero/modification/dictionaries/xml/bos_OCRFixReplaceList.xml
new file mode 100644
index 000000000..4faf79872
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/xml/bos_OCRFixReplaceList.xml
@@ -0,0 +1,1840 @@
+<OCRFixReplaceList>
+	<WholeWords>
+		<Word from="andele" to="anđele" />
+		<Word from="andeli" to="anđeli" />
+		<Word from="bacas" to="bacaš" />
+		<Word from="bas" to="baš" />
+		<Word from="Bas" to="Baš" />
+		<Word from="basta" to="vrt" />
+		<Word from="Basta" to="Vrt" />
+		<Word from="baste" to="vrtovi" />
+		<Word from="Baste" to="Vrtovi" />
+		<Word from="basti" to="vrtu" />
+		<Word from="Basti" to="Vrtu" />
+		<Word from="bastom" to="vrtom" />
+		<Word from="Bastom" to="Vrtom" />
+		<Word from="bastu" to="vrt" />
+		<Word from="Bastu" to="Vrt" />
+		<Word from="Bice" to="Biće" />
+		<Word from="bice" to="biće" />
+		<Word from="Biceš" to="Bit ćeš" />
+		<Word from="Bicu" to="Bit ću" />
+		<Word from="bicu" to="biću" />
+		<Word from="blagonaklonoscu" to="blagonaklonošću" />
+		<Word from="blizi" to="bliži" />
+		<Word from="bljesti" to="bliješti" />
+		<Word from="Bljesti" to="Bliješti" />
+		<Word from="bojis" to="bojiš" />
+		<Word from="braca" to="braća" />
+		<Word from="Braca" to="Braća" />
+		<Word from="broncane" to="brončane" />
+		<Word from="broncanu" to="brončanu" />
+		<Word from="budes" to="budeš" />
+		<!--c-->
+		<!-- cic u čić  - nikada automatski za sve! -->
+		<Word from="caj" to="čaj" />
+		<Word from="caja" to="čaja" />
+		<Word from="Cak" to="Čak" />
+		<Word from="cak" to="čak" />
+		<Word from="cale" to="tata" />
+		<Word from="Cao" to="Ćao" />
+		<Word from="cao" to="ćao" />
+		<Word from="cas" to="sat" />
+		<Word from="casno" to="časno" />
+		<Word from="Casno" to="Časno" />
+		<Word from="castis" to="častiš" />
+		<Word from="casu" to="cašu" />
+		<Word from="cašu" to="čašu" />
+		<Word from="cebe" to="deku" />
+		<Word from="cega" to="čega" />
+		<Word from="Cek" to="Ček" />
+		<Word from="cek" to="ček" />
+		<Word from="cekali" to="čekali" />
+		<Word from="cekas" to="čekaš" />
+		<Word from="Cemu" to="Čemu" />
+		<Word from="cemu" to="čemu" />
+		<Word from="cerka" to="kći" />
+		<Word from="Cerka" to="Kći" />
+		<Word from="cerke" to="kćeri" />
+		<Word from="Cerke" to="Kćeri" />
+		<Word from="cerku" to="kćer" />
+		<Word from="Cerku" to="Kćer" />
+		<Word from="ces" to="ćeš" />
+		<Word from="cesce" to="češće" />
+		<Word from="Cesce" to="Češće" />
+		<Word from="Ceskoj" to="Češkoj" />
+		<Word from="cestitki" to="čestitki" />
+		<Word from="cesto" to="često" />
+		<Word from="Cesto" to="Često" />
+		<Word from="cetiri" to="četiri" />
+		<Word from="Cetiri" to="Četiri" />
+		<Word from="cetri" to="četiri" />
+		<Word from="cetu" to="četu" />
+		<Word from="ceznja" to="čežnja" />
+		<Word from="ceznje" to="čežnje" />
+		<Word from="ceznji" to="čežnji" />
+		<Word from="ceznjom" to="čežnjom" />
+		<Word from="ceznju" to="čežnju" />
+		<Word from="ceznu" to="čeznu" />
+		<Word from="ceš" to="ćeš" />
+		<Word from="Cija" to="Čija" />
+		<Word from="cija" to="čija" />
+		<Word from="cije" to="čije" />
+		<Word from="Ciji" to="Čiji" />
+		<Word from="ciji" to="čiji" />
+		<Word from="cijih" to="čijih" />
+		<Word from="Cijih" to="Čijih" />
+		<Word from="cijim" to="čijim" />
+		<Word from="Cijim" to="Čijim" />
+		<Word from="Cim" to="Čim" />
+		<Word from="cim" to="čim" />
+		<Word from="cime" to="čime" />
+		<Word from="cinila" to="činila" />
+		<Word from="cinili" to="činili" />
+		<Word from="cinio" to="činio" />
+		<Word from="cinis" to="činiš" />
+		<Word from="ciniti" to="činiti" />
+		<Word from="cipka" to="čipka" />
+		<Word from="cipku" to="čipku" />
+		<Word from="cita" to="čita" />
+		<Word from="citao" to="čitao" />
+		<Word from="citas" to="čitaš" />
+		<Word from="citavu" to="čitavu" />
+		<Word from="cizme" to="čizme" />
+		<Word from="clan" to="član" />
+		<Word from="Clan" to="Član" />
+		<Word from="clanke" to="članke" />
+		<Word from="clanove" to="članove" />
+		<Word from="clanovi" to="članovi" />
+		<Word from="clanovima" to="članovima" />
+		<Word from="cmo" to="ćemo" />
+		<Word from="corsokak" to="slijepa ulica" />
+		<Word from="corsokaku" to="slijepoj ulici" />
+		<Word from="cosak" to="ugao" />
+		<Word from="cosku" to="uglu" />
+		<Word from="covece" to="čovječe" />
+		<Word from="covek" to="čovjek" />
+		<Word from="covjece" to="čovječe" />
+		<Word from="covjecnost" to="čovječnost" />
+		<Word from="covjek" to="čovjek" />
+		<Word from="covjeka" to="čovjeka" />
+		<Word from="covjeku" to="čovjeku" />
+		<Word from="crpeci" to="crpeći" />
+		<Word from="cte" to="ćete" />
+		<Word from="Cu" to="Ću" />
+    		<Word from="Ceš" to="Ćeš" />
+    		<Word from="Ce" to="Će" />
+    		<Word from="Cemo" to="Ćemo" />
+    		<Word from="Cete" to="Ćete" />
+    		<Word from="cu" to="ću" />
+    		<Word from="ce" to="će" />
+    		<Word from="cemo" to="ćemo" />
+    		<Word from="cete" to="ćete" />
+		<Word from="cudi" to="čudi" />
+		<Word from="Cudo" to="Čudo" />
+		<Word from="cudo" to="čudo" />
+		<Word from="Cujte" to="Čujte" />
+		<Word from="cula" to="čula" />
+		<Word from="culi" to="čuli" />
+		<Word from="Culi" to="Čuli" />
+		<Word from="culima" to="čulima" />
+		<Word from="cuo" to="čuo" />
+		<Word from="Cuo" to="Čuo" />
+		<Word from="cupam" to="čupam" />
+		<Word from="cutanje" to="šutnja" />
+		<Word from="Cutanje" to="Šutnja" />
+		<Word from="cutao" to="šutio" />
+		<Word from="Cutao" to="Šutio" />
+		<Word from="cuti" to="čuti" />
+		<Word from="cutljiv" to="šutljiv" />
+		<Word from="cutnja" to="šutnja" />
+		<Word from="cuvali" to="čuvali" />
+		<Word from="cuveni" to="čuveni" />
+		<!--d-->
+		<Word from="dace" to="dat će" />
+		<Word from="dacemo" to="dat ćemo" />
+		<Word from="davo" to="vrag" />
+		<Word from="definise" to="definira" />
+		<Word from="definisi" to="definiraj" />
+		<Word from="Desava" to="Događa" />
+		<Word from="desava" to="događa" />
+		<Word from="disemo" to="dišemo" />
+		<Word from="disi" to="diši" />
+		<Word from="dobijes" to="dobiješ" />
+		<Word from="dobivas" to="dobivaš" />
+		<Word from="doci" to="doći" />
+		<Word from="dode" to="dođe" />
+		<Word from="dodem" to="dođem" />
+		<Word from="dodes" to="dođeš" />
+		<Word from="dodete" to="dođete" />
+		<Word from="dodeš" to="dođeš" />
+		<Word from="Dodi" to="Dođi" />
+		<Word from="dodi" to="dođi" />
+		<Word from="dodite" to="dođite" />
+		<Word from="Dodji" to="Dođi" />
+		<Word from="dodji" to="dođi" />
+		<Word from="Dodjite" to="Dođite" />
+		<Word from="dodjite" to="dođite" />
+		<Word from="Dodju" to="Dođu" />
+		<Word from="dodju" to="dođu" />
+		<Word from="dodu" to="dođu" />
+		<Word from="dolazis" to="dolaziš" />
+		<Word from="dopustao" to="dopuštao" />
+		<Word from="dorucak" to="doručak" />
+		<Word from="dorucku" to="doručku" />
+		<Word from="Dosao" to="Došao" />
+		<Word from="dosao" to="došao" />
+		<Word from="drhteci" to="drhteći" />
+		<Word from="drhteći" to="drhteći" />
+		<Word from="Drhteći" to="Drhteći" />
+		<Word from="drugacija" to="drugačija" />
+		<Word from="Drugacije" to="Drugačije" />
+		<Word from="drugacije" to="drugačije" />
+		<Word from="drugaciji" to="drugačiji" />
+		<Word from="Drugaciji" to="Drugačiji" />
+		<Word from="drukciji" to="drugačiji" />
+		<Word from="drveca" to="drveća" />
+		<Word from="drvece" to="drveće" />
+		<Word from="drvecem" to="drvećem" />
+		<Word from="drvecu" to="drveću" />
+		<Word from="drzi" to="drži" />
+		<Word from="Drzim" to="Držim" />
+		<Word from="dugmici" to="gumbići" />
+		<Word from="duze" to="duže" />
+		<Word from="duzinom" to="dužinom" />
+		<Word from="dzanki" to="ovisnik" />
+		<Word from="Dzejk" to="Jake" />
+		<Word from="Dzime" to="Jime" />
+		<Word from="Dzone" to="Johne" />
+		<Word from="flasom" to="flašom" />
+		<Word from="flasu" to="flašu" />
+		<Word from="fucka" to="fućka" />
+		<Word from="funkcionisu" to="funkcioniraju" />
+		<!--g-->
+		<Word from="gacice" to="gaćice" />
+		<Word from="gadao" to="gađao" />
+		<Word from="gadis" to="gadiš" />
+		<Word from="Gadis" to="Gadiš" />
+		<Word from="gdica" to="gđica" />
+		<Word from="gdice" to="gđice" />
+		<Word from="gdici" to="gđici" />
+		<Word from="gdicu" to="gđicu" />
+		<Word from="gdu" to="gđu" />
+		<Word from="glupaco" to="glupačo" />
+		<Word from="govoris" to="govoriš" />
+		<Word from="gradani" to="građani" />
+		<Word from="gradic" to="gradić" />
+		<Word from="gradica" to="gradića" />
+		<Word from="gradicu" to="gradiću" />
+		<Word from="grancica" to="grančica" />
+		<Word from="grancicu" to="grančicu" />
+		<Word from="gresci" to="grešci" />
+		<Word from="grese" to="griješe" />
+		<Word from="greski" to="grešci" />
+		<Word from="gresku" to="grešku" />
+		<Word from="gubis" to="gubiš" />
+		<Word from="Hoces" to="Hoćeš" />
+		<Word from="hoces" to="hoćeš" />
+		<Word from="hocu" to="hoću" />
+		<Word from="Hocu" to="Hoću" />
+		<Word from="hodas" to="hodaš" />
+		<Word from="htjeo" to="htio" />
+		<!--i-->
+		<Word from="iceg" to="ičeg" />
+		<Word from="icega" to="ičega" />
+		<Word from="icemu" to="ičemu" />
+		<Word from="Ici" to="Ići" />
+		<Word from="ici" to="ići" />
+		<Word from="Ides" to="Ideš" />
+		<Word from="ides" to="ideš" />
+		<Word from="iduce" to="iduće" />
+		<Word from="iduceg" to="idućeg" />
+		<Word from="iducem" to="idućem" />
+		<Word from="Iduci" to="Idući" />
+		<Word from="iduci" to="idući" />
+		<Word from="ignorisi" to="ignoriraj" />
+		<Word from="ignorisi" to="ignoriraju" />
+		<Word from="igras" to="igraš" />
+		<Word from="Ijudi" to="ljudi" />
+		<Word from="imas" to="imaš" />
+		<Word from="imidz" to="imidž" />
+		<Word from="inace" to="inače" />
+		<Word from="Inace" to="Inače" />
+		<Word from="isao" to="išao" />
+		<Word from="Isao" to="Išao" />
+		<Word from="iscupao" to="iščupao" />
+		<Word from="isećemo" to="izrezati" />
+		<Word from="isla" to="išla" />
+		<Word from="istjece" to="istječe" />
+		<Word from="istrazio" to="istrazio" />
+		<Word from="Istrazio" to="Istrazio" />
+		<Word from="isuvise" to="previše" />
+		<Word from="izaci" to="izaći" />
+		<Word from="Izaci" to="Izaći" />
+		<Word from="izade" to="izađe" />
+		<Word from="Izade" to="Izađe" />
+		<Word from="izadem" to="izađem" />
+		<Word from="izades" to="izađeš" />
+		<Word from="izadete" to="izađete" />
+		<Word from="Izadi" to="Izađi" />
+		<Word from="izadi" to="izađi" />
+		<Word from="izasao" to="izašao" />
+		<Word from="izasla" to="izašla" />
+		<Word from="izici" to="izići" />
+		<Word from="izluduje" to="izluđuje" />
+		<Word from="izluduju" to="izluđuju" />
+		<Word from="izmedu" to="između" />
+		<Word from="Izmedu" to="Između" />
+		<Word from="izostri" to="izoštri" />
+		<Word from="izostrim" to="izoštrim" />
+		<Word from="izvuci" to="izvući" />
+		<Word from="išcupao" to="iščupao" />
+		<Word from="jebes" to="jebeš" />
+		<Word from="Jebes" to="Jebeš" />
+		<Word from="jos" to="još" />
+		<Word from="Jos" to="Još" />
+		<Word from="juce" to="jučer" />
+		<Word from="Juce" to="Jučer" />
+		<Word from="jucer" to="jučer" />
+		<Word from="Jucer" to="Jučer" />
+		<!--k-->
+		<Word from="kaslja" to="kašlja" />
+		<Word from="kaze" to="kaže" />
+		<Word from="Kaze" to="Kaže" />
+		<Word from="kazemo" to="kažemo" />
+		<Word from="kazite" to="kažite" />
+		<Word from="Kazite" to="Kažite" />
+		<Word from="kazu" to="kažu" />
+		<Word from="Kcer" to="Kćer" />
+		<Word from="kcer" to="kćer" />
+		<Word from="kcerka" to="kći" />
+		<Word from="Kcerka" to="Kći" />
+		<Word from="kcerkama" to="kćerima" />
+		<Word from="kcerku" to="kćer" />
+		<Word from="Kcerku" to="Kćer" />
+		<Word from="kecap" to="kečap" />
+		<Word from="kecapa" to="kečapa" />
+		<Word from="kise" to="kiše" />
+		<Word from="kisi" to="kiši" />
+		<Word from="kleknes" to="klekneš" />
+		<Word from="kociji" to="kočiji" />
+		<Word from="kolaca" to="kolača" />
+		<Word from="kolace" to="kolače" />
+		<Word from="komadic" to="komadić" />
+		<Word from="komsijama" to="susjedima" />
+		<Word from="komsije" to="susjedi" />
+		<Word from="komsiji" to="susjedu" />
+		<Word from="komsiluk" to="susjedstvo" />
+		<Word from="komsiluku" to="susjedstvu" />
+		<Word from="komšija" to="susjed" />
+		<Word from="Komšija" to="Susjed" />
+		<Word from="Konkurise" to="Konkurira" />
+		<Word from="konkurise" to="konkurira" />
+		<Word from="konkurisem" to="konkuriram" />
+		<Word from="konkurisu" to="konkuriraju" />
+		<Word from="kontrolisu" to="kontroliraju" />
+		<Word from="kosulja" to="košulja" />
+		<Word from="kosulje" to="košulje" />
+		<Word from="kosulji" to="košulji" />
+		<Word from="kosulju" to="košulju" />
+		<Word from="kovceg" to="kovčeg" />
+		<Word from="kovcegu" to="kovčegu" />
+		<Word from="krada" to="krađa" />
+		<Word from="Krada" to="Krađa" />
+		<Word from="Krece" to="Kreće" />
+		<Word from="krece" to="kreće" />
+		<Word from="Kreci" to="Kreći" />
+		<Word from="kreci" to="kreći" />
+		<Word from="krecu" to="kreću" />
+		<Word from="krećes" to="krećeš" />
+		<Word from="krosnje" to="krošnje" />
+		<Word from="krvaris" to="krvariš" />
+		<Word from="kuca" to="kuća" />
+		<Word from="kucama" to="kućama" />
+		<Word from="kuce" to="kuće" />
+		<Word from="kuci" to="kući" />
+		<Word from="kusa" to="kuša" />
+		<Word from="kusas" to="kušaš" />
+		<Word from="kuča" to="kuća" />
+		<Word from="kuči" to="kući" />
+		<!--l-->
+		<Word from="lakocom" to="lakoćom" />
+		<Word from="laz" to="laž" />
+		<Word from="lazac" to="lažljivac" />
+		<Word from="laze" to="laže" />
+		<Word from="lazi" to="laži" />
+		<Word from="lazne" to="lažne" />
+		<Word from="lazni" to="lažni" />
+		<Word from="lazov" to="lažljivac" />
+		<Word from="ledja" to="leđa" />
+		<Word from="ledjima" to="leđima" />
+		<Word from="leprsa" to="leprša" />
+		<Word from="lezala" to="ležala" />
+		<Word from="lezali" to="ležali" />
+		<Word from="lezati" to="ležati" />
+		<Word from="lezis" to="ležiš" />
+		<Word from="Lezis" to="Ležiš" />
+		<Word from="lici" to="liči" />
+		<Word from="licim" to="ličim" />
+		<Word from="licis" to="ličiš" />
+		<Word from="licnost" to="ličnost" />
+		<Word from="licnosti" to="ličnosti" />
+		<Word from="lijecniku" to="liječniku" />
+		<Word from="ljubis" to="ljubiš" />
+		<Word from="los" to="loš" />
+		<Word from="losa" to="loša" />
+		<Word from="losu" to="lošu" />
+		<!--m-->
+		<Word from="majcine" to="majčine" />
+		<Word from="masini" to="mašini" />
+		<Word from="medu" to="među" />
+		<Word from="Medutim" to="Međutim" />
+		<Word from="medutim" to="međutim" />
+		<Word from="mici" to="miči" />
+		<Word from="Mici" to="Miči" />
+		<Word from="micu" to="miču" />
+		<Word from="mislis" to="misliš" />
+		<Word from="Mislis" to="Misliš" />
+		<Word from="mjesecevom" to="mjesečevom" />
+		<Word from="mjesecine" to="mjesečine" />
+		<Word from="mjesecini" to="mjesečini" />
+		<Word from="mjesecinu" to="mjesečinu" />
+		<Word from="mladic" to="mladić" />
+		<Word from="moc" to="moć" />
+		<Word from="moci" to="moći" />
+		<Word from="motivisu" to="motiviraju" />
+		<Word from="mozda" to="možda" />
+		<Word from="Mozda" to="Možda" />
+		<Word from="moze" to="može" />
+		<Word from="mozete" to="možete" />
+		<Word from="mreza" to="mreža" />
+		<Word from="mrezu" to="mrežu" />
+		<Word from="mrzis" to="mrziš" />
+		<Word from="muce" to="muče" />
+		<Word from="mucenik" to="mučenik" />
+		<Word from="mucne" to="mučne" />
+		<Word from="muska" to="muška" />
+		<Word from="muz" to="muž" />
+		<Word from="muza" to="muža" />
+		<!--n-->
+		<Word from="naci" to="naći" />
+		<Word from="Naci" to="Naći" />
+		<Word from="nacin" to="način" />
+		<Word from="nadem" to="nađem" />
+		<Word from="Nadem" to="Nađem" />
+		<Word from="nademo" to="nađemo" />
+		<Word from="nades" to="nađeš" />
+		<Word from="Nades" to="Nađeš" />
+		<Word from="nadete" to="nađete" />
+		<Word from="nadici" to="nadići" />
+		<Word from="nadje" to="nađe" />
+		<Word from="Nadje" to="Nađe" />
+		<Word from="nadjen" to="nađen" />
+		<Word from="nadjes" to="nađeš" />
+		<Word from="Nadjes" to="Nađeš" />
+		<Word from="nadjete" to="nađete" />
+		<Word from="nagovestaj" to="nagovještaj" />
+		<Word from="najvise" to="najvise" />
+		<Word from="Najvise" to="Najviše" />
+		<Word from="naklonoscu" to="nakolonošću" />
+		<Word from="naocale" to="naočale" />
+		<Word from="Napisite" to="Napišite" />
+		<Word from="nasa" to="naša" />
+		<Word from="Nase" to="Naše" />
+		<Word from="nase" to="naše" />
+		<Word from="naseg" to="našeg" />
+		<Word from="nasi" to="naši" />
+		<Word from="Nasi" to="Naši" />
+		<Word from="nasao" to="našao" />
+		<Word from="Nasao" to="Našao" />
+		<Word from="nasla" to="našla" />
+		<Word from="Nasla" to="Našla" />
+		<Word from="nasli" to="našli" />
+		<Word from="Nasli" to="Našli" />
+		<Word from="nasoj" to="našoj" />
+		<Word from="nasrecu" to="na sreću" />
+		<Word from="nastavis" to="nastaviš" />
+		<Word from="nasu" to="našu" />
+		<Word from="nauce" to="nauče" />
+		<Word from="neceg" to="nečeg" />
+		<Word from="necega" to="nečega" />
+		<Word from="necemo" to="nećemo" />
+		<Word from="necemu" to="nečemu" />
+		<Word from="necije" to="nečije" />
+		<Word from="neciji" to="nečiji" />
+		<Word from="necim" to="nečim" />
+		<Word from="necovjecnost" to="nečovječnost" />
+		<Word from="necovjecnosti" to="nečovječnosti" />
+		<Word from="necu" to="neću" />
+		<Word from="Necu" to="Neću" />
+		<Word from="nekaze" to="ne kaže" />
+		<Word from="nekoc" to="nekoć" />
+		<Word from="Nemas" to="Nemaš" />
+		<Word from="nemas" to="nemaš" />
+		<Word from="Nesreca" to="Nesreća" />
+		<Word from="nesto" to="nešto" />
+		<Word from="Nesto" to="Nešto" />
+		<Word from="new yorski" to="njujorški" />
+		<Word from="Nezan" to="Nježan" />
+		<Word from="nezan" to="nježan" />
+		<Word from="nezna" to="nježna" />
+		<Word from="Neznam" to="Ne znam" />
+		<Word from="Neznas" to="Ne znas" />
+		<Word from="Neznajuci" to="Ne znajući" />
+		<Word from="Neznavsi" to="Ne znavši" />
+		<Word from="neznam" to="ne znam" />
+		<Word from="neznas" to="ne znas" />
+		<Word from="neznajuci" to="ne znajući" />
+		<Word from="neznavsi" to="ne znavši" />
+		<Word from="nezni" to="nježni" />
+		<Word from="neznih" to="nježnih" />
+		<Word from="neznim" to="nježnim" />
+		<Word from="nezno" to="nježno" />
+		<Word from="neznu" to="nježnu" />
+		<Word from="niceg" to="ničeg" />
+		<Word from="nicega" to="ničega" />
+		<Word from="nicemu" to="ničemu" />
+		<Word from="nicija" to="ničija" />
+		<Word from="niciji" to="ničiji" />
+		<Word from="nicim" to="ničim" />
+		<Word from="njezno" to="nježno" />
+		<Word from="nju jorski" to="njujorški" />
+		<Word from="noci" to="noći" />
+		<Word from="nocnu" to="noćnu" />
+		<Word from="nosac" to="nosač" />
+		<Word from="nosices" to="nosit ćeš" />
+		<Word from="nosis" to="nosiš" />
+		<Word from="noz" to="nož" />
+		<Word from="nozem" to="nožem" />
+		<!--o-->
+		<Word from="Obecao" to="Obećao" />
+		<Word from="Obezbedjuju" to="Osiguravaju" />
+		<Word from="obezbedjuju" to="osiguravaju" />
+		<Word from="obide" to="obiđe" />
+		<Word from="objasnis" to="objasniš" />
+		<Word from="obozavalac" to="obožavatelj" />
+		<Word from="obracas" to="obraćaš" />
+		<Word from="obraćas" to="obraćaš" />
+		<Word from="obuce" to="obuče" />
+		<Word from="obucem" to="obučem" />
+		<Word from="oceve" to="očeve" />
+		<Word from="ocito" to="očito" />
+		<Word from="ocnjaci" to="očnjaci" />
+		<Word from="odes" to="odeš" />
+		<Word from="odlazis" to="odlaziš" />
+		<Word from="odlezati" to="odležati" />
+		<Word from="odlucim" to="odlučim" />
+		<Word from="odmice" to="odmiče" />
+		<Word from="odraduje" to="odrađuje" />
+		<Word from="odreden" to="određen" />
+		<Word from="odreduje" to="određuje" />
+		<Word from="odredujemo" to="određujemo" />
+		<Word from="odvec" to="odveć" />
+		<Word from="ogrtac" to="ogrtač" />
+		<Word from="ohrabrujuce" to="ohrabrujuće" />
+		<Word from="ojacam" to="ojačam" />
+		<Word from="okrece" to="okreće" />
+		<Word from="opasac" to="opasač" />
+		<Word from="operise" to="operira" />
+		<Word from="operisemo" to="operiramo" />
+		<Word from="operisete" to="operirate" />
+		<Word from="operiseš" to="operiraš" />
+		<Word from="osecaces" to="osjećat ćeš" />
+		<Word from="osjecaces" to="osjećat ćeš" />
+		<Word from="osjecam" to="osjećam" />
+		<Word from="osjecanja" to="osjećanja" />
+		<Word from="oslobada" to="oslobađa" />
+		<Word from="ostra" to="oštra" />
+		<Word from="ostre" to="oštre" />
+		<Word from="ostri" to="oštri" />
+		<Word from="ostrom" to="oštrom" />
+		<Word from="ostru" to="oštru" />
+		<Word from="osvrnes" to="osvrneš" />
+		<Word from="Osvrnes" to="Osvrneš" />
+		<Word from="otezala" to="otežala" />
+		<Word from="otidi" to="otiđi" />
+		<Word from="otidji" to="otiđi" />
+		<Word from="otisao" to="otišao" />
+		<Word from="oziljak" to="ožiljak" />
+		<!--p-->		
+		<Word from="palaca" to="palača" />
+		<Word from="palaci" to="palači" />
+		<Word from="palacu" to="palaču" />
+		<Word from="papucama" to="papučama" />
+		<Word from="parce" to="komadić" />
+		<Word from="pateci" to="pateći" />
+		<Word from="patis" to="patiš" />
+		<Word from="pcela" to="pčela" />
+		<Word from="pcele" to="pčele" />
+		<Word from="pecini" to="pećini" />
+		<Word from="pecinski" to="pećinski" />
+		<Word from="peraca" to="perača" />
+		<Word from="Peraci" to="Perači" />
+		<Word from="pica" to="pića" />
+		<Word from="pice" to="piće" />
+		<Word from="picem" to="pićem" />
+		<Word from="pijes" to="piješ" />
+		<Word from="pisacoj" to="pisaćoj" />
+		<Word from="pise" to="piše" />
+		<Word from="pisem" to="pišem" />
+		<Word from="pisemo" to="pišemo" />
+		<Word from="pises" to="pišeš" />
+		<Word from="pisite" to="pišite" />
+		<Word from="pisu" to="pišu" />
+		<Word from="pitas" to="pitaš" />
+		<Word from="placa" to="plaća" />
+		<Word from="placam" to="plaćam" />
+		<Word from="placanje" to="plaćanje" />
+		<Word from="placanjem" to="plaćanjem" />
+		<Word from="place" to="plače" />
+		<Word from="placem" to="plačem" />
+		<Word from="placete" to="plačete" />
+		<Word from="placeš" to="plačeš" />
+		<Word from="placu" to="plaću" />
+		<Word from="placuci" to="plačući" />
+		<Word from="Plasi" to="Boji" />
+		<Word from="plazi" to="plaži" />
+		<Word from="plazu" to="plažu" />
+		<Word from="plese" to="pleše" />
+		<Word from="plesemo" to="plešemo" />
+		<Word from="plesete" to="plešete" />
+		<Word from="plesu" to="plešu" />
+		<Word from="ploca" to="ploča" />
+		<Word from="ploce" to="ploče" />
+		<Word from="pluca" to="pluća" />
+		<Word from="plucima" to="plućima" />
+		<Word from="pobjeci" to="pobjeći" />
+		<Word from="pobjeduje" to="pobjeđuje" />
+		<Word from="poceli" to="počeli" />
+		<Word from="poceo" to="počeo" />
+		<Word from="pocetak" to="početak" />
+		<Word from="pocevsi" to="počevši" />
+		<Word from="pocevši" to="počevši" />
+		<Word from="poci" to="poći" />
+		<Word from="pocinje" to="počinje" />
+		<Word from="pociva" to="počiva" />
+		<Word from="pocivali" to="počivali" />
+		<Word from="pocivao" to="počivao" />
+		<Word from="pode" to="pođe" />
+		<Word from="podi" to="pođi" />
+		<Word from="podici" to="podići" />
+		<Word from="Podici" to="Podići" />
+		<Word from="podimo" to="pođimo" />
+		<Word from="Podimo" to="Pođimo" />
+		<Word from="podje" to="pođe" />
+		<Word from="Podje" to="Pođe" />
+		<Word from="Podji" to="Pođi" />
+		<Word from="podji" to="pođi" />
+		<Word from="podneses" to="podneseš" />
+		<Word from="podocnjacima" to="podočnjacima" />
+		<Word from="podocnjake" to="podočnjake" />
+		<Word from="podstice" to="potiče" />
+		<Word from="poduzeca" to="poduzeća" />
+		<Word from="poduzece" to="poduzeće" />
+		<Word from="poduzecu" to="poduzeću" />
+		<Word from="pojesce" to="pojest će" />
+		<Word from="pojiliste" to="pojilište" />
+		<Word from="pokazi" to="pokaži" />
+		<Word from="Pokazi" to="Pokaži" />
+		<Word from="pokrece" to="pokreće" />
+		<Word from="pokusaj" to="pokušaj" />
+		<Word from="pokusam" to="pokušam" />
+		<Word from="pokusas" to="pokušaš" />
+		<Word from="poletis" to="poletiš" />
+		<Word from="polozaja" to="položaja" />
+		<Word from="polozaju" to="položaju" />
+		<Word from="pomaci" to="pomaknuti" />
+		<Word from="pomazes" to="pomažeš" />
+		<Word from="pomislis" to="pomisliš" />
+		<Word from="pomognes" to="pomogneš" />
+		<Word from="poneses" to="poneseš" />
+		<Word from="ponovis" to="ponoviš" />
+		<Word from="poreci" to="poreći" />
+		<Word from="porice" to="poriče" />
+		<Word from="posalji" to="pošalji" />
+		<Word from="Posalji" to="Pošalji" />
+		<Word from="posaljite" to="pošaljite" />
+		<Word from="posle" to="poslije" />
+		<Word from="posluzili" to="poslužili" />
+		<Word from="Posluzite" to="Poslužite" />
+		<Word from="posluzite" to="poslužite" />
+		<Word from="postaras" to="pobrineš" />
+		<Word from="posto" to="pošto" />
+		<Word from="Posto" to="Pošto" />
+		<Word from="potece" to="poteče" />
+		<Word from="potice" to="potiče" />
+		<Word from="potici" to="potiči" />
+		<Word from="potjece" to="potječe" />
+		<Word from="potjecem" to="potječem" />
+		<Word from="potjeces" to="potječeš" />
+		<Word from="potpises" to="potpišeš" />
+		<Word from="povedes" to="povedeš" />
+		<Word from="pozuda" to="požuda" />
+		<Word from="pozude" to="požude" />
+		<Word from="pozudi" to="požudi" />
+		<Word from="pozudu" to="požudu" />
+		<Word from="prakticno" to="praktično" />
+		<Word from="premasuje" to="premašuje" />
+		<Word from="premasuju" to="premašuju" />
+		<Word from="preporuca" to="preporučuje" />
+		<Word from="presao" to="prešao" />
+		<Word from="presjecen" to="presječen" />
+		<Word from="Previse" to="Previše" />
+		<Word from="previse" to="previše" />
+		<Word from="preziveo" to="preživio" />
+		<Word from="Priblizi" to="Približi" />
+		<Word from="price" to="priče" />
+		<Word from="prici" to="priči" />
+		<Word from="pricu" to="priču" />
+		<Word from="Pridji" to="Priđi" />
+		<Word from="pridji" to="priđi" />
+		<Word from="prijeci" to="prijeći" />
+		<Word from="prijedi" to="prijeđi" />
+		<Word from="prilazis" to="prilaziš" />
+		<Word from="prisao" to="prišao" />
+		<Word from="priusti" to="priušti" />
+		<Word from="priustimo" to="priuštimo" />
+		<Word from="priustiti" to="priuštiti" />
+		<Word from="proci" to="proći" />
+		<Word from="prodavac" to="prodavač" />
+		<Word from="promasio" to="promašio" />
+		<Word from="Promasio" to="Promašio" />
+		<Word from="prosao" to="prošao" />
+		<Word from="prosla" to="prošla" />
+		<Word from="Prosle" to="Prošle" />
+		<Word from="prosle" to="prošle" />
+		<Word from="prosli" to="prošli" />
+		<Word from="Prosli" to="Prošli" />
+		<Word from="proslim" to="prošlim" />
+		<Word from="proslo" to="prošlo" />
+		<Word from="Proslo" to="Prošlo" />
+		<Word from="provedes" to="provedeš" />
+		<Word from="provlaci" to="provlači" />
+		<Word from="provlacimo" to="provlačimo" />
+		<Word from="pticica" to="ptičica" />
+		<Word from="pticicu" to="ptičicu" />
+		<Word from="pucini" to="pučini" />
+		<Word from="pupcanu" to="pupčanu" />
+		<Word from="pusac" to="pušač" />
+		<Word from="pusaci" to="pušači" />
+		<Word from="pusi" to="puši" />
+		<Word from="pusimo" to="pušimo" />
+		<Word from="pusite" to="pušite" />
+		<Word from="pustam" to="puštam" />
+		<!--r-->		
+		<Word from="racunare" to="računala" />
+		<Word from="racunari" to="računala" />
+		<Word from="radis" to="radiš" />
+		<Word from="Radis" to="Radiš" />
+		<Word from="raskosni" to="raskošni" />
+		<Word from="razumes" to="razumiješ" />
+		<Word from="Razumes" to="Razumiješ" />
+		<Word from="rec" to="riječ" />
+		<Word from="rece" to="reče" />
+		<Word from="Receno" to="Rečeno" />
+		<Word from="receno" to="rečeno" />
+		<Word from="recima" to="riječima" />
+		<Word from="resimo" to="riješimo" />
+		<Word from="rijec" to="riječ" />
+		<Word from="Rijeci" to="Riječi" />
+		<Word from="rijedji" to="rjeđi" />
+		<Word from="rjedji" to="rjeđi" />
+		<Word from="Rjesit" to="Riješit" />
+		<Word from="rodena" to="rođena" />
+		<Word from="rodeni" to="rođeni" />
+		<Word from="rodis" to="rodiš" />
+		<Word from="rodjen" to="rođen" />
+		<Word from="rucno" to="ručno" />
+		<Word from="ruza" to="ruža" />
+		<Word from="ruzan" to="ružan" />
+		<Word from="ruzu" to="ružu" />
+		<!-- s -->
+		<Word from="sadrze" to="sadrže" />
+		<Word from="sadrzi" to="sadrži" />
+		<Word from="salje" to="šalje" />
+		<Word from="saljes" to="šalješ" />
+		<Word from="salju" to="šalju" />
+		<Word from="sasila" to="sašila" />
+		<Word from="sasili" to="sašili" />
+		<Word from="sasio" to="sašio" />
+		<Word from="sasiti" to="sašiti" />
+		<Word from="savescu" to="savješću" />
+		<Word from="savijescu" to="savješću" />
+		<Word from="sedeces" to="sjedit ćeš" />
+		<Word from="sedis" to="sjediš" />
+		<Word from="sedista" to="sjedala" />
+		<Word from="sediste" to="sjedište" />
+		<Word from="sendvic" to="sendvič" />
+		<Word from="sesir" to="šešir" />
+		<Word from="sesirom" to="šeširom" />
+		<Word from="sest" to="šest" />
+		<Word from="setala" to="šetala" />
+		<Word from="setam" to="šetam" />
+		<Word from="setis" to="sjetiš" />
+		<Word from="seva" to="ševa" />
+		<Word from="sevu" to="ševu" />
+		<Word from="sezdeset" to="šezdeset" />
+		<Word from="Sidji" to="Siđi" />
+		<Word from="sidji" to="siđi" />
+		<Word from="sijecanj" to="siječanj" />
+		<Word from="siroki" to="široki" />
+		<Word from="sjecaju" to="sjećaju" />
+		<Word from="sjecam" to="sjećam" />
+		<Word from="Sjecam" to="Sjećam" />
+		<Word from="sjecanja" to="sjećanja" />
+		<Word from="sjecanje" to="sjećanje" />
+		<Word from="skace" to="skače" />
+		<Word from="skaci" to="skači" />
+		<Word from="skacu" to="skaču" />
+		<Word from="sklanjas" to="sklanjaš" />
+		<Word from="sklonoscu" to="sklonošću" />
+		<Word from="sklupcam" to="sklupčam" />
+		<Word from="skola" to="škola" />
+		<Word from="Skola" to="Škola" />
+		<Word from="Skotska" to="Škotska" />
+		<Word from="Skotskoj" to="Škotskoj" />
+		<Word from="skrt" to="škrt" />
+		<Word from="skrte" to="škrte" />
+		<Word from="skrusena" to="skrušena" />
+		<Word from="Skrusena" to="Skrušena" />
+		<Word from="sledeca" to="sljedeća" />
+		<Word from="Sledece" to="Sljedeće" />
+		<Word from="sledeci" to="sljedeći" />
+		<Word from="Sledeci" to="Sljedeći" />
+		<Word from="slicno" to="slično" />
+		<Word from="sljedeci" to="sljedeći" />
+		<Word from="Sljedeci" to="Sljedeći" />
+		<Word from="slozila" to="složila" />
+		<Word from="slozili" to="složili" />
+		<Word from="slozio" to="složio" />
+		<Word from="sloziti" to="složiti" />
+		<Word from="slucaja" to="slučaja" />
+		<Word from="Smatras" to="Smatraš" />
+		<Word from="smatras" to="smatraš" />
+		<Word from="smece" to="smeće" />
+		<Word from="smeda" to="smeđa" />
+		<Word from="smedem" to="smeđem" />
+		<Word from="smedi" to="smeđi" />
+		<Word from="smedoj" to="smeđoj" />
+		<Word from="smedu" to="smeđu" />
+		<Word from="smesak" to="smješak" />
+		<Word from="Smijes" to="Smiješ" />
+		<Word from="smijes" to="smiješ" />
+		<Word from="smionoscu" to="smionošću" />
+		<Word from="smraci" to="smrači" />
+		<Word from="smracilo" to="smračilo" />
+		<Word from="smrcu" to="smrću" />
+		<Word from="snimacete" to="snimat ćete" />
+		<Word from="sokiras" to="šokiraš" />
+		<Word from="spases" to="spasiš" />
+		<Word from="Spases" to="Spasiš" />
+		<Word from="spavaca" to="spavaća" />
+		<Word from="spavacoj" to="spavaćoj" />
+		<Word from="spominjes" to="spominješ" />
+		<Word from="spustamo" to="spuštamo" />
+		<Word from="srdacan" to="srdačan" />
+		<Word from="srecom" to="srećom" />
+		<Word from="sresce" to="srest će" />
+		<Word from="srešce" to="srest će" />
+		<Word from="srljas" to="srljaš" />
+		<Word from="Sta" to="Što" />
+		<Word from="sta" to="što" />
+		<Word from="stab" to="stožer" />
+		<Word from="Stab" to="Stožer" />
+		<Word from="stagod" to="što god" />
+		<Word from="stampa" to="tisak" />
+		<Word from="stampati" to="tiskati" />
+		<Word from="stampi" to="tisku" />
+		<Word from="stampom" to="tiskom" />
+		<Word from="stampu" to="tisak" />
+		<Word from="standa" to="štanda" />
+		<Word from="standu" to="štandu" />
+		<Word from="stavis" to="staviš" />
+		<Word from="Stavise" to="Štoviše" />
+		<Word from="Stavićemo" to="Stavit ćemo" />
+		<Word from="steceni" to="stečeni" />
+		<Word from="stezuci" to="stežući" />
+		<Word from="stici" to="stići" />
+		<Word from="stojis" to="stojiš" />
+		<Word from="Stojis" to="Stojiš" />
+		<Word from="stp" to="što" />
+		<Word from="strasan" to="strašan" />
+		<Word from="strasno" to="strašno" />
+		<Word from="sudeci" to="sudeći" />
+		<Word from="sudenja" to="suđenja" />
+		<Word from="sudenje" to="suđenje" />
+		<Word from="sudenju" to="suđenju" />
+		<Word from="sugerisu" to="predlažu" />
+		<Word from="sumnjas" to="sumnjaš" />
+		<Word from="sumska" to="šumska" />
+		<Word from="sumski" to="šumski" />
+		<Word from="sumskoj" to="šumskoj" />
+		<Word from="supak" to="šupak" />
+		<Word from="suraduj" to="surađuj" />
+		<Word from="suraduje" to="surađuje" />
+		<Word from="suradujemo" to="surađujemo" />
+		<Word from="suraduju" to="surađuju" />
+		<Word from="Suraduj" to="Surađuj" />
+		<Word from="Suraduje" to="Surađuje" />
+		<Word from="Suradujemo" to="Surađujemo" />
+		<Word from="Suraduju" to="Surađuju" />
+		<Word from="sustina" to="bit" />
+	    	<Word from="sustine" to="biti" />
+    		<Word from="sustini" to="biti" />
+    		<Word from="Sustine" to="Biti" />
+    		<Word from="Sustini" to="Biti" />
+    		<Word from="Sustinom" to="Biti" />
+    		<Word from="sustinom" to="biti" />
+		<Word from="sustinski" to="bitni" />
+		<Word from="suti" to="šuti" />
+		<Word from="Suti" to="Šuti" />
+		<Word from="svacije" to="svačije" />
+		<Word from="svaciji" to="svačiji" />
+		<Word from="svaciju" to="svačiju" />
+		<Word from="svecan" to="svečan" />
+		<Word from="svecani" to="svečani" />
+		<Word from="svez" to="svjež" />
+    		<Word from="sveza" to="svježa" />
+    		<Word from="svezu" to="svježu" />
+    		<Word from="svezi" to="svježi" />
+    		<Word from="sveze" to="svježe" />
+    		<Word from="svezim" to="svježim" />
+    		<Word from="svezom" to="svježom" />
+    		<Word from="svezoj" to="svježoj" />
+    		<Word from="svezinom" to="svježinom" />
+    		<Word from="svezina" to="svježina" />
+    		<Word from="svezinu" to="svježinu" />
+    		<Word from="svezini" to="svježini" />
+    		<Word from="svezine" to="svježine" />
+		<Word from="Svida" to="Sviđa" />
+		<Word from="svidala" to="sviđala" />
+		<Word from="svidalo" to="sviđalo" />
+		<Word from="svidam" to="sviđam" />
+		<Word from="svidao" to="sviđao" />
+		<Word from="sviras" to="sviraš" />
+		<!--t-->
+		<Word from="taknes" to="takneš" />
+		<Word from="takode" to="također" />
+		<Word from="takoder" to="također" />
+		<Word from="takodje" to="također" />
+		<Word from="Takodje" to="Također" />
+		<Word from="tece" to="teče" />
+		<Word from="teska" to="teška" />
+		<Word from="Teska" to="Teška" />
+		<Word from="teske" to="teške" />
+		<Word from="teski" to="teški" />
+		<Word from="tesko" to="teško" />
+		<Word from="Tesko" to="Teško" />
+		<Word from="teskom" to="teškom" />
+		<Word from="tezak" to="težak" />
+		<Word from="Tezak" to="Težak" />
+		<Word from="teze" to="teže" />
+		<Word from="tezi" to="teži" />
+		<Word from="Tezi" to="Teži" />
+		<Word from="tezimo" to="težimo" />
+		<Word from="Tezimo" to="Težimo" />
+		<Word from="tezinu" to="težinu" />
+		<Word from="tezis" to="težiš" />
+		<Word from="Teziš" to="Težiš" />
+		<Word from="tisuce" to="tisuće" />
+		<Word from="tisucu" to="tisuću" />
+		<Word from="Tocak" to="Kotač" />
+		<Word from="tocak" to="kotač" />
+		<Word from="tocka" to="točka" />
+		<Word from="tocku" to="točku" />
+		<Word from="trajace" to="trajat će" />
+		<Word from="Trajace" to="Trajat će" />
+		<Word from="trazis" to="tražiš" />
+		<Word from="trcao" to="trčao" />
+		<Word from="trce" to="trče" />
+		<Word from="Trce" to="Trče" />
+		<Word from="trci" to="trči" />
+		<Word from="Trci" to="Trči" />
+		<Word from="trcim" to="trčim" />
+		<Word from="Trcim" to="Trčim" />
+		<Word from="trcimo" to="trčimo" />
+		<Word from="trebas" to="trebaš" />
+		<Word from="Trebas" to="Trebaš" />
+		<Word from="treci" to="treći" />
+		<Word from="tricarija" to="tričarija" />
+		<Word from="trudis" to="trudiš" />
+		<Word from="trunuce" to="trunut će" />
+		<Word from="tuce" to="tuče" />
+		<Word from="tuces" to="tučeš" />
+		<Word from="tucom" to="tučom" />
+		<Word from="tucu" to="tučnjavu" />
+		<Word from="tudje" to="tuđe" />
+		<Word from="tudjeg" to="tuđeg" />
+		<Word from="tudoj" to="tuđoj" />
+		<Word from="tudom" to="tuđom" />
+		<Word from="tudjem" to="tuđem" />
+		<Word from="tudem" to="tuđem" />
+		<Word from="tumaras" to="tumaraš" />
+		<Word from="tvoris" to="tvoriš" />
+		<!--u-->
+		<Word from="ubedjuju" to="uvjeravaju" />
+		<Word from="ubijes" to="ubiješ" />
+		<Word from="Ubijes" to="Ubiješ" />
+		<Word from="uceni" to="učeni" />
+		<Word from="uci" to="ući" />
+		<Word from="ucine" to="učine" />
+		<Word from="ucinimo" to="učinimo" />
+		<Word from="ucinio" to="učinio" />
+		<Word from="ucio" to="učio" />
+		<Word from="Ucio" to="Učio" />
+		<Word from="udas" to="udaš" />
+		<Word from="udete" to="uđete" />
+		<Word from="udeš" to="udeš" />
+		<Word from="udi" to="uđi" />
+		<Word from="Udi" to="Uđi" />
+		<Word from="Udje" to="Uđe" />
+		<Word from="udje" to="uđe" />
+		<Word from="udjes" to="uđeš" />
+		<Word from="ugriscu" to="ugrist ću" />
+		<Word from="ukljestena" to="ukliještena" />
+		<Word from="ukljucujuci" to="uključujući" />
+		<Word from="umes" to="umiješ" />
+		<Word from="umiruci" to="umirući" />
+		<Word from="umrecu" to="umrijet ću" />
+		<Word from="umres" to="umreš" />
+		<Word from="unistice" to="uništit će" />
+		<Word from="uopce" to="uopće" />
+		<Word from="Uopce" to="Uopće" />
+		<Word from="Uopste" to="Uopće" />
+		<Word from="uopste" to="uopće" />
+		<Word from="upoznas" to="upoznaš" />
+		<Word from="uradis" to="učiniš" />
+		<Word from="usao" to="ušao" />
+		<Word from="Usao" to="Ušao" />
+		<Word from="usli" to="ušli" />
+		<Word from="Usmjerice" to="Usmjerit će" />
+		<Word from="uspanicio" to="uspaničio" />
+		<Word from="utapas" to="utapaš" />
+		<Word from="utesi" to="utješi" />
+		<Word from="utesim" to="utješim" />
+		<Word from="uzinu" to="užinu" />
+		<Word from="uzivo" to="uživo" />
+		<!--v-->
+		<Word from="valda" to="valjda" />
+		<Word from="vasa" to="vaša" />
+		<Word from="vaseg" to="vašeg" />
+		<Word from="Vaseg" to="Vašeg" />
+		<Word from="vasem" to="vašem" />
+		<Word from="vasi" to="vaši" />
+		<Word from="vasoj" to="vašoj" />
+		<Word from="vazi" to="vrijedi" />
+		<Word from="Vec" to="Već" />
+		<Word from="vec" to="već" />
+		<Word from="vecan" to="vječan" />
+		<Word from="vecera" to="večera" />
+		<Word from="Veceras" to="Večeras" />
+		<Word from="veceras" to="večeras" />
+		<Word from="vecere" to="večere" />
+		<Word from="veceri" to="večeri" />
+		<Word from="veceru" to="večeru" />
+		<Word from="vecih" to="većih" />
+		<Word from="vecitim" to="vječitim" />
+		<Word from="vecna" to="vječna" />
+		<Word from="vecno" to="vječno" />
+		<Word from="vecnost" to="vječnost" />
+		<Word from="verovacu" to="vjerovat ću" />
+		<Word from="vice" to="viče" />
+		<Word from="vicem" to="vičem" />
+		<Word from="vicemo" to="vičemo" />
+		<Word from="vices" to="vičeš" />
+		<Word from="vicete" to="vičete" />
+		<Word from="viden" to="viđen" />
+		<Word from="Viden" to="Viđen" />
+		<Word from="vishe" to="više" />
+		<Word from="vjencali" to="vjenčali" />
+		<Word from="vjencati" to="vjenčati" />
+		<Word from="vjerujes" to="vjeruješ" />
+		<Word from="Vjerujes" to="Vjeruješ" />
+		<Word from="vjetrenjace" to="vjetrenjače" />
+		<Word from="voce" to="voće" />
+		<Word from="vocka" to="voćka" />
+		<Word from="vocku" to="voćku" />
+		<Word from="vocnjak" to="voćnjak" />
+		<Word from="vocnjaku" to="voćnjaku" />
+		<Word from="vodic" to="vodič" />
+		<Word from="vodju" to="vođu" />
+		<Word from="vozac" to="vozač" />
+		<Word from="Vozac" to="Vozač" />
+		<Word from="vozaca" to="vozača" />
+		<Word from="vracam" to="vraćam" />
+		<Word from="vracen" to="vračen" />
+		<Word from="vrazja" to="vražja" />
+		<Word from="vrazji" to="vražji" />
+		<Word from="vreca" to="vreča" />
+		<Word from="vrece" to="vreće" />
+		<Word from="vrecu" to="vreću" />
+		<Word from="vredja" to="vrijeđa" />
+		<Word from="vredjanje" to="vrijeđanje" />
+		<Word from="vrtic" to="vrtić" />
+		<Word from="vrtica" to="vrtića" />
+		<Word from="vrticu" to="vrtiću" />
+		<!--z-->
+		<Word from="zacepe" to="začepe" />
+		<Word from="Zacepi" to="Začepi" />
+		<Word from="Zadrzi" to="Zadrži" />
+		<Word from="zadrzi" to="zadrži" />
+		<Word from="zaduzen" to="zadužen" />
+		<Word from="Zaduzen" to="Zadužen" />
+		<Word from="zagrlis" to="zagrliš" />
+		<Word from="zaljenja" to="žaljenja" />
+		<Word from="zaljenje" to="žaljenje" />
+		<Word from="zalosna" to="žalosna" />
+		<Word from="Zalosna" to="Žalosna" />
+		<Word from="zaokruzi" to="zaokruži" />
+		<Word from="zaokruzim" to="zaokružim" />
+		<Word from="zaokruzimo" to="zaokružimo" />
+		<Word from="zapoceli" to="započeli" />
+		<Word from="zarucen" to="zaručen" />
+		<Word from="zasto" to="zašto" />
+		<Word from="Zasto" to="Zašto" />
+		<Word from="zateci" to="zateći" />
+		<Word from="zatvoris" to="zatvoriš" />
+		<Word from="zdrebe" to="ždrijebe" />
+		<Word from="Zele" to="Žele" />
+		<Word from="zele" to="žele" />
+		<Word from="Zeleci" to="Želeći" />
+		<Word from="zelila" to="željela" />
+		<Word from="Zelis" to="Želiš" />
+		<Word from="zelis" to="želiš" />
+		<Word from="zene" to="žene" />
+		<Word from="zenke" to="ženke" />
+		<Word from="zesce" to="žešće" />
+		<Word from="zezas" to="zezaš" />
+		<Word from="zita" to="žita" />
+		<Word from="zito" to="žito" />
+		<Word from="zitu" to="žitu" />
+		<Word from="ziv" to="živ" />
+		<Word from="ziva" to="živa" />
+		<Word from="zive" to="žive" />
+		<Word from="zivi" to="živi" />
+		<Word from="zivis" to="živiš" />
+		<Word from="zivjeo" to="živio" />
+		<Word from="Zivjeo" to="Živio" />
+		<Word from="zmureo" to="žmirio" />
+		<Word from="znacaj" to="značaj" />
+		<Word from="znacaja" to="značaja" />
+		<Word from="znace" to="znače" />
+		<Word from="znaceš" to="znat ćeš" />
+		<Word from="znas" to="znaš" />
+		<Word from="Znas" to="Znaš" />
+		<Word from="zuris" to="zuriš" />
+		<Word from="zutoj" to="žutoj" /> 
+		<Word from="zvanican" to="služben" />
+		<Word from="ćes" to="ćeš" />
+		<Word from="ćte" to="ćete" />
+		<Word from="Čime" to="Čime" />
+		<Word from="želis" to="želiš" />
+		<Word from="Živeo" to="Živio" />
+	</WholeWords>
+	<PartialWordsAlways />
+	<PartialWords />
+	<PartialLines>
+		<LinePart from="da nadjem" to="naći" />
+		<LinePart from="da nadjes" to="naći" />
+		<LinePart from="da budes" to="biti" />
+		<LinePart from="da ides" to="ići" />
+		<LinePart from="da prodemo" to="proći" />
+		<LinePart from="da udem" to="ući" />
+		<LinePart from="gdje ides" to="kamo ideš" />
+		<LinePart from="Gdje ides" to="Kamo ideš" />
+		<LinePart from="hocu da budem" to="želim biti" />
+		<LinePart from="Hocu da budem" to="Želim biti" />
+		<LinePart from="hocu da kazem" to="želim reći" />
+		<LinePart from="hoces da kazes" to="želiš reći" />
+		<LinePart from="hoce da kaze" to="želi reći" />
+		<LinePart from="kao sto sam" to="kao što sam" />
+		<LinePart from="me leda" to="me leđa" />
+		<LinePart from="medu nama" to="među nama" />
+		<LinePart from="moramo da idemo" to="moramo ići" />
+		<LinePart from="moras da ides" to="moraš ići" />
+		<LinePart from="na vecer" to="navečer" />
+		<LinePart from="Na vecer" to="Navečer" />
+		<LinePart from="ne cu" to="neću" />
+		<LinePart from="ne ces" to="nećeš" />
+		<LinePart  from="nešto sto"  to="nešto što"/>
+		<LinePart from="ono sto" to="ono što" />
+		<LinePart from="Ono sto" to="Ono što" />
+		<LinePart from="reci ću" to="reći ću" />
+		<LinePart from="sto ti se ne" to="što ti se ne" />
+		<LinePart from="sto vise" to="što više" />
+		<LinePart from="sve sto" to="sve što" />
+		<LinePart from="Zao mi" to="Žao mi" />
+		<LinePart from="zao mi" to="žao mi" />
+		<LinePart from="Zato sto" to="Zato što" />
+		<LinePart from="zato sto" to="zato što" />
+		<LinePart from="znas sto" to="znaš što" />
+		<LinePart from="znaš sto" to="znaš što" />
+	</PartialLines>
+	<PartialLinesAlways />
+	<BeginLines />
+	<EndLines />
+	<WholeLines />
+	<RegularExpressions>
+		<RegEx find="adas(?!v)" replaceWith="adaš" />
+		<RegEx find="(?&lt;![Pp]r|[Nn])adje(?!(v|n(e|u[olt]))\b)" replaceWith="ađe" />
+		<RegEx find="ajuc" replaceWith="ajuć" />
+		<RegEx find="ndj?el" replaceWith="nđel" />
+		<RegEx find="(?&lt;![ou])ndje" replaceWith="nđe" />
+		<RegEx find="([0-9])-ogodisnj([aeiu])\b" replaceWith="$1-godišnj$2" />
+		<RegEx find="(cetr|pet|ses)najst([aeiou]|i[mh]|o[mgj]|ima)\b" replaceWith="$1naest$2" />
+		<RegEx find="ajsmijesnij" replaceWith="ajsmješnij" />
+		<RegEx find="avljas" replaceWith="avljaš" />
+		<RegEx find="bastensk" replaceWith="vrtn" />
+		<RegEx find="beres" replaceWith="bereš" />
+		<RegEx find="([bB])elesk" replaceWith="$1ilješk" />
+		<RegEx find="([bB])elez" replaceWith="$1iljež" />
+		<RegEx find="\b([bBpP])ice(s|mo|te)\b" replaceWith="$1it će$2" />
+		<RegEx find="\b([bBpP])iti +c([ue]s?|emo|ete)\b" replaceWith="$1it ć$2" />
+		<RegEx find="eznadez" replaceWith="eznad" />
+		<RegEx find="([bB])ezanj" replaceWith="$1ježanj" />
+		<RegEx find="([bB])i?j?ez([ei]|i[ms]|imo|ite|ao|al[aeio]|ati)\b" replaceWith="$1jež$2" />
+		<RegEx find="boljs" replaceWith="boljš" />
+		<RegEx find="([bB])oric" replaceWith="$1orit ć" />
+		<RegEx find="([bB])ozij" replaceWith="$1ožj" />
+		<RegEx find="[bB]o[zž]ic([aeiun]|em|ima)?\b" replaceWith="Božić$1" />
+		<RegEx find="udu[cč]" replaceWith="uduć" />
+		<RegEx find="([cCsS])vj?ec([aeiou]|[oe]m|ama)\b" replaceWith="$1vijeć$2" />
+		<RegEx find="[Cc]acka" replaceWith="čačka" />
+		<RegEx find="[cC]amac" replaceWith="čamac" />
+		<RegEx find="[cC]amc" replaceWith="čamc" />
+		<RegEx find="\bcaro" replaceWith="čaro" />
+		<RegEx find="Caroli(?!n)" replaceWith="Čaroli" />
+		<RegEx find="cast" replaceWith="čast" />
+		<RegEx find="Cast" replaceWith="Čast" />
+		<RegEx find="cas([au]|om|ovima)\b" replaceWith="sat$1" />
+		<RegEx find="Cas([au]|om|ovima)\b" replaceWith="Sat$1" />
+		<RegEx find="[cC]ascen" replaceWith="čašćen" />
+		<RegEx find="[cC]ek" replaceWith="ček" />
+		<RegEx find="[cC]ekov" replaceWith="čekov" />
+		<RegEx find="[cC]etvrt" replaceWith="četvrt" />
+		<RegEx find="cetv" replaceWith="četv" />
+		<RegEx find="Cetv" replaceWith="Četv" />
+		<RegEx find="[cC]ist" replaceWith="čist" />
+		<RegEx find="[cC]isce" replaceWith="čišće" />
+		<RegEx find="[cC]ita" replaceWith="čita" />
+		<RegEx find="\bcin" replaceWith="čin" />
+		<RegEx find="\bCin" replaceWith="Čin" />
+		<RegEx find="[cCČč]istoc" replaceWith="čistoć" />
+		<RegEx find="[cC]lan" replaceWith="član" />
+		<RegEx find="[cC]okolad" replaceWith="čokolad" />
+		<RegEx find="[cC]ovi?j?ek" replaceWith="čovjek" />
+		<RegEx find="[cC]uda" replaceWith="čuda" />
+		<RegEx find="[cC]udes" replaceWith="čudes" />
+		<RegEx find="[cC]udn" replaceWith="čudn" />
+		<RegEx find="[cCČč]udovi[sš]" replaceWith="čudoviš" />
+		<RegEx find="\b[cC]uje" replaceWith="čuje" />
+		<RegEx find="(?&lt;!a)cuje" replaceWith="čuje" />
+		<RegEx find="[cC]u([vl])a" replaceWith="ču$1a" />
+		<RegEx find="cut([ei])" replaceWith="šut$1" />
+		<RegEx find="Cut([ei])" replaceWith="Šut$1" />
+		<RegEx find="cuta([ltšv])" replaceWith="šutje$1" />
+		<RegEx find="Cuta([ltšv])" replaceWith="Šutje$1" />
+		<RegEx find="[cC]vrst" replaceWith="čvrst" />
+		<RegEx find="\b([dD])ac([eu])" replaceWith="$1at ć$2" />
+		<RegEx find="dj?avol" replaceWith="vrag" />
+		<RegEx find="([Dd])eck" replaceWith="$1ečk" />
+		<RegEx find="vojcic" replaceWith="vojčic" />
+		<RegEx find="\b([dD])elic" replaceWith="$1jelić" />
+		<RegEx find="\b([dD])elimc" replaceWith="$1jelić" />
+		<RegEx find="\b([dD])j?elis\b" replaceWith="$1ijeliš" />
+		<RegEx find="\b([dD])ecic([aeiou]|om)\b" replaceWith="$1ječic$2" />
+		<RegEx find="([dD])j?eca([kc])" replaceWith="$1ječa$2" />
+		<RegEx find="([dD])eci?j([aeiou])" replaceWith="$1ječj$2" />
+		<RegEx find="\b([dD])esic" replaceWith="$1ogodit ć" />
+		<RegEx find="dnoslj" replaceWith="dnošlj" />
+		<RegEx find="\b([dD])omac" replaceWith="$1omać" />
+		<RegEx find="([ao])gada" replaceWith="$1gađa" />
+		<RegEx find="saduj" replaceWith="sađuj" />
+		<RegEx find="\b([dD])rustv" replaceWith="$1ruštv" />
+		<RegEx find="drzim" replaceWith="držim" />
+		<RegEx find="([dD])o[bc]ic([eu])" replaceWith="$1oći ć$2" />
+		<RegEx find="\b([dDpP])o(d?)nj?ec([eu])" replaceWith="$1o$2nijet ć$3" />
+		<RegEx find="ovesc([eu])" replaceWith="ovest ć$1" />
+		<RegEx find="\bd[jz]ep" replaceWith="džep" />
+		<RegEx find="\bD[jz]ep" replaceWith="Džep" />
+		<!-- posao i pošao je drugačije pa ne može biti uopće u skripti -->
+		<RegEx find="([dD])osl([aio])\b" replaceWith="$1ošl$2" />
+		<RegEx find="([dD])rza(?!k)" replaceWith="$1rža" />
+		<RegEx find="druze" replaceWith="druže" />
+		<RegEx find="\b([dD])us" replaceWith="$1uš" />
+		<RegEx find="dzigeric" replaceWith="jetr" />
+		<RegEx find="Dzigeric" replaceWith="Jetr" />
+		<RegEx find="([dD])zinov" replaceWith="$1ivov" />
+		<RegEx find="gipcan" replaceWith="gipćan" />
+		<RegEx find="entise" replaceWith="entira" />
+		<RegEx find="onise" replaceWith="onira" />
+		<RegEx find="([gG])dj(?!e)" replaceWith="$1đ" />
+		<RegEx find="ledac" replaceWith="ledat ć" />
+		<RegEx find="([gG])oruc" replaceWith="$1oruć" />
+		<RegEx find="(?&lt;![pP])radj" replaceWith="rađ" />
+		<RegEx find="\b([gG])rijesn" replaceWith="$1rješn" />
+		<RegEx find="([gG])rj?esi([smotl])" replaceWith="$1riješi$2" />
+		<RegEx find="([gG])reska" replaceWith="$1reška" />
+		<RegEx find="([hH])o[cč]e([sš]|mo|te)?\b" replaceWith="$1oće$2" />
+		<RegEx find="hri?scan" replaceWith="kršćan" />
+		<RegEx find="Hri?scan" replaceWith="Kršćan" />
+		<RegEx find="hronicn" replaceWith="kroničn" />
+		<RegEx find="Hronicn" replaceWith="Kroničn" />
+		<RegEx find="ijeci([lt])" replaceWith="iječi$1" />
+		<RegEx find="gnorise" replaceWith="gnorira" />
+		<RegEx find="gnori[sš]e[sš]" replaceWith="gnoriraš" />
+		<RegEx find="\b([iI])mac([eu]|es|emo|ete)\b" replaceWith="$1mat ć$2" />
+		<RegEx find="\b([iI])mas" replaceWith="$1maš" />
+		<RegEx find="nsistirac" replaceWith="nzistirat ć" />
+		<RegEx find="([iI])zadj" replaceWith="$1zađ" />
+		<RegEx find="zbec" replaceWith="zbjeć" />
+		<RegEx find="nadj?en" replaceWith="nađen" />
+		<RegEx find="([iI])scezn" replaceWith="$1ščezn" />
+		<RegEx find="(?&lt;![ŠšSs])([Pp])rica" replaceWith="$1riča" />
+		<RegEx find="([iI])znj?ec" replaceWith="$1znijet ć" />
+		<RegEx find="zvesta" replaceWith="zvješta" />
+		<RegEx find="jevandjelj" replaceWith="evanđelj" />
+		<RegEx find="kasi[kc]" replaceWith="žlic" />
+		<RegEx find="Kasi[kc]" replaceWith="Žlic" />
+		<RegEx find="([kKLl])aze([mt])" replaceWith="$1aže$2" />
+		<RegEx find="([kKLl])aze[sš]" replaceWith="$1ažeš" />
+		<RegEx find="aznjava" replaceWith="ažnjava" />
+		<RegEx find="kcerk[eio]" replaceWith="kćeri" />
+		<RegEx find="Kcerk[eio]" replaceWith="Kćeri" />
+		<RegEx find="kljuc" replaceWith="ključ" />
+		<RegEx find="oledz" replaceWith="oledž" />
+		<RegEx find="\b([kK])olicin" replaceWith="$1oličin" />
+		<RegEx find="arise" replaceWith="ira" />
+		<RegEx find="komsijsk" replaceWith="susjedn" />
+		<RegEx find="onacn" replaceWith="onačn" />
+		<RegEx find="centrise" replaceWith="centrira" />
+		<RegEx find="centrisi" replaceWith="centriraj" />
+		<RegEx find="trolise" replaceWith="trolira" />
+		<RegEx find="([kK])ori[sš][tc]en" replaceWith="$1orišten" />
+		<RegEx find="([kKTtSs])rece" replaceWith="$1reće" />
+		<RegEx find="rivicn" replaceWith="aznen" />
+		<RegEx find="krsten" replaceWith="kršten" />
+		<RegEx find="([kK])uck" replaceWith="$1uj" />
+		<RegEx find="([kK])uc([iueo]|no)" replaceWith="$1uć$2" />
+		<RegEx find="kupic" replaceWith="kupit ć" />
+		<RegEx find="\b([kK])rstask([aeiou]|om)?\b" replaceWith="$1rižarsk$2" />
+		<RegEx find="\b([lL])j?eci([stol])?" replaceWith="$1iječi$2" />
+		<RegEx find="([lL])j?ecni([kc])" replaceWith="$1iječni$2" />
+		<RegEx find="\b([lL])j?ecen" replaceWith="$1iječen" />
+		<RegEx find="\b([lL])aks" replaceWith="$1akš" />
+		<RegEx find="laksava" replaceWith="akšava" />
+		<RegEx find="([lL])eps" replaceWith="$1jepš" />
+		<RegEx find="[lL]isce" replaceWith="lišće" />
+		<RegEx find="([lL])ogic(?!i)" replaceWith="$1ogič" />
+		<RegEx find="\blicn" replaceWith="osobn" />
+		<RegEx find="\bLicn" replaceWith="Osobn" />
+		<RegEx find="\b([lL])os([aeiu]|o[mj]|e[mg])" replaceWith="$1oš$2" />
+		<RegEx find="udack([aeiou]|om)\b" replaceWith="uđa$1" />
+		<RegEx find="mack" replaceWith="mačk" />
+		<RegEx find="(?&lt;![iI]|[kK]a)([mM])j?enjas\b" replaceWith="$1ijenjaš" />
+		<RegEx find="([mM])ast([auoi](?!r))" replaceWith="$1ašt$2" />
+		<!--** besmislicu ?**-->
+		<RegEx find="([mM])islic([eu])" replaceWith="$1islit ć$2" />
+		<RegEx find="mislje" replaceWith="mišlje" />
+		<RegEx find="([mM])j?esalic" replaceWith="$1iješalic" />
+		<RegEx find="([mM])j?esa([jmns]|n[aio]|no[mgj]|nima?|mo|ju|njem|nju|l[aeio]|t[ei])\b" replaceWith="$1iješa$2" />
+		<RegEx find="([mM])lj?ecn" replaceWith="$1liječn" />
+		<RegEx find="\b([mMNn])oc([iuna])" replaceWith="$1oć$2" />
+		<RegEx find="oguc" replaceWith="oguć" />
+		<RegEx find="([mM])oras" replaceWith="$1oraš" />
+		<RegEx find="([mM])orac([eu])" replaceWith="$1orat ć$2" />
+		<RegEx find="otivise([mst])" replaceWith="otivira$1" />
+		<RegEx find="medju" replaceWith="među" />
+		<RegEx find="mjestaj" replaceWith="mještaj" />
+		<RegEx find="([mMbB])oze" replaceWith="$1ože" />
+		<RegEx find="([mM])o[zž]es" replaceWith="$1ožeš" />
+		<RegEx find="([mM])racn" replaceWith="$1račn" />
+		<RegEx find="([mM])rznj" replaceWith="$1ržnj" />
+		<RegEx find="rzec" replaceWith="rzit ć" />
+		<RegEx find="([mM])uci([mstol])" replaceWith="$1uči$2" />
+		<RegEx find="uskar" replaceWith="uškar" />
+		<RegEx find="uvas" replaceWith="otaš" />
+		<RegEx find="muzick" replaceWith="glazben" />
+		<RegEx find="Muzick" replaceWith="Glazben" />
+		<RegEx find="([nNZz])acel" replaceWith="$1ačel" />
+		<RegEx find="([nN])acin" replaceWith="$1ačin" />
+		<RegEx find="(?&lt;![iI])([nN])acic" replaceWith="$1aći ć" />
+		<RegEx find="adji" replaceWith="ađi" />
+		<RegEx find="aocit" replaceWith="aočit" />
+		<RegEx find="avas" replaceWith="avaš" />
+		<RegEx find="amj?enis" replaceWith="amijeniš" />
+		<RegEx find="amesta" replaceWith="amješta" />
+		<RegEx find="aocar(?!k)" replaceWith="aočal" />
+		<RegEx find="(?&lt;![[tT])apise" replaceWith="apiše" />
+		<RegEx find="([nN])as([io])([mj])\b" replaceWith="$1aš$2" />
+		<RegEx find="([nNvV])asi([mh])" replaceWith="$1aši$2" />
+		<RegEx find="([nN])auci([mstl])" replaceWith="$1auči$2" />
+		<RegEx find="(?&lt;![[pP])aucic" replaceWith="aučit ć" />
+		<RegEx find="naucn" replaceWith="znanstven" />
+		<RegEx find="Naucn" replaceWith="Znanstven" />
+		<RegEx find="([nN])a?zvac" replaceWith="$1azvat ć" />
+		<RegEx find="([nN])eca([kc])" replaceWith="$1eća$2" />
+		<RegEx find="\b([nN])ec([ue]|emo|ete)\b" replaceWith="$1eć$2" />
+		<RegEx find="([Nn])eda[cč]" replaceWith="$1edać" />
+		<RegEx find="(?&lt;!j)emack" replaceWith="jemačk" />
+		<RegEx find="rj?esen" replaceWith="riješen" />
+		<RegEx find="eutralis[eu]" replaceWith="eutralizira" />
+		    <!-- ne diraj -->
+		<RegEx find="\b([nN])ista" replaceWith="$1išta" />
+		<RegEx find="\b([nN])oc" replaceWith="$1oć" />
+		<RegEx find="ovcan" replaceWith="ovčan" />
+		<RegEx find="notez" replaceWith="notež" />
+		<RegEx find="beca" replaceWith="beća" />
+		<RegEx find="besen" replaceWith="bješen" />
+		<RegEx find="bezbj?edjenj" replaceWith="siguranj" />
+		<RegEx find="bezbj?edjivanj" replaceWith="siguravanj" />
+		<RegEx find="bezbj?edjuje" replaceWith="sigurava" />
+		<RegEx find="bidj" replaceWith="biđ" />
+		<RegEx find="bicn" replaceWith="bičn" />
+		<RegEx find="bozava" replaceWith="božava" />
+		<RegEx find="([oO])brac(?!u)" replaceWith="$1brać" />
+		<RegEx find="([oO])bracu" replaceWith="$1braču" />
+		<RegEx find="bucen" replaceWith="bučen" />
+		<RegEx find="\b([oO])caj" replaceWith="$1čaj" />
+		<RegEx find="\b([oO])cev" replaceWith="$1čev" />
+		<RegEx find="([oO])cek" replaceWith="$1ček" />
+		<RegEx find="\b([oO])ci" replaceWith="$1či" />
+		<RegEx find="dbacen" replaceWith="dbačen" />
+		<RegEx find="([oO])dl([iu])can" replaceWith="$1dl$2can" />
+		<RegEx find="\b([oO])dj?ec([aeiou]|om)" replaceWith="$1djeć$2" />
+		<RegEx find="\b((?:[oO]|[pP]o|[rR]a|[sS]a)d?)sec" replaceWith="$1sjeć" />
+		<RegEx find="dvesc([eu])" replaceWith="dvest ć$1" />
+		<RegEx find="gadj?a" replaceWith="gađa" />
+		<RegEx find="onizav" replaceWith="onižav" />
+		<RegEx find="\b([oO])pci(?!j)" replaceWith="$1pći" />
+		<RegEx find="rosti[cć]" replaceWith="rostit ć" />
+		<RegEx find="ruzj" replaceWith="ružj" />
+		<RegEx find="([oO])sj?e[cč]a" replaceWith="$1sjeća" />
+		<RegEx find="slobodić" replaceWith="slobodit ć" />
+		<RegEx find="([oO])sta[čć]([eu])" replaceWith="$1stat ć$2" />
+		<RegEx find="([oO])svj?ez" replaceWith="$1svjež" />
+		<RegEx find="tkri[cč]" replaceWith="tkrić" />
+		<RegEx find="([oOSs])tici" replaceWith="$1tići" />
+		<RegEx find="([oO])tis([al])" replaceWith="$1tiš$2" />
+		<RegEx find="zledjen" replaceWith="zlijeđen" />
+		<RegEx find="pam[cč]" replaceWith="pamć" />
+		<RegEx find="([pP])az([nl])j" replaceWith="$1až$2j" />
+		<RegEx find="\b([pP])j?es[cć]an" replaceWith="$1ješčan" />
+		<RegEx find="([pP])esa([kc])" replaceWith="$1ješa$2" />
+		<RegEx find="([pP](?:ita|lati|obrinu|okaza|oveza|rica))c" replaceWith="$1t ć" />
+		<RegEx find="istolj" replaceWith="ištolj" />
+		<RegEx find="isuc" replaceWith="išuć" />
+		<RegEx find="pjevas" replaceWith="pjevaš" />
+		<RegEx find="([pP])lasi([mslt])" replaceWith="$1laši$2" />
+		<RegEx find="([pP])lace([sn])" replaceWith="$1laće$2" />
+		<RegEx find="(?&lt;![mM])ljacka" replaceWith="ljačka" />
+		<RegEx find="prica" replaceWith="priča" />
+		<RegEx find="([pP])obj?ec" replaceWith="$1objeć" />
+		<RegEx find="objedis" replaceWith="obijediš" />
+		<RegEx find="obacaj" replaceWith="obačaj" />
+		<RegEx find="([pP])oce([tl])" replaceWith="$1oče$2" />
+		<RegEx find="([pPTt])ocn" replaceWith="$1očn" />
+		<RegEx find="\b([pP])o[dt]sj?etis?\b" replaceWith="$1odsjetiš" />
+		<RegEx find="oducava" replaceWith="odučava" />
+		<RegEx find="([pP])ogres" replaceWith="$1ogreš" />
+		<RegEx find="([pP])ogrj?esi(o|l[aeio]|t[ei])?\b" replaceWith="$1ogriješi$2" />
+		<RegEx find="okusa([jov])" replaceWith="okuša$1" />
+		<RegEx find="([pP])omoc" replaceWith="$1omoć" />
+		<RegEx find="([pP]o|[Ii]z)ludec" replaceWith="$1ludjet ć" />
+		<RegEx find="([pP])onasa" replaceWith="$1onaša" />
+		<RegEx find="porodicn" replaceWith="obiteljsk" />
+		<RegEx find="Porodicn" replaceWith="Obiteljsk" />
+		<RegEx find="([pP])os([lt])ac" replaceWith="$1os$2at ć" />
+		<RegEx find="osten" replaceWith="ošten" />
+		<RegEx find="(?&lt;![gG])ostuje" replaceWith="oštuje" />
+		<RegEx find="([pP])ostova" replaceWith="$1oštova" />
+		<RegEx find="ovredj?en" replaceWith="ovrijeđen" />
+		<RegEx find="([ao])vrj?edis" replaceWith="$1vrijediš" />
+		<RegEx find="pozoris" replaceWith="kazališ" />
+		<RegEx find="Pozoris" replaceWith="Kazališ" />
+		<RegEx find="ozuri" replaceWith="ožuri" />
+		<RegEx find="redjas" replaceWith="rijaš" />
+		<RegEx find="redlaz" replaceWith="redlaž" />
+		<RegEx find="(?&lt;![Šš])([pP])rica" replaceWith="$1riča" />
+		<RegEx find="rilicn" replaceWith="riličn" />
+		<RegEx find="romj?enis" replaceWith="romijeniš" />
+		<RegEx find="([pP](?:ri|od))sj?eca" replaceWith="$1sjeća" />
+		<RegEx find="rosj?ec" replaceWith="rosječ" />
+		<RegEx find="roslost" replaceWith="rošlost" />
+		<RegEx find="([pP]r?[io])vesc" replaceWith="$1vest ć" />
+		<RegEx find="rolec" replaceWith="roljeć" />
+		<RegEx find="romj?eniš" replaceWith="romijeniš" />
+		<RegEx find="ronac" replaceWith="ronać" />
+		<RegEx find="([pP])ruzi([lt])" replaceWith="$1ruži$2" />
+		<RegEx find="acun" replaceWith="ačun" />
+		<RegEx find="azlicit" replaceWith="azličit" />
+		<RegEx find="mislja" replaceWith="mišlja" />
+		<RegEx find="azumijec" replaceWith="azumjeć" />
+		<RegEx find="(?&lt;!v)ecenic" replaceWith="ečenic" />
+		<RegEx find="ecic" replaceWith="eći ć" />
+		<RegEx find="rivlac" replaceWith="rivlač" />
+		<RegEx find="([^d])rjesit" replaceWith="$1riješit" />
+		<RegEx find="\b([rR])i?j?esava" replaceWith="$1ješava" />
+		<RegEx find="([rR])i?j?esenj([aeiu])" replaceWith="$1ješenj$2" />
+		<RegEx find="\b([rR])jec(i|ima)?\b" replaceWith="$1iječ$2" />
+		<RegEx find="\b([rR])i?j?ecni([kc])" replaceWith="$1ječni$2" />
+		<RegEx find="(?&lt;!t)rocit" replaceWith="ročit" />
+		<RegEx find="([dDrRvVg])odje" replaceWith="$1ođe" />
+		<RegEx find="(?&lt;![Cc])ucak" replaceWith="učak" />
+		<RegEx find="ruce" replaceWith="ruče" />
+		<RegEx find="rucio" replaceWith="ručio" />
+		<RegEx find="arud[zž]bin" replaceWith="arudžb" />
+		<RegEx find="([rR])uck([auo])" replaceWith="$1učk$2" />
+		<RegEx find="\b([Rr])uca([lt])" replaceWith="$1uča$2" />
+		<RegEx find="saceka" replaceWith="pričeka" />
+		<RegEx find="Saceka" replaceWith="Pričeka" />
+		<RegEx find="sagarep" replaceWith="mrkv" />
+		<RegEx find="Sagarep" replaceWith="Mrkv" />
+		<RegEx find="([sS])amoc" replaceWith="$1amoć" />
+		<RegEx find="[sS]ans" replaceWith="šans" />
+		<RegEx find="([sS])alj([eu])" replaceWith="$1alj$2" />
+		<RegEx find="saobracaj(?!ac)" replaceWith="promet" />
+		<RegEx find="Saobracaj(?!ac)" replaceWith="Promet" />
+		<RegEx find="aosj?e[cč]a" replaceWith="uosjeća" />
+		<RegEx find="aucesni([kc])" replaceWith="udioni$1" />
+		<RegEx find="([sSZZ])avrs([ei])" replaceWith="$1avrš$2" />
+		<RegEx find="azvac" replaceWith="azvat ć" />
+		<RegEx find="azalj?eva" replaceWith="ažalijeva" />
+		<RegEx find="\b([sS])eca([msšo]|mo|t[ei]|ju|l[aeio]|nj[aeu]|njem?)?\b" replaceWith="$1jeća$2" />
+		<RegEx find="([sSŠš])ecer" replaceWith="šećer" />
+		<RegEx find="([sS])edec" replaceWith="$1jedit ć" />
+		<RegEx find="i[cč]u[sš]" replaceWith="ićuš" />
+		<RegEx find="([sS])isark" replaceWith="češer" />
+		<RegEx find="([sS])koci" replaceWith="$1koči" />
+		<RegEx find="\b[sS]kol(?!a)" replaceWith="škol" />
+		<RegEx find="([sS])li?j?ede[cč]" replaceWith="$1ljedeć" />
+		<RegEx find="(?&lt;!r)icn" replaceWith="ičn" />
+		<RegEx find="([sS])lucaj" replaceWith="$1lučaj" />
+		<RegEx find="([sS])lusa" replaceWith="$1luša" />
+		<RegEx find="([sS])luz([eb])" replaceWith="$1luž$2" />
+		<RegEx find="\b([sS])j?eca[sš]\b" replaceWith="$1jećaš" />
+		<RegEx find="\b([sS])mj?es(n[aeiou]|no[mgj])\b" replaceWith="$1miješ$2" />
+		<RegEx find="mestis" replaceWith="mjestiš" />
+		<RegEx find="([sS])nazn" replaceWith="$1nažn" />
+		<RegEx find="nizen" replaceWith="nižen" />
+		<RegEx find="([sS])okira" replaceWith="šokira" />
+		<RegEx find="spoljasnj?([aeiu])" replaceWith="vanjsk$1" />
+		<RegEx find="Spoljasnj?([aeiu])" replaceWith="Vanjsk$1" />
+		<RegEx find="pri?j?ecava" replaceWith="prječava" />
+		<RegEx find="prj?ec([ei])" replaceWith="priječ$1" />
+		<RegEx find="rdac" replaceWith="rdač" />
+		<RegEx find="([sS])rec([aeiou])" replaceWith="$1reć$2" />
+		<RegEx find="([sS])rec(a?)n" replaceWith="$1ret$2n" />
+		<RegEx find="spijun" replaceWith="špijun" />
+		<RegEx find="Spijun" replaceWith="Špijun" />
+		<RegEx find="([sS])rusi" replaceWith="$1ruši" />
+		<RegEx find="\b([sS])tac([eu])" replaceWith="$1tat ć$2" />
+		<RegEx find="stanes" replaceWith="staneš" />
+		<RegEx find="stomac" replaceWith="trbuš" />
+		<RegEx find="Stomac" replaceWith="Trbuš" />
+		<RegEx find="strasi" replaceWith="straši" />
+		<RegEx find="trucn" replaceWith="tručn" />
+		<RegEx find="sugerise" replaceWith="predlaže" />
+		<RegEx find="Sugerise" replaceWith="Predlaže" />
+		<RegEx find="vesteni([kc])" replaceWith="većeni$1" />
+		<RegEx find="([Ss])olj" replaceWith="šalic" />
+		<RegEx find="\bSpanij" replaceWith="Španjolsk" />
+		<RegEx find="\bSpansk" replaceWith="Španjolsk" />
+		<RegEx find="stabl" replaceWith="stožer" />
+		<RegEx find="Stabl" replaceWith="Stožer" />
+		<RegEx find="stamparsk" replaceWith="tiskovn" />
+		<RegEx find="Stamparsk" replaceWith="Tiskovn" />
+		<RegEx find="[sš]ticen" replaceWith="štićen" />
+		<RegEx find="stedj?e" replaceWith="štedje" />
+		<RegEx find="sicen" replaceWith="sićen" />
+		<RegEx find="eskoc" replaceWith="eškoć" />
+		<RegEx find="([sS])tize" replaceWith="$1tiže" />
+		<RegEx find="uoci" replaceWith="uoči" />
+		<RegEx find="\b([sS])uti" replaceWith="$1uti" />
+		<RegEx find="([sS])vjez" replaceWith="$1vjež" />
+		<RegEx find="resu([ct])" replaceWith="rešu$1" />
+		<RegEx find="([DRVdrvg])odja" replaceWith="$1ođa" />
+		<RegEx find="([sS])veći" replaceWith="$1vijeći" />
+		<RegEx find="takmicenj" replaceWith="natjecanj" />
+		<RegEx find="Takmicenj" replaceWith="Natjecanj" />
+		<RegEx find="\b([tT])ac([an])" replaceWith="$1oč$2" />    
+		<RegEx find="ehnic(?!i)" replaceWith="ehnič" />
+		<RegEx find="\b([tT])ice" replaceWith="$1iče" />
+		<RegEx find="\b([tTSs])rcan" replaceWith="$1rčan" />
+		<RegEx find="\b([tT])re[čc]in" replaceWith="$1rećin" />
+		<RegEx find="\b([tTDd])rzis" replaceWith="$1ržiš" />
+		<RegEx find="\b([tT])isin" replaceWith="$1išin" />
+		<RegEx find="\b([tT])is([aeiu]|om|e[mg])\b" replaceWith="$1iš$2" />
+		<RegEx find="\b([tT])raz([ei])" replaceWith="$1raž$2" />
+		<RegEx find="\b([nN])etac([an])" replaceWith="$1etoč$2" />
+		<RegEx find="\b([uU])cenj" replaceWith="$1čenj" />
+		<RegEx find="\b([uU])ci([mntl])" replaceWith="$1či$2" />
+		<RegEx find="([uU])ci([lt])" replaceWith="$1či$2" />
+		<RegEx find="paljac" replaceWith="paljač" />
+		<RegEx find="\b([uU])redj" replaceWith="$1ređ" />
+		<RegEx find="([uU])spjes(an|n[aeiou]|no[mgj])" replaceWith="$1spješ$2" />
+		<RegEx find="\b([uU])dje([mst])" replaceWith="$1đe$2" />
+		<RegEx find="\b([uU])sl([aeio])" replaceWith="$1šl$2" />
+		<RegEx find="\b([uU])zas(?!t)" replaceWith="$1žas" />
+		<RegEx find="\b([uU])zec([eu])" replaceWith="$1zet ć$2" />
+		<RegEx find="\b([uU])zmes" replaceWith="$1zmeš" />
+		<RegEx find="\b([uU])ziva" replaceWith="$1živa" />
+		<RegEx find="([vV])as([aeu]|o[jm])\b" replaceWith="$1aš$2" />
+		<RegEx find="([vV]l?)azn([aeiu]|o[mgj])\b" replaceWith="$1ažn$2" />
+		<RegEx find="([vV])ecn" replaceWith="$1ječn" />
+		<RegEx find="([vV])e[cč]in" replaceWith="$1ećin" />
+		<RegEx find="([vV])estin" replaceWith="$1ještin" />
+		<RegEx find="elicin" replaceWith="eličin" />
+		<RegEx find="\b([vV])i?j?enca" replaceWith="$1jenča" />
+		<RegEx find="([vV])j?ezb" replaceWith="$1ježb" />
+		<RegEx find="([vV])idj?ec" replaceWith="$1idjet ć" />
+		<RegEx find="(?&lt;!Da)([vV])idj?a" replaceWith="$1iđa" />
+		<RegEx find="([vV])idis" replaceWith="$1idiš" />
+		<RegEx find="\b([vV])ec([aeiu]|[ei]m|ima|o[mj])?\b" replaceWith="$1eć$2" />
+		<!--pro/do/raz vezeš-->
+		<RegEx find="eze[sš]" replaceWith="ezeš" />
+		<RegEx find="\b([vV])ise" replaceWith="$1iše" />
+		<RegEx find="\b([vV])islj" replaceWith="$1iš" />
+		<RegEx find="odj?enj(?!a[kc])" replaceWith="ođenj" />
+		<RegEx find="([vV])olis" replaceWith="$1oliš" />
+		<RegEx find="([vV])olj?ec" replaceWith="$1oljet ć" />
+		<RegEx find="\b([vV])ozic([eu])" replaceWith="$1ozit ć$2" />
+		<RegEx find="([vV])rac" replaceWith="$1rač" />
+		<RegEx find="vrsen" replaceWith="vršen" />
+		<RegEx find="\b([vV])ratic" replaceWith="$1ratit ć" />
+		<RegEx find="zalost" replaceWith="žalost" />
+		<RegEx find="zalosno" replaceWith="žalosno" />
+		<RegEx find="zalosni" replaceWith="žalosni" />
+		<RegEx find="zalosc" replaceWith="žalošć" />
+		<RegEx find="gorca" replaceWith="gorča" />
+		<RegEx find="ahtj?evas" replaceWith="ahtijevaš" />
+		<RegEx find="\bz([ae])li" replaceWith="ž$1li" />
+		<RegEx find="\bZ([ae])li" replaceWith="Ž$1li" />
+		<RegEx find="[zZ]alic" replaceWith="žalit ć" />
+		<RegEx find="apo[cč]mi" replaceWith="apočni" />
+		<RegEx find="asluzuj" replaceWith="aslužuj" />
+		<RegEx find="([zZ])astit" replaceWith="$1aštit" />
+		<RegEx find="astrasujuc" replaceWith="astrašujuć" />
+		<RegEx find="[zZ]edn" replaceWith="žedn" />
+		<RegEx find="\b[zZ]en([aeui]|om|io|il[aei]|sk)" replaceWith="žen$1" />
+		<RegEx find="[zZ]eli([mt])" replaceWith="želi$1" />
+		<RegEx find="[zZ]ele([ltz])" replaceWith="želje$1" />
+		<RegEx find="[zZ]elil" replaceWith="željel" />
+		<RegEx find="[zZ]eli[sš]" replaceWith="želiš" />
+		<!-- zaželio && poželio  -->
+		<RegEx find="[zZ]elj?eo" replaceWith="želio" />
+		<RegEx find="[zZ]elj([aeiou])" replaceWith="želj$1" />
+		<RegEx find="\b[zZ]ive([lt])" replaceWith="živje$1" />
+		<RegEx find="[zZ]ivec([eu])" replaceWith="živjet ć$1" />
+		<RegEx find="([žŽ])ive([lt])" replaceWith="$1ivje$2" />
+		<RegEx find="[zZ]ivi([mšt])" replaceWith="živi$1" />
+		<RegEx find="\b[zZ]ivo([mgjt])" replaceWith="živo$1" />
+		<RegEx find="[zZ]lj?ezd([aeiou])" replaceWith="žlijezd$1" />
+		<RegEx find="\b([zZ])locin" replaceWith="$1ločin" />
+		<RegEx find="([Zz])naci" replaceWith="$1nači" />
+		<RegEx find="znajes" replaceWith="znaješ" />
+		<RegEx find="([Zz])r?tv" replaceWith="žrtv" />
+		<RegEx find="zur[ck]" replaceWith="zabav" />
+		<RegEx find="Zur[ck]" replaceWith="Zabav" />
+		<RegEx find="zvanicn" replaceWith="služben" />
+		<RegEx find="Zvanicn" replaceWith="Služben" />
+		<RegEx find="([zZ])vuca([lto])" replaceWith="$1vuča$2" />
+		<RegEx find="\b([zZ])vuci" replaceWith="$1vuči" />
+		<!-- yxy experimental -->
+		<RegEx find="acic" replaceWith="ačic" />
+		<RegEx find="([aeiou])s([čć])" replaceWith="$1š$2" />
+		<RegEx find="bracun" replaceWith="bračun" />
+		<RegEx find="cupa" replaceWith="čupa" />
+		<RegEx find="dajes" replaceWith="daješ" />
+		<RegEx find="rosj?ecn" replaceWith="rosječn" />
+		<RegEx find="([Rr])odj?en" replaceWith="$1ođen" />
+		<RegEx find="jacanj" replaceWith="jačanj" />
+		<RegEx find="zvecark" replaceWith="zvečark" />
+		<RegEx find="locest" replaceWith="ločest" />
+		<RegEx find="icn" replaceWith="ičn" />
+		<RegEx find="zidem" replaceWith="ziđem" />
+		<RegEx find="zludu" replaceWith="zluđu" />
+		<RegEx find="zopacen" replaceWith="zopačen" />
+		<RegEx find="eskuc" replaceWith="eskuć" />
+		<RegEx find="([aez])vrsi" replaceWith="$1vrši" />
+		<RegEx find="acma" replaceWith="ačma" />
+		<RegEx find="aces" replaceWith="aćeš" />
+		<RegEx find="ajvec" replaceWith="ajveć" />
+		<RegEx find="amcen" replaceWith="amčen" />
+		<RegEx find="antic([nk])" replaceWith="antič$1" />
+		<RegEx find="aredu?j" replaceWith="aređ" />
+		<RegEx find="arezlj" replaceWith="arežlj" />
+		<RegEx find="aruci" replaceWith="aruči" />
+		<RegEx find="avlac" replaceWith="avlač" />
+		<RegEx find="azoc" replaceWith="azoč" />
+		<RegEx find="bacen" replaceWith="bačen" />
+		<RegEx find="bicaj" replaceWith="bičaj" />
+		<RegEx find="bivse" replaceWith="bivše" />
+		<RegEx find="blizn" replaceWith="bližn" />
+		<RegEx find="buden" replaceWith="buđen" />
+		<RegEx find="cemo" replaceWith="ćemo" />
+		<RegEx find="ucestvuj" replaceWith="sudjeluj" />
+		<RegEx find="cinje" replaceWith="činje" />
+		<RegEx find="[Cc]injen" replaceWith="činjen" />
+		<RegEx find="cisc" replaceWith="čišć" />
+		<RegEx find="Cisc" replaceWith="Čišć" />
+		<RegEx find="dacn" replaceWith="dačn" />
+		<RegEx find="daces" replaceWith="dat ćeš" />
+		<RegEx find="dinacn" replaceWith="dinačn" />
+		<RegEx find="dlucn" replaceWith="dlučn" />
+		<RegEx find="dlucuj" replaceWith="dlučuj" />
+		<RegEx find="djem" replaceWith="đem" />
+		<RegEx find="djit" replaceWith="đit" />
+		<RegEx find="djuj" replaceWith="đuj" />
+		<RegEx find="djujes" replaceWith="đuješ" />
+		<RegEx find="draz([ao])" replaceWith="draž$1" />
+		<RegEx find="(?&lt;!a)druzi" replaceWith="druži" />
+		<RegEx find="([dD])rzi([ia](?!k))" replaceWith="$1rž$2" />
+		<RegEx find="e[cć]as" replaceWith="ećaš" />
+		<RegEx find="emo[zž]e" replaceWith="e može" />
+		<RegEx find="(?&lt;![Rr])eces" replaceWith="ećeš" />
+		<RegEx find="emoz" replaceWith="e mož" />
+		<RegEx find="enadjen" replaceWith="enađen" />
+		<RegEx find="erisu" replaceWith="eriraju" />
+		<RegEx find="esavin" replaceWith="ešavin" />
+		<RegEx find="estace[sš]" replaceWith="estat ćeš" />
+		<RegEx find="ezoc" replaceWith="ezoč" />
+		<RegEx find="fise" replaceWith="fira" />
+		<RegEx find="frick" replaceWith="fričk" />
+		<!-- popravlja i iz/nad/gledaš -->
+		<RegEx find="gledas" replaceWith="gledaš" />
+		<RegEx find="granicava" replaceWith="graničava" />
+		<RegEx find="grisc(?!i)" replaceWith="grist ć" />
+		<RegEx find="guslj" replaceWith="gušlj" />
+		<RegEx find="gusi" replaceWith="guši" />
+		<RegEx find="(?&lt;!\b[oO]zlo|\b[iI]sp(rip)?ov|i)jedjen" replaceWith="ijeđen" />
+		<RegEx find="hic(k|en)" replaceWith="hić$1" />
+		<RegEx find="hva[cč]a" replaceWith="hvaća" />
+		<RegEx find="hva[cč]as" replaceWith="hvaćaš" />
+		<RegEx find="hva([lt])is" replaceWith="hva$1iš" />
+		<RegEx find="(?&lt;![Gg]r|[Ll])icka" replaceWith="ička" />
+		<RegEx find="(?&lt;!M)ick([eoiu])" replaceWith="ičk$1" />
+		<RegEx find="idja" replaceWith="iđa" />
+		<RegEx find="idje([mv])" replaceWith="iđe$1" />
+		<RegEx find="igrac" replaceWith="igrač" />
+		<RegEx find="igraca" replaceWith="igrača" />
+		<RegEx find="igrace" replaceWith="igrače" />
+		<RegEx find="igraci" replaceWith="igrači" />
+		<RegEx find="igracu" replaceWith="igraču" />
+		<RegEx find="igraliste" replaceWith="igraliste" />
+		<RegEx find="igralistu" replaceWith="igralistu" />
+		<RegEx find="igralista" replaceWith="igralista" />
+		<RegEx find="iznervira" replaceWith="iživcira" />
+		<RegEx find="asnjav" replaceWith="ašnjav" />
+		<RegEx find="jasnic([eu])" replaceWith="jasnit ć$1" />
+		<RegEx find="juci" replaceWith="jući" />
+		<RegEx find="kaslja" replaceWith="kašlja" />
+		<RegEx find="krsi" replaceWith="krši" />
+		<RegEx find="kruze" replaceWith="kruže" />
+		<RegEx find="kusava" replaceWith="kušava" />
+		<RegEx find="lican" replaceWith="ličan" />
+		<RegEx find="lacen" replaceWith="lačen" />
+		<RegEx find="l([ae])dj" replaceWith="l$1đ" />
+		<RegEx find="mj?ecen" replaceWith="mjećen" />
+		<RegEx find="([mv])edje" replaceWith="$1eđe" />
+		<RegEx find="miruce" replaceWith="miruće" />
+		<RegEx find="mec([eu])" replaceWith="meć$1" />
+		<RegEx find="mrsav" replaceWith="mršav" />
+		<RegEx find="naranc" replaceWith="naranč" />
+		<RegEx find="nacenj" replaceWith="načenj" />
+		<RegEx find="(?&lt;![Rr]evo)lucio" replaceWith="lučio" />
+		<RegEx find="(?&lt;!sit)nisem" replaceWith="niram" />
+		<RegEx find="(?&lt;!sit)nises" replaceWith="niraš" />
+		<RegEx find="([lrvn])adj" replaceWith="$1ađ" />
+		<RegEx find="nise" replaceWith="nira" />
+		<RegEx find="nisten" replaceWith="ništen" />
+		<RegEx find="(?&lt;![Ee]t|[Gg]e|[Rr]i|[Tt]am)noc" replaceWith="noć" />
+		<RegEx find="oceju" replaceWith="oće" />
+		<RegEx find="oceo" replaceWith="očeo" />
+		<RegEx find="ocni" replaceWith="očni" />
+		<RegEx find="o([mk])aze" replaceWith="o$1aže" />
+		<RegEx find="/\bni[cć]k" replaceWith="ničk" />
+		<RegEx find="nosc" replaceWith="nošć" />
+		<RegEx find="sta([jn])es" replaceWith="sta$1eš" />
+		<RegEx find="(?&lt;!m)oroca" replaceWith="oroča" />
+		<RegEx find="osvece" replaceWith="osveće" />
+		<RegEx find="oti[cć]n" replaceWith="otičn" />
+		<RegEx find="ozen" replaceWith="ožen" />
+		<RegEx find="pecific" replaceWith="pecifič" />
+		<RegEx find="plase" replaceWith="plaše" />
+		<RegEx find="ptuz" replaceWith="ptuž" />
+		<RegEx find="pustaj" replaceWith="puštaj" />
+		<RegEx find="pustas" replaceWith="puštaš" />
+		<RegEx find="pusten" replaceWith="pušten" />
+		<RegEx find="racen" replaceWith="raćen" />
+		<RegEx find="([auogz])raduj" replaceWith="$1rađuj" />
+		<RegEx find="reden" replaceWith="ređen" />
+		<RegEx find="redoce" replaceWith="redoče" />
+		<RegEx find="rucin" replaceWith="rućin" />
+		<RegEx find="([lr])adj" replaceWith="$1ađ" />
+		<RegEx find="redje([nm])" replaceWith="ređe$1" />
+		<RegEx find="ronad" replaceWith="ronađ" />
+		<RegEx find="([KkPp])renes\b" replaceWith="$1reneš" />
+		<RegEx find="sapni" replaceWith="šapni" />
+		<RegEx find="setnj" replaceWith="šetnj" />
+		<RegEx find="slusa" replaceWith="sluša" />
+		<RegEx find="slusk" replaceWith="slušk" />
+		<RegEx find="slj?edece" replaceWith="sljedeće" />
+		<RegEx find="spesn" replaceWith="spješn" />
+		<RegEx find="splac" replaceWith="splač" />
+		<RegEx find="stand(?!a)" replaceWith="štand" />
+		<RegEx find="sudj?en" replaceWith="suđen" />
+		<RegEx find="tace" replaceWith="tat će" />
+		<RegEx find="tces" replaceWith="t ćeš" />
+		<RegEx find="teza([kv])" replaceWith="teža$1" />
+		<RegEx find="tjesi" replaceWith="tješi" />
+		<RegEx find="tocis" replaceWith="točiš" />
+		<RegEx find="trazi([vo])" replaceWith="traži$1" />
+		<RegEx find="trazuj" replaceWith="tražuj" />
+		<RegEx find="trise" replaceWith="trira" />
+		<RegEx find="trisi" replaceWith="triraj" />
+		<RegEx find="tros([ek])" replaceWith="troš$1" />
+		<RegEx find="tumaci" replaceWith="tumači" />
+		<RegEx find="\b([DdtTRrNn])uzn" replaceWith="$1užn" />
+		<RegEx find="\b([dtDTRr])uzan" replaceWith="$1užan" />
+		<RegEx find="vrdj" replaceWith="vrđ" />
+		<RegEx find="tvrden" replaceWith="tvrđen" />
+		<RegEx find="\bujes\b" replaceWith="uješ" />
+		<RegEx find="\bzes\b" replaceWith="žeš" />
+		<RegEx find="ucis" replaceWith="učiš" />
+		<RegEx find="ucice" replaceWith="učit će" />
+		<RegEx find="(?&lt;![Kk]lj)učiće" replaceWith="učit će" />
+		<RegEx find="udiva" replaceWith="uđiva" />
+		<RegEx find="udj([aiu])" replaceWith="uđ$1" />
+		<RegEx find="([Uu])nisti" replaceWith="$1ništi" />
+		<RegEx find="nistav" replaceWith="ništav" />
+		<!--busenje je iznimka, ali bušenje nije, dakle češća riječ prevladava-->
+		<RegEx find="(?&lt;![jk])us[cč]" replaceWith="ušć" />
+		<RegEx find="usenj" replaceWith="ušenj" />
+		<RegEx find="uspece" replaceWith="uspjet će" />
+		<RegEx find="varas" replaceWith="varaš" />
+		<RegEx find="vazn" replaceWith="važn" />
+		<RegEx find="vadj" replaceWith="vađ" />
+		<RegEx find="visis" replaceWith="visiš" />
+		<RegEx find="([Vv])jecn" replaceWith="$1ječn" />
+		<RegEx find="vjezb" replaceWith="vježb" />
+		<RegEx find="(?&lt;!p)rsten" replaceWith="ršten" />
+		<RegEx find="vruc" replaceWith="vruć" />
+		<!-- izvuče // razvuče  // podvuče etc. -->
+		<RegEx find="vuce" replaceWith="vuče" />
+		<RegEx find="\b([Sso])naci" replaceWith="$1naći" />
+		<RegEx find="edjen" replaceWith="eđen" />
+		<RegEx find="ziljk" replaceWith="žiljk" />
+		<RegEx find="zitk" replaceWith="žitk" />
+		<RegEx find="zgajivac" replaceWith="zgajivač" />
+		<RegEx find="zogira" replaceWith="žogira" />
+		<!-- preživeo/doživeo/nadživeo etc. -->
+		<RegEx find="zivj?e([lt])i" replaceWith="živje$1i" />
+		<RegEx find="ziveo" replaceWith="živio" />
+		<!-- pozoveš nazoveš sazoveš -->
+		<RegEx find="zoves" replaceWith="zoveš" />
+		<RegEx find="zurb" replaceWith="žurb" />
+		<RegEx find="Zurb" replaceWith="Žurb" />
+		<RegEx find="zvucen" replaceWith="zvučen" />
+	</RegularExpressions>
+</OCRFixReplaceList>
diff --git a/libs/subzero/modification/dictionaries/xml/dan_OCRFixReplaceList.xml b/libs/subzero/modification/dictionaries/xml/dan_OCRFixReplaceList.xml
new file mode 100644
index 000000000..2135ce878
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/xml/dan_OCRFixReplaceList.xml
@@ -0,0 +1,642 @@
+<OCRFixReplaceList>
+  <WholeWords>
+    <Word from="Haner" to="Han er" />
+    <Word from="JaveL" to="Javel" />
+    <Word from="Pa//e" to="Palle" />
+    <Word from="bffte" to="bitte" />
+    <Word from="Utro//gt" to="Utroligt" />
+    <Word from="Kommerdu" to="Kommer du" />
+    <Word from="smi/er" to="smiler" />
+    <Word from="/eg" to="leg" />
+    <Word from="harvinger" to="har vinger" />
+    <Word from="/et" to="let" />
+    <Word from="erjeres" to="er jeres" />
+    <Word from="hardet" to="har det" />
+    <Word from="tænktjer" to="tænkt jer" />
+    <Word from="erjo" to="er jo" />
+    <Word from="sti/" to="stil" />
+    <Word from="Iappe" to="lappe" />
+    <Word from="Beklagelç" to="Beklager," />
+    <Word from="vardet" to="var det" />
+    <Word from="afden" to="af den" />
+    <Word from="snupperjeg" to="snupper jeg" />
+    <Word from="ikkejeg" to="ikke jeg" />
+    <Word from="bliverjeg" to="bliver jeg" />
+    <Word from="hartravit" to="har travlt" />
+    <Word from="pandekagef/ag" to="pandekageflag" />
+    <Word from="Stormvarsell" to="Stormvarsel!" />
+    <Word from="stormvejn" to="stormvejr." />
+    <Word from="morgenkomp/et" to="morgenkomplet" />
+    <Word from="/yv" to="lyv" />
+    <Word from="varjo" to="var jo" />
+    <Word from="/eger" to="leger" />
+    <Word from="harjeg" to="har jeg" />
+    <Word from="havdejeg" to="havde jeg" />
+    <Word from="hvorjeg" to="hvor jeg" />
+    <Word from="nårjeg" to="når jeg" />
+    <Word from="gårvi" to="går vi" />
+    <Word from="atjeg" to="at jeg" />
+    <Word from="isine" to="i sine" />
+    <Word from="fårjeg" to="får jeg" />
+    <Word from="kærtighed" to="kærlighed" />
+    <Word from="skullejeg" to="skulle jeg" />
+    <Word from="laest" to="læst" />
+    <Word from="laese" to="læse" />
+    <Word from="gørjeg" to="gør jeg" />
+    <Word from="gørvi" to="gør vi" />
+    <Word from="angrerjo" to="angrer jo" />
+    <Word from="Hvergang" to="Hver gang" />
+    <Word from="erder" to="er der" />
+    <Word from="villetilgive" to="ville tilgive" />
+    <Word from="fieme" to="fjeme" />
+    <Word from="genopståri" to="genopstår i" />
+    <Word from="svigtejer" to="svigte jer" />
+    <Word from="kommernu" to="kommer nu" />
+    <Word from="nårman" to="når man" />
+    <Word from="erfire" to="er fire" />
+    <Word from="Hvorforfinderdu" to="Hvorfor finder du" />
+    <Word from="undertigt" to="underligt" />
+    <Word from="itroen" to="i troen" />
+    <Word from="erløgnt" to="er løgn!" />
+    <Word from="gørden" to="gør den" />
+    <Word from="forhelvede" to="for helvede" />
+    <Word from="hjpe" to="hjælpe" />
+    <Word from="togeti" to="toget i" />
+    <Word from="Måjeg" to="Må jeg" />
+    <Word from="savnerjer" to="savner jer" />
+    <Word from="erjeg" to="er jeg" />
+    <Word from="vaere" to="være" />
+    <Word from="geme" to="gerne" />
+    <Word from="trorpå" to="tror på" />
+    <Word from="forham" to="for ham" />
+    <Word from="afham" to="af ham" />
+    <Word from="harjo" to="har jo" />
+    <Word from="ovemafiet" to="overnattet" />
+    <Word from="begaefiighed" to="begærlighed" />
+    <Word from="sy’g" to="syg" />
+    <Word from="Imensjeg" to="Imens jeg" />
+    <Word from="bliverdu" to="bliver du" />
+    <Word from="fiser" to="fiser" />
+    <Word from="manipuierer" to="manipulerer" />
+    <Word from="forjeg" to="for jeg" />
+    <Word from="iivgivendefor" to="livgivende for" />
+    <Word from="formig" to="for mig" />
+    <Word from="Hardu" to="Har du" />
+    <Word from="fornold" to="forhold" />
+    <Word from="defrelste" to="de frelste" />
+    <Word from="Såjeg" to="Så jeg" />
+    <Word from="varjeg" to="var jeg" />
+    <Word from="gørved" to="gør ved" />
+    <Word from="kalderjeg" to="kalder jeg" />
+    <Word from="flytte" to="flytte" />
+    <Word from="handlerdet" to="handler det" />
+    <Word from="trorjeg" to="tror jeg" />
+    <Word from="flytter" to="flytter" />
+    <Word from="soverjeg" to="sover jeg" />
+    <Word from="finderud" to="finder ud" />
+    <Word from="naboerpå" to="naboer på" />
+    <Word from="ervildt" to="er vildt" />
+    <Word from="væreher" to="være her" />
+    <Word from="hyggerjer" to="hygger jer" />
+    <Word from="borjo" to="bor jo" />
+    <Word from="kommerikke" to="kommer ikke" />
+    <Word from="folkynde" to="forkynde" />
+    <Word from="farglad" to="far glad" />
+    <Word from="misterjeg" to="mister jeg" />
+    <Word from="fint" to="fint" />
+    <Word from="Harl" to="Har I" />
+    <Word from="bedejer" to="bede jer" />
+    <Word from="synesjeg" to="synes jeg" />
+    <Word from="vartil" to="var til" />
+    <Word from="eren" to="er en" />
+    <Word from="\Al" to="Vil" />
+    <Word from="\A" to="Vi" />
+    <Word from="fjeme" to="fjerne" />
+    <Word from="Iigefyldt" to="lige fyldt" />
+    <Word from="ertil" to="er til" />
+    <Word from="fafiigt" to="farligt" />
+    <Word from="finder" to="finder" />
+    <Word from="findes" to="findes" />
+    <Word from="irettesaefielse" to="irettesættelse" />
+    <Word from="ermed" to="er med" />
+    <Word from="èn" to="én" />
+    <Word from="gikjoi" to="gik jo i" />
+    <Word from="Hvisjeg" to="Hvis jeg" />
+    <Word from="ovemafier" to="overnatter" />
+    <Word from="hoident" to="holdent" />
+    <Word from="\Adne" to="Vidne" />
+    <Word from="fori" to="for i" />
+    <Word from="vei" to="vel" />
+    <Word from="savnerjerjo" to="savner jer jo" />
+    <Word from="elskerjer" to="elsker jer" />
+    <Word from="harløjet" to="har løjet" />
+    <Word from="eri" to="er i" />
+    <Word from="fiende" to="fjende" />
+    <Word from="derjo" to="der jo" />
+    <Word from="sigerjo" to="siger jo" />
+    <Word from="menerjeg" to="mener jeg" />
+    <Word from="Harjeg" to="Har jeg" />
+    <Word from="sigerjeg" to="siger jeg" />
+    <Word from="splitterjeg" to="splitter jeg" />
+    <Word from="erjournalist" to="er journalist" />
+    <Word from="erjoumalist" to="er journalist" />
+    <Word from="Forjeg" to="For jeg" />
+    <Word from="gârjeg" to="går jeg" />
+    <Word from="Nârjeg" to="Når jeg" />
+    <Word from="afllom" to="afkom" />
+    <Word from="farerjo" to="farer jo" />
+    <Word from="tagerjeg" to="tager jeg" />
+    <Word from="Virkerjeg" to="Virker jeg" />
+    <Word from="morerjer" to="morer jer" />
+    <Word from="kommerjo" to="kommer jo" />
+    <Word from="istand" to="i stand" />
+    <Word from="bøm" to="børn" />
+    <Word from="frygterjeg" to="frygter jeg" />
+    <Word from="kommerjeg" to="kommer jeg" />
+    <Word from="eriournalistelev" to="er journalistelev" />
+    <Word from="harfat" to="har fat" />
+    <Word from="fårfingre" to="får fingre" />
+    <Word from="slârjeg" to="slår jeg" />
+    <Word from="bam" to="barn" />
+    <Word from="erjournalistelev" to="er journalistelev" />
+    <Word from="politietjo" to="politiet jo" />
+    <Word from="elskerjo" to="elsker jo" />
+    <Word from="vari" to="var i" />
+    <Word from="fornemmerjeres" to="fornemmer jeres" />
+    <Word from="udklækketl" to="udklækket!" />
+    <Word from="í" to="i" />
+    <Word from="nyi" to="ny i" />
+    <Word from="Iumijelse" to="fornøjelse" />
+    <Word from="vures" to="vores" />
+    <Word from="I/Vashíngtan" to="Washington" />
+    <Word from="opleverjeg" to="oplever jeg" />
+    <Word from="PANTELÃNER" to="PANTELÅNER" />
+    <Word from="Gudmurgen" to="Godmorgen" />
+    <Word from="SKYDEVÃBEN" to="SKYDEVÅBEN" />
+    <Word from="PÃLIDELIG" to="PÅLIDELIG" />
+    <Word from="avertalte" to="overtalte" />
+    <Word from="Omsíder" to="Omsider" />
+    <Word from="lurtebåd" to="lortebåd" />
+    <Word from="Telrslning" to="Tekstning" />
+    <Word from="miUø" to="miljø" />
+    <Word from="gåri" to="går i" />
+    <Word from="Fan/el" to="Farvel" />
+    <Word from="abefiæs" to="abefjæs" />
+    <Word from="hartalt" to="har talt" />
+    <Word from="\Årkelig" to="Virkelig" />
+    <Word from="beklagerjeg" to="beklager jeg" />
+    <Word from="Nårjeg" to="Når jeg" />
+    <Word from="rnaend" to="mænd" />
+    <Word from="vaskebjorn" to="vaskebjørn" />
+    <Word from="Ivil" to="I vil" />
+    <Word from="besog" to="besøg" />
+    <Word from="Vaer" to="Vær" />
+    <Word from="Undersogte" to="Undersøgte" />
+    <Word from="modte" to="mødte" />
+    <Word from="toj" to="tøj" />
+    <Word from="fodt" to="født" />
+    <Word from="gore" to="gøre" />
+    <Word from="provede" to="prøvede" />
+    <Word from="forste" to="første" />
+    <Word from="igang" to="i gang" />
+    <Word from="ligenu" to="lige nu" />
+    <Word from="clet" to="det" />
+    <Word from="Strombell" to="Strombel!" />
+    <Word from="tmvlt" to="travlt" />
+    <Word from="studererjournalistik" to="studerer journalistik" />
+    <Word from="inforrnererjeg" to="informerer jeg" />
+    <Word from="omkfing" to="omkring" />
+    <Word from="tilAsgård" to="til Asgård" />
+    <Word from="Kederjeg" to="Keder jeg" />
+    <Word from="jaettetamp" to="jættetamp" />
+    <Word from="erjer" to="er jer" />
+    <Word from="atjulehygge" to="at julehygge" />
+    <Word from="Ueneste" to="tjeneste" />
+    <Word from="foltsaetter" to="fortsætter" />
+    <Word from="A/ice" to="Alice" />
+    <Word from="tvivlerjeg" to="tvivler jeg" />
+    <Word from="henterjer" to="henter jer" />
+    <Word from="forstårjeg" to="forstår jeg" />
+    <Word from="hvisjeg" to="hvis jeg" />
+    <Word from="/ært" to="lært" />
+    <Word from="vfgtrgt" to="vigtigt" />
+    <Word from="hurtigtjeg" to="hurtigt jeg" />
+    <Word from="kenderjo" to="kender jo" />
+    <Word from="seiv" to="selv" />
+    <Word from="/ægehuset" to="lægehuset" />
+    <Word from="herjo" to="her jo" />
+    <Word from="stolerjeg" to="stoler jeg" />
+    <Word from="digi" to="dig i" />
+    <Word from="taberi" to="taber i" />
+    <Word from="slårjeres" to="slår jeres" />
+    <Word from="laere" to="lære" />
+    <Word from="trænerwushu" to="træner wushu" />
+    <Word from="efterjeg" to="efter jeg" />
+    <Word from="efier" to="efter" />
+    <Word from="dui" to="du i" />
+    <Word from="afien" to="aften" />
+    <Word from="bliveri" to="bliver i" />
+    <Word from="acceptererjer" to="accepterer jer" />
+    <Word from="drikkerjo" to="drikker jo" />
+    <Word from="fianjin" to="Tianjin" />
+    <Word from="erlænge" to="er længe" />
+    <Word from="erikke" to="er ikke" />
+    <Word from="medjer" to="med jer" />
+    <Word from="Tmykke" to="Tillykke" />
+    <Word from="'fianjins" to="Tianjins" />
+    <Word from="Mesteri" to="Mester i" />
+    <Word from="sagdetil" to="sagde til" />
+    <Word from="indei" to="inde i" />
+    <Word from="ofie" to="ofte" />
+    <Word from="'filgiv" to="Tilgiv" />
+    <Word from="Lfår" to="I får" />
+    <Word from="viserjer" to="viser jer" />
+    <Word from="Rejsjerblot" to="Rejs jer blot" />
+    <Word from="'fillad" to="Tillad" />
+    <Word from="iiiiefinger" to="lillefinger" />
+    <Word from="VILOMFATTE" to="VIL OMFATTE" />
+    <Word from="mofio" to="motto" />
+    <Word from="gørjer" to="gør jer" />
+    <Word from="gifi" to="gift" />
+    <Word from="hardu" to="har du" />
+    <Word from="gifi" to="gift" />
+    <Word from="Iaeggerjeg" to="lægger jeg" />
+    <Word from="iet" to="i et" />
+    <Word from="sv/yte" to="svigte" />
+    <Word from="ti/" to="til" />
+    <Word from="Wdal" to="Vidal" />
+    <Word from="fiået" to="fået" />
+    <Word from="Hvo/for" to="Hvorfor" />
+    <Word from="hellerikke" to="heller ikke" />
+    <Word from="Wlle" to="Ville" />
+    <Word from="dr/ver" to="driver" />
+    <Word from="V\fllliam" to="William" />
+    <Word from="V\fllliams" to="Williams" />
+    <Word from="Vkfilliam" to="William" />
+    <Word from="vådejakke" to="våde jakke" />
+    <Word from="kæfll" to="kæft!" />
+    <Word from="sagdejeg" to="sagde jeg" />
+    <Word from="oven/ejet" to="overvejet" />
+    <Word from="karameisauce" to="karamelsauce" />
+    <Word from="Lfølgejødisk" to="Ifølge jødisk" />
+    <Word from="blevjo" to="blev jo" />
+    <Word from="asiateri" to="asiater i" />
+    <Word from="erV\fllliam" to="er William" />
+    <Word from="lidtflov" to="lidt flov" />
+    <Word from="sagdejo" to="sagde jo" />
+    <Word from="erlige" to="er lige" />
+    <Word from="Vtfilliam" to="William" />
+    <Word from="WfiII" to="Will" />
+    <Word from="afldarede" to="afklarede" />
+    <Word from="hjæiperjeg" to="hjælper jeg" />
+    <Word from="laderjeg" to="lader jeg" />
+    <Word from="Hândledsbeskyttere" to="Håndledsbeskyttere" />
+    <Word from="Lsabels" to="Isabels" />
+    <Word from="Gørjeg" to="Gør jeg" />
+    <Word from="mâjeg" to="må jeg" />
+    <Word from="ogjeg" to="og jeg" />
+    <Word from="gjordejeg" to="gjorde jeg" />
+    <Word from="villejeg" to="ville jeg" />
+    <Word from="Vlfllliams" to="Williams" />
+    <Word from="Dajeg" to="Da jeg" />
+    <Word from="iorden" to="i orden" />
+    <Word from="fandtjeg" to="fandt jeg" />
+    <Word from="Tilykke" to="Tillykke" />
+    <Word from="kørerjer" to="kører jer" />
+    <Word from="gøfjeg" to="gør jeg" />
+    <Word from="Selvflgelig" to="Selvfølgelig" />
+    <Word from="fdder" to="fadder" />
+    <Word from="bnfaldt" to="bønfaldt" />
+    <Word from="t\/ehovedede" to="tvehovedede" />
+    <Word from="EIler" to="Eller" />
+    <Word from="ringerjeg" to="ringer jeg" />
+    <Word from="blevvæk" to="blev væk" />
+    <Word from="stárjeg" to="står jeg" />
+    <Word from="varforbi" to="var forbi" />
+    <Word from="harfortalt" to="har fortalt" />
+    <Word from="iflere" to="i flere" />
+    <Word from="tørjeg" to="tør jeg" />
+    <Word from="kunnejeg" to="kunne jeg" />
+    <Word from="má" to="må" />
+    <Word from="hartænkt" to="har tænkt" />
+    <Word from="Fárjeg" to="Får jeg" />
+    <Word from="afdelingervar" to="afdelinger var" />
+    <Word from="0rd" to="ord" />
+    <Word from="pástá" to="påstå" />
+    <Word from="gráharet" to="gråharet" />
+    <Word from="varforbløffende" to="var forbløffende" />
+    <Word from="holdtjeg" to="holdt jeg" />
+    <Word from="hængerjo" to="hænger jo" />
+    <Word from="fikjeg" to="fik jeg" />
+    <Word from="fár" to="får" />
+    <Word from="Hvorforfølerjeg" to="Hvorfor føler jeg" />
+    <Word from="harfeber" to="har feber" />
+    <Word from="ándssvagt" to="åndssvagt" />
+    <Word from="0g" to="Og" />
+    <Word from="vartre" to="var tre" />
+    <Word from="abner" to="åbner" />
+    <Word from="garjeg" to="går jeg" />
+    <Word from="sertil" to="ser til" />
+    <Word from="hvorfin" to="hvor fin" />
+    <Word from="harfri" to="har fri" />
+    <Word from="forstarjeg" to="forstår jeg" />
+    <Word from="Sä" to="Så" />
+    <Word from="hvorfint" to="hvor fint" />
+    <Word from="mærkerjeg" to="mærker jeg" />
+    <Word from="ogsa" to="også" />
+    <Word from="nárjeg" to="når jeg" />
+    <Word from="Jasá" to="Jaså" />
+    <Word from="bándoptager" to="båndoptager" />
+    <Word from="bedárende" to="bedårende" />
+    <Word from="sá" to="så" />
+    <Word from="nár" to="når" />
+    <Word from="kunnejo" to="kunne jo" />
+    <Word from="Brammertil" to="Brammer til" />
+    <Word from="serjeg" to="ser jeg" />
+    <Word from="gikjeg" to="gik jeg" />
+    <Word from="udholderjeg" to="udholder jeg" />
+    <Word from="máneder" to="måneder" />
+    <Word from="vartræt" to="var træt" />
+    <Word from="dárligt" to="dårligt" />
+    <Word from="klaretjer" to="klaret jer" />
+    <Word from="pavirkelig" to="påvirkelig" />
+    <Word from="spekulererjeg" to="spekulerer jeg" />
+    <Word from="forsøgerjeg" to="forsøger jeg" />
+    <Word from="huskerjeg" to="husker jeg" />
+    <Word from="ifavnen" to="i favnen" />
+    <Word from="skullejo" to="skulle jo" />
+    <Word from="vartung" to="var tung" />
+    <Word from="varfuldstændig" to="var fuldstændig" />
+    <Word from="Paskedag" to="Påskedag" />
+    <Word from="turi" to="tur i" />
+    <Word from="spillerschumanns" to="spiller Schumanns" />
+    <Word from="forstárjeg" to="forstår jeg" />
+    <Word from="istedet" to="i stedet" />
+    <Word from="nárfrem" to="når frem" />
+    <Word from="habertrods" to="håber trods" />
+    <Word from="forførste" to="for første" />
+    <Word from="varto" to="var to" />
+    <Word from="overtil" to="over til" />
+    <Word from="forfem" to="for fem" />
+    <Word from="holdtjo" to="holdt jo" />
+    <Word from="passerjo" to="passer jo" />
+    <Word from="ellerto" to="eller to" />
+    <Word from="hartrods" to="har trods" />
+    <Word from="harfuldstændig" to="har fuldstændig" />
+    <Word from="gårjeg" to="går jeg" />
+    <Word from="giderjeg" to="gider jeg" />
+    <Word from="forjer" to="for jer" />
+    <Word from="erindrerjeg" to="erindrer jeg" />
+    <Word from="tænkerjeg" to="tænker jeg" />
+    <Word from="GAEt" to="GÅET" />
+    <Word from="hørerjo" to="hører jo" />
+    <Word from="forladerjeg" to="forlader jeg" />
+    <Word from="kosterjo" to="koster jo" />
+    <Word from="fortællerjeg" to="fortæller jeg" />
+    <Word from="Forstyrrerjeg" to="Forstyrrer jeg" />
+    <Word from="tjekkerjeg" to="tjekker jeg" />
+    <Word from="erjurist" to="er jurist" />
+    <Word from="tlLBUD" to="TILBUD" />
+    <Word from="serjo" to="se rjo" />
+    <Word from="bederjeg" to="beder jeg" />
+    <Word from="bilderjeg" to="bilder jeg" />
+    <Word from="ULVEtlME" to="ULVETlME" />
+    <Word from="skærerjo" to="skærer jo" />
+    <Word from="afjer" to="af jer" />
+    <Word from="ordnerjeg" to="ordner jeg" />
+    <Word from="giverjeg" to="giver jeg" />
+    <Word from="rejservi" to="rejser vi" />
+    <Word from="fangerjeg" to="fanger jeg" />
+    <Word from="erjaloux" to="er jaloux" />
+    <Word from="glemmerjeg" to="glemmer jeg" />
+    <Word from="Behøverjeg" to="Behøver jeg" />
+    <Word from="harvi" to="har vi" />
+    <Word from="ertyndere" to="er tyndere" />
+    <Word from="fårtordenvejr" to="får tordenvejr" />
+    <Word from="varfærdig" to="var færdig" />
+    <Word from="hørerfor" to="hører for" />
+    <Word from="varvel" to="var vel" />
+    <Word from="erforbi" to="er forbi" />
+    <Word from="AIle" to="Alle" />
+    <Word from="læserjo" to="læser jo" />
+    <Word from="Edgarer" to="Edgar er" />
+    <Word from="hartaget" to="har taget" />
+    <Word from="derer" to="der er" />
+    <Word from="stikkerfrem" to="stikker frem" />
+    <Word from="haraldrig" to="har aldrig" />
+    <Word from="ellerfar" to="eller far" />
+    <Word from="erat" to="er at" />
+    <Word from="turtil" to="tur til" />
+    <Word from="erfærdig" to="er færdig" />
+    <Word from="følerjeg" to="føler jeg" />
+    <Word from="jerfra" to="jer fra" />
+    <Word from="eralt" to="er alt" />
+    <Word from="harfaktisk" to="har faktisk" />
+    <Word from="harfundet" to="har fundet" />
+    <Word from="harvendt" to="har vendt" />
+    <Word from="Kunstneraf" to="Kunstner af" />
+    <Word from="ervel" to="er vel" />
+    <Word from="ståransigt" to="står ansigt" />
+    <Word from="Erjeg" to="Er jeg" />
+    <Word from="venterjeg" to="venter jeg" />
+    <Word from="Hvorvar" to="Hvor var" />
+    <Word from="varfint" to="var fint" />
+    <Word from="ervarmt" to="er varmt" />
+    <Word from="gårfint" to="går fint" />
+    <Word from="flyverforbi" to="flyver forbi" />
+    <Word from="Dervar" to="Der var" />
+    <Word from="dervar" to="der var" />
+    <Word from="meneråndeligt" to="mener åndeligt" />
+    <Word from="forat" to="for at" />
+    <Word from="herovertil" to="herover til" />
+    <Word from="soverfor" to="sover for" />
+    <Word from="begyndtejeg" to="begyndte jeg" />
+    <Word from="vendertilbage" to="vender tilbage" />
+    <Word from="erforfærdelig" to="er forfærdelig" />
+    <Word from="gøraltid" to="gør altid" />
+    <Word from="ertilbage" to="er tilbage" />
+    <Word from="harværet" to="har været" />
+    <Word from="bagoverellertil" to="bagover eller til" />
+    <Word from="hertaler" to="her taler" />
+    <Word from="vågnerjeg" to="vågner jeg" />
+    <Word from="vartomt" to="var tomt" />
+    <Word from="gårfrem" to="går frem" />
+    <Word from="talertil" to="taler til" />
+    <Word from="ertryg" to="er tryg" />
+    <Word from="ansigtervendes" to="ansigter vendes" />
+    <Word from="hervirkeligt" to="her virkeligt" />
+    <Word from="herer" to="her er" />
+    <Word from="drømmerjo" to="drømmer jo" />
+    <Word from="erfuldkommen" to="er fuldkommen" />
+    <Word from="hveren" to="hver en" />
+    <Word from="erfej" to="er fej" />
+    <Word from="datterforgæves" to="datter forgæves" />
+    <Word from="forsøgerjo" to="forsøger jo" />
+    <Word from="ertom" to="er tom" />
+    <Word from="vareftermiddag" to="var eftermiddag" />
+    <Word from="vartom" to="var tom" />
+    <Word from="angerellerforventninger" to="anger eller forventninger" />
+    <Word from="kørtejeg" to="kørte jeg" />
+    <Word from="Hvorforfortæller" to="Hvorfor fortæller" />
+    <Word from="gårtil" to="går til" />
+    <Word from="ringerefter" to="ringer efter" />
+    <Word from="søgertilflugt" to="søger tilflugt" />
+    <Word from="ertvunget" to="er tvunget" />
+    <Word from="megetjeg" to="meget jeg" />
+    <Word from="varikke" to="var ikke" />
+    <Word from="Derermange" to="Der e rmange" />
+    <Word from="dervilhindre" to="der vil hindre" />
+    <Word from="erså" to="er så" />
+    <Word from="DetforstårLeggodt" to="Det forstår jeg godt" />
+    <Word from="ergodt" to="er godt" />
+    <Word from="vorventen" to="vor venten" />
+    <Word from="tagerfejl" to="tager fejl" />
+    <Word from="ellerer" to="eller er" />
+    <Word from="laverjeg" to="laver jeg" />
+    <Word from="0mgang" to="omgang" />
+    <Word from="afstár" to="afstår" />
+    <Word from="pá" to="på" />
+    <Word from="rejserjeg" to="rejser jeg" />
+    <Word from="ellertage" to="eller tage" />
+    <Word from="takkerjeg" to="takker jeg" />
+    <Word from="ertilfældigvis" to="er tilfældigvis" />
+    <Word from="fremstar" to="fremstår" />
+    <Word from="ertæt" to="er tæt" />
+    <Word from="ijeres" to="i jeres" />
+    <Word from="Sagdejeg" to="Sagde jeg" />
+    <Word from="overi" to="over i" />
+    <Word from="plukkerjordbær" to="plukker jordbær" />
+    <Word from="klarerjeg" to="klarer jeg" />
+    <Word from="jerfire" to="jer fire" />
+    <Word from="tábeligste" to="tåbeligste" />
+    <Word from="sigertvillingerne" to="siger tvillingerne" />
+    <Word from="erfaktisk" to="er faktisk" />
+    <Word from="gár" to="går" />
+    <Word from="harvasket" to="har vasket" />
+    <Word from="harplukketjordbærtil" to="har plukket jordbær til" />
+    <Word from="plukketjordbær" to="plukket jordbær" />
+    <Word from="klaverfirehændigt" to="klaver firehændigt" />
+    <Word from="erjævnaldrende" to="er jævnaldrende" />
+    <Word from="tierjeg" to="tier jeg" />
+    <Word from="Hvorerden" to="Hvor er den" />
+    <Word from="0veraltjeg" to="overalt jeg" />
+    <Word from="gårpå" to="går på" />
+    <Word from="finderjeg" to="finder jeg" />
+    <Word from="serhans" to="ser hans" />
+    <Word from="tiderbliver" to="tider bliver" />
+    <Word from="ellertrist" to="eller trist" />
+    <Word from="forstårjeres" to="forstår jeres" />
+    <Word from="Hvorsjælen" to="Hvor sjælen" />
+    <Word from="finderro" to="finder ro" />
+    <Word from="sidderjeg" to="sidder jeg" />
+    <Word from="tagerjo" to="tager jo" />
+    <Word from="efterjeres" to="efter jeres" />
+    <Word from="10O" to="100" />
+    <Word from="besluttedejeg" to="besluttede jeg" />
+    <Word from="varsket" to="var sket" />
+    <Word from="uadskillige" to="uadskillelige" />
+    <Word from="harjetlag" to="har jetlag" />
+    <Word from="lkke" to="Ikke" />
+    <Word from="lntet" to="Intet" />
+    <Word from="afslørerjeg" to="afslører jeg" />
+    <Word from="måjeg" to="må jeg" />
+    <Word from="Vl" to="VI" />
+    <Word from="atbygge" to="at bygge" />
+    <Word from="detmakabre" to="det makabre" />
+    <Word from="vilikke" to="vil ikke" />
+    <Word from="talsmandbekræfter" to="talsmand bekræfter" />
+    <Word from="vedatrenovere" to="ved at renovere" />
+    <Word from="forsøgeratforstå" to="forsøger at forstå" />
+    <Word from="ersket" to="er sket" />
+    <Word from="morderpå" to="morder på" />
+    <Word from="frifodiRosewood" to="fri fod i Rosewood" />
+    <Word from="holdtpressemøde" to="holdt pressemøde" />
+    <Word from="lngen" to="Ingen" />
+    <Word from="lND" to="IND" />
+    <Word from="henterjeg" to="henter jeg" />
+    <Word from="lsabel" to="Isabel" />
+    <Word from="lsabels" to="Isabels" />
+    <Word from="vinderjo" to="vinder jo" />
+    <Word from="rødmerjo" to="rødmer jo" />
+    <Word from="etjakkesæt" to="et jakkesæt" />
+    <Word from="glæderjeg" to="glæder jeg" />
+    <Word from="lgen" to="Igen" />
+    <Word from="lsær" to="Især" />
+    <Word from="iparken" to="i parken" />
+    <Word from="nårl" to="når I" />
+    <Word from="tilA1" to="til A1" />
+    <Word from="FBl" to="FBI" />
+    <Word from="viljo" to="vil jo" />
+    <Word from="detpå" to="det på" />
+    <Word from="KIar" to="Klar" />
+    <Word from="PIan" to="Plan" />
+    <Word from="EIIer" to="Eller" />
+    <Word from="FIot" to="Flot" />
+    <Word from="AIIe" to="Alle" />
+    <Word from="AIt" to="Alt" />
+    <Word from="KIap" to="Klap" />
+    <Word from="PIaza" to="Plaza" />
+    <Word from="SIap" to="Slap" />
+    <Word from="Iå" to="lå" />
+    <Word from="BIing" to="Bling" />
+    <Word from="GIade" to="Glade" />
+    <Word from="Iejrbålssange" to="lejrbålssange" />
+    <Word from="bedtjer" to="bedt jer" />
+    <Word from="hørerjeg" to="hører jeg" />
+    <Word from="Fårjeg" to="Får jeg" />
+    <Word from="fikJames" to="fik James" />
+    <Word from="atsnakke" to="at snakke" />
+    <Word from="varkun" to="var kun" />
+    <Word from="retterjeg" to="retter jeg" />
+    <Word from="ernormale" to="er normale" />
+    <Word from="viljeg" to="vil jeg" />
+    <Word from="Sætjer" to="Sæt jer" />
+    <Word from="udsatham" to="udsat ham" />
+    <Word from="afen" to="af en" />
+    <Word from="påjorden" to="på jorden" />
+    <Word from="afdem" to="af dem" />
+    <Word from="kmt" to="km/t" />
+  </WholeWords>
+  <PartialWordsAlways>
+    <WordPart from="¤" to="o" />
+    <WordPart from="IVI" to="M" />
+    <WordPart from="lVI" to="M" />
+    <WordPart from="IVl" to="M" />
+    <WordPart from="lVl" to="M" />
+  </PartialWordsAlways>
+  <PartialWords>
+    <!-- Will be used to check words not in dictionary -->
+    <!-- If new word(s) exists in spelling dictionary, it(they) is accepted -->
+    <WordPart from="fi" to="fi" />
+    <WordPart from="fl" to="fl" />
+    <WordPart from="/" to="l" />
+    <WordPart from="vv" to="w" />
+    <WordPart from="m" to="rn" />
+    <WordPart from="l" to="i" />
+    <WordPart from="€" to="e" />
+    <WordPart from="I" to="l" />
+    <WordPart from="c" to="o" />
+    <WordPart from="i" to="t" />
+    <WordPart from="cc" to="oo" />
+    <WordPart from="ii" to="tt" />
+    <WordPart from="n/" to="ry" />
+    <WordPart from="ae" to="æ" />
+    <!-- "f " will be two words -->
+    <WordPart from="f" to="f " />
+    <WordPart from="c" to="e" />
+    <WordPart from="o" to="e" />
+    <WordPart from="I" to="t" />
+    <WordPart from="n" to="o" />
+    <WordPart from="s" to="e" />
+    <WordPart from="\A" to="Vi" />
+    <WordPart from="n/" to="rv" />
+    <WordPart from="Ã" to="Å" />
+    <WordPart from="í" to="i" />
+  </PartialWords>
+  <PartialLines />
+  <PartialLinesAlways />
+  <BeginLines />
+  <EndLines />
+  <WholeLines />
+  <RegularExpressions />
+</OCRFixReplaceList>
\ No newline at end of file
diff --git a/libs/subzero/modification/dictionaries/xml/deu_OCRFixReplaceList.xml b/libs/subzero/modification/dictionaries/xml/deu_OCRFixReplaceList.xml
new file mode 100644
index 000000000..bb64f0987
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/xml/deu_OCRFixReplaceList.xml
@@ -0,0 +1,6865 @@
+<OCRFixReplaceList>
+  <WholeWords>
+    <Word from="/a" to="Ja" />
+    <Word from="/ch" to="Ich" />
+    <Word from="/d/of" to="Idiot" />
+    <Word from="/ebte" to="lebte" />
+    <Word from="/eid" to="leid" />
+    <Word from="/hn" to="ihn" />
+    <Word from="/hnen" to="Ihnen" />
+    <Word from="/hr" to="Ihr" />
+    <Word from="/hre" to="Ihre" />
+    <Word from="/hren" to="Ihren" />
+    <Word from="/m" to="im" />
+    <Word from="/mmer" to="immer" />
+    <Word from="/n" to="In" />
+    <Word from="/ndividuen" to="Individuen" />
+    <Word from="/nn" to="Inn" />
+    <Word from="/oe" to="Joe" />
+    <Word from="/sf" to="ist" />
+    <Word from="/sf/0/1n" to="Ist John" />
+    <Word from="/ungs" to="Jungs" />
+    <Word from="/Vfinuten" to="Minuten" />
+    <Word from="/énger" to="länger" />
+    <Word from="/éuft" to="läuft" />
+    <Word from="0/1" to="Oh" />
+    <Word from="0/me" to="ohne" />
+    <Word from="0/vne" to="ohne" />
+    <Word from="00om" to="000 m" />
+    <Word from="100m" to="100 m" />
+    <Word from="120m" to="120 m" />
+    <Word from="13Oj§hrie" to="130 jährige" />
+    <Word from="13Oj§hrie" to="130-jährige" />
+    <Word from="145m" to="145 m" />
+    <Word from="150m" to="150 m" />
+    <Word from="160m" to="160 m" />
+    <Word from="165m" to="165 m" />
+    <Word from="19m" to="19 m" />
+    <Word from="20m" to="20 m" />
+    <Word from="27m" to="27 m" />
+    <Word from="30m" to="30 m" />
+    <Word from="37m" to="37 m" />
+    <Word from="38m" to="38 m" />
+    <Word from="3km" to="3 km" />
+    <Word from="5/ch" to="sich" />
+    <Word from="5/cher" to="sicher" />
+    <Word from="5/cherer" to="sicherer" />
+    <Word from="5/e" to="Sie" />
+    <Word from="5/nd" to="Sind" />
+    <Word from="500m" to="500 m" />
+    <Word from="5ulSere" to="äußere" />
+    <Word from="60m" to="60 m" />
+    <Word from="6de" to="öde" />
+    <Word from="6dere" to="ödere" />
+    <Word from="6ffne" to="öffne" />
+    <Word from="6ffnen" to="öffnen" />
+    <Word from="6ffnet" to="Öffnet" />
+    <Word from="6fter" to="öfter" />
+    <Word from="750m" to="750 m" />
+    <Word from="85m" to="85 m" />
+    <Word from="90m" to="90 m" />
+    <Word from="a//em" to="allem" />
+    <Word from="A//es" to="Alles" />
+    <Word from="abbeif$en" to="abbeißen" />
+    <Word from="abdrficken" to="abdrücken" />
+    <Word from="aBen" to="aßen" />
+    <Word from="abergléiubischen" to="abergläubischen" />
+    <Word from="aberja" to="aber ja" />
+    <Word from="aberjemand" to="aber jemand" />
+    <Word from="Aberjetzt" to="Aber jetzt" />
+    <Word from="abféhrt" to="abfährt" />
+    <Word from="abféillt" to="abfällt" />
+    <Word from="abgeférbt" to="abgefärbt" />
+    <Word from="abgehéngt" to="abgehängt" />
+    <Word from="abgehért" to="abgehört" />
+    <Word from="abgelost" to="abgelöst" />
+    <Word from="abgesprengli" to="abgesprengt!" />
+    <Word from="abgestfirztl" to="abgestürzt" />
+    <Word from="abgestilrzt" to="abgestürzt" />
+    <Word from="abgestofien" to="abgestoßen" />
+    <Word from="abgewéhlt" to="abgewählt" />
+    <Word from="abgewéhnen" to="abgewöhnen" />
+    <Word from="abgewéhnt" to="abgewöhnt" />
+    <Word from="abgeénderten" to="abgeänderten" />
+    <Word from="abhéingt" to="abhängt" />
+    <Word from="abhéngen" to="abhängen" />
+    <Word from="abhéngig" to="abhängig" />
+    <Word from="abhéngiges" to="abhängiges" />
+    <Word from="Abhérstationen" to="Abhörstationen" />
+    <Word from="Abjetzt" to="Ab jetzt" />
+    <Word from="abkfihlen" to="abkühlen" />
+    <Word from="Abkfirzung" to="Abkürzung" />
+    <Word from="abkommlich" to="abkömmlich" />
+    <Word from="Ablegenl" to="Ablegen!" />
+    <Word from="ablfisen" to="ablösen" />
+    <Word from="ablosen" to="ablösen" />
+    <Word from="Ablosung" to="Ablösung" />
+    <Word from="abreif$en" to="abreißen" />
+    <Word from="Abrijcken" to="Abrücken" />
+    <Word from="abréumen" to="abräumen" />
+    <Word from="Absch/ed" to="Abschied" />
+    <Word from="abschiefien" to="abschießen" />
+    <Word from="abschlief$en" to="abschließen" />
+    <Word from="abschliefien" to="abschließen" />
+    <Word from="abschwiiren" to="abschwören" />
+    <Word from="abstoflsend" to="abstoßend" />
+    <Word from="Abtrijnnige" to="Abtrünnige" />
+    <Word from="abwiirgt" to="abwürgt" />
+    <Word from="abwégen" to="abwägen" />
+    <Word from="abzuhéren" to="abzuhören" />
+    <Word from="abzuschwiiren" to="abzuschwören" />
+    <Word from="abzusfofien" to="abzustoßen" />
+    <Word from="ACh" to="Ach" />
+    <Word from="Achtungl" to="Achtung!" />
+    <Word from="Achzen" to="Ächzen" />
+    <Word from="ACHZT" to="ÄCHZT" />
+    <Word from="Acic" to="Acid" />
+    <Word from="ADDRESSDATEI" to="ADRESSDATEI" />
+    <Word from="Adiös" to="Adiós" />
+    <Word from="Admiralitat" to="Admiralität" />
+    <Word from="Admiralitéit" to="Admiralität" />
+    <Word from="Admiralitét" to="Admiralität" />
+    <Word from="Affére" to="Affäre" />
+    <Word from="Afféren" to="Affären" />
+    <Word from="AFl" to="AFI" />
+    <Word from="aggresivem" to="aggressivem" />
+    <Word from="Agypten" to="Ägypten" />
+    <Word from="aher" to="aber" />
+    <Word from="AI/en/vichtigste" to="Allerwichtigste" />
+    <Word from="Ain/vays" to="Airways" />
+    <Word from="AIs" to="Als" />
+    <Word from="Aktivitéiten" to="Aktivitäten" />
+    <Word from="Aktivitéten" to="Aktivitäten" />
+    <Word from="AKTMERT" to="AKTIVIERT" />
+    <Word from="Alarmsfufe" to="Alarmstufe" />
+    <Word from="albem" to="albern" />
+    <Word from="Albtriiume" to="Albträume" />
+    <Word from="ale" to="als" />
+    <Word from="alleinl" to="allein!" />
+    <Word from="allejubeln" to="alle jubeln" />
+    <Word from="allernéchsten" to="allernächsten" />
+    <Word from="Allmiichtigerl" to="Allmächtiger!" />
+    <Word from="Allméchtige" to="Allmächtige" />
+    <Word from="Allméchtiger" to="Allmächtiger" />
+    <Word from="allméhlich" to="allmählich" />
+    <Word from="Allméichtiger" to="Allmächtiger" />
+    <Word from="Allsparkl" to="Allspark!" />
+    <Word from="alltéiglichen" to="alltäglichen" />
+    <Word from="ALTESTE" to="ÄLTESTE" />
+    <Word from="Altester" to="Ältester" />
+    <Word from="Alzte" to="Ärzte" />
+    <Word from="Amerx'kaner" to="Amerikaner" />
+    <Word from="amfisierst" to="amüsierst" />
+    <Word from="Amiilsierst" to="Amüsierst" />
+    <Word from="amiisieren" to="amüsieren" />
+    <Word from="amiisierenl" to="amüsieren!" />
+    <Word from="amiisierte" to="amüsierte" />
+    <Word from="Amijsant" to="Amüsant" />
+    <Word from="amlllsant" to="amüsant" />
+    <Word from="amlllsiert" to="amüsiert" />
+    <Word from="amtlsant" to="amüsant" />
+    <Word from="Amusanf" to="Amüsant" />
+    <Word from="amusant" to="amüsant" />
+    <Word from="Amusiert" to="Amüsiert" />
+    <Word from="Anderst" to="Änderst" />
+    <Word from="Anderung" to="Änderung" />
+    <Word from="Anderungen" to="Änderungen" />
+    <Word from="anfa'ngt" to="anfängt" />
+    <Word from="Anffihrer" to="Anführer" />
+    <Word from="Anffingerl" to="Anfänger!" />
+    <Word from="Anfiihrer" to="Anführer" />
+    <Word from="anfijhlt" to="anfühlt" />
+    <Word from="Anfingerl" to="Anfänger!" />
+    <Word from="Anfuhrer" to="Anführer" />
+    <Word from="Anfuhrern" to="Anführern" />
+    <Word from="Anféinger" to="Anfänger" />
+    <Word from="Anféingergliick" to="Anfängerglück" />
+    <Word from="Anfénge" to="Anfänge" />
+    <Word from="anféngst" to="anfängst" />
+    <Word from="anféngt" to="anfängt" />
+    <Word from="angebrfillt" to="angebrüllt" />
+    <Word from="angebrullt" to="angebrüllt" />
+    <Word from="angefiihrt" to="angeführt" />
+    <Word from="ANGEHCHDRIGE" to="ANGEHÖRIGE" />
+    <Word from="angehfirt" to="angehört" />
+    <Word from="Angehtirigen" to="Angehörigen" />
+    <Word from="angehéren" to="angehören" />
+    <Word from="angehért" to="angehört" />
+    <Word from="angeléchelt" to="angelächelt" />
+    <Word from="angerilhrt" to="angerührt" />
+    <Word from="angerflhrt" to="angerührt" />
+    <Word from="angeschweifit" to="angeschweißt" />
+    <Word from="angespruht" to="angesprüht" />
+    <Word from="angetiltert" to="angetütert" />
+    <Word from="Angriffsplénen" to="Angriffsplänen" />
+    <Word from="Angstschweili" to="Angstschweiß" />
+    <Word from="anhiiren" to="anhören" />
+    <Word from="Anhéinger" to="Anhänger" />
+    <Word from="anhélt" to="anhält" />
+    <Word from="anhéngen" to="anhängen" />
+    <Word from="anhéren" to="anhören" />
+    <Word from="ankijndigen" to="ankündigen" />
+    <Word from="anliigen" to="anlügen" />
+    <Word from="anlugen" to="anlügen" />
+    <Word from="anmal3ende" to="anmaßende" />
+    <Word from="annéhern" to="annähern" />
+    <Word from="anriihrst" to="anrührst" />
+    <Word from="anrijuhren" to="anrühren" />
+    <Word from="anstéindig" to="anständig" />
+    <Word from="anstéindiger" to="anständiger" />
+    <Word from="anstéindiges" to="anständiges" />
+    <Word from="ansténdig" to="anständig" />
+    <Word from="ansténdige" to="anständige" />
+    <Word from="ansténdigen" to="anständigen" />
+    <Word from="Ansténdiges" to="Anständiges" />
+    <Word from="Antikérper" to="Antikörper" />
+    <Word from="Antiquitét" to="Antiquität" />
+    <Word from="Antistrahlengerét" to="Antistrahlengerät" />
+    <Word from="antwortenl" to="antworten!" />
+    <Word from="Anwe/sung" to="Anweisung" />
+    <Word from="Anwe/sungen" to="Anweisungen" />
+    <Word from="Anwéiltin" to="Anwältin" />
+    <Word from="Anwélte" to="Anwälte" />
+    <Word from="Anwéltin" to="Anwältin" />
+    <Word from="Anzilge" to="Anzüge" />
+    <Word from="Anztinden" to="Anzünden" />
+    <Word from="Anzuge" to="Anzüge" />
+    <Word from="Anzugen" to="Anzügen" />
+    <Word from="anzuhiiren" to="anzuhören" />
+    <Word from="anzuhoren" to="anzuhören" />
+    <Word from="anzundenl" to="anzünden!" />
+    <Word from="anzupiibeln" to="anzupöbeln" />
+    <Word from="Anésthesie" to="Anästhesie" />
+    <Word from="Anésthesieprofessor" to="Anästhesieprofessor" />
+    <Word from="Anésthesieteam" to="Anästhesieteam" />
+    <Word from="Anésthesist" to="Anästhesist" />
+    <Word from="Anésthesisten" to="Anästhesisten" />
+    <Word from="Anésthetikum" to="Anästhetikum" />
+    <Word from="ARBEITERI" to="ARBEITER:" />
+    <Word from="Arbeitsflflgel" to="Arbeitsflügel" />
+    <Word from="Armeefunkgerét" to="Armeefunkgerät" />
+    <Word from="Armel" to="Ärmel" />
+    <Word from="Arschkichern" to="Arschlöchern" />
+    <Word from="Arschliicher" to="Arschlöcher" />
+    <Word from="Arschliichern" to="Arschlöchern" />
+    <Word from="Arschlécher" to="Arschlöcher" />
+    <Word from="Arschléchern" to="Arschlöchern" />
+    <Word from="Arzte" to="Ärzte" />
+    <Word from="Arzten" to="Ärzten" />
+    <Word from="Arztin" to="Ärztin" />
+    <Word from="Atemgeréusche" to="Atemgeräusche" />
+    <Word from="Atlantikkiiste" to="Atlantikküste" />
+    <Word from="Atlantikkuste" to="Atlantikküste" />
+    <Word from="ATMOSPHARE" to="ATMOSPHÄRE" />
+    <Word from="Atmosphére" to="Atmosphäre" />
+    <Word from="Atmosphérenbereich" to="Atmosphärenbereich" />
+    <Word from="Atmosphéreneinflugsequenz" to="Atmosphäreneinflugsequenz" />
+    <Word from="Atmosphéreneintritt" to="Atmosphäreneintritt" />
+    <Word from="Attenfaiter" to="Attentäter" />
+    <Word from="Attentéiter" to="Attentäter" />
+    <Word from="Attentéter" to="Attentäter" />
+    <Word from="Attentéters" to="Attentäters" />
+    <Word from="Attraktivitét" to="Attraktivität" />
+    <Word from="auBen" to="außen" />
+    <Word from="Aubenblick" to="Augenblick" />
+    <Word from="AuBenbord" to="Außenbord" />
+    <Word from="AuBenwelt" to="Außenwelt" />
+    <Word from="auBer" to="außer" />
+    <Word from="AuBerdem" to="Außerdem" />
+    <Word from="auBerhalb" to="außerhalb" />
+    <Word from="auc/1" to="auch" />
+    <Word from="auchl" to="auch!" />
+    <Word from="Auf$erdem" to="Außerdem" />
+    <Word from="auf3er" to="außer" />
+    <Word from="aufAugenh6he" to="auf Augenhöhe" />
+    <Word from="aufblilhende" to="aufblühende" />
+    <Word from="auff'a'ngt" to="auffängt" />
+    <Word from="Auffélliges" to="Auffälliges" />
+    <Word from="aufgebltiht" to="aufgeblüht" />
+    <Word from="aufgeftlhrt" to="aufgeführt" />
+    <Word from="aufgehéingt" to="aufgehängt" />
+    <Word from="aufgehért" to="aufgehört" />
+    <Word from="aufgeklért" to="aufgeklärt" />
+    <Word from="aufgeréumt" to="aufgeräumt" />
+    <Word from="aufgespiefit" to="aufgespießt" />
+    <Word from="aufgewiihlter" to="aufgewühlter" />
+    <Word from="aufgezéhlt" to="aufgezählt" />
+    <Word from="Aufh6ren" to="Aufhören" />
+    <Word from="aufhbren" to="aufhören" />
+    <Word from="aufhdrf" to="aufhört" />
+    <Word from="aufhfiren" to="aufhören" />
+    <Word from="aufhiiren" to="aufhören" />
+    <Word from="Aufhoren" to="Aufhören" />
+    <Word from="Aufhéiren" to="Aufhören" />
+    <Word from="aufhéngen" to="aufhängen" />
+    <Word from="Aufhéren" to="Aufhören" />
+    <Word from="aufhérenl" to="aufhören" />
+    <Word from="aufi" to="auf," />
+    <Word from="Aufienministerium" to="Außenministerium" />
+    <Word from="aufier" to="außer" />
+    <Word from="Aufierdem" to="Außerdem" />
+    <Word from="aufiergewéhnliche" to="außergewöhnliche" />
+    <Word from="aufierhalb" to="außerhalb" />
+    <Word from="Aufierirdischer" to="Außerirdischer" />
+    <Word from="Aufierlich" to="Äußerlich" />
+    <Word from="aufierordentlich" to="außerordentlich" />
+    <Word from="Aufkenposten" to="Außenposten" />
+    <Word from="aufkisen" to="auflösen" />
+    <Word from="aufkléren" to="aufklären" />
+    <Word from="Aufklérung" to="Aufklärung" />
+    <Word from="aufl" to="auf!" />
+    <Word from="Aufl6sung" to="Auflösung" />
+    <Word from="aufliisen" to="auflösen" />
+    <Word from="auflser" to="außer" />
+    <Word from="auflésen" to="auflösen" />
+    <Word from="aufmiibeln" to="aufmöbeln" />
+    <Word from="aufraumte" to="aufräumte" />
+    <Word from="aufréumen" to="aufräumen" />
+    <Word from="aufschlief$en" to="aufschließen" />
+    <Word from="Aufschlull" to="Aufschluss" />
+    <Word from="aufSer" to="außer" />
+    <Word from="aufSIJBigkeiten" to="auf Süßigkeiten" />
+    <Word from="aufspturen" to="aufspüren" />
+    <Word from="aufstellenl" to="aufstellen!" />
+    <Word from="Aufsténdige" to="Aufständische" />
+    <Word from="aufTanis" to="auf Tanis" />
+    <Word from="Auftrége" to="Aufträge" />
+    <Word from="aufvvéndigen" to="aufwändigen" />
+    <Word from="aufwéichst" to="aufwächst" />
+    <Word from="aufwérmen" to="aufwärmen" />
+    <Word from="aufZ&gt;er" to="außer" />
+    <Word from="Aufztlge" to="Aufzüge" />
+    <Word from="aufzuhiivren" to="aufzuhören" />
+    <Word from="aufzukléren" to="aufzuklären" />
+    <Word from="aufzuldsen" to="aufzulösen" />
+    <Word from="aufzuréumen" to="aufzuräumen" />
+    <Word from="aufzéhlen" to="aufzählen" />
+    <Word from="auféer" to="außer" />
+    <Word from="auffliegen" to="auffliegen" />
+    <Word from="Augenméigen" to="Augenmägen" />
+    <Word from="aul'5er" to="außer" />
+    <Word from="aul3er" to="außer" />
+    <Word from="Aul3erdem" to="Außerdem" />
+    <Word from="aul5er" to="außer" />
+    <Word from="aulier" to="außer" />
+    <Word from="Aulierdem" to="Außerdem" />
+    <Word from="auliergewfihnlich" to="außergewöhnlich" />
+    <Word from="aulierhalb" to="außerhalb" />
+    <Word from="Aulierirdischen" to="Außerirdischen" />
+    <Word from="auller" to="außer" />
+    <Word from="aullerhalb" to="außerhalb" />
+    <Word from="AulSer" to="Außer" />
+    <Word from="AulSerdem" to="Außerdem" />
+    <Word from="ausdriicken" to="ausdrücken" />
+    <Word from="ausdriickt" to="ausdrückt" />
+    <Word from="ausdrijcken" to="ausdrücken" />
+    <Word from="ausdrucklicher" to="ausdrücklicher" />
+    <Word from="Ausdrflcken" to="Ausdrücken" />
+    <Word from="Ausen/véhlte" to="Auserwählte" />
+    <Word from="Ausen/véhlter" to="Auserwählter" />
+    <Word from="auserwéhlt" to="auserwählt" />
+    <Word from="Ausffillen" to="Ausfüllen" />
+    <Word from="ausfijhren" to="ausführen" />
+    <Word from="ausfijhrt" to="ausführt" />
+    <Word from="ausfuhren" to="ausführen" />
+    <Word from="ausfullt" to="ausfüllt" />
+    <Word from="ausgefflllt" to="ausgefüllt" />
+    <Word from="ausgeliischt" to="ausgelöscht" />
+    <Word from="ausgeliist" to="ausgelöst" />
+    <Word from="ausgeléist" to="ausgelöst" />
+    <Word from="ausgeléscht" to="ausgelöscht" />
+    <Word from="ausgelést" to="ausgelöst" />
+    <Word from="ausgeriickt" to="ausgerückt" />
+    <Word from="ausgerijstet" to="ausgerüstet" />
+    <Word from="AUSGEWAHLT" to="AUSGEWÄHLT" />
+    <Word from="ausgewéhlt" to="ausgewählt" />
+    <Word from="Ausgéngen" to="Ausgängen" />
+    <Word from="aush6hlen" to="aushöhlen" />
+    <Word from="aushiilt" to="aushält" />
+    <Word from="Aushilfspunkerl" to="Aushilfspunker!" />
+    <Word from="aushélt" to="aushält" />
+    <Word from="ausilben" to="ausüben" />
+    <Word from="Auskunfte" to="Auskünfte" />
+    <Word from="ausl" to="aus!" />
+    <Word from="Auslénder" to="Ausländer" />
+    <Word from="Auslénderl" to="Ausländer" />
+    <Word from="ausléschen" to="auslöschen" />
+    <Word from="auslésen" to="auslösen" />
+    <Word from="Ausléser" to="Auslöser" />
+    <Word from="AusmaB" to="Ausmaß" />
+    <Word from="ausprobiefl" to="ausprobiert" />
+    <Word from="Ausriistung" to="Ausrüstung" />
+    <Word from="ausrusten" to="ausrüsten" />
+    <Word from="Ausrustung" to="Ausrüstung" />
+    <Word from="Ausschullware" to="Ausschussware" />
+    <Word from="ausschwinnenl" to="ausschwärmen!" />
+    <Word from="auszudriicken" to="auszudrücken" />
+    <Word from="auszuschliefien" to="auszuschließen" />
+    <Word from="auszuwéhlen" to="auszuwählen" />
+    <Word from="Autoritét" to="Autorität" />
+    <Word from="Autoschlilssel" to="Autoschlüssel" />
+    <Word from="Autoschlflssel" to="Autoschlüssel" />
+    <Word from="aufl/viihlt" to="aufwühlt" />
+    <Word from="Auflergewiihnlich" to="Außergewöhnlich" />
+    <Word from="Azevedol" to="Azevedo!" />
+    <Word from="Afles" to="Alles" />
+    <Word from="B/ick" to="Blick" />
+    <Word from="b/olog/sch" to="biologisch" />
+    <Word from="b/sschen" to="bisschen" />
+    <Word from="B6se" to="Böse" />
+    <Word from="B6sem" to="Bösem" />
+    <Word from="B6ser" to="Böser" />
+    <Word from="Babymédchen" to="Babymädchen" />
+    <Word from="Ballaststéffchen" to="Ballaststöffchen" />
+    <Word from="Ballmédchen" to="Ballmädchen" />
+    <Word from="Ballméidchen" to="Ballmädchen" />
+    <Word from="Ballonverkéufer" to="Ballonverkäufer" />
+    <Word from="Balzenl" to="Balzen!" />
+    <Word from="Bankijberfall" to="Banküberfall" />
+    <Word from="Barbarenilberfall" to="Barbarenüberfall" />
+    <Word from="Barenkénig" to="Barenkönig" />
+    <Word from="basfeln" to="basteln" />
+    <Word from="Bastianol" to="Bastiano!" />
+    <Word from="Bastlano" to="Bastiano" />
+    <Word from="Bauchfellentztmdung" to="Bauchfellentzündung" />
+    <Word from="Bauchkrémpfe" to="Bauchkrämpfe" />
+    <Word from="bauféllig" to="baufällig" />
+    <Word from="bauféllige" to="baufällige" />
+    <Word from="Baumstémme" to="Baumstämme" />
+    <Word from="Baupléne" to="Baupläne" />
+    <Word from="Bbses" to="Böses" />
+    <Word from="be/de" to="beide" />
+    <Word from="bedecktl" to="bedeckt!" />
+    <Word from="Bedilrfnisse" to="Bedürfnisse" />
+    <Word from="Bedilrfnissen" to="Bedürfnissen" />
+    <Word from="Bedllirfnisse" to="Bedürfnisse" />
+    <Word from="bedrijckt" to="bedrückt" />
+    <Word from="bedréngen" to="bedrängen" />
+    <Word from="bedréngt" to="bedrängt" />
+    <Word from="bedréngten" to="bedrängten" />
+    <Word from="Beeilungf" to="Beeilung!" />
+    <Word from="Beeilungl" to="Beeilung!" />
+    <Word from="Beerdingungsinsiiiui" to="Beerdigungsinstitut" />
+    <Word from="Beerdingungsinstitut" to="Beerdigungsinstitut" />
+    <Word from="Befehll" to="Befehl!" />
+    <Word from="beffirdert" to="befördert" />
+    <Word from="Beffirderung" to="Beförderung" />
+    <Word from="befiirchte" to="befürchte" />
+    <Word from="befiirchteten" to="befürchteten" />
+    <Word from="befiirdert" to="befördert" />
+    <Word from="befiirderte" to="beförderte" />
+    <Word from="Befiirderung" to="Beförderung" />
+    <Word from="befilrchtete" to="befürchtete" />
+    <Word from="befllirchte" to="befürchte" />
+    <Word from="befurworte" to="befürworte" />
+    <Word from="befurwortet" to="befürwortet" />
+    <Word from="beférdere" to="befördere" />
+    <Word from="beférdert" to="befördert" />
+    <Word from="Beférderung" to="Beförderung" />
+    <Word from="beg/ng" to="beging" />
+    <Word from="beglflckt" to="beglückt" />
+    <Word from="begniigt" to="begnügt" />
+    <Word from="begrfindetes" to="begründetes" />
+    <Word from="Begriiliungsruf" to="Begrüßungsruf" />
+    <Word from="begrijfien" to="begrüßen" />
+    <Word from="Begrilfiung" to="Begrüßung" />
+    <Word from="Begrilfkung" to="Begrüßung" />
+    <Word from="begrL'llZ&gt;en" to="begrüßen" />
+    <Word from="BegrUBungsruf" to="Begrüßungsruf" />
+    <Word from="begrUf$t" to="begrüßt" />
+    <Word from="begrufie" to="begrüße" />
+    <Word from="begrufit" to="begrüßt" />
+    <Word from="Begrundung" to="Begründung" />
+    <Word from="Beh6rden" to="Behörden" />
+    <Word from="behélt" to="behält" />
+    <Word from="Behélter" to="Behälter" />
+    <Word from="behémmert" to="behämmert" />
+    <Word from="beiB" to="beiß" />
+    <Word from="beiBen" to="beißen" />
+    <Word from="beiBt" to="beißt" />
+    <Word from="beif$t" to="beißt" />
+    <Word from="beif2&gt;en" to="beißen" />
+    <Word from="beifken" to="beißen" />
+    <Word from="beiflsen" to="beißen" />
+    <Word from="beijenen" to="bei jenen" />
+    <Word from="Beiliring" to="Beißring" />
+    <Word from="BEKAMPFEN" to="BEKÄMPFEN" />
+    <Word from="bekannf" to="bekannt" />
+    <Word from="bekanntermafken" to="bekanntermaßen" />
+    <Word from="bekéme" to="bekäme" />
+    <Word from="bekémpfen" to="bekämpfen" />
+    <Word from="Bekémpfung" to="Bekämpfung" />
+    <Word from="bel" to="bei" />
+    <Word from="belde" to="beide" />
+    <Word from="beliellsen" to="beließen" />
+    <Word from="belm" to="beim" />
+    <Word from="Beltlftungstunnels" to="Belüftungstunnels" />
+    <Word from="Beluftungstunnel" to="Belüftungstunnel" />
+    <Word from="Beluftungstunnell" to="Belüftungstunnel!" />
+    <Word from="beléstigen" to="belästigen" />
+    <Word from="Bemiihe" to="Bemühe" />
+    <Word from="Bemiihen" to="Bemühen" />
+    <Word from="bemL'lhe" to="bemühe" />
+    <Word from="bemtuht" to="bemüht" />
+    <Word from="bemuhen" to="bemühen" />
+    <Word from="bemuhten" to="bemühten" />
+    <Word from="Benétigen" to="Benötigen" />
+    <Word from="benétigt" to="benötigt" />
+    <Word from="benétigten" to="benötigten" />
+    <Word from="Beobachtar" to="Beobachter" />
+    <Word from="bereft" to="bereit" />
+    <Word from="bereitféndet" to="bereitfändet" />
+    <Word from="beriichtigtsten" to="berüchtigtsten" />
+    <Word from="beriichtlgten" to="berüchtigten" />
+    <Word from="beriihmt" to="berühmt" />
+    <Word from="Beriihmtheiten" to="Berühmtheiten" />
+    <Word from="beriihren" to="berühren" />
+    <Word from="Beriihrend" to="Berührend" />
+    <Word from="beriihrt" to="berührt" />
+    <Word from="Beriihrtl" to="Berührt!" />
+    <Word from="berijhrt" to="berührt" />
+    <Word from="berilhmter" to="berühmter" />
+    <Word from="berilhrt" to="berührt" />
+    <Word from="Berilhrung" to="Berührung" />
+    <Word from="Berks/1/re" to="Berkshire" />
+    <Word from="BerL'lhre" to="Berühre" />
+    <Word from="berllichtigter" to="berüchtigter" />
+    <Word from="berllihren" to="berühren" />
+    <Word from="berllihrt" to="berührt" />
+    <Word from="berlllhmten" to="berühmten" />
+    <Word from="Bern/e" to="Bernie" />
+    <Word from="beruhrt" to="berührt" />
+    <Word from="beruhrte" to="berührte" />
+    <Word from="berflhmter" to="berühmter" />
+    <Word from="besafi" to="besaß" />
+    <Word from="Besch'a'ftigt" to="Beschäftigt" />
+    <Word from="bescheifien" to="bescheißen" />
+    <Word from="beschiftigt" to="beschäftigt" />
+    <Word from="beschiiftigt" to="beschäftigt" />
+    <Word from="beschiitzen" to="beschützen" />
+    <Word from="beschiitzt" to="beschützt" />
+    <Word from="beschiltze" to="beschütze" />
+    <Word from="beschiltzen" to="beschützen" />
+    <Word from="beschleun/gt" to="beschleunigt" />
+    <Word from="beschliefkt" to="beschließt" />
+    <Word from="beschliefltloszuziehen" to="beschließt loszuziehen" />
+    <Word from="beschllitzet" to="beschützet" />
+    <Word from="beschllitzt" to="beschützt" />
+    <Word from="beschrénkt" to="beschränkt" />
+    <Word from="Beschrénkungen" to="Beschränkungen" />
+    <Word from="beschtitze" to="beschütze" />
+    <Word from="beschutzen" to="beschützen" />
+    <Word from="beschédigt" to="beschädigt" />
+    <Word from="beschéftigen" to="beschäftigen" />
+    <Word from="beschéftigt" to="beschäftigt" />
+    <Word from="beschéftigte" to="beschäftigte" />
+    <Word from="beschéftigten" to="beschäftigten" />
+    <Word from="beschéiftige" to="beschäftige" />
+    <Word from="beschéiftigt" to="beschäftigt" />
+    <Word from="Beschéimen" to="Beschämen" />
+    <Word from="beschémendste" to="beschämendste" />
+    <Word from="beschéoligen" to="beschädigen" />
+    <Word from="beschfltzen" to="beschützen" />
+    <Word from="Beschfltzer" to="Beschützer" />
+    <Word from="Besféf/gen" to="Bestätigen" />
+    <Word from="Besitztijmer" to="Besitztümer" />
+    <Word from="BESTATIGE" to="BESTÄTIGE" />
+    <Word from="BESTATIGT" to="BESTÄTIGT" />
+    <Word from="bestenl" to="besten!" />
+    <Word from="bestiirzt" to="bestürzt" />
+    <Word from="bestiitigen" to="bestätigen" />
+    <Word from="bestltigt" to="bestätigt" />
+    <Word from="bestx'mmt" to="bestimmt" />
+    <Word from="bestéindige" to="beständige" />
+    <Word from="bestéitigt" to="bestätigt" />
+    <Word from="Bestéitigung" to="Bestätigung" />
+    <Word from="Bestéitigungen" to="Bestätigungen" />
+    <Word from="Bestétige" to="Bestätige" />
+    <Word from="Bestétigen" to="Bestätigen" />
+    <Word from="bestétigt" to="bestätigt" />
+    <Word from="Bestétigung" to="Bestätigung" />
+    <Word from="beséinftigen" to="besänftigen" />
+    <Word from="beséinftigt" to="besänftigt" />
+    <Word from="besénftigen" to="besänftigen" />
+    <Word from="Betiiubt" to="Betäubt" />
+    <Word from="betriibt" to="betrübt" />
+    <Word from="betriigen" to="betrügen" />
+    <Word from="Betriiger" to="Betrüger" />
+    <Word from="betriigt" to="betrügt" />
+    <Word from="betrijgen" to="betrügen" />
+    <Word from="Betrijgerl" to="Betrüger!" />
+    <Word from="betrilgen" to="betrügen" />
+    <Word from="betrtlgerischer" to="betrügerischer" />
+    <Word from="betréchtliches" to="beträchtliches" />
+    <Word from="Betrége" to="Beträge" />
+    <Word from="betrégt" to="beträgt" />
+    <Word from="Bettwéische" to="Bettwäsche" />
+    <Word from="Beviilkerung" to="Bevölkerung" />
+    <Word from="bevorwir" to="bevor wir" />
+    <Word from="bevélkern" to="bevölkern" />
+    <Word from="bewegf" to="bewegt" />
+    <Word from="Bewéhrungsauflage" to="Bewährungsauflage" />
+    <Word from="bewéihrte" to="bewährte" />
+    <Word from="bewéiltigen" to="bewältigen" />
+    <Word from="bewéissern" to="bewässern" />
+    <Word from="bewélkten" to="bewölkten" />
+    <Word from="bewéltigen" to="bewältigen" />
+    <Word from="Bewéltigung" to="Bewältigung" />
+    <Word from="bewéssern" to="bewässern" />
+    <Word from="Bewésserungssysteme" to="Bewässerungssysteme" />
+    <Word from="Bezirksgelinde" to="Bezirksgelände" />
+    <Word from="bezuglich" to="bezüglich" />
+    <Word from="beéingstigende" to="beängstigende" />
+    <Word from="beéngstigend" to="beängstigend" />
+    <Word from="beéngstigender" to="beängstigender" />
+    <Word from="bffnen" to="öffnen" />
+    <Word from="Bficher" to="Bücher" />
+    <Word from="Bfiro" to="Büro" />
+    <Word from="bfirsten" to="bürsten" />
+    <Word from="bfise" to="böse" />
+    <Word from="bfisen" to="bösen" />
+    <Word from="bfiser" to="böser" />
+    <Word from="bfises" to="böses" />
+    <Word from="bfiseste" to="böseste" />
+    <Word from="bfisesten" to="bösesten" />
+    <Word from="bgsonderen" to="besonderen" />
+    <Word from="BI6de" to="Blöde" />
+    <Word from="Bierbfichse" to="Bierbüchse" />
+    <Word from="Biicher" to="Bücher" />
+    <Word from="Biicherei" to="Bücherei" />
+    <Word from="Biick" to="Bück" />
+    <Word from="Biiffel" to="Büffel" />
+    <Word from="BIiHlt" to="Blüht" />
+    <Word from="Biihne" to="Bühne" />
+    <Word from="Biilcherei" to="Bücherei" />
+    <Word from="BIind" to="Blind" />
+    <Word from="Biirger" to="Bürger" />
+    <Word from="Biirgerrechte" to="Bürgerrechte" />
+    <Word from="Biiro" to="Büro" />
+    <Word from="Biiros" to="Büros" />
+    <Word from="Biirotiir" to="Bürotür" />
+    <Word from="biirsten" to="bürsten" />
+    <Word from="Biise" to="Böse" />
+    <Word from="Biisen" to="Bösen" />
+    <Word from="biises" to="böses" />
+    <Word from="Bijchern" to="Büchern" />
+    <Word from="Bijhne" to="Bühne" />
+    <Word from="Bijndnis" to="Bündnis" />
+    <Word from="Bijrger" to="Bürger" />
+    <Word from="Bijrgermeister" to="Bürgermeister" />
+    <Word from="Bijro" to="Büro" />
+    <Word from="Bijrokraten" to="Bürokraten" />
+    <Word from="Bijrzel" to="Bürzel" />
+    <Word from="Bilchern" to="Büchern" />
+    <Word from="Bildseitenverhéltnis" to="Bildseitenverhältnis" />
+    <Word from="Bilndel" to="Bündel" />
+    <Word from="Bilro" to="Büro" />
+    <Word from="BIood" to="Blood" />
+    <Word from="BIQIS" to="Bloß" />
+    <Word from="Bischiife" to="Bischöfe" />
+    <Word from="Bischiifen" to="Bischöfen" />
+    <Word from="Bischéfe" to="Bischöfe" />
+    <Word from="bistja" to="bist ja" />
+    <Word from="bistjetzt" to="bist jetzt" />
+    <Word from="Bittejetzt" to="Bitte jetzt" />
+    <Word from="bittersiJl3es" to="bittersüßes" />
+    <Word from="Bitteschén" to="Bitteschön" />
+    <Word from="BIue" to="Blue" />
+    <Word from="bißchen" to="bisschen" />
+    <Word from="BL1hne" to="Bühne" />
+    <Word from="Bl6cke" to="Blöcke" />
+    <Word from="bl6d" to="blöd" />
+    <Word from="bl6de" to="blöde" />
+    <Word from="bl6den" to="blöden" />
+    <Word from="bl6der" to="blöder" />
+    <Word from="bl6des" to="blödes" />
+    <Word from="Bl6dian" to="Blödian" />
+    <Word from="Bl6dmann" to="Blödmann" />
+    <Word from="Bl6dsinn" to="Blödsinn" />
+    <Word from="Blauaugel" to="Blauauge!" />
+    <Word from="Blddes" to="Blödes" />
+    <Word from="Ble/bf" to="Bleibt" />
+    <Word from="bleibenl" to="bleiben!" />
+    <Word from="blelbenl" to="blelben!" />
+    <Word from="Blfidmann" to="Blödmann" />
+    <Word from="Blfidsinn" to="Blödsinn" />
+    <Word from="Blfimchen" to="Blümchen" />
+    <Word from="BLicher" to="Bücher" />
+    <Word from="BLihne" to="Bühne" />
+    <Word from="Bliid" to="Blöd" />
+    <Word from="bliide" to="blöde" />
+    <Word from="bliiden" to="blöden" />
+    <Word from="bliidere" to="blödere" />
+    <Word from="bliides" to="blödes" />
+    <Word from="Bliidmann" to="Blödmann" />
+    <Word from="Bliidsinn" to="Blödsinn" />
+    <Word from="bliiht" to="blüht" />
+    <Word from="bliirgerlichen" to="bürgerlichen" />
+    <Word from="Blijmchen" to="Blümchen" />
+    <Word from="Bllck" to="Blick" />
+    <Word from="Bllindel" to="Bündel" />
+    <Word from="Blllroklammer" to="Büroklammer" />
+    <Word from="bln" to="bin" />
+    <Word from="bloB" to="bloß" />
+    <Word from="bloBen" to="bloßen" />
+    <Word from="bloBstellen" to="bloßstellen" />
+    <Word from="blockiertl" to="blockiert!" />
+    <Word from="BLODE" to="BLÖDE" />
+    <Word from="blof$" to="bloß" />
+    <Word from="blofl" to="bloß" />
+    <Word from="Blol2&gt;" to="Bloß" />
+    <Word from="blol3" to="bloß" />
+    <Word from="blol3&gt;" to="bloß" />
+    <Word from="blol3stellen" to="bloßstellen" />
+    <Word from="bloli" to="bloß" />
+    <Word from="blolistellen" to="bloßstellen" />
+    <Word from="blolls" to="bloß" />
+    <Word from="bls" to="bis" />
+    <Word from="Blst" to="Bist" />
+    <Word from="bltte" to="bitte" />
+    <Word from="Blumenstréiulichen" to="Blumensträußchen" />
+    <Word from="Blumentépfen" to="Blumentöpfen" />
+    <Word from="Blutgetränkte" to="Blut getränkte" />
+    <Word from="Blutgetrénkte" to="Blutgetränkte" />
+    <Word from="blutjungl" to="blutjung!" />
+    <Word from="blutriinstig" to="blutrünstig" />
+    <Word from="Blutvergiefien" to="Blutvergießen" />
+    <Word from="bléd" to="blöd" />
+    <Word from="Bléde" to="Blöde" />
+    <Word from="bléden" to="blöden" />
+    <Word from="bléder" to="blöder" />
+    <Word from="Blédes" to="Blödes" />
+    <Word from="Blédheit" to="Blödheit" />
+    <Word from="Blédmann" to="Blödmann" />
+    <Word from="Blédsinn" to="Blödsinn" />
+    <Word from="Bléiser" to="Bläser" />
+    <Word from="Bléser" to="Bläser" />
+    <Word from="blést" to="bläst" />
+    <Word from="Bnjicke" to="Brücke" />
+    <Word from="Bodenschétze" to="Bodenschätze" />
+    <Word from="Bogenschiefien" to="Bogenschießen" />
+    <Word from="Bogenschiefienl" to="Bogenschießen!" />
+    <Word from="Bogenschiefiens" to="Bogenschießens" />
+    <Word from="Bogenschiitze" to="Bogenschütze" />
+    <Word from="Bogenschiitzen" to="Bogenschützen" />
+    <Word from="Bogenschijtze" to="Bogenschütze" />
+    <Word from="Bogenschijtzen" to="Bogenschützen" />
+    <Word from="Bogenschutzen" to="Bogenschützen" />
+    <Word from="Bogenschutzenl" to="Bogenschützen!" />
+    <Word from="BOnjour" to="Bonjour" />
+    <Word from="bosartige" to="bösartige" />
+    <Word from="Bracken" to="Brocken" />
+    <Word from="Briicke" to="Brücke" />
+    <Word from="Briicken" to="Brücken" />
+    <Word from="Briider" to="Brüder" />
+    <Word from="Briihe" to="Brühe" />
+    <Word from="Briillen" to="Brüllen" />
+    <Word from="briillt" to="brüllt" />
+    <Word from="Brijcke" to="Brücke" />
+    <Word from="Brijderlichkeit" to="Brüderlichkeit" />
+    <Word from="brijllen" to="brüllen" />
+    <Word from="Brilcke" to="Brücke" />
+    <Word from="Brilder" to="Brüder" />
+    <Word from="Brilllen" to="Brüllen" />
+    <Word from="brillltjeden" to="brüllt jeden" />
+    <Word from="Brilnette" to="Brünette" />
+    <Word from="Brilsten" to="Brüsten" />
+    <Word from="brilten" to="brüten" />
+    <Word from="BrL'lcke" to="Brücke" />
+    <Word from="brL'lllen" to="brüllen" />
+    <Word from="brlliderliche" to="brüderliche" />
+    <Word from="Brllidern" to="Brüdern" />
+    <Word from="Brlliste" to="Brüste" />
+    <Word from="Broschijre" to="Broschüre" />
+    <Word from="Broschilren" to="Broschüren" />
+    <Word from="Broschuren" to="Broschüren" />
+    <Word from="Brucke" to="Brücke" />
+    <Word from="Brucken" to="Brücken" />
+    <Word from="Brudern" to="Brüdern" />
+    <Word from="Bruhe" to="Brühe" />
+    <Word from="brullen" to="brüllen" />
+    <Word from="brullt" to="brüllt" />
+    <Word from="Brutalitiit" to="Brutalität" />
+    <Word from="Brutzelhtihnchen" to="Brutzelhühnchen" />
+    <Word from="Bréchtet" to="Brächtet" />
+    <Word from="Bréiutigam" to="Bräutigam" />
+    <Word from="Brésel" to="Brösel" />
+    <Word from="Brétchen" to="Brötchen" />
+    <Word from="bréuchte" to="bräuchte" />
+    <Word from="bréuchten" to="bräuchten" />
+    <Word from="bréunen" to="bräunen" />
+    <Word from="Bréute" to="Bräute" />
+    <Word from="Brflcke" to="Brücke" />
+    <Word from="Brflder" to="Brüder" />
+    <Word from="Btiro" to="Büro" />
+    <Word from="Btiser" to="Böser" />
+    <Word from="Bucher" to="Bücher" />
+    <Word from="Buchern" to="Büchern" />
+    <Word from="Budgetkiirzung" to="Budgetkürzung" />
+    <Word from="BUFO" to="Büro" />
+    <Word from="Bugschutzgerate" to="Bugschutzgeräte" />
+    <Word from="Buhnenbild" to="Bühnenbild" />
+    <Word from="Bullel" to="Bulle!" />
+    <Word from="Buml" to="Bum!" />
+    <Word from="Bundnis" to="Bündnis" />
+    <Word from="Burger" to="Bürger" />
+    <Word from="Burgerrechtlerin" to="Bürgerrechtlerin" />
+    <Word from="Buro" to="Büro" />
+    <Word from="BURO" to="BÜRO" />
+    <Word from="Burol" to="Büro!" />
+    <Word from="Burottlr" to="Bürotür" />
+    <Word from="Busche" to="Büsche" />
+    <Word from="Béickchen" to="Bäckchen" />
+    <Word from="Béickerei" to="Bäckerei" />
+    <Word from="Béille" to="Bälle" />
+    <Word from="Béinder" to="Bänder" />
+    <Word from="Béir" to="Bär" />
+    <Word from="Béirgermeister" to="Bürgermeister" />
+    <Word from="Béiro" to="Büro" />
+    <Word from="béise" to="böse" />
+    <Word from="Béiume" to="Bäume" />
+    <Word from="Bénder" to="Bänder" />
+    <Word from="Bér" to="Bär" />
+    <Word from="Béren" to="Bären" />
+    <Word from="Bérenhasser" to="Bärenhasser" />
+    <Word from="Bérenhunger" to="Bärenhunger" />
+    <Word from="Bérenjéger" to="Bärenjäger" />
+    <Word from="Bérenkénig" to="Bärenkönig" />
+    <Word from="Bérenlaute" to="Bärenlaute" />
+    <Word from="Bérenrolle" to="Bärenrolle" />
+    <Word from="Bérenschnitzereien" to="Bärenschnitzereien" />
+    <Word from="Bérenstimmen" to="Bärenstimmen" />
+    <Word from="Bérin" to="Bärin" />
+    <Word from="Bérisch" to="Bärisch" />
+    <Word from="Bérs" to="Bärs" />
+    <Word from="Bérte" to="Bärte" />
+    <Word from="bés" to="bös" />
+    <Word from="bése" to="böse" />
+    <Word from="bésen" to="bösen" />
+    <Word from="Béses" to="Böses" />
+    <Word from="Béume" to="Bäume" />
+    <Word from="Béumen" to="Bäumen" />
+    <Word from="Bflchern" to="Büchern" />
+    <Word from="Bflste" to="Büste" />
+    <Word from="Cafe" to="Café" />
+    <Word from="Cafä" to="Café" />
+    <Word from="CASAREN" to="CÄSAREN" />
+    <Word from="Charakterméngel" to="Charaktermängel" />
+    <Word from="Charakterstérke" to="Charakterstärke" />
+    <Word from="Chrlntlna" to="Christina" />
+    <Word from="Ciden" to="öden" />
+    <Word from="Ciffnet" to="Öffnet" />
+    <Word from="Cihrchen" to="Öhrchen" />
+    <Word from="Citroén" to="Citroën" />
+    <Word from="clamit" to="damit" />
+    <Word from="class" to="dass" />
+    <Word from="Clbernimmt" to="übernimmt" />
+    <Word from="cler" to="der" />
+    <Word from="Coimbrasl" to="Coimbras!" />
+    <Word from="CommanderWill" to="Commander Will" />
+    <Word from="Corenillal" to="Corenilla!" />
+    <Word from="Cowboyscheifi" to="Cowboyscheiß" />
+    <Word from="César" to="Cäsar" />
+    <Word from="D/e" to="Die" />
+    <Word from="d/ese" to="diese" />
+    <Word from="d/esem" to="diesem" />
+    <Word from="d/esen" to="diesen" />
+    <Word from="D/eser" to="Dieser" />
+    <Word from="D/eses" to="Dieses" />
+    <Word from="D/sko" to="Disko" />
+    <Word from="dabel" to="dabei" />
+    <Word from="dachfen" to="dachten" />
+    <Word from="daffir" to="dafür" />
+    <Word from="dafiir" to="dafür" />
+    <Word from="Dafijr" to="Dafür" />
+    <Word from="Dafijur" to="Dafür" />
+    <Word from="Dafilr" to="Dafür" />
+    <Word from="dafL'lr" to="dafür" />
+    <Word from="dafLir" to="dafür" />
+    <Word from="dafljr" to="dafür" />
+    <Word from="dafllir" to="dafür" />
+    <Word from="Daflllrwar" to="Dafür war" />
+    <Word from="daftir" to="dafür" />
+    <Word from="dafUr" to="dafür" />
+    <Word from="dafzjir" to="dafür" />
+    <Word from="dajemand" to="da jemand" />
+    <Word from="dal" to="da!" />
+    <Word from="Damenhénde" to="Damenhände" />
+    <Word from="damitl" to="damit!" />
+    <Word from="damlt" to="damit" />
+    <Word from="DANEMARK" to="DÄNEMARK" />
+    <Word from="darfiber" to="darüber" />
+    <Word from="Dariiber" to="Darüber" />
+    <Word from="darijber" to="darüber" />
+    <Word from="Darilber" to="Darüber" />
+    <Word from="dart/'ber" to="darüber" />
+    <Word from="dartlber" to="darüber" />
+    <Word from="DARUBER" to="DARÜBER" />
+    <Word from="DarUber" to="Darüber" />
+    <Word from="dasjetzt" to="das jetzt" />
+    <Word from="dasl" to="das!" />
+    <Word from="Dateniibermittlung" to="Datenübermittlung" />
+    <Word from="dauem" to="dauern" />
+    <Word from="dauerf" to="dauert" />
+    <Word from="dazugehéren" to="dazugehören" />
+    <Word from="Daß" to="Dass" />
+    <Word from="Dafllr" to="Dafür" />
+    <Word from="Ddrfern" to="Dörfern" />
+    <Word from="def" to="der" />
+    <Word from="Defekf/v" to="Detektiv" />
+    <Word from="deinerZelle" to="deiner Zelle" />
+    <Word from="deln" to="dein" />
+    <Word from="delne" to="deine" />
+    <Word from="demfiltigen" to="demütigen" />
+    <Word from="Demijtigung" to="Demütigung" />
+    <Word from="demllitige" to="demütige" />
+    <Word from="demllitigen" to="demütigen" />
+    <Word from="denkwurdiger" to="denkwürdiger" />
+    <Word from="denkwflrdiger" to="denkwürdiger" />
+    <Word from="derAbgeordnete" to="der Abgeordnete" />
+    <Word from="derAusgabe" to="der Ausgabe" />
+    <Word from="derAusl6ser" to="der Auslöser" />
+    <Word from="DerjL'lngste" to="Der jüngste" />
+    <Word from="derjunge" to="der junge" />
+    <Word from="dermaben" to="dermaßen" />
+    <Word from="derTyp" to="der Typ" />
+    <Word from="derWeg" to="der Weg" />
+    <Word from="derWelle" to="der Welle" />
+    <Word from="DerWL1rfel" to="Der Würfel" />
+    <Word from="DerZauberer" to="Der Zauberer" />
+    <Word from="de__n" to="den" />
+    <Word from="dfeserr" to="diesem" />
+    <Word from="dffentlichen" to="öffentlichen" />
+    <Word from="dffnen" to="öffnen" />
+    <Word from="Dfimonen" to="Dämonen" />
+    <Word from="dfinn" to="dünn" />
+    <Word from="dichl" to="dich!" />
+    <Word from="diejüngste" to="die Jüngste" />
+    <Word from="dienstunfahig" to="dienstunfähig" />
+    <Word from="Dieselkapitéin" to="Dieselkapitän" />
+    <Word from="Dieselkapitén" to="Dieselkapitän" />
+    <Word from="Dieselmotorenl" to="Dieselmotoren!" />
+    <Word from="dieserAufnahme" to="dieser Aufnahme" />
+    <Word from="Dieserjunge" to="Dieser junge" />
+    <Word from="Diiit" to="Diät" />
+    <Word from="diirfe" to="dürfe" />
+    <Word from="Diirfen" to="Dürfen" />
+    <Word from="diirft" to="dürft" />
+    <Word from="diirfte" to="dürfte" />
+    <Word from="dijfien" to="dürfen" />
+    <Word from="dijnn" to="dünn" />
+    <Word from="dijrfen" to="dürfen" />
+    <Word from="Dijrfte" to="Dürfte" />
+    <Word from="dijstere" to="düstere" />
+    <Word from="dilmmer" to="dümmer" />
+    <Word from="dilrfen" to="dürfen" />
+    <Word from="dilrft" to="dürft" />
+    <Word from="dilrften" to="dürften" />
+    <Word from="dilrftig" to="dürftig" />
+    <Word from="Dine" to="Däne" />
+    <Word from="dirja" to="dir ja" />
+    <Word from="dirjemand" to="dir jemand" />
+    <Word from="dirjetzt" to="dir jetzt" />
+    <Word from="dirJulie" to="dir Julie" />
+    <Word from="dirl" to="dir!" />
+    <Word from="dirwehzutun" to="dir wehzutun" />
+    <Word from="Diét" to="Diät" />
+    <Word from="Diétberaterin" to="Diätberaterin" />
+    <Word from="Diétbier" to="Diätbier" />
+    <Word from="dlch" to="dich" />
+    <Word from="Dle" to="Die" />
+    <Word from="dles" to="dies" />
+    <Word from="Dlese" to="Diese" />
+    <Word from="Dlfit" to="Diät" />
+    <Word from="Dlitplan" to="Diätplan" />
+    <Word from="dllirfen" to="dürfen" />
+    <Word from="dllirft" to="dürft" />
+    <Word from="dllirstet" to="dürstet" />
+    <Word from="dlr" to="dir" />
+    <Word from="doc/1" to="doch" />
+    <Word from="dochl" to="doch!" />
+    <Word from="dolthin" to="dorthin" />
+    <Word from="Doppelgfiner" to="Doppelgänger" />
+    <Word from="Doppelgfinger" to="Doppelgänger" />
+    <Word from="Doppelgéinger" to="Doppelgänger" />
+    <Word from="Doppelgénger" to="Doppelgänger" />
+    <Word from="Doppelzijngig" to="Doppelzüngig" />
+    <Word from="doppelztmgiger" to="doppelzüngiger" />
+    <Word from="dor" to="der" />
+    <Word from="Dr'a'ngt" to="Drängt" />
+    <Word from="drachengriinen" to="drachengrünen" />
+    <Word from="Drahte" to="Drähte" />
+    <Word from="dranl" to="dran!" />
+    <Word from="drau/3en" to="draußen" />
+    <Word from="drau/Sen" to="draußen" />
+    <Word from="drauBen" to="draußen" />
+    <Word from="drauf$en" to="draußen" />
+    <Word from="draufdrilcken" to="draufdrücken" />
+    <Word from="draufgestllirzt" to="draufgestürzt" />
+    <Word from="draufgéngerisch" to="draufgängerisch" />
+    <Word from="draufien" to="draußen" />
+    <Word from="draufken" to="draußen" />
+    <Word from="drauflsenl" to="draußen!" />
+    <Word from="drauféen" to="draußen" />
+    <Word from="drauilen" to="draußen" />
+    <Word from="draul3en" to="draußen" />
+    <Word from="draul5en" to="draußen" />
+    <Word from="draulien" to="draußen" />
+    <Word from="draullen" to="draußen" />
+    <Word from="draulSen" to="draußen" />
+    <Word from="Dreckléchern" to="Drecklöchern" />
+    <Word from="Drecksmiihle" to="Drecksmühle" />
+    <Word from="Drecksécke" to="Drecksäcke" />
+    <Word from="drfiben" to="drüben" />
+    <Word from="Drfick" to="Drück" />
+    <Word from="Drfingeln" to="Drängeln" />
+    <Word from="drih" to="dritt" />
+    <Word from="driiben" to="drüben" />
+    <Word from="driicken" to="drücken" />
+    <Word from="driickt" to="drückt" />
+    <Word from="drijben" to="drüben" />
+    <Word from="drijber" to="drüber" />
+    <Word from="drijck" to="drück" />
+    <Word from="drijckt" to="drückt" />
+    <Word from="drilben" to="drüben" />
+    <Word from="drilber" to="drüber" />
+    <Word from="drilcken" to="drücken" />
+    <Word from="drLiber" to="drüber" />
+    <Word from="drlliben" to="drüben" />
+    <Word from="drlllben" to="drüben" />
+    <Word from="Drogenabhéngige" to="Drogenabhängige" />
+    <Word from="Drticken" to="Drücken" />
+    <Word from="druben" to="drüben" />
+    <Word from="drubenl" to="drüben!" />
+    <Word from="druber" to="drüber" />
+    <Word from="Druckknépfe" to="Druckknöpfe" />
+    <Word from="drunterliegt" to="drunter liegt" />
+    <Word from="Drénage" to="Dränage" />
+    <Word from="dréngeln" to="drängeln" />
+    <Word from="dréngen" to="drängen" />
+    <Word from="dréngt" to="drängt" />
+    <Word from="drflben" to="drüben" />
+    <Word from="dtirft" to="dürft" />
+    <Word from="dtlrfen" to="dürfen" />
+    <Word from="Dudelsécken" to="Dudelsäcken" />
+    <Word from="dUFf€l'1" to="dürfen" />
+    <Word from="dul" to="du!" />
+    <Word from="dull" to="dass" />
+    <Word from="Dummk6pfe" to="Dummköpfe" />
+    <Word from="Dummkiipfe" to="Dummköpfe" />
+    <Word from="Dunnschiss" to="Dünnschiss" />
+    <Word from="durchdrficken" to="durchdrücken" />
+    <Word from="durchdréngen" to="durchdrängen" />
+    <Word from="Durchfiihrung" to="Durchführung" />
+    <Word from="durchfuhren" to="durchführen" />
+    <Word from="durchgefiihlt" to="durchgeführt" />
+    <Word from="durchgefijhrt" to="durchgeführt" />
+    <Word from="durchgefuhrt" to="durchgeführt" />
+    <Word from="durchgefflhrt" to="durchgeführt" />
+    <Word from="Durchgénge" to="Durchgänge" />
+    <Word from="Durchladenl" to="Durchladen!" />
+    <Word from="durchlfichere" to="durchlöchere" />
+    <Word from="durchsetzungsféhiger" to="durchsetzungsfähiger" />
+    <Word from="durchstébern" to="durchstöbern" />
+    <Word from="durchwilhlt" to="durchwühlt" />
+    <Word from="durchzufilhren" to="durchzuführen" />
+    <Word from="durchzufuhren" to="durchzuführen" />
+    <Word from="Durfen" to="Dürfen" />
+    <Word from="durft" to="dürft" />
+    <Word from="dusterer" to="düsterer" />
+    <Word from="Décher" to="Dächer" />
+    <Word from="Déimon" to="Dämon" />
+    <Word from="Déimonen" to="Dämonen" />
+    <Word from="Déinemark" to="Dänemark" />
+    <Word from="Déinemarks" to="Dänemarks" />
+    <Word from="Déinen" to="Dänen" />
+    <Word from="déinisches" to="dänisches" />
+    <Word from="démlich" to="dämlich" />
+    <Word from="Démliche" to="Dämliche" />
+    <Word from="démlichen" to="dämlichen" />
+    <Word from="démlicher" to="dämlicher" />
+    <Word from="démlichl" to="dämlich" />
+    <Word from="démmert" to="dämmert" />
+    <Word from="Démonenbéren" to="Dämonenbären" />
+    <Word from="démonischen" to="dämonischen" />
+    <Word from="Dérme" to="Därme" />
+    <Word from="Dérrfleisch" to="Dörrfleisch" />
+    <Word from="Déumchen" to="Däumchen" />
+    <Word from="dflrfen" to="dürfen" />
+    <Word from="E//e" to="Elle" />
+    <Word from="e/n" to="ein" />
+    <Word from="e/ne" to="eine" />
+    <Word from="e/nem" to="einem" />
+    <Word from="e/nen" to="einen" />
+    <Word from="e/ner" to="einer" />
+    <Word from="e/nes" to="eines" />
+    <Word from="e/ns" to="eins" />
+    <Word from="e/nsf" to="einst" />
+    <Word from="E9YPt" to="Egypt" />
+    <Word from="Ea/vtes" to="Echtes" />
+    <Word from="ebenbfirtig" to="ebenbürtig" />
+    <Word from="ebenburtige" to="ebenbürtige" />
+    <Word from="Ec/vte" to="Echte" />
+    <Word from="echfen" to="echten" />
+    <Word from="edelmfltig" to="edelmütig" />
+    <Word from="efn" to="ein" />
+    <Word from="efwas" to="etwas" />
+    <Word from="Eheminner" to="Ehemänner" />
+    <Word from="Eheménnern" to="Ehemännern" />
+    <Word from="Ehezerstfirerin" to="Ehezerstörerin" />
+    <Word from="Ehrenbijrger" to="Ehrenbürger" />
+    <Word from="EHRENBURGERSCHAFT" to="EHRENBÜRGERSCHAFT" />
+    <Word from="Ehrengéiste" to="Ehrengäste" />
+    <Word from="Eichhfirnchen" to="Eichhörnchen" />
+    <Word from="Eichhiirnchen" to="Eichhörnchen" />
+    <Word from="Eichhérnchens" to="Eichhörnchens" />
+    <Word from="eifersfichtig" to="eifersüchtig" />
+    <Word from="eifersiichtig" to="eifersüchtig" />
+    <Word from="eifersflchtig" to="eifersüchtig" />
+    <Word from="eigenhéndig" to="eigenhändig" />
+    <Word from="eigenmlchtig" to="eigenmächtig" />
+    <Word from="eigenntltziges" to="eigennütziges" />
+    <Word from="Eihnlich" to="ähnlich" />
+    <Word from="Eimen/veise" to="Eimerweise" />
+    <Word from="Einbruche" to="Einbrüche" />
+    <Word from="eindriicken" to="eindrücken" />
+    <Word from="Eindring/Inge" to="Eindringlinge" />
+    <Word from="eindrucken" to="eindrücken" />
+    <Word from="einejunge" to="eine junge" />
+    <Word from="einerfrflhen" to="einer frühen" />
+    <Word from="einervorfuhrung" to="einer Vorführung" />
+    <Word from="einfiihren" to="einführen" />
+    <Word from="Einfiihrung" to="Einführung" />
+    <Word from="einfilgen" to="einfügen" />
+    <Word from="einfilhlsamsten" to="einfühlsamsten" />
+    <Word from="einflllgen" to="einfügen" />
+    <Word from="Einflusse" to="Einflüsse" />
+    <Word from="einfugen" to="einfügen" />
+    <Word from="einfuhrten" to="einführten" />
+    <Word from="Einfuhrung" to="Einführung" />
+    <Word from="Einféltige" to="Einfältige" />
+    <Word from="eingefiigt" to="eingefügt" />
+    <Word from="eingefflgt" to="eingefügt" />
+    <Word from="eingehiillt" to="eingehüllt" />
+    <Word from="eingeprégt" to="eingeprägt" />
+    <Word from="eingeréiumt" to="eingeräumt" />
+    <Word from="eingeréumt" to="eingeräumt" />
+    <Word from="eingeschléfert" to="eingeschläfert" />
+    <Word from="eingeschrénkt" to="eingeschränkt" />
+    <Word from="eingeschéitzt" to="eingeschätzt" />
+    <Word from="eingeschétzt" to="eingeschätzt" />
+    <Word from="eingesturzt" to="eingestürzt" />
+    <Word from="eingieBt" to="eingießt" />
+    <Word from="eingschaltet" to="eingeschaltet" />
+    <Word from="Einhérnern" to="Einhörner" />
+    <Word from="einlegenl" to="einlegen!" />
+    <Word from="einlédt" to="einlädt" />
+    <Word from="einlésen" to="einlösen" />
+    <Word from="Einsatzfahigkeit" to="Einsatzfähigkeit" />
+    <Word from="Einschiichterung" to="Einschüchterung" />
+    <Word from="Einschliefklich" to="Einschließlich" />
+    <Word from="Einschlielilich" to="Einschließlich" />
+    <Word from="einstellenl" to="einstellen!" />
+    <Word from="Einsétze" to="Einsätze" />
+    <Word from="einténig" to="eintönig" />
+    <Word from="Einzelgéngerin" to="Einzelgängerin" />
+    <Word from="einzuschétzen" to="einzuschätzen" />
+    <Word from="Eisstiirme" to="Eisstürme" />
+    <Word from="Elektrizitét" to="Elektrizität" />
+    <Word from="elfenbeingetfinte" to="elfenbeingetönte" />
+    <Word from="elitérer" to="elitärer" />
+    <Word from="Eln" to="Ein" />
+    <Word from="Elne" to="Eine" />
+    <Word from="elnem" to="einem" />
+    <Word from="Elnen" to="Einen" />
+    <Word from="elner" to="einer" />
+    <Word from="Elnes" to="Eines" />
+    <Word from="empfindungsféhigen" to="empfindungsfähigen" />
+    <Word from="Empféinger" to="Empfänger" />
+    <Word from="empféngt" to="empfängt" />
+    <Word from="Empiirend" to="Empörend" />
+    <Word from="Empiirendste" to="Empörendste" />
+    <Word from="empiirt" to="empört" />
+    <Word from="emst" to="ernst" />
+    <Word from="en/varten" to="erwarten" />
+    <Word from="En/vartungen" to="Erwartungen" />
+    <Word from="en/véhnt" to="erwähnt" />
+    <Word from="Enchantä" to="Enchanté" />
+    <Word from="endgiiltig" to="endgültig" />
+    <Word from="endgultig" to="endgültig" />
+    <Word from="endgultigen" to="endgültigen" />
+    <Word from="endgflltig" to="endgültig" />
+    <Word from="endlichl" to="endlich!" />
+    <Word from="ENERIGE" to="ENERGIE" />
+    <Word from="enfternt" to="entfernt" />
+    <Word from="Englénder" to="Engländer" />
+    <Word from="Englénderin" to="Engländerin" />
+    <Word from="eniillen" to="erfüllen" />
+    <Word from="entbl6Bte" to="entblößte" />
+    <Word from="entbl6f$en" to="entblößen" />
+    <Word from="entfiihre" to="entführe" />
+    <Word from="entfiihrt" to="entführt" />
+    <Word from="entfiihrte" to="entführte" />
+    <Word from="Entfiihrung" to="Entführung" />
+    <Word from="Entftihrung" to="Entführung" />
+    <Word from="ENTFUHRUNGSVERDACHTIGER" to="ENTFÜHRUNGSVERDÄCHTIGER" />
+    <Word from="enthllt" to="enthält" />
+    <Word from="enthUllt" to="enthüllt" />
+    <Word from="enthélt" to="enthält" />
+    <Word from="entliiften" to="entlüften" />
+    <Word from="Entliiftungen" to="Entlüftungen" />
+    <Word from="Entlijlftungen" to="Entlüftungen" />
+    <Word from="entluften" to="entlüften" />
+    <Word from="entlésst" to="entlässt" />
+    <Word from="Entreilit" to="Entreißt" />
+    <Word from="entriistet" to="entrüstet" />
+    <Word from="entréitseln" to="enträtseln" />
+    <Word from="Entschlrfen" to="Entschärfen" />
+    <Word from="Entschlull" to="Entschluss" />
+    <Word from="ENTSCHLUSSELN" to="ENTSCHLÜSSELN" />
+    <Word from="Entschlussen" to="Entschlüssen" />
+    <Word from="entschérfen" to="entschärfen" />
+    <Word from="enttausche" to="enttäusche" />
+    <Word from="enttiiuscht" to="enttäuscht" />
+    <Word from="Enttluscht" to="Enttäuscht" />
+    <Word from="Enttluschungen" to="Enttäuschungen" />
+    <Word from="enttéiuschen" to="enttäuschen" />
+    <Word from="enttéuschen" to="enttäuschen" />
+    <Word from="enttéuschst" to="enttäuschst" />
+    <Word from="enttéuscht" to="enttäuscht" />
+    <Word from="Entv\/Urfe" to="Entwürfe" />
+    <Word from="Entwicklungsléndern" to="Entwicklungsländern" />
+    <Word from="entzllickt" to="entzückt" />
+    <Word from="entzllindet" to="entzündet" />
+    <Word from="entzuckend" to="entzückend" />
+    <Word from="entzundet" to="entzündet" />
+    <Word from="enzvérmt" to="erwärmt" />
+    <Word from="Er6ffnen" to="Eröffnen" />
+    <Word from="erbérml/ch" to="erbärmlich" />
+    <Word from="erbérmlich" to="erbärmlich" />
+    <Word from="Erbérmliches" to="Erbärmliches" />
+    <Word from="Erdnijsse" to="Erdnüsse" />
+    <Word from="erdriickt" to="erdrückt" />
+    <Word from="erdéihnliche" to="erdähnliche" />
+    <Word from="erfebst" to="erlebst" />
+    <Word from="erffillen" to="erfüllen" />
+    <Word from="erfiffnet" to="eröffnet" />
+    <Word from="erfiille" to="erfülle" />
+    <Word from="erfiillen" to="erfüllen" />
+    <Word from="erfiillt" to="erfüllt" />
+    <Word from="erfijllt" to="erfüllt" />
+    <Word from="erfillle" to="erfülle" />
+    <Word from="erfilllen" to="erfüllen" />
+    <Word from="erfilllt" to="erfüllt" />
+    <Word from="erfllille" to="erfülle" />
+    <Word from="erfllillt" to="erfüllt" />
+    <Word from="erflllllen" to="erfüllen" />
+    <Word from="Erfolgl" to="Erfolg!" />
+    <Word from="erfullen" to="erfüllen" />
+    <Word from="erfullt" to="erfüllt" />
+    <Word from="erféhrst" to="erfährst" />
+    <Word from="erféhrt" to="erfährt" />
+    <Word from="erfflllen" to="erfüllen" />
+    <Word from="ergrllindet" to="ergründet" />
+    <Word from="erhalfen" to="erhalten" />
+    <Word from="Erhdhe" to="Erhöhe" />
+    <Word from="erhiihter" to="erhöhter" />
+    <Word from="erhiiren" to="erhören" />
+    <Word from="ERHKLT" to="ERHÄLT" />
+    <Word from="erhllt" to="erhält" />
+    <Word from="erhéhen" to="erhöhen" />
+    <Word from="erhéht" to="erhöht" />
+    <Word from="erhéilt" to="erhällt" />
+    <Word from="erhélt" to="erhält" />
+    <Word from="erhért" to="erhört" />
+    <Word from="erhérte" to="erhörte" />
+    <Word from="eriiffnet" to="eröffnet" />
+    <Word from="erja" to="er ja" />
+    <Word from="erjetzt" to="er jetzt" />
+    <Word from="erjung" to="er jung" />
+    <Word from="erkl'a'ren" to="erklären" />
+    <Word from="erkl'air's" to="erklär's" />
+    <Word from="erklaren" to="erklären" />
+    <Word from="erklfire" to="erkläre" />
+    <Word from="Erklfirung" to="Erklärung" />
+    <Word from="erklirt" to="erklärt" />
+    <Word from="erkllre" to="erkläre" />
+    <Word from="erkllrt" to="erklärt" />
+    <Word from="erkllrte" to="erklärte" />
+    <Word from="erkllrten" to="erklärten" />
+    <Word from="Erkllrung" to="Erklärung" />
+    <Word from="erkléir" to="erklär" />
+    <Word from="erkléire" to="erkläre" />
+    <Word from="erkléiren" to="erklären" />
+    <Word from="erklér" to="erklär" />
+    <Word from="erklér's" to="erklär's" />
+    <Word from="erklérbar" to="erklärbar" />
+    <Word from="Erklére" to="Erkläre" />
+    <Word from="erkléren" to="erklären" />
+    <Word from="erklért" to="erklärt" />
+    <Word from="Erklérung" to="Erklärung" />
+    <Word from="erkéltest" to="erkaltest" />
+    <Word from="erlC'&gt;st" to="erlöst" />
+    <Word from="erldse" to="erlöse" />
+    <Word from="Erled/gen" to="Erledigen" />
+    <Word from="erlieB" to="erließ" />
+    <Word from="erlnnem" to="erinnern" />
+    <Word from="erléscht" to="erlöscht" />
+    <Word from="erlésen" to="erlösen" />
+    <Word from="erlést" to="erlöst" />
+    <Word from="Erlésung" to="Erlösung" />
+    <Word from="ermbglichen" to="ermöglichen" />
+    <Word from="Erméchtige" to="Ermächtige" />
+    <Word from="erméglicht" to="ermöglicht" />
+    <Word from="erméglichte" to="ermöglichte" />
+    <Word from="ernlllchtert" to="ernüchtert" />
+    <Word from="ernéhren" to="ernähren" />
+    <Word from="Ernéhrung" to="Ernährung" />
+    <Word from="eroffnet" to="eröffnet" />
+    <Word from="Erpressungsscheilie" to="Erpressungsscheiße" />
+    <Word from="errétst" to="errätst" />
+    <Word from="erschieB" to="erschieß" />
+    <Word from="erschieBen" to="erschießen" />
+    <Word from="erschiefien" to="erschießen" />
+    <Word from="erschiefit" to="erschießt" />
+    <Word from="erschiefke" to="erschieße" />
+    <Word from="erschielie" to="erschieße" />
+    <Word from="Erschielit" to="Erschießt" />
+    <Word from="erschiipft" to="erschöpft" />
+    <Word from="erschiittert" to="erschüttert" />
+    <Word from="erschilttert" to="erschüttert" />
+    <Word from="erschlégt" to="erschlägt" />
+    <Word from="ERTCHDNT" to="ERTÖNT" />
+    <Word from="ERTCNT" to="ERTÖNT" />
+    <Word from="ERTGNT" to="ERTÖNT" />
+    <Word from="ertiffnen" to="eröffnen" />
+    <Word from="ertrégst" to="erträgst" />
+    <Word from="ertréinken" to="ertränken" />
+    <Word from="ertént" to="ertönt" />
+    <Word from="ervvartez" to="erwartet" />
+    <Word from="ervvilrgen" to="erwürgen" />
+    <Word from="ervvéhnen" to="erwähnen" />
+    <Word from="ervvéihnen" to="erwähnen" />
+    <Word from="ervvéihnt" to="erwähnt" />
+    <Word from="ervvéihnte" to="erwähnte" />
+    <Word from="Erv\/an" to="Erwan" />
+    <Word from="Erv\/an's" to="Erwan's" />
+    <Word from="erw'a'hnt" to="erwähnt" />
+    <Word from="Erwar" to="Er war" />
+    <Word from="erwe/sen" to="erweisen" />
+    <Word from="Erwfirmung" to="Erwärmung" />
+    <Word from="Erwird" to="Er wird" />
+    <Word from="Erwtirde" to="Er würde" />
+    <Word from="erwégt" to="erwägt" />
+    <Word from="Erwégung" to="Erwägung" />
+    <Word from="Erwéhne" to="Erwähne" />
+    <Word from="erwéhnen" to="erwähnen" />
+    <Word from="erwéhnt" to="erwähnt" />
+    <Word from="erwéhnte" to="erwähnte" />
+    <Word from="Erwéhnung" to="Erwähnung" />
+    <Word from="erwéihlt" to="erwählt" />
+    <Word from="erwéihnt" to="erwähnt" />
+    <Word from="erwérmt" to="erwärmt" />
+    <Word from="erz'a'hlt" to="erzählt" />
+    <Word from="Erzdiiizese" to="Erzdiözese" />
+    <Word from="erzfihlen" to="erzählen" />
+    <Word from="Erzfihler" to="Erzähler" />
+    <Word from="erzihlenl" to="erzählen!" />
+    <Word from="erziihlen" to="erzählen" />
+    <Word from="erziihlt" to="erzählt" />
+    <Word from="erziirnt" to="erzürnt" />
+    <Word from="erzilrnt" to="erzürnt" />
+    <Word from="erzllirnt" to="erzürnt" />
+    <Word from="erzurnen" to="erzürnen" />
+    <Word from="erzéhl" to="erzähl" />
+    <Word from="erzéhle" to="erzähle" />
+    <Word from="Erzéhlen" to="Erzählen" />
+    <Word from="erzéhlerische" to="erzählerische" />
+    <Word from="erzéhlerischen" to="erzählerischen" />
+    <Word from="erzéhlerischer" to="erzählerischer" />
+    <Word from="Erzéhlkunste" to="Erzählkünste" />
+    <Word from="erzéhlst" to="erzählst" />
+    <Word from="erzéhlt" to="erzählt" />
+    <Word from="erzéhlte" to="erzählte" />
+    <Word from="Erzéhlung" to="Erzählung" />
+    <Word from="Erzéihl" to="Erzähl" />
+    <Word from="Erzéihle" to="Erzähle" />
+    <Word from="erzéihlen" to="erzählen" />
+    <Word from="erzéihlst" to="erzählst" />
+    <Word from="erzéihlt" to="erzählt" />
+    <Word from="erzéihlte" to="erzählte" />
+    <Word from="eréffnen" to="eröffnen" />
+    <Word from="eréffnet" to="eröffnet" />
+    <Word from="eréffnete" to="eröffnete" />
+    <Word from="Eréffnungsaufnahme" to="Eröffnungsaufnahme" />
+    <Word from="Eréffnungssequenz" to="Eröffnungssequenz" />
+    <Word from="Eréffnungsszene" to="Eröffnungsszene" />
+    <Word from="Erfllllen" to="Erfüllen" />
+    <Word from="etemity" to="eternity" />
+    <Word from="etvva" to="etwa" />
+    <Word from="euc/1" to="euch" />
+    <Word from="Européer" to="Europäer" />
+    <Word from="européische" to="europäische" />
+    <Word from="ex'nfac'/7" to="einfach" />
+    <Word from="Examenspriifungen" to="Examensprüfungen" />
+    <Word from="Exekutivzusténoligkeit" to="Exekutivzuständigkeit" />
+    <Word from="Explosionenl" to="Explosionen!" />
+    <Word from="Extrablattl" to="Extrablatt!" />
+    <Word from="F/nden" to="Finden" />
+    <Word from="F/ugba/I" to="Flugball" />
+    <Word from="Fahnrich" to="Fähnrich" />
+    <Word from="fahrlissiges" to="fahrlässiges" />
+    <Word from="Fairbankverlieh" to="Fairbank verlieh" />
+    <Word from="Fallef" to="Falle!" />
+    <Word from="fallengelassen" to="fallen gelassen" />
+    <Word from="Fallschirmjégereinheiten" to="Fallschirmjägereinheiten" />
+    <Word from="Fam/Z/e" to="Familie" />
+    <Word from="Faß" to="Fass" />
+    <Word from="FBl" to="FBI" />
+    <Word from="Fe/nd" to="Feind" />
+    <Word from="fehlschlégt" to="fehlschlägt" />
+    <Word from="Feindberllihrung" to="Feindberührung" />
+    <Word from="Feindübewvachung" to="Feindüberwachung" />
+    <Word from="feltig" to="fertig" />
+    <Word from="femen" to="fernen" />
+    <Word from="fernhéilt" to="fernhält" />
+    <Word from="Festhaltenl" to="Festhalten!" />
+    <Word from="Fettwénste" to="Fettwänste" />
+    <Word from="Feuen/vehr" to="Feuerwehr" />
+    <Word from="Feuerliischer" to="Feuerlöscher" />
+    <Word from="Feuervvehrrnann" to="Feuerwehrrnann" />
+    <Word from="Feuerwehrl" to="Feuerwehr!" />
+    <Word from="Feuerwfirmen" to="Feuer wärmen" />
+    <Word from="Feuefl" to="Feuer!" />
+    <Word from="ff'Ul'1€f'€l'1" to="früheren" />
+    <Word from="Ffiegen" to="Fliegen" />
+    <Word from="ffihft" to="fühlt" />
+    <Word from="ffihren" to="führen" />
+    <Word from="ffinf" to="fünf" />
+    <Word from="ffir" to="für" />
+    <Word from="ffirchte" to="fürchte" />
+    <Word from="ffirs" to="fürs" />
+    <Word from="ffittere" to="füttere" />
+    <Word from="FI6he" to="Flöhe" />
+    <Word from="Fiasenméiher" to="Rasenmäher" />
+    <Word from="fibel" to="übel" />
+    <Word from="fiber" to="über" />
+    <Word from="fiberdressierter" to="überdressierter" />
+    <Word from="fibergezogen" to="übergezogen" />
+    <Word from="fiberhaupt" to="überhaupt" />
+    <Word from="fiberholt" to="überholt" />
+    <Word from="fiberlegt" to="überlegt" />
+    <Word from="fibernachtet" to="übernachtet" />
+    <Word from="fiberspannt" to="überspannt" />
+    <Word from="fibertreiben" to="übertreiben" />
+    <Word from="fiberzfichtete" to="überzüchtete" />
+    <Word from="fibrig" to="übrig" />
+    <Word from="Fieferenz" to="Referenz" />
+    <Word from="Fieifi" to="Reiß" />
+    <Word from="fiffentlichkeit" to="Öffentlichkeit" />
+    <Word from="fiffnen" to="öffnen" />
+    <Word from="fiffnest" to="öffnest" />
+    <Word from="fifter" to="öfter" />
+    <Word from="Fihigkeit" to="Fähigkeit" />
+    <Word from="fihneln" to="ähneln" />
+    <Word from="Fihrt" to="Fährt" />
+    <Word from="fiihl" to="fühl" />
+    <Word from="fiihle" to="fühle" />
+    <Word from="fiihlen" to="fühlen" />
+    <Word from="fiihlst" to="fühlst" />
+    <Word from="fiihlt" to="fühlt" />
+    <Word from="Fiihlte" to="Fühlte" />
+    <Word from="Fiihre" to="Führe" />
+    <Word from="Fiihren" to="Führen" />
+    <Word from="Fiihrerin" to="Führerin" />
+    <Word from="Fiihrerschein" to="Führerschein" />
+    <Word from="fiihrfe" to="führte" />
+    <Word from="fiihrt" to="führt" />
+    <Word from="fiihrte" to="führte" />
+    <Word from="Fiihrungsféihigkeiten" to="Führungsfähigkeiten" />
+    <Word from="Fiihrungsprogramm" to="Führungsprogramm" />
+    <Word from="Fiihrungsstil" to="Führungsstil" />
+    <Word from="Fiilcksicht" to="Rücksicht" />
+    <Word from="fiillen" to="füllen" />
+    <Word from="fiinden" to="fänden" />
+    <Word from="fiinf" to="fünf" />
+    <Word from="fiinfhundert" to="fünfhundert" />
+    <Word from="fiinfzehn" to="fünfzehn" />
+    <Word from="fiir" to="für" />
+    <Word from="fiirchte" to="fürchte" />
+    <Word from="fiirchten" to="fürchten" />
+    <Word from="fiirchterlich" to="fürchterlich" />
+    <Word from="fiirchterlichl" to="fürchterlich!" />
+    <Word from="fiirchterllches" to="fürchterliches" />
+    <Word from="fiirchtet" to="fürchtet" />
+    <Word from="fiirchteten" to="fürchteten" />
+    <Word from="fiirjeden" to="für jeden" />
+    <Word from="Fiirmchen" to="Förmchen" />
+    <Word from="fiirs" to="fürs" />
+    <Word from="Fijgen" to="Fügen" />
+    <Word from="fijhl" to="fühl" />
+    <Word from="fijhle" to="fühle" />
+    <Word from="fijhlen" to="fühlen" />
+    <Word from="fijhlst" to="fühlst" />
+    <Word from="fijhlt" to="fühlt" />
+    <Word from="fijhren" to="führen" />
+    <Word from="Fijhrer" to="Führer" />
+    <Word from="fijhrt" to="führt" />
+    <Word from="Fijhrungsqualitéiten" to="Führungsqualitäten" />
+    <Word from="FiJl3en" to="Füßen" />
+    <Word from="Fijlie" to="Füße" />
+    <Word from="fijlr" to="für" />
+    <Word from="Fijnf" to="Fünf" />
+    <Word from="Fijnfziger" to="Fünfziger" />
+    <Word from="fijr" to="für" />
+    <Word from="fijrchte" to="fürchte" />
+    <Word from="fijrchten" to="fürchten" />
+    <Word from="Fijrjedenl" to="Für jeden!" />
+    <Word from="fijrs" to="fürs" />
+    <Word from="fiJrVorteile" to="für Vorteile" />
+    <Word from="fijttern" to="füttern" />
+    <Word from="fijur" to="für" />
+    <Word from="filhl" to="fühl" />
+    <Word from="filhle" to="fühle" />
+    <Word from="filhlen" to="fühlen" />
+    <Word from="filhlte" to="fühlte" />
+    <Word from="filhre" to="führe" />
+    <Word from="filhren" to="führen" />
+    <Word from="Filhrern" to="Führern" />
+    <Word from="Filhrerschein" to="Führerschein" />
+    <Word from="filhrst" to="führst" />
+    <Word from="filhrt" to="führt" />
+    <Word from="filhrte" to="führte" />
+    <Word from="filhrten" to="führten" />
+    <Word from="Filhrung" to="Führung" />
+    <Word from="Fillle" to="Fülle" />
+    <Word from="Fillléen" to="Füßen" />
+    <Word from="Filmemachen" to="Filme machen" />
+    <Word from="Filml" to="Film!" />
+    <Word from="filnf" to="fünf" />
+    <Word from="Filnfl" to="Fünf!" />
+    <Word from="Filr" to="Für" />
+    <Word from="filr'ne" to="für'ne" />
+    <Word from="filrchten" to="fürchten" />
+    <Word from="filrchterlich" to="fürchterlich" />
+    <Word from="filrs" to="fürs" />
+    <Word from="filter" to="älter" />
+    <Word from="findem" to="ändern" />
+    <Word from="findenlassen" to="finden lassen" />
+    <Word from="Fingerabdrijcke" to="Fingerabdrücke" />
+    <Word from="Fingerabdrilcke" to="Fingerabdrücke" />
+    <Word from="Fingerniigeln" to="Fingernägeln" />
+    <Word from="Fingernégel" to="Fingernägel" />
+    <Word from="Fingernégeln" to="Fingernägeln" />
+    <Word from="fingstlich" to="ängstlich" />
+    <Word from="Fiothaarige" to="Rothaarige" />
+    <Word from="Firmenérzte" to="Firmenärzte" />
+    <Word from="Fischképfe" to="Fischköpfe" />
+    <Word from="FIUssigkeitsgleichgewicht" to="Flüssigkeitsgleichgewicht" />
+    <Word from="Fiusten" to="Fäusten" />
+    <Word from="FIynn" to="Flynn" />
+    <Word from="fjffnen" to="öffnen" />
+    <Word from="fL'1'r" to="für" />
+    <Word from="fL'1hle" to="fühle" />
+    <Word from="FL'1r" to="Für" />
+    <Word from="fL'ir" to="für" />
+    <Word from="fL'lr" to="für" />
+    <Word from="fL1r" to="für" />
+    <Word from="Fl6he" to="Flöhe" />
+    <Word from="Flclse" to="Rose" />
+    <Word from="fleifkige" to="fleißige" />
+    <Word from="fleifkiges" to="fleißiges" />
+    <Word from="fleil3ig" to="fleißig" />
+    <Word from="Fleischbéllchen" to="Fleischbällchen" />
+    <Word from="Fleischkl6l'Sen" to="Fleischklößen" />
+    <Word from="Flfige" to="Flüge" />
+    <Word from="Flfigell" to="Flügel!" />
+    <Word from="flfistert" to="flüstert" />
+    <Word from="Flhigkeiten" to="Fähigkeiten" />
+    <Word from="Flhnrich" to="Fähnrich" />
+    <Word from="Flhnriche" to="Fähnriche" />
+    <Word from="flieBen" to="fließen" />
+    <Word from="Fliefiband" to="Fließband" />
+    <Word from="Fliefiheck" to="Fließheck" />
+    <Word from="Flieflsbénder" to="Fließbänder" />
+    <Word from="flielit" to="fließt" />
+    <Word from="flielSt" to="fließt" />
+    <Word from="FLif$e" to="Füße" />
+    <Word from="fLihlt" to="fühlt" />
+    <Word from="fliichtige" to="flüchtige" />
+    <Word from="Fliigel" to="Flügel" />
+    <Word from="flijchtig" to="flüchtig" />
+    <Word from="Flijgel" to="Flügel" />
+    <Word from="Flijgelfedernl" to="Flügelfedern!" />
+    <Word from="Flilssige" to="Flüssige" />
+    <Word from="flilstert" to="flüstert" />
+    <Word from="fLir" to="für" />
+    <Word from="fljhrt" to="führt" />
+    <Word from="Fljr" to="Für" />
+    <Word from="flJr'n" to="für'n" />
+    <Word from="fllihrst" to="führst" />
+    <Word from="Fllihrt" to="Führt" />
+    <Word from="fllinf" to="fünf" />
+    <Word from="fllinften" to="fünften" />
+    <Word from="Fllinkchen" to="Fünkchen" />
+    <Word from="Fllir" to="Für" />
+    <Word from="fllirchte" to="fürchte" />
+    <Word from="fllirchten" to="fürchten" />
+    <Word from="fllirchterlichen" to="fürchterlichen" />
+    <Word from="fllirchtet" to="fürchtet" />
+    <Word from="Fllirsten" to="Fürsten" />
+    <Word from="Fllitterungszeitenl" to="Fütterungszeiten!" />
+    <Word from="flllgte" to="fügte" />
+    <Word from="flllgten" to="fügten" />
+    <Word from="flllhrten" to="flührten" />
+    <Word from="Flllhrung" to="Führung" />
+    <Word from="Fllligel" to="Flügel" />
+    <Word from="flllistern" to="flüstern" />
+    <Word from="fllllstert" to="flüstert" />
+    <Word from="flllrchte" to="fürchte" />
+    <Word from="flllrchten" to="fürchten" />
+    <Word from="flllrjede" to="für jede" />
+    <Word from="Flohtransporterl" to="Flohtransporter!" />
+    <Word from="Floli" to="Floß" />
+    <Word from="Flottenalzt" to="Flottenarzt" />
+    <Word from="Flottenstiitzpunkt" to="Flottenstützpunkt" />
+    <Word from="Flottenstutzpunkt" to="Flottenstützpunkt" />
+    <Word from="Flrma" to="Firma" />
+    <Word from="fltlsterte" to="flüsterte" />
+    <Word from="Fluchtig" to="Flüchtig" />
+    <Word from="Flughdhe" to="Flughöhe" />
+    <Word from="Flughiihe" to="Flughöhe" />
+    <Word from="Flughéifen" to="Flughäfen" />
+    <Word from="Flugunféihig" to="Flugunfähig" />
+    <Word from="flugunféihigen" to="flugunfähigen" />
+    <Word from="Flugunféihigl" to="Flugunfähig!" />
+    <Word from="Flugzeugl" to="Flugzeug!" />
+    <Word from="FLUSSIGER" to="FLÜSSIGER" />
+    <Word from="Flustereffekt" to="Flüstereffekt" />
+    <Word from="Flustern" to="Flüstern" />
+    <Word from="FLUSTERT" to="FLÜSTERT" />
+    <Word from="flflstern" to="flüstern" />
+    <Word from="flflsterten" to="flüsterten" />
+    <Word from="Folgendesz" to="Folgendes:" />
+    <Word from="fortgespiilt" to="fortgespült" />
+    <Word from="fortspiilen" to="fortspülen" />
+    <Word from="fortwéhrend" to="fortwährend" />
+    <Word from="Fr/ed/10/" to="Friedhof" />
+    <Word from="Fr5ulein" to="Fräulein" />
+    <Word from="Fr6hliche" to="Fröhliche" />
+    <Word from="Frachfmodule" to="Frachtmodule" />
+    <Word from="Frafi" to="Fraß" />
+    <Word from="fragfe" to="fragte" />
+    <Word from="Fral'S" to="Fraß" />
+    <Word from="fralken" to="fraßen" />
+    <Word from="Franzfisisch" to="Französisch" />
+    <Word from="Franziisin" to="Französin" />
+    <Word from="franziisische" to="französische" />
+    <Word from="franziisischen" to="französischen" />
+    <Word from="franziisischer" to="französischer" />
+    <Word from="franziisisches" to="französisches" />
+    <Word from="Franzésisch" to="Französisch" />
+    <Word from="franzésische" to="französische" />
+    <Word from="franzésischen" to="französischen" />
+    <Word from="franzésischer" to="französischer" />
+    <Word from="Franzésisches" to="Französisches" />
+    <Word from="FRAULEIN" to="FRÄULEIN" />
+    <Word from="fre/em" to="freiem" />
+    <Word from="freffen" to="treffen" />
+    <Word from="freilieB" to="freiließ" />
+    <Word from="freimiitigen" to="freimütigen" />
+    <Word from="Fressgeréusche" to="Fressgeräusche" />
+    <Word from="Frfichtekuchen" to="Früchtekuchen" />
+    <Word from="frfih" to="früh" />
+    <Word from="frfiher" to="früher" />
+    <Word from="Friedhéfe" to="Friedhöfe" />
+    <Word from="Friichtchen" to="Früchtchen" />
+    <Word from="friih" to="früh" />
+    <Word from="friihen" to="frühen" />
+    <Word from="friiher" to="früher" />
+    <Word from="friihere" to="frühere" />
+    <Word from="friihliche" to="fröhliche" />
+    <Word from="friihlichen" to="fröhlichen" />
+    <Word from="Friihstiick" to="Frühstück" />
+    <Word from="friilher" to="früher" />
+    <Word from="friilhesten" to="frühesten" />
+    <Word from="Frijchte" to="Früchte" />
+    <Word from="frijh" to="früh" />
+    <Word from="frijher" to="früher" />
+    <Word from="frijherer" to="friüherer" />
+    <Word from="frilh" to="früh" />
+    <Word from="frilhen" to="frühen" />
+    <Word from="Frilher" to="Früher" />
+    <Word from="frilhere" to="frühere" />
+    <Word from="Frilhstflck" to="Frühstück" />
+    <Word from="Fris6r" to="Frisör" />
+    <Word from="frL'lher" to="früher" />
+    <Word from="Frljihling" to="Frühling" />
+    <Word from="Frllichte" to="Früchte" />
+    <Word from="frllih" to="früh" />
+    <Word from="frlliher" to="früher" />
+    <Word from="Frllihstiickskiiche" to="Frühstücksküche" />
+    <Word from="fro/1" to="froh" />
+    <Word from="FROHLICHE" to="FRÖHLICHE" />
+    <Word from="frtih" to="früh" />
+    <Word from="Frtiher" to="Früher" />
+    <Word from="Frtihliche" to="Fröhliche" />
+    <Word from="Frtihstticksei" to="Frühstücksei" />
+    <Word from="Frtlh" to="Früh" />
+    <Word from="FrUh" to="Früh" />
+    <Word from="FRUHE" to="FRÜHE" />
+    <Word from="fruhe" to="frühe" />
+    <Word from="fruhen" to="frühen" />
+    <Word from="Fruher" to="Früher" />
+    <Word from="fruheren" to="früheren" />
+    <Word from="Fruhling" to="Frühling" />
+    <Word from="Fruhlingsrolle" to="Frühlingsrolle" />
+    <Word from="FrUhstUck" to="Frühstuck" />
+    <Word from="Fruhstuck" to="Frühstück" />
+    <Word from="frUhstUcken" to="frühstücken" />
+    <Word from="fréhliches" to="fröhliches" />
+    <Word from="fréihfiches" to="fröhliches" />
+    <Word from="fréihlich" to="fröhlich" />
+    <Word from="Fréiulein" to="Fräulein" />
+    <Word from="frénen" to="frönen" />
+    <Word from="Frésche" to="Frösche" />
+    <Word from="Fréulein" to="Fräulein" />
+    <Word from="ftihlen" to="fühlen" />
+    <Word from="Ftillhorn" to="Füllhorn" />
+    <Word from="Ftir" to="Für" />
+    <Word from="Ftirs" to="Fürs" />
+    <Word from="Ftlhrung" to="Führung" />
+    <Word from="ftlrchte" to="fürchte" />
+    <Word from="ftmf" to="fünf" />
+    <Word from="Fu/3" to="Fuß" />
+    <Word from="FuB" to="Fuß" />
+    <Word from="FuBballspieler" to="Fußballspieler" />
+    <Word from="FUBen" to="Füßen" />
+    <Word from="Fuf$" to="Fuß" />
+    <Word from="Fufi" to="Fuß" />
+    <Word from="Fufiabdrucke" to="Fußabdrücke" />
+    <Word from="Fufiballtraining" to="Fußballtraining" />
+    <Word from="FufL" to="Fuß" />
+    <Word from="Fuflsball" to="Fußball" />
+    <Word from="Fuflsballszene" to="Fußballszene" />
+    <Word from="fUhl't" to="führt" />
+    <Word from="fuhle" to="fühle" />
+    <Word from="fuhlst" to="fühlst" />
+    <Word from="fUhlt" to="fühlt" />
+    <Word from="fUhre" to="führe" />
+    <Word from="fUhrt" to="führt" />
+    <Word from="fuhrte" to="führte" />
+    <Word from="fuhrten" to="führten" />
+    <Word from="Fuhrung" to="Führung" />
+    <Word from="Fuhrungsféhigkeiten" to="Führungsfähigkeiten" />
+    <Word from="Fuhrungsoffizier" to="Führungsoffizier" />
+    <Word from="Fuhrungsqualitét" to="Führungsqualität" />
+    <Word from="FUI3en" to="Füßen" />
+    <Word from="Fuli" to="Fuß" />
+    <Word from="Fuliball" to="Fußball" />
+    <Word from="Fulisohlen" to="Fußsohlen" />
+    <Word from="FUller" to="Füller" />
+    <Word from="fUllten" to="füllten" />
+    <Word from="fumt" to="fühlt" />
+    <Word from="Fundbiiro" to="Fundbüro" />
+    <Word from="FUnf" to="Fünf" />
+    <Word from="Funftbeste" to="Fünftbeste" />
+    <Word from="Funkchen" to="Fünkchen" />
+    <Word from="Funkgeréit" to="Funkgerät" />
+    <Word from="Funkgeréite" to="Funkgeräte" />
+    <Word from="Funkgerét" to="Funkgerät" />
+    <Word from="funktionstilchtig" to="funktionstüchtig" />
+    <Word from="FUR" to="FÜR" />
+    <Word from="Fur" to="Für" />
+    <Word from="fUrAusweichmanc'§ver" to="für Ausweichmanöver" />
+    <Word from="furchteinfl6Bend" to="furchteinflößend" />
+    <Word from="furchteinfl6Bende" to="furchteinflößende" />
+    <Word from="furchten" to="fürchten" />
+    <Word from="Furchtest" to="Fürchtest" />
+    <Word from="furchtet" to="fürchtet" />
+    <Word from="furchteten" to="fürchteten" />
+    <Word from="fureinander" to="füreinander" />
+    <Word from="furjeden" to="für jeden" />
+    <Word from="furjemanden" to="für jemanden" />
+    <Word from="furjudische" to="fur jüdische" />
+    <Word from="furs" to="fürs" />
+    <Word from="FUrWalter" to="Für Walter" />
+    <Word from="fut" to="tut" />
+    <Word from="Fuflballspiel" to="Fußballspiel" />
+    <Word from="F§hnlein" to="Fähnlein" />
+    <Word from="fé//t" to="fällt" />
+    <Word from="féhig" to="fähig" />
+    <Word from="Féhigkeit" to="Fähigkeit" />
+    <Word from="Féhigkeiten" to="Fähigkeiten" />
+    <Word from="féhnen" to="föhnen" />
+    <Word from="Féhnens" to="Föhnens" />
+    <Word from="Féhnerei" to="Föhnerei" />
+    <Word from="Féhnleinmiitter" to="Fähnleinmütter" />
+    <Word from="Féhre" to="Fähre" />
+    <Word from="féhrst" to="fährst" />
+    <Word from="féhrt" to="fährt" />
+    <Word from="Féihigkeit" to="Fähigkeit" />
+    <Word from="Féihigkeiten" to="Fähigkeiten" />
+    <Word from="féihrt" to="fährt" />
+    <Word from="féillst" to="fällst" />
+    <Word from="féillt" to="fällt" />
+    <Word from="Féilschung" to="Fälschung" />
+    <Word from="Féingt" to="Fängt" />
+    <Word from="féir" to="für" />
+    <Word from="Félle" to="Fälle" />
+    <Word from="Féllen" to="Fällen" />
+    <Word from="félligl" to="fällig" />
+    <Word from="Féllt" to="Fällt" />
+    <Word from="féllt's" to="fällt's" />
+    <Word from="Félschen" to="Fälschen" />
+    <Word from="Félschung" to="Fälschung" />
+    <Word from="fénde" to="fände" />
+    <Word from="Féngst" to="Fängst" />
+    <Word from="Féngt" to="Fängt" />
+    <Word from="férben" to="färben" />
+    <Word from="férbt" to="färbt" />
+    <Word from="férdern" to="fördern" />
+    <Word from="férmlich" to="förmlich" />
+    <Word from="Féustlinge" to="Fäustlinge" />
+    <Word from="für'ne" to="für 'ne" />
+    <Word from="fürchlerlichen" to="fürchterlichen" />
+    <Word from="fürjede" to="für jede" />
+    <Word from="fürjeden" to="für jeden" />
+    <Word from="Fflhrungsprogramm" to="Führungsprogramm" />
+    <Word from="Fflhrungsstil" to="Führungsstil" />
+    <Word from="fflllen" to="füllen" />
+    <Word from="fflllt" to="fällt" />
+    <Word from="fflnf" to="fünf" />
+    <Word from="Fflr" to="Für" />
+    <Word from="fflrchte" to="fürchte" />
+    <Word from="fflrjeden" to="für jeden" />
+    <Word from="g/bf" to="gibt" />
+    <Word from="g/bsf" to="gibst" />
+    <Word from="G5ste" to="Gäste" />
+    <Word from="G6nn" to="Gönn" />
+    <Word from="G6t'lllche" to="Göttliche" />
+    <Word from="G6tter" to="Götter" />
+    <Word from="G6ttern" to="Göttern" />
+    <Word from="Gamilonl" to="Gamilon!" />
+    <Word from="ganzlich" to="gänzlich" />
+    <Word from="gardel" to="garde!" />
+    <Word from="Gasbrfiter" to="Gasbräter" />
+    <Word from="gauze" to="ganze" />
+    <Word from="GCJKTEN" to="GÖKTEN" />
+    <Word from="ge6lt" to="geölt" />
+    <Word from="gebauf" to="gebaut" />
+    <Word from="Gebiez" to="Gebiet" />
+    <Word from="Gebiéude" to="Gebäude" />
+    <Word from="gebliebenl" to="geblieben!" />
+    <Word from="GEBRAUCHTWAGENIPOLIZEIITAXI" to="GEBRAUCHTWAGEN/POLIZEI/TAXI" />
+    <Word from="Gebréu" to="Gebräu" />
+    <Word from="gebs" to="geb's" />
+    <Word from="gebuhrend" to="gebührend" />
+    <Word from="Gebéick" to="Gebäck" />
+    <Word from="Gebéiude" to="Gebäude" />
+    <Word from="gebérdet" to="gebärdet" />
+    <Word from="Gebérmutter" to="Gebärmutter" />
+    <Word from="Gebérmutterhals" to="Gebärmutterhals" />
+    <Word from="Gebéude" to="Gebäude" />
+    <Word from="Gebéudedach" to="Gebäudedach" />
+    <Word from="Gebéuden" to="Gebäuden" />
+    <Word from="Gebéudes" to="Gebäudes" />
+    <Word from="gedemiitigt" to="gedemütigt" />
+    <Word from="gedemijtigt" to="gedemütigt" />
+    <Word from="gedemllitigt" to="gedemütigt" />
+    <Word from="gedrtickt" to="gedrückt" />
+    <Word from="gedréngt" to="gedrängt" />
+    <Word from="Gedéchtnisverlustes" to="Gedächtnisverlustes" />
+    <Word from="Gedéichtnis" to="Gedächtnis" />
+    <Word from="gedémpft" to="gedämpft" />
+    <Word from="gef'a'hrlich" to="gefährlich" />
+    <Word from="gef'a'llt" to="gefällt" />
+    <Word from="gef5IIt" to="gefällt" />
+    <Word from="gefahrdet" to="gefährdet" />
+    <Word from="gefahrlich" to="gefährlich" />
+    <Word from="gefallsllichtige" to="gefallsüchtige" />
+    <Word from="GEFANGNISTECHNOLOGIE" to="GEFÄNGNISTECHNOLOGIE" />
+    <Word from="Gefechtsausrustung" to="Gefechtsausrüstung" />
+    <Word from="Geffihl" to="Gefühl" />
+    <Word from="geffihrt" to="geführt" />
+    <Word from="geffillt" to="gefällt" />
+    <Word from="Gefihrliche" to="Gefärliche" />
+    <Word from="Gefiihl" to="Gefühl" />
+    <Word from="Gefiihle" to="Gefühle" />
+    <Word from="Gefiihlen" to="Gefühlen" />
+    <Word from="Gefiihlslebens" to="Gefühlslebens" />
+    <Word from="gefiihlsmiliigen" to="gefühlsmäßigen" />
+    <Word from="gefiihrt" to="geführt" />
+    <Word from="gefiillst" to="gefällst" />
+    <Word from="gefiillt" to="gefüllt" />
+    <Word from="gefiirchtet" to="gefürchtet" />
+    <Word from="Gefijhl" to="Gefühl" />
+    <Word from="Gefijhle" to="Gefühle" />
+    <Word from="gefijhlt" to="gefühlt" />
+    <Word from="gefijllte" to="gefüllte" />
+    <Word from="Gefilhl" to="Gefühl" />
+    <Word from="Gefilhle" to="Gefühle" />
+    <Word from="gefillt" to="gefällt" />
+    <Word from="Gefingnis" to="Gefängnis" />
+    <Word from="gefL'lllten" to="gefüllten" />
+    <Word from="Geflilster" to="Geflüster" />
+    <Word from="gefllihllos" to="gefühllos" />
+    <Word from="Geflllhlsduselige" to="Gefühlsduselige" />
+    <Word from="GEFLUSTERT" to="GEFLÜSTERT" />
+    <Word from="Geftuhle" to="Gefühle" />
+    <Word from="Gefuhl" to="Gefühl" />
+    <Word from="Gefuhle" to="Gefühle" />
+    <Word from="Gefuhlen" to="Gefühlen" />
+    <Word from="gefuhlt" to="gefühlt" />
+    <Word from="gefuhlvolle" to="gefühlvolle" />
+    <Word from="gefurchtet" to="gefürchtet" />
+    <Word from="Geféhrde" to="Gefährde" />
+    <Word from="geféhrden" to="gefährden" />
+    <Word from="geféhrdet" to="gefährdet" />
+    <Word from="Geféhrdung" to="Gefährdung" />
+    <Word from="geféhrlich" to="gefährlich" />
+    <Word from="geféhrliche" to="gefährliche" />
+    <Word from="geféhrlicher" to="gefährlicher" />
+    <Word from="geféhrlicheren" to="gefährlicheren" />
+    <Word from="Geféhrliches" to="Gefährliches" />
+    <Word from="Geféhrt" to="Gefährt" />
+    <Word from="geféihrden" to="gefährden" />
+    <Word from="geféihrdet" to="gefährdet" />
+    <Word from="geféihrlich" to="gefährlich" />
+    <Word from="Geféihrte" to="Gefährte" />
+    <Word from="Geféihrten" to="Gefährten" />
+    <Word from="geféillt" to="gefällt" />
+    <Word from="Geféillt's" to="Gefällt's" />
+    <Word from="geféllf" to="gefällt" />
+    <Word from="geféllfs" to="gefällt's" />
+    <Word from="geféllig" to="gefällig" />
+    <Word from="gefélligst" to="gefälligst" />
+    <Word from="geféllst" to="gefällst" />
+    <Word from="Geféllt" to="Gefällt" />
+    <Word from="Geféllt's" to="Gefällt's" />
+    <Word from="gefélscht" to="gefälscht" />
+    <Word from="Geféngnis" to="Gefängnis" />
+    <Word from="Geféngnisregeln" to="Gefängnisregeln" />
+    <Word from="Geféngnisse" to="Gefängnisse" />
+    <Word from="Geféngnissen" to="Gefängnissen" />
+    <Word from="Geféngnisses" to="Gefängnisses" />
+    <Word from="Geféngniswagen" to="Gefängniswagen" />
+    <Word from="gefflgig" to="gefügig" />
+    <Word from="gegenfiber" to="gegenüber" />
+    <Word from="gegeniiber" to="gegenüber" />
+    <Word from="gegeniibertritt" to="gegenübertritt" />
+    <Word from="gegeniiberzusfehen" to="gegenüberzustehen" />
+    <Word from="gegenijber" to="gegenüber" />
+    <Word from="gegenlliber" to="gegenüber" />
+    <Word from="gegenlliberstehen" to="gegenüberstehen" />
+    <Word from="Gegenstrfimung" to="Gegenströmung" />
+    <Word from="Gegenstrémung" to="Gegenströmung" />
+    <Word from="Gegensttlck" to="Gegenstück" />
+    <Word from="Gegensténde" to="Gegenstände" />
+    <Word from="gegenuber" to="gegenüber" />
+    <Word from="Gegenverschwiirung" to="Gegenverschwörung" />
+    <Word from="gegenwértigen" to="gegenwärtigen" />
+    <Word from="gegriindet" to="gegründet" />
+    <Word from="gegrijfit" to="gegrüßt" />
+    <Word from="gegrilfit" to="gegrüßt" />
+    <Word from="GegrUl3t" to="Gegrüßt" />
+    <Word from="gegrundet" to="gegründet" />
+    <Word from="geh6ren" to="gehören" />
+    <Word from="geh6rt" to="gehört" />
+    <Word from="gehdrt" to="gehört" />
+    <Word from="GeheilS" to="Geheiß" />
+    <Word from="geheilSen" to="geheißen" />
+    <Word from="gehejetzt" to="gehe jetzt" />
+    <Word from="gehf" to="geht" />
+    <Word from="gehfiirt" to="gehört" />
+    <Word from="gehfire" to="gehöre" />
+    <Word from="gehfiren" to="gehören" />
+    <Word from="gehfirt" to="gehört" />
+    <Word from="gehiipft" to="gehüpft" />
+    <Word from="Gehiir" to="Gehör" />
+    <Word from="gehiire" to="gehöre" />
+    <Word from="gehiiren" to="gehören" />
+    <Word from="gehiirst" to="gehörst" />
+    <Word from="gehiirt" to="gehört" />
+    <Word from="Gehim" to="Gehirn" />
+    <Word from="Gehirnschéden" to="Gehirnschäden" />
+    <Word from="gehlngt" to="gehängt" />
+    <Word from="gehore" to="gehöre" />
+    <Word from="gehoren" to="gehören" />
+    <Word from="gehort" to="gehört" />
+    <Word from="geht'sl" to="geht's!" />
+    <Word from="Gehtirt" to="Gehört" />
+    <Word from="gehtjetzt" to="geht jetzt" />
+    <Word from="gehéirt" to="gehört" />
+    <Word from="Gehéiuteten" to="Gehäuteten" />
+    <Word from="gehér" to="gehör" />
+    <Word from="gehére" to="gehöre" />
+    <Word from="gehéren" to="gehören" />
+    <Word from="gehérst" to="gehörst" />
+    <Word from="Gehért" to="Gehört" />
+    <Word from="gehérten" to="gehörten" />
+    <Word from="gehértf" to="gehört!" />
+    <Word from="geiiffnet" to="geöffnet" />
+    <Word from="geilbt" to="geübt" />
+    <Word from="geistesgestort" to="geistesgestört" />
+    <Word from="Geiflblatt" to="Geißblatt" />
+    <Word from="Geiflblattstaude" to="Geißblattstaude" />
+    <Word from="gekiisst" to="geküsst" />
+    <Word from="gekiisstl" to="geküsst!" />
+    <Word from="gekijndigt" to="gekündigt" />
+    <Word from="gekijsst" to="geküsst" />
+    <Word from="gekilsst" to="geküsst" />
+    <Word from="gekimpfl" to="gekämpft" />
+    <Word from="gekimpft" to="gekämpft" />
+    <Word from="geklautl" to="geklaut!" />
+    <Word from="gekliirt" to="geklärt" />
+    <Word from="gekllrt" to="geklärt" />
+    <Word from="geklért" to="geklärt" />
+    <Word from="gekriint" to="gekrönt" />
+    <Word from="gekrijmmt" to="gekrümmt" />
+    <Word from="GEKUHLTER" to="GEKÜHLTER" />
+    <Word from="gekurzt" to="gekürzt" />
+    <Word from="gekémpft" to="gekämpft" />
+    <Word from="gelaufenl" to="gelaufen!" />
+    <Word from="gelegf" to="gelegt" />
+    <Word from="gelegtwurde" to="gelegt wurde" />
+    <Word from="geliist" to="gelöst" />
+    <Word from="gelilftet" to="gelüftet" />
+    <Word from="gelndert" to="geändert" />
+    <Word from="Gelst" to="Geist" />
+    <Word from="Geltungsbedurfnis" to="Geltungsbedürfnis" />
+    <Word from="GELUBDE" to="GELÜBDE" />
+    <Word from="Geléchter" to="Gelächter" />
+    <Word from="geléhmt" to="gelähmt" />
+    <Word from="geléischt" to="gelöscht" />
+    <Word from="Gelénde" to="Gelände" />
+    <Word from="gelénge" to="gelänge" />
+    <Word from="gelést" to="gelöst" />
+    <Word from="gem" to="gern" />
+    <Word from="gemafiregelt" to="gemaßregelt" />
+    <Word from="Geme" to="Gerne" />
+    <Word from="gemfitliches" to="gemütliches" />
+    <Word from="Gemiise" to="Gemüse" />
+    <Word from="gemiitlich" to="gemütlich" />
+    <Word from="Gemijlse" to="Gemüse" />
+    <Word from="Gemilt" to="Gemüt" />
+    <Word from="gemiltlicher" to="gemütlicher" />
+    <Word from="GemLise" to="Gemüse" />
+    <Word from="Gemut" to="Gemüt" />
+    <Word from="geméfi" to="gemäß" />
+    <Word from="Geméfk" to="Gemäß" />
+    <Word from="geméht" to="gemäht" />
+    <Word from="Geméili" to="Gemäß" />
+    <Word from="Gemélde" to="Gemälde" />
+    <Word from="Gemélden" to="Gemälden" />
+    <Word from="Genaul" to="Genau!" />
+    <Word from="genieBt" to="genießt" />
+    <Word from="genief$en" to="genießen" />
+    <Word from="Geniefien" to="Genießen" />
+    <Word from="geniefk" to="genieß" />
+    <Word from="genielien" to="genießen" />
+    <Word from="genielken" to="genießen" />
+    <Word from="genieflen" to="genießen" />
+    <Word from="genligen" to="genügen" />
+    <Word from="genlligend" to="genügend" />
+    <Word from="genlligt" to="genügt" />
+    <Word from="genlllgend" to="genügend" />
+    <Word from="genugt" to="genügt" />
+    <Word from="genugte" to="genügte" />
+    <Word from="georfef" to="geortet" />
+    <Word from="gepfluckt" to="gepflückt" />
+    <Word from="gepriifter" to="geprüfter" />
+    <Word from="gepruft" to="geprüft" />
+    <Word from="Gepéck" to="Gepäck" />
+    <Word from="gerfit" to="gerät" />
+    <Word from="Geriichte" to="Gerüchte" />
+    <Word from="Geriite" to="Geräte" />
+    <Word from="Gerijcht" to="Gerücht" />
+    <Word from="Gerllicht" to="Gerücht" />
+    <Word from="gerllistet" to="gerüstet" />
+    <Word from="gernhaben" to="gern haben" />
+    <Word from="gernhaben" to="gern-haben" />
+    <Word from="gernntgt" to="geröntgt" />
+    <Word from="geréit" to="gerät" />
+    <Word from="Geréiusch" to="Geräusch" />
+    <Word from="Gerét" to="Gerät" />
+    <Word from="Geréte" to="Geräte" />
+    <Word from="Gerétschaften" to="Gerätschaften" />
+    <Word from="geréumt" to="geräumt" />
+    <Word from="Geréusch" to="Geräusch" />
+    <Word from="Geréusche" to="Geräusche" />
+    <Word from="geréuschvoll" to="geräuschvoll" />
+    <Word from="geschafff" to="geschafft" />
+    <Word from="GESCHAFTSFUHRER" to="GESCHÄFTSFÜHRER" />
+    <Word from="geschafli" to="geschafft" />
+    <Word from="Geschfift" to="Geschäft" />
+    <Word from="geschfimt" to="geschämt" />
+    <Word from="Geschift" to="Geschäft" />
+    <Word from="Geschifte" to="Geschäfte" />
+    <Word from="Geschiftsleute" to="Geschäftsleute" />
+    <Word from="Geschiftswelt" to="Geschäftswelt" />
+    <Word from="geschiidigt" to="geschädigt" />
+    <Word from="Geschiift" to="Geschäft" />
+    <Word from="Geschiiftsleben" to="Geschäftsleben" />
+    <Word from="geschijtzten" to="geschützten" />
+    <Word from="Geschiltz" to="Geschütz" />
+    <Word from="Geschiltze" to="Geschütze" />
+    <Word from="Geschiltzrohre" to="Geschützrohre" />
+    <Word from="Geschiltzturm" to="Geschützturm" />
+    <Word from="geschlijpftl" to="geschlüpft!" />
+    <Word from="Geschllitzstellungen" to="Geschützstellungen" />
+    <Word from="geschnfiffelt" to="geschnüffelt" />
+    <Word from="Geschtitz" to="Geschütz" />
+    <Word from="Geschtltz" to="Geschütz" />
+    <Word from="Geschutz" to="Geschütz" />
+    <Word from="Geschutze" to="Geschütze" />
+    <Word from="Geschwiir" to="Geschwür" />
+    <Word from="Geschwllir" to="Geschwür" />
+    <Word from="Geschwur" to="Geschwür" />
+    <Word from="geschwécht" to="geschwächt" />
+    <Word from="geschwéingert" to="geschwängert" />
+    <Word from="Geschwétz" to="Geschwätz" />
+    <Word from="Geschéft" to="Geschäft" />
+    <Word from="Geschéfte" to="Geschäfte" />
+    <Word from="Geschéftige" to="Geschäftige" />
+    <Word from="geschéftlich" to="geschäftlich" />
+    <Word from="Geschéfts" to="Geschäfts" />
+    <Word from="Geschéftsleben" to="Geschäftsleben" />
+    <Word from="Geschéift" to="Geschäft" />
+    <Word from="Geschéifte" to="Geschäfte" />
+    <Word from="geschéiftsméifiig" to="geschäftsmäßig" />
+    <Word from="geschéitzt" to="geschätzt" />
+    <Word from="geschénolet" to="geschändet" />
+    <Word from="Geschfltze" to="Geschütze" />
+    <Word from="Gesetzeshiiter" to="Gesetzeshüter" />
+    <Word from="Gesichtl" to="Gesicht!" />
+    <Word from="Gesichtsausdrijcke" to="Gesichtsausdrücke" />
+    <Word from="Gesiiff" to="Gesöff" />
+    <Word from="gesiindigt" to="gesündigt" />
+    <Word from="gespiirt" to="gespürt" />
+    <Word from="Gesprach" to="Gespräch" />
+    <Word from="GESPRACH" to="GESPRÄCH" />
+    <Word from="GESPRACHE" to="GESPRÄCHE" />
+    <Word from="Gespréch" to="Gespräch" />
+    <Word from="Gespréche" to="Gespräche" />
+    <Word from="Gespréiche" to="Gespräche" />
+    <Word from="Gespréichsthema" to="Gesprächsthema" />
+    <Word from="Gespur" to="Gespür" />
+    <Word from="gestiirt" to="gestört" />
+    <Word from="gestijrzt" to="gestürzt" />
+    <Word from="gestijtzte" to="gestützte" />
+    <Word from="gestof$en" to="gestoßen" />
+    <Word from="gestolken" to="gestoßen" />
+    <Word from="Gestriipp" to="Gestrüpp" />
+    <Word from="Gestrijpp" to="Gestrüpp" />
+    <Word from="GESTURZT" to="GESTÜRZT" />
+    <Word from="gestéirt" to="gestört" />
+    <Word from="Gesténdnis" to="Geständnis" />
+    <Word from="gestért" to="gestört" />
+    <Word from="gestflrzt" to="gestürzt" />
+    <Word from="Gesundheitsbehijrde" to="Gesundheitsbehörde" />
+    <Word from="Gesundheitsftlrsorge" to="Gesundheitsfürsorge" />
+    <Word from="Geséfitaschel" to="Gesäßtasche!" />
+    <Word from="Geséiffstaschenl" to="Gesäßtaschen!" />
+    <Word from="get6tet" to="getötet" />
+    <Word from="Getiise" to="Getöse" />
+    <Word from="getiitet" to="getötet" />
+    <Word from="getr'a'umt" to="geträumt" />
+    <Word from="getréumt" to="geträumt" />
+    <Word from="getétet" to="getötet" />
+    <Word from="getétetf" to="getötet!" />
+    <Word from="getéuscht" to="getäuscht" />
+    <Word from="gevégelt" to="gevögelt" />
+    <Word from="gew6hnt" to="gewöhnt" />
+    <Word from="GEWACHSHAUS" to="GEWÄCHSHAUS" />
+    <Word from="gewalttétig" to="gewalttätig" />
+    <Word from="gewarnf" to="gewarnt" />
+    <Word from="Gewerkschaftsfunktionéren" to="Gewerkschaftsfunktionären" />
+    <Word from="gewfinscht" to="gewünscht" />
+    <Word from="Gewiasenskonflikte" to="Gewissenskonflikte" />
+    <Word from="gewiihlt" to="gewählt" />
+    <Word from="gewiihnen" to="gewöhnen" />
+    <Word from="gewiihnlich" to="gewöhnlich" />
+    <Word from="gewiihnlicher" to="gewöhnlicher" />
+    <Word from="gewiihnliches" to="gewöhnliches" />
+    <Word from="gewiihnt" to="gewöhnt" />
+    <Word from="gewiinscht" to="gewünscht" />
+    <Word from="gewijhnlichen" to="gewöhnlichen" />
+    <Word from="gewijnscht" to="gewünscht" />
+    <Word from="gewissermafien" to="gewissermaßen" />
+    <Word from="gewissermallsen" to="gewissermaßen" />
+    <Word from="gewlllnscht" to="gewünscht" />
+    <Word from="Gewohnheitstiter" to="Gewohnheitstäter" />
+    <Word from="gewtinscht" to="gewünscht" />
+    <Word from="gewunscht" to="gewünscht" />
+    <Word from="gewunschten" to="gewünschten" />
+    <Word from="Gewéchshaus" to="Gewächshaus" />
+    <Word from="gewéhlt" to="gewählt" />
+    <Word from="gewéhnen" to="gewöhnen" />
+    <Word from="gewéhnlicher" to="gewöhnlicher" />
+    <Word from="gewéhnst" to="gewöhnst" />
+    <Word from="gewéhnt" to="gewöhnt" />
+    <Word from="Gewéhren" to="Gewähren" />
+    <Word from="gewéhrt" to="gewährt" />
+    <Word from="Gewéisser" to="Gewässer" />
+    <Word from="Gewéssern" to="Gewässern" />
+    <Word from="gezfichtet" to="gezüchtet" />
+    <Word from="gezilndet" to="gezündet" />
+    <Word from="gezéhlt" to="gezählt" />
+    <Word from="gezéihlt" to="gezählt" />
+    <Word from="gezéihmt" to="gezähmt" />
+    <Word from="geéndert" to="geändert" />
+    <Word from="GF6l'1Z6fUf" to="Grenze für" />
+    <Word from="Gfirtel" to="Gürtel" />
+    <Word from="Gfirtner" to="Gärtner" />
+    <Word from="Gfiste" to="Gäste" />
+    <Word from="Gfitter" to="Götter" />
+    <Word from="Ghrchen" to="Öhrchen" />
+    <Word from="gibtjede" to="gibt jede" />
+    <Word from="gibtk" to="gibt's" />
+    <Word from="gibts" to="gibt's" />
+    <Word from="gieBen" to="gießen" />
+    <Word from="GieBkanne" to="Gießkanne" />
+    <Word from="gief$t" to="gießt" />
+    <Word from="giefit" to="gießt" />
+    <Word from="gielit" to="gießt" />
+    <Word from="gignalton" to="Signalton" />
+    <Word from="giinstiger" to="günstiger" />
+    <Word from="Giire" to="Göre" />
+    <Word from="Giite" to="Güte" />
+    <Word from="giitiger" to="gütiger" />
+    <Word from="Giitter" to="Götter" />
+    <Word from="Giittliche" to="Göttliche" />
+    <Word from="giittlichen" to="göttlichen" />
+    <Word from="Gijte" to="Güte" />
+    <Word from="Gijtel" to="Güte!" />
+    <Word from="Gilrtel" to="Gürtel" />
+    <Word from="Gilte" to="Güte" />
+    <Word from="Giltiger" to="Gütiger" />
+    <Word from="Gitarrenklénge" to="Gitarrenklänge" />
+    <Word from="Gite" to="Güte" />
+    <Word from="GIUck" to="Glück" />
+    <Word from="GIUCKliCl'1" to="Glücklich" />
+    <Word from="GL'lte" to="Güte" />
+    <Word from="Glaubwurdigkeit" to="Glaubwürdigkeit" />
+    <Word from="Glaubwurdigkeitl" to="Glaubwürdigkeit!" />
+    <Word from="glaubwflrdig" to="glaubwürdig" />
+    <Word from="glb" to="gib" />
+    <Word from="glbt" to="gibt" />
+    <Word from="Gle/ch" to="Gleich" />
+    <Word from="gleichgiiltig" to="gleichgültig" />
+    <Word from="gleichmémig" to="gleichmäßig" />
+    <Word from="Glfick" to="Glück" />
+    <Word from="glficklich" to="glücklich" />
+    <Word from="Glfickspilz" to="Glückspilz" />
+    <Word from="Gliick" to="Glück" />
+    <Word from="Gliickchen" to="Glöckchen" />
+    <Word from="gliicklich" to="glücklich" />
+    <Word from="gliicklicher" to="glücklicher" />
+    <Word from="Gliicksbringer" to="Glücksbringer" />
+    <Word from="Gliickssfréhne" to="Glückssträhne" />
+    <Word from="Gliickwunsch" to="Glückwunsch" />
+    <Word from="gliilcklich" to="glücklich" />
+    <Word from="Glijck" to="Glück" />
+    <Word from="glijcklich" to="glücklich" />
+    <Word from="Glilck" to="Glück" />
+    <Word from="glilcklich" to="glücklich" />
+    <Word from="Glilckwunsch" to="Glückwunsch" />
+    <Word from="Glillck" to="Glück" />
+    <Word from="gllinstig" to="günstig" />
+    <Word from="gllinstigem" to="günstigem" />
+    <Word from="gllinstigen" to="günstigen" />
+    <Word from="glljcklich" to="glücklich" />
+    <Word from="glllicklich" to="glücklich" />
+    <Word from="glllickliche" to="glückliche" />
+    <Word from="Glllte" to="Güte" />
+    <Word from="Glorifiziertl" to="Glorifiziert!" />
+    <Word from="glticklich" to="glücklich" />
+    <Word from="Gltickszahlen" to="Glückszahlen" />
+    <Word from="gltlckliohes" to="glückliches" />
+    <Word from="Gluck" to="Glück" />
+    <Word from="glucklich" to="glücklich" />
+    <Word from="gluckliche" to="glückliche" />
+    <Word from="GLUCKSELIGKEIT" to="GLÜCKSELIGKEIT" />
+    <Word from="Gluckwunsch" to="Glückwunsch" />
+    <Word from="Gluok" to="Glück" />
+    <Word from="gluoklich" to="glücklich" />
+    <Word from="Glupschéugige" to="Glupschäugige" />
+    <Word from="glutheilie" to="glutheiße" />
+    <Word from="gléinzende" to="glänzende" />
+    <Word from="glénzende" to="glänzende" />
+    <Word from="glénzte" to="glänzte" />
+    <Word from="Gléser" to="Gläser" />
+    <Word from="gléubige" to="gläubige" />
+    <Word from="Gléubigen" to="Gläubigen" />
+    <Word from="Glflck" to="Glück" />
+    <Word from="Glflcklich" to="Glücklich" />
+    <Word from="Glflckstag" to="Glückstag" />
+    <Word from="Glflckwilnsche" to="Glückwünsche" />
+    <Word from="gnidig" to="gnädig" />
+    <Word from="Gnllnden" to="Gründen" />
+    <Word from="gnédig" to="gnädig" />
+    <Word from="gnédige" to="gnädige" />
+    <Word from="gnédigen" to="gnädigen" />
+    <Word from="Gnédigste" to="Gnädigste" />
+    <Word from="gnéidig" to="gnädig" />
+    <Word from="Goff" to="Gott" />
+    <Word from="Golfballweili" to="Golfballweiß" />
+    <Word from="gonnst" to="gönnst" />
+    <Word from="gottesfllirchtiger" to="gottesfürchtiger" />
+    <Word from="Gottverdammt" to="Gott verdammt" />
+    <Word from="Gofl" to="Gott" />
+    <Word from="Gr6Be" to="Größe" />
+    <Word from="gr6Ber" to="größer" />
+    <Word from="gr6Bere" to="größere" />
+    <Word from="gr6Beren" to="größeren" />
+    <Word from="Gr6Bte" to="Größte" />
+    <Word from="Gr6Bten" to="Größten" />
+    <Word from="gr6Bter" to="größter" />
+    <Word from="gr6Btes" to="größtes" />
+    <Word from="gr6f$te" to="größte" />
+    <Word from="gr6f$ten" to="größten" />
+    <Word from="gr6f5ten" to="größten" />
+    <Word from="gr6I3ter" to="größter" />
+    <Word from="gr6ISten" to="größten" />
+    <Word from="Gr6l3e" to="Größe" />
+    <Word from="gr6l3ter" to="größter" />
+    <Word from="Grabstétte" to="Grabstätte" />
+    <Word from="gratulierel" to="gratuliere!" />
+    <Word from="grClf$en" to="grüßen" />
+    <Word from="grfilieren" to="größeren" />
+    <Word from="Grfiner" to="Grüner" />
+    <Word from="griil3e" to="grüße" />
+    <Word from="griiliere" to="größere" />
+    <Word from="griiliten" to="größten" />
+    <Word from="griin" to="grün" />
+    <Word from="Griinde" to="Gründe" />
+    <Word from="Griinden" to="Gründen" />
+    <Word from="griindlich" to="gründlich" />
+    <Word from="Griine" to="Grüne" />
+    <Word from="griinen" to="grünen" />
+    <Word from="Griiner" to="Grüner" />
+    <Word from="griinéiugige" to="grünäugige" />
+    <Word from="griinéiugiges" to="grünäugiges" />
+    <Word from="griiflte" to="größte" />
+    <Word from="Grijbeln" to="Grübeln" />
+    <Word from="griJBen" to="grüßen" />
+    <Word from="grijn" to="grün" />
+    <Word from="Grijnde" to="Gründe" />
+    <Word from="grijnden" to="gründen" />
+    <Word from="grijndlich" to="gründlich" />
+    <Word from="grijnes" to="grünes" />
+    <Word from="Grijnfutter" to="Grünfutter" />
+    <Word from="Grilbelt" to="Grübelt" />
+    <Word from="grilfken" to="grüßen" />
+    <Word from="Grillhéhnchen" to="Grillhähnchen" />
+    <Word from="Grilnde" to="Gründe" />
+    <Word from="Grilnden" to="Gründen" />
+    <Word from="grilndet" to="gründet" />
+    <Word from="grilndlich" to="gründlich" />
+    <Word from="grilndlicherf" to="gründlicher!" />
+    <Word from="grilndlichl" to="gründlich!" />
+    <Word from="grilne" to="grüne" />
+    <Word from="Grilnschnébel" to="Grünschnäbel" />
+    <Word from="grim" to="grün" />
+    <Word from="Grime" to="Größe" />
+    <Word from="grinco" to="gringo" />
+    <Word from="Grllinde" to="Gründe" />
+    <Word from="grllinden" to="gründen" />
+    <Word from="grllindlich" to="gründlich" />
+    <Word from="grlllnes" to="grünes" />
+    <Word from="Gro/3artig" to="Großartig" />
+    <Word from="gro/3es" to="großes" />
+    <Word from="gro/3zUgig" to="großzügig" />
+    <Word from="Gro/Bstadt" to="Großstadt" />
+    <Word from="gro/Ken" to="großen" />
+    <Word from="groB" to="groß" />
+    <Word from="groBartig" to="großartig" />
+    <Word from="GroBe" to="Große" />
+    <Word from="GroBes" to="Großes" />
+    <Word from="GroBmutter" to="Großmutter" />
+    <Word from="GroBteil" to="Großteil" />
+    <Word from="groBziJgiger" to="großzügiger" />
+    <Word from="grof$" to="groß" />
+    <Word from="grof$artig" to="großartig" />
+    <Word from="grof$artigen" to="großartigen" />
+    <Word from="grof$e" to="große" />
+    <Word from="grof$er" to="großer" />
+    <Word from="grof$es" to="großes" />
+    <Word from="grof3" to="groß" />
+    <Word from="grof3&gt;artige" to="großartige" />
+    <Word from="Grof3e" to="Große" />
+    <Word from="grof3en" to="großen" />
+    <Word from="grof3erAlien" to="großer Alien" />
+    <Word from="grof5es" to="großes" />
+    <Word from="Grofbvaters" to="Großvaters" />
+    <Word from="grofi" to="groß" />
+    <Word from="Grofiangriffs" to="Großangriffs" />
+    <Word from="Grofiartig" to="Großartig" />
+    <Word from="grofiartige" to="großartige" />
+    <Word from="grofiartigen" to="großartigen" />
+    <Word from="grofiartiger" to="großartiger" />
+    <Word from="Grofiartiges" to="Großartiges" />
+    <Word from="Grofibritannien" to="Großbritannien" />
+    <Word from="Grofidiebstahl" to="Großdiebstahl" />
+    <Word from="Grofie" to="Große" />
+    <Word from="grofier" to="großer" />
+    <Word from="grofies" to="großes" />
+    <Word from="grofiten" to="größten" />
+    <Word from="grofk" to="groß" />
+    <Word from="Grofkartig" to="Großartig" />
+    <Word from="grofke" to="große" />
+    <Word from="Grofken" to="Großen" />
+    <Word from="Grofker" to="Großer" />
+    <Word from="Grofkvater" to="Großvater" />
+    <Word from="grofLe" to="große" />
+    <Word from="grofler" to="großer" />
+    <Word from="groflsartig" to="großartig" />
+    <Word from="groflsartige" to="großartige" />
+    <Word from="Groflse" to="Große" />
+    <Word from="groflsen" to="großen" />
+    <Word from="Grofser" to="Großer" />
+    <Word from="grol" to="groß" />
+    <Word from="grol'3&gt;en" to="großen" />
+    <Word from="grol2&gt;" to="groß" />
+    <Word from="grol2&gt;en" to="großen" />
+    <Word from="grol3&gt;es" to="großes" />
+    <Word from="grol3e" to="große" />
+    <Word from="grol3er" to="großer" />
+    <Word from="Grol3raum" to="Großraum" />
+    <Word from="groli" to="groß" />
+    <Word from="Groliartig" to="Großartig" />
+    <Word from="groliartige" to="großartige" />
+    <Word from="groliartigen" to="großartigen" />
+    <Word from="grolie" to="große" />
+    <Word from="grolien" to="großen" />
+    <Word from="groliherzig" to="großherzig" />
+    <Word from="Grolimutter" to="Großmutter" />
+    <Word from="Grolisegel" to="Großsegel" />
+    <Word from="Grolkvater" to="Großvater" />
+    <Word from="groller" to="großer" />
+    <Word from="Grollser" to="Großer" />
+    <Word from="grollzugig" to="großzügig" />
+    <Word from="grolS" to="groß" />
+    <Word from="grolSe" to="große" />
+    <Word from="GrolSeltern" to="Großeltern" />
+    <Word from="grolSer" to="großer" />
+    <Word from="GrolSvater" to="Großvater" />
+    <Word from="grolZ~" to="große" />
+    <Word from="gror$er" to="großer" />
+    <Word from="grorker" to="großer" />
+    <Word from="grosses" to="großes" />
+    <Word from="GROSSTE" to="GRÖSSTE" />
+    <Word from="grofl" to="groß" />
+    <Word from="grofle" to="große" />
+    <Word from="Groflstadtkind" to="Großstadtkind" />
+    <Word from="Groflvater" to="Großvater" />
+    <Word from="Grtin" to="Grün" />
+    <Word from="Grtmde" to="Gründe" />
+    <Word from="GruB" to="Gruß" />
+    <Word from="Grubenausgénge" to="Grubenausgänge" />
+    <Word from="Gruf$" to="Gruß" />
+    <Word from="grUf$en" to="grüßen" />
+    <Word from="grufit" to="grüßt" />
+    <Word from="Gruli" to="Gruß" />
+    <Word from="Grulikarte" to="Grußkarte" />
+    <Word from="Grulikarten" to="Grußkarten" />
+    <Word from="Grun" to="Grün" />
+    <Word from="grundlich" to="gründlich" />
+    <Word from="Grundstiick" to="Grundstück" />
+    <Word from="grundsétzlich" to="grundsätzlich" />
+    <Word from="grune" to="grüne" />
+    <Word from="grunen" to="grünen" />
+    <Word from="Grében" to="Gräben" />
+    <Word from="grébst" to="gräbst" />
+    <Word from="gréfier" to="größer" />
+    <Word from="gréfkte" to="größte" />
+    <Word from="gréflserer" to="größerer" />
+    <Word from="Gréifite" to="Größte" />
+    <Word from="gréillten" to="größten" />
+    <Word from="grésslich" to="grässlich" />
+    <Word from="Gréuel" to="Gräuel" />
+    <Word from="grflndlich" to="gründlich" />
+    <Word from="grflne" to="grüne" />
+    <Word from="gull" to="gut!" />
+    <Word from="Gummistépsel" to="Gummistöpsel" />
+    <Word from="Gumml" to="Gummi" />
+    <Word from="GUNSTIGSTEN" to="GÜNSTIGSTEN" />
+    <Word from="Gurtell" to="Gürtel!" />
+    <Word from="gutaussehend" to="gut aussehend" />
+    <Word from="gutaussehender" to="gut aussehender" />
+    <Word from="GUte" to="Güte" />
+    <Word from="gutgebaut" to="gut gebaut" />
+    <Word from="gutgehen" to="gut gehen" />
+    <Word from="Gutmijtigkeit" to="Gutmütigkeit" />
+    <Word from="gébe" to="gäbe" />
+    <Word from="gében" to="gäben" />
+    <Word from="géibe" to="gäbe" />
+    <Word from="Géittern" to="Göttern" />
+    <Word from="Gélisch" to="Gälisch" />
+    <Word from="Gélische" to="Gälische" />
+    <Word from="gélisches" to="gälisches" />
+    <Word from="Génsehaut" to="Gänsehaut" />
+    <Word from="Génsen" to="Gänsen" />
+    <Word from="Génze" to="Gänze" />
+    <Word from="Gérfen" to="Gärten" />
+    <Word from="Gértnern" to="Gärtnern" />
+    <Word from="Géste" to="Gäste" />
+    <Word from="Géstezimmer" to="Gästezimmer" />
+    <Word from="Gétter" to="Götter" />
+    <Word from="Gétterspeise" to="Götterspeise" />
+    <Word from="Géttin" to="Göttin" />
+    <Word from="Géttliche" to="Göttliche" />
+    <Word from="géttlichen" to="göttlichen" />
+    <Word from="Gétze" to="Götze" />
+    <Word from="G€fUhl6" to="Gefühle" />
+    <Word from="G€StFUpp" to="Gestrüpp" />
+    <Word from="h&lt;'&gt;'r't" to="hört" />
+    <Word from="h&lt;'5r" to="hör" />
+    <Word from="h'a'lt" to="hält" />
+    <Word from="H'a'nde" to="Hände" />
+    <Word from="H'a'nden" to="Händen" />
+    <Word from="H'a'ttest" to="Hättest" />
+    <Word from="H/" to="Hi" />
+    <Word from="H/er" to="Hier" />
+    <Word from="h/nfer" to="hinter" />
+    <Word from="h5tte" to="hätte" />
+    <Word from="H6fe" to="Höfe" />
+    <Word from="h6flich" to="höflich" />
+    <Word from="H6fling" to="Höfling" />
+    <Word from="H6hen" to="Höhen" />
+    <Word from="h6her" to="höher" />
+    <Word from="h6here" to="höhere" />
+    <Word from="H6HERER" to="HÖHERER" />
+    <Word from="H6hle" to="Höhle" />
+    <Word from="H6l1e" to="Hörte" />
+    <Word from="H6lle" to="Hölle" />
+    <Word from="H6llen" to="Höllen" />
+    <Word from="h6lte" to="hörte" />
+    <Word from="H6r" to="Hör" />
+    <Word from="h6re" to="höre" />
+    <Word from="h6ren" to="hören" />
+    <Word from="H6rer" to="Hörer" />
+    <Word from="H6rner" to="Hörner" />
+    <Word from="h6rst" to="hörst" />
+    <Word from="h6rt" to="hört" />
+    <Word from="h6rte" to="hörte" />
+    <Word from="Ha/s" to="Hals" />
+    <Word from="Haarbijrstel" to="Haarbürste!" />
+    <Word from="Haarhfirste" to="Haarbürste" />
+    <Word from="Haarl" to="Haar!" />
+    <Word from="Haarstréhne" to="Haarsträhne" />
+    <Word from="hab'jemanden" to="hab' jemanden" />
+    <Word from="Hah" to="Häh" />
+    <Word from="halbstlllndiges" to="halbstündiges" />
+    <Word from="halbvervvandelt" to="halbverwandelt" />
+    <Word from="halfef" to="haltet" />
+    <Word from="Hallfjchen" to="Hallöchen" />
+    <Word from="hallol" to="hallo!" />
+    <Word from="Halsbénder" to="Halsbänder" />
+    <Word from="Halsl" to="Hals!" />
+    <Word from="haltenl" to="halten!" />
+    <Word from="Haltjohnny" to="Halt Johnny" />
+    <Word from="Hammerschédel" to="Hammerschädel" />
+    <Word from="Handfléche" to="Handfläche" />
+    <Word from="Handlungsstrénge" to="Handlungsstränge" />
+    <Word from="harfe" to="harte" />
+    <Word from="hartnéickig" to="hartnäckig" />
+    <Word from="Hasenful" to="Hasenfuß" />
+    <Word from="Hasenfull" to="Hasenfuß" />
+    <Word from="hassq" to="hasse" />
+    <Word from="Hastja" to="Hast ja" />
+    <Word from="hatjetzt" to="hat jetzt" />
+    <Word from="hatta" to="hatte" />
+    <Word from="Haupfbus" to="Hauptbus" />
+    <Word from="Hauptaktionéire" to="Hauptaktionäre" />
+    <Word from="Hauptaktionéirinnen" to="Hauptaktionärinnen" />
+    <Word from="Hauptkabell" to="Hauptkabel!" />
+    <Word from="hauptséchlich" to="hauptsächlich" />
+    <Word from="hauptséichlich" to="hauptsächlich" />
+    <Word from="Haupttribflne" to="Haupttribüne" />
+    <Word from="Hauptverschwiirer" to="Hauptverschwörer" />
+    <Word from="Hauptwasserrohrwar" to="Hauptwasserrohr war" />
+    <Word from="Hausfirzte" to="Hausärzte" />
+    <Word from="Haushélterin" to="Haushälterin" />
+    <Word from="Hausschlilssel" to="Hausschlüssel" />
+    <Word from="Haustilr" to="Haustür" />
+    <Word from="Hausubervvachung" to="Hausüberwachung" />
+    <Word from="haßt" to="hasst" />
+    <Word from="Hbr" to="Hör" />
+    <Word from="hc'5ren" to="hören" />
+    <Word from="hc'§r" to="hör" />
+    <Word from="hdchsfens" to="höchstens" />
+    <Word from="Hdchstleistung" to="Höchstleistung" />
+    <Word from="hdher" to="höher" />
+    <Word from="Hdlle" to="Hölle" />
+    <Word from="Hdllenfeuer" to="Höllenfeuer" />
+    <Word from="hdre" to="höre" />
+    <Word from="hdren" to="hören" />
+    <Word from="hdrsf" to="hörst" />
+    <Word from="hdrten" to="horten" />
+    <Word from="He/nr/ch" to="Heinrich" />
+    <Word from="hedeutest" to="bedeutest" />
+    <Word from="hegrfille" to="begrüße" />
+    <Word from="heiB" to="heiß" />
+    <Word from="heiBe" to="heiße" />
+    <Word from="heiBen" to="heißen" />
+    <Word from="HeiBer" to="Heißer" />
+    <Word from="heiBes" to="heißes" />
+    <Word from="heiBt" to="heißt" />
+    <Word from="heif$" to="heiß" />
+    <Word from="heif$e" to="heiße" />
+    <Word from="heif$es" to="heißes" />
+    <Word from="Heif$t" to="Heißt" />
+    <Word from="heif3&gt;en" to="heißen" />
+    <Word from="heif3t" to="heißt" />
+    <Word from="heif5en" to="heißen" />
+    <Word from="heifie" to="heiße" />
+    <Word from="heifiem" to="heißem" />
+    <Word from="heifien" to="heißen" />
+    <Word from="heifit" to="heißt" />
+    <Word from="heifkt" to="heißt" />
+    <Word from="heifLt" to="heißt" />
+    <Word from="heifZ&gt;e" to="heiße" />
+    <Word from="heil'$" to="heiß" />
+    <Word from="heil'$en" to="heißen" />
+    <Word from="heil'$t" to="heißt" />
+    <Word from="heil'Se" to="heiße" />
+    <Word from="heil2&gt;en" to="heißen" />
+    <Word from="heil2&gt;t" to="heißt" />
+    <Word from="heil3en" to="heißen" />
+    <Word from="heil3t" to="heißt" />
+    <Word from="heil5e" to="heiße" />
+    <Word from="heil5t" to="heißt" />
+    <Word from="heili" to="heiß" />
+    <Word from="heilies" to="heißes" />
+    <Word from="heilit" to="heißt" />
+    <Word from="heillst" to="heißt" />
+    <Word from="heilZ~" to="heißt" />
+    <Word from="heir$" to="heiß" />
+    <Word from="heisst" to="heißt" />
+    <Word from="Helllger" to="Heiliger" />
+    <Word from="Helzlichen" to="Herzlichen" />
+    <Word from="Hen'je" to="Herrje" />
+    <Word from="herabstofien" to="herabstoßen" />
+    <Word from="heransttlrmtet" to="heranstürmtet" />
+    <Word from="heraushéngendem" to="heraushängendem" />
+    <Word from="herhfiren" to="herhören" />
+    <Word from="herhéren" to="herhören" />
+    <Word from="heriiber" to="herüber" />
+    <Word from="HerrSchmidt" to="Herr Schmidt" />
+    <Word from="herumféhrt" to="herumfährt" />
+    <Word from="herumkehren" to="herum kehren" />
+    <Word from="herumlluft" to="herumläuft" />
+    <Word from="herumzuwijhlen" to="herumzuwühlen" />
+    <Word from="Herzrhythmusstérungen" to="Herzrhythmusstörungen" />
+    <Word from="Herzschlielierei" to="Herzschließerei" />
+    <Word from="Herzstlllck" to="Herzstück" />
+    <Word from="Heuta" to="Heute" />
+    <Word from="Hexenhtltte" to="Hexenhütte" />
+    <Word from="HeY·" to="Hey." />
+    <Word from="Hfibscheste" to="Hübscheste" />
+    <Word from="hfiherer" to="höherer" />
+    <Word from="hfihsch" to="hübsch" />
+    <Word from="Hfilfte" to="Häfte" />
+    <Word from="Hfille" to="Hölle" />
+    <Word from="hfilt" to="hält" />
+    <Word from="hfiltst" to="hältst" />
+    <Word from="Hfin" to="Hört" />
+    <Word from="hfipft" to="hüpft" />
+    <Word from="Hfir" to="Hör" />
+    <Word from="hfiren" to="hören" />
+    <Word from="hfirst" to="hörst" />
+    <Word from="hfirt" to="hört" />
+    <Word from="hfitte" to="hätte" />
+    <Word from="hfitten" to="hätten" />
+    <Word from="hie/3" to="hieß" />
+    <Word from="hieB" to="hieß" />
+    <Word from="hiefL" to="hieß" />
+    <Word from="hiel3" to="hieß" />
+    <Word from="hiells" to="hieß" />
+    <Word from="hierhergereist" to="hierher gereist" />
+    <Word from="hierherzuriick" to="hierher zurück" />
+    <Word from="hierijber" to="hierüber" />
+    <Word from="hierjede" to="hier jede" />
+    <Word from="hierjeder" to="hier jeder" />
+    <Word from="hierl" to="hier!" />
+    <Word from="hierL" to="hieß" />
+    <Word from="hierwar" to="hier war" />
+    <Word from="hierzum" to="hier zum" />
+    <Word from="hierzum" to="hier-zum" />
+    <Word from="hiefl" to="hieß" />
+    <Word from="Hiibsch" to="Hübsch" />
+    <Word from="Hiibsche" to="Hübsche" />
+    <Word from="Hiibscher" to="Hübscher" />
+    <Word from="hiibschl" to="hübsch!" />
+    <Word from="hiichst" to="höchst" />
+    <Word from="hiichstens" to="höchstens" />
+    <Word from="hiichster" to="höchster" />
+    <Word from="hiichstpersiinlich" to="höchstpersönlich" />
+    <Word from="Hiifen" to="Höfen" />
+    <Word from="hiifischen" to="höfischen" />
+    <Word from="Hiifling" to="Höfling" />
+    <Word from="Hiigel" to="Hügel" />
+    <Word from="Hiihe" to="Höhe" />
+    <Word from="Hiihepunkt" to="Höhepunkt" />
+    <Word from="hiiher" to="höher" />
+    <Word from="hiihere" to="höhere" />
+    <Word from="Hiihlen" to="Höhlen" />
+    <Word from="Hiihnchen" to="Hühnchen" />
+    <Word from="Hiihner" to="Hühner" />
+    <Word from="Hiihnerkléfkchen" to="Hühnerklößchen" />
+    <Word from="Hiilfte" to="Hälfte" />
+    <Word from="Hiille" to="Hölle" />
+    <Word from="Hiillenstreitmacht" to="Höllenstreitmacht" />
+    <Word from="hiillischen" to="höllischen" />
+    <Word from="hiipfen" to="hüpfen" />
+    <Word from="Hiir" to="Hör" />
+    <Word from="hiire" to="höre" />
+    <Word from="Hiiren" to="Hören" />
+    <Word from="Hiirer" to="Hörer" />
+    <Word from="Hiiret" to="Höret" />
+    <Word from="Hiirjetzt" to="Hör jetzt" />
+    <Word from="Hiirt" to="Hört" />
+    <Word from="hiirte" to="hörte" />
+    <Word from="hiirtest" to="hörtest" />
+    <Word from="Hiissliches" to="Hässliches" />
+    <Word from="Hiite" to="Hüte" />
+    <Word from="Hiiten" to="Hüten" />
+    <Word from="hiitet" to="hütet" />
+    <Word from="Hiitte" to="Hätte" />
+    <Word from="hiitten" to="hätten" />
+    <Word from="Hiitten" to="Hütten" />
+    <Word from="hijbsch" to="hübsch" />
+    <Word from="hijbschen" to="hübschen" />
+    <Word from="hijbsches" to="hübsches" />
+    <Word from="Hijfte" to="Hüfte" />
+    <Word from="Hijften" to="Hüften" />
+    <Word from="Hijgel" to="Hügel" />
+    <Word from="Hijgels" to="Hügels" />
+    <Word from="Hijpfburgl" to="Hüpfburg!" />
+    <Word from="hijpfe" to="hüpfe" />
+    <Word from="hijpfen" to="hüpfen" />
+    <Word from="hijre" to="höre" />
+    <Word from="Hijren" to="Hören" />
+    <Word from="Hijrer" to="Hörer" />
+    <Word from="hilbsch" to="hübsch" />
+    <Word from="hilbsche" to="hübsche" />
+    <Word from="hilbschen" to="hübschen" />
+    <Word from="hilbscher" to="hübscher" />
+    <Word from="Hilfel" to="Hilfe!" />
+    <Word from="HILFSPERSONALI" to="HILFSPERSONAL:" />
+    <Word from="Hilgel" to="Hügel" />
+    <Word from="hillig" to="billig" />
+    <Word from="Hilt" to="Hält" />
+    <Word from="hilfl" to="hilft" />
+    <Word from="Him" to="Hirn" />
+    <Word from="Himmell" to="Himmel!" />
+    <Word from="hineintréumen" to="hineinträumen" />
+    <Word from="hinfijhrt" to="hinführt" />
+    <Word from="hingefiihrt" to="hingeführt" />
+    <Word from="hingehdren" to="hingehören" />
+    <Word from="hingehiiren" to="hingehören" />
+    <Word from="hinilber" to="hinüber" />
+    <Word from="hinreiliend" to="hinreißend" />
+    <Word from="hinschmeifit" to="hinschmeißt" />
+    <Word from="HintenNäldler" to="Hinterwäldler" />
+    <Word from="Hintergrundlérm" to="Hintergrundlärm" />
+    <Word from="hinterhfiltig" to="hinterhältig" />
+    <Word from="hinterhéiltiger" to="hinterhältiger" />
+    <Word from="Hinterhéiltigl" to="Hinterhältig!" />
+    <Word from="hinterhéltige" to="hinterhältige" />
+    <Word from="hinterhéltiger" to="hinterhältiger" />
+    <Word from="Hinterképfen" to="Hinterköpfen" />
+    <Word from="hinterlieBe" to="hinterließe" />
+    <Word from="hinterlésst" to="hinterlässt" />
+    <Word from="Hintersttlbchen" to="Hinterstübchen" />
+    <Word from="Hintertur" to="Hintertür" />
+    <Word from="hinwollen" to="hin wollen" />
+    <Word from="hinzufuhren" to="hinzuführen" />
+    <Word from="hinzufflgten" to="hinzufügten" />
+    <Word from="Hirnrnel" to="Himmel" />
+    <Word from="hirteste" to="härteste" />
+    <Word from="hisslich" to="hässlich" />
+    <Word from="Hiétte" to="Hätte" />
+    <Word from="Hler" to="Her" />
+    <Word from="hler" to="hier" />
+    <Word from="hllf" to="hilf" />
+    <Word from="hllibsch" to="hübsch" />
+    <Word from="Hllindinnen" to="Hündinnen" />
+    <Word from="Hlllpf" to="Hüpf" />
+    <Word from="hln" to="hin" />
+    <Word from="Hlnbllck" to="Hinblick" />
+    <Word from="hltte" to="hätte" />
+    <Word from="Hltten" to="Hätten" />
+    <Word from="Hochfrequenzstérungenl" to="Hochfrequenzstörungen!" />
+    <Word from="hochl" to="hoch!" />
+    <Word from="Hochsicherheitsgeféngnis" to="Hochsicherheitsgefängnis" />
+    <Word from="Hochstens" to="Höchstens" />
+    <Word from="Hochzeitskostiime" to="Hochzeitskostüme" />
+    <Word from="Hohek" to="Hoheit" />
+    <Word from="Hohepunkt" to="Höhepunkt" />
+    <Word from="hohere" to="höhere" />
+    <Word from="HoHo" to="Hoho" />
+    <Word from="Holle" to="Hölle" />
+    <Word from="Holzsttlck" to="Holzstück" />
+    <Word from="hor" to="hör" />
+    <Word from="Horen" to="Hören" />
+    <Word from="Hosenscheifker" to="Hosenscheißer" />
+    <Word from="Hosenscheiiker" to="Hosenscheißer" />
+    <Word from="Hosenscheifler" to="Hosenscheißer" />
+    <Word from="Hotelgéste" to="Hotelgäste" />
+    <Word from="HQHE" to="HÖHE" />
+    <Word from="htibscher" to="hübscher" />
+    <Word from="Htihnchen" to="Hühnchen" />
+    <Word from="Htipfen" to="Hüpfen" />
+    <Word from="Htipfenl" to="Hüpfen!" />
+    <Word from="htiren" to="hören" />
+    <Word from="hubsch" to="hübsch" />
+    <Word from="hubsche" to="hübsche" />
+    <Word from="hubschen" to="hübschen" />
+    <Word from="Hubscher" to="Hübscher" />
+    <Word from="hubscheres" to="hübscheres" />
+    <Word from="Hubsches" to="Hübsches" />
+    <Word from="Huhner" to="Hühner" />
+    <Word from="humon/oll" to="humorvoll" />
+    <Word from="Hundchen" to="Hündchen" />
+    <Word from="Hundebullel" to="Hundebulle!" />
+    <Word from="Hundenépfe" to="Hundenäpfe" />
+    <Word from="Hundescheilie" to="Hundescheiße" />
+    <Word from="Hundl" to="Hund!" />
+    <Word from="HUNG" to="Hülle" />
+    <Word from="hunte" to="bunte" />
+    <Word from="Hurensiihne" to="Hurensöhne" />
+    <Word from="Hurensohnl" to="Hurensohn!" />
+    <Word from="Huterin" to="Hüterin" />
+    <Word from="HUtte" to="Hütte" />
+    <Word from="Hypoglykémie" to="Hypoglykämie" />
+    <Word from="hé" to="hä" />
+    <Word from="Héchste" to="Höchste" />
+    <Word from="héchsten" to="höchsten" />
+    <Word from="Héchstens" to="Höchstens" />
+    <Word from="Héchstpersénlich" to="Höchstpersönlich" />
+    <Word from="Héfen" to="Häfen" />
+    <Word from="héflich" to="höflich" />
+    <Word from="Héftling" to="Häftling" />
+    <Word from="Héftlinge" to="Häftlinge" />
+    <Word from="Héftlingsréte" to="Häftlingsräte" />
+    <Word from="Héhef" to="Höhe!" />
+    <Word from="Héhepunkt" to="Höhepunkt" />
+    <Word from="héher" to="höher" />
+    <Word from="héheren" to="höheren" />
+    <Word from="Héi" to="Hä" />
+    <Word from="Héifen" to="Häfen" />
+    <Word from="Héilften" to="Hälften" />
+    <Word from="héiltst" to="hältst" />
+    <Word from="Héinde" to="Hände" />
+    <Word from="héing" to="häng" />
+    <Word from="héingen" to="hängen" />
+    <Word from="héingt" to="hängt" />
+    <Word from="héir" to="hör" />
+    <Word from="héirter" to="härter" />
+    <Word from="héitt" to="hätt" />
+    <Word from="Héitte" to="Hätte" />
+    <Word from="héitten" to="hätten" />
+    <Word from="héittest" to="hättest" />
+    <Word from="héiufig" to="häufig" />
+    <Word from="Hélfte" to="Hälfte" />
+    <Word from="Hélle" to="Hölle" />
+    <Word from="Héllen" to="Höllen" />
+    <Word from="Héllenloch" to="Höllenloch" />
+    <Word from="héllisch" to="höllisch" />
+    <Word from="héllische" to="höllische" />
+    <Word from="hélt" to="hält" />
+    <Word from="Héltst" to="Hältst" />
+    <Word from="hélzernes" to="hölzernes" />
+    <Word from="hémisch" to="hämisch" />
+    <Word from="Hémmer" to="Hämmer" />
+    <Word from="hémmernde" to="hämmernde" />
+    <Word from="Hémoglobin" to="Hämoglobin" />
+    <Word from="Hémorrhoiden" to="Hämorrhoiden" />
+    <Word from="Héndchen" to="Händchen" />
+    <Word from="Hénde" to="Hände" />
+    <Word from="Héndedruck" to="Händedruck" />
+    <Word from="Hénden" to="Händen" />
+    <Word from="Héndlerin" to="Händlerin" />
+    <Word from="héng" to="häng" />
+    <Word from="héngen" to="hängen" />
+    <Word from="héngend" to="hängend" />
+    <Word from="héngst" to="hängst" />
+    <Word from="héngt" to="hängt" />
+    <Word from="Hér" to="Hör" />
+    <Word from="hére" to="höre" />
+    <Word from="héren" to="hören" />
+    <Word from="Hérgeschéidigte" to="Hörgeschädigte" />
+    <Word from="hérst" to="hörst" />
+    <Word from="hért" to="hört" />
+    <Word from="hérte" to="hörte" />
+    <Word from="hérten" to="hörten" />
+    <Word from="hérter" to="härter" />
+    <Word from="Hérzu" to="Hör zu" />
+    <Word from="Héschen" to="Haschen" />
+    <Word from="hésslich" to="hässlich" />
+    <Word from="hésslicher" to="hässlicher" />
+    <Word from="hésslichl" to="hässlich" />
+    <Word from="hésslichste" to="hässlichste" />
+    <Word from="hétt" to="hätt" />
+    <Word from="Hétte" to="Hätte" />
+    <Word from="hétten" to="hätten" />
+    <Word from="hétten's" to="hätten's" />
+    <Word from="héttest" to="hättest" />
+    <Word from="Héttet" to="Hättet" />
+    <Word from="Héufi" to="Häufi" />
+    <Word from="héufig" to="häufig" />
+    <Word from="héufiger" to="häufiger" />
+    <Word from="Héufigkeit" to="Häufigkeit" />
+    <Word from="héufigsten" to="häufigsten" />
+    <Word from="Héuser" to="Häuser" />
+    <Word from="Héusern" to="Häusern" />
+    <Word from="héute" to="häute" />
+    <Word from="H€Y" to="Hey" />
+    <Word from="Hflgeln" to="Hügeln" />
+    <Word from="i'§ffne" to="Öffne" />
+    <Word from="I/egen" to="liegen" />
+    <Word from="I5sst" to="lässt" />
+    <Word from="I5stern" to="lästern" />
+    <Word from="I6sen" to="lösen" />
+    <Word from="Iaß" to="lass" />
+    <Word from="Iaßt" to="lasst" />
+    <Word from="Icll" to="Ich" />
+    <Word from="identifizieet" to="identifiziert" />
+    <Word from="IDENTITAT" to="IDENTITÄT" />
+    <Word from="IE" to="Iß" />
+    <Word from="Iebendigl" to="lebendig!" />
+    <Word from="Iebenslinglich" to="lebensläglich" />
+    <Word from="Iebtjetzt" to="lebt jetzt" />
+    <Word from="Ieck" to="leck" />
+    <Word from="Iehn" to="lehn" />
+    <Word from="Ieid‚" to="leid‚" />
+    <Word from="Ieinenlose" to="leinenlose" />
+    <Word from="Ienistische" to="leninistische" />
+    <Word from="Ietztendlich" to="letztendlich" />
+    <Word from="Ifigt" to="lügt" />
+    <Word from="Ihrdllirft" to="Ihr dürft" />
+    <Word from="ihrja" to="ihr ja" />
+    <Word from="ihrjemals" to="ihr jemals" />
+    <Word from="ihrjetzt" to="ihr jetzt" />
+    <Word from="ihrjeweiliges" to="ihr jeweiliges" />
+    <Word from="ihrVater" to="ihr Vater" />
+    <Word from="ihrvorstrafenregister" to="ihr Vorstrafenregister" />
+    <Word from="ihrwahres" to="ihr wahres" />
+    <Word from="Ihrwerdet" to="Ihr werdet" />
+    <Word from="ihrzwei" to="ihr zwei" />
+    <Word from="iibel" to="übel" />
+    <Word from="iibemehmen" to="übernehmen" />
+    <Word from="iiber" to="über" />
+    <Word from="iiberall" to="überall" />
+    <Word from="iiberallhin" to="überallhin" />
+    <Word from="iiberdauern" to="überdauern" />
+    <Word from="iiberdauerte" to="überdauerte" />
+    <Word from="iibereinstimmte" to="übereinstimme" />
+    <Word from="iiberfallen" to="überfallen" />
+    <Word from="iiberfiel" to="überfiel" />
+    <Word from="iibergeben" to="übergeben" />
+    <Word from="iiberhaupt" to="überhaupt" />
+    <Word from="iiberhiirt" to="überhört" />
+    <Word from="iiberholt" to="überholt" />
+    <Word from="iiberholter" to="überholter" />
+    <Word from="iiberkam" to="überkam" />
+    <Word from="iiberlassen" to="überlassen" />
+    <Word from="iiberleben" to="überleben" />
+    <Word from="iiberlebt" to="überlebt" />
+    <Word from="iiberlegen" to="überlegen" />
+    <Word from="iiberlegten" to="überlegten" />
+    <Word from="iibernahmen" to="übernahmen" />
+    <Word from="iibernehme" to="übernehme" />
+    <Word from="iibernehmen" to="übernehmen" />
+    <Word from="iibernimmt" to="übernimmt" />
+    <Word from="iibernommen" to="übernommen" />
+    <Word from="iiberpriife" to="überprüfe" />
+    <Word from="iiberpriifen" to="überprüfen" />
+    <Word from="iiberpriift" to="überprüft" />
+    <Word from="iiberpriiften" to="überprüften" />
+    <Word from="iiberqueren" to="überqueren" />
+    <Word from="iiberragen" to="überragen" />
+    <Word from="iiberrascht" to="überrascht" />
+    <Word from="iiberraschte" to="überraschte" />
+    <Word from="iiberreden" to="überreden" />
+    <Word from="iiberschritten" to="überschritten" />
+    <Word from="iibersetzen" to="übersetzen" />
+    <Word from="iibersetzt" to="übersetzt" />
+    <Word from="iibersteigt" to="übersteigt" />
+    <Word from="iibertragen" to="übertragen" />
+    <Word from="iibertreffen" to="übertreffen" />
+    <Word from="iibertreib" to="übertreib" />
+    <Word from="iibertreiben" to="übertreiben" />
+    <Word from="iibertrieben" to="übertrieben" />
+    <Word from="iiberzeugen" to="überzeugen" />
+    <Word from="iiberzeugt" to="überzeugt" />
+    <Word from="iiblich" to="üblich" />
+    <Word from="iibliche" to="übliche" />
+    <Word from="iibrig" to="übrig" />
+    <Word from="IieB" to="ließ" />
+    <Word from="Iiebte" to="liebte" />
+    <Word from="Iief's" to="lief's" />
+    <Word from="Iiehe" to="liebe" />
+    <Word from="Iieflest" to="ließest" />
+    <Word from="iiffentlichen" to="öffentlichen" />
+    <Word from="iiffentliches" to="öffentliches" />
+    <Word from="iiffnest" to="öffnest" />
+    <Word from="iifter" to="öfter" />
+    <Word from="iihnllchkelt" to="Ähnllchkelt" />
+    <Word from="Iisst" to="lässt" />
+    <Word from="ijbel" to="übel" />
+    <Word from="ijben" to="üben" />
+    <Word from="ijberall" to="überall" />
+    <Word from="ijberhaupt" to="überhaupt" />
+    <Word from="ijberlegene" to="überlegene" />
+    <Word from="ijbernehme" to="übernehme" />
+    <Word from="ijbernimmst" to="übernimmst" />
+    <Word from="ijberprijfen" to="überprüfen" />
+    <Word from="ijberreden" to="überreden" />
+    <Word from="ijbertrage" to="übertrage" />
+    <Word from="ijberwunden" to="überwunden" />
+    <Word from="ijberzeugen" to="überzeugen" />
+    <Word from="ijberzogen" to="überzogen" />
+    <Word from="Il6her" to="höher" />
+    <Word from="IleiB" to="heiß" />
+    <Word from="Ill" to="III" />
+    <Word from="Illfie" to="Wie" />
+    <Word from="Ilrger" to="Ärger" />
+    <Word from="Ilufierste" to="Äußerste" />
+    <Word from="immerja" to="immer ja" />
+    <Word from="immerjung" to="immer jung" />
+    <Word from="immerweinen" to="immer weinen" />
+    <Word from="immerwährende" to="immer währende" />
+    <Word from="immerwéhrende" to="immerwährende" />
+    <Word from="Improvisiation" to="Improvisation" />
+    <Word from="Impulswellengeschutz" to="Impulswellengeschütz" />
+    <Word from="INBRUNSTIGE" to="INBRÜNSTIGE" />
+    <Word from="instfindig" to="inständig" />
+    <Word from="intramuskulér" to="intramuskulär" />
+    <Word from="INVASIONSFLOTFE" to="INVASIONSFLOTTE" />
+    <Word from="Iosgeliist" to="losgelöst" />
+    <Word from="Iosgelést" to="losgelöst" />
+    <Word from="Ioszuliisen" to="loszulösen" />
+    <Word from="ip" to="in" />
+    <Word from="irn" to="im" />
+    <Word from="irrefuhren" to="irreführen" />
+    <Word from="irrefuhrende" to="irreführende" />
+    <Word from="istja" to="ist ja" />
+    <Word from="istjedoch" to="ist jedoch" />
+    <Word from="istjemand" to="ist jemand" />
+    <Word from="istjetzt" to="ist jetzt" />
+    <Word from="istJohnny" to="ist Johnny" />
+    <Word from="istjung" to="ist jung" />
+    <Word from="istweg" to="ist weg" />
+    <Word from="ITIUSSEFI" to="müssen" />
+    <Word from="ITIUSSGI7" to="müssen" />
+    <Word from="ITTITTRZ" to="Danke." />
+    <Word from="Ivlégliche" to="Mögliche" />
+    <Word from="Iécheln" to="lächeln" />
+    <Word from="Iécherlich" to="lächerlich" />
+    <Word from="Iécherlichen" to="lächerlichen" />
+    <Word from="Iéhmt" to="lähmt" />
+    <Word from="Iéiuft" to="läuft" />
+    <Word from="Iénger" to="länger" />
+    <Word from="Iésst" to="lässt" />
+    <Word from="Iésste" to="lässte" />
+    <Word from="Iéuft" to="läuft" />
+    <Word from="J0Shua" to="Joshua" />
+    <Word from="Jackettkaufen" to="Jackett kaufen" />
+    <Word from="jahr" to="Jahr" />
+    <Word from="jahre" to="Jahre" />
+    <Word from="jahren" to="Jahren" />
+    <Word from="JAHRIGE" to="JÄHRIGE" />
+    <Word from="jal" to="ja!" />
+    <Word from="jemandenl" to="jemanden!" />
+    <Word from="jetztl" to="jetzt!" />
+    <Word from="jiidisch" to="jüdisch" />
+    <Word from="Jiingem" to="Jüngern" />
+    <Word from="jiingerwar" to="jünger war" />
+    <Word from="Jiingste" to="Jüngste" />
+    <Word from="jilnger" to="jünger" />
+    <Word from="Jlllngling" to="Jüngling" />
+    <Word from="job" to="Job" />
+    <Word from="Jogglng" to="Jogging" />
+    <Word from="john" to="John" />
+    <Word from="johnny" to="Johnny" />
+    <Word from="journalisten" to="Journalisten" />
+    <Word from="Jullo" to="Julie" />
+    <Word from="JUNGFRAULICHE" to="JUNGFRÄULICHE" />
+    <Word from="jungfréuliche" to="jungfräuliche" />
+    <Word from="jungfréulichen" to="jungfräulichen" />
+    <Word from="jungfréulicher" to="jungfräulicher" />
+    <Word from="Jungfréulichkeit" to="Jungfräulichkeit" />
+    <Word from="Jungsl" to="Jungs!" />
+    <Word from="Jungste" to="Jüngste" />
+    <Word from="Jurlgs" to="Jungs" />
+    <Word from="Justitzministeriums" to="Justizministeriums" />
+    <Word from="Jéger" to="Jäger" />
+    <Word from="Jéhrige" to="Jährige" />
+    <Word from="jéhrigen" to="jährigen" />
+    <Word from="jéhriger" to="jähriger" />
+    <Word from="jéhrlich" to="jährlich" />
+    <Word from="Jéiger" to="Jäger" />
+    <Word from="jéihrigen" to="jährigen" />
+    <Word from="jémmerlich" to="jämmerlich" />
+    <Word from="k'a'mpfen" to="kämpfen" />
+    <Word from="K/no" to="Kino" />
+    <Word from="K/Varte" to="Warte" />
+    <Word from="K/Velle" to="Welle" />
+    <Word from="K5NIGIN" to="KÖNIGIN" />
+    <Word from="K6der" to="Köder" />
+    <Word from="K6ln" to="Köln" />
+    <Word from="K6nig" to="König" />
+    <Word from="K6nige" to="Könige" />
+    <Word from="K6nigin" to="Königin" />
+    <Word from="k6nnen" to="können" />
+    <Word from="k6nnen's" to="können's" />
+    <Word from="k6nnest" to="könntest" />
+    <Word from="k6nnt" to="könnt" />
+    <Word from="K6nnte" to="Könnte" />
+    <Word from="k6nnte's" to="könnte's" />
+    <Word from="k6nnten" to="könnten" />
+    <Word from="k6nntest" to="könntest" />
+    <Word from="K6pfe" to="Köpfe" />
+    <Word from="K6rper" to="Körper" />
+    <Word from="K6rpers" to="Körpers" />
+    <Word from="K6stlich" to="Köstlich" />
+    <Word from="Kabelménner" to="Kabelmänner" />
+    <Word from="kalf" to="kalt" />
+    <Word from="kaltblijtig" to="kaltblütig" />
+    <Word from="kampfen" to="kämpfen" />
+    <Word from="Kampfjéger" to="Kampfjäger" />
+    <Word from="Kanarienviigeln" to="Kanarienvögeln" />
+    <Word from="kann'sja" to="kann's ja" />
+    <Word from="kannstja" to="kannst ja" />
+    <Word from="Kanélen" to="Kanälen" />
+    <Word from="Kapitan" to="Kapitän" />
+    <Word from="Kapitln" to="Kapitän" />
+    <Word from="Kapitlnen" to="Kapitänen" />
+    <Word from="Kapitlns" to="Kapitäns" />
+    <Word from="Kapitéin" to="Kapitän" />
+    <Word from="Kapitéinleutnant" to="Kapitänleutnant" />
+    <Word from="Kapitéins" to="Kapitäns" />
+    <Word from="Kapitén" to="Kapitän" />
+    <Word from="Kapiténleutnant" to="Kapitänleutnant" />
+    <Word from="Kapiténs" to="Kapitäns" />
+    <Word from="Kapt'n" to="Käpt'n" />
+    <Word from="kaputthaust" to="kaputt haust" />
+    <Word from="Kartoffelschélen" to="Kartoffelschälen" />
+    <Word from="Kassettengeréit" to="Kassettengerät" />
+    <Word from="kbnnen" to="können" />
+    <Word from="kbnnten" to="könnten" />
+    <Word from="kdnnen" to="können" />
+    <Word from="kdnnfe" to="könnte" />
+    <Word from="kdnnte" to="könnte" />
+    <Word from="ke/ne" to="keine" />
+    <Word from="Kefn" to="Kein" />
+    <Word from="Keh/1" to="Kehrt" />
+    <Word from="Keithl" to="Keith!" />
+    <Word from="keln" to="kein" />
+    <Word from="kelne" to="keine" />
+    <Word from="Keri" to="Kerl" />
+    <Word from="kfime" to="käme" />
+    <Word from="Kfimmer" to="Kümmer" />
+    <Word from="kfimmere" to="kümmere" />
+    <Word from="kfimmern" to="kümmern" />
+    <Word from="kfimmert" to="kümmert" />
+    <Word from="kfimpft" to="kämpft" />
+    <Word from="kfimpften" to="kämpften" />
+    <Word from="Kfinig" to="König" />
+    <Word from="Kfinnen" to="Können" />
+    <Word from="kfinnte" to="könnte" />
+    <Word from="Kfinnten" to="Könnten" />
+    <Word from="Kfinntest" to="Könntest" />
+    <Word from="Kfiss" to="Küss" />
+    <Word from="Kfisschen" to="Küsschen" />
+    <Word from="Kfissen" to="Küssen" />
+    <Word from="Kfjnnte" to="Könnte" />
+    <Word from="Khnlichkeit" to="Ähnlichkeit" />
+    <Word from="KIar" to="Klar" />
+    <Word from="Kifig" to="Käfig" />
+    <Word from="Kiiche" to="Küche" />
+    <Word from="Kiichenhelfer" to="Küchenhelfer" />
+    <Word from="Kiichln" to="Köchin" />
+    <Word from="Kiihe" to="Kühe" />
+    <Word from="Kiihlbox" to="Kühlbox" />
+    <Word from="kiihler" to="kühler" />
+    <Word from="Kiihlschrank" to="Kühlschrank" />
+    <Word from="kiimmem" to="kümmern" />
+    <Word from="kiimmer" to="kümmer" />
+    <Word from="kiimmere" to="kümmere" />
+    <Word from="Kiimmern" to="Kümmern" />
+    <Word from="kiindigen" to="kündigen" />
+    <Word from="Kiinig" to="König" />
+    <Word from="Kiinige" to="Könige" />
+    <Word from="Kiinigen" to="Königen" />
+    <Word from="Kiinigin" to="Königin" />
+    <Word from="Kiiniginnen" to="Königinnen" />
+    <Word from="kiinigliche" to="königliche" />
+    <Word from="kiiniglichen" to="königlichen" />
+    <Word from="kiiniglicher" to="königlicher" />
+    <Word from="Kiinigreichs" to="Königreichs" />
+    <Word from="Kiinigs" to="Königs" />
+    <Word from="Kiinigtum" to="Königtum" />
+    <Word from="kiinne" to="könne" />
+    <Word from="kiinnen" to="können" />
+    <Word from="kiinnt" to="könnt" />
+    <Word from="Kiinnte" to="Könnte" />
+    <Word from="kiinnten" to="könnten" />
+    <Word from="kiinntest" to="könntest" />
+    <Word from="kiinntet" to="könntet" />
+    <Word from="Kiinstler" to="Künstler" />
+    <Word from="kiinstlerischen" to="künstlerischen" />
+    <Word from="kiipfen" to="köpfen" />
+    <Word from="Kiirper" to="Körper" />
+    <Word from="Kiirperfunktionen" to="Körperfunktionen" />
+    <Word from="Kiirperhaltung" to="Körperhaltung" />
+    <Word from="kiirperliche" to="körperliche" />
+    <Word from="Kiirperliches" to="Körperliches" />
+    <Word from="Kiirpersprache" to="Körpersprache" />
+    <Word from="Kiirperverletzung" to="Körperverletzung" />
+    <Word from="kiirzen" to="kürzen" />
+    <Word from="kiirzerzutreten" to="kürzerzutreten" />
+    <Word from="kiirzeste" to="kürzeste" />
+    <Word from="Kiisschen" to="Küsschen" />
+    <Word from="Kiissen" to="Küssen" />
+    <Word from="Kiisst" to="Küsst" />
+    <Word from="Kiiste" to="Küste" />
+    <Word from="kiistlich" to="köstlich" />
+    <Word from="Kijche" to="Küche" />
+    <Word from="Kijhlschrank" to="Kühlschrank" />
+    <Word from="Kijmmere" to="Kümmere" />
+    <Word from="kijmmern" to="kümmern" />
+    <Word from="kijmmernl" to="kümmern!" />
+    <Word from="kijmmerst" to="kümmerst" />
+    <Word from="kijmmerten" to="kümmerten" />
+    <Word from="kijndigt" to="kündigt" />
+    <Word from="kijnnen" to="können" />
+    <Word from="kijnnt" to="könnt" />
+    <Word from="kijnnte" to="könnte" />
+    <Word from="kijnnten" to="könnten" />
+    <Word from="Kijnstler" to="Künstler" />
+    <Word from="Kijrbis" to="Kürbis" />
+    <Word from="kijrzlich" to="kürzlich" />
+    <Word from="kijrzliche" to="kürzliche" />
+    <Word from="Kijrzungen" to="Kürzungen" />
+    <Word from="kijsst" to="küsst" />
+    <Word from="Kijste" to="Küste" />
+    <Word from="Kilche" to="Küche" />
+    <Word from="Kilchlein" to="Küchlein" />
+    <Word from="kilhlen" to="kühlen" />
+    <Word from="kilhler" to="kühler" />
+    <Word from="Kilhlkreislauf" to="Kühlkreislauf" />
+    <Word from="Kilhlschrank" to="Kühlschrank" />
+    <Word from="Kilmmern" to="Kümmern" />
+    <Word from="Kilmmert" to="Kümmert" />
+    <Word from="kilndigen" to="kündigen" />
+    <Word from="kilnstliche" to="künstliche" />
+    <Word from="kilss" to="küss" />
+    <Word from="kilsse" to="küsse" />
+    <Word from="kilssen" to="küssen" />
+    <Word from="Kindermédchen" to="Kindermädchen" />
+    <Word from="Kinderspiell" to="Kinderspiel!" />
+    <Word from="Kindsképfe" to="Kindsköpfe" />
+    <Word from="kiokflip" to="kickflip" />
+    <Word from="KIotz" to="Klotz" />
+    <Word from="KL'lr" to="Kür" />
+    <Word from="KL'lste" to="Küste" />
+    <Word from="Klapsmiihle" to="Klapsmühle" />
+    <Word from="Klassemédchen" to="Klassemädchen" />
+    <Word from="kle/ne" to="kleine" />
+    <Word from="Kleidergr6Be" to="Kleidergröße" />
+    <Word from="Kleidergrfilie" to="Kleidergröße" />
+    <Word from="Kleinerl" to="Kleiner!" />
+    <Word from="kleinwiichsige" to="kleinwüchsige" />
+    <Word from="kleinwilchsiges" to="kleinwüchsiges" />
+    <Word from="klijger" to="klüger" />
+    <Word from="klijgsten" to="klügsten" />
+    <Word from="klilger" to="klüger" />
+    <Word from="kLinft'gen" to="künft'gen" />
+    <Word from="klirst" to="klärst" />
+    <Word from="kljmmere" to="kümmere" />
+    <Word from="Kllirze" to="Kürze" />
+    <Word from="kllissen" to="küssen" />
+    <Word from="Klliste" to="Küste" />
+    <Word from="Klllche" to="Küche" />
+    <Word from="klllhnsten" to="kühnsten" />
+    <Word from="kllllger" to="klüger" />
+    <Word from="Klobtlrsten" to="Klobürsten" />
+    <Word from="klopfll" to="klopft!" />
+    <Word from="Klpt'n" to="Käpt'n" />
+    <Word from="Klpt'nl" to="Käpt'n!" />
+    <Word from="Klpt'ns" to="Käpt'ns" />
+    <Word from="Klse" to="Käse" />
+    <Word from="Klseschnuffelei" to="Käseschnüffelei" />
+    <Word from="Kltigste" to="Klügste" />
+    <Word from="Klugscheifler" to="Klugscheißer" />
+    <Word from="kléffen" to="kläffen" />
+    <Word from="Kléiren" to="Klären" />
+    <Word from="Kléranlage" to="Kläranlage" />
+    <Word from="Klére" to="Kläre" />
+    <Word from="kléren" to="klären" />
+    <Word from="Kn6pf" to="Knöpf" />
+    <Word from="Knallttite" to="Knalltüte" />
+    <Word from="Knastwill" to="Knast will" />
+    <Word from="Knderung" to="Änderung" />
+    <Word from="Knochengrfinde" to="Knochengründe" />
+    <Word from="Knofen" to="Knoten" />
+    <Word from="Knuller" to="Knüller" />
+    <Word from="Knupf" to="Knüpf" />
+    <Word from="Knupfe" to="Knüpfe" />
+    <Word from="knupfen" to="knüpfen" />
+    <Word from="knzjipfe" to="knüpfe" />
+    <Word from="Knédell" to="Knödel!" />
+    <Word from="knépf" to="knöpf" />
+    <Word from="Knépfe" to="Knöpfe" />
+    <Word from="Knésten" to="Knästen" />
+    <Word from="Kofferraumschliissel" to="Kofferraumschlüssel" />
+    <Word from="Kohlenséure" to="Kohlensäure" />
+    <Word from="Komafélle" to="Komafälle" />
+    <Word from="Komaféllen" to="Komafällen" />
+    <Word from="Kombiise" to="Kombüse" />
+    <Word from="Kombuse" to="Kombüse" />
+    <Word from="Komiidie" to="Komödie" />
+    <Word from="kommerz/ellen" to="kommerziellen" />
+    <Word from="kommjetzt" to="komm jetzt" />
+    <Word from="Kompatibilitfits" to="Kompatibilitäts" />
+    <Word from="Kompatibilitéits" to="Kompatibilitäts" />
+    <Word from="Kompatiblit5ts" to="Kompatiblitäts" />
+    <Word from="Komédie" to="Komödie" />
+    <Word from="KONIGIN" to="KÖNIGIN" />
+    <Word from="konne" to="könne" />
+    <Word from="konnen" to="können" />
+    <Word from="konnt" to="könnt" />
+    <Word from="konsen/ativ" to="konservativ" />
+    <Word from="Kopfabreifimann" to="Kopfabreißmann" />
+    <Word from="Kopfgeldjéger" to="Kopfgeldjäger" />
+    <Word from="Kopfgeldjégern" to="Kopfgeldjägern" />
+    <Word from="Kopfméfiig" to="Kopfmäßig" />
+    <Word from="Kopfnijsse" to="Kopfnüsse" />
+    <Word from="kostengtlnstige" to="kostengünstige" />
+    <Word from="Kostiim" to="Kostüm" />
+    <Word from="Kostiimdesigner" to="Kostümdesigner" />
+    <Word from="Kostiimdesignerin" to="Kostümdesignerin" />
+    <Word from="Kostiimdrama" to="Kostümdrama" />
+    <Word from="Kostiime" to="Kostüme" />
+    <Word from="Kostiims" to="Kostüms" />
+    <Word from="Kostume" to="Kostüme" />
+    <Word from="Kostflm" to="Kostüm" />
+    <Word from="kr/egen" to="kriegen" />
+    <Word from="kr6ne" to="kröne" />
+    <Word from="kr6nen" to="krönen" />
+    <Word from="Kr6ten" to="Kröten" />
+    <Word from="Krafte" to="Kräfte" />
+    <Word from="Kraftwfirfel" to="Kraftwürfel" />
+    <Word from="Kranfflhrer" to="Kranführer" />
+    <Word from="Kreativitét" to="Kreativität" />
+    <Word from="Kreuzverhor" to="Kreuzverhör" />
+    <Word from="krfiftiger" to="kräftiger" />
+    <Word from="Krfiutertee" to="Kräutertee" />
+    <Word from="Kriegserklérungen" to="Kriegserklärungen" />
+    <Word from="Kriegsfuhrung" to="Kriegsführung" />
+    <Word from="Kriegsschauplatze" to="Kriegsschauplätze" />
+    <Word from="Kriifte" to="Kräfte" />
+    <Word from="Kriinung" to="Krönung" />
+    <Word from="Kriinungsfeier" to="Krönungsfeier" />
+    <Word from="Krijppel" to="Krüppel" />
+    <Word from="Krijte" to="Kröte" />
+    <Word from="Kronjuwell" to="Kronjuwel!" />
+    <Word from="KROTE" to="KRÖTE" />
+    <Word from="Krsche" to="Ärsche" />
+    <Word from="Kréfte" to="Kräfte" />
+    <Word from="Kréften" to="Kräften" />
+    <Word from="Kréftigsten" to="Kräftigsten" />
+    <Word from="Kréhe" to="Krähe" />
+    <Word from="kréht" to="kräht" />
+    <Word from="kréichzt" to="krächzt" />
+    <Word from="Kréifte" to="Kräfte" />
+    <Word from="Kréiutertee" to="Kräutertee" />
+    <Word from="Krémpfe" to="Krämpfe" />
+    <Word from="krénte" to="krönte" />
+    <Word from="Kréte" to="Kröte" />
+    <Word from="Krétes" to="Krötes" />
+    <Word from="Kréutern" to="Kräutern" />
+    <Word from="Kréutersenf" to="Kräutersenf" />
+    <Word from="Ktiche" to="Küche" />
+    <Word from="Ktinige" to="Könige" />
+    <Word from="ktinntest" to="könntest" />
+    <Word from="Ktisschen" to="Küsschen" />
+    <Word from="ktlmmere" to="kümmere" />
+    <Word from="ktznnen" to="können" />
+    <Word from="Kuche" to="Küche" />
+    <Word from="KUCHE" to="KÜCHE" />
+    <Word from="Kuckucksgeréusch" to="Kuckucksgeräusch" />
+    <Word from="KUl'ZSCl'1lUSS9" to="Kürzschlüsse" />
+    <Word from="kulz" to="kurz" />
+    <Word from="kummer" to="kümmer" />
+    <Word from="Kummere" to="Kümmere" />
+    <Word from="kummern" to="kümmern" />
+    <Word from="kummert" to="kümmert" />
+    <Word from="Kumpell" to="Kumpel!" />
+    <Word from="Kunststficke" to="Kunststücke" />
+    <Word from="Kunststticke" to="Kunststücke" />
+    <Word from="Kuriositéten" to="Kuriositäten" />
+    <Word from="kurzeste" to="kürzeste" />
+    <Word from="kurzte" to="kürzte" />
+    <Word from="Kurzwellenfunkgeréte" to="Kurzwellenfunkgeräte" />
+    <Word from="Kurzzeitgediichtnis" to="Kurzzeitgedächtnis" />
+    <Word from="Kurzzeitgedéchtnis" to="Kurzzeitgedächtnis" />
+    <Word from="KUS1I€" to="Küste" />
+    <Word from="Kuschelhengstl" to="Kuschelhengst!" />
+    <Word from="KUSSE" to="KÜSSE" />
+    <Word from="KUSSGH" to="küssen" />
+    <Word from="kusste" to="küsste" />
+    <Word from="KUSTE" to="KÜSTE" />
+    <Word from="Kuste" to="Küste" />
+    <Word from="Kéfer" to="Käfer" />
+    <Word from="Kéfig" to="Käfig" />
+    <Word from="kéime" to="käme" />
+    <Word from="kéimpfen" to="kämpfen" />
+    <Word from="kéimpfend" to="kämpfend" />
+    <Word from="kéimpft" to="kämpft" />
+    <Word from="kéimpfte" to="kämpfte" />
+    <Word from="kéimpften" to="kämpften" />
+    <Word from="kéimpftest" to="kämpftest" />
+    <Word from="kéimpfwie" to="kämpf wie" />
+    <Word from="Kéinguru" to="Känguru" />
+    <Word from="kéinnen" to="können" />
+    <Word from="kéinnte" to="könnte" />
+    <Word from="Kéirper" to="Körper" />
+    <Word from="Kéise" to="Käse" />
+    <Word from="Kéisebrunnen" to="Käsebrunnen" />
+    <Word from="Kélte" to="Kälte" />
+    <Word from="kélter" to="kälter" />
+    <Word from="kélteste" to="kälteste" />
+    <Word from="kéme" to="käme" />
+    <Word from="kémen" to="kämen" />
+    <Word from="kémpfe" to="kämpfe" />
+    <Word from="Kémpfen" to="Kämpfen" />
+    <Word from="Kémpfer" to="Kämpfer" />
+    <Word from="kémpferische" to="kämpferische" />
+    <Word from="kémpfst" to="kämpfst" />
+    <Word from="kémpft" to="kämpft" />
+    <Word from="kémpfte" to="kämpfte" />
+    <Word from="kémpften" to="kämpften" />
+    <Word from="kémt" to="kämt" />
+    <Word from="Kénig" to="König" />
+    <Word from="Kénige" to="Könige" />
+    <Word from="Kénigin" to="Königin" />
+    <Word from="Kéniginl" to="Königin!" />
+    <Word from="Kéniginnen" to="Königinnen" />
+    <Word from="kéniglich" to="königlich" />
+    <Word from="kénigliche" to="königliche" />
+    <Word from="kéniglichen" to="königlichen" />
+    <Word from="kénigliches" to="königliches" />
+    <Word from="Kénigreich" to="Königreich" />
+    <Word from="Kénigreichs" to="Königreichs" />
+    <Word from="Kénigs" to="Königs" />
+    <Word from="Kénigsfamilie" to="Königsfamilie" />
+    <Word from="kénne" to="könne" />
+    <Word from="kénnen" to="können" />
+    <Word from="kénnt" to="könnt" />
+    <Word from="kénnte" to="könnte" />
+    <Word from="Kénnten" to="Könnten" />
+    <Word from="Kénntest" to="Könntest" />
+    <Word from="Kénntet" to="Könntet" />
+    <Word from="Képfchen" to="Köpfchen" />
+    <Word from="Képfe" to="Köpfe" />
+    <Word from="Képfen" to="Köpfen" />
+    <Word from="képft" to="köpft" />
+    <Word from="Képt'n" to="Käpt'n" />
+    <Word from="Kérbchen" to="Körbchen" />
+    <Word from="Kérbchengréfie" to="Körbchengröße" />
+    <Word from="Kérben" to="Körben" />
+    <Word from="Kérper" to="Körper" />
+    <Word from="Kérperfunktionen" to="Körperfunktionen" />
+    <Word from="kérperlich" to="körperlich" />
+    <Word from="kérperliche" to="körperliche" />
+    <Word from="Kérperproportionen" to="Körperproportionen" />
+    <Word from="Kérpersprache" to="Körpersprache" />
+    <Word from="Kérpertyp" to="Körpertyp" />
+    <Word from="Kérperverletzung" to="Körperverletzung" />
+    <Word from="Kérperéffnungen" to="Körperöffnungen" />
+    <Word from="Kése" to="Käse" />
+    <Word from="Késebrett" to="Käsebrett" />
+    <Word from="Késecracker" to="Käsecracker" />
+    <Word from="késtlich" to="köstlich" />
+    <Word from="Kéter" to="Köter" />
+    <Word from="Kétern" to="Kötern" />
+    <Word from="Kflmmere" to="Kümmere" />
+    <Word from="kflmmern" to="kümmern" />
+    <Word from="L'a'cherlich" to="Lächerlich" />
+    <Word from="L'a'ndern" to="Ländern" />
+    <Word from="l'a'sst" to="lässt" />
+    <Word from="l'a'uft" to="läuft" />
+    <Word from="l/chtes" to="lichtes" />
+    <Word from="l/Vings" to="Wings" />
+    <Word from="L5cheln" to="Lächeln" />
+    <Word from="L6ffel" to="Löffel" />
+    <Word from="L6schen" to="Löschen" />
+    <Word from="L6se" to="Löse" />
+    <Word from="l6sen" to="lösen" />
+    <Word from="L6wen" to="Löwen" />
+    <Word from="L6win" to="Löwin" />
+    <Word from="LADIESMANZ17" to="LADIESMAN217" />
+    <Word from="Landhéuser" to="Landhäuser" />
+    <Word from="Landstrafle" to="Landstraße" />
+    <Word from="Landséiugetier" to="Landsäugetier" />
+    <Word from="langl" to="lang!" />
+    <Word from="langweiligl" to="langweilig!" />
+    <Word from="Lasergestutzte" to="Lasergestützte" />
+    <Word from="Laserzielgerét" to="Laserzielgerät" />
+    <Word from="Lattenzaunweifl" to="Lattenzaunweiß" />
+    <Word from="Laudal" to="Lauda!" />
+    <Word from="laufl" to="lauf!" />
+    <Word from="Laufl" to="Lauf!" />
+    <Word from="Laß" to="Lass" />
+    <Word from="lch" to="Ich" />
+    <Word from="ldee" to="Idee" />
+    <Word from="ldeen" to="Ideen" />
+    <Word from="ldelia" to="Idelia" />
+    <Word from="ldentifikation" to="Identifikation" />
+    <Word from="ldentifikationsnummer" to="Identifikationsnummer" />
+    <Word from="ldentifikationssignal" to="Identifikationssignal" />
+    <Word from="ldentifizierung" to="Identifizierung" />
+    <Word from="ldentit'a'tsscheibe" to="ldentitätsscheibe" />
+    <Word from="ldioten" to="Idioten" />
+    <Word from="ldloten" to="Idioten" />
+    <Word from="Le/d" to="Leid" />
+    <Word from="Lebenl" to="Leben!" />
+    <Word from="lebensféhig" to="lebensfähig" />
+    <Word from="lebenslénglich" to="lebenslänglich" />
+    <Word from="lebensmijlde" to="lebensmüde" />
+    <Word from="Leberschéden" to="Leberschäden" />
+    <Word from="leergegessen" to="leer gegessen" />
+    <Word from="legendére" to="legendäre" />
+    <Word from="legendéren" to="legendären" />
+    <Word from="Legionér" to="Legionär" />
+    <Word from="Legionére" to="Legionäre" />
+    <Word from="Lehe" to="Lebe" />
+    <Word from="Leichenschéndung" to="Leichenschändung" />
+    <Word from="leichtjemanden" to="leicht jemanden" />
+    <Word from="leidl" to="leid!" />
+    <Word from="Leistuljg" to="Leistung" />
+    <Word from="Lelbwfichter" to="Leibwächter" />
+    <Word from="Leld" to="Leid" />
+    <Word from="lemen" to="lernen" />
+    <Word from="Lenkséule" to="Lenksäule" />
+    <Word from="lfidt" to="lädt" />
+    <Word from="lfigt" to="lügt" />
+    <Word from="lfinger" to="länger" />
+    <Word from="lfiuft" to="läuft" />
+    <Word from="Lfiuterung" to="Läuterung" />
+    <Word from="lgitt" to="Igitt" />
+    <Word from="lgnorier" to="Ignorier" />
+    <Word from="lhm" to="Ihm" />
+    <Word from="lhn" to="Ihn" />
+    <Word from="lhnen" to="Ihnen" />
+    <Word from="lhnenl" to="Ihnen!" />
+    <Word from="lhr" to="Ihr" />
+    <Word from="lhre" to="Ihre" />
+    <Word from="lhrem" to="Ihrem" />
+    <Word from="lhren" to="Ihren" />
+    <Word from="lhrer" to="Ihrer" />
+    <Word from="lhrerverffigung" to="Ihrer Verfügung" />
+    <Word from="lhres" to="Ihres" />
+    <Word from="lhrfehlt" to="Ihr fehlt" />
+    <Word from="lhrjemalsjemanden" to="lhr jemals jemanden" />
+    <Word from="lhrVerteidiger" to="lhr Verteidiger" />
+    <Word from="Libel" to="übel" />
+    <Word from="Libelwollen" to="übelwollen" />
+    <Word from="Liben" to="üben" />
+    <Word from="Liber" to="über" />
+    <Word from="Liberall" to="überall" />
+    <Word from="Liberdenken" to="überdenken" />
+    <Word from="Liberdrllissig" to="überdrüssig" />
+    <Word from="Liberfallen" to="überfallen" />
+    <Word from="Libergebrannt" to="übergebrannt" />
+    <Word from="Liberhaupt" to="überhaupt" />
+    <Word from="Liberlasst" to="überlasst" />
+    <Word from="Liberleben" to="Überleben" />
+    <Word from="Liberlegen" to="überlegen" />
+    <Word from="Liberlegt" to="überlegt" />
+    <Word from="Libernimmt" to="übernimmt" />
+    <Word from="Liberpriift" to="überprüft" />
+    <Word from="Liberreden" to="überreden" />
+    <Word from="Libersteht" to="übersteht" />
+    <Word from="Liberstllirzen" to="überstürzen" />
+    <Word from="Liberwachen" to="überwachen" />
+    <Word from="Liberwacht" to="überwacht" />
+    <Word from="Liberwinden" to="überwinden" />
+    <Word from="Liberwéltigen" to="überwältigen" />
+    <Word from="Liberwéltigt" to="überwältigt" />
+    <Word from="Liberzeugt" to="überzeugt" />
+    <Word from="Lible" to="üble" />
+    <Word from="Liblich" to="üblich" />
+    <Word from="Libliche" to="Übliche" />
+    <Word from="Librig" to="übrig" />
+    <Word from="lie/3" to="ließ" />
+    <Word from="lie/Se" to="ließe" />
+    <Word from="lieB" to="ließ" />
+    <Word from="lieBe" to="ließe" />
+    <Word from="liebenswilrdig" to="liebenswürdig" />
+    <Word from="liebenswurdiger" to="liebenswürdiger" />
+    <Word from="Liebesgestiindnis" to="Liebesgeständnis" />
+    <Word from="Lieblingsbeschéftigung" to="Lieblingsbeschäftigung" />
+    <Word from="Lieblingsrockerl" to="Lieblingsrocker!" />
+    <Word from="Lieblingssétze" to="Lieblingssätze" />
+    <Word from="lief2&gt;en" to="ließen" />
+    <Word from="Liefergebiihren" to="Liefergebühren" />
+    <Word from="lieflsen" to="ließen" />
+    <Word from="liegenlassen" to="liegen lassen" />
+    <Word from="Liehe" to="Liebe" />
+    <Word from="lieli" to="ließ" />
+    <Word from="lielien" to="ließen" />
+    <Word from="Liellen" to="Ließen" />
+    <Word from="liells" to="ließ" />
+    <Word from="lien" to="ließ" />
+    <Word from="Liicher" to="Löcher" />
+    <Word from="Liige" to="Lüge" />
+    <Word from="Liigner" to="Lügner" />
+    <Word from="liinger" to="länger" />
+    <Word from="liischen" to="löschen" />
+    <Word from="liischt" to="löscht" />
+    <Word from="Liisst" to="Lässt" />
+    <Word from="liist" to="löst" />
+    <Word from="Liisung" to="Lösung" />
+    <Word from="Liisungen" to="Lösungen" />
+    <Word from="Liiwen" to="Löwen" />
+    <Word from="Liiflung" to="Lüftung" />
+    <Word from="lijgen" to="lügen" />
+    <Word from="Lijgner" to="Lügner" />
+    <Word from="Lilgner" to="Lügner" />
+    <Word from="lilgst" to="lügst" />
+    <Word from="lilgt" to="lügt" />
+    <Word from="Lilterer" to="Älterer" />
+    <Word from="LIMOUSINENSERVICE10I06" to="LIMOUSINENSERVICE 10:06" />
+    <Word from="linger" to="länger" />
+    <Word from="lke's" to="Ike's" />
+    <Word from="lkone" to="Ikone" />
+    <Word from="lL'lgt" to="lügt" />
+    <Word from="Llberstehen" to="überstehen" />
+    <Word from="Llebe" to="Liebe" />
+    <Word from="llebt" to="liebt" />
+    <Word from="lllfie" to="Wie" />
+    <Word from="lllfillensstark" to="Willensstark" />
+    <Word from="lllfillie's" to="Willie's" />
+    <Word from="lllfir" to="Wir" />
+    <Word from="Lllignerl" to="Lügner!" />
+    <Word from="llligtl" to="lügt!" />
+    <Word from="lllusionen" to="Illusionen" />
+    <Word from="llngst" to="längst" />
+    <Word from="llztlicher" to="ärztlicher" />
+    <Word from="lm" to="Im" />
+    <Word from="lmbiss" to="Imbiss" />
+    <Word from="lmmer" to="Immer" />
+    <Word from="lmmigranten" to="Immigranten" />
+    <Word from="lmpuls" to="Impuls" />
+    <Word from="lmpulsantrieb" to="Impulsantrieb" />
+    <Word from="lndianer" to="Indianer" />
+    <Word from="lndianerin" to="Indianerin" />
+    <Word from="lndianermédchen" to="Indianermädchen" />
+    <Word from="lndianertanz" to="Indianertanz" />
+    <Word from="lndikation" to="Indikation" />
+    <Word from="lndividualitét" to="Individualität" />
+    <Word from="lndividuen" to="Individuen" />
+    <Word from="lndividuum" to="Individuum" />
+    <Word from="lnduktion" to="Induktion" />
+    <Word from="lneffizienz" to="Ineffizienz" />
+    <Word from="lnformationen" to="Informationen" />
+    <Word from="lnfos" to="Infos" />
+    <Word from="lngenieur" to="Ingenieur" />
+    <Word from="lngenieure" to="Ingenieure" />
+    <Word from="lnhalt" to="Inhalt" />
+    <Word from="lnhalte" to="Inhalte" />
+    <Word from="lnnenraum" to="Innenraum" />
+    <Word from="lnnenréume" to="Innenräume" />
+    <Word from="lnsekt" to="Insekt" />
+    <Word from="lnsekten" to="Insekten" />
+    <Word from="lnsel" to="Insel" />
+    <Word from="lnserat" to="Inserat" />
+    <Word from="lnspektion" to="Inspektion" />
+    <Word from="lnstinkt" to="Instinkt" />
+    <Word from="lnstinkte" to="Instinkte" />
+    <Word from="lnstitut" to="Institut" />
+    <Word from="lnstrumente" to="Instrumente" />
+    <Word from="lnstrumentenwagen" to="Instrumentenwagen" />
+    <Word from="lnsubordination" to="Insubordination" />
+    <Word from="lntellektuellste" to="Intellektuellste" />
+    <Word from="lntelligenz" to="Intelligenz" />
+    <Word from="lntensivstation" to="Intensivstation" />
+    <Word from="lnteraktion" to="Interaktion" />
+    <Word from="lnteresse" to="Interesse" />
+    <Word from="lnteressen" to="Interessen" />
+    <Word from="lnternat" to="Internat" />
+    <Word from="lntrigantin" to="Intrigantin" />
+    <Word from="lntrigantl" to="Intrigant!" />
+    <Word from="lntrigen" to="Intrigen" />
+    <Word from="lnverness" to="Inverness" />
+    <Word from="lnvestition" to="Investition" />
+    <Word from="lnvestoren" to="Investoren" />
+    <Word from="lnzucht" to="Inzucht" />
+    <Word from="lo" to="Io" />
+    <Word from="Lordkémmerer" to="Lordkämmerer" />
+    <Word from="losf" to="los!" />
+    <Word from="losl" to="los!" />
+    <Word from="loswflrde" to="loswürde" />
+    <Word from="Lou/e" to="Louie" />
+    <Word from="Loyalitét" to="Loyalität" />
+    <Word from="lrak" to="Irak" />
+    <Word from="lraner" to="Iraner" />
+    <Word from="lren" to="Iren" />
+    <Word from="Lrgendetvvas" to="Irgendetwas" />
+    <Word from="lrland" to="Irland" />
+    <Word from="lronhide" to="Ironhide" />
+    <Word from="lronie" to="Ironie" />
+    <Word from="lrre" to="Irre" />
+    <Word from="lrren" to="Irren" />
+    <Word from="lrrenanstalt" to="Irrenanstalt" />
+    <Word from="lrrenhaus" to="Irrenhaus" />
+    <Word from="lrrer" to="Irrer" />
+    <Word from="lrrgarten" to="Irrgarten" />
+    <Word from="lrrlicht" to="Irrlicht" />
+    <Word from="lrrlichter" to="Irrlichter" />
+    <Word from="lrrsinn" to="Irrsinn" />
+    <Word from="lrrsinns" to="Irrsinns" />
+    <Word from="lrrtum" to="Irrtum" />
+    <Word from="lscandar" to="Iscandar" />
+    <Word from="lscandars" to="Iscandars" />
+    <Word from="lsolierband" to="Isolierband" />
+    <Word from="lss" to="Iss" />
+    <Word from="lstja" to="Ist ja" />
+    <Word from="ltaker" to="Itaker" />
+    <Word from="ltakerflossen" to="Itakerflossen" />
+    <Word from="ltalo" to="Italo" />
+    <Word from="Ltiffel" to="Löffel" />
+    <Word from="ltlgen" to="lügen" />
+    <Word from="Lufijagen" to="Luft jagen" />
+    <Word from="Luftballonsl" to="Luftballons!" />
+    <Word from="Luftjagen" to="Luft jagen" />
+    <Word from="Luftunterstfltzung" to="Luftunterstützung" />
+    <Word from="LUgen" to="Lügen" />
+    <Word from="lvléidchen" to="Mädchen" />
+    <Word from="lwan" to="Iwan" />
+    <Word from="l§uft's" to="läuft's" />
+    <Word from="Léchelmfinderl" to="Lächelmünder!" />
+    <Word from="lécheln" to="lächeln" />
+    <Word from="léchelt" to="lächelt" />
+    <Word from="Lécher" to="Löcher" />
+    <Word from="Lécherlich" to="Lächerlich" />
+    <Word from="lécherliches" to="lächerliches" />
+    <Word from="Léchle" to="Lächle" />
+    <Word from="lédt" to="lädt" />
+    <Word from="Léffel" to="Löffel" />
+    <Word from="lége" to="läge" />
+    <Word from="Léicheln" to="Lächeln" />
+    <Word from="Léicherlich" to="Lächerlich" />
+    <Word from="léichle" to="lächle" />
+    <Word from="Léindchen" to="Ländchen" />
+    <Word from="léingst" to="längst" />
+    <Word from="léisen" to="lösen" />
+    <Word from="léissig" to="lässig" />
+    <Word from="léisst" to="lässt" />
+    <Word from="Léiuft" to="Läuft" />
+    <Word from="Léjsung" to="Lösung" />
+    <Word from="Lémmchen" to="Lämmchen" />
+    <Word from="Lémmer" to="Lämmer" />
+    <Word from="Lénder" to="Länder" />
+    <Word from="Léndern" to="Ländern" />
+    <Word from="Lénge" to="Länge" />
+    <Word from="Léngen" to="Längen" />
+    <Word from="lénger" to="länger" />
+    <Word from="léngst" to="längst" />
+    <Word from="léngste" to="längste" />
+    <Word from="Lérm" to="Lärm" />
+    <Word from="Lérmbeschwerden" to="Lärmbeschwerden" />
+    <Word from="léschen" to="löschen" />
+    <Word from="Lése" to="Löse" />
+    <Word from="Lésegeld" to="Lösegeld" />
+    <Word from="lésst" to="lässt" />
+    <Word from="lést" to="löst" />
+    <Word from="léste" to="löste" />
+    <Word from="lésten" to="lösten" />
+    <Word from="léstig" to="listig" />
+    <Word from="Lésung" to="Lösung" />
+    <Word from="léufig" to="läufig" />
+    <Word from="léufst" to="läufst" />
+    <Word from="Léuft" to="Läuft" />
+    <Word from="léuten" to="läuten" />
+    <Word from="léutet" to="läutet" />
+    <Word from="Léwe" to="Löwe" />
+    <Word from="Lflgner" to="Lügner" />
+    <Word from="M'a'dchen" to="Mädchen" />
+    <Word from="m/ese" to="miese" />
+    <Word from="M/ffsommernachfsfraum" to="Mittsommernachtstraum" />
+    <Word from="M/r" to="Mir" />
+    <Word from="M0I8KUI" to="Molekül" />
+    <Word from="m6belt" to="möbelt" />
+    <Word from="m6chte" to="möchte" />
+    <Word from="m6chtest" to="möchtest" />
+    <Word from="m6gen" to="mögen" />
+    <Word from="m6glich" to="möglich" />
+    <Word from="m6glichen" to="möglichen" />
+    <Word from="m6glicher" to="möglicher" />
+    <Word from="m6gt" to="mögt" />
+    <Word from="M6rder" to="Mörder" />
+    <Word from="MaB" to="Maß" />
+    <Word from="MaBgabe" to="Maßgabe" />
+    <Word from="mac/1e" to="mache" />
+    <Word from="mac/7" to="nach" />
+    <Word from="machs" to="mach's" />
+    <Word from="Machtiibernahme" to="Machtübernahme" />
+    <Word from="madenschwéinziger" to="madenschwänziger" />
+    <Word from="Mafinahme" to="Maßnahme" />
+    <Word from="Magengeschwiire" to="Magengeschwüre" />
+    <Word from="Magengeschwilr" to="Magengeschwür" />
+    <Word from="Magengeschwtir" to="Magengeschwür" />
+    <Word from="Magnolienbliiten" to="Magnolienblüten" />
+    <Word from="Majesfait" to="Majestät" />
+    <Word from="Majestéit" to="Majestät" />
+    <Word from="Majestét" to="Majestät" />
+    <Word from="Majestéten" to="Majestäten" />
+    <Word from="Mal2&gt;en" to="Maßen" />
+    <Word from="Mal3en" to="Maßen" />
+    <Word from="malf" to="mal!" />
+    <Word from="Malinahme" to="Maßnahme" />
+    <Word from="mall" to="mal!" />
+    <Word from="Mallregelten" to="Maßregelten" />
+    <Word from="Mandverstation" to="Manöverstation" />
+    <Word from="Manfiver" to="Manöver" />
+    <Word from="Maniiver" to="Manöver" />
+    <Word from="Manikfire" to="Maniküre" />
+    <Word from="Mannschafl" to="Mannschaft" />
+    <Word from="Manscllefl'enkm'5pfe" to="Manschettenknöpfe" />
+    <Word from="Manéiver" to="Manöver" />
+    <Word from="Manéver" to="Manöver" />
+    <Word from="manévrieren" to="manövrieren" />
+    <Word from="manévrierféhig" to="manövrierfähig" />
+    <Word from="Manévriermodus" to="Manövriermodus" />
+    <Word from="Margoliserklfirung" to="Margoliserklärung" />
+    <Word from="Margoliserklérung" to="Margoliserklärung" />
+    <Word from="marschéhnliche" to="marschähnliche" />
+    <Word from="Massagestllihlen" to="Massagestühlen" />
+    <Word from="Massenzerstérung" to="Massenzerstörung" />
+    <Word from="Massenzerstérungswaffen" to="Massenzerstörungswaffen" />
+    <Word from="Mater/al" to="Material" />
+    <Word from="Maxiriicke" to="Maxiröcke" />
+    <Word from="Mayonaise" to="Mayonnaise" />
+    <Word from="mbglichst" to="möglichst" />
+    <Word from="Mdge" to="Möge" />
+    <Word from="mdglichen/veise" to="möglicherweise" />
+    <Word from="mdglicherweise" to="möglicherweise" />
+    <Word from="Mdglichkeit" to="Möglichkeit" />
+    <Word from="me/n" to="mein" />
+    <Word from="mehrZeit" to="mehr Zeit" />
+    <Word from="mein'ja" to="mein' ja" />
+    <Word from="meinerjetzigen" to="meiner jetzigen" />
+    <Word from="Meinungséufierung" to="Meinungsäußerung" />
+    <Word from="Meisterbréu" to="Meisterbräu" />
+    <Word from="Meisterstijck" to="Meisterstück" />
+    <Word from="meistgehasste" to="meist gehasste" />
+    <Word from="meln" to="mein" />
+    <Word from="melne" to="meine" />
+    <Word from="Mend" to="Mond" />
+    <Word from="Menschenhéindler" to="Menschenhändler" />
+    <Word from="Menstruationsstérungen" to="Menstruationsstörungen" />
+    <Word from="Merkwiirdig" to="Merkwürdig" />
+    <Word from="Merkwiirdige" to="Merkwürdige" />
+    <Word from="merkwiirdiger" to="merkwürdiger" />
+    <Word from="merkwilrdig" to="merkwürdig" />
+    <Word from="merkwlllrdige" to="merkwürdige" />
+    <Word from="merkwurdig" to="merkwürdig" />
+    <Word from="merkwurolig" to="merkwürdig" />
+    <Word from="merkwflrdig" to="merkwürdig" />
+    <Word from="Messgerét" to="Messgerät" />
+    <Word from="mfichte" to="möchte" />
+    <Word from="Mfichten" to="Möchten" />
+    <Word from="Mfidchen" to="Mädchen" />
+    <Word from="Mfidchenl" to="Mädchen!" />
+    <Word from="Mfidels" to="Mädels" />
+    <Word from="mfigen" to="mögen" />
+    <Word from="Mfigliche" to="Mögliche" />
+    <Word from="mfiglichen" to="möglichen" />
+    <Word from="mfiglicherweise" to="möglicherweise" />
+    <Word from="Mfill" to="Müll" />
+    <Word from="Mfillhalde" to="Müllhalde" />
+    <Word from="Mfinchen" to="München" />
+    <Word from="Mfinder" to="Münder" />
+    <Word from="Mfinnern" to="Männern" />
+    <Word from="Mfissen" to="Müssen" />
+    <Word from="mfisst" to="müsst" />
+    <Word from="mfisste" to="müsste" />
+    <Word from="Mfjrder" to="Mörder" />
+    <Word from="Midchen" to="Mädchen" />
+    <Word from="Migrane" to="Migräne" />
+    <Word from="Migréne" to="Migräne" />
+    <Word from="Migrflne" to="Migräne" />
+    <Word from="miichte" to="möchte" />
+    <Word from="Miichtegern" to="Möchtegern" />
+    <Word from="Miichten" to="Möchten" />
+    <Word from="miichtest" to="möchtest" />
+    <Word from="miide" to="müde" />
+    <Word from="Miidels" to="Mädels" />
+    <Word from="miides" to="müdes" />
+    <Word from="miige" to="möge" />
+    <Word from="miigen" to="mögen" />
+    <Word from="miiglich" to="möglich" />
+    <Word from="miigliche" to="mögliche" />
+    <Word from="miiglichen" to="möglichen" />
+    <Word from="miigliches" to="mögliches" />
+    <Word from="Miiglichkeit" to="Möglichkeit" />
+    <Word from="Miiglichkeiten" to="Möglichkeiten" />
+    <Word from="miigt" to="mögt" />
+    <Word from="Miill" to="Müll" />
+    <Word from="Miillhalde" to="Müllhalde" />
+    <Word from="Miilltonnen" to="Mülltonnen" />
+    <Word from="miilssen" to="müssen" />
+    <Word from="miirderisch" to="mörderisch" />
+    <Word from="miisse" to="müsse" />
+    <Word from="Miissen" to="Müssen" />
+    <Word from="miisst" to="müsst" />
+    <Word from="miisste" to="müsste" />
+    <Word from="Miiuse" to="Mäuse" />
+    <Word from="mijchte" to="möchte" />
+    <Word from="Mijcken" to="Mücken" />
+    <Word from="Mijhe" to="Mühe" />
+    <Word from="Mijnzen" to="Münzen" />
+    <Word from="mijssen" to="müssen" />
+    <Word from="mijsst" to="müsst" />
+    <Word from="mijsste" to="müsste" />
+    <Word from="mijsstest" to="müsstest" />
+    <Word from="Milchstrafie" to="Milchstraße" />
+    <Word from="Milhe" to="Mühe" />
+    <Word from="Milhle" to="Mühle" />
+    <Word from="MILITAR" to="MILITÄR" />
+    <Word from="Militiirprogramme" to="Militärprogramme" />
+    <Word from="Militir" to="Militär" />
+    <Word from="militlrische" to="militärische" />
+    <Word from="Militéirkodex" to="Militärkodex" />
+    <Word from="Militér" to="Militär" />
+    <Word from="Militérakademie" to="Militärakademie" />
+    <Word from="Militérdienst" to="Militärdienst" />
+    <Word from="militérischen" to="militärischen" />
+    <Word from="Militérkodex" to="Militärkodex" />
+    <Word from="Militérluftraum" to="Militärluftraum" />
+    <Word from="Militérnetzwerk" to="Militärnetzwerk" />
+    <Word from="Militérs" to="Militärs" />
+    <Word from="Militérsystem" to="Militärsystem" />
+    <Word from="Millbilligung" to="Missbilligung" />
+    <Word from="Millefs" to="Miller's" />
+    <Word from="Millgeburt" to="Missgeburt" />
+    <Word from="Milliardéiren" to="Milliardären" />
+    <Word from="Millionérssohn" to="Millionärssohn" />
+    <Word from="Milliéquivalent" to="Milliäquivalent" />
+    <Word from="Millltonne" to="Mülltonne" />
+    <Word from="millverstanden" to="missverstanden" />
+    <Word from="milssen" to="müssen" />
+    <Word from="milsst" to="müsst" />
+    <Word from="milsste" to="müsste" />
+    <Word from="milssten" to="müssten" />
+    <Word from="Miltter" to="Mütter" />
+    <Word from="Minenraumen" to="Minenräumen" />
+    <Word from="Miniriicke" to="Miniröcke" />
+    <Word from="mirglauben" to="mir glauben" />
+    <Word from="mirja" to="mir ja" />
+    <Word from="mirje" to="mir je" />
+    <Word from="mirjeglichen" to="mir jeglichen" />
+    <Word from="mirjemals" to="mir jemals" />
+    <Word from="mirjemand" to="mir jemand" />
+    <Word from="mirjetzt" to="mir jetzt" />
+    <Word from="mirso" to="mir so" />
+    <Word from="mirvon" to="mir von" />
+    <Word from="mirzu" to="mir zu" />
+    <Word from="Miserabell" to="Miserabel!" />
+    <Word from="missféllt" to="missfällt" />
+    <Word from="Missverstfindnisl" to="Missverständnis!" />
+    <Word from="Missverstiindnis" to="Missverständnis" />
+    <Word from="Missversténdnis" to="Missverständnis" />
+    <Word from="Missversténdnissen" to="Missverständnissen" />
+    <Word from="Mistkerlel" to="Mistkerle!" />
+    <Word from="Mistkiiter" to="Mistköter" />
+    <Word from="Miststiick" to="Miststück" />
+    <Word from="Miststflcke" to="Miststücke" />
+    <Word from="Mitbijrger" to="Mitbürger" />
+    <Word from="Mitbilrger" to="Mitbürger" />
+    <Word from="mitfiihlend" to="mitfühlend" />
+    <Word from="mitfiihlender" to="mitfühlender" />
+    <Word from="mitfuhlend" to="mitfühlend" />
+    <Word from="Mitgefiihl" to="Mitgefühl" />
+    <Word from="Mitgefuhl" to="Mitgefühl" />
+    <Word from="mitgehiirt" to="mitgehört" />
+    <Word from="mitgezéhlt" to="mitgezählt" />
+    <Word from="mitjedem" to="mit jedem" />
+    <Word from="mitjemandem" to="mit jemandem" />
+    <Word from="mittlen/veile" to="mittlerweile" />
+    <Word from="ML'1nze" to="Münze" />
+    <Word from="mlch" to="mich" />
+    <Word from="Mldchen" to="Mädchen" />
+    <Word from="mLissen" to="müssen" />
+    <Word from="Mljnder" to="Münder" />
+    <Word from="Mllillschlucker" to="Müllschlucker" />
+    <Word from="Mllindel" to="Mündel" />
+    <Word from="Mllindung" to="Mündung" />
+    <Word from="mllissen" to="müssen" />
+    <Word from="mllisst" to="müsst" />
+    <Word from="Mlllhe" to="Mühe" />
+    <Word from="Mllllon" to="Million" />
+    <Word from="Mllllonen" to="Millionen" />
+    <Word from="mlllsst" to="müsst" />
+    <Word from="Mllltterjedoch" to="Mütter jedoch" />
+    <Word from="Mlnnern" to="Männern" />
+    <Word from="mlr" to="mir" />
+    <Word from="mlrl" to="mir!" />
+    <Word from="mlt" to="mit" />
+    <Word from="moglich" to="möglich" />
+    <Word from="Moglichkeit" to="Möglichkeit" />
+    <Word from="Moglichkeiten" to="Möglichkeiten" />
+    <Word from="Molekijle" to="Moleküle" />
+    <Word from="MolekL'lle" to="Moleküle" />
+    <Word from="Mondeinhiirner" to="Mondeinhörner" />
+    <Word from="Mondeinhiirnerl" to="Mondeinhörner!" />
+    <Word from="Mondeinhéirner" to="Mondeinhörner" />
+    <Word from="Mondkéilber" to="Mondkälber" />
+    <Word from="Monl" to="Mom" />
+    <Word from="MONTONEI" to="MONTONE:" />
+    <Word from="Mordsiiberraschung" to="Mordsüberraschung" />
+    <Word from="Mordverdéchtiger" to="Mordverdächtiger" />
+    <Word from="Morsealphabetl" to="Morsealphabet!" />
+    <Word from="Motorgeréusch" to="Motorgeräusch" />
+    <Word from="Motorgeréusche" to="Motorgeräusche" />
+    <Word from="Moussetfle's" to="Moussette's" />
+    <Word from="Mowen" to="Möwen" />
+    <Word from="Mtihe" to="Mühe" />
+    <Word from="Mtillschlucker" to="Müllschlucker" />
+    <Word from="mtissen" to="müssen" />
+    <Word from="mtissenl" to="müssen!" />
+    <Word from="Mtitzel" to="Mütze!" />
+    <Word from="mtlde" to="müde" />
+    <Word from="mtlsste" to="müsste" />
+    <Word from="muBt" to="musst" />
+    <Word from="Mucken" to="Mücken" />
+    <Word from="mucksméuschenstill" to="mucksmäuschenstill" />
+    <Word from="mude" to="müde" />
+    <Word from="Muhe" to="Mühe" />
+    <Word from="MUII" to="Müll" />
+    <Word from="mull" to="muss" />
+    <Word from="MULL" to="MÜLL" />
+    <Word from="mullte" to="musste" />
+    <Word from="Mundl" to="Mund!" />
+    <Word from="Mundung" to="Mündung" />
+    <Word from="Munzfernsprecher" to="Münzfernsprecher" />
+    <Word from="Muskatnijsse" to="Muskatnüsse" />
+    <Word from="Muskelkumpelsl" to="Muskelkumpels!" />
+    <Word from="muskuléren" to="muskulären" />
+    <Word from="mussen" to="müssen" />
+    <Word from="MUSSEN" to="MÜSSEN" />
+    <Word from="mUssen's" to="müssen's" />
+    <Word from="muss_'§e" to="musste" />
+    <Word from="Musterschuler" to="Musterschüler" />
+    <Word from="Mutterja" to="Mutter ja" />
+    <Word from="mutterlich" to="mütterlich" />
+    <Word from="Mutze" to="Mütze" />
+    <Word from="muß" to="muss" />
+    <Word from="mußt" to="musst" />
+    <Word from="mußte" to="musste" />
+    <Word from="mx't" to="mit" />
+    <Word from="Mzlinnern" to="Männern" />
+    <Word from="Mébel" to="Möbel" />
+    <Word from="mécht" to="möcht" />
+    <Word from="Méchte" to="Mächte" />
+    <Word from="méchte" to="möchte" />
+    <Word from="Méchtegern" to="Möchtegern" />
+    <Word from="méchten" to="möchten" />
+    <Word from="méchtest" to="möchtest" />
+    <Word from="méchtet" to="möchtet" />
+    <Word from="méchtig" to="mächtig" />
+    <Word from="méchtige" to="mächtige" />
+    <Word from="méchtigen" to="mächtigen" />
+    <Word from="méchtiger" to="mächtiger" />
+    <Word from="méchtiges" to="mächtiges" />
+    <Word from="méchtigste" to="mächtigste" />
+    <Word from="méchtigsten" to="mächtigsten" />
+    <Word from="Médchen" to="Mädchen" />
+    <Word from="Médchenhénden" to="Mädchenhänden" />
+    <Word from="Médchens" to="Mädchens" />
+    <Word from="Médel" to="Mädel" />
+    <Word from="Médels" to="Mädels" />
+    <Word from="Médelsl" to="Mädels!" />
+    <Word from="Méfiigung" to="Mäßigung" />
+    <Word from="mége" to="möge" />
+    <Word from="Mégen" to="Mögen" />
+    <Word from="Méglich" to="Möglich" />
+    <Word from="mégliche" to="mögliche" />
+    <Word from="Méglichen" to="Möglichen" />
+    <Word from="Mégliches" to="Mögliches" />
+    <Word from="Méglichkeit" to="Möglichkeit" />
+    <Word from="Méglichkeiten" to="Möglichkeiten" />
+    <Word from="méglichst" to="möglichst" />
+    <Word from="mégt" to="mögt" />
+    <Word from="méichtig" to="mächtig" />
+    <Word from="méichtige" to="mächtige" />
+    <Word from="méichtigen" to="mächtigen" />
+    <Word from="méichtiger" to="mächtiger" />
+    <Word from="Méidchen" to="Mädchen" />
+    <Word from="Méidel" to="Mädel" />
+    <Word from="Méinner" to="Männer" />
+    <Word from="Méinnl" to="Männl" />
+    <Word from="méinnlicher" to="männlicher" />
+    <Word from="Méirder" to="Mörder" />
+    <Word from="Méirz" to="März" />
+    <Word from="Ménnchen" to="Männchen" />
+    <Word from="Ménnchens" to="Männchens" />
+    <Word from="Ménner" to="Männer" />
+    <Word from="Ménnerfreundschaft" to="Männerfreundschaft" />
+    <Word from="Ménnern" to="Männern" />
+    <Word from="Ménnersache" to="Männersache" />
+    <Word from="ménnlich" to="männlich" />
+    <Word from="ménnliche" to="männliche" />
+    <Word from="Méntel" to="Mäntel" />
+    <Word from="Méolel" to="Mädel" />
+    <Word from="Méolels" to="Mädels" />
+    <Word from="Mérchen" to="Märchen" />
+    <Word from="Mérchenl" to="Märchen!" />
+    <Word from="Mérchenprinzen" to="Märchenprinzen" />
+    <Word from="Mérder" to="Mörder" />
+    <Word from="Mértyrer" to="Märtyrer" />
+    <Word from="Mérz" to="März" />
+    <Word from="Métresse" to="Mätresse" />
+    <Word from="Méuschen" to="Mäuschen" />
+    <Word from="Méuse" to="Mäuse" />
+    <Word from="Méusehtipfer" to="Mäusehüpfer" />
+    <Word from="Méusen" to="Mäusen" />
+    <Word from="Méuserennen" to="Mäuserennen" />
+    <Word from="müßt" to="müsst" />
+    <Word from="mflde" to="müde" />
+    <Word from="mflssen" to="müssen" />
+    <Word from="n'a'chste" to="nächste" />
+    <Word from="n'a'hert" to="nähert" />
+    <Word from="n/chfs" to="nichts" />
+    <Word from="n/chi" to="nicht" />
+    <Word from="N/ck" to="Nick" />
+    <Word from="n/e" to="nie" />
+    <Word from="N6" to="Nö" />
+    <Word from="n6tig" to="nötig" />
+    <Word from="nac/1" to="nach" />
+    <Word from="Nachf" to="Nacht" />
+    <Word from="nachllssig" to="nachlässig" />
+    <Word from="nachléssig" to="nachlässig" />
+    <Word from="nachlésst" to="nachlässt" />
+    <Word from="nachprufen" to="nachprüfen" />
+    <Word from="Nachschlussel" to="Nachschlüssel" />
+    <Word from="Nachste" to="Nächste" />
+    <Word from="NAHERT" to="NÄHERT" />
+    <Word from="NAHERTE" to="NÄHERTE" />
+    <Word from="Nat/on" to="Nation" />
+    <Word from="natfirlich" to="natürlich" />
+    <Word from="Natiilrlich" to="Natürlich" />
+    <Word from="Natiirlich" to="Natürlich" />
+    <Word from="Natiirllch" to="Natürlich" />
+    <Word from="natijrlich" to="natürlich" />
+    <Word from="natijrlichen" to="natürlichen" />
+    <Word from="natilrlich" to="natürlich" />
+    <Word from="natilrliche" to="natürliche" />
+    <Word from="natL'lrlich" to="natürlich" />
+    <Word from="Natllirlich" to="Natürlich" />
+    <Word from="Nattirlich" to="Natürlich" />
+    <Word from="Nattlrlich" to="Natürlich" />
+    <Word from="Nattlrliohl" to="Natürlich!" />
+    <Word from="Naturlich" to="Naturloch" />
+    <Word from="naturlich" to="natürlich" />
+    <Word from="naturlichen" to="natürlichen" />
+    <Word from="naturlichsten" to="natürlichsten" />
+    <Word from="Navajoweifi" to="Navajoweiß" />
+    <Word from="ndtige" to="nötige" />
+    <Word from="ne/n" to="nein" />
+    <Word from="Nebengebéude" to="Nebengebäude" />
+    <Word from="Nebengeschéift" to="Nebengeschäft" />
+    <Word from="neffes" to="nettes" />
+    <Word from="Nehmf" to="Nehmt" />
+    <Word from="neinl" to="nein!" />
+    <Word from="Neln" to="Nein" />
+    <Word from="nerv6s" to="nervös" />
+    <Word from="Nervensége" to="Nervensäge" />
+    <Word from="Nervenséige" to="Nervensäge" />
+    <Word from="nerviis" to="nervös" />
+    <Word from="Nervés" to="Nervös" />
+    <Word from="ner\/t" to="nervt" />
+    <Word from="Neuankiimmlinge" to="Neuankömmlinge" />
+    <Word from="neuromuskuléren" to="neuromuskulären" />
+    <Word from="Neuzugéinge" to="Neuzugänge" />
+    <Word from="Nfichster" to="Nächster" />
+    <Word from="NIANN" to="MANN" />
+    <Word from="nichsten" to="nächsten" />
+    <Word from="nichtim" to="nicht im" />
+    <Word from="nichtjemand" to="nicht jemand" />
+    <Word from="Nichtjetzt" to="Nicht jetzt" />
+    <Word from="Nichtsl" to="Nichts!" />
+    <Word from="nichtzurilckgelassen" to="nicht zurückgelassen" />
+    <Word from="nic_l_1t" to="nicht" />
+    <Word from="niederkémpfen" to="niederkämpfen" />
+    <Word from="niederliells" to="niederließ" />
+    <Word from="niedlichl" to="niedlich!" />
+    <Word from="niher" to="näher" />
+    <Word from="niichsten" to="nächsten" />
+    <Word from="niichstes" to="nächstes" />
+    <Word from="niirgeln" to="nörgeln" />
+    <Word from="niitig" to="nötig" />
+    <Word from="niitige" to="nötige" />
+    <Word from="Nijssen" to="Nüssen" />
+    <Word from="Nijsternl" to="Nüstern!" />
+    <Word from="nijtzlich" to="nützlich" />
+    <Word from="nilchtern" to="nüchtern" />
+    <Word from="niltzen" to="nützen" />
+    <Word from="Nlagnaten" to="Magnaten" />
+    <Word from="Nlannern" to="Männern" />
+    <Word from="nlchste" to="nächste" />
+    <Word from="nlchsthoheren" to="nächsthöheren" />
+    <Word from="nlcht" to="nicht" />
+    <Word from="nle" to="nie" />
+    <Word from="Nlemalsl" to="Niemals!" />
+    <Word from="Nlhe" to="Nähe" />
+    <Word from="nlir" to="mir" />
+    <Word from="nllitzen" to="nützen" />
+    <Word from="Nléinner" to="Männer" />
+    <Word from="noc/1" to="noch" />
+    <Word from="Not/'all" to="Notfall" />
+    <Word from="Notfalll" to="Notfall!" />
+    <Word from="notig" to="nötig" />
+    <Word from="notigen" to="nötigen" />
+    <Word from="Notliige" to="Notlüge" />
+    <Word from="Notziindung" to="Notzündung" />
+    <Word from="NUFI" to="Nur:" />
+    <Word from="Nunja" to="Nun ja" />
+    <Word from="Nurdich" to="Nur dich" />
+    <Word from="nureins" to="nur eins" />
+    <Word from="nurflustern" to="nur flüstern" />
+    <Word from="Nurjetzt" to="Nur jetzt" />
+    <Word from="nurl" to="nur 1" />
+    <Word from="nurwunscht" to="nur wünscht" />
+    <Word from="Nurzu" to="Nur zu" />
+    <Word from="nus" to="aus" />
+    <Word from="NUSSS" to="Nüsse" />
+    <Word from="nutzlich" to="nützlich" />
+    <Word from="Nx'emand" to="Niemand" />
+    <Word from="Néchste" to="Nächste" />
+    <Word from="néchsten" to="nächsten" />
+    <Word from="Néchster" to="Nächster" />
+    <Word from="néchstes" to="nächstes" />
+    <Word from="Néchte" to="Nächte" />
+    <Word from="Néchten" to="Nächten" />
+    <Word from="néchtlichen" to="nächtlichen" />
+    <Word from="Négel" to="Nägel" />
+    <Word from="Néh" to="Näh" />
+    <Word from="Néhe" to="Nähe" />
+    <Word from="néhenf" to="nähert" />
+    <Word from="néher" to="näher" />
+    <Word from="néhere" to="nähere" />
+    <Word from="Néhern" to="Nähern" />
+    <Word from="néhernde" to="nähernde" />
+    <Word from="néhert" to="nähert" />
+    <Word from="néherte" to="näherte" />
+    <Word from="néhren" to="nähren" />
+    <Word from="néht" to="näht" />
+    <Word from="Néhten" to="Nähten" />
+    <Word from="Néichste" to="Nächste" />
+    <Word from="néichsten" to="nächsten" />
+    <Word from="Néichstes" to="Nächstes" />
+    <Word from="Néihe" to="Nähe" />
+    <Word from="néiher" to="näher" />
+    <Word from="néihern" to="nähern" />
+    <Word from="néihert" to="nähert" />
+    <Word from="Néihten" to="Nähten" />
+    <Word from="néimlich" to="nämlich" />
+    <Word from="némlich" to="nämlich" />
+    <Word from="Népfe" to="Näpfe" />
+    <Word from="nérdlich" to="nördlich" />
+    <Word from="nérgelnde" to="nörgelnde" />
+    <Word from="Nérrin" to="Närrin" />
+    <Word from="Néschen" to="Näschen" />
+    <Word from="nétig" to="nötig" />
+    <Word from="nétige" to="nötige" />
+    <Word from="nétiges" to="nötiges" />
+    <Word from="O8" to="08" />
+    <Word from="obdachlosl" to="obdachlos!" />
+    <Word from="Obefiléiche" to="Oberfläche" />
+    <Word from="OBERFLACHENSCHWERKRAFT" to="OBERFLÄCHENSCHWERKRAFT" />
+    <Word from="Oberfléche" to="Oberfläche" />
+    <Word from="Oberfléchen" to="Oberflächen" />
+    <Word from="oberfléchlich" to="oberflächlich" />
+    <Word from="oberfléchliche" to="oberflächliche" />
+    <Word from="Oberméinner" to="Obermänner" />
+    <Word from="Oberflfiche" to="Oberfläche" />
+    <Word from="of/'en" to="offen" />
+    <Word from="Offenslchtllch" to="Offensichtlich" />
+    <Word from="Offentliches" to="Öffentliches" />
+    <Word from="Offentlichkeit" to="Öffentlichkeit" />
+    <Word from="Offne" to="Öffne" />
+    <Word from="Offnen" to="Öffnen" />
+    <Word from="Offnet" to="Öffnet" />
+    <Word from="ofi" to="oft" />
+    <Word from="Ofiiziere" to="Offiziere" />
+    <Word from="Ofiiziers" to="Offiziers" />
+    <Word from="Oftweg" to="Oft weg" />
+    <Word from="Offlcer" to="Officer" />
+    <Word from="Ohnejede" to="Ohne jede" />
+    <Word from="ohnméchtig" to="ohnmächtig" />
+    <Word from="ohnméichtig" to="ohnmächtig" />
+    <Word from="OI" to="Öl" />
+    <Word from="olas" to="das" />
+    <Word from="oles" to="des" />
+    <Word from="Oltanks" to="Öltanks" />
+    <Word from="OO" to="00" />
+    <Word from="Orgelténe" to="Orgeltöne" />
+    <Word from="ORTI" to="ORT:" />
+    <Word from="Ortl" to="Ort!" />
+    <Word from="Ostfltlgel" to="Ostflügel" />
+    <Word from="Paliontologie" to="Paläontologie" />
+    <Word from="pallt" to="passt" />
+    <Word from="Palésten" to="Palästen" />
+    <Word from="Panfike/chen" to="Partikelchen" />
+    <Word from="Papierblétter" to="Papierblätter" />
+    <Word from="Papiertiite" to="Papiertüte" />
+    <Word from="Papiertilcher" to="Papiertücher" />
+    <Word from="Parfyknaller" to="Partyknaller" />
+    <Word from="Partyhiite" to="Partyhüte" />
+    <Word from="Partyhijte" to="Partyhüte" />
+    <Word from="Passendervveise" to="Passenderweise" />
+    <Word from="Paulgenauso" to="Paul genauso" />
+    <Word from="paß" to="pass" />
+    <Word from="paßt" to="passt" />
+    <Word from="peinliohl" to="peinlich" />
+    <Word from="persdnlich" to="persönlich" />
+    <Word from="persfinlich" to="persönlich" />
+    <Word from="persiinlich" to="persönlich" />
+    <Word from="persiinliche" to="persönliche" />
+    <Word from="persiinlicher" to="persönlicher" />
+    <Word from="Persiinllchkeltsspaltun" to="Persönllchkeltsspaltung" />
+    <Word from="persijnliche" to="persönliche" />
+    <Word from="personlich" to="persönlich" />
+    <Word from="Personlichkeit" to="Persönlichkeit" />
+    <Word from="persénlich" to="persönlich" />
+    <Word from="persénliche" to="persönliche" />
+    <Word from="persénlicher" to="persönlicher" />
+    <Word from="Persénliches" to="Persönliches" />
+    <Word from="Persénlichkeit" to="Persönlichkeit" />
+    <Word from="peflg" to="peng" />
+    <Word from="Pfadfindervvappen" to="Pfadfinderwappen" />
+    <Word from="Pfadflndeml" to="Pfadflndern!" />
+    <Word from="Pffitzen" to="Pfützen" />
+    <Word from="Pfiitchen" to="Pfötchen" />
+    <Word from="Pfippchen" to="Püppchen" />
+    <Word from="pflL'lgen" to="pflügen" />
+    <Word from="Pfllitze" to="Pfütze" />
+    <Word from="pflugte" to="pflügte" />
+    <Word from="Pfundbijro" to="Pfundbüro" />
+    <Word from="phénomenal" to="phänomenal" />
+    <Word from="PIatz" to="Platz" />
+    <Word from="Piimpel" to="Pömpel" />
+    <Word from="Piinlttchenltrawatte" to="Pünktchenkrawatte" />
+    <Word from="Pijppchen" to="Püppchen" />
+    <Word from="Pijppchenl" to="Püppchen!" />
+    <Word from="Planetenf" to="Planeten!" />
+    <Word from="planméfiigen" to="planmäßigen" />
+    <Word from="Plastikfréiuleinl" to="Plastikfräulein!" />
+    <Word from="plattmachen" to="platt machen" />
+    <Word from="Plfitzchen" to="Plätzchen" />
+    <Word from="plfitzlich" to="plötzlich" />
+    <Word from="pliitzlich" to="plötzlich" />
+    <Word from="pliitzllch" to="plötzlich" />
+    <Word from="Pllllnderer" to="Plünderer" />
+    <Word from="plotzlich" to="plötzlich" />
+    <Word from="plédieren" to="plädieren" />
+    <Word from="Pléine" to="Pläne" />
+    <Word from="Pléinen" to="Plänen" />
+    <Word from="Pléitzchen" to="Plätzchen" />
+    <Word from="Pléitze" to="Plätze" />
+    <Word from="Pléne" to="Pläne" />
+    <Word from="Plétzchen" to="Plätzchen" />
+    <Word from="Plétze" to="Platze" />
+    <Word from="Plétzel" to="Plätze!" />
+    <Word from="plétzlich" to="plötzlich" />
+    <Word from="plétzliche" to="plötzliche" />
+    <Word from="Pofkawoche" to="Polkawoche" />
+    <Word from="Polizistl" to="Polizist!" />
+    <Word from="pompiise" to="pompöse" />
+    <Word from="populér" to="populär" />
+    <Word from="potthésslich" to="potthässlich" />
+    <Word from="prasentleren" to="präsentieren" />
+    <Word from="prfignant" to="prägnant" />
+    <Word from="Prfisentation" to="Präsentation" />
+    <Word from="Prfisi" to="Präsi" />
+    <Word from="priide" to="prüde" />
+    <Word from="Priife" to="Prüfe" />
+    <Word from="priifen" to="prüfen" />
+    <Word from="prijfen" to="prüfen" />
+    <Word from="Priorit2a't" to="Priorität" />
+    <Word from="PRIORITKT" to="PRIORITÄT" />
+    <Word from="PRIORITKTSZUGANG" to="PRIORITÄTSZUGANG" />
+    <Word from="Prioritéitszugang" to="Prioritätszugang" />
+    <Word from="Prioritét" to="Priorität" />
+    <Word from="Prisident" to="Präsident" />
+    <Word from="Privatgeméchern" to="Privatgemächern" />
+    <Word from="Privatsphére" to="Privatsphäre" />
+    <Word from="Probfeme" to="Probleme" />
+    <Word from="Profitinzerinnen" to="Profitänzerinnen" />
+    <Word from="Protege" to="Protégé" />
+    <Word from="prude" to="prüde" />
+    <Word from="Pruf" to="Prüf" />
+    <Word from="prufen" to="prüfen" />
+    <Word from="Prugelei" to="Prügelei" />
+    <Word from="prugeln" to="prügeln" />
+    <Word from="préchtig" to="prächtig" />
+    <Word from="Préfekt" to="Präfekt" />
+    <Word from="préhistorischer" to="prähistorischer" />
+    <Word from="préichtiger" to="prächtiger" />
+    <Word from="préichtiges" to="prächtiges" />
+    <Word from="Préimie" to="Prämie" />
+    <Word from="préipotente" to="präpotente" />
+    <Word from="préisentiert" to="präsentiert" />
+    <Word from="Préisidenten" to="Präsidenten" />
+    <Word from="Préitorianer" to="Prätorianer" />
+    <Word from="Prémie" to="Prämie" />
+    <Word from="Préoperative" to="Präoperative" />
+    <Word from="présentiere" to="präsentiere" />
+    <Word from="présentieren" to="präsentieren" />
+    <Word from="Présentiert" to="Präsentiert" />
+    <Word from="Présenz" to="Präsenz" />
+    <Word from="Président" to="Präsident" />
+    <Word from="Présidenten" to="Präsidenten" />
+    <Word from="Présidentin" to="Präsidentin" />
+    <Word from="Présidentschaft" to="Präsidentschaft" />
+    <Word from="Prétorianer" to="Prätorianer" />
+    <Word from="prézise" to="präzise" />
+    <Word from="préziser" to="präziser" />
+    <Word from="Prflfungen" to="Prüfungen" />
+    <Word from="Pubertéit" to="Pubertät" />
+    <Word from="Publlkuml" to="Publlkum!" />
+    <Word from="PUPPCHEN" to="PÜPPCHEN" />
+    <Word from="PUpst" to="Pupst" />
+    <Word from="Purzelbéume" to="Purzelbäume" />
+    <Word from="Péckchen" to="Päckchen" />
+    <Word from="péidagogisch" to="pädagogisch" />
+    <Word from="Péirchen" to="Pärchen" />
+    <Word from="Pérchen" to="Pärchen" />
+    <Word from="pflegen" to="pflegen" />
+    <Word from="Pflicht" to="Pflicht" />
+    <Word from="pflichtbewullt" to="pflichtbewusst" />
+    <Word from="Qas" to="Das" />
+    <Word from="Qualitétskontrolle" to="Qualitätskontrolle" />
+    <Word from="Quten" to="guten" />
+    <Word from="quéilen" to="quälen" />
+    <Word from="quéilt" to="quält" />
+    <Word from="Quél" to="Quäl" />
+    <Word from="Quélt" to="Quält" />
+    <Word from="R'a'che" to="Räche" />
+    <Word from="R/ck" to="Rick" />
+    <Word from="R/nge" to="Ringe" />
+    <Word from="R6mer" to="Römer" />
+    <Word from="rachsiichtiger" to="rachsüchtiger" />
+    <Word from="ranghfiheren" to="ranghöheren" />
+    <Word from="ranghéheren" to="ranghöheren" />
+    <Word from="ranzukommen" to="ran zukommen" />
+    <Word from="ranzukommen" to="ran-zukommen" />
+    <Word from="Rasenméherunfall" to="Rasenmäherunfall" />
+    <Word from="Rasterllibertragung" to="Rasterübertragung" />
+    <Word from="Rasterubertragung" to="Rasterübertragung" />
+    <Word from="Ratschléige" to="Ratschläge" />
+    <Word from="Rattenfénger" to="Rattenfänger" />
+    <Word from="Rauc/7" to="Rauch" />
+    <Word from="Rauc/vender" to="Rauchender" />
+    <Word from="rauhen" to="rauen" />
+    <Word from="RAUMFAHRE" to="RAUMFÄHRE" />
+    <Word from="Raumféhre" to="Raumfähre" />
+    <Word from="Raumsschiff" to="Raumschiff" />
+    <Word from="rausféhrt" to="rausfährt" />
+    <Word from="rausgeprtigeltl" to="rausgeprügelt!" />
+    <Word from="rausliefien" to="rausließen" />
+    <Word from="rauszuschmeifien" to="rauszuschmeißen" />
+    <Word from="raufl" to="rau!" />
+    <Word from="Re/se" to="Reise" />
+    <Word from="Realitéit" to="Realität" />
+    <Word from="Realitét" to="Realität" />
+    <Word from="Rechtgléubige" to="Rechtgläubige" />
+    <Word from="rechtméfkigen" to="rechtmäßigen" />
+    <Word from="RECHTSANWALTE" to="RECHTSANWÄLTE" />
+    <Word from="rechtsl" to="rechts!" />
+    <Word from="Reffer" to="Retter" />
+    <Word from="regelméfiige" to="regelmäßige" />
+    <Word from="Regenhéigen" to="Regenbögen" />
+    <Word from="Regenméntel" to="Regenmäntel" />
+    <Word from="Regierungsgehirnwéischesignal" to="Regierungsgehirnwäschesignal" />
+    <Word from="regulére" to="reguläre" />
+    <Word from="reiB" to="reiß" />
+    <Word from="reiBt" to="reißt" />
+    <Word from="Reichtfimer" to="Reichtümer" />
+    <Word from="Reichtllimern" to="Reichtümern" />
+    <Word from="reif$" to="reiß" />
+    <Word from="reif$en" to="reißen" />
+    <Word from="Reifiverschluss" to="Reißverschluss" />
+    <Word from="Reil3t" to="Reißt" />
+    <Word from="reil5" to="reiß" />
+    <Word from="Reili" to="Reiß" />
+    <Word from="reilien" to="reißen" />
+    <Word from="Reilinégel" to="Reißnägel" />
+    <Word from="Reillt" to="Reißt" />
+    <Word from="reilZ&gt;" to="reiß" />
+    <Word from="reingehéngt" to="reingehängt" />
+    <Word from="Reingelegtl" to="Reingelegt!" />
+    <Word from="reinhupft" to="reinhüpft" />
+    <Word from="reinl" to="rein!" />
+    <Word from="reinstilrmen" to="reinstürmen" />
+    <Word from="reiohen" to="reichen" />
+    <Word from="REISSVERSCHLUSSGERAUSCH" to="REISSVERSCHLUSSGERÄUSCH" />
+    <Word from="reifl" to="reiß" />
+    <Word from="reiflen" to="reißen" />
+    <Word from="relch" to="reich" />
+    <Word from="religi6s" to="religiös" />
+    <Word from="religiiiser" to="religiöser" />
+    <Word from="religiés" to="religiös" />
+    <Word from="Rels" to="Reis" />
+    <Word from="Rentenbezuge" to="Rentenbezüge" />
+    <Word from="Représentantin" to="Repräsentantin" />
+    <Word from="Rettungsflofi" to="Rettungsfloß" />
+    <Word from="Rev/er" to="Revier" />
+    <Word from="rfiber" to="rüber" />
+    <Word from="rfiberwachsen" to="rüberwachsen" />
+    <Word from="Rfickseite" to="Rückseite" />
+    <Word from="rfihrselige" to="rührselige" />
+    <Word from="rfilpse" to="rülpse" />
+    <Word from="Rfissel" to="Rüssel" />
+    <Word from="RGMISCHE" to="RÖMISCHE" />
+    <Word from="Richer" to="Rächer" />
+    <Word from="Riesenhfipfer" to="Riesenhüpfer" />
+    <Word from="Riesenspafi" to="Riesenspaß" />
+    <Word from="Riesentijr" to="Riesentür" />
+    <Word from="riiber" to="rüber" />
+    <Word from="Riicheln" to="Röcheln" />
+    <Word from="riichelt" to="röchelt" />
+    <Word from="Riick" to="Rück" />
+    <Word from="Riickblickend" to="Rückblickend" />
+    <Word from="Riicken" to="Rücken" />
+    <Word from="Riickenlage" to="Rückenlage" />
+    <Word from="Riickenwind" to="Rückenwind" />
+    <Word from="riicksichtslos" to="rücksichtslos" />
+    <Word from="Riicksichtslosigkeit" to="Rücksichtslosigkeit" />
+    <Word from="Riicksitz" to="Rücksitz" />
+    <Word from="Riickwéirts" to="Rückwärts" />
+    <Word from="Riickzug" to="Rückzug" />
+    <Word from="Riickflug" to="Rückflug" />
+    <Word from="riihrt" to="rührt" />
+    <Word from="Riilpsen" to="Rülpsen" />
+    <Word from="riilpst" to="rülpst" />
+    <Word from="Riimischen" to="Römischen" />
+    <Word from="Riistung" to="Rüstung" />
+    <Word from="Riiumlichkeiten" to="Räumlichkeiten" />
+    <Word from="Rijbe" to="Rübe" />
+    <Word from="rijber" to="rüber" />
+    <Word from="rijckgfingig" to="rückgängig" />
+    <Word from="rijckwéirts" to="rückwärts" />
+    <Word from="Rijsseltierl" to="Rüsseltier!" />
+    <Word from="Rilbe" to="Rübe" />
+    <Word from="rilber" to="rüber" />
+    <Word from="rilberkommen" to="rüberkommen" />
+    <Word from="Rilckkehr" to="Rückkehr" />
+    <Word from="rilcksichtsloses" to="rücksichtsloses" />
+    <Word from="rilckwérts" to="rückwärts" />
+    <Word from="Rillpsen" to="Rülpsen" />
+    <Word from="Riol" to="Rio!" />
+    <Word from="Rivalitét" to="Rivalität" />
+    <Word from="rL'lber" to="rüber" />
+    <Word from="RL'lhr" to="Rühr" />
+    <Word from="rllicken" to="rücken" />
+    <Word from="rllickt" to="rückt" />
+    <Word from="Rlllckgrat" to="Rückgrat" />
+    <Word from="Rlnge" to="Ringe" />
+    <Word from="Rlumgerate" to="Räumgeräte" />
+    <Word from="ROMISCHE" to="RÖMISCHE" />
+    <Word from="ROMISCHEN" to="RÖMISCHEN" />
+    <Word from="rosaéugiges" to="rosaäugiges" />
+    <Word from="rotiugiger" to="rotäugiger" />
+    <Word from="Rotképpchen" to="Rotkäppchen" />
+    <Word from="Rotténen" to="Rottönen" />
+    <Word from="Routinetlberprijfung" to="Routineüberprüfung" />
+    <Word from="Rticken" to="Rücken" />
+    <Word from="rticksichtslos" to="rücksichtslos" />
+    <Word from="rtlber" to="rüber" />
+    <Word from="Rtlckseite" to="Rückseite" />
+    <Word from="ruber" to="rüber" />
+    <Word from="Ruberrutschen" to="Rüberrutschen" />
+    <Word from="Ruckblende" to="Rückblende" />
+    <Word from="Ruckblick" to="Rückblick" />
+    <Word from="Rucken" to="Rücken" />
+    <Word from="Ruckenlage" to="Rückenlage" />
+    <Word from="Ruckenwind" to="Rückenwind" />
+    <Word from="Ruckfall" to="Rückfall" />
+    <Word from="Ruckfrage" to="Rückfrage" />
+    <Word from="Ruckgriff" to="Rückgriff" />
+    <Word from="Ruckkehr" to="Rückkehr" />
+    <Word from="Rucksitz" to="Rücksitz" />
+    <Word from="Ruckzugl" to="Rückzug!" />
+    <Word from="ruhlg" to="ruhig" />
+    <Word from="ruhrenl" to="rühren!" />
+    <Word from="Ruhrt" to="Rührt" />
+    <Word from="Rul3" to="Ruß" />
+    <Word from="Rumgebrfillel" to="Rumgebrülle!" />
+    <Word from="rumhingen" to="rumhängen" />
+    <Word from="rumhéngen" to="rumhängen" />
+    <Word from="rumhéngst" to="rumhängst" />
+    <Word from="rumléuft" to="rumläuft" />
+    <Word from="rumwuhlen" to="rumwühlen" />
+    <Word from="rumzufflhren" to="rumzuführen" />
+    <Word from="rumérgern" to="rumärgern" />
+    <Word from="runterffihrt" to="runterfährt" />
+    <Word from="runtergespillt" to="runtergespült" />
+    <Word from="runtergespfllt" to="runtergespült" />
+    <Word from="Runterl" to="Runter!" />
+    <Word from="runterspillen" to="runterspülen" />
+    <Word from="runterspllllen" to="runterspülen" />
+    <Word from="runterspült" to="runter spült" />
+    <Word from="runterspült" to="runter-spült" />
+    <Word from="runtervverfen" to="runterwerfen" />
+    <Word from="Rupem" to="Rupert!" />
+    <Word from="Rustung" to="Rüstung" />
+    <Word from="réche" to="räche" />
+    <Word from="réchen" to="rächen" />
+    <Word from="Récher" to="Rächer" />
+    <Word from="récht" to="rächt" />
+    <Word from="Réder" to="Räder" />
+    <Word from="Rédern" to="Rädern" />
+    <Word from="Réhre" to="Röhre" />
+    <Word from="Réidern" to="Rädern" />
+    <Word from="Réitsel" to="Rätsel" />
+    <Word from="réitseln" to="rätseln" />
+    <Word from="réitst" to="rätst" />
+    <Word from="Réiume" to="Räume" />
+    <Word from="Rémern" to="Römern" />
+    <Word from="rémische" to="römische" />
+    <Word from="rémischen" to="römischen" />
+    <Word from="rémischer" to="römischer" />
+    <Word from="Rénder" to="Ränder" />
+    <Word from="Rénke" to="Ränke" />
+    <Word from="Rénken" to="Ränken" />
+    <Word from="Réntgenaufnahme" to="Röntgenaufnahme" />
+    <Word from="Réntgenbild" to="Röntgenbild" />
+    <Word from="Réson" to="Räson" />
+    <Word from="rét" to="rät" />
+    <Word from="Rétsel" to="Rätsel" />
+    <Word from="rétselhaft" to="rätselhaft" />
+    <Word from="Rétselhaftes" to="Rätselhaftes" />
+    <Word from="Réume" to="Räume" />
+    <Word from="Réumen" to="Räumen" />
+    <Word from="Réumlichkeiten" to="Räumlichkeiten" />
+    <Word from="Réumt" to="Räumt" />
+    <Word from="réuspert" to="räuspert" />
+    <Word from="Rflbe" to="Rübe" />
+    <Word from="rflbergeguckt" to="rübergekuckt" />
+    <Word from="Rflckkehr" to="Rückkehr" />
+    <Word from="S/e" to="Sie" />
+    <Word from="s/nd" to="sind" />
+    <Word from="S5tze" to="Sätze" />
+    <Word from="S6hne" to="Söhne" />
+    <Word from="saB" to="saß" />
+    <Word from="Sachverstlndiger" to="Sachverständiger" />
+    <Word from="sagf" to="sagt" />
+    <Word from="sagfen" to="sagten" />
+    <Word from="Sammlerstiicken" to="Sammlerstücken" />
+    <Word from="Sandsécke" to="Sandsäcke" />
+    <Word from="Sanftmiltigen" to="Sanftmütigen" />
+    <Word from="Sanierungsbehérde" to="Sanierungsbehörde" />
+    <Word from="Sanitéter" to="Sanitäter" />
+    <Word from="Sargnégel" to="Sargnägel" />
+    <Word from="sari" to="saß" />
+    <Word from="Satellitenschijssel" to="Satellitenschüssel" />
+    <Word from="Satellitenschusseln" to="Satellitenschüsseln" />
+    <Word from="Satellitenuberwachung" to="Satellitenüberwachung" />
+    <Word from="Saugfflflsen" to="Saugfüßen" />
+    <Word from="sc/10/1" to="schon" />
+    <Word from="sc/16/1" to="schön" />
+    <Word from="sch/cken" to="schicken" />
+    <Word from="Sch/ffe" to="Schiffe" />
+    <Word from="sch6n" to="schön" />
+    <Word from="Schadeniiberpriifung" to="Schadenüberprüfung" />
+    <Word from="Schadenuberprtlfung" to="Schadenüberprüfung" />
+    <Word from="Scharfschijtze" to="Scharfschütze" />
+    <Word from="schbn" to="schön" />
+    <Word from="schc'§n" to="schön" />
+    <Word from="Schdn" to="Schön" />
+    <Word from="schdnen" to="schönen" />
+    <Word from="Schecksl" to="Schecks!" />
+    <Word from="ScheiB" to="Scheiß" />
+    <Word from="ScheiBe" to="Scheiße" />
+    <Word from="scheiBegal" to="scheißegal" />
+    <Word from="Scheif$e" to="Scheiße" />
+    <Word from="scheiffsel" to="scheiße!" />
+    <Word from="Scheifi" to="Scheiß" />
+    <Word from="Scheifiding" to="Scheißding" />
+    <Word from="scheifie" to="scheiße" />
+    <Word from="Scheifiel" to="Scheiße!" />
+    <Word from="Scheifier" to="Scheißer" />
+    <Word from="Scheifihelm" to="Scheißhelm" />
+    <Word from="Scheifiloch" to="Scheißloch" />
+    <Word from="Scheifipascha" to="Scheißpascha" />
+    <Word from="Scheifisofa" to="Scheißsofa" />
+    <Word from="Scheifiweiber" to="Scheißweiber" />
+    <Word from="Scheifle" to="Scheiße" />
+    <Word from="Scheiiislangweilig" to="Scheißlangweilig" />
+    <Word from="Scheil'$e" to="Scheiße" />
+    <Word from="Scheil3&gt;er" to="Scheißer" />
+    <Word from="Scheil3e" to="Scheiße" />
+    <Word from="Scheili" to="Scheiß" />
+    <Word from="Scheilie" to="Scheiße" />
+    <Word from="scheilien" to="scheißen" />
+    <Word from="Scheille" to="Scheiße" />
+    <Word from="Scheillel" to="Scheiße!" />
+    <Word from="ScheilSe" to="Scheiße" />
+    <Word from="ScheilZ&gt;" to="Scheiß" />
+    <Word from="Scheir$oling" to="Scheißding" />
+    <Word from="scheissegal" to="scheißegal" />
+    <Word from="Scheisskarre" to="Scheißkarre" />
+    <Word from="Scheifle" to="Scheiße" />
+    <Word from="scheme" to="scheiße" />
+    <Word from="scheuf$lich" to="scheußlich" />
+    <Word from="Scheulilich" to="Scheußlich" />
+    <Word from="schfichtern" to="schüchtern" />
+    <Word from="schfimen" to="schämen" />
+    <Word from="schfin" to="schön" />
+    <Word from="Schfine" to="Schöne" />
+    <Word from="schfinen" to="schönen" />
+    <Word from="Schfines" to="Schönes" />
+    <Word from="schfirfer" to="schärfer" />
+    <Word from="Schfissel" to="Schüssel" />
+    <Word from="Schfitzchen" to="Schätzchen" />
+    <Word from="schfjnes" to="schönes" />
+    <Word from="Schideln" to="Schädeln" />
+    <Word from="schief$en" to="schießen" />
+    <Word from="Schief3&gt;en" to="Schießen" />
+    <Word from="Schiefien" to="Schießen" />
+    <Word from="schiefit" to="schießt" />
+    <Word from="schiefZ&gt;t" to="schießt" />
+    <Word from="schiel'5" to="schieß" />
+    <Word from="Schiel3t" to="Schießt" />
+    <Word from="schiellen" to="schießen" />
+    <Word from="Schielmbung" to="Schießübung" />
+    <Word from="schieflen" to="schießen" />
+    <Word from="schieflt" to="schießt" />
+    <Word from="Schiffsérzte" to="Schiffsärzte" />
+    <Word from="Schiffzerstfiren" to="Schiff zerstören" />
+    <Word from="Schifies" to="Schiffes" />
+    <Word from="Schiidel" to="Schädel" />
+    <Word from="schiilzen" to="schätzen" />
+    <Word from="schiin" to="schön" />
+    <Word from="schiine" to="schöne" />
+    <Word from="Schiinen" to="Schönen" />
+    <Word from="Schiiner" to="Schöner" />
+    <Word from="schiines" to="schönes" />
+    <Word from="Schiinheit" to="Schönheit" />
+    <Word from="Schiipfer" to="Schöpfer" />
+    <Word from="Schiipfung" to="Schöpfung" />
+    <Word from="Schiisse" to="Schüsse" />
+    <Word from="Schiitt" to="Schütt" />
+    <Word from="Schiittelfrost" to="Schüttelfrost" />
+    <Word from="schiitten" to="schütten" />
+    <Word from="schiittet" to="schüttet" />
+    <Word from="schiitze" to="schätze" />
+    <Word from="schiitzen" to="schützen" />
+    <Word from="schiitzt" to="schützt" />
+    <Word from="schijn" to="schön" />
+    <Word from="Schijnes" to="Schönes" />
+    <Word from="schijng" to="schön!" />
+    <Word from="Schijssel" to="Schüssel" />
+    <Word from="schijttelt" to="schüttelt" />
+    <Word from="Schijtze" to="Schütze" />
+    <Word from="schijtzen" to="schützen" />
+    <Word from="Schildkréte" to="Schildkröte" />
+    <Word from="Schilrze" to="Schürze" />
+    <Word from="Schilsse" to="Schüsse" />
+    <Word from="schiltten" to="schütten" />
+    <Word from="schiltzen" to="schützen" />
+    <Word from="schimte" to="schämte" />
+    <Word from="Schizophrenia" to="Schizophrenie" />
+    <Word from="Schiétze" to="Schätze" />
+    <Word from="Schlachtgetllimmels" to="Schlachtgetümmels" />
+    <Word from="Schlachtschifl" to="Schlachtschiff" />
+    <Word from="schlafenl" to="schlafen!" />
+    <Word from="Schlafkéfern" to="Schlafkäfern" />
+    <Word from="Schlafmiitzenl" to="Schlafmützen!" />
+    <Word from="Schlafmfltzel" to="Schlafmütze!" />
+    <Word from="Schlangengéttin" to="Schlangengöttin" />
+    <Word from="Schlappschwénze" to="Schlappschwänze" />
+    <Word from="Schlaumeierl" to="Schlaumeier!" />
+    <Word from="schlechf" to="schlecht" />
+    <Word from="Schlelistiinde" to="Schießstände" />
+    <Word from="Schlellen" to="Schießen" />
+    <Word from="Schleflt" to="Schießt" />
+    <Word from="Schlfilsselparty" to="Schlüsselparty" />
+    <Word from="Schlfisse" to="Schlüsse" />
+    <Word from="SchlieBe" to="Schließe" />
+    <Word from="schlieBen" to="schließen" />
+    <Word from="schlieBIich" to="schließlich" />
+    <Word from="schlieBlich" to="schließlich" />
+    <Word from="SchlieBt" to="Schließt" />
+    <Word from="schlief$en" to="schließen" />
+    <Word from="Schlief$lich" to="Schließlich" />
+    <Word from="schlief2&gt;lich" to="schließlich" />
+    <Word from="schlief3t" to="schließt" />
+    <Word from="Schliefie" to="Schließe" />
+    <Word from="schliefien" to="schließen" />
+    <Word from="Schliefilich" to="Schließlich" />
+    <Word from="schlieflslich" to="schließlich" />
+    <Word from="schliel3en" to="schließen" />
+    <Word from="schliel3lich" to="schließlich" />
+    <Word from="Schliel5t" to="Schließt" />
+    <Word from="schlielie" to="schließe" />
+    <Word from="schlielien" to="schließen" />
+    <Word from="schlielilich" to="schließlich" />
+    <Word from="schliellsen" to="schließen" />
+    <Word from="SchlielSt" to="Schließt" />
+    <Word from="Schliissel" to="Schlüssel" />
+    <Word from="Schliissell" to="Schlüssel!" />
+    <Word from="Schliisselmoment" to="Schlüsselmoment" />
+    <Word from="Schliisseln" to="Schlüsseln" />
+    <Word from="Schlijsse" to="Schlüsse" />
+    <Word from="Schlijssel" to="Schlüssel" />
+    <Word from="Schlijsselloch" to="Schlüsselloch" />
+    <Word from="Schlilssel" to="Schlüssel" />
+    <Word from="Schlilssell" to="Schlüssel" />
+    <Word from="Schlilsselparty" to="Schlüsselparty" />
+    <Word from="schlimmsterAlbtraum" to="schlimmster Albtraum" />
+    <Word from="Schlleflen" to="Schließen" />
+    <Word from="Schllisse" to="Schüsse" />
+    <Word from="schllitze" to="schütze" />
+    <Word from="schllitzen" to="schützen" />
+    <Word from="Schlllissell" to="Schlüssel!" />
+    <Word from="Schlull" to="Schluss" />
+    <Word from="Schlupfern" to="Schlüpfern" />
+    <Word from="Schlusselmoment" to="Schlüsselmoment" />
+    <Word from="Schlusselszenen" to="Schlüsselszenen" />
+    <Word from="Schlusselwérter" to="Schlusselwörter" />
+    <Word from="Schlussl" to="Schluss!" />
+    <Word from="Schluß" to="Schluss" />
+    <Word from="Schléchter" to="Schlächter" />
+    <Word from="schléfst" to="schläfst" />
+    <Word from="Schléft" to="Schläft" />
+    <Word from="Schlége" to="Schläge" />
+    <Word from="Schléger" to="Schläger" />
+    <Word from="Schlégerei" to="Schlägerei" />
+    <Word from="schlégt" to="schlägt" />
+    <Word from="schléift" to="schläft" />
+    <Word from="schléigst" to="schlägst" />
+    <Word from="Schlflssel" to="Schlüssel" />
+    <Word from="Schmatzgeréusche" to="Schmatzgeräusche" />
+    <Word from="SchmeiBt" to="Schmeißt" />
+    <Word from="Schmeif$" to="Schmeiß" />
+    <Word from="Schmeif$t" to="Schmeißt" />
+    <Word from="Schmeifien" to="Schmeißen" />
+    <Word from="schmeifit" to="schmeißt" />
+    <Word from="Schmeilit" to="Schmeißt" />
+    <Word from="Schmeifl" to="Schmeiß" />
+    <Word from="Schmierél" to="Schmieröl" />
+    <Word from="schmiicken" to="schmücken" />
+    <Word from="schmilztl" to="schmilzt!" />
+    <Word from="schmifl" to="schmiss" />
+    <Word from="Schmuckkéstchen" to="Schmuckkästchen" />
+    <Word from="Schmuckstiick" to="Schmuckstück" />
+    <Word from="Schnappschijsse" to="Schnappschüsse" />
+    <Word from="Schnauzel" to="Schnauze!" />
+    <Word from="Schneegestéber" to="Schneegestöber" />
+    <Word from="Schneidezéhnen" to="Schneidezähnen" />
+    <Word from="Schneidezéihne" to="Schneidezähne" />
+    <Word from="schnellf" to="schnell!" />
+    <Word from="Schnfiffeln" to="Schnüffeln" />
+    <Word from="schnfiffelnl" to="schnüffeln!" />
+    <Word from="schnfiffelst" to="schnüffelst" />
+    <Word from="Schnfirsenkel" to="Schnürsenkel" />
+    <Word from="schniiffele" to="schnüffele" />
+    <Word from="schnijffelt" to="schnüffelt" />
+    <Word from="Schnilffeln" to="Schnüffeln" />
+    <Word from="schnilrt" to="schnürt" />
+    <Word from="Schnitzereigeschéft" to="Schnitzereigeschäft" />
+    <Word from="Schniuzer" to="Schnäuzer" />
+    <Word from="Schnuoki" to="Schnucki" />
+    <Word from="Schnéppchen" to="Schnäppchen" />
+    <Word from="SchoB" to="Schoß" />
+    <Word from="Schofk" to="Schoß" />
+    <Word from="ScholShund" to="Schoßhund" />
+    <Word from="Schones" to="Schönes" />
+    <Word from="schonl" to="schon!" />
+    <Word from="schopferische" to="schöpferische" />
+    <Word from="schoß" to="schoss" />
+    <Word from="Schrankwénde" to="Schrankwände" />
+    <Word from="Schraubenschlijssel" to="Schraubenschlüssel" />
+    <Word from="schrecklichl" to="schrecklich!" />
+    <Word from="Schriftist" to="Schrift ist" />
+    <Word from="Schriftstijcks" to="Schriftstücks" />
+    <Word from="schrége" to="schräge" />
+    <Word from="Schréges" to="Schräges" />
+    <Word from="Schrénke" to="Schränke" />
+    <Word from="Schrénken" to="Schränken" />
+    <Word from="schtin" to="schön" />
+    <Word from="schtine" to="schöne" />
+    <Word from="Schtisse" to="Schüsse" />
+    <Word from="schuchtern" to="schüchtern" />
+    <Word from="Schuchterne" to="Schüchterne" />
+    <Word from="Schuhl" to="Schuh!" />
+    <Word from="Schuldgeftihlen" to="Schuldgefühlen" />
+    <Word from="Schulterl" to="Schulter!" />
+    <Word from="Schutzen" to="Schützen" />
+    <Word from="Schutzréume" to="Schutzräume" />
+    <Word from="SCHUTZT" to="SCHÜTZT" />
+    <Word from="Schw6r's" to="Schwör's" />
+    <Word from="Schwachkopfl" to="Schwachkop!" />
+    <Word from="Schwanzlutscherl" to="Schwanzlutscher!" />
+    <Word from="Schwarzhéndler" to="Schwarzhändler" />
+    <Word from="Schwarzweills" to="Schwarzweiß" />
+    <Word from="schweifldurchnisst" to="schweißdurchnässt" />
+    <Word from="schwerhérig" to="schwerhörig" />
+    <Word from="schwiicht" to="schwächt" />
+    <Word from="schwiire" to="schwöre" />
+    <Word from="schwiiren" to="schwören" />
+    <Word from="Schwimmanziige" to="Schwimmanzüge" />
+    <Word from="schwiérmten" to="schwärmten" />
+    <Word from="schwnre" to="schwöre" />
+    <Word from="Schwéche" to="Schwäche" />
+    <Word from="Schwéchen" to="Schwächen" />
+    <Word from="schwécher" to="schwächer" />
+    <Word from="schwécheren" to="schwächeren" />
+    <Word from="schwéchsten" to="schwächsten" />
+    <Word from="Schwéicheanfall" to="Schwächeanfall" />
+    <Word from="Schwéichen" to="Schwächen" />
+    <Word from="schwéicher" to="schwächer" />
+    <Word from="Schwéichling" to="Schwächling" />
+    <Word from="Schwéirmerei" to="Schwärmerei" />
+    <Word from="schwéirzeste" to="schwärzeste" />
+    <Word from="Schwémme" to="Schwämme" />
+    <Word from="schwére" to="schwöre" />
+    <Word from="schwéren" to="schwören" />
+    <Word from="Schwérme" to="Schwärme" />
+    <Word from="schwérmt" to="schwärmt" />
+    <Word from="schwérmte" to="schwärmte" />
+    <Word from="Schwétzer" to="Schwätzer" />
+    <Word from="schébiger" to="schäbiger" />
+    <Word from="Schédel" to="Schädel" />
+    <Word from="Schéden" to="Schäden" />
+    <Word from="Schéinder" to="Schänder" />
+    <Word from="schéine" to="schöne" />
+    <Word from="schéinen" to="schönen" />
+    <Word from="Schéiner" to="Schöner" />
+    <Word from="schéirfen" to="schärfen" />
+    <Word from="schéle" to="schäle" />
+    <Word from="schéme" to="schäme" />
+    <Word from="Schén" to="Schön" />
+    <Word from="schéne" to="schöne" />
+    <Word from="Schénen" to="Schönen" />
+    <Word from="Schéner" to="Schöner" />
+    <Word from="Schénes" to="Schönes" />
+    <Word from="Schénheit" to="Schönheit" />
+    <Word from="schénl" to="schön!" />
+    <Word from="schénste" to="schönste" />
+    <Word from="schénsten" to="schönsten" />
+    <Word from="schénstes" to="schönstes" />
+    <Word from="Schétzchen" to="Schätzchen" />
+    <Word from="Schétze" to="Schätze" />
+    <Word from="schétzen" to="schätzen" />
+    <Word from="schétzt" to="schätzt" />
+    <Word from="Schétzung" to="Schätzung" />
+    <Word from="Schéumen" to="Schäumen" />
+    <Word from="schflchtern" to="schüchtern" />
+    <Word from="SCl'1lUSS6l" to="Schlüssel" />
+    <Word from="Scllrift" to="Schrift" />
+    <Word from="scmoss" to="SCHLOSS" />
+    <Word from="se/n" to="sein" />
+    <Word from="Se/wen" to="Sehen" />
+    <Word from="sehenl" to="sehen!" />
+    <Word from="Sehenswlllrdigkeiten" to="Sehenswürdigkeiten" />
+    <Word from="Sehnsilchte" to="Sehnsüchte" />
+    <Word from="sehrangespannt" to="sehr angespannt" />
+    <Word from="sehrjung" to="sehr jung" />
+    <Word from="Sehrwohl" to="Sehr wohl" />
+    <Word from="sehrzufrieden" to="sehr zufrieden" />
+    <Word from="sehtjetzt" to="seht jetzt" />
+    <Word from="Seidenglattl" to="Seidenglatt!" />
+    <Word from="seidjetzt" to="seid jetzt" />
+    <Word from="Seitwann" to="Seit wann" />
+    <Word from="SEKRETARIN" to="SEKRETÄRIN" />
+    <Word from="Sekretiir" to="Sekretär" />
+    <Word from="Sekretir" to="Sekretär" />
+    <Word from="Sekretéirin" to="Sekretärin" />
+    <Word from="Sekretérin" to="Sekretärin" />
+    <Word from="sel/g" to="selig" />
+    <Word from="selbstl" to="selbst!" />
+    <Word from="selbststiindig" to="selbstständig" />
+    <Word from="selbstsuchtige" to="selbstsüchtige" />
+    <Word from="selbstverstindlich" to="selbstverständlich" />
+    <Word from="Selbstverstlndlich" to="Selbstverständlich" />
+    <Word from="Selbstverstéindlich" to="Selbstverständlich" />
+    <Word from="Selbstversténdlich" to="Selbstverständlich" />
+    <Word from="seld" to="seid" />
+    <Word from="selhst" to="selbst" />
+    <Word from="SeligerVater" to="Seliger Vater" />
+    <Word from="seln" to="sein" />
+    <Word from="Selt" to="Seit" />
+    <Word from="sentimalen" to="sentimentalen" />
+    <Word from="seriéser" to="seriöser" />
+    <Word from="Sexualitét" to="Sexualität" />
+    <Word from="Sfe" to="Sie" />
+    <Word from="Sfidamerikas" to="Südamerikas" />
+    <Word from="Sfidwind" to="Südwind" />
+    <Word from="Sfifies" to="Süßes" />
+    <Word from="Sfihne" to="Söhne" />
+    <Word from="Sfildner" to="Söldner" />
+    <Word from="Sfilie" to="Süße" />
+    <Word from="Sfilieste" to="Süßeste" />
+    <Word from="Sfifligkeiten" to="Süßigkeiten" />
+    <Word from="sfnd" to="sind" />
+    <Word from="SICHERHEITSBEHORDE" to="SICHERHEITSBEHÖRDE" />
+    <Word from="Sicherheitsgrijnden" to="Sicherheitsgründen" />
+    <Word from="Sichtubervvachung" to="Sichtüberwachung" />
+    <Word from="Sichtunterstutzung" to="Sichtunterstützung" />
+    <Word from="Sieja" to="Sie ja" />
+    <Word from="Sifihnchen" to="Söhnchen" />
+    <Word from="Signalstérke" to="Signalstärke" />
+    <Word from="Siiden" to="Süden" />
+    <Word from="Siidfrankreich" to="Südfrankreich" />
+    <Word from="siidliche" to="südliche" />
+    <Word from="siil$" to="süß" />
+    <Word from="siili" to="süß" />
+    <Word from="Siilie" to="Süße" />
+    <Word from="siilier" to="süßer" />
+    <Word from="SIim's" to="Slim's" />
+    <Word from="Siinde" to="Sünde" />
+    <Word from="Siinden" to="Sünden" />
+    <Word from="Siinder" to="Sünder" />
+    <Word from="siindigen" to="sündigen" />
+    <Word from="siiflen" to="süßen" />
+    <Word from="siJB" to="süß" />
+    <Word from="SiJBe" to="Süße" />
+    <Word from="siJchtige" to="süchtige" />
+    <Word from="sijlien" to="siüßen" />
+    <Word from="sijliesten" to="süßesten" />
+    <Word from="Sijsser" to="Süßer" />
+    <Word from="Sildtunnel" to="Südtunnel" />
+    <Word from="Silfie" to="Süße" />
+    <Word from="Silfier" to="Süßer" />
+    <Word from="Silfies" to="Süßes" />
+    <Word from="silfker" to="süßer" />
+    <Word from="Silnden" to="Sünden" />
+    <Word from="Silndenbock" to="Sündenbock" />
+    <Word from="sindja" to="sind ja" />
+    <Word from="Sirl" to="Sir!" />
+    <Word from="Sj_r" to="Sir" />
+    <Word from="Skilaufen" to="Ski laufen" />
+    <Word from="skrupelloserAnwélte" to="skrupelloser Anwälte" />
+    <Word from="sL'lf$e" to="süße" />
+    <Word from="sL1B" to="süß" />
+    <Word from="slch" to="sich" />
+    <Word from="sle" to="sie" />
+    <Word from="slebe" to="siebe" />
+    <Word from="sLif$" to="süß" />
+    <Word from="SLif$e" to="Süße" />
+    <Word from="SLif$er" to="Süßer" />
+    <Word from="sLif$es" to="süßes" />
+    <Word from="SLilSe" to="Süße" />
+    <Word from="Slliden" to="Süden" />
+    <Word from="Sllinde" to="Sünde" />
+    <Word from="sllindigen" to="sündigen" />
+    <Word from="Slnd" to="Sind" />
+    <Word from="Slr" to="Sir" />
+    <Word from="Slrs" to="Sirs" />
+    <Word from="SoBen" to="Soßen" />
+    <Word from="sofortl" to="sofort!" />
+    <Word from="sohénen" to="schönen" />
+    <Word from="Solien" to="Soßen" />
+    <Word from="sollenl" to="sollen!" />
+    <Word from="SONDERMULL" to="SONDERMÜLL" />
+    <Word from="sorgféiltig" to="sorgfältig" />
+    <Word from="sorgféltig" to="sorgfältig" />
+    <Word from="souveréine" to="souveräne" />
+    <Word from="souveréinen" to="souveränen" />
+    <Word from="souveréner" to="souveräner" />
+    <Word from="sp'a'ter" to="später" />
+    <Word from="sp/elen" to="spielen" />
+    <Word from="SpaB" to="Spaß" />
+    <Word from="Spaf$" to="Spaß" />
+    <Word from="Spaf2&gt;" to="Spaß" />
+    <Word from="Spaffs" to="Spaß" />
+    <Word from="Spafi" to="Spaß" />
+    <Word from="Spafls" to="Spaß" />
+    <Word from="SpafS" to="Spaß" />
+    <Word from="Spal'5" to="Spaß" />
+    <Word from="Spal2&gt;" to="Spaß" />
+    <Word from="Spal3" to="Spaß" />
+    <Word from="Spali" to="Spaß" />
+    <Word from="Spall" to="Spaß" />
+    <Word from="Spass" to="Spaß" />
+    <Word from="spat" to="spät" />
+    <Word from="spektakular" to="spektakulär" />
+    <Word from="Spell" to="Späß" />
+    <Word from="Spells" to="Späß" />
+    <Word from="Spell»" to="Spaß" />
+    <Word from="Spezialitét" to="Spezialität" />
+    <Word from="spfit" to="spät" />
+    <Word from="SpieB" to="Spieß" />
+    <Word from="spief$ig" to="spießig" />
+    <Word from="Spielzeuggeschfiftn" to="Spielzeuggeschäft" />
+    <Word from="Spielzeuggeschfiftn" to="Spielzeuggeschäft--" />
+    <Word from="spiilte" to="spülte" />
+    <Word from="spiiren" to="spüren" />
+    <Word from="spiirt" to="spürt" />
+    <Word from="spiit" to="spät" />
+    <Word from="spijre" to="spüre" />
+    <Word from="spijren" to="spüren" />
+    <Word from="spijrt" to="spürt" />
+    <Word from="Spillmeier" to="Spülmeier" />
+    <Word from="spilre" to="spüre" />
+    <Word from="spilren" to="spüren" />
+    <Word from="spit" to="spät" />
+    <Word from="Spitzenfriihstiick" to="Spitzenfrühstück" />
+    <Word from="spLir's" to="spür's" />
+    <Word from="splliren" to="spüren" />
+    <Word from="splter" to="später" />
+    <Word from="Sportilbertragung" to="Sportübertragung" />
+    <Word from="Sportsfraund" to="Sportsfreund" />
+    <Word from="Sprachpijppchen" to="Sprachpüppchen" />
+    <Word from="SPRACHPUPPCHEN" to="SPRACHPÜPPCHEN" />
+    <Word from="Spriichlein" to="Sprüchlein" />
+    <Word from="Sprilht" to="Sprüht" />
+    <Word from="spréche" to="spräche" />
+    <Word from="spréchen" to="sprächen" />
+    <Word from="spréchet" to="sprächet" />
+    <Word from="Sprflche" to="Sprüche" />
+    <Word from="sprflht" to="sprüht" />
+    <Word from="spUl" to="spül" />
+    <Word from="spUr" to="spür" />
+    <Word from="spurbare" to="spürbare" />
+    <Word from="spUrt" to="spürt" />
+    <Word from="sp§ter" to="später" />
+    <Word from="Späß" to="Spaß" />
+    <Word from="spéit" to="spät" />
+    <Word from="spéiter" to="später" />
+    <Word from="spét" to="spät" />
+    <Word from="Spéter" to="Später" />
+    <Word from="Spétzchen" to="Spätzchen" />
+    <Word from="Spétzchenl" to="Spätzchen!" />
+    <Word from="ssh" to="sah" />
+    <Word from="st6Bt" to="stößt" />
+    <Word from="st6hnt" to="stöhnt" />
+    <Word from="st6lSt" to="stößt" />
+    <Word from="St6rt" to="Stört" />
+    <Word from="ST@HNT" to="STÖHNT" />
+    <Word from="Staatsafféren" to="Staatsaffären" />
+    <Word from="staatsbllirgerliches" to="staatsbürgerliches" />
+    <Word from="Staatsgeschéfte" to="Staatsgeschäfte" />
+    <Word from="Standardanésthesie" to="Standardanästhesie" />
+    <Word from="standig" to="ständig" />
+    <Word from="STARSCREAMI" to="STARSCREAM:" />
+    <Word from="stationér" to="stationär" />
+    <Word from="Statusmeldungl" to="Statusmeldung!" />
+    <Word from="stdrte" to="störte" />
+    <Word from="stecktjede" to="steckt jede" />
+    <Word from="Stehenbleiben" to="Stehen bleiben" />
+    <Word from="Stehvermiigen" to="Stehvermögen" />
+    <Word from="Steigbilgeldinger" to="Steigbügeldinger" />
+    <Word from="Steinhéuser" to="Steinhäuser" />
+    <Word from="Sternenkijsse" to="Sternenküsse" />
+    <Word from="Steuererklérung" to="Steuererklärung" />
+    <Word from="Steuererklérungen" to="Steuererklärungen" />
+    <Word from="Steuerprtifer" to="Steuerprüfer" />
+    <Word from="Steuerprtifung" to="Steuerprüfung" />
+    <Word from="Steuersiitzen" to="Steuersätzen" />
+    <Word from="stfipseln" to="stöpseln" />
+    <Word from="stfiren" to="stören" />
+    <Word from="stfirker" to="stärker" />
+    <Word from="Stfirt" to="Stört" />
+    <Word from="stfirzt" to="stürzt" />
+    <Word from="stieB" to="stieß" />
+    <Word from="Stiefbriider" to="Stiefbrüder" />
+    <Word from="Stiicke" to="Stücke" />
+    <Word from="Stiihle" to="Stühle" />
+    <Word from="Stiihlen" to="Stühlen" />
+    <Word from="stiihnt" to="stöhnt" />
+    <Word from="Stiillen" to="Ställen" />
+    <Word from="Stiire" to="Störe" />
+    <Word from="stiiren" to="stören" />
+    <Word from="Stiirme" to="Stürme" />
+    <Word from="stiirmischen" to="stürmischen" />
+    <Word from="Stiirsignale" to="Störsignale" />
+    <Word from="stiirt" to="stört" />
+    <Word from="Stiirung" to="Störung" />
+    <Word from="stiirzen" to="stürzen" />
+    <Word from="Stiitzpunkt" to="Stützpunkt" />
+    <Word from="Stijck" to="Stück" />
+    <Word from="Stijckchen" to="Stückchen" />
+    <Word from="Stijcke" to="Stücke" />
+    <Word from="stijhle" to="stühle" />
+    <Word from="stijrme" to="stürme" />
+    <Word from="stijrzen" to="stürzen" />
+    <Word from="Stilck" to="Stück" />
+    <Word from="Stilcke" to="Stücke" />
+    <Word from="Stillckchen" to="Stückchen" />
+    <Word from="Stillsténde" to="Stillstände" />
+    <Word from="Stilvolll" to="Stilvoll!" />
+    <Word from="stinden" to="ständen" />
+    <Word from="Stldseite" to="Südseite" />
+    <Word from="stleg" to="stieg" />
+    <Word from="Stllihle" to="Stühle" />
+    <Word from="Stllirmen" to="Stürmen" />
+    <Word from="stllirzt" to="stürzt" />
+    <Word from="stlllrzen" to="stürzen" />
+    <Word from="Stlfl" to="Stift" />
+    <Word from="sto/3en" to="stoßen" />
+    <Word from="StoB" to="Stoß" />
+    <Word from="stoBe" to="stoße" />
+    <Word from="stof$en" to="stoßen" />
+    <Word from="Stofi" to="Stoß" />
+    <Word from="STOHNT" to="STÖHNT" />
+    <Word from="Stol3zahn" to="Stoßzahn" />
+    <Word from="Stol3zeit" to="Stoßzeit" />
+    <Word from="stolie" to="stoße" />
+    <Word from="Storung" to="Störung" />
+    <Word from="Str6men" to="Strömen" />
+    <Word from="str6mt" to="strömt" />
+    <Word from="StraBe" to="Straße" />
+    <Word from="StraBen" to="Straßen" />
+    <Word from="StraBenk6tern" to="Straßenkötern" />
+    <Word from="Straf$e" to="Straße" />
+    <Word from="Strafiengang" to="Straßengang" />
+    <Word from="Strafienratten" to="Straßenratten" />
+    <Word from="Strafienschlacht" to="Straßenschlacht" />
+    <Word from="Straflsenecke" to="Straßenecke" />
+    <Word from="Straflsenmaler" to="Straßenmaler" />
+    <Word from="Straflsenschilder" to="Straßenschilder" />
+    <Word from="Straftéter" to="Straftäter" />
+    <Word from="Strahlenschutzgerét" to="Strahlenschutzgerät" />
+    <Word from="Strahlungsintensitét" to="Strahlungsintensität" />
+    <Word from="Stral3en" to="Straßen" />
+    <Word from="Stral5e" to="Straße" />
+    <Word from="Stralie" to="Straße" />
+    <Word from="Straliengang" to="Straßengang" />
+    <Word from="Stralienkéter" to="Straßenköter" />
+    <Word from="Straliensperre" to="Straßensperre" />
+    <Word from="Streitkréfte" to="Streitkräfte" />
+    <Word from="Streitkréften" to="Streitkräften" />
+    <Word from="Streitéxte" to="Streitäxte" />
+    <Word from="strfimten" to="strömten" />
+    <Word from="Striimen" to="Strömen" />
+    <Word from="Striimungen" to="Strömungen" />
+    <Word from="Stromschliige" to="Stromschläge" />
+    <Word from="Stromschnellenl" to="Stromschnellen!" />
+    <Word from="Stromung" to="Strömung" />
+    <Word from="Strullerl" to="Struller!" />
+    <Word from="Strémung" to="Strömung" />
+    <Word from="Strémungen" to="Strömungen" />
+    <Word from="sturzte" to="stürzte" />
+    <Word from="STUTZPUNKT" to="STÜTZPUNKT" />
+    <Word from="Stébe" to="Stäbe" />
+    <Word from="stéhnt" to="stöhnt" />
+    <Word from="stéhnte" to="stöhnte" />
+    <Word from="Stéidtchen" to="Städtchen" />
+    <Word from="Stéidte" to="Städte" />
+    <Word from="stéindig" to="ständig" />
+    <Word from="Stéirke" to="Stärke" />
+    <Word from="stéirker" to="stärker" />
+    <Word from="Stéirkeres" to="Stärkeres" />
+    <Word from="stéllst" to="stößt" />
+    <Word from="Sténdchen" to="Ständchen" />
+    <Word from="Sténder" to="Ständer" />
+    <Word from="Sténdig" to="Ständig" />
+    <Word from="stépseln" to="stöpseln" />
+    <Word from="stéren" to="stören" />
+    <Word from="Stérke" to="Stärke" />
+    <Word from="Stérken" to="Stärken" />
+    <Word from="stérker" to="stärker" />
+    <Word from="Stérkere" to="Stärkere" />
+    <Word from="stérkeres" to="stärkeres" />
+    <Word from="stérkste" to="stärkste" />
+    <Word from="stérst" to="störst" />
+    <Word from="stért" to="stört" />
+    <Word from="Stérung" to="Störung" />
+    <Word from="Stétten" to="Stätten" />
+    <Word from="Stflck" to="Stück" />
+    <Word from="Stflhlen" to="Stühlen" />
+    <Word from="sUB" to="süß" />
+    <Word from="sUBe" to="süße" />
+    <Word from="Suchfeam" to="Suchteam" />
+    <Word from="SUden" to="Süden" />
+    <Word from="Sudseite" to="Südseite" />
+    <Word from="Sudwest" to="Südwest" />
+    <Word from="sUf$" to="süß" />
+    <Word from="SUf$e" to="Süße" />
+    <Word from="suMM†" to="SUMMT" />
+    <Word from="Suohet" to="Suchet" />
+    <Word from="Superkréfte" to="Superkräfte" />
+    <Word from="superlécherlich" to="superlächerlich" />
+    <Word from="s¢'il3" to="süß" />
+    <Word from="Sécke" to="Säcke" />
+    <Word from="Sége" to="Säge" />
+    <Word from="séhe" to="sähe" />
+    <Word from="Séhne" to="Söhne" />
+    <Word from="Séhnen" to="Söhnen" />
+    <Word from="Séicke" to="Säcke" />
+    <Word from="Séinger" to="Sänger" />
+    <Word from="Séiulen" to="Säulen" />
+    <Word from="Séldner" to="Söldner" />
+    <Word from="sémfl/che" to="sämtliche" />
+    <Word from="sémtliche" to="sämtliche" />
+    <Word from="sémtlichen" to="sämtlichen" />
+    <Word from="Sénger" to="Sänger" />
+    <Word from="Séngerin" to="Sängerin" />
+    <Word from="séubern" to="säubern" />
+    <Word from="séuft" to="säuft" />
+    <Word from="séugen" to="säugen" />
+    <Word from="Séulen" to="Säulen" />
+    <Word from="Séurewannen" to="Säurewannen" />
+    <Word from="Sfldhéingen" to="Südhängen" />
+    <Word from="T6chter" to="Töchter" />
+    <Word from="T6pfchen" to="Töpfchen" />
+    <Word from="T6rn" to="Törn" />
+    <Word from="T6rtchen" to="Törtchen" />
+    <Word from="t6te" to="töte" />
+    <Word from="T6ten" to="Töten" />
+    <Word from="t6tet" to="tötet" />
+    <Word from="TANZERINNEN" to="TÄNZERINNEN" />
+    <Word from="Tater" to="Täter" />
+    <Word from="tatséchlich" to="tatsächlich" />
+    <Word from="tatséchliche" to="tatsächliche" />
+    <Word from="tatséichlich" to="tatsächlich" />
+    <Word from="Tatverdéichtigen" to="Tatverdächtigen" />
+    <Word from="Tauchgéinge" to="Tauchgänge" />
+    <Word from="Tauchgénge" to="Tauchgänge" />
+    <Word from="Tauschgeschéfte" to="Tauschgeschäfte" />
+    <Word from="Tauschgeschéfle" to="Tauschgeschäfte" />
+    <Word from="Tbrn" to="Törn" />
+    <Word from="tbten" to="töten" />
+    <Word from="tdten" to="töten" />
+    <Word from="tdtete" to="tötete" />
+    <Word from="Telefongespréche" to="Telefongespräche" />
+    <Word from="Tempelschénderf" to="Tempelschänder!" />
+    <Word from="TemPO" to="Tempo" />
+    <Word from="TESTGELANDE" to="TESTGELÄNDE" />
+    <Word from="Testvorfflhrungen" to="Testvorführungen" />
+    <Word from="tfidlich" to="tödlich" />
+    <Word from="tfiitet" to="tötet" />
+    <Word from="Tfir" to="Tür" />
+    <Word from="tfirkischen" to="türkischen" />
+    <Word from="Tfite" to="Tüte" />
+    <Word from="Theaterstfick" to="Theaterstück" />
+    <Word from="Therapiel" to="Therapie!" />
+    <Word from="Thermalgerét" to="Thermalgerät" />
+    <Word from="Thronréuber" to="Thronräuber" />
+    <Word from="Thronréuberin" to="Thronräuberin" />
+    <Word from="Tiefkilhlung" to="Tiefkühlung" />
+    <Word from="Tiefktih/system" to="Tiefkühlsystem" />
+    <Word from="Tiefktihleindémmung" to="Tiefkühleindämmung" />
+    <Word from="TIEFKUHL" to="TIEFKÜHL" />
+    <Word from="Tiefkuhlstasis" to="Tiefkühlstasis" />
+    <Word from="Tiefkuhlung" to="Tiefkühlung" />
+    <Word from="tiglich" to="täglich" />
+    <Word from="tiichtige" to="tüchtige" />
+    <Word from="tiint" to="tönt" />
+    <Word from="Tiipfchen" to="Töpfchen" />
+    <Word from="Tiipfchennummer" to="Töpfchennummer" />
+    <Word from="Tiir" to="Tür" />
+    <Word from="Tiiren" to="Türen" />
+    <Word from="Tiirl" to="Tür!" />
+    <Word from="Tiirme" to="Türme" />
+    <Word from="tiite" to="töte" />
+    <Word from="Tiite" to="Tüte" />
+    <Word from="tiiten" to="töten" />
+    <Word from="tiitet" to="tötet" />
+    <Word from="tiitete" to="tötete" />
+    <Word from="TiJr" to="Tür" />
+    <Word from="Tijrme" to="Türme" />
+    <Word from="Tilr" to="Tür" />
+    <Word from="Tilrglocke" to="Türglocke" />
+    <Word from="Tilrklingel" to="Türklingel" />
+    <Word from="Tilréffner" to="Türöffner" />
+    <Word from="Tippgeréusch" to="Tippgeräusch" />
+    <Word from="Tischlenuerkstatt" to="Tischlerwerkstatt" />
+    <Word from="TL'lr" to="Tür" />
+    <Word from="tlglich" to="täglich" />
+    <Word from="Tllir" to="Tür" />
+    <Word from="Tllirkei" to="Türkei" />
+    <Word from="Tlllpfelchen" to="Tüpfelchen" />
+    <Word from="TOILETTENSPULUNG" to="TOILETTENSPÜLUNG" />
+    <Word from="Tonl" to="Ton" />
+    <Word from="Toreroabsétze" to="Toreroabsätze" />
+    <Word from="Tortenbéickerin" to="Tortenbäckerin" />
+    <Word from="Tragfidie" to="Tragödie" />
+    <Word from="Tragiidie" to="Tragödie" />
+    <Word from="Tragédie" to="Tragödie" />
+    <Word from="Trainingsijbung" to="Trainingsübung" />
+    <Word from="TRAUMKCRPER" to="TRAUMKÖRPER" />
+    <Word from="treffan" to="treffen" />
+    <Word from="trfiumen" to="träumen" />
+    <Word from="Tribiinen" to="Tribünen" />
+    <Word from="trif'f't" to="trifft" />
+    <Word from="trigt" to="trägt" />
+    <Word from="Triibsal" to="Trübsal" />
+    <Word from="Triimmem" to="Trümmern" />
+    <Word from="triistllch" to="tröstlich" />
+    <Word from="Triistungen" to="Tröstungen" />
+    <Word from="Triiume" to="Träume" />
+    <Word from="Trilmmer" to="Trümmer" />
+    <Word from="triume" to="träume" />
+    <Word from="Trockengeréite" to="Trockengeräte" />
+    <Word from="Trockengeréte" to="Trockengeräte" />
+    <Word from="Tropfsteinhiihle" to="Tropfsteinhöhle" />
+    <Word from="Trottell" to="Trottel!" />
+    <Word from="Trubsal" to="Trübsal" />
+    <Word from="trége" to="träge" />
+    <Word from="Trégerschiff" to="Trägerschiff" />
+    <Word from="trégt" to="trägt" />
+    <Word from="Tréigerschiff" to="Trägerschiff" />
+    <Word from="tréigt" to="trägt" />
+    <Word from="tréium" to="träum" />
+    <Word from="tréiume" to="träume" />
+    <Word from="tréiumen" to="träumen" />
+    <Word from="tréiumt" to="träumt" />
+    <Word from="tréllert" to="trällert" />
+    <Word from="Tréne" to="Träne" />
+    <Word from="Trénen" to="Tränen" />
+    <Word from="Tréum" to="Träum" />
+    <Word from="tréume" to="träume" />
+    <Word from="Tréumen" to="Träumen" />
+    <Word from="Tréumer" to="Träumer" />
+    <Word from="tréumst" to="träumst" />
+    <Word from="Tréumt" to="Träumt" />
+    <Word from="Tschiiss" to="Tschüss" />
+    <Word from="Tschiissl" to="Tschüss!" />
+    <Word from="tschijss" to="tschüss" />
+    <Word from="Tschtiss" to="Tschüss" />
+    <Word from="tschüß" to="tschüss" />
+    <Word from="Tschfls" to="Tschüs" />
+    <Word from="Ttir" to="Tür" />
+    <Word from="ttlckisch" to="tückisch" />
+    <Word from="Ttlte" to="Tüte" />
+    <Word from="tubulére" to="tubuläre" />
+    <Word from="Tupperschiissel" to="Tupperschüssel" />
+    <Word from="TUR" to="TÜR" />
+    <Word from="TUr" to="Tür" />
+    <Word from="Turen" to="Türen" />
+    <Word from="TURKEI" to="TÜRKEI" />
+    <Word from="Turmwiichter" to="Turmwächter" />
+    <Word from="tutjetzt" to="tut jetzt" />
+    <Word from="typlschl" to="typlsch!" />
+    <Word from="Téchter" to="Töchter" />
+    <Word from="téd/ichen" to="tödlichen" />
+    <Word from="tédlich" to="tödlich" />
+    <Word from="tédliche" to="tödliche" />
+    <Word from="tédlichen" to="tödlichen" />
+    <Word from="téglich" to="täglich" />
+    <Word from="téglichen" to="täglichen" />
+    <Word from="téiglich" to="täglich" />
+    <Word from="téitowieren" to="tätowieren" />
+    <Word from="téitowierte" to="tätowierte" />
+    <Word from="Téitowierung" to="Tätowierung" />
+    <Word from="téiuschen" to="täuschen" />
+    <Word from="Téler" to="Täler" />
+    <Word from="Télpell" to="Tölpel!" />
+    <Word from="Ténze" to="Tänze" />
+    <Word from="Ténzerin" to="Tänzerin" />
+    <Word from="Tépfchen" to="Töpfchen" />
+    <Word from="Tépfchenquatsch" to="Töpfchenquatsch" />
+    <Word from="Tépfchensache" to="Töpfchensache" />
+    <Word from="téte" to="töte" />
+    <Word from="Téten" to="Töten" />
+    <Word from="tétest" to="tätest" />
+    <Word from="tétet" to="tötet" />
+    <Word from="tétete" to="tötete" />
+    <Word from="tétowieren" to="tätowieren" />
+    <Word from="tétowierte" to="tätowierte" />
+    <Word from="Tétowierung" to="Tätowierung" />
+    <Word from="Tétowierungen" to="Tätowierungen" />
+    <Word from="téuschen" to="täuschen" />
+    <Word from="téuscht" to="täuscht" />
+    <Word from="Téuschung" to="Täuschung" />
+    <Word from="Téuschungsmanéver" to="Täuschungsmanöver" />
+    <Word from="Ub6FpFUfl'T1al" to="überprüf" />
+    <Word from="Ub6l'pl'Uf€" to="Überprüfe" />
+    <Word from="Ube" to="Übe" />
+    <Word from="Ubel" to="übel" />
+    <Word from="Ubelkeit" to="Übelkeit" />
+    <Word from="Ubeltéter" to="Übeltäter" />
+    <Word from="Uben" to="Üben" />
+    <Word from="Uben/vachen" to="Überwachen" />
+    <Word from="Uben/vacher" to="Überwacher" />
+    <Word from="Uben/vacht" to="Überwacht" />
+    <Word from="Uben/vachungen" to="Überwachungen" />
+    <Word from="Uben/vachungsgesetz" to="Überwachungsgesetz" />
+    <Word from="Uben/vinden" to="überwinden" />
+    <Word from="Uber" to="über" />
+    <Word from="UBER" to="ÜBER" />
+    <Word from="Uberall" to="überall" />
+    <Word from="Uberanstrenge" to="überanstrenge" />
+    <Word from="Uberanstrengung" to="Überanstrengung" />
+    <Word from="Uberarbeiten" to="Überarbeiten" />
+    <Word from="UberAuf$erirdische" to="über Außerirdische" />
+    <Word from="Uberaus" to="überaus" />
+    <Word from="Uberbleibsel" to="Überbleibsel" />
+    <Word from="Uberblick" to="Überblick" />
+    <Word from="Uberbringe" to="überbringe" />
+    <Word from="Uberdauern" to="überdauern" />
+    <Word from="Uberdecken" to="überdecken" />
+    <Word from="Ubereinstimmung" to="Übereinstimmung" />
+    <Word from="Uberfahren" to="überfahren" />
+    <Word from="Uberfall" to="Überfall" />
+    <Word from="Uberflilssig" to="überflüssig" />
+    <Word from="Ubergabe" to="Übergabe" />
+    <Word from="Ubergaben" to="Übergaben" />
+    <Word from="Ubergabepunkt" to="Übergabepunkt" />
+    <Word from="Ubergangen" to="übergangen" />
+    <Word from="Ubergangsweise" to="übergangsweise" />
+    <Word from="Ubergeben" to="übergeben" />
+    <Word from="Ubergehen" to="übergehen" />
+    <Word from="Uberhaupt" to="Überhaupt" />
+    <Word from="Uberholt" to="Überholt" />
+    <Word from="Uberholter" to="überholter" />
+    <Word from="Uberhért" to="überhört" />
+    <Word from="Uberjemanden" to="über jemanden" />
+    <Word from="Uberlagerungs" to="Überlagerungs" />
+    <Word from="Uberlandleitungen" to="Überlandleitungen" />
+    <Word from="Uberlass" to="Überlass" />
+    <Word from="Uberlasse" to="überlasse" />
+    <Word from="Uberlassen" to="überlassen" />
+    <Word from="Uberlassenl" to="überlassen!" />
+    <Word from="Uberlasteten" to="Überlasteten" />
+    <Word from="Uberleben" to="Überleben" />
+    <Word from="Uberlebende" to="Überlebende" />
+    <Word from="Uberlebenden" to="Überlebenden" />
+    <Word from="Uberlebenschancen" to="Überlebenschancen" />
+    <Word from="Uberlebenswichtigen" to="überlebenswichtigen" />
+    <Word from="Uberlebt" to="überlebt" />
+    <Word from="Uberleg" to="überleg" />
+    <Word from="Uberlegen" to="Überlegen" />
+    <Word from="Uberlegenheit" to="Überlegenheit" />
+    <Word from="uberlegt" to="überlegt" />
+    <Word from="Uberlegten" to="überlegten" />
+    <Word from="Uberleiten" to="überleiten" />
+    <Word from="Uberleitung" to="Überleitung" />
+    <Word from="Uberlieferungen" to="Überlieferungen" />
+    <Word from="Uberlésst" to="überlässt" />
+    <Word from="Uberm" to="überm" />
+    <Word from="Ubermorgen" to="Übermorgen" />
+    <Word from="Ubernachtungsgast" to="Übernachtungsgast" />
+    <Word from="Ubernahm" to="übernahm" />
+    <Word from="Ubernahme" to="Übernahme" />
+    <Word from="Ubernahmen" to="übernahmen" />
+    <Word from="Ubernehme" to="übernehme" />
+    <Word from="Ubernehmen" to="übernehmen" />
+    <Word from="Ubernimmst" to="übernimmst" />
+    <Word from="ubernimmt" to="übernimmt" />
+    <Word from="Ubernommen" to="übernommen" />
+    <Word from="Uberpriifen" to="überprüfen" />
+    <Word from="Uberprilfen" to="überprüfen" />
+    <Word from="Uberprliifen" to="Überprüfen" />
+    <Word from="Uberprufe" to="überprüfe" />
+    <Word from="Uberprufen" to="überprüfen" />
+    <Word from="Uberpruft" to="überprüft" />
+    <Word from="Uberraschend" to="Überraschend" />
+    <Word from="Uberrascht" to="Überrascht" />
+    <Word from="Uberraschte" to="Überraschte" />
+    <Word from="Uberraschter" to="überraschter" />
+    <Word from="Uberraschung" to="Überraschung" />
+    <Word from="Uberraschungen" to="Überraschungen" />
+    <Word from="Uberraschungl" to="Überraschung!" />
+    <Word from="Uberreagiert" to="überreagiert" />
+    <Word from="Uberreden" to="überreden" />
+    <Word from="Uberredet" to="Überredet" />
+    <Word from="Uberreste" to="Überreste" />
+    <Word from="Uberrumpeln" to="überrumpeln" />
+    <Word from="Uberrumple" to="Überrumple" />
+    <Word from="Ubers" to="übers" />
+    <Word from="Uberschlégt" to="Überschlägt" />
+    <Word from="Uberschreiten" to="Überschreiten" />
+    <Word from="Uberschritten" to="überschritten" />
+    <Word from="Uberschwemmung" to="Überschwemmung" />
+    <Word from="Ubersehen" to="übersehen" />
+    <Word from="Ubersensibilitét" to="Übersensibilität" />
+    <Word from="Ubersetzung" to="Übersetzung" />
+    <Word from="Uberspannte" to="überspannte" />
+    <Word from="Uberspielt" to="überspielt" />
+    <Word from="Uberstehen" to="Überstehen" />
+    <Word from="Ubersteigerten" to="übersteigerten" />
+    <Word from="Ubersteigt" to="übersteigt" />
+    <Word from="Uberstunden" to="Überstunden" />
+    <Word from="Ubertraf" to="übertraf" />
+    <Word from="UBERTRAGEN" to="ÜBERTRAGEN" />
+    <Word from="Ubertragen" to="übertragen" />
+    <Word from="UBERTRAGUNG" to="ÜBERTRAGUNG" />
+    <Word from="ubertreibe" to="übertreibe" />
+    <Word from="Ubertreiben" to="übertreiben" />
+    <Word from="Ubertrieben" to="übertrieben" />
+    <Word from="Ubertriebene" to="Übertriebene" />
+    <Word from="ubertriebener" to="übertriebener" />
+    <Word from="Ubertrifft" to="Übertrifft" />
+    <Word from="Ubervvachen" to="überwachen" />
+    <Word from="Ubervvacht" to="überwacht" />
+    <Word from="Ubervvachung" to="Überwachung" />
+    <Word from="Ubervvachungs" to="Überwachungs" />
+    <Word from="Ubervvachungsstaat" to="Überwachungsstaat" />
+    <Word from="Ubervvachungsstaats" to="Überwachungsstaats" />
+    <Word from="Ubervvachungsvideos" to="Überwachungsvideos" />
+    <Word from="Ubervvéiltigend" to="überwältigend" />
+    <Word from="Uberwachen" to="überwachen" />
+    <Word from="Uberwacher" to="Überwacher" />
+    <Word from="Uberwachung" to="Überwachung" />
+    <Word from="Uberzeuge" to="überzeuge" />
+    <Word from="Uberzeugen" to="überzeugen" />
+    <Word from="Uberzeugend" to="überzeugend" />
+    <Word from="Uberzeugt" to="überzeugt" />
+    <Word from="Uberzeugung" to="Überzeugung" />
+    <Word from="Uberzeugungen" to="Überzeugungen" />
+    <Word from="Uberziehen" to="überziehen" />
+    <Word from="Uberzuleiten" to="überzuleiten" />
+    <Word from="ublem" to="üblem" />
+    <Word from="Ubler" to="Übler" />
+    <Word from="Ubles" to="Übles" />
+    <Word from="Ublich" to="üblich" />
+    <Word from="Ubliche" to="Übliche" />
+    <Word from="ublichen" to="üblichen" />
+    <Word from="Ubrig" to="übrig" />
+    <Word from="Ubrige" to="Übrige" />
+    <Word from="Ubrigen" to="Übrigen" />
+    <Word from="Ubrigens" to="übrigens" />
+    <Word from="Ubrlgens" to="Übrigens" />
+    <Word from="Ubrllccol" to="Ubriacco!" />
+    <Word from="Ubung" to="Übung" />
+    <Word from="Ubungsbedingungen" to="Übungsbedingungen" />
+    <Word from="Ubungsschiisse" to="Übungsschüsse" />
+    <Word from="Ubungsschusse" to="Übungsschüsse" />
+    <Word from="Ub€f'pf'Uf€l'1" to="überprüfen" />
+    <Word from="Uher" to="Über" />
+    <Word from="ultrakiistlichl" to="ultraköstlich!" />
+    <Word from="umgeriistet" to="umgerüstet" />
+    <Word from="umgénglich" to="umgänglich" />
+    <Word from="umhdren" to="umhören" />
+    <Word from="umhéngt" to="umhängt" />
+    <Word from="Umschlfigen" to="Umschlägen" />
+    <Word from="umschlieBt" to="umschließt" />
+    <Word from="Umstéinden" to="Umständen" />
+    <Word from="Umsténde" to="Umstände" />
+    <Word from="Umsténden" to="Umständen" />
+    <Word from="umsténdlich" to="umständlich" />
+    <Word from="umweltschédlich" to="umweltschädlich" />
+    <Word from="unabhiingiges" to="unabhängiges" />
+    <Word from="unabhéingig" to="unabhängig" />
+    <Word from="unabhéngig" to="unabhängig" />
+    <Word from="unabléssig" to="unablässig" />
+    <Word from="Unauffélligeres" to="Unauffälligeres" />
+    <Word from="unaufhalfsam" to="unaufhaltsam" />
+    <Word from="unaufhiirlich" to="unaufhörlich" />
+    <Word from="unaufhérlich" to="unaufhörlich" />
+    <Word from="unaufiéllig" to="unauffällig" />
+    <Word from="unberijhrbar" to="unberührbar" />
+    <Word from="unberllihrten" to="unberührten" />
+    <Word from="unbeschédigt" to="unbeschädigt" />
+    <Word from="Uncl" to="Und" />
+    <Word from="undja" to="und ja" />
+    <Word from="undjeder" to="und jeder" />
+    <Word from="undjemand" to="und jemand" />
+    <Word from="undjetzt" to="und jetzt" />
+    <Word from="undlassenihn" to="und lassen ihn" />
+    <Word from="undlhnen" to="und Ihnen" />
+    <Word from="undurchfuhrbar" to="undurchführbar" />
+    <Word from="uneingeschrénkten" to="uneingeschränkten" />
+    <Word from="unergrilndliche" to="unergründliche" />
+    <Word from="unerhort" to="unerhört" />
+    <Word from="unerhorte" to="unerhörte" />
+    <Word from="unerklérliche" to="unerklärliche" />
+    <Word from="unerklérlichen" to="unerklärlichen" />
+    <Word from="unertréglich" to="unerträglich" />
+    <Word from="unf'a'hig" to="unfähig" />
+    <Word from="Unfahigkeit" to="Unfähigkeit" />
+    <Word from="unfersfellen" to="unterstellen" />
+    <Word from="unfiirmigen" to="unförmigen" />
+    <Word from="unféhig" to="unfähig" />
+    <Word from="unféhigste" to="unfähigste" />
+    <Word from="unféihigste" to="unfähigste" />
+    <Word from="Unféille" to="Unfälle" />
+    <Word from="Unfélle" to="Unfälle" />
+    <Word from="ungeféhr" to="ungefähr" />
+    <Word from="ungeféhre" to="ungefähre" />
+    <Word from="Ungeféihr" to="Ungefähr" />
+    <Word from="ungeféihrlich" to="ungefährlich" />
+    <Word from="ungemutlich" to="ungemütlich" />
+    <Word from="ungenugend" to="ungenügend" />
+    <Word from="ungestbrt" to="ungestört" />
+    <Word from="ungewfihnliche" to="ungewöhnliche" />
+    <Word from="Ungewfjhnliches" to="Ungewöhnliches" />
+    <Word from="ungewiihnlich" to="ungewöhnlich" />
+    <Word from="Ungewijhnliches" to="Ungewöhnliches" />
+    <Word from="ungewéhnlich" to="ungewöhnlich" />
+    <Word from="ungewéhnliche" to="ungewöhnliche" />
+    <Word from="ungewéhnlichste" to="ungewöhnlichste" />
+    <Word from="ungfinstigen" to="ungünstigen" />
+    <Word from="ungiiltig" to="ungültig" />
+    <Word from="ungilnstig" to="ungünstig" />
+    <Word from="Unglaubliohl" to="Unglaublich!" />
+    <Word from="unglaubwurdig" to="unglaubwürdig" />
+    <Word from="Unglfiubige" to="Ungläubige" />
+    <Word from="Ungliicklicherweise" to="Unglücklicherweise" />
+    <Word from="Unglilck" to="Unglück" />
+    <Word from="Ungll'Jcklichervveise" to="Unglücklicherweise" />
+    <Word from="Unglllick" to="Unglück" />
+    <Word from="unglllicklich" to="unglücklich" />
+    <Word from="ungllllckliche" to="unglückliche" />
+    <Word from="unglucklich" to="unglücklich" />
+    <Word from="Ungléubiger" to="Ungläubiger" />
+    <Word from="ungultig" to="ungültig" />
+    <Word from="ungunstigen" to="ungünstigen" />
+    <Word from="unheimlichl" to="unheimlich!" />
+    <Word from="UNHORBARES" to="UNHÖRBARES" />
+    <Word from="unhéflich" to="unhöflich" />
+    <Word from="Universitlt" to="Universität" />
+    <Word from="Universitét" to="Universität" />
+    <Word from="unlfisbare" to="unlösbare" />
+    <Word from="unm6glich" to="unmöglich" />
+    <Word from="unmfiglich" to="unmöglich" />
+    <Word from="Unmiiglich" to="Unmöglich" />
+    <Word from="Unmiigliche" to="Unmögliche" />
+    <Word from="unmijglich" to="unmöglich" />
+    <Word from="unmissversténdlich" to="unmissverständlich" />
+    <Word from="unmoglich" to="unmöglich" />
+    <Word from="Unmtioglich" to="Unmöglich" />
+    <Word from="Unméglich" to="Unmöglich" />
+    <Word from="unméglioh" to="unmöglich" />
+    <Word from="unnatiirliche" to="unnatürliche" />
+    <Word from="unnaturliche" to="unnatürliche" />
+    <Word from="unnfitigen" to="unnötigen" />
+    <Word from="unniitig" to="unnötig" />
+    <Word from="unnllitz" to="unnütz" />
+    <Word from="unnétig" to="unnötig" />
+    <Word from="unnétigen" to="unnötigen" />
+    <Word from="unol" to="und" />
+    <Word from="unpésslich" to="unpässlich" />
+    <Word from="UNREGELMASSIG" to="UNREGELMÄSSIG" />
+    <Word from="Unregelméfiigkeiten" to="Unregelmäßigkeiten" />
+    <Word from="unschliissig" to="unschlüssig" />
+    <Word from="unserejungen" to="unsere jungen" />
+    <Word from="unsererAnwélte" to="unserer Anwälte" />
+    <Word from="unsererjungfréulichen" to="unserer jungfräulichen" />
+    <Word from="unsjede" to="uns jede" />
+    <Word from="unséglich" to="unsäglich" />
+    <Word from="Untenuelt" to="Unterwelt" />
+    <Word from="unterdriickten" to="unterdrückten" />
+    <Word from="Unterdrilckung" to="Ünterdrückung" />
+    <Word from="unterdrtlckte" to="unterdrückte" />
+    <Word from="Unterdrflckung" to="Unterdrückung" />
+    <Word from="Unterhaltskostenl" to="Unterhaltskosten!" />
+    <Word from="Unterhaltungsméfiig" to="Unterhaltungsmäßig" />
+    <Word from="unterhfilt" to="unterhält" />
+    <Word from="unterhélt" to="unterhält" />
+    <Word from="unterschitzt" to="unterschätzt" />
+    <Word from="unterschétzte" to="unterschätzte" />
+    <Word from="unterstiitzt" to="unterstützt" />
+    <Word from="Unterstiitzung" to="Unterstützung" />
+    <Word from="unterstijtzt" to="unterstützt" />
+    <Word from="Unterstiltzung" to="Unterstützung" />
+    <Word from="Unterstllitzung" to="Unterstützung" />
+    <Word from="unterstutzen" to="unterstützen" />
+    <Word from="unterstutzt" to="unterstützt" />
+    <Word from="Unterstutzten" to="Unterstützten" />
+    <Word from="Unterstutzung" to="Unterstützung" />
+    <Word from="Untersuchungsausschijsse" to="Untersuchungsausschüsse" />
+    <Word from="Unterwésche" to="Unterwäsche" />
+    <Word from="untréstlich" to="untröstlich" />
+    <Word from="Untétigkeit" to="Untätigkeit" />
+    <Word from="unumgénglich" to="unumgänglich" />
+    <Word from="unverméhlt" to="unvermählt" />
+    <Word from="Unverschfimtheitl" to="Unverschämtheit" />
+    <Word from="unverschémte" to="unverschämte" />
+    <Word from="Unverschémtheitl" to="Unverschämtheit" />
+    <Word from="UNVERSTANDLICH" to="UNVERSTÄNDLICH" />
+    <Word from="UNVERSTANDLICHE" to="UNVERSTÄNDLICHE" />
+    <Word from="UNVERSTANDLICHER" to="UNVERSTÄNDLICHER" />
+    <Word from="UNVERSTANDLICHES" to="UNVERSTÄNDLICHES" />
+    <Word from="Unversténdliche" to="Unverständliche" />
+    <Word from="unversténdlichen" to="unverständlichen" />
+    <Word from="unversténdliches" to="unverständliches" />
+    <Word from="unverzlliglich" to="unverzüglich" />
+    <Word from="unveréndert" to="unverändert" />
+    <Word from="Unzerbrechliohen" to="Unzerbrechlichen" />
+    <Word from="unzurechnungsfahig" to="unzurechnungsfähig" />
+    <Word from="unzuverlassiger" to="unzuverlässiger" />
+    <Word from="Unzuverléssiger" to="Unzuverlässiger" />
+    <Word from="unzuverléssiges" to="unzuverlässiges" />
+    <Word from="unzéhlige" to="unzählige" />
+    <Word from="unzéhligen" to="unzähligen" />
+    <Word from="unzéihlige" to="unzählige" />
+    <Word from="Urgrofivaters" to="Urgroßvaters" />
+    <Word from="Urlaubsuberschreitung" to="Urlaubsüberschreitung" />
+    <Word from="Ursprijnglich" to="Ursprünglich" />
+    <Word from="ursprtmglich" to="ursprünglich" />
+    <Word from="Ursprunglich" to="Ursprünglich" />
+    <Word from="Ururgrofivater" to="Ururgroßvater" />
+    <Word from="v/el" to="viel" />
+    <Word from="v/er" to="vier" />
+    <Word from="v/erfe" to="vierte" />
+    <Word from="v/erfes" to="viertes" />
+    <Word from="V6gel" to="Vögel" />
+    <Word from="v6IIig" to="völlig" />
+    <Word from="V6lker" to="Völker" />
+    <Word from="V6llig" to="Völlig" />
+    <Word from="v6lllg" to="völlig" />
+    <Word from="vdllig" to="völlig" />
+    <Word from="Ve/Teidigungskréfte" to="Verteidigungskräfte" />
+    <Word from="Velzeih" to="Verzeih" />
+    <Word from="Velzeihung" to="Verzeihung" />
+    <Word from="velzichte" to="verzichte" />
+    <Word from="Ven/vandter" to="Verwandter" />
+    <Word from="ven/véhntl" to="verwöhnt!" />
+    <Word from="Ventilationsfiffnung" to="Ventilationsöffnung" />
+    <Word from="Ventilatorschéchte" to="Ventilatorschächte" />
+    <Word from="VERACHTLICH" to="VERÄCHTLICH" />
+    <Word from="verandert" to="verändert" />
+    <Word from="Verbiindeten" to="Verbündeten" />
+    <Word from="Verbilndeter" to="Verbündeter" />
+    <Word from="verbliidet" to="verblödet" />
+    <Word from="Verbliidung" to="Verblödung" />
+    <Word from="verbllirgen" to="verbürgen" />
+    <Word from="verbrachfe" to="verbrachte" />
+    <Word from="Verbrec/ver" to="Verbrecher" />
+    <Word from="Verbtmdeter" to="Verbündeter" />
+    <Word from="Verbundeten" to="Verbündeten" />
+    <Word from="Verbflnolete" to="Verbündete" />
+    <Word from="verdiichtigen" to="verdächtigen" />
+    <Word from="verdiinnt" to="verdünnt" />
+    <Word from="verdllistern" to="verdüstern" />
+    <Word from="verdrflckt" to="verdrückt" />
+    <Word from="verdunnt" to="verdünnt" />
+    <Word from="verdéchtig" to="verdächtig" />
+    <Word from="Verdéchtigen" to="Verdächtigen" />
+    <Word from="verdéchtiger" to="verdächtiger" />
+    <Word from="verffilgbares" to="verfügbares" />
+    <Word from="Verfiigung" to="Verfügung" />
+    <Word from="verfiihren" to="verführen" />
+    <Word from="verfiihrt" to="verführt" />
+    <Word from="verfiittem" to="verfüttern" />
+    <Word from="Verfijgung" to="Verfügung" />
+    <Word from="verfilgst" to="verfügst" />
+    <Word from="verfilgte" to="verfügte" />
+    <Word from="Verfilgung" to="Verfügung" />
+    <Word from="Verfilhrungskilnste" to="Verführungskünste" />
+    <Word from="verflligen" to="verfügen" />
+    <Word from="verfllihrt" to="verführt" />
+    <Word from="Verflllgung" to="Verfügung" />
+    <Word from="verfolgf" to="verfolgt" />
+    <Word from="verfolgtl" to="verfolgt!" />
+    <Word from="VERFUGBAR" to="VERFÜGBAR" />
+    <Word from="verfugt" to="verfügt" />
+    <Word from="vergafk" to="vergaß" />
+    <Word from="Vergniigen" to="Vergnügen" />
+    <Word from="Vergniigens" to="Vergnügens" />
+    <Word from="Vergniigungsausflug" to="Vergnügungsausflug" />
+    <Word from="Vergnijgen" to="Vergnügen" />
+    <Word from="Vergnilgen" to="Vergnügen" />
+    <Word from="Vergnlligen" to="Vergnügen" />
+    <Word from="Vergntigen" to="Vergnügen" />
+    <Word from="Vergnugen" to="Vergnügen" />
+    <Word from="vergnugt" to="vergnügt" />
+    <Word from="vergnugte" to="vergnügte" />
+    <Word from="Vergnugungsausflug" to="Vergnügungsausflug" />
+    <Word from="vergr6Bern" to="vergrößern" />
+    <Word from="vergréfiern" to="vergrößern" />
+    <Word from="Vergréfierung" to="Vergrößerung" />
+    <Word from="vergénglich" to="vergänglich" />
+    <Word from="verhiirt" to="verhört" />
+    <Word from="Verhiitung" to="Verhütung" />
+    <Word from="Verhor" to="Verhör" />
+    <Word from="verhort" to="verhört" />
+    <Word from="verhorten" to="verhörten" />
+    <Word from="verhéilt" to="verhält" />
+    <Word from="verhélt" to="verhält" />
+    <Word from="Verhéltnis" to="Verhältnis" />
+    <Word from="Verhéltnisse" to="Verhältnisse" />
+    <Word from="verhéltst" to="verhältst" />
+    <Word from="veriindert" to="verändert" />
+    <Word from="Verinderungen" to="Veränderungen" />
+    <Word from="verkilnden" to="verkünden" />
+    <Word from="verkilndet" to="verkündet" />
+    <Word from="verkniipft" to="verknüpft" />
+    <Word from="verknUpf't" to="verknüpft" />
+    <Word from="verkunde" to="verkünde" />
+    <Word from="verkunden" to="verkünden" />
+    <Word from="verkundet" to="verkündet" />
+    <Word from="VERKUNDIGUNG" to="VERKÜNDIGUNG" />
+    <Word from="Verkéufer" to="Verkäufer" />
+    <Word from="verletztl" to="verletzt!" />
+    <Word from="verlieB" to="verließ" />
+    <Word from="verlielien" to="verließen" />
+    <Word from="verlorenl" to="verloren!" />
+    <Word from="verléingert" to="verlängert" />
+    <Word from="Verléingerungskabel" to="Verlängerungskabel" />
+    <Word from="verléisst" to="verlässt" />
+    <Word from="verlésst" to="verlässt" />
+    <Word from="verléuft" to="verläuft" />
+    <Word from="verm'aihlen" to="vermählen" />
+    <Word from="verm/ssf" to="vermisst" />
+    <Word from="vermiibelt" to="vermöbelt" />
+    <Word from="Vermiigt" to="Vermögt" />
+    <Word from="Vermégen" to="Vermögen" />
+    <Word from="verméhle" to="vermähle" />
+    <Word from="verméhlen" to="vermählen" />
+    <Word from="verméhlt" to="vermählt" />
+    <Word from="Verméihlung" to="Vermählung" />
+    <Word from="vernachléssigt" to="vernachlässigt" />
+    <Word from="Vernachléssigung" to="Vernachlässigung" />
+    <Word from="vernfinftig" to="vernünftig" />
+    <Word from="vernfinftige" to="vernünftige" />
+    <Word from="vernilnftig" to="vernünftig" />
+    <Word from="vernllmftigsten" to="vernünftigsten" />
+    <Word from="verntmftige" to="vernünftige" />
+    <Word from="vernunftig" to="vernünftig" />
+    <Word from="vernunftigsten" to="vernünftigsten" />
+    <Word from="vernflnftig" to="vernünftig" />
+    <Word from="verpaßt" to="verpasst" />
+    <Word from="verpesfefe" to="verpestete" />
+    <Word from="verprilgle" to="verprügle" />
+    <Word from="verprugeln" to="verprügeln" />
+    <Word from="Verpflichtungen" to="Verpflichtungen" />
+    <Word from="verrat" to="verrät" />
+    <Word from="verrfickter" to="verrückter" />
+    <Word from="verriickt" to="verrückt" />
+    <Word from="Verriickte" to="Verrückte" />
+    <Word from="Verriickten" to="Verrückten" />
+    <Word from="Verriickter" to="Verrückter" />
+    <Word from="verriicktes" to="verrücktes" />
+    <Word from="verrijckt" to="verrückt" />
+    <Word from="verrijckte" to="verrückte" />
+    <Word from="verrilckt" to="verrückt" />
+    <Word from="Verrilckte" to="Verrückte" />
+    <Word from="Verrilckter" to="Verrückter" />
+    <Word from="Verrilcktes" to="Verrücktes" />
+    <Word from="verrL'lckt" to="verrückt" />
+    <Word from="verrljckt" to="verrückt" />
+    <Word from="verrllickt" to="verrückt" />
+    <Word from="Verrllickte" to="Verrückte" />
+    <Word from="Verrllickter" to="Verrückter" />
+    <Word from="verrlllckte" to="verrückte" />
+    <Word from="verrtickt" to="verrückt" />
+    <Word from="verrUckt" to="verrückt" />
+    <Word from="Verruckte" to="Verrückte" />
+    <Word from="verruckten" to="verrückten" />
+    <Word from="Verruckter" to="Verrückter" />
+    <Word from="Verréiter" to="Verräter" />
+    <Word from="verréitst" to="verräitst" />
+    <Word from="verrét" to="verrät" />
+    <Word from="Verréter" to="Verräter" />
+    <Word from="Verréterin" to="Verräterin" />
+    <Word from="verréterisch" to="verräterisch" />
+    <Word from="verréterischen" to="verräterischen" />
+    <Word from="verrflckt" to="verrückt" />
+    <Word from="versaumt" to="versäumt" />
+    <Word from="Verscheifier" to="Verscheißer" />
+    <Word from="verschiichtert" to="verschüchtert" />
+    <Word from="verschiitten" to="verschütten" />
+    <Word from="verschlucktl" to="verschluckt!" />
+    <Word from="VERSCHLUSSELN" to="VERSCHLÜSSELN" />
+    <Word from="VERSCHLUSSELT" to="VERSCHLÜSSELT" />
+    <Word from="Verschlusselung" to="Verschlüsselung" />
+    <Word from="Verschnauferst" to="Verschnauf erst" />
+    <Word from="Verschwdrung" to="Verschwörung" />
+    <Word from="verschweilit" to="verschweißt" />
+    <Word from="Verschwiirer" to="Verschwörer" />
+    <Word from="verschwiirerisch" to="verschwörerisch" />
+    <Word from="Verschwiirern" to="Verschwörern" />
+    <Word from="Verschwiirung" to="Verschwörung" />
+    <Word from="Verschwiirungen" to="Verschwörungen" />
+    <Word from="Verschwérer" to="Verschwörer" />
+    <Word from="Verschwérung" to="Verschwörung" />
+    <Word from="Verschwérungstheoretiker" to="Verschwörungstheoretiker" />
+    <Word from="verschérft" to="verschärft" />
+    <Word from="versfanden" to="verstanden" />
+    <Word from="Versfehen" to="Verstehen" />
+    <Word from="versiihnlich" to="versöhnlich" />
+    <Word from="Versiihnung" to="Versöhnung" />
+    <Word from="verslumte" to="versäumte" />
+    <Word from="Verspfitung" to="Verspätung" />
+    <Word from="verspiire" to="verspüre" />
+    <Word from="verspilre" to="verspüre" />
+    <Word from="verspiten" to="verspäten" />
+    <Word from="versprijht" to="versprüht" />
+    <Word from="verst0I3en" to="verstoßen" />
+    <Word from="verst6Bt" to="verstößt" />
+    <Word from="Verst6ISt" to="Verstößt" />
+    <Word from="verst6l3t" to="verstößt" />
+    <Word from="verstehejetzt" to="verstehe jetzt" />
+    <Word from="Verstiindnis" to="Verständnis" />
+    <Word from="verstiirkt" to="verstärkt" />
+    <Word from="Verstiirkung" to="Verstärkung" />
+    <Word from="verstilmmelst" to="verstümmelst" />
+    <Word from="verstoBen" to="Verstoßen" />
+    <Word from="verstofken" to="verstoßen" />
+    <Word from="verstolien" to="verstoßen" />
+    <Word from="verstummelt" to="verstümmelt" />
+    <Word from="verstunde" to="verstünde" />
+    <Word from="verstundest" to="verstündest" />
+    <Word from="verstéfkt" to="verstößt" />
+    <Word from="verstéindlich" to="verständlich" />
+    <Word from="Verstéirkung" to="Verstärkung" />
+    <Word from="Versténdigen" to="Verständigen" />
+    <Word from="Versténdigt" to="Verständigt" />
+    <Word from="versténdlich" to="verständlich" />
+    <Word from="Versténdnis" to="Verständnis" />
+    <Word from="verstérken" to="verstärken" />
+    <Word from="verstérkt" to="verstärkt" />
+    <Word from="verstérkte" to="verstärkte" />
+    <Word from="verstérkter" to="verstärkter" />
+    <Word from="Verstérkung" to="Verstärkung" />
+    <Word from="verstért" to="verstört" />
+    <Word from="verséhnen" to="versöhnen" />
+    <Word from="verséhnt" to="versöhnt" />
+    <Word from="verséumen" to="versäumen" />
+    <Word from="verséumt" to="versäumt" />
+    <Word from="VERTRAGSLANGE" to="VERTRAGSLÄNGE" />
+    <Word from="vertrauenswiirdig" to="vertrauenswürdig" />
+    <Word from="vertrauenswtlrdig" to="vertrauenswürdig" />
+    <Word from="vertrauenswtlrdigen" to="vertrauenswürdigen" />
+    <Word from="vertréumte" to="verträumte" />
+    <Word from="vervvanzt" to="verwanzt" />
+    <Word from="verwiistete" to="verwüstete" />
+    <Word from="verwllisten" to="verwüsten" />
+    <Word from="verwustet" to="verwüstet" />
+    <Word from="verwéhnten" to="verwöhnten" />
+    <Word from="verwéihnen" to="verwöhnen" />
+    <Word from="verwéssert" to="verwässert" />
+    <Word from="verzégere" to="verzögere" />
+    <Word from="Verzégerte" to="Verzögerte" />
+    <Word from="Verzégerung" to="Verzögerung" />
+    <Word from="veréffentliche" to="veröffentliche" />
+    <Word from="veréffentlichen" to="veröffentlichen" />
+    <Word from="veréffentlicht" to="veröffentlicht" />
+    <Word from="veréindert" to="verändert" />
+    <Word from="Veréinderung" to="Veränderung" />
+    <Word from="veréndern" to="verändern" />
+    <Word from="veréndert" to="verändert" />
+    <Word from="verénderte" to="veränderte" />
+    <Word from="verénderten" to="veränderten" />
+    <Word from="Verénderung" to="Veränderung" />
+    <Word from="Verénderungen" to="Veränderungen" />
+    <Word from="veréngstigtes" to="verängstigtes" />
+    <Word from="veréppelt" to="veräppelt" />
+    <Word from="verérgert" to="verärgert" />
+    <Word from="vewvendet" to="verwendet" />
+    <Word from="vfillig" to="völlig" />
+    <Word from="VGFKUFZGH" to="verkürzen" />
+    <Word from="VI/illkommen" to="Willkommen" />
+    <Word from="VI/itwicky" to="Witwicky" />
+    <Word from="vial" to="viel" />
+    <Word from="Videoiiben/vachung" to="Videoüberwachung" />
+    <Word from="Vie/e" to="Viele" />
+    <Word from="Vielfrafi" to="Vielfraß" />
+    <Word from="vielféltig" to="vielfältig" />
+    <Word from="Vielleichtja" to="Vielleicht ja" />
+    <Word from="vielversprechend" to="viel versprechend" />
+    <Word from="Vieraugengespréch" to="Vieraugengespräch" />
+    <Word from="vieriunge" to="vier junge" />
+    <Word from="vierjéhriges" to="vierjähriges" />
+    <Word from="vierképfige" to="vierköpfige" />
+    <Word from="Viigel" to="Vögel" />
+    <Word from="viillig" to="völlig" />
+    <Word from="viilliges" to="völliges" />
+    <Word from="Viterchen" to="Väterchen" />
+    <Word from="Vizepréisident" to="Vizepräsident" />
+    <Word from="vlel" to="viel" />
+    <Word from="Vlellelcht" to="Vielleicht" />
+    <Word from="Vogelscheifke" to="Vogelscheiße" />
+    <Word from="Vogelscheilie" to="Vogelscheiße" />
+    <Word from="Volksmérchen" to="Volksmärchen" />
+    <Word from="vollerjeder" to="voller jeder" />
+    <Word from="vollmachen" to="voll machen" />
+    <Word from="vollsténdig" to="vollständig" />
+    <Word from="vollsténdige" to="vollständige" />
+    <Word from="Volltrefferl" to="Volltreffer!" />
+    <Word from="vollzéhlig" to="vollzählig" />
+    <Word from="Volumenl" to="Volumen!" />
+    <Word from="von/vagten" to="vorwagten" />
+    <Word from="von/véirts" to="vorwärts" />
+    <Word from="vonn6ten" to="vonnöten" />
+    <Word from="Vonnéirts" to="Vorwärts" />
+    <Word from="Vordertiir" to="Vordertür" />
+    <Word from="Vorderturl" to="Vordertür!" />
+    <Word from="vordréngelnl" to="vordrängeln!" />
+    <Word from="vorfibergehend" to="vorübergehend" />
+    <Word from="Vorfuhrungen" to="Vorführungen" />
+    <Word from="vorgefflhrt" to="vorgeführt" />
+    <Word from="Vorgiinge" to="Vorgänge" />
+    <Word from="Vorgénger" to="Vorgänger" />
+    <Word from="Vorgéngern" to="Vorgängern" />
+    <Word from="Vorhénge" to="Vorhänge" />
+    <Word from="vorijbergehend" to="vorübergehend" />
+    <Word from="vorilber" to="vorüber" />
+    <Word from="vorilbergehende" to="vorübergehende" />
+    <Word from="vorkniipfen" to="vorknöpfen" />
+    <Word from="Vorléufer" to="Vorläufer" />
+    <Word from="Vorléufig" to="Vorläufig" />
+    <Word from="Vorraus" to="Voraus" />
+    <Word from="Vorschlége" to="Vorschläge" />
+    <Word from="vorschriftsméfiig" to="vorschriftsmäßig" />
+    <Word from="vorschriftsméiliig" to="vorschriftsmäßig" />
+    <Word from="Vorsichtsmaflnahme" to="Vorsichtsmaßnahme" />
+    <Word from="Vorstellungsgespréch" to="Vorstellungsgespräch" />
+    <Word from="Vorstellungsgespréche" to="Vorstellungsgespräche" />
+    <Word from="Vorstof$" to="Vorstoß" />
+    <Word from="Vortlbergehende" to="Vorübergehende" />
+    <Word from="vortéuschen" to="vortäuschen" />
+    <Word from="vorubergehend" to="vorübergehend" />
+    <Word from="vorvvérts" to="vorwärts" />
+    <Word from="Vorwfirts" to="Vorwärts" />
+    <Word from="vorwérts" to="vorwärts" />
+    <Word from="vorzfiglichl" to="vorzüglich!" />
+    <Word from="vorflber" to="vorüber" />
+    <Word from="Vorflbergehend" to="Vorübergehend" />
+    <Word from="VVACHMANN" to="WACHMANN" />
+    <Word from="Vvaffen" to="Waffen" />
+    <Word from="Vvagen" to="Wagen" />
+    <Word from="VVarte" to="Warte" />
+    <Word from="VVeif3&gt;t" to="Weißt" />
+    <Word from="VVeil'2&gt;t" to="Weißt" />
+    <Word from="VVir" to="Wir" />
+    <Word from="VVM" to="WM" />
+    <Word from="v\/as" to="was" />
+    <Word from="V\/e" to="We" />
+    <Word from="Végel" to="Vögel" />
+    <Word from="végeln" to="vögeln" />
+    <Word from="végelt" to="vögelt" />
+    <Word from="véllig" to="völlig" />
+    <Word from="w/'r" to="wir" />
+    <Word from="W/e" to="Wie" />
+    <Word from="w/eder" to="wieder" />
+    <Word from="W/nkel" to="Winkel" />
+    <Word from="w/r" to="wir" />
+    <Word from="w/rd" to="wird" />
+    <Word from="w/rkl/ch" to="wirklich" />
+    <Word from="W0" to="Wo" />
+    <Word from="w5r" to="wär" />
+    <Word from="w5r's" to="wär's" />
+    <Word from="W6lfe" to="Wölfe" />
+    <Word from="W6lfen" to="Wölfen" />
+    <Word from="W99" to="Weg" />
+    <Word from="Waffenschrénke" to="Waffenschränke" />
+    <Word from="wafs" to="wär's" />
+    <Word from="wahrend" to="während" />
+    <Word from="WAHRENDDESSEN" to="WÄHRENDDESSEN" />
+    <Word from="Wahrheitl" to="Wahrheit!" />
+    <Word from="wail" to="weil" />
+    <Word from="Walbl" to="Walöl" />
+    <Word from="Walsinghaml" to="Walsingham!" />
+    <Word from="wankelmiltig" to="wankelmütig" />
+    <Word from="ware" to="wäre" />
+    <Word from="WAREST" to="WÄREST" />
+    <Word from="Warfe" to="Warte" />
+    <Word from="warja" to="war ja" />
+    <Word from="Waschbrettbéuche" to="Waschbrettbäuche" />
+    <Word from="Waschbéir" to="Waschbär" />
+    <Word from="Waschbéiren" to="Waschbären" />
+    <Word from="Wasseranschlljssen" to="Wasseranschlüssen" />
+    <Word from="Watteknéuel" to="Watteknäuel" />
+    <Word from="Wattestébchen" to="Wattestäbchen" />
+    <Word from="we're" to="wäre" />
+    <Word from="We'ro" to="We're" />
+    <Word from="we/B" to="weiß" />
+    <Word from="We/Bf" to="Weißt" />
+    <Word from="we/fere" to="weitere" />
+    <Word from="Wechsell" to="Wechsel!" />
+    <Word from="weggebfirstet" to="weggebürstet" />
+    <Word from="weggespllllt" to="weggespült" />
+    <Word from="weggesplllltl" to="weggespült!" />
+    <Word from="weggespfllt" to="weggespült" />
+    <Word from="wegl" to="weg!" />
+    <Word from="wegreiflsen" to="wegreißen" />
+    <Word from="wegschieBen" to="wegschießen" />
+    <Word from="Wegtratan" to="Wegtreten" />
+    <Word from="wegzuwefien" to="wegzuwerfen" />
+    <Word from="wei/3" to="weiß" />
+    <Word from="WeiB" to="Weiß" />
+    <Word from="weiBe" to="weiße" />
+    <Word from="weiBen" to="weißen" />
+    <Word from="weiBer" to="weißer" />
+    <Word from="weiBes" to="weißes" />
+    <Word from="WeiBfresse" to="Weißfresse" />
+    <Word from="weiBt" to="weißt" />
+    <Word from="Weif$" to="Weiß" />
+    <Word from="Weif$t" to="Weißt" />
+    <Word from="weif2&gt;" to="weiß" />
+    <Word from="weif3" to="weiß" />
+    <Word from="weif3&gt;" to="weiß" />
+    <Word from="Weif3t" to="Weißt" />
+    <Word from="weif5" to="weiß" />
+    <Word from="Weifbe" to="Weiße" />
+    <Word from="weifbt" to="weißt" />
+    <Word from="Weifi" to="Weiß" />
+    <Word from="Weifie" to="Weiße" />
+    <Word from="weifies" to="weißes" />
+    <Word from="Weifist" to="Weißt" />
+    <Word from="Weifit" to="Weißt" />
+    <Word from="weifk" to="weiß" />
+    <Word from="weifken" to="weißen" />
+    <Word from="Weifker" to="Weißer" />
+    <Word from="weifkes" to="weißes" />
+    <Word from="weifkt" to="weißt" />
+    <Word from="weifL" to="weiß" />
+    <Word from="weifLt" to="weißt" />
+    <Word from="weifl»" to="weiß" />
+    <Word from="weifS" to="weiß" />
+    <Word from="WeifSt" to="Weißt" />
+    <Word from="weifZ&gt;" to="weiß" />
+    <Word from="WeifZ&gt;t" to="Weißt" />
+    <Word from="weifét" to="weißt" />
+    <Word from="Weihnachtseinkéufe" to="Weihnachtseinkäufe" />
+    <Word from="Weihnachtsménner" to="Weihnachtsmänner" />
+    <Word from="weil'5" to="weiß" />
+    <Word from="weil'5t" to="weißt" />
+    <Word from="weil3" to="weiß" />
+    <Word from="Weil3t" to="Weißt" />
+    <Word from="weil5" to="weiß" />
+    <Word from="Weil5t" to="Weißt" />
+    <Word from="weili" to="weiß" />
+    <Word from="weilit" to="weißt" />
+    <Word from="weilke" to="weiße" />
+    <Word from="Weill" to="Weiß" />
+    <Word from="weills" to="weiß" />
+    <Word from="weillst" to="weißt" />
+    <Word from="weillt" to="weisst" />
+    <Word from="weilS" to="weiß" />
+    <Word from="weilSe" to="weiße" />
+    <Word from="WeilSglut" to="Weißglut" />
+    <Word from="weilZ&gt;" to="weiß" />
+    <Word from="weilZ~" to="weiß" />
+    <Word from="weiss" to="weiß" />
+    <Word from="weissen" to="weißen" />
+    <Word from="weisst" to="weißt" />
+    <Word from="weiterhiipfen" to="weiterhüpfen" />
+    <Word from="Weiterpessen" to="Weiterpressen" />
+    <Word from="weitléufige" to="weitläufige" />
+    <Word from="weitweg" to="weit weg" />
+    <Word from="WelBt" to="Weißt" />
+    <Word from="well" to="weil" />
+    <Word from="Well" to="Welt" />
+    <Word from="Wellit" to="Weißt" />
+    <Word from="welllt" to="weißt" />
+    <Word from="welt" to="weit" />
+    <Word from="WELTBEVOLKERUNG" to="WELTBEVÖLKERUNG" />
+    <Word from="Welflt" to="Weißt" />
+    <Word from="Werdja" to="Werd ja" />
+    <Word from="Werkstétten" to="Werkstätten" />
+    <Word from="Werkzeuggflrtel" to="Werkzeuggürtel" />
+    <Word from="wertschfitzen" to="wertschätzen" />
+    <Word from="Westflilgel" to="Westflügel" />
+    <Word from="Westkilste" to="Westküste" />
+    <Word from="Wettkémpfe" to="Wettkämpfe" />
+    <Word from="Wettkémpfen" to="Wettkämpfen" />
+    <Word from="Wettkémpfer" to="Wettkämpfer" />
+    <Word from="Wfinsche" to="Wünsche" />
+    <Word from="wfinschen" to="wünschen" />
+    <Word from="Wfird" to="Würd" />
+    <Word from="wfirde" to="würde" />
+    <Word from="Wfirden" to="Würden" />
+    <Word from="wfirdest" to="würdest" />
+    <Word from="wfire" to="wäre" />
+    <Word from="Wfirme" to="Wärme" />
+    <Word from="Wfisste" to="Wüsste" />
+    <Word from="wfitete" to="wütete" />
+    <Word from="wfssen" to="wissen" />
+    <Word from="Widen/vértig" to="Widerwärtig" />
+    <Word from="widerf'a'hrt" to="widerfährt" />
+    <Word from="widerspriichliche" to="widersprüchliche" />
+    <Word from="Widerwéirtig" to="Widerwärtig" />
+    <Word from="wiedergewéihltl" to="wiedergewählt" />
+    <Word from="wiederhaben" to="wieder haben" />
+    <Word from="wiederhaben" to="wieder-haben" />
+    <Word from="Wiederhéren" to="Wiederhören" />
+    <Word from="Wieheifiternoch" to="Wieheißternoch" />
+    <Word from="Wieheiliternoch" to="Wieheißternoch" />
+    <Word from="wihlerisch" to="wählerisch" />
+    <Word from="wihlerlsch" to="wählerisch" />
+    <Word from="wiihlen" to="wühlen" />
+    <Word from="wiihlte" to="wählte" />
+    <Word from="wiihrend" to="während" />
+    <Word from="wiilrdest" to="würdest" />
+    <Word from="Wiinde" to="Wände" />
+    <Word from="wiinsch" to="wünsch" />
+    <Word from="Wiinsche" to="Wünsche" />
+    <Word from="Wiinschen" to="Wünschen" />
+    <Word from="wiinschst" to="wünschst" />
+    <Word from="wiinscht" to="wünscht" />
+    <Word from="wiinschte" to="wünschte" />
+    <Word from="wiirde" to="würde" />
+    <Word from="Wiirden" to="Würden" />
+    <Word from="Wiirdest" to="Würdest" />
+    <Word from="wiirdet" to="würdet" />
+    <Word from="wiirdigst" to="würdigst" />
+    <Word from="Wiire" to="Wäre" />
+    <Word from="wiiren" to="wären" />
+    <Word from="Wiirfel" to="Würfel" />
+    <Word from="wiirfeln" to="würfeln" />
+    <Word from="Wiirfels" to="Würfels" />
+    <Word from="wiirs" to="wär's" />
+    <Word from="Wiirstchen" to="Würstchen" />
+    <Word from="wiischt" to="wäscht" />
+    <Word from="Wiisste" to="Wüsste" />
+    <Word from="wiissten" to="wüssten" />
+    <Word from="wiisstest" to="wüsstest" />
+    <Word from="Wiiste" to="Wüste" />
+    <Word from="wiitenden" to="wütenden" />
+    <Word from="wijnsche" to="wünsche" />
+    <Word from="wijnschen" to="wünschen" />
+    <Word from="wijnschte" to="wünschte" />
+    <Word from="wijrd" to="würd" />
+    <Word from="wijrde" to="würde" />
+    <Word from="wijrden" to="würden" />
+    <Word from="wijrdest" to="würdest" />
+    <Word from="wijrdiger" to="würdiger" />
+    <Word from="Wijrg" to="Würg" />
+    <Word from="wijsste" to="wüsste" />
+    <Word from="wijtend" to="wütend" />
+    <Word from="wildl" to="wild!" />
+    <Word from="wilnsch" to="wünsch" />
+    <Word from="wilnsche" to="wünsche" />
+    <Word from="wilnschen" to="wünschen" />
+    <Word from="wilnscht" to="wünscht" />
+    <Word from="wilnschte" to="wünschte" />
+    <Word from="wilrd" to="würd" />
+    <Word from="Wilrde" to="Würde" />
+    <Word from="Wilrden" to="Würden" />
+    <Word from="Wilrdest" to="Würdest" />
+    <Word from="wilrdig" to="würdig" />
+    <Word from="Wilrfel" to="Würfel" />
+    <Word from="Wilrfelenergie" to="Würfelenergie" />
+    <Word from="wilsste" to="wüsste" />
+    <Word from="wilssten" to="wüssten" />
+    <Word from="Wilstling" to="Wüstling" />
+    <Word from="wiltend" to="wütend" />
+    <Word from="Windelhundl" to="Windelhund!" />
+    <Word from="Windhundkérper" to="Windhundkörper" />
+    <Word from="winner" to="wärmer" />
+    <Word from="Wire" to="Wäre" />
+    <Word from="wires" to="wir es" />
+    <Word from="Wirfangen" to="Wir fangen" />
+    <Word from="wirja" to="wir ja" />
+    <Word from="wirje" to="wir je" />
+    <Word from="wirjede" to="wir jede" />
+    <Word from="wirjeden" to="wir jeden" />
+    <Word from="wirjetzt" to="wir jetzt" />
+    <Word from="Wirnisse" to="Wirrnisse" />
+    <Word from="Wirsind" to="Wir sind" />
+    <Word from="wirtragen" to="wir tragen" />
+    <Word from="Wirtschaftspriifer" to="Wirtschaftsprüfer" />
+    <Word from="Wirverfolgen" to="Wir verfolgen" />
+    <Word from="wirvom" to="wir vom" />
+    <Word from="Wirwaren" to="Wir waren" />
+    <Word from="Wirwarten" to="Wir warten" />
+    <Word from="Wirwerden" to="Wir werden" />
+    <Word from="Wirwissen" to="Wir wissen" />
+    <Word from="Wirwollen" to="Wir wollen" />
+    <Word from="Wirwollten" to="Wir wollten" />
+    <Word from="Wirzeigten" to="Wir zeigten" />
+    <Word from="wirzu" to="wir zu" />
+    <Word from="Witzl" to="Witz!" />
+    <Word from="WKHRENDDESSEN" to="WÄHRENDDESSEN" />
+    <Word from="wL'lrden" to="würden" />
+    <Word from="wle" to="wie" />
+    <Word from="Wleso" to="Wieso" />
+    <Word from="Wlhlen" to="Wählen" />
+    <Word from="wllinsch" to="wünsch" />
+    <Word from="wllinschst" to="wünschst" />
+    <Word from="wllinscht" to="wünscht" />
+    <Word from="wllirde" to="würde" />
+    <Word from="wllirden" to="würden" />
+    <Word from="wllirdest" to="würdest" />
+    <Word from="wllirdet" to="würdet" />
+    <Word from="Wllirgegriff" to="Würgegriff" />
+    <Word from="wllirgen" to="würgen" />
+    <Word from="wllisste" to="wüsste" />
+    <Word from="wlr" to="wir" />
+    <Word from="wlrd" to="wird" />
+    <Word from="wlrkllch" to="wirklich" />
+    <Word from="Wlrkllchkelt" to="Wirklichkeit" />
+    <Word from="wlrst" to="wirst" />
+    <Word from="Wlrwarten" to="Wir warten" />
+    <Word from="wlrwollen" to="wir wollen" />
+    <Word from="Wo/f" to="Wolf" />
+    <Word from="Wochenféhre" to="Wochenfähre" />
+    <Word from="woffir" to="wofür" />
+    <Word from="Wofiir" to="Wofür" />
+    <Word from="Wofijr" to="Wofür" />
+    <Word from="wofilr" to="wofür" />
+    <Word from="Wofur" to="Wofür" />
+    <Word from="WoherweiB" to="Woher weiß" />
+    <Word from="WoherweiBt" to="Woher weißt" />
+    <Word from="Woherweif$t" to="Woher weißt" />
+    <Word from="wohlfilhlen" to="wohlfühlen" />
+    <Word from="Wollknéuel" to="Wollknäuel" />
+    <Word from="womiiglich" to="womöglich" />
+    <Word from="woméglich" to="womöglich" />
+    <Word from="woméiglich" to="womöglich" />
+    <Word from="Worfiber" to="Worüber" />
+    <Word from="woriiber" to="worüber" />
+    <Word from="Worijber" to="Worüber" />
+    <Word from="Wortgeplénkel" to="Wortgeplänkel" />
+    <Word from="Woruber" to="Worüber" />
+    <Word from="wt/'rden" to="würden" />
+    <Word from="wtinsche" to="wünsche" />
+    <Word from="wtinschst" to="wünschst" />
+    <Word from="wtirde" to="würde" />
+    <Word from="Wtirdest" to="Würdest" />
+    <Word from="Wtirfel" to="Würfel" />
+    <Word from="Wtmschen" to="Wünschen" />
+    <Word from="WUl'd€" to="würde" />
+    <Word from="WUlfelbecher" to="Würfelbecher" />
+    <Word from="wullte" to="wusste" />
+    <Word from="Wundersch6n" to="Wunderschön" />
+    <Word from="wunderschfin" to="wunderschön" />
+    <Word from="Wunderschiin" to="Wunderschön" />
+    <Word from="wunderschiinen" to="wunderschönen" />
+    <Word from="wunderschén" to="wunderschön" />
+    <Word from="wunderschéne" to="wunderschöne" />
+    <Word from="Wunderschénel" to="Wunderschöne!" />
+    <Word from="wunderschénen" to="wunderschönen" />
+    <Word from="wunderschénes" to="wunderschönes" />
+    <Word from="wundersohén" to="wunderschön" />
+    <Word from="wunsche" to="wünsche" />
+    <Word from="Wunschen" to="Wünschen" />
+    <Word from="wunscht" to="wünscht" />
+    <Word from="wunschte" to="wünschte" />
+    <Word from="WUNSCHTE" to="WÜNSCHTE" />
+    <Word from="wurcle" to="wurde" />
+    <Word from="wUrde" to="würde" />
+    <Word from="Wurdige" to="Würdige" />
+    <Word from="WURGT" to="WÜRGT" />
+    <Word from="Wurmer" to="Würmer" />
+    <Word from="Wursfsfulle" to="Wurststulle" />
+    <Word from="Wuste" to="Wüste" />
+    <Word from="WUSTEN" to="WÜSTEN" />
+    <Word from="wutend" to="wütend" />
+    <Word from="wußte" to="wusste" />
+    <Word from="wußtest" to="wusstest" />
+    <Word from="w§r's" to="wär's" />
+    <Word from="w§re" to="wäre" />
+    <Word from="W§ren's" to="Wären's" />
+    <Word from="wé'hrend" to="während" />
+    <Word from="wéchst" to="wächst" />
+    <Word from="Wéchter" to="Wächter" />
+    <Word from="wéfs" to="wär's" />
+    <Word from="Wég" to="Weg" />
+    <Word from="wéhle" to="wähle" />
+    <Word from="wéhlejetzt" to="wähle jetzt" />
+    <Word from="wéhlen" to="wählen" />
+    <Word from="Wéhler" to="Wähler" />
+    <Word from="Wéhlern" to="Wählern" />
+    <Word from="wéhlt" to="wählt" />
+    <Word from="wéhlte" to="wählte" />
+    <Word from="wéhrend" to="während" />
+    <Word from="Wéhrung" to="Währung" />
+    <Word from="Wéichter" to="Wächter" />
+    <Word from="wéihlen" to="wählen" />
+    <Word from="wéihrend" to="während" />
+    <Word from="wéir" to="wär" />
+    <Word from="wéir's" to="wär's" />
+    <Word from="wéirde" to="würde" />
+    <Word from="Wéire" to="Wäre" />
+    <Word from="wéiren" to="wären" />
+    <Word from="wéirmen" to="wärmen" />
+    <Word from="wéirst" to="wärst" />
+    <Word from="Wélder" to="Wälder" />
+    <Word from="Wéldern" to="Wäldern" />
+    <Word from="Wélfen" to="Wölfen" />
+    <Word from="Wélkchen" to="Wölkchen" />
+    <Word from="Wénde" to="Wände" />
+    <Word from="Wénden" to="Wänden" />
+    <Word from="wér" to="wär" />
+    <Word from="wér's" to="wär's" />
+    <Word from="Wére" to="Wäre" />
+    <Word from="Wéren" to="Wären" />
+    <Word from="wéret" to="wäret" />
+    <Word from="wérja" to="wär ja" />
+    <Word from="Wérm" to="Wärm" />
+    <Word from="Wérme" to="Wärme" />
+    <Word from="wérmt" to="wärmt" />
+    <Word from="Wérst" to="Wärst" />
+    <Word from="wért" to="wärt" />
+    <Word from="Wérter" to="Wörter" />
+    <Word from="Wérterbuch" to="Wörterbuch" />
+    <Word from="wértliche" to="wörtliche" />
+    <Word from="Wésche" to="Wäsche" />
+    <Word from="Wéscheklammer" to="Wäscheklammer" />
+    <Word from="Wéschst" to="Wäschst" />
+    <Word from="wéscht" to="wäscht" />
+    <Word from="wflrde" to="würde" />
+    <Word from="wflrden" to="würden" />
+    <Word from="Wflrfel" to="Würfel" />
+    <Word from="z'a'h" to="zäh" />
+    <Word from="Z/egf" to="liegt" />
+    <Word from="Z/yarettenbäume" to="Zigarettenbäume" />
+    <Word from="Z05" to="los" />
+    <Word from="z6gel1e" to="zögerte" />
+    <Word from="z6gern" to="zögern" />
+    <Word from="zahlenméflig" to="zahlenmäßig" />
+    <Word from="zappelnl" to="zappeln!" />
+    <Word from="Zauberspruchen" to="Zaubersprüchen" />
+    <Word from="Zaubervoodookréfte" to="Zaubervoodookräfte" />
+    <Word from="Zauherpfippchen" to="Zauberpüppchen" />
+    <Word from="Zefietzende" to="Zerfetzende" />
+    <Word from="zeitgem5B" to="zeitgemäß" />
+    <Word from="Zeitgeméfle" to="Zeitgemäße" />
+    <Word from="Zeitgeniissische" to="Zeitgenössische" />
+    <Word from="zeitgeniissischen" to="zeitgenössischen" />
+    <Word from="Zellenschliissel" to="Zellenschlüssel" />
+    <Word from="zerbeif$en" to="zerbeißen" />
+    <Word from="zerbeif$t" to="zerbeißt" />
+    <Word from="zerféllt" to="zerfällt" />
+    <Word from="Zermatschgeréusch" to="Zermatschgeräusch" />
+    <Word from="zermflrben" to="zermürben" />
+    <Word from="zerreifien" to="zerreißen" />
+    <Word from="zerreilit" to="zerreißt" />
+    <Word from="zersfdren" to="zerstören" />
+    <Word from="zerst6rst" to="zerstörst" />
+    <Word from="zerst6rt" to="zerstört" />
+    <Word from="zerstdren" to="zerstören" />
+    <Word from="Zerstfiren" to="Zerstören" />
+    <Word from="Zerstfirer" to="Zerstörer" />
+    <Word from="Zerstfirungskraft" to="Zerstörungskraft" />
+    <Word from="Zerstiickelung" to="Zerstückelung" />
+    <Word from="zerstiire" to="zerstöre" />
+    <Word from="zerstiiren" to="zerstören" />
+    <Word from="Zerstiirer" to="Zerstörer" />
+    <Word from="zerstiirt" to="zerstört" />
+    <Word from="zerstiirten" to="zerstörten" />
+    <Word from="zerstiirtl" to="zerstört!" />
+    <Word from="Zerstiirungl" to="Zerstörung!" />
+    <Word from="zerstoren" to="zerstören" />
+    <Word from="zerstére" to="zerstöre" />
+    <Word from="zerstéren" to="zerstören" />
+    <Word from="Zerstérer" to="Zerstörer" />
+    <Word from="zerstért" to="zerstört" />
+    <Word from="Zerstérung" to="Zerstörung" />
+    <Word from="Zerstérungsfeldzug" to="Zerstörungsfeldzug" />
+    <Word from="zertrlllmmert" to="zertrümmert" />
+    <Word from="zfihlt" to="zählt" />
+    <Word from="Ziel160m" to="Ziel 160 m" />
+    <Word from="Zihnelt" to="ähnelt" />
+    <Word from="ziichtiger" to="züchtiger" />
+    <Word from="Ziige" to="Züge" />
+    <Word from="Ziindkapseln" to="Zündkapseln" />
+    <Word from="Zilnd" to="Zünd" />
+    <Word from="Zilnden" to="Zünden" />
+    <Word from="Zilndungsenergie" to="Zündungsenergie" />
+    <Word from="Zilrich" to="Zürich" />
+    <Word from="Zindern" to="ändern" />
+    <Word from="Zingstlich" to="ängstlich" />
+    <Word from="Ziufierst" to="äußerst" />
+    <Word from="zleht" to="zieht" />
+    <Word from="ZLIFUCK" to="zurück" />
+    <Word from="Zooschlieliung" to="Zooschließung" />
+    <Word from="Zuckerschnfltchen" to="Zuckerschnütchen" />
+    <Word from="zuerstvor" to="zuerst vor" />
+    <Word from="zuffillig" to="zufällig" />
+    <Word from="zuflligen" to="zufügen" />
+    <Word from="ZUFUCK" to="zurück" />
+    <Word from="Zuféillig" to="Zufällig" />
+    <Word from="Zuféilligerweise" to="Zufälligerweise" />
+    <Word from="zuféllig" to="zufällig" />
+    <Word from="Zufélligerweise" to="Zufälligerweise" />
+    <Word from="zug'a'nglichen" to="zugänglichen" />
+    <Word from="ZUGANGSPRIORITKT" to="ZUGANGSPRIORITÄT" />
+    <Word from="zugehdrt" to="zugehört" />
+    <Word from="zugehért" to="zugehört" />
+    <Word from="zugestofien" to="zugestoßen" />
+    <Word from="Zugesténdnis" to="Zugeständnis" />
+    <Word from="Zugesténdnisse" to="Zugeständnisse" />
+    <Word from="Zugiinge" to="Zugänge" />
+    <Word from="zuh6ren" to="zuhören" />
+    <Word from="zuh6rt" to="zuhört" />
+    <Word from="zuhiiren" to="zuhören" />
+    <Word from="zuhiirt" to="zuhört" />
+    <Word from="Zuhélter" to="Zuhälter" />
+    <Word from="Zuhéren" to="Zuhören" />
+    <Word from="Zuhérer" to="Zuhörer" />
+    <Word from="zukilnftiges" to="zukünftiges" />
+    <Word from="zul" to="zu!" />
+    <Word from="zundete" to="zündete" />
+    <Word from="Zundverteilerkappe" to="Zündverteilerkappe" />
+    <Word from="zunjick" to="zurück" />
+    <Word from="zunéchst" to="zunächst" />
+    <Word from="zunéhen" to="zunähen" />
+    <Word from="zunéihen" to="zunähen" />
+    <Word from="Zuokerschntltchen" to="Zuckerschnütchen" />
+    <Word from="zurfick" to="zurück" />
+    <Word from="zurfickblicken" to="zurückblicken" />
+    <Word from="zurfickgekommen" to="zurückgekommen" />
+    <Word from="zurfickgezogen" to="zurückgezogen" />
+    <Word from="zurfickkehren" to="zurückkehren" />
+    <Word from="zurfickzufuhren" to="zurückzuführen" />
+    <Word from="zuriick" to="zurück" />
+    <Word from="zuriickbleiben" to="zurückbleiben" />
+    <Word from="zuriickgeben" to="zurückgeben" />
+    <Word from="zuriickgehen" to="zurückgehen" />
+    <Word from="zuriickgekommen" to="zurückgekommen" />
+    <Word from="zuriickgezogen" to="zurückgezogen" />
+    <Word from="zuriickhaben" to="zurückhaben" />
+    <Word from="zuriickkehre" to="zurückkehre" />
+    <Word from="zuriickkehren" to="zurückkehren" />
+    <Word from="zuriickkehrst" to="zurückkehrst" />
+    <Word from="zuriickziehen" to="zurückziehen" />
+    <Word from="Zurijck" to="Zurück" />
+    <Word from="zurijckbringen" to="zurückbringen" />
+    <Word from="zurijckfordem" to="zurückfordern" />
+    <Word from="zurijckgeholt" to="zurückgeholt" />
+    <Word from="zurijckgekehrt" to="zurückgekehrt" />
+    <Word from="zurijckgekommen" to="zurückgekommen" />
+    <Word from="zurijckgelassen" to="zurückgelassen" />
+    <Word from="zurijckgerufen" to="zurückgerufen" />
+    <Word from="zurijckkehren" to="zurückkehren" />
+    <Word from="zurijcknehmen" to="zurücknehmen" />
+    <Word from="zurijckstolpern" to="zurückstolpern" />
+    <Word from="Zurilck" to="Zurück" />
+    <Word from="Zurilckf" to="Zurück!" />
+    <Word from="zurilckgeblieben" to="zurückgeblieben" />
+    <Word from="zurilckgeholt" to="zurückgeholt" />
+    <Word from="zurilckgekehrt" to="zurückgekehrt" />
+    <Word from="zurilckhalten" to="zurückhalten" />
+    <Word from="zurilckholen" to="zurückholen" />
+    <Word from="zurilckkehre" to="zurückkehre" />
+    <Word from="zurilckkehren" to="zurückkehren" />
+    <Word from="zurilckkehrt" to="zurückkehrt" />
+    <Word from="zurilckkommen" to="zurückkommen" />
+    <Word from="zurilckkommt" to="zurückkommt" />
+    <Word from="zurilcklassen" to="zurücklassen" />
+    <Word from="zurilckziehen" to="zurückziehen" />
+    <Word from="Zurilckziehenl" to="Zurückziehen!" />
+    <Word from="zurilckzugeben" to="zurückzugeben" />
+    <Word from="zurl'Jck" to="zurück!" />
+    <Word from="zurL'lck" to="zurück" />
+    <Word from="zurLick" to="zurück" />
+    <Word from="zurljckgeben" to="zurückgeben" />
+    <Word from="zurllickfallen" to="zurückfallen" />
+    <Word from="zurllickgekehrt" to="zurückgekehrt" />
+    <Word from="zurllickkehrt" to="zurückkehrt" />
+    <Word from="zurllickzukehren" to="zurückzukehren" />
+    <Word from="zurlllckgehen" to="zurückgehen" />
+    <Word from="zurlllckkomme" to="zurückkomme" />
+    <Word from="zurtick" to="zurück" />
+    <Word from="zurtickbringe" to="zurückbringe" />
+    <Word from="zurtickgezogen" to="zurückgezogen" />
+    <Word from="zurtlckgekommen" to="zurückgekommen" />
+    <Word from="zurtlckvervvandeln" to="zurückverwandeln" />
+    <Word from="Zuruck" to="Zurück" />
+    <Word from="ZURUCK" to="ZURÜCK" />
+    <Word from="zuruckbleiben" to="zurückbleiben" />
+    <Word from="zuruckblicken" to="zurückblicken" />
+    <Word from="zuruckdenke" to="zurückdenke" />
+    <Word from="zuruckfeuern" to="zurückfeuern" />
+    <Word from="zuruckgehen" to="zurückgehen" />
+    <Word from="zuruckgelegt" to="zurückgelegt" />
+    <Word from="zuruckgewiesen" to="zurückgewiesen" />
+    <Word from="zuruckgreifen" to="zurückgreifen" />
+    <Word from="zuruckhaben" to="zurückhaben" />
+    <Word from="zuruckkehren" to="zurückkehren" />
+    <Word from="zuruckkehrten" to="zurückkehrten" />
+    <Word from="zuruckkomme" to="zurückkomme" />
+    <Word from="zuruckkommen" to="zurückkommen" />
+    <Word from="zuruckkémst" to="zurückkämst" />
+    <Word from="zuruckl" to="zurück!" />
+    <Word from="zurucklassen" to="zurücklassen" />
+    <Word from="zurUcklieB" to="zurückließ" />
+    <Word from="zurucklécheln" to="zurücklächeln" />
+    <Word from="zurucknehmen" to="zurücknehmen" />
+    <Word from="zuruckverwandeln" to="zurückverwandeln" />
+    <Word from="zuruckverwandelt" to="zurückverwandelt" />
+    <Word from="zuruckziehen" to="zurückziehen" />
+    <Word from="zuruckzukommen" to="zurückzukommen" />
+    <Word from="zurverfilgung" to="zur Verfügung" />
+    <Word from="zuréickrufen" to="zurückrufen" />
+    <Word from="zurflck" to="zurück" />
+    <Word from="Zurflckbleiben" to="Zurückbleiben" />
+    <Word from="zurflckfliegen" to="zurückfliegen" />
+    <Word from="zurflckgeschickt" to="zurückgeschickt" />
+    <Word from="zurflckgibst" to="zurückgibst" />
+    <Word from="zus'a'tzliche" to="zusätzliche" />
+    <Word from="zusammenbeilien" to="zusammenbeißen" />
+    <Word from="zusammenffigen" to="zusammenfügen" />
+    <Word from="zusammenfugen" to="zusammenfügen" />
+    <Word from="zusammenfuhren" to="zusammenführen" />
+    <Word from="zusammenféillt" to="zusammenfällt" />
+    <Word from="zusammenhéilt" to="zusammenhält" />
+    <Word from="zusammenhélt" to="zusammenhält" />
+    <Word from="zusammenhéngen" to="zusammenhängen" />
+    <Word from="zusammenreifien" to="zusammenreißen" />
+    <Word from="zusammenzuschweifien" to="zusammenzuschweißen" />
+    <Word from="zuschlégst" to="zuschlägst" />
+    <Word from="zust6Bt" to="zustößt" />
+    <Word from="zustofken" to="zustoßen" />
+    <Word from="zustéindig" to="zuständig" />
+    <Word from="zusténcligen" to="zuständigen" />
+    <Word from="zusténdig" to="zuständig" />
+    <Word from="zusténdigen" to="zuständigen" />
+    <Word from="zusétzlich" to="zusätzlich" />
+    <Word from="zusétzliche" to="zusätzliche" />
+    <Word from="zuverlfissig" to="zuverlässig" />
+    <Word from="zuverllssig" to="zuverlässig" />
+    <Word from="zuverléssig" to="zuverlässig" />
+    <Word from="zuverléssiger" to="zuverlässiger" />
+    <Word from="zuviel" to="zu viel" />
+    <Word from="zuviele" to="zu viele" />
+    <Word from="zuzuflligen" to="zuzufügen" />
+    <Word from="Zuflucht" to="Zuflucht" />
+    <Word from="zvvei" to="zwei" />
+    <Word from="Zw6If" to="Zwölf" />
+    <Word from="zw6lfmal" to="zwölfmal" />
+    <Word from="Zwel" to="Zwei" />
+    <Word from="Zwickmfihle" to="Zwickmühle" />
+    <Word from="Zwillingstiichter" to="Zwillingstöchter" />
+    <Word from="Zwischenfélle" to="Zwischenfälle" />
+    <Word from="zwnlf" to="zwölf" />
+    <Word from="Zwéilften" to="Zwölften" />
+    <Word from="zwélf" to="zwölf" />
+    <Word from="zégerlich" to="zögerlich" />
+    <Word from="zégern" to="zögern" />
+    <Word from="Zégerns" to="Zögerns" />
+    <Word from="zéh" to="zäh" />
+    <Word from="zéhe" to="zähe" />
+    <Word from="zéher" to="zäher" />
+    <Word from="zéhl" to="zähl" />
+    <Word from="zéhle" to="zähle" />
+    <Word from="zéhlen" to="zählen" />
+    <Word from="Zéhlerei" to="Zählerei" />
+    <Word from="zéhlt" to="zählt" />
+    <Word from="zéhltl" to="zählt!" />
+    <Word from="Zéhlung" to="Zählung" />
+    <Word from="Zéhne" to="Zähne" />
+    <Word from="Zéhnen" to="Zähnen" />
+    <Word from="Zéhneputzen" to="Zähneputzen" />
+    <Word from="zéihle" to="zähle" />
+    <Word from="zéihlen" to="zählen" />
+    <Word from="zéihlt" to="zählt" />
+    <Word from="Zéihlungen" to="Zählungen" />
+    <Word from="Zéihne" to="Zähne" />
+    <Word from="Zélibat" to="Zölibat" />
+    <Word from="\/GFQHUQGH" to="Vergnügen" />
+    <Word from="\/OFVVUFf€" to="Vorwürfe" />
+    <Word from="\/Vahrheit" to="Wahrheit" />
+    <Word from="\/Vir" to="Wir" />
+    <Word from="\/\/i6fUl'1l€fi" to="Wie fühlen" />
+    <Word from="\/\/il'fUl'1I'€l'1" to="Wir führen" />
+    <Word from="\Nynn" to="Wynn" />
+    <Word from="_" to="-" />
+    <Word from="Äu" to="Au" />
+    <Word from="é" to="à" />
+    <Word from="échzt" to="ächzt" />
+    <Word from="éffentlich" to="öffentlich" />
+    <Word from="éffne" to="öffne" />
+    <Word from="éffnen" to="öffnen" />
+    <Word from="éffnet" to="öffnet" />
+    <Word from="éfft" to="äfft" />
+    <Word from="éfter" to="öfter" />
+    <Word from="éfters" to="öfters" />
+    <Word from="éh" to="äh" />
+    <Word from="éhnlich" to="ähnlich" />
+    <Word from="éhnliche" to="ähnliche" />
+    <Word from="éhnlicher" to="ähnlicher" />
+    <Word from="éih" to="äh" />
+    <Word from="éihnlich" to="ähnlich" />
+    <Word from="éindern" to="ändern" />
+    <Word from="éitzend" to="ätzend" />
+    <Word from="élter" to="älter" />
+    <Word from="élteste" to="älteste" />
+    <Word from="éltesten" to="ältesten" />
+    <Word from="éndere" to="ändere" />
+    <Word from="éndern" to="ändern" />
+    <Word from="éndert" to="ändert" />
+    <Word from="énderte" to="änderte" />
+    <Word from="énderten" to="änderten" />
+    <Word from="éngstlich" to="ängstlich" />
+    <Word from="érgere" to="ärgere" />
+    <Word from="érgern" to="ärgern" />
+    <Word from="érztliche" to="ärztliche" />
+    <Word from="érztlichen" to="ärztlichen" />
+    <Word from="érztlicher" to="ärztlicher" />
+    <Word from="ésthetisch" to="ästhetisch" />
+    <Word from="étzend" to="ätzend" />
+    <Word from="éufierst" to="äußerst" />
+    <Word from="éufiersten" to="äußersten" />
+    <Word from="éuflserst" to="äußerst" />
+    <Word from="flatterndem" to="flatterndem" />
+    <Word from="flel" to="fiel" />
+    <Word from="fliehen" to="fliehen" />
+    <Word from="fljr" to="für" />
+    <Word from="fllhlen" to="fühlen" />
+    <Word from="fllllen" to="füllen" />
+    <Word from="fllr" to="für" />
+    <Word from="fllrchterlich" to="fürchterlich" />
+    <Word from="flndet" to="findet" />
+    <Word from="AIle" to="Alle" />
+    <Word from="AIter" to="Alter" />
+    <Word from="GIück" to="Glück" />
+    <Word from="PIaystation" to="Playstation" />
+    <Word from="AIIes" to="Alles" />
+    <Word from="AIso" to="Also" />
+    <Word from="Ouatsch" to="Quatsch" />
+    <Word from="AIles" to="Alles" />
+    <Word from="BIeib" to="Bleib" />
+    <Word from="KIaut" to="Klaut" />
+    <Word from="AIlah" to="Allah" />
+    <Word from="PIan" to="Plan" />
+    <Word from="oderjemand" to="oder jemand" />
+    <Word from="liestjetzt" to="liest jetzt" />
+  </WholeWords>
+  <PartialWordsAlways>
+    <!-- Will be replaced always -->
+    <WordPart from="IVI" to="M" />
+    <WordPart from="IVl" to="M" />
+    <WordPart from="I\/I" to="M" />
+    <WordPart from="I\/l" to="M" />
+    <WordPart from="lVI" to="M" />
+    <WordPart from="lVl" to="M" />
+    <WordPart from="l\/I" to="M" />
+    <WordPart from="l\/l" to="M" />
+    <WordPart from="¤" to="o" />
+  </PartialWordsAlways>
+  <PartialWords>
+    <!-- Will be used to check words not in dictionary -->
+    <!-- If new word(s) exists in spelling dictionary, it (they) is accepted -->
+    <WordPart from="/" to="l" />
+    <WordPart from="B" to="ß" />
+    <WordPart from="c" to="e" />
+    <WordPart from="c" to="o" />
+    <WordPart from="cc" to="oo" />
+    <!-- "f " will be two words -->
+    <WordPart from="f" to="f " />
+    <WordPart from="I" to="l" />
+    <WordPart from="i" to="t" />
+    <WordPart from="ii" to="tt" />
+    <WordPart from="ii" to="ü" />
+    <WordPart from="IVI" to="M" />
+    <WordPart from="IVl" to="M" />
+    <WordPart from="l" to="i" />
+    <WordPart from="lVI" to="M" />
+    <WordPart from="lVl" to="M" />
+    <WordPart from="m" to="rn" />
+    <WordPart from="n" to="o" />
+    <WordPart from="n/" to="rv" />
+    <WordPart from="n/" to="ry" />
+    <WordPart from="o" to="e" />
+    <WordPart from="s" to="e" />
+    <WordPart from="VV" to="W" />
+    <WordPart from="\A" to="Vi" />
+    <WordPart from="¤" to="o" />
+    <WordPart from="é" to="ä" />
+    <WordPart from="í" to="i" />
+    <WordPart from="ı=" to="f" />
+    <WordPart from="€" to="e" />
+    <WordPart from="fi" to="fi" />
+    <WordPart from="fl" to="fl" />
+  </PartialWords>
+  <PartialLines>
+    <!-- Partial lines - but whole words only -->
+  </PartialLines>
+  <PartialLinesAlways />
+  <BeginLines />
+  <EndLines />
+  <WholeLines />
+  <RegularExpressions />
+</OCRFixReplaceList>
\ No newline at end of file
diff --git a/libs/subzero/modification/dictionaries/xml/eng_OCRFixReplaceList.xml b/libs/subzero/modification/dictionaries/xml/eng_OCRFixReplaceList.xml
new file mode 100644
index 000000000..05adb1d9c
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/xml/eng_OCRFixReplaceList.xml
@@ -0,0 +1,2416 @@
+<?xml version="1.0" encoding="utf-8"?>
+<OCRFixReplaceList>
+  <WholeWords>
+    <Word from="$COff$" to="scoffs" />
+    <Word from="$ergei" to="Sergei" />
+    <Word from="$'llOp" to="Stop" />
+    <Word from="/'//" to="I'll" />
+    <Word from="/'/I" to="I'll" />
+    <Word from="/ennifer" to="Jennifer" />
+    <Word from="/got" to="I got" />
+    <Word from="/have" to="I have" />
+    <Word from="/hope" to="I hope" />
+    <Word from="/just" to="I just" />
+    <Word from="/love" to="I love" />
+    <Word from="/'m" to="I'm" />
+    <Word from="/mmerse" to="immerse" />
+    <Word from="/nsu/ts" to="Insults" />
+    <Word from="/ong" to="long" />
+    <Word from="/ook" to="look" />
+    <Word from="/t's" to="It's" />
+    <Word from="/'ve" to="I've" />
+    <Word from="\/\/e'd" to="We'd" />
+    <Word from="\/\/e're" to="We're" />
+    <Word from="\/\/e've" to="We've" />
+    <Word from="\/\/hat" to="What" />
+    <Word from="\/\/here'd" to="Where'd" />
+    <Word from="\/\/hoo" to="Whoo" />
+    <Word from="\/\/hy" to="Why" />
+    <Word from="\/\/hy'd" to="Why'd" />
+    <Word from="\/\le're" to="We're" />
+    <Word from="\/Ve" to="We" />
+    <Word from="\Ne're" to="We're" />
+    <Word from="\Nhat's" to="What's" />
+    <Word from="\Nhere's" to="Where's" />
+    <Word from="|'mjust" to="I'm just" />
+    <Word from="¤ff" to="off" />
+    <Word from="¤Id" to="old" />
+    <Word from="¤Ids" to="olds" />
+    <Word from="¤n" to="on" />
+    <Word from="¤ne" to="one" />
+    <Word from="¤nly" to="only" />
+    <Word from="¤pen" to="open" />
+    <Word from="¤r" to="or" />
+    <Word from="¤rder" to="order" />
+    <Word from="¤ther" to="other" />
+    <Word from="¤ur" to="our" />
+    <Word from="¤ut" to="out" />
+    <Word from="¤ver" to="over" />
+    <Word from="¤wn" to="own" />
+    <Word from="€V€I'y" to="every" />
+    <Word from="0'clock" to="o'clock" />
+    <Word from="0f" to="of" />
+    <Word from="0fEngland" to="of England" />
+    <Word from="0fft0" to="off to" />
+    <Word from="0l/er" to="over" />
+    <Word from="0n" to="on" />
+    <Word from="0ne" to="one" />
+    <Word from="0ne's" to="one's" />
+    <Word from="0r" to="or" />
+    <Word from="0rders" to="orders" />
+    <Word from="0thers'" to="others'" />
+    <Word from="0ut" to="out" />
+    <Word from="0utlaw's" to="outlaw's" />
+    <Word from="0utlaws'" to="outlaws'" />
+    <Word from="0ver" to="over" />
+    <Word from="13oos" to="1300s" />
+    <Word from="18oos" to="1800s" />
+    <Word from="195os" to="1950s" />
+    <Word from="1et's" to="let's" />
+    <Word from="1o" to="10" />
+    <Word from="1oo" to="100" />
+    <Word from="1ooth" to="100th" />
+    <Word from="1oth" to="10th" />
+    <Word from="2E_" to="2E." />
+    <Word from="2'IST" to="21ST" />
+    <Word from="2'Ist_" to="2'1st." />
+    <Word from="2o" to="20" />
+    <Word from="2oth" to="20th" />
+    <Word from="3o" to="30" />
+    <Word from="3oth" to="30th" />
+    <Word from="4o" to="40" />
+    <Word from="4os" to="40s" />
+    <Word from="4oth" to="40th" />
+    <Word from="50rry" to="sorry" />
+    <Word from="5o" to="50" />
+    <Word from="5oth" to="50th" />
+    <Word from="6o" to="60" />
+    <Word from="6os" to="60s" />
+    <Word from="'6os" to="'60s" />
+    <Word from="6oth" to="60th" />
+    <Word from="7o" to="70" />
+    <Word from="'7os" to="'70s" />
+    <Word from="7oth" to="70th" />
+    <Word from="8o" to="80" />
+    <Word from="'8os" to="'80s" />
+    <Word from="8oth" to="80th" />
+    <Word from="9/aim" to="alarm" />
+    <Word from="9o" to="90" />
+    <Word from="9oth" to="90th" />
+    <Word from="9UnShQt" to="gunshot" />
+    <Word from="a//" to="all" />
+    <Word from="a/bum" to="album" />
+    <Word from="a/so" to="also" />
+    <Word from="A/ways" to="Always" />
+    <Word from="abcut" to="about" />
+    <Word from="aboutjoining" to="about joining" />
+    <Word from="aboutposh" to="about posh" />
+    <Word from="aboutus" to="about us" />
+    <Word from="aboutyou" to="about you" />
+    <Word from="accldent" to="accident" />
+    <Word from="Acool" to="A cool" />
+    <Word from="afier" to="after" />
+    <Word from="affraid" to="afraid" />
+    <Word from="Afriend" to="A friend" />
+    <Word from="afterall" to="after all" />
+    <Word from="afterthe" to="after the" />
+    <Word from="afulcrum" to="a fulcrum" />
+    <Word from="Afunny" to="A funny" />
+    <Word from="aga/nst" to="against" />
+    <Word from="ahsolutes" to="absolutes" />
+    <Word from="AI_I_" to="ALL" />
+    <Word from="AIien" to="Alien" />
+    <Word from="AIex" to="Alex" />
+    <Word from="AII" to="All" />
+    <Word from="AIIan" to="Allan" />
+    <Word from="AIIow" to="Allow" />
+    <Word from="AIive" to="Alive" />
+    <Word from="ain'tgotno" to="ain't got no" />
+    <Word from="Ain'tgotno" to="Ain't got no" />
+    <Word from="airstrike" to="air strike" />
+    <Word from="AIVIBULANCE" to="AMBULANCE" />
+    <Word from="ajob" to="a job" />
+    <Word from="ajockey_" to="a jockey." />
+    <Word from="ajoke" to="a joke" />
+    <Word from="Ajoke" to="A joke" />
+    <Word from="ajoking" to="a joking" />
+    <Word from="al/" to="all" />
+    <Word from="al/en" to="alien" />
+    <Word from="alittle" to="a little" />
+    <Word from="allgasp" to="all gasp" />
+    <Word from="alljustforshow" to="all just for show" />
+    <Word from="aln't" to="ain't" />
+    <Word from="alot" to="a lot" />
+    <Word from="Alot" to="A lot" />
+    <Word from="An5wer" to="Answer" />
+    <Word from="Andit" to="And it" />
+    <Word from="Andit's" to="And it's" />
+    <Word from="andl" to="and I" />
+    <Word from="andlaughs" to="and laughs" />
+    <Word from="andleave" to="and leave" />
+    <Word from="andthe" to="and the" />
+    <Word from="andyou" to="and you" />
+    <Word from="Andyou" to="And you" />
+    <Word from="ANNOUNC/NG" to="ANNOUNCING" />
+    <Word from="anotherstep" to="another step" />
+    <Word from="ANSWER/NG" to="ANSWERING" />
+    <Word from="answerwhat" to="answer what" />
+    <Word from="antiquejoke" to="antique joke" />
+    <Word from="anyhcdy's" to="anybody's" />
+    <Word from="Anyidea" to="Any idea" />
+    <Word from="anyone's_" to="anyone's." />
+    <Word from="apejust" to="ape just" />
+    <Word from="ARABlc" to="ARABIC" />
+    <Word from="aren't_" to="aren't." />
+    <Word from="arerl't" to="aren't" />
+    <Word from="Arnsteln's" to="Arnstein's" />
+    <Word from="atleast" to="at least" />
+    <Word from="Atough" to="A tough" />
+    <Word from="Awhole" to="A whole" />
+    <Word from="awoman" to="a woman" />
+    <Word from="Awoman" to="A woman" />
+    <Word from="barelytalked" to="barely talked" />
+    <Word from="bcat" to="boat" />
+    <Word from="Bcllvla" to="Bolivia" />
+    <Word from="bcmb" to="bomb" />
+    <Word from="bcmbs" to="bombs" />
+    <Word from="be//y" to="belly" />
+    <Word from="becuase" to="because" />
+    <Word from="Beep/'ng" to="Beeping" />
+    <Word from="bejumpy" to="be jumpy" />
+    <Word from="besldes" to="besides" />
+    <Word from="bestfriend" to="best friend" />
+    <Word from="bestguy" to="best guy" />
+    <Word from="bestjob" to="best job" />
+    <Word from="BIack" to="Black" />
+    <Word from="BIess" to="Bless" />
+    <Word from="bigos___" to="bigos..." />
+    <Word from="BIame" to="Blame" />
+    <Word from="BIind" to="Blind" />
+    <Word from="BIood" to="Blood" />
+    <Word from="BIue" to="Blue" />
+    <Word from="BLOVVS" to="BLOWS" />
+    <Word from="blowholel" to="blowhole!" />
+    <Word from="blt" to="bit" />
+    <Word from="Bo99" to="Bogg" />
+    <Word from="bodiedyoung" to="bodied young" />
+    <Word from="breakféwtl" to="breakfast!" />
+    <Word from="bulldozlng" to="bulldozing" />
+    <Word from="butjust" to="but just" />
+    <Word from="butl" to="but I" />
+    <Word from="Butl" to="But I" />
+    <Word from="butljust" to="but I just" />
+    <Word from="Butljustcan'tgetenough" to="But I just can't get enough" />
+    <Word from="Butyou're" to="But you're" />
+    <Word from="buythem" to="buy them" />
+    <Word from="buyyou" to="buy you" />
+    <Word from="byjust" to="by just" />
+    <Word from="bythe" to="by the" />
+    <Word from="C/latter/'/7g" to="Chattering" />
+    <Word from="ca///ng" to="calling" />
+    <Word from="ca/I" to="call" />
+    <Word from="call/ng" to="calling" />
+    <Word from="callyou" to="call you" />
+    <Word from="can*t" to="can't" />
+    <Word from="can'i" to="can't" />
+    <Word from="can'I" to="can't" />
+    <Word from="canlgetyou" to="canI get you" />
+    <Word from="cannotchange" to="cannot change" />
+    <Word from="cannut" to="cannot" />
+    <Word from="can'T" to="can't" />
+    <Word from="can't_" to="Crucially" />
+    <Word from="can'tjust" to="can't just" />
+    <Word from="can'tletgo" to="can't let go" />
+    <Word from="Car0l" to="Carol" />
+    <Word from="Carhorn" to="Car horn" />
+    <Word from="carrled" to="carried" />
+    <Word from="Ccug" to="Coug" />
+    <Word from="Ccugs" to="Cougs" />
+    <Word from="Ccver" to="Cover" />
+    <Word from="cellularchange" to="cellular change" />
+    <Word from="cff" to="off" />
+    <Word from="cfycu" to="of you" />
+    <Word from="cfycur" to="of your" />
+    <Word from="Ch/rping" to="Chirping" />
+    <Word from="chaletgirl" to="chalet girl" />
+    <Word from="changejobs" to="change jobs" />
+    <Word from="Charliejust" to="Charlie just" />
+    <Word from="Chatter/'rtg" to="Chattering" />
+    <Word from="CHATTERWG" to="CHATTERING" />
+    <Word from="Chequeredlove" to="Chequered love" />
+    <Word from="cHIRPINcs" to="CHIRPING" />
+    <Word from="chjldishness" to="childishness" />
+    <Word from="chlldrcn" to="children" />
+    <Word from="chlldren" to="children" />
+    <Word from="chocolatte" to="chocolate" />
+    <Word from="Cho/r" to="Choir" />
+    <Word from="cHucKl_Es" to="CHUCKLES" />
+    <Word from="CIark" to="Clark" />
+    <Word from="CIear" to="Clear" />
+    <Word from="circumcised_" to="circumcised." />
+    <Word from="ckay" to="okay" />
+    <Word from="cl_osEs" to="CLOSES" />
+    <Word from="CLATTERWG" to="CLATTERING" />
+    <Word from="cn" to="on" />
+    <Word from="cne" to="one" />
+    <Word from="cnes" to="ones" />
+    <Word from="Coincidenta//y" to="Coincidentally" />
+    <Word from="COm€" to="Come" />
+    <Word from="comp/etey" to="completely" />
+    <Word from="complainingabout" to="complaining about" />
+    <Word from="coms" to="come" />
+    <Word from="cond/lion" to="condition" />
+    <Word from="confdence" to="confidence" />
+    <Word from="conhrmed" to="confirmed" />
+    <Word from="connrm" to="confirm" />
+    <Word from="Consecutivelyl" to="Consecutively!" />
+    <Word from="COUGH5" to="COUGHS" />
+    <Word from="CouGHING" to="COUGHING" />
+    <Word from="couIdn't" to="couldn't" />
+    <Word from="couldjust" to="could just" />
+    <Word from="couldn'T" to="couldn't" />
+    <Word from="couldn'tjust" to="couldn't just" />
+    <Word from="Couldyou" to="Could you" />
+    <Word from="crappyjob" to="crappy job" />
+    <Word from="CRAsHING" to="CRASHING" />
+    <Word from="crder" to="order" />
+    <Word from="Crowdcheers" to="Crowd cheers" />
+    <Word from="Cruoially" to="Crucially" />
+    <Word from="cther" to="other" />
+    <Word from="cuuld" to="could" />
+    <Word from="cver" to="over" />
+    <Word from="d/'dn't" to="didn't" />
+    <Word from="d/squietude" to="disquietude" />
+    <Word from="D¤esn't" to="Doesn't" />
+    <Word from="d¤n'i" to="don't" />
+    <Word from="d¤n't" to="don't" />
+    <Word from="d°9" to="dog" />
+    <Word from="d0" to="do" />
+    <Word from="D0" to="Do" />
+    <Word from="D0asn't" to="Doesn't" />
+    <Word from="Dad'//" to="Dad'll" />
+    <Word from="dairyjust" to="dairy just" />
+    <Word from="Dar//ng" to="Darling" />
+    <Word from="dc" to="do" />
+    <Word from="Dcbby" to="Dobby" />
+    <Word from="dccsn't" to="doesn't" />
+    <Word from="dcctcr" to="doctor" />
+    <Word from="Dces" to="Does" />
+    <Word from="dcgs" to="dogs" />
+    <Word from="dcing" to="doing" />
+    <Word from="dcn'I" to="don't" />
+    <Word from="dcn't" to="don't" />
+    <Word from="Dcn't" to="Don't" />
+    <Word from="dcughnut" to="doughnut" />
+    <Word from="declslons" to="decisions" />
+    <Word from="deedhas" to="deed has" />
+    <Word from="Dehnitely" to="Definitely" />
+    <Word from="desewes" to="deserves" />
+    <Word from="desperate/»y" to="desperately" />
+    <Word from="Dflnk" to="Drink" />
+    <Word from="DIAl_lNcs" to="DIALING" />
+    <Word from="didn'!" to="didn't" />
+    <Word from="didnt" to="didn't" />
+    <Word from="didn'T" to="didn't" />
+    <Word from="dIdn't" to="didn't" />
+    <Word from="didn't_" to="didn't." />
+    <Word from="didrft" to="didn't" />
+    <Word from="didrl't" to="didn't" />
+    <Word from="didyou" to="did you" />
+    <Word from="divorcing_" to="divorcing." />
+    <Word from="dld" to="did" />
+    <Word from="dldn't" to="didn't" />
+    <Word from="dlfflcull" to="difficult" />
+    <Word from="dlg" to="dig" />
+    <Word from="dlsobeyed" to="disobeyed" />
+    <Word from="doasn't" to="doesn't" />
+    <Word from="Doasn't" to="Doesn't" />
+    <Word from="doctoh" to="doctor" />
+    <Word from="Doctor___tell" to="Doctor... tell" />
+    <Word from="doesnt" to="doesn't" />
+    <Word from="doesn'T" to="doesn't" />
+    <Word from="doesri't" to="doesnt't" />
+    <Word from="doesrt" to="doesn't" />
+    <Word from="Doesrt" to="Doesn't" />
+    <Word from="doit" to="do it" />
+    <Word from="dojust" to="do just" />
+    <Word from="don*t" to="don't" />
+    <Word from="donejobs" to="done jobs" />
+    <Word from="don'i" to="don't" />
+    <Word from="don'l" to="don't" />
+    <Word from="Don'l" to="Don't" />
+    <Word from="Donllook" to="Don't look" />
+    <Word from="dont" to="don't" />
+    <Word from="don'T" to="don't" />
+    <Word from="don'tcare" to="don't care" />
+    <Word from="don'tjoke" to="don't joke" />
+    <Word from="Don'tjudge" to="Don't judge" />
+    <Word from="don'tjust" to="don't just" />
+    <Word from="Don'tjust" to="Don't just" />
+    <Word from="Don'tlet" to="Don't let" />
+    <Word from="don'tlhink" to="don't think" />
+    <Word from="don'tpush" to="don't push" />
+    <Word from="Don'tyou" to="Don't you" />
+    <Word from="DonWlook" to="Don't look" />
+    <Word from="Dooropens" to="Door opens" />
+    <Word from="doorshuts" to="door shuts" />
+    <Word from="dothat" to="do that" />
+    <Word from="dothis" to="do this" />
+    <Word from="Drinkthis" to="Drink this" />
+    <Word from="dumbass" to="dumb-ass" />
+    <Word from="dumbto" to="dumb to" />
+    <Word from="dun't" to="don't" />
+    <Word from="E//e" to="Elle" />
+    <Word from="E9YPt" to="Egypt" />
+    <Word from="ea/'t/7" to="earth" />
+    <Word from="eart/7" to="earth" />
+    <Word from="efi'/'c/'ent" to="efficient" />
+    <Word from="EN&lt;3LlsH" to="ENGLISH" />
+    <Word from="Enjoythe" to="Enjoy the" />
+    <Word from="Erv\/an" to="Erwan" />
+    <Word from="Erv\/an's" to="Erwan's" />
+    <Word from="etemity" to="eternity" />
+    <Word from="ev/I" to="evil" />
+    <Word from="eve/yone" to="everyone" />
+    <Word from="even/body's" to="everybody's" />
+    <Word from="eversay" to="ever say" />
+    <Word from="Everymonth" to="Every month" />
+    <Word from="everythings" to="everything's" />
+    <Word from="Everythirlg's" to="Everything’s" />
+    <Word from="Everythlng's" to="Everything's" />
+    <Word from="Everytime" to="Every time" />
+    <Word from="Exacfly" to="Exactly" />
+    <Word from="ExacUy_" to="Exactly." />
+    <Word from="excitedshrieking" to="excited shrieking" />
+    <Word from="ExcLAllvls" to="EXCLAIMS" />
+    <Word from="exploatation" to="exploitation" />
+    <Word from="expreusion" to="expression" />
+    <Word from="fairthat" to="fair that" />
+    <Word from="Fathef" to="Father" />
+    <Word from="fatherfigure" to="father figure" />
+    <Word from="FBl" to="FBI" />
+    <Word from="fcrebcdlng" to="foreboding" />
+    <Word from="fcreverjudges" to="forever judges" />
+    <Word from="fcund" to="found" />
+    <Word from="feeleverything" to="feel everything" />
+    <Word from="feelsweet" to="feel sweet" />
+    <Word from="fiam/'/y" to="family" />
+    <Word from="fingernail" to="fingernail" />
+    <Word from="finishedjunior" to="finished junior" />
+    <Word from="FIynn" to="Flynn" />
+    <Word from="flll" to="fill" />
+    <Word from="flra" to="fira" />
+    <Word from="Flylng" to="Flying" />
+    <Word from="Fnends" to="Fiends" />
+    <Word from="fo/low" to="follow" />
+    <Word from="fonzvard" to="forward" />
+    <Word from="fora" to="for a" />
+    <Word from="Fora" to="For a" />
+    <Word from="forajob" to="for a job" />
+    <Word from="forAmerica" to="for America" />
+    <Word from="forNew" to="for New" />
+    <Word from="forone" to="for one" />
+    <Word from="forso" to="for so" />
+    <Word from="Forsuch" to="For such" />
+    <Word from="forsunburns" to="for sunburns" />
+    <Word from="forthe" to="for the" />
+    <Word from="Foryears" to="For years" />
+    <Word from="foryou" to="for you" />
+    <Word from="Foudeen" to="Fouteen" />
+    <Word from="Foufleen" to="Fourteen" />
+    <Word from="FourSeasons" to="Four Seasons" />
+    <Word from="fr/ends" to="friends" />
+    <Word from="freezerfood" to="freezer food" />
+    <Word from="Führerfeels" to="Führer feels" />
+    <Word from="furthernotice" to="further notice" />
+    <Word from="furyou" to="for you" />
+    <Word from="G0" to="Go" />
+    <Word from="g0in9" to="going" />
+    <Word from="gamlenias" to="gardenias" />
+    <Word from="GAsPING" to="GASPING" />
+    <Word from="gc" to="go" />
+    <Word from="gcing" to="going" />
+    <Word from="gcnna" to="gonna" />
+    <Word from="Gcnna" to="Gonna" />
+    <Word from="gct" to="get" />
+    <Word from="Gct" to="Got" />
+    <Word from="genercsity" to="generosity" />
+    <Word from="generosityn" to="generosity&quot;" />
+    <Word from="getjust" to="get just" />
+    <Word from="gfling" to="going" />
+    <Word from="giflfriend" to="girlfriend" />
+    <Word from="gir/" to="girl" />
+    <Word from="gir/s'boarding" to="girls' boarding" />
+    <Word from="giris" to="girls" />
+    <Word from="gLlyS" to="guys" />
+    <Word from="glum_" to="glum." />
+    <Word from="gnyone" to="anyone" />
+    <Word from="golng" to="going" />
+    <Word from="goodboyand" to="good boy and" />
+    <Word from="goodjob" to="good job" />
+    <Word from="gOt" to="got" />
+    <Word from="gotjumped" to="got jumped" />
+    <Word from="gotmyfirstinterview" to="got my first interview" />
+    <Word from="grandjury" to="grand jury" />
+    <Word from="greatjob" to="great job" />
+    <Word from="Greatjobl" to="Great job!" />
+    <Word from="grinco" to="gringo" />
+    <Word from="GRoANING" to="GROANING" />
+    <Word from="GRUNUNG" to="GRUNTING" />
+    <Word from="gu" to="go" />
+    <Word from="gunna" to="gonna" />
+    <Word from="guyjumped" to="guy jumped" />
+    <Word from="guyjust" to="guy just" />
+    <Word from="gUyS" to="guys" />
+    <Word from="_H6Y-" to="- Hey!" />
+    <Word from="H€Y" to="Hey" />
+    <Word from="H0we·ver" to="However" />
+    <Word from="halftheir" to="half their" />
+    <Word from="hapPY" to="happy" />
+    <Word from="hasrt" to="hasn't" />
+    <Word from="Hasrt" to="Hasn't" />
+    <Word from="haven'tspokerl" to="haven't spoken" />
+    <Word from="hcle" to="hole" />
+    <Word from="hcme" to="home" />
+    <Word from="hcmes" to="homes" />
+    <Word from="hcpe" to="hope" />
+    <Word from="hctel" to="hotel" />
+    <Word from="hcurs" to="hours" />
+    <Word from="Hcw" to="How" />
+    <Word from="he/ps" to="helps" />
+    <Word from="hearjokestonight" to="hear jokes tonight" />
+    <Word from="hearme" to="hear me" />
+    <Word from="Hefell" to="He fell" />
+    <Word from="he'II" to="he'll" />
+    <Word from="He'II" to="He'll" />
+    <Word from="HeII0" to="Hello" />
+    <Word from="He'Il" to="He'll" />
+    <Word from="Hejust" to="He just" />
+    <Word from="He'lI" to="He'll" />
+    <Word from="HelIo" to="Hello" />
+    <Word from="hellc" to="hello" />
+    <Word from="HellO" to="Hello" />
+    <Word from="herboyfr/end" to="her boyfriend" />
+    <Word from="herflesh" to="her flesh" />
+    <Word from="herfollov\/ed" to="her followed" />
+    <Word from="herjob_" to="her job." />
+    <Word from="HerrSchmidt" to="Herr Schmidt" />
+    <Word from="herwith" to="her with" />
+    <Word from="HeY·" to="Hey." />
+    <Word from="HeyJennifer" to="Hey Jennifer" />
+    <Word from="hiddsn" to="hidden" />
+    <Word from="hisjunk" to="his junk" />
+    <Word from="Hitlershare" to="Hitler share" />
+    <Word from="Hlneed" to="I'll need" />
+    <Word from="Hnally" to="finally" />
+    <Word from="Hnishing" to="finishing" />
+    <Word from="HOId" to="Hold" />
+    <Word from="hOIes" to="holes" />
+    <Word from="HONMNG" to="HONKING" />
+    <Word from="honorthe" to="honor the" />
+    <Word from="honoryou" to="honor you" />
+    <Word from="honoryour" to="honor your" />
+    <Word from="Hov\/'s" to="How's" />
+    <Word from="Hov\/'S" to="How's" />
+    <Word from="HovvLING" to="HOWLING" />
+    <Word from="howit" to="how it" />
+    <Word from="HoW's" to="How's" />
+    <Word from="howto" to="how to" />
+    <Word from="Hs's" to="He's" />
+    <Word from="hurtyou" to="hurt you" />
+    <Word from="I/erilj/" to="verify" />
+    <Word from="I/fe" to="life" />
+    <Word from="I\/I" to="M" />
+    <Word from="I\/Ian" to="Man" />
+    <Word from="I\/Iathies" to="Mathies" />
+    <Word from="I\/Ie" to="Me" />
+    <Word from="I\/Iommy" to="Mommy" />
+    <Word from="I\/Ir" to="Mr" />
+    <Word from="I\/Ir." to="Mr." />
+    <Word from="I\/ly" to="My" />
+    <Word from="I3EEPING" to="BEEPING" />
+    <Word from="I3LARING" to="BLARING" />
+    <Word from="Iacings" to="lacings" />
+    <Word from="Iaid" to="laid" />
+    <Word from="Iam" to="I am" />
+    <Word from="Iand" to="land" />
+    <Word from="Ianding" to="landing" />
+    <Word from="Iast" to="last" />
+    <Word from="Iate" to="late" />
+    <Word from="Icad" to="load" />
+    <Word from="Icading" to="loading" />
+    <Word from="Ican" to="I can" />
+    <Word from="Iccked" to="locked" />
+    <Word from="Icng" to="long" />
+    <Word from="Icsing" to="losing" />
+    <Word from="Icslng" to="losing" />
+    <Word from="Idid" to="I did" />
+    <Word from="Ididn't" to="I didn't" />
+    <Word from="Ido" to="I do" />
+    <Word from="Idon'i" to="I don't" />
+    <Word from="Idon't" to="I don't" />
+    <Word from="Idon'tthink" to="I don't think" />
+    <Word from="I'E'$" to="It's" />
+    <Word from="Ieamed" to="learned" />
+    <Word from="Ieapt" to="leapt" />
+    <Word from="Iearned" to="learned" />
+    <Word from="Ieast" to="least" />
+    <Word from="Ieave" to="leave" />
+    <Word from="Ied" to="led" />
+    <Word from="Ieft" to="left" />
+    <Word from="Ieg's" to="leg's" />
+    <Word from="Iess" to="less" />
+    <Word from="Iet" to="let" />
+    <Word from="Iet's" to="let's" />
+    <Word from="Iet'sjust" to="let's just" />
+    <Word from="if/just" to="if I just" />
+    <Word from="Ifear" to="I fear" />
+    <Word from="Ifeared" to="I feared" />
+    <Word from="Ifeel" to="I feel" />
+    <Word from="ifI'||" to="if I'll" />
+    <Word from="ifI'd" to="if I'd" />
+    <Word from="ifI'II" to="if I'll" />
+    <Word from="ifI'll" to="if I'll" />
+    <Word from="ifI'm" to="if I'm" />
+    <Word from="Ifinally" to="I finally" />
+    <Word from="ifI've" to="if I've" />
+    <Word from="ifl" to="if I" />
+    <Word from="Iforgot" to="I forgot" />
+    <Word from="Ifound" to="I found" />
+    <Word from="ifshe" to="if she" />
+    <Word from="ifthat's" to="if that's" />
+    <Word from="ifthe" to="if the" />
+    <Word from="Ifthe" to="If the" />
+    <Word from="ifthere's" to="if there's" />
+    <Word from="Ifthey" to="If they" />
+    <Word from="ifwe" to="if we" />
+    <Word from="Ifwe" to="If we" />
+    <Word from="Ifycu" to="If you" />
+    <Word from="ifyou" to="if you" />
+    <Word from="Ifyou" to="If you" />
+    <Word from="ifyuu" to="if you" />
+    <Word from="Iget" to="I get" />
+    <Word from="Igot" to="I got" />
+    <Word from="Igotta" to="I gotta" />
+    <Word from="Igotyou" to="I got you" />
+    <Word from="Iguess" to="I guess" />
+    <Word from="Iguessljust" to="I guess I just" />
+    <Word from="Ihad" to="I had" />
+    <Word from="Ihat's" to="that's" />
+    <Word from="Ihave" to="I have" />
+    <Word from="Iheard" to="I heard" />
+    <Word from="ihere's" to="there's" />
+    <Word from="ihey've" to="they've" />
+    <Word from="Ihope" to="I hope" />
+    <Word from="ii/Iary" to="Mary" />
+    <Word from="ii/Ir" to="Mr" />
+    <Word from="ii/Ir." to="Mr." />
+    <Word from="ii/love" to="Move" />
+    <Word from="Iife" to="life" />
+    <Word from="I'II" to="I'll" />
+    <Word from="Iike" to="like" />
+    <Word from="I'Il" to="I'll" />
+    <Word from="Iine" to="line" />
+    <Word from="iirst" to="first" />
+    <Word from="ii's" to="it's" />
+    <Word from="Ii's" to="It's" />
+    <Word from="Iiterallyjumped" to="literally jumped" />
+    <Word from="Ijoined" to="I joined" />
+    <Word from="Ijust" to="I just" />
+    <Word from="Iknew" to="I knew" />
+    <Word from="Iknow" to="I know" />
+    <Word from="Ile" to="lie" />
+    <Word from="Ileft" to="I left" />
+    <Word from="I'lldo" to="I'll do" />
+    <Word from="I'llmake" to="I'll make" />
+    <Word from="Ilons" to="lions" />
+    <Word from="Ilove" to="I love" />
+    <Word from="I'mjust" to="I'm just" />
+    <Word from="Inconceivablel" to="Inconceivable!" />
+    <Word from="infact" to="in fact" />
+    <Word from="Infact" to="In fact" />
+    <Word from="influence" to="influence" />
+    <Word from="infront" to="in front" />
+    <Word from="injust" to="in just" />
+    <Word from="inscfipfions" to="inscriptions" />
+    <Word from="insolencel" to="insolence!" />
+    <Word from="intc" to="into" />
+    <Word from="internationaljudges" to="international judges" />
+    <Word from="inthe" to="in the" />
+    <Word from="Iockdown" to="lockdown" />
+    <Word from="Iong" to="long" />
+    <Word from="Iongships" to="longships" />
+    <Word from="Iook" to="look" />
+    <Word from="Iookjust" to="look just" />
+    <Word from="Iooklng" to="looking" />
+    <Word from="Iooks" to="looks" />
+    <Word from="Ioose" to="loose" />
+    <Word from="Iord's" to="lord's" />
+    <Word from="Iose" to="lose" />
+    <Word from="Ioser" to="loser" />
+    <Word from="Ioss" to="loss" />
+    <Word from="Iost" to="lost" />
+    <Word from="Iot" to="lot" />
+    <Word from="Iot's" to="lot's" />
+    <Word from="Iousyjob" to="lousy job" />
+    <Word from="Iove" to="love" />
+    <Word from="Ioves" to="loves" />
+    <Word from="Iowlife" to="lowlife" />
+    <Word from="Ipaid" to="I paid" />
+    <Word from="Iquit" to="I quit" />
+    <Word from="Ireallythinkthis" to="I really think this" />
+    <Word from="I'rn" to="I'm" />
+    <Word from="Isaw" to="I saw" />
+    <Word from="Isayt/1e" to="I say the" />
+    <Word from="isjust" to="is just" />
+    <Word from="isn'i" to="isn't" />
+    <Word from="isn't_" to="isn't." />
+    <Word from="Isthis" to="Is this" />
+    <Word from="Istill" to="I still" />
+    <Word from="Istumblod" to="I stumbled" />
+    <Word from="Itake" to="I take" />
+    <Word from="itdown" to="it down" />
+    <Word from="Iteach" to="I teach" />
+    <Word from="Itfeels" to="It feels" />
+    <Word from="ithave" to="it have" />
+    <Word from="Ithink" to="I think" />
+    <Word from="Ithinkthat" to="I think that" />
+    <Word from="Ithinkthis" to="I think this" />
+    <Word from="Ithinkyou're" to="I think you're" />
+    <Word from="Ithlnk" to="I think" />
+    <Word from="Ithoguht" to="I thought" />
+    <Word from="Ithought" to="I thought" />
+    <Word from="Ithoughtl" to="I thought I" />
+    <Word from="it'II" to="it'll" />
+    <Word from="It'II" to="It'll" />
+    <Word from="it'Il" to="it'll" />
+    <Word from="It'Il" to="It'll" />
+    <Word from="itin" to="it in" />
+    <Word from="itjust" to="it just" />
+    <Word from="Itjust" to="It just" />
+    <Word from="it'lI" to="it'll" />
+    <Word from="It'lI" to="It'll" />
+    <Word from="It'llhappen" to="It'll happen" />
+    <Word from="it'lljust" to="it'll just" />
+    <Word from="Itold" to="I told" />
+    <Word from="Itook" to="I took" />
+    <Word from="itout" to="it out" />
+    <Word from="it'S" to="it's" />
+    <Word from="it'sjinxed" to="it's jinxed" />
+    <Word from="it'sjust" to="it's just" />
+    <Word from="It'sjust" to="It's just" />
+    <Word from="itso" to="it so" />
+    <Word from="Ittends" to="It tends" />
+    <Word from="Itwasn't" to="It wasn't" />
+    <Word from="Iuckier" to="luckier" />
+    <Word from="IV|oney" to="Money" />
+    <Word from="IV|oney's" to="Money's" />
+    <Word from="I'va" to="I've" />
+    <Word from="I'Ve" to="I've" />
+    <Word from="IVIan" to="Man" />
+    <Word from="IVIAN" to="MAN" />
+    <Word from="IVIarch" to="March" />
+    <Word from="IVIarci's" to="Marci's" />
+    <Word from="IVIarko" to="Marko" />
+    <Word from="IVIe" to="Me" />
+    <Word from="IVIine's" to="Mine's" />
+    <Word from="IVImm" to="Mmm" />
+    <Word from="IVIoney" to="Money" />
+    <Word from="IVIr." to="Mr." />
+    <Word from="IVIrs" to="Mrs" />
+    <Word from="IVIuch" to="Much" />
+    <Word from="IVIust" to="Must" />
+    <Word from="IVIy" to="My" />
+    <Word from="IVlacArthur" to="MacArthur" />
+    <Word from="IVlacArthur's" to="MacArthur's" />
+    <Word from="IVlcBride" to="McBride" />
+    <Word from="IVlore" to="More" />
+    <Word from="IVlotherfucker_" to="Motherfucker." />
+    <Word from="IVlr" to="Mr" />
+    <Word from="IVlr." to="Mr." />
+    <Word from="IVlr_" to="Mr." />
+    <Word from="IVlust" to="Must" />
+    <Word from="IVly" to="My" />
+    <Word from="Iwake" to="I wake" />
+    <Word from="Iwant" to="I want" />
+    <Word from="Iwanted" to="I wanted" />
+    <Word from="Iwas" to="I was" />
+    <Word from="Iwasjust" to="I was just" />
+    <Word from="Iwasjustu" to="I was just..." />
+    <Word from="Iwill" to="I will" />
+    <Word from="Iwish" to="I wish" />
+    <Word from="Iwon't" to="I won't" />
+    <Word from="Iworked" to="I worked" />
+    <Word from="Iwould" to="I would" />
+    <Word from="jalapeno" to="jalapeño" />
+    <Word from="Jaokson" to="Jackson" />
+    <Word from="Jascn" to="Jason" />
+    <Word from="jcke" to="joke" />
+    <Word from="jennifer" to="Jennifer" />
+    <Word from="joseph" to="Joseph" />
+    <Word from="jsut" to="just" />
+    <Word from="Jumpthem" to="Jump them" />
+    <Word from="jusi" to="just" />
+    <Word from="jusl" to="just" />
+    <Word from="justjudge" to="just judge" />
+    <Word from="justleave" to="just leave" />
+    <Word from="Justletgo" to="Just let go" />
+    <Word from="kidsjumped" to="kids jumped" />
+    <Word from="kiokflip" to="kickflip" />
+    <Word from="knowjust" to="know just" />
+    <Word from="knowthat" to="know that" />
+    <Word from="knowthis" to="know this" />
+    <Word from="knowwhat" to="know what" />
+    <Word from="knowyet" to="know yet" />
+    <Word from="knowyourlove" to="know your love" />
+    <Word from="korean" to="Korean" />
+    <Word from="L/ght" to="Light" />
+    <Word from="L/kes" to="Likes" />
+    <Word from="L\/Ianuela" to="Manuela" />
+    <Word from="L\/Ianuelal" to="Manuela!" />
+    <Word from="l\/Iauzard" to="Mauzard" />
+    <Word from="l\/Iélanie" to="Mélanie" />
+    <Word from="L\/Iélanie" to="Mélanie" />
+    <Word from="l\/Iom" to="Mom" />
+    <Word from="l\/Iommy" to="Mommy" />
+    <Word from="l\/Ir" to="Mr" />
+    <Word from="l\/Ir." to="Mr." />
+    <Word from="l\/Is" to="Ms" />
+    <Word from="l\/ly" to="My" />
+    <Word from="l_AuGHING" to="LAUGHING" />
+    <Word from="l‘m" to="I'm" />
+    <Word from="Laml6" to="I am l6" />
+    <Word from="Lcad" to="Load" />
+    <Word from="lcan" to="I can" />
+    <Word from="lcan't" to="I can't" />
+    <Word from="lcarl't_" to="I can't." />
+    <Word from="Lcve" to="Love" />
+    <Word from="l'd" to="I'd" />
+    <Word from="L'd" to="I'd" />
+    <Word from="ldid" to="I did" />
+    <Word from="Ldid" to="I did" />
+    <Word from="ldiot" to="Idiot" />
+    <Word from="L'djump" to="I'd jump" />
+    <Word from="ldon't" to="I don't" />
+    <Word from="Ldon't" to="I don't" />
+    <Word from="Lefs" to="Let's" />
+    <Word from="Let'sjust" to="Let's just" />
+    <Word from="lf" to="if" />
+    <Word from="Lf" to="If" />
+    <Word from="lfeelonelung" to="I feel one lung" />
+    <Word from="lfthey" to="if they" />
+    <Word from="lfyou" to="If you" />
+    <Word from="Lfyou" to="If you" />
+    <Word from="lfyou're" to="If you're" />
+    <Word from="lget" to="I get" />
+    <Word from="lgive" to="I give" />
+    <Word from="Li/0/Academy" to="Lilly Academy" />
+    <Word from="li/lr." to="Mr." />
+    <Word from="ligature___" to="ligature..." />
+    <Word from="l'II" to="I'll" />
+    <Word from="l'Il" to="I'll" />
+    <Word from="ljust" to="I just" />
+    <Word from="Ljust" to="I just" />
+    <Word from="ll/Iommy's" to="Mommy's" />
+    <Word from="ll/lajor" to="Major" />
+    <Word from="Ll/lajor" to="Major" />
+    <Word from="ll/layans" to="Mayans" />
+    <Word from="l'lI" to="I'll" />
+    <Word from="l'll" to="I'll" />
+    <Word from="L'll" to="I'll" />
+    <Word from="l'lljust" to="I'll just" />
+    <Word from="L'lltake" to="I'll take" />
+    <Word from="llte" to="lite" />
+    <Word from="l'm" to="I'm" />
+    <Word from="L'm" to="I'm" />
+    <Word from="Lmean" to="I mean" />
+    <Word from="l'mjust" to="I'm just" />
+    <Word from="ln" to="In" />
+    <Word from="lN" to="IN" />
+    <Word from="lNAuDll3LE" to="INAUDIBLE" />
+    <Word from="LNAuDll3LE" to="INAUDIBLE" />
+    <Word from="LNDlsTINcT" to="INDISTINCT" />
+    <Word from="lneed" to="I need" />
+    <Word from="lostyou" to="lost you" />
+    <Word from="Loudmusic" to="Loud music" />
+    <Word from="lraq" to="Iraq" />
+    <Word from="lRA's" to="IRA's" />
+    <Word from="Lrenka" to="Irenka" />
+    <Word from="Lrn" to="I'm" />
+    <Word from="lRS" to="IRS" />
+    <Word from="lsabella" to="Isabella" />
+    <Word from="lsn't" to="isn't" />
+    <Word from="Lsn't" to="Isn't" />
+    <Word from="Lst's" to="Let's" />
+    <Word from="lsuppose" to="I suppose" />
+    <Word from="lt" to="It" />
+    <Word from="ltake" to="I take" />
+    <Word from="ltell" to="I tell" />
+    <Word from="lthink" to="I think" />
+    <Word from="Lthink" to="I think" />
+    <Word from="lthink___" to="I think..." />
+    <Word from="lt'II" to="It'll" />
+    <Word from="lt'Il" to="It'll" />
+    <Word from="ltjammed_" to="It jammed." />
+    <Word from="lt'll" to="It'll" />
+    <Word from="ltold" to="I told" />
+    <Word from="lt's" to="It's" />
+    <Word from="lT'S" to="IT'S" />
+    <Word from="Lt'S" to="It's" />
+    <Word from="Lt'sjust" to="It's just" />
+    <Word from="lv\/asn't" to="I wasn't" />
+    <Word from="l've" to="I've" />
+    <Word from="L've" to="I've" />
+    <Word from="lVIan" to="Man" />
+    <Word from="lVIcHenry" to="McHenry" />
+    <Word from="lVIr." to="Mr." />
+    <Word from="lVlacArthur" to="MacArthur" />
+    <Word from="LVlore" to="More" />
+    <Word from="lVlr" to="Mr" />
+    <Word from="lVlr." to="Mr." />
+    <Word from="lvluslc" to="MUSIC" />
+    <Word from="lVlust" to="Must" />
+    <Word from="LVly" to="Lily" />
+    <Word from="lwaited" to="I waited" />
+    <Word from="lwamoto" to="Iwamoto" />
+    <Word from="lwant" to="I want" />
+    <Word from="lwanted" to="I wanted" />
+    <Word from="lwas" to="I was" />
+    <Word from="lwill" to="I will" />
+    <Word from="lwon't" to="I won't" />
+    <Word from="lworked" to="I worked" />
+    <Word from="lwould" to="I would" />
+    <Word from="lwould've" to="I would've" />
+    <Word from="lx/Iorning" to="Morning" />
+    <Word from="M/dd/e" to="Middle" />
+    <Word from="m/g/7ty" to="mighty" />
+    <Word from="MACH/NE" to="MACHINE" />
+    <Word from="MacKenz/e" to="MacKenzie" />
+    <Word from="majorjackpot" to="major jackpot" />
+    <Word from="majormuscle" to="major muscle" />
+    <Word from="Manuela_" to="Manuela." />
+    <Word from="maste/y" to="mastery" />
+    <Word from="Masturhate" to="Masturbate" />
+    <Word from="Mattei_" to="Mattei." />
+    <Word from="mayjust" to="may just" />
+    <Word from="mbecause" to="&quot;because" />
+    <Word from="McCa/Iister" to="McCallister" />
+    <Word from="McCallisler" to="McCallister" />
+    <Word from="Mccallister" to="McCallister" />
+    <Word from="Mccallisters" to="McCallisters" />
+    <Word from="mcm's" to="mom's" />
+    <Word from="mcney" to="money" />
+    <Word from="mcral" to="moral" />
+    <Word from="mcre" to="more" />
+    <Word from="mcve" to="move" />
+    <Word from="mejust" to="me just" />
+    <Word from="Mexioo" to="Mexico" />
+    <Word from="mi//&lt;" to="milk" />
+    <Word from="misfartune" to="misfortune" />
+    <Word from="Ml6" to="MI6" />
+    <Word from="Mlnd" to="Mind" />
+    <Word from="Mock/'ngbl'rd" to="Mockingbird" />
+    <Word from="mOI'€" to="more" />
+    <Word from="Mom_" to="Mom." />
+    <Word from="monkeyback" to="monkey back" />
+    <Word from="move___l" to="move... I" />
+    <Word from="moveto" to="move to" />
+    <Word from="mustknock" to="must knock" />
+    <Word from="Myheart" to="My heart" />
+    <Word from="myjch" to="my job" />
+    <Word from="myjet" to="my jet" />
+    <Word from="myjob" to="my job" />
+    <Word from="Myjob" to="My job" />
+    <Word from="myjob's" to="my job's" />
+    <Word from="mylife" to="my life" />
+    <Word from="Mynew" to="My new" />
+    <Word from="myown" to="my own" />
+    <Word from="mypants" to="my pants" />
+    <Word from="myselli" to="myself" />
+    <Word from="Myshoes" to="My shoes" />
+    <Word from="mysong" to="my song" />
+    <Word from="mytemper" to="my temper" />
+    <Word from="mythumb" to="my thumb" />
+    <Word from="Myworld" to="My world" />
+    <Word from="N0" to="No" />
+    <Word from="narne" to="name" />
+    <Word from="Natians" to="Nations" />
+    <Word from="naTve" to="naive" />
+    <Word from="nc" to="no" />
+    <Word from="Nc" to="No" />
+    <Word from="ncne" to="none" />
+    <Word from="Ncrth" to="North" />
+    <Word from="ncw" to="new" />
+    <Word from="Ncw" to="Now" />
+    <Word from="needyou" to="need you" />
+    <Word from="neighboun" to="neighbour" />
+    <Word from="neverfound" to="never found" />
+    <Word from="neverthere" to="never there" />
+    <Word from="neverv\/ill_" to="never will." />
+    <Word from="NewJersey" to="New Jersey" />
+    <Word from="newjob" to="new job" />
+    <Word from="newjobs" to="new jobs" />
+    <Word from="nextdoor" to="next door" />
+    <Word from="Nighw" to="Nighty" />
+    <Word from="nilios" to="niños" />
+    <Word from="Nlagnificence" to="Magnificence" />
+    <Word from="Nlakes" to="Makes" />
+    <Word from="Nlalina" to="Malina" />
+    <Word from="Nlan" to="Man" />
+    <Word from="Nlarch" to="March" />
+    <Word from="Nlarine" to="Marine" />
+    <Word from="Nlarion" to="Marion" />
+    <Word from="Nlarry" to="Marry" />
+    <Word from="Nlars" to="Mars" />
+    <Word from="Nlarty" to="Marty" />
+    <Word from="Nle" to="Me" />
+    <Word from="Nleet" to="Meet" />
+    <Word from="Nlen" to="Men" />
+    <Word from="Nlom" to="Mom" />
+    <Word from="Nlore" to="More" />
+    <Word from="Nlornin" to="Mornin" />
+    <Word from="Nlother" to="Mother" />
+    <Word from="Nlr" to="Mr" />
+    <Word from="Nlr." to="Mr." />
+    <Word from="Nlrs" to="Mrs" />
+    <Word from="Nluch" to="Much" />
+    <Word from="nojurisdiction" to="no jurisdiction" />
+    <Word from="noone" to="no one" />
+    <Word from="Noone" to="No one" />
+    <Word from="not judging" to="not judging" />
+    <Word from="notgoing" to="not going" />
+    <Word from="notjunk" to="not junk" />
+    <Word from="Notjunk" to="Not junk" />
+    <Word from="notjust" to="not just" />
+    <Word from="notsure" to="not sure" />
+    <Word from="novv" to="now" />
+    <Word from="Nowjust" to="Now just" />
+    <Word from="Nowthat's" to="Now that's" />
+    <Word from="Numbertwo" to="Number two" />
+    <Word from="oan't" to="can't" />
+    <Word from="oan'tjust" to="can't just" />
+    <Word from="objecl" to="object" />
+    <Word from="occultpowerand" to="occult power and" />
+    <Word from="Ocps" to="Oops" />
+    <Word from="ofa" to="of a" />
+    <Word from="ofajudge" to="of a judge" />
+    <Word from="ofall" to="of all" />
+    <Word from="Ofall" to="Of all" />
+    <Word from="ofBedford" to="of Bedford" />
+    <Word from="ofcourse" to="of course" />
+    <Word from="Ofcourse" to="Of course" />
+    <Word from="ofeach" to="of each" />
+    <Word from="ofeither" to="of either" />
+    <Word from="Offioer's" to="Officer's" />
+    <Word from="ofFrance" to="of France" />
+    <Word from="offreedom" to="of freedom" />
+    <Word from="offthe" to="off the" />
+    <Word from="offthis" to="off this" />
+    <Word from="offto" to="off to" />
+    <Word from="offun" to="of fun" />
+    <Word from="ofguy" to="of guy" />
+    <Word from="Ofhce" to="Office" />
+    <Word from="ofhis" to="of his" />
+    <Word from="ofHis" to="of His" />
+    <Word from="ofhoneybees" to="of honeybees" />
+    <Word from="ofit" to="of it" />
+    <Word from="ofjam" to="of jam" />
+    <Word from="OFJOAN" to="OF JOAN" />
+    <Word from="ofjoy" to="of joy" />
+    <Word from="ofjunior" to="of junior" />
+    <Word from="ofme" to="of me" />
+    <Word from="ofmead" to="of mead" />
+    <Word from="ofmicroinjections" to="of microinjections" />
+    <Word from="ofmy" to="of my" />
+    <Word from="ofNew" to="of New" />
+    <Word from="ofNorris'" to="of Norris'" />
+    <Word from="ofopinions" to="of opinions" />
+    <Word from="ofour" to="of our" />
+    <Word from="ofpeopla" to="of people" />
+    <Word from="ofthat" to="of that" />
+    <Word from="ofthe" to="of the" />
+    <Word from="Ofthe" to="Of the" />
+    <Word from="oftheir" to="of their" />
+    <Word from="ofthem" to="of them" />
+    <Word from="ofthem's" to="of them's" />
+    <Word from="ofthemselves" to="of themselves" />
+    <Word from="ofthere" to="of there" />
+    <Word from="ofthese" to="of these" />
+    <Word from="ofthings" to="of things" />
+    <Word from="ofthis" to="of this" />
+    <Word from="ofthlngs" to="of things" />
+    <Word from="ofthose" to="of those" />
+    <Word from="ofuse" to="of use" />
+    <Word from="ofwashington" to="of Washington" />
+    <Word from="ofyou" to="of you" />
+    <Word from="ofyour" to="of your" />
+    <Word from="OId" to="Old" />
+    <Word from="OIsson" to="Olsson" />
+    <Word from="Ok3Y" to="Okay" />
+    <Word from="okaY" to="okay" />
+    <Word from="OkaY" to="Okay" />
+    <Word from="OKaY" to="Okay" />
+    <Word from="OKGY" to="Okay" />
+    <Word from="Ol&lt;" to="Ole" />
+    <Word from="oldAdolfon" to="old Adolf on" />
+    <Word from="onboard" to="on board" />
+    <Word from="onIy" to="only" />
+    <Word from="onIything" to="only thing" />
+    <Word from="onJanuaw" to="on January" />
+    <Word from="onlyjust" to="only just" />
+    <Word from="Onyinal" to="Original" />
+    <Word from="oomprise" to="comprise" />
+    <Word from="oonstitution" to="constitution" />
+    <Word from="oouldn't" to="couldn't" />
+    <Word from="oould've" to="could've" />
+    <Word from="oousin's" to="cousin's" />
+    <Word from="opiimistically" to="optimistically" />
+    <Word from="ora" to="or a" />
+    <Word from="orfall" to="or fall" />
+    <Word from="orglory" to="or glory" />
+    <Word from="orjust" to="or just" />
+    <Word from="Orjust" to="Or just" />
+    <Word from="Orthat" to="Or that" />
+    <Word from="orwould" to="or would" />
+    <Word from="Orwould" to="Or would" />
+    <Word from="Othenzvise" to="Otherwise" />
+    <Word from="our joumey" to="our journey" />
+    <Word from="ourbrave" to="our brave" />
+    <Word from="ourfathers" to="our fathers" />
+    <Word from="ourgirlon" to="our girl on" />
+    <Word from="Ourgoal" to="Our goal" />
+    <Word from="Ourguy" to="Our guy" />
+    <Word from="ourj0b's" to="our job's" />
+    <Word from="Ourj0b's" to="Our job's" />
+    <Word from="ourjobs" to="our jobs" />
+    <Word from="ourjob's" to="our job's" />
+    <Word from="Ourjob's" to="Our job's" />
+    <Word from="ourjoumey" to="our journey" />
+    <Word from="ourphotos" to="our photos" />
+    <Word from="ourv\/ay" to="our way" />
+    <Word from="outlool&lt;'s" to="outlook's" />
+    <Word from="overme" to="over me" />
+    <Word from="overthe" to="over the" />
+    <Word from="overthere" to="over there" />
+    <Word from="p/ace" to="place" />
+    <Word from="P/ease" to="Please" />
+    <Word from="p_m_" to="p.m." />
+    <Word from="P°P$" to="Pops" />
+    <Word from="PANUNG" to="PANTING" />
+    <Word from="pclnt" to="point" />
+    <Word from="pclnts" to="points" />
+    <Word from="pe0pIe" to="people" />
+    <Word from="Perrut_" to="Perrut." />
+    <Word from="Persona/4/" to="Personally" />
+    <Word from="Persona/y" to="Personally" />
+    <Word from="persors" to="person's" />
+    <Word from="PIain" to="Plain" />
+    <Word from="PIease" to="Please" />
+    <Word from="PIeasure" to="Pleasure" />
+    <Word from="PIus" to="Plus" />
+    <Word from="pleasurlng" to="pleasuring" />
+    <Word from="POIe" to="Pole" />
+    <Word from="Polynes/ans" to="Polynesians" />
+    <Word from="poorshowing" to="poor showing" />
+    <Word from="popsicle" to="Popsicle" />
+    <Word from="Presidenfs" to="President's" />
+    <Word from="probablyjust" to="probably just" />
+    <Word from="puIIing" to="pulling" />
+    <Word from="Putyourhand" to="Put your hand" />
+    <Word from="Qh" to="Oh" />
+    <Word from="QkaY" to="Okay" />
+    <Word from="Qpen" to="Open" />
+    <Word from="QUYS" to="GUYS" />
+    <Word from="_QW" to="Aw" />
+    <Word from="r/ght" to="right" />
+    <Word from="ralnbow" to="rainbow" />
+    <Word from="ratherjump" to="rather jump" />
+    <Word from="ratherjust" to="rather just" />
+    <Word from="Rcque" to="Roque" />
+    <Word from="rcscucd" to="rescued" />
+    <Word from="rea/" to="real" />
+    <Word from="readytolaunchu" to="ready to launch..." />
+    <Word from="reaHy" to="really" />
+    <Word from="ReaHy" to="Really" />
+    <Word from="reallyjust" to="really just" />
+    <Word from="reallymiss" to="really miss" />
+    <Word from="reallytalked" to="really talked" />
+    <Word from="reallythink" to="really think" />
+    <Word from="reallythinkthis" to="really think this" />
+    <Word from="rememberthem" to="remember them" />
+    <Word from="reoalibrated" to="recalibrated" />
+    <Word from="retum" to="return" />
+    <Word from="rhfluence" to="influence" />
+    <Word from="rightdown" to="right down" />
+    <Word from="roadyou" to="road you" />
+    <Word from="RUMBUNG" to="RUMBLING" />
+    <Word from="s/uggikh" to="sluggish" />
+    <Word from="S0" to="So" />
+    <Word from="S1oW1y" to="Slowly" />
+    <Word from="saidyou" to="said you" />
+    <Word from="sayeverything's" to="say everything's" />
+    <Word from="saynothing" to="say nothing" />
+    <Word from="saythat" to="say that" />
+    <Word from="sc" to="so" />
+    <Word from="scientihc" to="scientific" />
+    <Word from="SCREAIVHNG" to="SCREAMING" />
+    <Word from="sCREAlvllNG" to="SCREAMING" />
+    <Word from="SCREAlvllNG" to="SCREAMING" />
+    <Word from="scund" to="sound" />
+    <Word from="S'EOp" to="Stop" />
+    <Word from="severa/parents" to="several parents" />
+    <Word from="sfill" to="still" />
+    <Word from="Sflence" to="Silence" />
+    <Word from="shallrise" to="shall rise" />
+    <Word from="sHATTERING" to="SHATTERING" />
+    <Word from="shcws" to="shows" />
+    <Word from="Shdsjust" to="She's just" />
+    <Word from="She`s" to="She's" />
+    <Word from="She‘II" to="She'll" />
+    <Word from="she'II" to="she'll" />
+    <Word from="She'II" to="She'll" />
+    <Word from="she'Il" to="she'll" />
+    <Word from="Shejust" to="She just" />
+    <Word from="she'lI" to="she'll" />
+    <Word from="Shoofing" to="Shooting" />
+    <Word from="ShOp" to="shop" />
+    <Word from="shortyears" to="short years" />
+    <Word from="shou/dn" to="shouldn’t" />
+    <Word from="shoufing" to="shouting" />
+    <Word from="Shouflng" to="Shouting" />
+    <Word from="shouldnt" to="shouldn't" />
+    <Word from="Shouldrt" to="Shouldn't" />
+    <Word from="shouldrt" to="shouldn't" />
+    <Word from="Shs's" to="She's" />
+    <Word from="SHUDDERWG" to="SHUDDERING" />
+    <Word from="Shutup" to="Shut up" />
+    <Word from="SIGH$" to="SIGHS" />
+    <Word from="signifcance" to="significance" />
+    <Word from="Sincc" to="Since" />
+    <Word from="sistervvill" to="sister will" />
+    <Word from="Skarsgérd" to="Skarsgård" />
+    <Word from="slcsHs" to="SIGHS" />
+    <Word from="slGHINcs" to="SIGHING" />
+    <Word from="slGHING" to="SIGHING" />
+    <Word from="slNGING" to="SINGING" />
+    <Word from="slzzLING" to="SIZZLING" />
+    <Word from="smarfest" to="smartest" />
+    <Word from="Smiih" to="Smith" />
+    <Word from="so/id" to="solid" />
+    <Word from="SoBl3lNG" to="SOBBING" />
+    <Word from="soemtimes" to="sometimes" />
+    <Word from="Sojust" to="So just" />
+    <Word from="soldierl" to="soldier!" />
+    <Word from="somethlng" to="something" />
+    <Word from="somethlng's" to="something's" />
+    <Word from="somez'/7/ng" to="something" />
+    <Word from="somthing" to="something" />
+    <Word from="sumthing" to="something" />
+    <Word from="sou/" to="soul" />
+    <Word from="SoundofMusic" to="Sound of Music" />
+    <Word from="SP/ash" to="Splash" />
+    <Word from="SPEAK/NG" to="SPEAKING" />
+    <Word from="speII" to="spell" />
+    <Word from="speII's" to="spell's" />
+    <Word from="Spendourtime" to="Spend our time" />
+    <Word from="sQUA\/\/KING" to="SQUAWKING" />
+    <Word from="StAnton" to="St Anton" />
+    <Word from="stealsjeans" to="steals jeans" />
+    <Word from="StilI" to="Still" />
+    <Word from="Stilldesperatelyseeking" to="Still desperately seeking" />
+    <Word from="stlll" to="still" />
+    <Word from="sToPs" to="STOPS" />
+    <Word from="storyl" to="story!" />
+    <Word from="Stubbom" to="Stubborn" />
+    <Word from="su/faces" to="surfaces" />
+    <Word from="suffocaiing" to="suffocating" />
+    <Word from="summerjob" to="summer job" />
+    <Word from="Summerjust" to="Summer just" />
+    <Word from="sun/ive" to="survive" />
+    <Word from="superiorman" to="superior man" />
+    <Word from="surflaces" to="surfaces" />
+    <Word from="t/ying" to="trying" />
+    <Word from="T0" to="To" />
+    <Word from="T00" to="Too" />
+    <Word from="ta/ks" to="talks" />
+    <Word from="taiked" to="talked" />
+    <Word from="talkto" to="talk to" />
+    <Word from="Talkto" to="Talk to" />
+    <Word from="talktonight" to="talk tonight" />
+    <Word from="tampax" to="Tampax" />
+    <Word from="tc" to="to" />
+    <Word from="tcday" to="today" />
+    <Word from="tcrturing" to="torturing" />
+    <Word from="tcuch" to="touch" />
+    <Word from="te//" to="tell" />
+    <Word from="tearjust" to="tear just" />
+    <Word from="tellsjokes" to="tells jokes" />
+    <Word from="tellyou" to="tell you" />
+    <Word from="terriers_" to="terriers." />
+    <Word from="th/nk" to="think" />
+    <Word from="THEPASSION" to="THE PASSION" />
+    <Word from="thafs" to="that's" />
+    <Word from="Thafs" to="That's" />
+    <Word from="Thai's" to="That's" />
+    <Word from="Thal's" to="That's" />
+    <Word from="thankyou" to="thank you" />
+    <Word from="Thankyou" to="Thank you" />
+    <Word from="thatconverts" to="that converts" />
+    <Word from="thatgoes" to="that goes" />
+    <Word from="that'II" to="that'll" />
+    <Word from="That'II" to="That'll" />
+    <Word from="thatjob" to="that job" />
+    <Word from="thatjunk" to="that junk" />
+    <Word from="thatjust" to="that just" />
+    <Word from="thatleads" to="that leads" />
+    <Word from="Thatl'm" to="That I'm" />
+    <Word from="that's just" to="that's just" />
+    <Word from="Thatsand" to="That sand" />
+    <Word from="that'sjust" to="that's just" />
+    <Word from="That'sjust" to="That's just" />
+    <Word from="Thc" to="The" />
+    <Word from="theirface" to="their face" />
+    <Word from="theirfeet" to="their feet" />
+    <Word from="theirfury" to="their fury" />
+    <Word from="thejaw" to="the jaw" />
+    <Word from="thejoint" to="the joint" />
+    <Word from="thejudge" to="the judge" />
+    <Word from="thejudges" to="the judges" />
+    <Word from="Thejudges" to="The judges" />
+    <Word from="thejury" to="the jury" />
+    <Word from="Thelook" to="The look" />
+    <Word from="Therds" to="There's" />
+    <Word from="There'II" to="There'll" />
+    <Word from="There'Il" to="There'll" />
+    <Word from="There'lI" to="There'll" />
+    <Word from="They'/'e" to="They're" />
+    <Word from="they/'II" to="they'll" />
+    <Word from="They/re" to="They're" />
+    <Word from="They/'re" to="They're" />
+    <Word from="they'II" to="they'll" />
+    <Word from="they'Il" to="they'll" />
+    <Word from="theyjust" to="they just" />
+    <Word from="Theyjust" to="They just" />
+    <Word from="they'lI" to="they'll" />
+    <Word from="They'lI" to="They'll" />
+    <Word from="theyre" to="they're" />
+    <Word from="theysay" to="they say" />
+    <Word from="thinkthat" to="think that" />
+    <Word from="this'II" to="this'll" />
+    <Word from="thlngs" to="things" />
+    <Word from="Thlnkthls" to="Think this" />
+    <Word from="thls" to="this" />
+    <Word from="thore's" to="there's" />
+    <Word from="Thore's" to="There's" />
+    <Word from="Thorjust" to="Thor just" />
+    <Word from="thoughtl'dletyou" to="thought I'd let you" />
+    <Word from="tnatjust" to="that just" />
+    <Word from="tnat's" to="that's" />
+    <Word from="Tnat's" to="That's" />
+    <Word from="Tnere'll" to="There'll" />
+    <Word from="to//et" to="toilet" />
+    <Word from="To//S" to="Tolls" />
+    <Word from="todayl'd" to="today I'd" />
+    <Word from="togelher" to="together" />
+    <Word from="togethen" to="together" />
+    <Word from="tojoin" to="to join" />
+    <Word from="tojudge" to="to judge" />
+    <Word from="toldyou" to="told you" />
+    <Word from="tomorrovv" to="tomorrow" />
+    <Word from="Tonighfsjust" to="Tonight's just" />
+    <Word from="totake" to="to take" />
+    <Word from="totalk" to="to talk" />
+    <Word from="tothat" to="to that" />
+    <Word from="tothe" to="to the" />
+    <Word from="Towef" to="Tower" />
+    <Word from="Tr/ck/ing" to="Trickling" />
+    <Word from="Traitur" to="Traitor" />
+    <Word from="tv\/o" to="two" />
+    <Word from="tvvelve" to="twelve" />
+    <Word from="Tvvelve" to="Twelve" />
+    <Word from="tvventy" to="tvventy" />
+    <Word from="Tvventy" to="Tvventy" />
+    <Word from="tvvo" to="two" />
+    <Word from="Tvvo" to="Two" />
+    <Word from="twc" to="two" />
+    <Word from="unconhrmed" to="unconfirmed" />
+    <Word from="underthat" to="under that" />
+    <Word from="underthe" to="under the" />
+    <Word from="underthese" to="under these" />
+    <Word from="underyour" to="under your" />
+    <Word from="unfilyou" to="until you" />
+    <Word from="Unfon'unate/y" to="Unfortunately" />
+    <Word from="Uninnabited" to="Uninhabited" />
+    <Word from="untilApril" to="until April" />
+    <Word from="untilyou" to="until you" />
+    <Word from="upthinking" to="up thinking" />
+    <Word from="upto" to="up to" />
+    <Word from="V\/ait___" to="Wait..." />
+    <Word from="v\/as" to="was" />
+    <Word from="V\/as" to="Was" />
+    <Word from="V\/e" to="We" />
+    <Word from="v\/eek's" to="week's" />
+    <Word from="V\/eird_" to="Weird." />
+    <Word from="V\/ell" to="Well" />
+    <Word from="V\/hat" to="what" />
+    <Word from="V\/hen'll" to="When'll" />
+    <Word from="V\/ho" to="Who" />
+    <Word from="v\/ho'll" to="who'll" />
+    <Word from="v\/Hoops" to="Whoops" />
+    <Word from="v\/ho's" to="who's" />
+    <Word from="V\/ho's" to="Who's" />
+    <Word from="V\/hy" to="Why" />
+    <Word from="v\/ith" to="with" />
+    <Word from="v\/on't" to="won't" />
+    <Word from="V\fith" to="With" />
+    <Word from="V\fithin" to="Within" />
+    <Word from="valedictolian" to="valedictorian" />
+    <Word from="vcice" to="voice" />
+    <Word from="ve/y" to="very" />
+    <Word from="veiy" to="very" />
+    <Word from="Véry" to="Very" />
+    <Word from="versioin" to="version" />
+    <Word from="vi/ay" to="way" />
+    <Word from="visitjails" to="visit jails" />
+    <Word from="Viva/di's" to="Vivaldi's" />
+    <Word from="vlll" to="vill" />
+    <Word from="Voilá" to="Voilà" />
+    <Word from="Voilé" to="Voilà" />
+    <Word from="vvasjust" to="was just" />
+    <Word from="VVasn't" to="Wasn't" />
+    <Word from="vvay" to="way" />
+    <Word from="VVe" to="We" />
+    <Word from="VVe'II" to="We'll" />
+    <Word from="VVe'll" to="We'll" />
+    <Word from="Vvelooked" to="We looked" />
+    <Word from="VVe're" to="We're" />
+    <Word from="VVe've" to="We've" />
+    <Word from="VVhat" to="What" />
+    <Word from="VVhat's" to="What's" />
+    <Word from="VVhat'S" to="What's" />
+    <Word from="VVhen" to="When" />
+    <Word from="'v'Vhere's" to="Where's" />
+    <Word from="VVhip" to="Whip" />
+    <Word from="vvHooPING" to="WHOOPING" />
+    <Word from="VvHooPING" to="WHOOPING" />
+    <Word from="VVhy" to="Why" />
+    <Word from="VVill" to="Will" />
+    <Word from="VVinters" to="Winters" />
+    <Word from="vvlND" to="WIND" />
+    <Word from="w¤n't" to="won't" />
+    <Word from="W9" to="We" />
+    <Word from="waht" to="want" />
+    <Word from="waierfall" to="waterfall" />
+    <Word from="walkjust" to="walk just" />
+    <Word from="wallplant" to="wall plant" />
+    <Word from="wannajump" to="wanna jump" />
+    <Word from="wantyou" to="want you" />
+    <Word from="Warcontinues" to="War continues" />
+    <Word from="wasjennifer" to="was Jennifer" />
+    <Word from="wasjust" to="was just" />
+    <Word from="wasrt" to="wasn't" />
+    <Word from="Wasrt" to="Wasn't" />
+    <Word from="wayl" to="way I" />
+    <Word from="wayround" to="way round" />
+    <Word from="wclf" to="wolf" />
+    <Word from="wcman" to="woman" />
+    <Word from="wcmen" to="women" />
+    <Word from="wcn't" to="won't" />
+    <Word from="wcrse" to="worse" />
+    <Word from="wculd" to="would" />
+    <Word from="We//" to="Well" />
+    <Word from="We/came" to="Welcome" />
+    <Word from="we/come" to="welcome" />
+    <Word from="We/come" to="Welcome" />
+    <Word from="We/I" to="Well" />
+    <Word from="weekendjust" to="weekend just" />
+    <Word from="werert" to="weren't" />
+    <Word from="Werert" to="Weren't" />
+    <Word from="we'II" to="we'll" />
+    <Word from="We'II" to="We'll" />
+    <Word from="we'Il" to="we'll" />
+    <Word from="We'Il" to="We'll" />
+    <Word from="wejust" to="we just" />
+    <Word from="we'lI" to="we'll" />
+    <Word from="We'rejust" to="We're just" />
+    <Word from="We'ro" to="We're" />
+    <Word from="We'Ve" to="We've" />
+    <Word from="wh/p" to="whip" />
+    <Word from="Wh°ops" to="Whoops" />
+    <Word from="Whafs" to="What's" />
+    <Word from="Whatam" to="What am" />
+    <Word from="Whatare" to="What are" />
+    <Word from="Whateverwe" to="Whatever we" />
+    <Word from="What'II" to="What'll" />
+    <Word from="Whatis" to="What is" />
+    <Word from="whatjust" to="what just" />
+    <Word from="Whatl" to="What I" />
+    <Word from="whatshe" to="what she" />
+    <Word from="whatwe" to="what we" />
+    <Word from="Whc's" to="Who's" />
+    <Word from="Whcse" to="Whose" />
+    <Word from="wHlsPERs" to="WHISPERS" />
+    <Word from="wi//" to="will" />
+    <Word from="wil/" to="will" />
+    <Word from="Wil/" to="Will" />
+    <Word from="wilI" to="will" />
+    <Word from="willbe" to="will be" />
+    <Word from="willhire" to="will hire" />
+    <Word from="willneverknow" to="will never know" />
+    <Word from="willyou" to="will you" />
+    <Word from="wlfe" to="wife" />
+    <Word from="wlfe's" to="wife's" />
+    <Word from="wlth" to="with" />
+    <Word from="wnat's" to="what's" />
+    <Word from="Wno" to="Who" />
+    <Word from="Wo/f" to="Wolf" />
+    <Word from="wofld" to="world" />
+    <Word from="WOI'1't" to="won't" />
+    <Word from="wondernobody" to="wonder nobody" />
+    <Word from="won'T" to="won't" />
+    <Word from="won'tanswerme" to="won't answer me" />
+    <Word from="won'tforget" to="won't forget" />
+    <Word from="won'tletitbring" to="won't let it bring" />
+    <Word from="Wo're" to="We're" />
+    <Word from="worfd" to="world" />
+    <Word from="won'th" to="worth" />
+    <Word from="won'thwhile" to="worthwhile" />
+    <Word from="workyou" to="work you" />
+    <Word from="wouIdn't" to="wouldn't" />
+    <Word from="wouldn'!" to="wouldn't" />
+    <Word from="Wouldrt" to="Wouldn't" />
+    <Word from="wr/'2'/ng" to="writing" />
+    <Word from="writign" to="writing" />
+    <Word from="wrcng" to="wrong" />
+    <Word from="wuuld" to="would" />
+    <Word from="_Yay" to="Yay" />
+    <Word from="Y¤u'II" to="You'll" />
+    <Word from="Y¤u'll" to="You'll" />
+    <Word from="y¤u're" to="you're" />
+    <Word from="Y¤u're" to="You're" />
+    <Word from="y¤u've" to="you've" />
+    <Word from="Y0" to="Yo" />
+    <Word from="y0LI" to="you" />
+    <Word from="y0u'II" to="you'll" />
+    <Word from="Y0u'rc" to="You're" />
+    <Word from="Y0u're" to="You're" />
+    <Word from="Y0u've" to="You've" />
+    <Word from="yaming" to="yarning" />
+    <Word from="yaurparents" to="your parents" />
+    <Word from="ycu" to="you" />
+    <Word from="ycu'd" to="you'd" />
+    <Word from="ycur" to="your" />
+    <Word from="Ycu're" to="You're" />
+    <Word from="Ycursins" to="Your sins" />
+    <Word from="YEI_I_" to="YELL" />
+    <Word from="YELL$" to="YELLS" />
+    <Word from="yigg/mg" to="giggling" />
+    <Word from="Yigg/mg" to="giggling" />
+    <Word from="yoLI" to="you" />
+    <Word from="yOu" to="you" />
+    <Word from="yOU" to="you" />
+    <Word from="you`re" to="you're" />
+    <Word from="you'II" to="you'll" />
+    <Word from="You'II" to="You'll" />
+    <Word from="You'Il" to="You'll" />
+    <Word from="youjack" to="you jack" />
+    <Word from="youjoin" to="you join" />
+    <Word from="Youjoin" to="You join" />
+    <Word from="youjust" to="you just" />
+    <Word from="You'lI" to="You'll" />
+    <Word from="youngsterlike" to="youngster like" />
+    <Word from="youpick" to="you pick" />
+    <Word from="you'ra" to="you're" />
+    <Word from="Yourattention" to="Your attention" />
+    <Word from="yourautomobile" to="your automobile" />
+    <Word from="You'rejustjealous" to="You're just jealous" />
+    <Word from="yourextra" to="your extra" />
+    <Word from="yourfather" to="your father" />
+    <Word from="yourhand" to="your hand" />
+    <Word from="yourhusband" to="your husband" />
+    <Word from="yourjewelry" to="your jewelry" />
+    <Word from="yourjob" to="your job" />
+    <Word from="Yourjob" to="Your job" />
+    <Word from="yourjob_" to="your job." />
+    <Word from="yourjockey" to="your jockey" />
+    <Word from="yourjury" to="your jury" />
+    <Word from="yourname" to="your name" />
+    <Word from="Yourpackage" to="Your package" />
+    <Word from="yourpackage" to="your package" />
+    <Word from="you'ro" to="you're" />
+    <Word from="yourpoorleg" to="your poor leg" />
+    <Word from="yourvveak" to="your weak" />
+    <Word from="you'va" to="you've" />
+    <Word from="You'va" to="You've" />
+    <Word from="youWlneversee" to="you'll never see" />
+    <Word from="yQu" to="you" />
+    <Word from="YQu" to="You" />
+    <Word from="yQu'_7" to="you?" />
+    <Word from="yummY" to="yummy" />
+    <Word from="yuu" to="you" />
+    <Word from="Yuu" to="You" />
+    <Word from="Yuu've" to="You've" />
+    <Word from="z'housand" to="thousand" />
+    <Word from="zlPPING" to="ZIPPING" />
+    <Word from="Ifslocked" to="It's locked" />
+    <Word from="nightjust" to="night just" />
+    <Word from="dayjourney" to="day journey" />
+    <Word from="Ourjob" to="Our job" />
+    <Word from="IunCh" to="lunch" />
+    <Word from="nieCe" to="niece" />
+    <Word from="giVes" to="gives" />
+    <Word from="wantto" to="want to" />
+    <Word from="besttoday" to="best today" />
+    <Word from="NiCe" to="Nice" />
+    <Word from="oftravelling" to="of travelling" />
+    <Word from="oftwo" to="of two" />
+    <Word from="ALl" to="ALI" />
+    <Word from="afterparty" to="after-party" />
+    <Word from="welL" to="well." />
+    <Word from="theirjob" to="their job" />
+    <Word from="lfhe's" to="If he's" />
+    <Word from="babyjesus" to="baby Jesus" />
+    <Word from="shithousejohn" to="shithouse John" />
+    <Word from="jesus" to="Jesus" />
+    <Word from="withjesus" to="with Jesus" />
+    <Word from="Gojoin" to="Go join" />
+    <Word from="Adaughter" to="A daughter" />
+    <Word from="talkwith" to="talk with" />
+    <Word from="anyjournals" to="any journals" />
+    <Word from="L'mjewish" to="I'm Jewish" />
+    <Word from="arejust" to="are just" />
+    <Word from="soundjust" to="sound just" />
+    <Word from="ifl'm" to="if I'm" />
+    <Word from="askyou" to="ask you" />
+    <Word from="ordinarywoman" to="ordinary woman" />
+    <Word from="andjunkies" to="and junkies" />
+    <Word from="isjack" to="is Jack" />
+    <Word from="helpyou" to="help you" />
+    <Word from="thinkyou" to="think you" />
+    <Word from="Lordjesus" to="Lord Jesus" />
+    <Word from="injuvy" to="in juvy" />
+    <Word from="thejets" to="the jets" />
+    <Word from="ifGod" to="if God" />
+    <Word from="againstjewish" to="against Jewish" />
+    <Word from="ajunkie" to="a junkie" />
+    <Word from="dearjesus" to="dear Jesus" />
+    <Word from="hearyour" to="hear your" />
+    <Word from="takeyears" to="take years" />
+    <Word from="friendjean" to="friend Jean" />
+    <Word from="Fatherjohn" to="Father John" />
+    <Word from="youjean" to="you Jean" />
+    <Word from="hearyou" to="hear you" />
+    <Word from="Ifshe" to="If she" />
+    <Word from="didn'tjust" to="didn't just" />
+    <Word from="IfGod" to="If God" />
+    <Word from="notjudge" to="not judge" />
+    <Word from="andjudge" to="and judge" />
+    <Word from="OKBY" to="Okay" />
+    <Word from="myjourney" to="my journey" />
+    <Word from="yourpremium" to="your premium" />
+    <Word from="we'rejust" to="we're just" />
+    <Word from="Iittlejokes" to="little jokes" />
+    <Word from="Iifejust" to="life just" />
+    <Word from="Andjust" to="And just" />
+    <Word from="ofThe" to="of The" />
+    <Word from="lifejust" to="life just" />
+    <Word from="AIice" to="Alice" />
+    <Word from="lnternationalAirport" to="International Airport" />
+    <Word from="yourbody" to="your body" />
+    <Word from="DollarBaby" to="Dollar Baby" />
+    <Word from="ofjonesing" to="of jonesing" />
+    <Word from="yourpanties" to="your panties" />
+    <Word from="offforme" to="off for me" />
+    <Word from="pantyparty" to="panty party" />
+    <Word from="everhit" to="ever hit" />
+    <Word from="theirhomes" to="their homes" />
+    <Word from="AirForce" to="Air Force" />
+    <Word from="yourhead" to="your head" />
+    <Word from="betterbe" to="better be" />
+    <Word from="myparty" to="my party" />
+    <Word from="disasterlockdown" to="disaster lockdown" />
+    <Word from="Ifpot's" to="If pot's" />
+    <Word from="ifmy" to="if my" />
+    <Word from="yourmoney" to="your money" />
+    <Word from="Potterfan" to="Potter fan" />
+    <Word from="Hermionejust" to="Hermione just" />
+    <Word from="ofourshit" to="of our shit" />
+    <Word from="showyou" to="show you" />
+    <Word from="answernow" to="answer now" />
+    <Word from="theirsjust" to="theirs just" />
+    <Word from="BIackie" to="Blackie" />
+    <Word from="SIeep" to="Sleep" />
+    <Word from="foryour" to="for your" />
+    <Word from="oryour" to="or your" />
+    <Word from="forArthur" to="for Arthur" />
+    <Word from="CIamp" to="Clamp" />
+    <Word from="CIass" to="Class" />
+    <Word from="CIose" to="Close" />
+    <Word from="GIove" to="Glove" />
+    <Word from="EIIen" to="Ellen" />
+    <Word from="PIay" to="Play" />
+    <Word from="PIace" to="Place" />
+    <Word from="EIgyn" to="Elgyn" />
+    <Word from="AIert" to="Alert" />
+    <Word from="CIaus" to="Claus" />
+    <Word from="CIimb" to="Climb" />
+    <Word from="military'II" to="military'll" />
+    <Word from="anylonget" to="any longer" />
+    <Word from="yourlife" to="your life" />
+    <Word from="Yourbitch'IIgetyou" to="Your bitch'll get you" />
+    <Word from="yourdick" to="your dick" />
+    <Word from="Tellyourbitch" to="Tell your bitch" />
+    <Word from="rememberyou" to="remember you" />
+    <Word from="newface" to="new face" />
+    <Word from="Butyou" to="But you" />
+    <Word from="don'tyou" to="don't you" />
+    <Word from="yourlives" to="your lives" />
+    <Word from="Iovedher" to="loved her" />
+    <Word from="reallydid" to="really did" />
+    <Word from="firstperson" to="first person" />
+    <Word from="mybest" to="my best" />
+    <Word from="Justgive" to="Just give" />
+    <Word from="AIong" to="Along" />
+    <Word from="atyourbody" to="at your body" />
+    <Word from="myhands" to="my hands" />
+    <Word from="sayhe" to="say he" />
+    <Word from="mybooty" to="my booty" />
+    <Word from="yourbooty" to="your booty" />
+    <Word from="yourgirl" to="your girl" />
+    <Word from="yourlegs" to="your legs" />
+    <Word from="betterifthey" to="better if they" />
+    <Word from="manybeautiful" to="many beautiful" />
+    <Word from="contactpolice" to="contact police" />
+    <Word from="numberbelow" to="number below" />
+    <Word from="biggestproblem" to="biggest problem" />
+    <Word from="Itgave" to="It gave" />
+    <Word from="everybodykind" to="everybody kind" />
+    <Word from="theyhad" to="they had" />
+    <Word from="knowherlast" to="know her last" />
+    <Word from="herhearing" to="her hearing" />
+    <Word from="othermembers" to="other members" />
+    <Word from="BIing" to="Bling" />
+    <Word from="CIyde" to="Clyde" />
+    <Word from="foundguilty" to="found guilty" />
+    <Word from="fouryears" to="four years" />
+    <Word from="countyjail" to="county jail" />
+    <Word from="yearin" to="year in" />
+    <Word from="theirrole" to="their role" />
+    <Word from="manybottles" to="many bottles" />
+    <Word from="can'tpronounce" to="can't pronounce" />
+    <Word from="manybowls" to="many bowls" />
+    <Word from="ofthatgreen" to="of that green" />
+    <Word from="manyjoyrides" to="many joyrides" />
+    <Word from="Superrich" to="Super rich" />
+    <Word from="Iprefer" to="I prefer" />
+    <Word from="Theymust" to="They must" />
+    <Word from="whatyou" to="what you" />
+    <Word from="I'IIjump" to="I'll jump" />
+    <Word from="nobodyknow" to="nobody know" />
+    <Word from="neverknew" to="never knew" />
+    <Word from="EIectronica" to="Electronica" />
+    <Word from="AIarm" to="Alarm" />
+    <Word from="getyourman" to="get your man" />
+    <Word from="sayyou" to="say you" />
+    <Word from="getyour" to="get your" />
+    <Word from="Fuckyou" to="Fuck you" />
+    <Word from="Whyyou" to="Why you" />
+    <Word from="butyoujust" to="but you just" />
+    <Word from="forgetyourname" to="forget your name" />
+    <Word from="Whatyou" to="What you" />
+    <Word from="Co/'ncidenta//y" to="Coincidentally" />
+    <Word from="GIad" to="Glad" />
+    <Word from="RachelMarron" to="Rachel Marron" />
+    <Word from="She'llgive" to="She'll give" />
+    <Word from="presidentialsuite" to="presidential suite" />
+    <Word from="andgentlemen" to="and gentlemen" />
+    <Word from="willnot" to="will not" />
+    <Word from="ourproducers" to="our producers" />
+    <Word from="Ifshe's" to="If she's" />
+    <Word from="CIock" to="Clock" />
+    <Word from="Ishould" to="I should" />
+    <Word from="I'llgo" to="I'll go" />
+    <Word from="maypass" to="may pass" />
+    <Word from="andprotecting" to="and protecting" />
+    <Word from="BIessed" to="Blessed" />
+    <Word from="CIean" to="Clean" />
+    <Word from="SIave" to="Slave" />
+    <Word from="AIi" to="Ali" />
+    <Word from="AIIah" to="Allah" />
+    <Word from="AIIahu" to="Allahu" />
+    <Word from="CIick" to="Click" />
+    <Word from="BIast" to="Blast" />
+    <Word from="AIlah" to="Allah" />
+    <Word from="SIow" to="Slow" />
+    <Word from="theirpolicies" to="their policies" />
+    <Word from="Orperhaps" to="Or perhaps" />
+    <Word from="ofsex" to="of sex" />
+    <Word from="forpleasure" to="for pleasure" />
+    <Word from="ourpower" to="our power" />
+    <Word from="Yourpiece" to="Your piece" />
+    <Word from="Offioers" to="Officers" />
+    <Word from="oondesoended" to="condescended" />
+    <Word from="myseif" to="myself" />
+    <Word from="let'sjust" to="let’s just" />
+    <Word from="yourway" to="your way" />
+    <Word from="An9TY" to="Angry" />
+    <Word from="ourjourney" to="our journey" />
+    <Word from="LuCY" to="Lucy" />
+    <Word from="\'m" to="I’m" />
+    <Word from="CEDR/C" to="CEDRIC" />
+    <Word from="lsaac" to="Isaac" />
+    <Word from="FIy" to="Fly" />
+    <Word from="Ionger" to="longer" />
+    <Word from="Iousy" to="lousy" />
+    <Word from="Iosing" to="losing" />
+    <Word from="They'II" to="They'll" />
+    <Word from="yourpaws" to="your paws" />
+    <Word from="littie" to="little" />
+    <Word from="It'lljust" to="It'll just" />
+    <Word from="AIso" to="Also" />
+    <Word from="Iisten" to="listen" />
+    <Word from="suPPosed" to="supposed" />
+    <Word from="somePIace" to="someplace" />
+    <Word from="exPIain" to="explain" />
+    <Word from="Iittle" to="little" />
+    <Word from="StoP" to="Stop" />
+    <Word from="AIways" to="Always" />
+    <Word from="Iectures" to="lectures" />
+    <Word from="Iow" to="low" />
+    <Word from="Ieaving" to="leaving" />
+    <Word from="Ietting" to="letting" />
+    <Word from="Iistening" to="listening" />
+    <Word from="Iecture" to="lecture" />
+    <Word from="Iicking" to="licking" />
+    <Word from="Iosses" to="losses" />
+    <Word from="PIeased" to="Pleased" />
+    <Word from="ofburglaries" to="of burglaries" />
+    <Word from="He'sjust" to="He's just" />
+    <Word from="mytrucktoo" to="my truck too" />
+    <Word from="nowwhat" to="now what" />
+    <Word from="yourfire" to="your fire" />
+    <Word from="herwhat's" to="her what's" />
+    <Word from="hearthat" to="hear that" />
+    <Word from="oryou" to="or you" />
+    <Word from="preferjournalist" to="prefer journalist" />
+    <Word from="CIaw" to="Claw" />
+    <Word from="Ifour" to="If our" />
+    <Word from="lron" to="Iron" />
+    <Word from="It'syour" to="It's your" />
+    <Word from="lfstill" to="If still" />
+    <Word from="forjoining" to="for joining" />
+    <Word from="foryears" to="for years" />
+    <Word from="Ifit" to="If it" />
+    <Word from="notjump" to="not jump" />
+    <Word from="ourproblem" to="our problem" />
+    <Word from="yourprofile" to="your profile" />
+    <Word from="ifJanine" to="if Janine" />
+    <Word from="forpreventative" to="for preventative" />
+    <Word from="whetherprotest" to="whether protest" />
+    <Word from="Ifnot" to="If not" />
+    <Word from="ourpeople" to="our people" />
+    <Word from="offmy" to="off my" />
+    <Word from="forproviding" to="for providing" />
+    <Word from="hadjust" to="had just" />
+    <Word from="nearyou" to="near you" />
+    <Word from="whateveryou" to="whatever you" />
+    <Word from="hourputs" to="hour puts" />
+    <Word from="timejob" to="time job" />
+    <Word from="overyour" to="over your" />
+    <Word from="orpermanent" to="or permanent" />
+    <Word from="createjobs" to="create jobs" />
+    <Word from="I'vejust" to="I've just" />
+    <Word from="peoplejobs" to="people jobs" />
+    <Word from="dinnerpail" to="dinner pail" />
+    <Word from="hasjumped" to="has jumped" />
+    <Word from="theirprivacy" to="their privacy" />
+    <Word from="AIl" to="All" />
+    <Word from="ofserious" to="of serious" />
+    <Word from="yourprofessional" to="your professional" />
+    <Word from="poiitical" to="political" />
+    <Word from="tojump" to="to jump" />
+    <Word from="iives" to="lives" />
+    <Word from="eiections" to="elections" />
+    <Word from="militaryjuntas" to="military juntas" />
+    <Word from="nojoke" to="no joke" />
+    <Word from="yourpresidency" to="your presidency" />
+    <Word from="ofmilitaryjuntas" to="of military juntas" />
+    <Word from="Ourproposal" to="Our proposal" />
+    <Word from="LeBIanc" to="LeBlanc" />
+    <Word from="KIaus" to="Klaus" />
+    <Word from="yourpussy" to="your pussy" />
+    <Word from="lNTERVIEWER" to="INTERVIEWER" />
+    <Word from="lNAUDIBLE" to="INAUDIBLE" />
+    <Word from="SImpsons" to="Simpsons" />
+    <Word from="anotherjob" to="another job" />
+    <Word from="lfthere" to="If there" />
+    <Word from="descentinto" to="descent into" />
+    <Word from="ofthathere" to="of that here" />
+    <Word from="ofway" to="of way" />
+    <Word from="yourseat" to="your seat" />
+    <Word from="allyou" to="all you" />
+    <Word from="Allyou" to="All you" />
+    <Word from="yourass" to="your ass" />
+    <Word from="Yourbutt" to="Your butt" />
+    <Word from="iustiiggle" to="just jiggle" />
+    <Word from="iust" to="just" />
+    <Word from="CSi" to="CSI" />
+    <Word from="affernoon" to="afternoon" />
+    <Word from="orpersecution" to="or persecution" />
+    <Word from="theirpetty" to="their petty" />
+    <Word from="Fourpercent" to="Four percent" />
+    <Word from="fourpercent" to="four percent" />
+    <Word from="willjust" to="will just" />
+    <Word from="Ifyou're" to="If you're" />
+    <Word from="ourplanet" to="our planet" />
+    <Word from="lsolation" to="Isolation" />
+    <Word from="yourprimitive" to="your primitive" />
+    <Word from="yourplanet" to="your planet" />
+    <Word from="matteryour" to="matter your" />
+    <Word from="Yourplace" to="Your place" />
+    <Word from="andjustice" to="and justice" />
+    <Word from="anotherpart" to="another part" />
+    <Word from="confiict" to="conflict" />
+    <Word from="growingjeopardy" to="growing jeopardy" />
+    <Word from="hasjust" to="has just" />
+    <Word from="havejust" to="have just" />
+    <Word from="herselfinto" to="herself into" />
+    <Word from="ifnecessary" to="if necessary" />
+    <Word from="we'vejust" to="we've just" />
+    <Word from="tojust" to="to just" />
+    <Word from="yourjudgment" to="your judgment" />
+    <Word from="yourjeans" to="your jeans" />
+    <Word from="Youjust" to="You just" />
+    <Word from="ajanitor" to="a janitor" />
+    <Word from="FIattery" to="Flattery" />
+    <Word from="myjournal" to="my journal" />
+    <Word from="myjudgment" to="my judgment" />
+    <Word from="offofmy" to="off of my" />
+    <Word from="offyour" to="off your" />
+    <Word from="ofgood" to="of good" />
+    <Word from="ofguilty" to="of guilty" />
+    <Word from="ofhaving" to="of having" />
+    <Word from="ofheart" to="of heart" />
+    <Word from="ofhonor" to="of honor" />
+    <Word from="oflove" to="of love" />
+    <Word from="ofmankind" to="of mankind" />
+    <Word from="ofmany" to="of many" />
+    <Word from="ofnormal" to="of normal" />
+    <Word from="ofpeople" to="of people" />
+    <Word from="ofpower" to="of power" />
+    <Word from="ofsuch" to="of such" />
+    <Word from="peoplejust" to="people just" />
+    <Word from="They'rejust" to="They're just" />
+    <Word from="tojeopardize" to="to jeopardize" />
+    <Word from="Yourplaces" to="Your places" />
+    <Word from="yourposition" to="your position" />
+    <Word from="yourselfa" to="yourself a" />
+    <Word from="yourselfright" to="yourself right" />
+    <Word from="thejob" to="the job" />
+    <Word from="thejanitors" to="the janitors" />
+    <Word from="alljust" to="all just" />
+    <Word from="forAmerica's" to="for America's" />
+    <Word from="Forpencils" to="For pencils" />
+    <Word from="forpondering" to="for pondering" />
+    <Word from="handwrittenjournals" to="handwritten journals" />
+    <Word from="herpursuit" to="her pursuit" />
+    <Word from="ofjust" to="of just" />
+    <Word from="oflanding" to="of landing" />
+    <Word from="oflife" to="of life" />
+    <Word from="outjust" to="out just" />
+    <Word from="Thejoke" to="The joke" />
+    <Word from="ourpatient" to="our patient" />
+    <Word from="oryou're" to="or you're" />
+    <Word from="ofyourself" to="of yourself" />
+    <Word from="poweryour" to="power your" />
+    <Word from="Ofmy" to="Of my" />
+    <Word from="EIlen" to="Ellen" />
+    <Word from="Don'tget" to="Don't get" />
+    <Word from="tellme" to="tell me" />
+    <Word from="ofdecision" to="of decision" />
+    <Word from="itgoing" to="it going" />
+    <Word from="artificialgravity" to="artificial gravity" />
+    <Word from="shouldknow" to="should know" />
+    <Word from="Hasn'tgot" to="Hasn't got" />
+    <Word from="thirdjunction" to="third junction" />
+    <Word from="somebodypicks" to="somebody picks" />
+    <Word from="Willyou" to="Will you" />
+    <Word from="can'tget" to="can't get" />
+    <Word from="BuZZes" to="Buzzes" />
+    <Word from="wouldn'tyou" to="wouldn't you" />
+    <Word from="Wellbelow" to="Well below" />
+    <Word from="What'dyou" to="What'd you" />
+    <Word from="decipheredpart" to="deciphered part" />
+    <Word from="they'llknow" to="they'll know" />
+    <Word from="ifit's" to="if it's" />
+    <Word from="ornot" to="or not" />
+    <Word from="myposition" to="my position" />
+    <Word from="lndistinct" to="Indistinct" />
+    <Word from="anybiscuits" to="any biscuits" />
+    <Word from="Andifyou" to="And if you" />
+    <Word from="lfwe" to="If we" />
+    <Word from="yourarm" to="your arm" />
+    <Word from="lnteresting" to="Interesting" />
+    <Word from="findit" to="find it" />
+    <Word from="it'llstart" to="it'll start" />
+    <Word from="holdit" to="hold it" />
+    <Word from="ofkilling" to="of killing" />
+    <Word from="Howyou" to="How you" />
+    <Word from="lnhales" to="Inhales" />
+    <Word from="lgot" to="I got" />
+    <Word from="CIip" to="Clip" />
+    <Word from="what'II" to="what'll" />
+    <Word from="road'II" to="road'll" />
+    <Word from="girI" to="girl" />
+    <Word from="LIoyd" to="Lloyd" />
+    <Word from="BIake" to="Blake" />
+    <Word from="reaI" to="real" />
+    <Word from="Foryour" to="For your" />
+    <Word from="yourpublic" to="your public" />
+  </WholeWords>
+  <PartialWordsAlways>
+    <!-- Will be replaced always -->
+    <WordPart from="¤" to="o" />
+    <WordPart from="lVI" to="M" />
+    <WordPart from="IVl" to="M" />
+    <WordPart from="lVl" to="M" />
+    <WordPart from="I\/I" to="M" />
+    <WordPart from="l\/I" to="M" />
+    <WordPart from="I\/l" to="M" />
+    <WordPart from="l\/l" to="M" />
+    <WordPart from="IVIa" to="Ma" />
+    <WordPart from="IVIe" to="Me" />
+    <WordPart from="IVIi" to="Mi" />
+    <WordPart from="IVIo" to="Mo" />
+    <WordPart from="IVIu" to="Mu" />
+    <WordPart from="IVIy" to="My" />
+  </PartialWordsAlways>
+  <PartialWords>
+    <!-- Will be used to check words not in dictionary.
+          If new word(s) and longer than 5 chars and exists in spelling dictionary, it is (or they are) accepted -->
+    <WordPart from="IVI" to="M" />
+    <WordPart from="/" to="l" />
+    <WordPart from="vv" to="w" />
+    <WordPart from="m" to="rn" />
+    <WordPart from="l" to="i" />
+    <WordPart from="€" to="e" />
+    <WordPart from="I" to="l" />
+    <WordPart from="c" to="o" />
+    <WordPart from="i" to="t" />
+    <WordPart from="cc" to="oo" />
+    <WordPart from="ii" to="tt" />
+    <WordPart from="ii" to="ll" />
+    <!-- "f " will be two words -->
+    <WordPart from="f" to="f " />
+    <WordPart from="c" to="e" />
+    <WordPart from="I" to="t" />
+    <WordPart from="n" to="o" />
+    <WordPart from="s" to="e" />
+    <WordPart from="l-l" to="H" />
+    <WordPart from="l_" to="L" />
+    <WordPart from="°" to="o" />
+    <WordPart from=")/" to="y" />
+    <WordPart from=")'" to="y" />
+    <WordPart from="a’" to="d" />
+  </PartialWords>
+  <PartialLines>
+    <LinePart from=" /be " to=" I be " />
+    <LinePart from=" aren '1'" to=" aren't" />
+    <LinePart from=" aren'tyou" to=" aren't you" />
+    <LinePart from=" doesn '1'" to=" doesn't" />
+    <LinePart from=" fr/eno'" to=" friend" />
+    <LinePart from=" fr/eno'." to=" friend." />
+    <LinePart from=" haven 'z' " to=" haven't " />
+    <LinePart from=" haven 'z'." to=" haven't." />
+    <LinePart from=" I ha ve " to=" I have " />
+    <LinePart from=" I']I " to=" I'll " />
+    <LinePart from=" L am" to=" I am" />
+    <LinePart from=" L can" to=" I can" />
+    <LinePart from=" L don't " to=" I don't " />
+    <LinePart from=" L hate " to=" I hate " />
+    <LinePart from=" L have " to=" I have " />
+    <LinePart from=" L like " to=" I like " />
+    <LinePart from=" L will" to=" I will" />
+    <LinePart from=" L would" to=" I would" />
+    <LinePart from=" L'll " to=" I'll " />
+    <LinePart from=" L've " to=" I've " />
+    <LinePart from=" m y family" to=" my family" />
+    <LinePart from=" 's " to="'s " />
+    <LinePart from=" shou/dn '1 " to=" shouldn't " />
+    <LinePart from=" won 'z' " to=" won't " />
+    <LinePart from=" won 'z'." to=" won't." />
+    <LinePart from=" wou/c/n 'z' " to=" wouldn't " />
+    <LinePart from=" wou/c/n 'z'." to=" wouldn't." />
+    <LinePart from=" wou/dn 'z' " to=" wouldn't " />
+    <LinePart from=" wou/dn 'z'." to=" wouldn't." />
+    <LinePart from="/ did" to="I did" />
+    <LinePart from="/ have " to="I have " />
+    <LinePart from="/ just " to="I just " />
+    <LinePart from="/ loved " to="I loved " />
+    <LinePart from="/ need" to="I need" />
+    <LinePart from="|was11" to="I was 11" />
+    <LinePart from="at Hrst" to="at first" />
+    <LinePart from="B ullshiz'" to="Bullshit" />
+    <LinePart from="big lunk" to="love you" />
+    <LinePart from="can 't" to="can't" />
+    <LinePart from="can' t " to="can't " />
+    <LinePart from="can 't " to="can't " />
+    <LinePart from="CHA TTERING" to="CHATTERING" />
+    <LinePart from="come 0n" to="come on" />
+    <LinePart from="Come 0n" to="Come on" />
+    <LinePart from="couldn 't" to="couldn't" />
+    <LinePart from="couldn' t " to="couldn't " />
+    <LinePart from="couldn 't " to="couldn't " />
+    <LinePart from="Destin y's" to="Destiny's" />
+    <LinePart from="didn 't" to="didn't" />
+    <LinePart from="didn' t " to="didn't " />
+    <LinePart from="didn 't " to="didn't " />
+    <LinePart from="Doesn '1'" to="Doesn't" />
+    <LinePart from="doesn '1' " to="doesn't " />
+    <LinePart from="doesn '1‘ " to="doesn't " />
+    <LinePart from="doesn 't" to="doesn't" />
+    <LinePart from="doesn'1' " to="doesn't " />
+    <LinePart from="doesn'1‘ " to="doesn't " />
+    <LinePart from="don '1' " to="don't " />
+    <LinePart from="don '1‘ " to="don't " />
+    <LinePart from="don '2' " to="don't " />
+    <LinePart from=" aren '2'" to=" aren't" />
+    <LinePart from="aren '2' " to="aren't " />
+    <LinePart from="don '2‘ " to="don't " />
+    <LinePart from="don 't" to="don't" />
+    <LinePart from="Don' t " to="Don't " />
+    <LinePart from="Don 't " to="Don't " />
+    <LinePart from="don'1' " to="don't " />
+    <LinePart from="don'1‘ " to="don't " />
+    <LinePart from="there '5 " to="there's " />
+    <LinePart from="E very" to="Every" />
+    <LinePart from="get 0n" to="get on" />
+    <LinePart from="go 0n" to="go on" />
+    <LinePart from="Go 0n" to="Go on" />
+    <LinePart from="H3993' birthday" to="Happy birthday" />
+    <LinePart from="hadn 't" to="hadn't" />
+    <LinePart from="he 's" to="he's" />
+    <LinePart from="He 's" to="He's" />
+    <LinePart from="He y" to="Hey" />
+    <LinePart from="he)/" to="hey" />
+    <LinePart from="He)/" to="Hey" />
+    <LinePart from="HEA VY" to="HEAVY" />
+    <LinePart from="Henry ll" to="Henry II" />
+    <LinePart from="Henry lll" to="Henry III" />
+    <LinePart from="Henry Vlll" to="Henry VIII" />
+    <LinePart from="Henry Vll" to="Henry VII" />
+    <LinePart from="Henry Vl" to="Henry VI" />
+    <LinePart from="Hold 0n" to="Hold on" />
+    <LinePart from="I am. ls" to="I am. Is" />
+    <LinePart from="I d0" to="I do" />
+    <LinePart from="I 'm" to="I'm" />
+    <LinePart from="I 'rn " to="I'm " />
+    <LinePart from="I 've" to="I've" />
+    <LinePart from="I0 ve her" to="love her" />
+    <LinePart from="I0 ve you" to="love you" />
+    <LinePart from="I02'" to="lot" />
+    <LinePart from="I'm sony" to="I'm sorry" />
+    <LinePart from="isn' t " to="isn't " />
+    <LinePart from="isn 't " to="isn't " />
+    <LinePart from="K)/le" to="Kyle" />
+    <LinePart from="L ook" to="Look" />
+    <LinePart from="let me 90" to="let me go" />
+    <LinePart from="Let me 90" to="Let me go" />
+    <LinePart from="let's 90" to="let's go" />
+    <LinePart from="Let's 90" to="Let's go" />
+    <LinePart from="lfl had" to="If I had" />
+    <LinePart from="lova you" to="love you" />
+    <LinePart from="Lova you" to="love you" />
+    <LinePart from="lovo you" to="love you" />
+    <LinePart from="Lovo you" to="love you" />
+    <LinePart from="ls anyone" to="Is anyone" />
+    <LinePart from="ls he" to="Is he" />
+    <LinePart from="-ls he" to="- Is he" />
+    <LinePart from="ls it" to="Is it" />
+    <LinePart from="-ls it" to="- Is it" />
+    <LinePart from="ls she" to="Is she" />
+    <LinePart from="-ls she" to="- Is she" />
+    <LinePart from="ls that" to="Is that" />
+    <LinePart from="-ls that" to="- Is that" />
+    <LinePart from="ls this" to="Is this" />
+    <LinePart from="-ls this" to="- Is this" />
+    <LinePart from="Maze] tov" to="Mazel tov" />
+    <LinePart from="N02' " to="Not " />
+    <LinePart from=" of 0ur " to=" of our " />
+    <LinePart from=" ot mine " to=" of mine " />
+    <LinePart from="PLA YING" to="PLAYING" />
+    <LinePart from="REPEA TING " to="REPEATING " />
+    <LinePart from="Sa y" to="Say" />
+    <LinePart from="she 's" to="she's" />
+    <LinePart from="She 's" to="She's" />
+    <LinePart from="shouldn 't" to="shouldn't" />
+    <LinePart from="sta y" to="stay" />
+    <LinePart from="Sta y" to="Stay" />
+    <LinePart from="SWO rd" to="Sword" />
+    <LinePart from="taka care" to="take care" />
+    <LinePart from="Taka care" to="Take care" />
+    <LinePart from="the Hrst" to="the first" />
+    <LinePart from="toc late" to="too late" />
+    <LinePart from="uf me" to="of me" />
+    <LinePart from="uf our" to="of our" />
+    <LinePart from="wa y" to="way" />
+    <LinePart from="Wal-I\/Iart" to="Wal-Mart" />
+    <LinePart from="wasn '1' " to="wasn't " />
+    <LinePart from="Wasn '1' " to="Wasn't " />
+    <LinePart from="wasn '1‘ " to="wasn't " />
+    <LinePart from="Wasn '1‘ " to="Wasn't " />
+    <LinePart from="wasn 't" to="wasn't" />
+    <LinePart from="Wasn 't" to="Wasn't" />
+    <LinePart from="we 've" to="we've" />
+    <LinePart from="We 've" to="We've" />
+    <LinePart from="wem' off" to="went off" />
+    <LinePart from="weren 't" to="weren't" />
+    <LinePart from="who 's" to="who's" />
+    <LinePart from="won 't" to="won't" />
+    <LinePart from="would ha ve" to="would have " />
+    <LinePart from="wouldn 't" to="wouldn't" />
+    <LinePart from="Wouldn 't" to="Wouldn't" />
+    <LinePart from="y()u" to="you" />
+    <LinePart from="you QUYS" to="you guys" />
+    <LinePart from="you' re " to="you're " />
+    <LinePart from="you 're " to="you're " />
+    <LinePart from="you 've" to="you've" />
+    <LinePart from="You 've" to="You've" />
+    <LinePart from="you' ve " to="you've " />
+    <LinePart from="you 've " to="you've " />
+    <LinePart from="aftera while" to="after a while" />
+    <LinePart from="Aftera while" to="After a while" />
+    <LinePart from="THUN DERCLAPS" to="THUNDERCLAPS" />
+    <LinePart from="(BUZZI N G)" to="(BUZZING)" />
+    <LinePart from="[BUZZI N G]" to="[BUZZING]" />
+    <LinePart from="(G RU NTING" to="(GRUNTING" />
+    <LinePart from="[G RU NTING" to="[GRUNTING" />
+    <LinePart from="(G ROWLING" to="(GROWLING" />
+    <LinePart from="[G ROWLING" to="[GROWLING" />
+    <LinePart from=" WAI LS)" to="WAILS)" />
+    <LinePart from=" WAI LS]" to="WAILS]" />
+    <LinePart from="(scu RRYING)" to="(SCURRYING)" />
+    <LinePart from="[scu RRYING]" to="[SCURRYING]" />
+    <LinePart from="(GRUNT5)" to="(GRUNTS)" />
+    <LinePart from="[GRUNT5]" to="[GRUNTS]" />
+    <LinePart from="NARRA TOR:" to="NARRATOR:" />
+    <LinePart from="(GROAN ING" to="(GROANING" />
+    <LinePart from="[GROAN ING" to="[GROANING" />
+    <LinePart from="GROAN ING)" to="GROANING)" />
+    <LinePart from="GROAN ING]" to="GROANING]" />
+    <LinePart from="(LAUGH ING" to="(LAUGHING" />
+    <LinePart from="[LAUGH ING" to="[LAUGHING" />
+    <LinePart from="LAUGH ING)" to="LAUGHING)" />
+    <LinePart from="LAUGH ING]" to="LAUGHING]" />
+    <LinePart from="(BU BBLING" to="(BUBBLING" />
+    <LinePart from="[BU BBLING" to="[BUBBLING" />
+    <LinePart from="BU BBLING)" to="BUBBLING)" />
+    <LinePart from="BU BBLING]" to="BUBBLING]" />
+    <LinePart from="(SH USHING" to="(SHUSHING" />
+    <LinePart from="[SH USHING" to="[SHUSHING" />
+    <LinePart from="SH USHING)" to="SHUSHING)" />
+    <LinePart from="SH USHING]" to="SHUSHING]" />
+    <LinePart from="(CH ILDREN" to="(CHILDREN" />
+    <LinePart from="[CH ILDREN" to="[CHILDREN" />
+    <LinePart from="CH ILDREN)" to="CHILDREN)" />
+    <LinePart from="CH ILDREN]" to="CHILDREN]" />
+    <LinePart from="(MURMU RING" to="(MURMURING" />
+    <LinePart from="[MURMU RING" to="[MURMURING" />
+    <LinePart from="MURMU RING)" to="MURMURING)" />
+    <LinePart from="MURMU RING]" to="MURMURING]" />
+    <LinePart from="(GU N " to="(GUN " />
+    <LinePart from="[GU N " to="[GUN " />
+    <LinePart from="GU N)" to="GUN)" />
+    <LinePart from="GU N]" to="GUN]" />
+    <LinePart from="CH ILDREN:" to="CHILDREN:" />
+    <LinePart from="STU DENTS:" to="STUDENTS:" />
+    <LinePart from="(WH ISTLE" to="(WHISTLE" />
+    <LinePart from="[WH ISTLE" to="[WHISTLE" />
+    <LinePart from="WH ISTLE)" to="WHISTLE)" />
+    <LinePart from="WH ISTLE]" to="WHISTLE]" />
+    <LinePart from="U LU LATING" to="ULULATING" />
+    <LinePart from="AU DIENCE:" to="AUDIENCE:" />
+    <LinePart from="HA WAIIAN" to="HAWAIIAN" />
+    <LinePart from="(ARTH UR" to="(ARTHUR" />
+    <LinePart from="[ARTH UR" to="[ARTHUR" />
+    <LinePart from="ARTH UR)" to="ARTHUR)" />
+    <LinePart from="ARTH UR]" to="ARTHUR]" />
+    <LinePart from="J EREMY:" to="JEREMY:" />
+    <LinePart from="(ELEVA TOR" to="(ELEVATOR" />
+    <LinePart from="[ELEVA TOR" to="[ELEVATOR" />
+    <LinePart from="ELEVA TOR)" to="ELEVATOR)" />
+    <LinePart from="ELEVA TOR]" to="ELEVATOR]" />
+    <LinePart from="CONTIN U ES" to="CONTINUES" />
+    <LinePart from="WIN D HOWLING" to="WIND HOWLING" />
+    <LinePart from="telis me" to="tells me" />
+    <LinePart from="Telis me" to="Tells me" />
+    <LinePart from=". Ls " to=". Is " />
+    <LinePart from="! Ls " to="! Is " />
+    <LinePart from="? Ls " to="? Is " />
+    <LinePart from=". Lt " to=". It " />
+    <LinePart from="! Lt " to="! It " />
+    <LinePart from="? Lt " to="? It " />
+    <LinePart from="SQMEWH ERE ELSE" to="SOMEWHERE ELSE" />
+    <LinePart from=" I,m " to=" I'm " />
+    <LinePart from=" I,ve " to=" I've " />
+    <LinePart from=" you,re " to=" you're " />
+    <LinePart from=" you,ll " to=" you'll " />
+    <LinePart from=" doesn,t " to=" doesn't " />
+    <LinePart from=" let,s " to=" let's " />
+    <LinePart from=" he,s " to=" he's " />
+    <LinePart from=" it,s " to=" it's " />
+    <LinePart from=" can,t " to=" can't " />
+    <LinePart from=" Can,t " to=" Can't " />
+    <LinePart from=" don,t " to=" don't " />
+    <LinePart from=" Don,t " to=" Don't " />
+    <LinePart from="wouldn 'tyou" to="wouldn't you" />
+    <LinePart from=" lgot it" to=" I got it" />
+    <LinePart from=" you,ve " to=" you've " />
+    <LinePart from=" I ve " to=" I've " />
+    <LinePart from=" I ii " to=" I'll " />
+    <LinePart from=" I m " to=" I'm " />
+    <LinePart from=" why d " to=" why'd " />
+    <LinePart from=" couldn t " to=" couldn't " />
+    <LinePart from=" that s " to=" that's " />
+    <LinePart from=" i... " to=" I... " />
+  </PartialLines>
+  <PartialLinesAlways>
+    <LinePart from="forbest act" to="for best act" />
+  </PartialLinesAlways>
+  <BeginLines>
+    <Beginning from="lgot it" to="I got it" />
+    <Beginning from="Don,t " to="Don't " />
+    <Beginning from="Can,t " to="Can't " />
+    <Beginning from="Let,s " to="Let's " />
+    <Beginning from="He,s " to="He's " />
+    <Beginning from="I,m " to="I'm " />
+    <Beginning from="I,ve " to="I've " />
+    <Beginning from="I,ll " to="I'll " />
+    <Beginning from="You,ll " to="You'll " />
+    <Beginning from="T hey " to="They " />
+    <Beginning from="T here " to="There " />
+    <Beginning from="W here " to="Where " />
+    <Beginning from="M aybe " to="Maybe " />
+    <Beginning from="S hould " to="Should " />
+    <Beginning from="|was" to="I was" />
+    <Beginning from="|am " to="I am" />
+    <Beginning from="No w, " to="Now, " />
+    <Beginning from="l... I " to="I... I " />
+    <Beginning from="L... I " to="I... I " />
+    <Beginning from="lrn gonna" to="I'm gonna" />
+    <Beginning from="-l don't" to="-I don't" />
+    <Beginning from="l don't" to="I don't" />
+    <Beginning from="L " to="I " />
+    <Beginning from="-L " to="-I " />
+    <Beginning from="- L " to="- I " />
+    <Beginning from="-l " to="-I " />
+    <Beginning from="- l " to="- I " />
+    <Beginning from="G0" to="Go" />
+    <Beginning from="GO get" to="Go get" />
+    <Beginning from="GO to" to="Go to" />
+    <Beginning from="GO for" to="Go for" />
+    <Beginning from="Ifl" to="If I" />
+    <Beginning from="lt'll" to="It'll" />
+    <Beginning from="Lt'll" to="It'll" />
+    <Beginning from="IVIa" to="Ma" />
+    <Beginning from="IVIu" to="Mu" />
+    <Beginning from="0ne" to="One" />
+    <Beginning from="0nly" to="Only" />
+    <Beginning from="0n " to="On " />
+    <Beginning from="lt " to="It " />
+    <Beginning from="Lt " to="It " />
+    <Beginning from="lt's " to="It's " />
+    <Beginning from="Lt's " to="It's " />
+    <Beginning from="ln " to="In " />
+    <Beginning from="Ln " to="In " />
+    <Beginning from="l-in " to="I-in " />
+    <Beginning from="l-impossible" to="I-impossible" />
+    <Beginning from="l- impossible" to="I-impossible" />
+    <Beginning from="L- impossible" to="I-impossible" />
+    <Beginning from="l-isn't " to="I-isn't " />
+    <Beginning from="L-isn't " to="I-isn't " />
+    <Beginning from="l- isn't " to="I-isn't " />
+    <Beginning from="L- isn't " to="I-isn't " />
+    <Beginning from="l- l " to="I-I " />
+    <Beginning from="L- l " to="I-I " />
+    <Beginning from="l- it " to="I-it " />
+    <Beginning from="L- it " to="I-it " />
+    <Beginning from="Ls it " to="Is it " />
+    <Beginning from="Ls there " to="Is there " />
+    <Beginning from="Ls he " to="Is he " />
+    <Beginning from="Ls she " to="Is she " />
+    <Beginning from="L can" to="I can" />
+    <Beginning from="l can" to="I can" />
+    <Beginning from="L'm " to="I'm " />
+    <Beginning from="L' m " to="I'm " />
+    <Beginning from="Lt' s " to="It's " />
+    <Beginning from="I']I " to="I'll " />
+    <Beginning from="...ls " to="...Is " />
+    <Beginning from="- ls " to="- Is " />
+    <Beginning from="...l " to="...I " />
+    <Beginning from="Ill " to="I'll " />
+    <Beginning from="L hope " to="I hope " />
+    <Beginning from="|’E'$ " to="It's " />
+    <Beginning from="The y're " to="They're " />
+    <Beginning from="&lt;i&gt;/ " to="&lt;i&gt;I " />
+    <Beginning from="/ " to="I " />
+    <Beginning from="&lt;i&gt;/n " to="&lt;i&gt;In " />
+    <Beginning from="/n " to="In " />
+    <Beginning from="&lt;i&gt;Ana’ " to="&lt;i&gt;And " />
+    <Beginning from="&lt;i&gt;Ana' " to="&lt;i&gt;And " />
+    <Beginning from="~ " to="- " />
+    <Beginning from="&lt;i&gt;A'|'|'EN BOROUGH:" to="&lt;i&gt;ATTENBOROUGH:" />
+    <Beginning from="A'|'|'EN BOROUGH:" to="ATTENBOROUGH:" />
+    <Beginning from="DAVID A'|'|'EN BOROUGH:" to="DAVID ATTENBOROUGH:" />
+    <Beginning from="AT|'EN BOROUGH:" to="ATTENBOROUGH:" />
+    <Beginning from="DAVID AT|'EN BOROUGH:" to="DAVID ATTENBOROUGH:" />
+    <Beginning from="&lt;i&gt;AT|'EN BOROUGH:" to="&lt;i&gt;ATTENBOROUGH:" />
+    <Beginning from="TH REE " to="THREE " />
+    <Beginning from="NARRA TOR" to="NARRATOR" />
+    <Beginning from="&lt;i&gt;NARRA TOR" to="&lt;i&gt;NARRATOR" />
+    <Beginning from="lt'syour" to="It's your" />
+    <Beginning from="It'syour" to="It's your" />
+    <Beginning from="Ls " to="Is " />
+    <Beginning from="I ve " to="I've " />
+    <Beginning from="I ii " to="I'll " />
+    <Beginning from="I m " to="I'm " />
+    <Beginning from="Why d " to="Why'd " />
+    <Beginning from="why d " to="Why'd " />
+    <Beginning from="Couldn t " to="Couldn't " />
+    <Beginning from="couldn t " to="Couldn't " />
+    <Beginning from="That s " to="That's " />
+    <Beginning from="that s " to="That's " />
+  </BeginLines>
+  <EndLines>
+    <Ending from=", sin" to=", sir." />
+    <Ending from=" mothen" to=" mother." />
+    <Ending from=" can't_" to=" can't." />
+    <Ending from=" openiL" to=" open it." />
+    <Ending from=" offl" to=" off!" />
+    <Ending from="pshycol" to="psycho!" />
+    <Ending from=" i..." to=" I..." />
+    <Ending from=" L." to=" I." />
+  </EndLines>
+  <WholeLines>
+    <!-- Whole lines - including -" etc -->
+    <Line from="H ey." to="Hey." />
+    <Line from="He)’-" to="Hey." />
+    <Line from="N0." to="No." />
+    <Line from="-N0." to="-No." />
+    <Line from="Noll" to="No!!" />
+    <Line from="(G ROANS)" to="(GROANS)" />
+    <Line from="[G ROANS]" to="[GROANS]" />
+    <Line from="(M EOWS)" to="(MEOWS)" />
+    <Line from="[M EOWS]" to="[MEOWS]" />
+    <Line from="Uaughs]" to="[laughs]" />
+    <Line from="[chitte rs]" to="[chitters]" />
+    <Line from="Hil‘ it!" to="Hit it!" />
+    <Line from="&lt;i&gt;Hil‘ it!&lt;/i&gt;" to="&lt;i&gt;Hit it!&lt;/i&gt;" />
+    <Line from="ISIGHS]" to="[SIGHS]" />
+  </WholeLines>
+  <RegularExpressions>
+    <RegEx find="([a-z]) Won't " replaceWith="$1 won't " />
+    <RegEx find=" L([,\r\n :;!?]+)" replaceWith=" I$1" />
+    <RegEx find=" L.([,\r\n :;!?]+)" replaceWith=" I.$1" />
+  </RegularExpressions>
+</OCRFixReplaceList>
diff --git a/libs/subzero/modification/dictionaries/xml/fin_OCRFixReplaceList.xml b/libs/subzero/modification/dictionaries/xml/fin_OCRFixReplaceList.xml
new file mode 100644
index 000000000..cdce55c73
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/xml/fin_OCRFixReplaceList.xml
@@ -0,0 +1,1032 @@
+<OCRFixReplaceList>
+  <WholeWords>
+    <Word from="kellojo" to="kello jo" />
+    <Word from="onjo" to="on jo" />
+    <Word from="senjälkeen" to="sen jälkeen" />
+    <Word from="Tsäu" to="Tsau" />
+    <Word from="hydraulinenjousitus" to="hydraulinen jousitus" />
+    <Word from="Kevyetja" to="Kevyet ja" />
+    <Word from="Oleijo" to="Olet jo" />
+    <Word from="viimeinenjuna" to="viimeinen juna" />
+    <Word from="näyttääjotenkin" to="näyttää jotenkin" />
+    <Word from="onjoku" to="on joku" />
+    <Word from="Iapsuuteen" to="Lapsuuteen" />
+    <Word from="Ieikitjunillä" to="leikit junilla" />
+    <Word from="Sfiy" to="Stig" />
+    <Word from="Iukulasejani" to="Lukulasejani" />
+    <Word from="Ieikkiminen" to="Leikkiminen" />
+    <Word from="Käälikäärylepizzä" to="Kaalikäärylepizza" />
+    <Word from="suklääkästikkeen" to="suklaakastikkeen" />
+    <Word from="päistetun" to="paistetun" />
+    <Word from="bänäänin" to="banaanin" />
+    <Word from="pifi" to="piti" />
+    <Word from="aıkeasfaan" to="oikeastaan" />
+    <Word from="Stg" to="Stig" />
+    <Word from="sikainfluenssatja" to="sikainfluenssat ja" />
+    <Word from="Hienojuna" to="Hieno juna" />
+    <Word from="kiinnostuajunista" to="kiinnostua junista" />
+    <Word from="häyıyvetuıín" to="höyryveturin" />
+    <Word from="pienaismalli" to="pienoismalli" />
+    <Word from="ena" to="eno" />
+    <Word from="racfiosãhkäffájãnã" to="radiosähköttäjänä" />
+    <Word from="Amenkan" to="Amerikan" />
+    <Word from="laiva/la" to="laivalla" />
+    <Word from="0/in" to="Olin" />
+    <Word from="Junahaırasfus" to="Junaharrastus" />
+    <Word from="enasfa" to="enosta" />
+    <Word from="/Vıín" to="Niin" />
+    <Word from="Oliivarmasii" to="Olit varmasti" />
+    <Word from="Internetistäjuuri" to="Internetistä juuri" />
+    <Word from="huıjanjãnniffåvãàl" to="hurjan jännittävää." />
+    <Word from="Vaikkajunat" to="Vaikka junat" />
+    <Word from="kääntyija" to="kääntyi ja" />
+    <Word from="osaajotain" to="osaa jotain" />
+    <Word from="Ieikillämme" to="leikillämme" />
+    <Word from="Bellinjuna" to="Beltin juna" />
+    <Word from="tästäjohtolangasta" to="tästä johtolangasta" />
+    <Word from="tuntisijonkun" to="tuntisi jonkun" />
+    <Word from="Olgajotain" to="Olga jotain" />
+    <Word from="tulokseivuodesia" to="tulokset vuodesta" />
+    <Word from="tuloksetvuodesta" to="tulokset vuodesta" />
+    <Word from="Vainjalkapallo" to="Vain jalkapallo" />
+    <Word from="lloveyou" to="I love you" />
+    <Word from="pofl‹aisi" to="potkaisi" />
+    <Word from="minufulos" to="minut ulos" />
+    <Word from="Ieivänpaahdinl" to="leivänpaahdin!" />
+    <Word from="Ieivänpaahdinta" to="leivänpaahdinta" />
+    <Word from="asuajossain" to="asua jossain" />
+    <Word from="Koiratjuoksentelivat" to="Koirat juoksentelivat" />
+    <Word from="tietääjotain" to="tietää jotain" />
+    <Word from="osaatjuna" to="osaat juna" />
+    <Word from="va/as" to="valas" />
+    <Word from="va/asperhe" to="valasperhe" />
+    <Word from="koskeejotain" to="koskee jotain" />
+    <Word from="Iääkkeensä" to="lääkkeensä" />
+    <Word from="Iaulavan" to="laulavan" />
+    <Word from="Kuulitjään" to="Kuulit jään" />
+    <Word from="Ievolle" to="levolle" />
+    <Word from="Va/aa//e" to="Valaalle" />
+    <Word from="va/aa//a" to="valaalla" />
+    <Word from="Iähdenkin" to="lähdenkin" />
+    <Word from="Iakkiin" to="lakkiin" />
+    <Word from="Iohikäärmeellä" to="lohikäärmeellä" />
+    <Word from="Mikı" to="Mik!" />
+    <Word from="Iukossa" to="lukossa" />
+    <Word from="Va/aan" to="Valaan" />
+    <Word from="säve/mä" to="sävelmä" />
+    <Word from="jä//een" to="jälleen" />
+    <Word from="Pööı" to="Pöö!" />
+    <Word from="Hnjaa" to="Hiljaa" />
+    <Word from="Iiftasin" to="liftasin" />
+    <Word from="Jute//aan" to="Jutellaan" />
+    <Word from="Iohduttamaan" to="lohduttamaan" />
+    <Word from="L'lYPäfään" to="Hypätään" />
+    <Word from="Äırıı" to="Äiti!" />
+    <Word from="Fıııpı" to="Filip!" />
+    <Word from="Yr›r›ääı" to="Hyppää!" />
+    <Word from="Miki" to="Mik!" />
+    <Word from="Hengıräı" to="Hengitä!" />
+    <Word from="Va/as" to="Valas" />
+    <Word from="Ko///is" to="Koillis" />
+    <Word from="Audieja" to="Audie ja" />
+    <Word from="I/man" to="Ilman" />
+    <Word from="/entotukia/ukse/ta" to="lentotukialukselta" />
+    <Word from="/aivastosta" to="laivastosta" />
+    <Word from="/entotukikohtaan" to="lentotukikohtaan" />
+    <Word from="tu/ee" to="tulee" />
+    <Word from="akse/iva//at" to="akselivallat" />
+    <Word from="aııekırjoırerrıın" to="allekirjoitettiin" />
+    <Word from="Iitkua" to="litkua" />
+    <Word from="0li" to="Oli" />
+    <Word from="Iaskuvarjojoukkoihin" to="laskuvarjojoukkoihin" />
+    <Word from="Iaskuvarjojoukoissa" to="laskuvarjojoukoissa" />
+    <Word from="Tarvitsetjotain" to="Tarvitset jotain" />
+    <Word from="Ieukaremmi" to="leukaremmi" />
+    <Word from="Iainaatko" to="lainaatko" />
+    <Word from="päällikölleja" to="päällikölle ja" />
+    <Word from="Iähelläni" to="lähelläni" />
+    <Word from="Soti/aan" to="Sotilaan" />
+    <Word from="va//attava" to="vallattava" />
+    <Word from="viho//ise/ta" to="viholliselta" />
+    <Word from="/iittoutuneet" to="liittoutuneet" />
+    <Word from="voitjohtaa" to="voit johtaa" />
+    <Word from="pohditkojotain" to="pohditko jotain" />
+    <Word from="viho//ista" to="vihollista" />
+    <Word from="sejäisi" to="se jäisi" />
+    <Word from="Ientäjillä" to="lentäjillä" />
+    <Word from="Soltutl" to="Soltut!" />
+    <Word from="Iaulustamme" to="laulustamme" />
+    <Word from="Iakkiani" to="lakkiani" />
+    <Word from="Iiemeen" to="liemeen" />
+    <Word from="kanadalaıšia" to="kanadalaisia" />
+    <Word from="si//anpääasema" to="sillanpääasema" />
+    <Word from="vahvıštettiin" to="vahvıstettiin" />
+    <Word from="tu/ituki" to="tulituki" />
+    <Word from="eliittıjoukkoa" to="eliittijoukkoa" />
+    <Word from="paıkaııasıı" to="paikallasi!" />
+    <Word from="Ieikkinyt" to="leikkinyt" />
+    <Word from="Iujitettu" to="lujitettu" />
+    <Word from="Ete/ä" to="Etelä" />
+    <Word from="viho//isranna//e" to="vihollisrannalle" />
+    <Word from="sivusta/ta" to="sivustalta" />
+    <Word from="/oppuisi" to="loppuisi" />
+    <Word from="Iaskuvarjojoukkojen" to="laskuvarjojoukkojen" />
+    <Word from="päättänytjäädä" to="päättänyt jäädä" />
+    <Word from="Iuutnanteille" to="luutnanteille" />
+    <Word from="Iähtövalmiiksi" to="lähtövalmiiksi" />
+    <Word from="Iokoisat" to="lokoisat" />
+    <Word from="Korjaus/ukemat" to="Korjauslukemat" />
+    <Word from="tanke///e" to="tankeille" />
+    <Word from="kyııäı" to="kyllä!" />
+    <Word from="Iistiä" to="listiä" />
+    <Word from="Kunniamita/in" to="Kunniamitalin" />
+    <Word from="Vemon" to="Vernon" />
+    <Word from="fiedãn" to="Tiedän" />
+    <Word from="Eiıis" to="Elvis" />
+    <Word from="Inlemätionä" to="International" />
+    <Word from="holelfssä" to="hotellissa" />
+    <Word from="Hanıey" to="Harvey" />
+    <Word from="peikkä" to="pelkkä" />
+    <Word from="Ehislã" to="Elvistä" />
+    <Word from="Yflãllãvã" to="Yllättävä" />
+    <Word from="mahdolisuus" to="mahdollisuus" />
+    <Word from="loisteiaan" to="loisteliaan" />
+    <Word from="aku" to="alku" />
+    <Word from="Garonilie" to="Garonille" />
+    <Word from="Iikainen" to="likainen" />
+    <Word from="vaiehtelijoita" to="valehtelijoita" />
+    <Word from="puutariıaasi" to="puutarhaasi" />
+    <Word from="Garunin" to="Garonin" />
+    <Word from="oravaiettiä" to="oravalettiä" />
+    <Word from="paijon" to="paljon" />
+    <Word from="sutja" to="sut ja" />
+    <Word from="gospeikvartetissa" to="gospelkvartetissa" />
+    <Word from="Iauiajaksi" to="laulajaksi" />
+    <Word from="viihdyltäjä" to="viihdyttäjä" />
+    <Word from="hannaala" to="harmaata" />
+    <Word from="Iaulajalta" to="laulajalta" />
+    <Word from="saatjotain" to="saat jotain" />
+    <Word from="Löydänjonkun" to="Löydän jonkun" />
+    <Word from="pyüríyi" to="pyörtyi" />
+    <Word from="Cnıdupia" to="Crudupia" />
+    <Word from="Iiikaa" to="liikaa" />
+    <Word from="keıtaa" to="kertaa" />
+    <Word from="Thafs" to="That's" />
+    <Word from="Kappaietta" to="Kappaletta" />
+    <Word from="soijoka" to="soi joka" />
+    <Word from="Levytlä" to="Levyllä" />
+    <Word from="paiaamista" to="palaamista" />
+    <Word from="kuonnunn" to="kuormurin" />
+    <Word from="Tyttüystävät" to="Tyttöystävät" />
+    <Word from="kãpãlöifiin" to="käpälöitiin" />
+    <Word from="Oiko" to="Oliko" />
+    <Word from="tuipalo" to="tulipalo" />
+    <Word from="hebofiavaa" to="helpottavaa" />
+    <Word from="ongeina" to="ongelma" />
+    <Word from="ongeimia" to="ongelmia" />
+    <Word from="Ajateikaa" to="Ajatelkaa" />
+    <Word from="kuıki" to="kurki" />
+    <Word from="lhailen" to="Ihailen" />
+    <Word from="Lähtüsi" to="Lähtösi" />
+    <Word from="yhtiöile" to="yhtiölle" />
+    <Word from="eitoimi" to="ei toimi" />
+    <Word from="voijäädä" to="voi jäädä" />
+    <Word from="Pomkat" to="Porukat" />
+    <Word from="konıata" to="korvata" />
+    <Word from="konsentien" to="konserttien" />
+    <Word from="Sepã" to="Sepä" />
+    <Word from="hebolus" to="helpotus" />
+    <Word from="küyryssä" to="köyryssä" />
+    <Word from="repiat" to="replat" />
+    <Word from="kuikee" to="kulkee" />
+    <Word from="ponıkoita" to="porukoita" />
+    <Word from="naisetja" to="naiset ja" />
+    <Word from="tenıetuileeksi" to="tervetulleeksi" />
+    <Word from="yläpuolelia" to="yläpuolella" />
+    <Word from="kuullut180" to="kuullut 180" />
+    <Word from="Iapsellista" to="lapsellista" />
+    <Word from="esiinnytja" to="esiinnyt ja" />
+    <Word from="Iaulat" to="laulat" />
+    <Word from="Henanjestas" to="Herranjestas" />
+    <Word from="teilie" to="teille" />
+    <Word from="IIe" to="lle" />
+    <Word from="täilaisia" to="tällaisia" />
+    <Word from="Varu" to="Varo" />
+    <Word from="nimeliään" to="nimellään" />
+    <Word from="anneijaan" to="armeijaan" />
+    <Word from="penıstaa" to="perustaa" />
+    <Word from="minkkituıkkia" to="minkkiturkkia" />
+    <Word from="minkkituiiiilla" to="minkkiturkilla" />
+    <Word from="Tenıetuioa" to="Tervetuloa" />
+    <Word from="kuitalevyä" to="kultalevyä" />
+    <Word from="eiämässä" to="elämässä" />
+    <Word from="jutkaisua" to="julkaisua" />
+    <Word from="Foıt" to="Fort" />
+    <Word from="oien" to="olen" />
+    <Word from="asioilie" to="asioille" />
+    <Word from="Eitarvitsekaan" to="Ei tarvitsekaan" />
+    <Word from="pökenyin" to="pökerryin" />
+    <Word from="ylläiiyy" to="yllättyy" />
+    <Word from="komeaita" to="komealta" />
+    <Word from="Chadie" to="Charlie" />
+    <Word from="laulaisilteko" to="laulaisitteko" />
+    <Word from="Iaittaa" to="laittaa" />
+    <Word from="iyttärenne" to="tyttärenne" />
+    <Word from="pikkutyttünä" to="pikkutyttönä" />
+    <Word from="tyttükulta" to="tyttökulta" />
+    <Word from="vimuilua" to="virnuilua" />
+    <Word from="reporitereita" to="reporttereita" />
+    <Word from="vime" to="virne" />
+    <Word from="eijohdu" to="ei johdu" />
+    <Word from="eriiainen" to="erilainen" />
+    <Word from="Iasketa" to="lasketa" />
+    <Word from="kemıttu" to="kerrottu" />
+    <Word from="Manyja" to="Marty ja" />
+    <Word from="etteijutusta" to="ettei jutusta" />
+    <Word from="Katifomiassa" to="Kaliforniassa" />
+    <Word from="sun°filaudan" to="surffilaudan" />
+    <Word from="bnınetti" to="brunetti" />
+    <Word from="vaimiina" to="valmiina" />
+    <Word from="yiimääräiset" to="ylimääräiset" />
+    <Word from="leffatjää" to="leffat jää" />
+    <Word from="koin'lle" to="koirille" />
+    <Word from="Täilaisen" to="Tällaisen" />
+    <Word from="antanutjo" to="antanut jo" />
+    <Word from="Chaılien" to="Charlien" />
+    <Word from="ympäriliesi" to="ympärillesi" />
+    <Word from="Iyü" to="lyö" />
+    <Word from="lopan't" to="loparit" />
+    <Word from="hıisi" to="tulisi" />
+    <Word from="kuuiuvanijonnekin" to="kuuluvani jonnekin" />
+    <Word from="juhın" to="jutun" />
+    <Word from="miefkseni" to="mielikseni" />
+    <Word from="Tuisitko" to="Tulisitko" />
+    <Word from="Iıonäni" to="luonani" />
+    <Word from="äkää" to="alkaa" />
+    <Word from="yi" to="yli" />
+    <Word from="rupallelemaan" to="rupattelemaan" />
+    <Word from="Priscilialla" to="Priscillalla" />
+    <Word from="Hemmoltelet" to="Hemmotelet" />
+    <Word from="Hearlbreak" to="Heartbreak" />
+    <Word from="Holelia" to="Hotelia" />
+    <Word from="Nyton" to="Nyt on" />
+    <Word from="kiertueeile" to="kiertueelle" />
+    <Word from="Elvistã" to="Elvistä" />
+    <Word from="puoleila" to="puolella" />
+    <Word from="Äıä" to="Älä" />
+    <Word from="lnlemalional" to="International" />
+    <Word from="Iuottamustanne" to="luottamustanne" />
+    <Word from="Mycroftísta" to="Mycroftista" />
+    <Word from="Iopettako" to="lopettako" />
+    <Word from="Ielukauppa" to="lelukauppa" />
+    <Word from="Iomamatkalle" to="lomamatkalle" />
+    <Word from="Iyhyelle" to="lyhyelle" />
+    <Word from="Alkää" to="Älkää" />
+    <Word from="K_uka" to="Kuka" />
+    <Word from="IIa" to="lla" />
+    <Word from="Aitinne" to="Äitinne" />
+    <Word from="Vä/ikohtaus" to="Välikohtaus" />
+    <Word from="kuo//aan" to="kuollaan" />
+    <Word from="nä/kään" to="nälkään" />
+    <Word from="Su/je" to="Sulje" />
+    <Word from="Iäimäytit" to="läimäytit" />
+    <Word from="Iähetystössä" to="lähetystössä" />
+    <Word from="Iähetystöön" to="lähetystöön" />
+    <Word from="Iaosilainen" to="laosilainen" />
+    <Word from="Iiiketarjous" to="liiketarjous" />
+    <Word from="kaappavat" to="kaappaavat" />
+    <Word from="Ieivissään" to="leivissään" />
+    <Word from="EriC" to="Eric" />
+    <Word from="Voi/à" to="Voilà" />
+    <Word from="Crawleyı" to="Crawley!" />
+    <Word from="Iihaksiaan" to="lihaksiaan" />
+    <Word from="Iuenkaan" to="luenkaan" />
+    <Word from="Olemma" to="Olemme" />
+    <Word from="Iähtisitte" to="lähtisitte" />
+    <Word from="jotâin" to="jotain" />
+    <Word from="Eversi" to="Eversti" />
+    <Word from="Ieiriytyä" to="leiriytyä" />
+    <Word from="Iiikutte" to="liikutte" />
+    <Word from="Iääketiedettä" to="lääketiedettä" />
+    <Word from="Iivetä" to="livetä" />
+    <Word from="Iapsetkin" to="lapsetkin" />
+    <Word from="Iääkeluettelo" to="lääkeluettelo" />
+    <Word from="Iaatiko" to="laatikko" />
+    <Word from="hyvih" to="hyvin" />
+    <Word from="Ieukakuoppa" to="leukakuoppa" />
+    <Word from="Ientäjäni" to="lentäjäni" />
+    <Word from="Ieikkisi" to="leikkisi" />
+    <Word from="Iupaamastaan" to="lupaamastaan" />
+    <Word from="ku/taseni" to="kultaseni" />
+    <Word from="tu/en" to="tulen" />
+    <Word from="Iautalle" to="lautalle" />
+    <Word from="100_vuotiaaksi" to="100 vuotiaaksi" />
+    <Word from="_" to="" />
+    <Word from="Viiltäjã_Jackin" to="Viiltäjä Jackin" />
+    <Word from="keffärfkerro" to="kellarikerroksen" />
+    <Word from="tan/itsi" to="tarvitsi" />
+    <Word from="_Aivan" to="Aivan" />
+    <Word from="_Valosta" to="Valosta" />
+    <Word from="_Teemmekö" to="Teemmekö" />
+    <Word from="Viiltäjä_Jack" to="Viiltäjä Jack" />
+    <Word from="_Voi" to="Voi" />
+    <Word from="_Tiedätte" to="Tiedätte" />
+    <Word from="kulunutjo" to="kulunut jo" />
+    <Word from="Vuokra_auto" to="Vuokra-auto" />
+    <Word from="_Tuokaa" to="Tuokaa" />
+    <Word from="_Tunnetteko" to="Tunnetteko" />
+    <Word from="_Tiedämme" to="Tiedämme" />
+    <Word from="toissayön" to="toissa yön" />
+    <Word from="_Toki" to="Toki" />
+    <Word from="_Ammuttu" to="Ammuttu" />
+    <Word from="_Jahtasit" to="Jahtasit" />
+    <Word from="_Tunnenko" to="Tunnenko" />
+    <Word from="_Joku" to="Joku" />
+    <Word from="_Taivahan" to="Taivahan" />
+    <Word from="Kuorma_auto" to="Kuorma-auto" />
+    <Word from="_Vain" to="Vain" />
+    <Word from="Mesmer_klubille" to="Mesmer klubille" />
+    <Word from="0nslow'IIe" to="Onslow'lle" />
+    <Word from="Mesmer_klubi" to="Mesmer klubi" />
+    <Word from="_Anteeksi" to="Anteeksi" />
+    <Word from="Schrenk_Notzing" to="Schrenk Notzing" />
+    <Word from="_Tapoin" to="Tapoin" />
+    <Word from="_AIkää" to="Älkää" />
+    <Word from="0dotan" to="Odotan" />
+    <Word from="Iuonteenlu" to="luonteenlu" />
+    <Word from="Iempikaupunkini" to="lempikaupunkini" />
+    <Word from="Iavasta" to="lavasta" />
+    <Word from="Iämmittelijät" to="lämmittelijät" />
+    <Word from="Iaastaria" to="laastaria" />
+    <Word from="Riiuää" to="Riittää" />
+    <Word from="Käyuävätkö" to="Käyttävätkö" />
+    <Word from="Iähestykö" to="lähestykö" />
+    <Word from="Ieikekirja" to="leikekirja" />
+    <Word from="Ievyjään" to="levyjään" />
+    <Word from="Iahjoitamme" to="lahjoitamme" />
+    <Word from="Läppäätuohon" to="Läppää tuohon" />
+    <Word from="CIawdy" to="Clawdy" />
+    <Word from="mita" to="mitä" />
+    <Word from="jalkeen" to="jälkeen" />
+    <Word from="Cannabisjaponica" to="Cannabis japonica" />
+    <Word from="Ieningin" to="leningin" />
+    <Word from="kiıjoitatte" to="kirjoitatte" />
+    <Word from="kiıjoitetuksi" to="kirjoitetuksi" />
+    <Word from="kuluttuu" to="kuluttaa" />
+    <Word from="Iuvulta" to="luvulta" />
+    <Word from="Ieipomiskilpailuun" to="leipomiskilpailuun" />
+    <Word from="Maclntire" to="MacIntire" />
+    <Word from="Iehteemme" to="lehteemme" />
+    <Word from="Alä" to="Älä" />
+    <Word from="kysesssä" to="kyseessä" />
+    <Word from="Itsepuolustustal" to="Itsepuolustusta!" />
+    <Word from="Iiipasimesta" to="liipasimesta" />
+    <Word from="Iuutani" to="luutani" />
+    <Word from="Iahjansa" to="lahjansa" />
+    <Word from="Iähimmäisemme" to="lähimmäisemme" />
+    <Word from="Iuhistuu" to="luhistuu" />
+    <Word from="ıöyhkä" to="löyhkä" />
+    <Word from="Iehtileikkeleitä" to="lehtileikkeleitä" />
+    <Word from="vefieni" to="veljeni" />
+    <Word from="Iapselleni" to="lapselleni" />
+    <Word from="epänormaalinal" to="epänormaalina!" />
+    <Word from="Iuurankoja" to="luurankoja" />
+    <Word from="Iuurangoista" to="luurangoista" />
+    <Word from="päätiellel" to="päätielle!" />
+    <Word from="Valonneitsytta" to="Valonneitsyttä" />
+    <Word from="Iohikáármekuula" to="lohikäärmekuula" />
+    <Word from="yhdella" to="yhdellä" />
+    <Word from="Tasta" to="Tästä" />
+    <Word from="__" to="" />
+    <Word from="Alkáä" to="Älkää" />
+    <Word from="etta" to="että" />
+    <Word from="pitaa" to="pitää" />
+    <Word from="nälkáisiä" to="nälkäisiä" />
+    <Word from="Hyva" to="Hyvä" />
+    <Word from="hyvasta" to="hyvästä" />
+    <Word from="ruoastaja" to="ruoasta ja" />
+    <Word from="Kásivarteni" to="Käsivarteni" />
+    <Word from="käikki" to="kaikki" />
+    <Word from="Mozukustä" to="Mozukusta" />
+    <Word from="Etsivátkö" to="Etsivätkö" />
+    <Word from="Iohikáármekuulaa" to="lohikäärmekuulaa" />
+    <Word from="Valonneitsyttá" to="Valonneitsyttä" />
+    <Word from="taalla" to="täällä" />
+    <Word from="siemeniáán" to="siemeniään" />
+    <Word from="kunhän" to="kunhan" />
+    <Word from="äjättelen" to="ajattelen" />
+    <Word from="pelkuril" to="pelkuri!" />
+    <Word from="kyla" to="kylä" />
+    <Word from="hyökkáykseltä" to="hyökkäykseltä" />
+    <Word from="hyökkáisi" to="hyökkäisi" />
+    <Word from="hyökataan" to="hyökätään" />
+    <Word from="Voitjuoda" to="Voit juoda" />
+    <Word from="Iittaamisesta" to="littaamisesta" />
+    <Word from="Iahtenyt" to="lähtenyt" />
+    <Word from="kylasta" to="kylästä" />
+    <Word from="Etjuurikään" to="Et juurikaan" />
+    <Word from="sämältä" to="samalta" />
+    <Word from="käikkiällä" to="kaikkialla" />
+    <Word from="ehka" to="ehkä" />
+    <Word from="tiennytkaan" to="tiennytkään" />
+    <Word from="taistelenl" to="taistelen!" />
+    <Word from="Iiikkeita" to="liikkeitä" />
+    <Word from="Taistellaanl" to="Taistellaan!" />
+    <Word from="Odottämättomät" to="Odottamattomat" />
+    <Word from="näutinnot" to="nautinnot" />
+    <Word from="rikkään" to="rikkaan" />
+    <Word from="Iuotettavalta" to="luotettavalta" />
+    <Word from="elaa" to="elää" />
+    <Word from="pekkiã" to="pelkkiä" />
+    <Word from="jãkeen" to="jälkeen" />
+    <Word from="nörttejã" to="nörttejä" />
+    <Word from="penıskursseja" to="peruskursseja" />
+    <Word from="Suorititjo" to="Suoritit jo" />
+    <Word from="seinäilä" to="seinällä" />
+    <Word from="Iaiteta" to="laiteta" />
+    <Word from="hennostu" to="hermostu" />
+    <Word from="Coiumbiassa" to="Columbiassa" />
+    <Word from="Penıerssiä" to="Perverssejä" />
+    <Word from="sukupuoieimislã" to="sukupuolielimistä" />
+    <Word from="epãiooginen" to="epälooginen" />
+    <Word from="oisin" to="olisin" />
+    <Word from="iittoni" to="liittoni" />
+    <Word from="oisi" to="olisi" />
+    <Word from="asuntoia" to="asuntola" />
+    <Word from="pääsittejatkoseminaariini" to="pääsitte jatkoseminaariini" />
+    <Word from="Anıatkaapa" to="Arvatkaapa" />
+    <Word from="Iopussa" to="lopussa" />
+    <Word from="Oletjo" to="Olet jo" />
+    <Word from="Haiuan" to="Haluan" />
+    <Word from="luennoilie" to="luennoille" />
+    <Word from="Iintsata" to="lintsata" />
+    <Word from="oletjuuri" to="olet juuri" />
+    <Word from="Iuuietko" to="luuletko" />
+    <Word from="kylvyssã" to="kylvyssä" />
+    <Word from="vãlãhti" to="välähti" />
+    <Word from="Miettikãã" to="Miettikää" />
+    <Word from="insinöün" to="insinööri" />
+    <Word from="Menithalpaan" to="Menit halpaan" />
+    <Word from="Tukaa" to="Tulkaa" />
+    <Word from="Aarun" to="Aaron" />
+    <Word from="Kieleiläsi" to="Kielelläsi" />
+    <Word from="pystytjohonkin" to="pystyt johonkin" />
+    <Word from="KämppikseniWilliam" to="Kämppikseni William" />
+    <Word from="Iuolamies" to="luolamies" />
+    <Word from="keskianıon" to="keskiarvon" />
+    <Word from="kananosta" to="kartanosta" />
+    <Word from="päivälliselie" to="päivälliselle" />
+    <Word from="Iasagnea" to="lasagnea" />
+    <Word from="voitehota" to="voi tehota" />
+    <Word from="0lisit" to="Olisit" />
+    <Word from="menijuuri" to="meni juuri" />
+    <Word from="tapasivatjo" to="tapasivat jo" />
+    <Word from="knıunukoriiiliiset" to="kruunukorkilliset" />
+    <Word from="eijuo" to="ei juo" />
+    <Word from="Näytätuupuneeita" to="Näytät uupuneelta" />
+    <Word from="Etanıaakaan" to="Et arvaakaan" />
+    <Word from="lhanko" to="Ihanko" />
+    <Word from="yfltäkään" to="yritäkään" />
+    <Word from="serkkuniWinn" to="serkkuni Winn" />
+    <Word from="voijatkua" to="voi jatkua" />
+    <Word from="miehetja" to="miehet ja" />
+    <Word from="víesfiní" to="viestini" />
+    <Word from="kuullılsinusla" to="kuullut sinusta" />
+    <Word from="Tãmã" to="Tämä" />
+    <Word from="kelããn" to="ketään" />
+    <Word from="vedessãkãveijã" to="vedessäkävelijä" />
+    <Word from="/abrassa" to="labrassa" />
+    <Word from="akaa" to="alkaa" />
+    <Word from="Iiinaa" to="liinaa" />
+    <Word from="kanıainen" to="karvainen" />
+    <Word from="oten" to="olen" />
+    <Word from="kallaisesi" to="kaltaisesi" />
+    <Word from="pmffa" to="proffa" />
+    <Word from="tulittänne" to="tulit tänne" />
+    <Word from="Alalteko" to="Alatteko" />
+    <Word from="luuiisit" to="luulisit" />
+    <Word from="Pysãhdy" to="Pysähdy" />
+    <Word from="Paskathänestä" to="Paskat hänestä" />
+    <Word from="Pysãhdyheti" to="Pysähdy heti" />
+    <Word from="Heivetti" to="Helvetti" />
+    <Word from="Pidãlãn" to="Pidätän" />
+    <Word from="Vflru" to="Varo" />
+    <Word from="huolissasijostain" to="huolissasi jostain" />
+    <Word from="hurmaavatpuhelusi" to="hurmaavat puhelusi" />
+    <Word from="ystävysiyin" to="ystävystyin" />
+    <Word from="Cunya" to="Currya" />
+    <Word from="cunya" to="currya" />
+    <Word from="kohdaliani" to="kohdallani" />
+    <Word from="anıoista" to="arvoista" />
+    <Word from="Loputnäkevätnälkää" to="Loput näkevät nälkää" />
+    <Word from="oletollut" to="olet ollut" />
+    <Word from="jäikinıoan" to="jälkiruoan" />
+    <Word from="Saathänet" to="Saat hänet" />
+    <Word from="Kemın" to="Kerron" />
+    <Word from="kappaieiksi" to="kappaleiksi" />
+    <Word from="vuokıanja" to="vuokran ja" />
+    <Word from="iyperys" to="typerys" />
+    <Word from="mmanltisella" to="romanttisella" />
+    <Word from="ıakastellut" to="rakastellut" />
+    <Word from="jutteiimme" to="juttelimme" />
+    <Word from="vesimittann" to="vesimittarin" />
+    <Word from="kuikevat" to="kulkevat" />
+    <Word from="tavaratja" to="tavarat ja" />
+    <Word from="piiltaal" to="piittaat" />
+    <Word from="etehkä" to="et ehkä" />
+    <Word from="Lapsenvahtisituli" to="Lapsenvahtisi tuli" />
+    <Word from="Ymmänälkö" to="Ymmärrätkö" />
+    <Word from="iyiiãresi" to="tyttäresi" />
+    <Word from="myöhã" to="myöhä" />
+    <Word from="nähnytAaron" to="nähnyt Aaron" />
+    <Word from="haiunnut" to="halunnut" />
+    <Word from="Olitoikeassa" to="Olit oikeassa" />
+    <Word from="itseenijuuri" to="itseeni juuri" />
+    <Word from="lempinıokaani" to="lempiruokaani" />
+    <Word from="Iupaamaan" to="lupaamaan" />
+    <Word from="Teetsoimun" to="Teet solmun" />
+    <Word from="Senıice" to="Service" />
+    <Word from="Iasini" to="lasini" />
+    <Word from="Ieuassa" to="leuassa" />
+    <Word from="Iiikekumppaninsa" to="liikekumppaninsa" />
+    <Word from="Iiikekumppani" to="liikekumppani" />
+    <Word from="Iausuttiinkaan" to="lausuttiinkaan" />
+    <Word from="Iastauslaiturille" to="lastauslaiturille" />
+    <Word from="Oleko" to="Oletko" />
+    <Word from="tie/tä" to="tieltä" />
+    <Word from="Mayhew'IIe" to="Mayhew'lle" />
+    <Word from="Iakiasiaintoimisto" to="lakiasiaintoimisto" />
+    <Word from="Iakimiestä" to="lakimiestä" />
+    <Word from="ne//eensä" to="nelleensä" />
+    <Word from="ha//ituksiin" to="hallituksiin" />
+    <Word from="soti/aa//isiin" to="sotilaallisiin" />
+    <Word from="Iahtasit" to="lahtasit" />
+    <Word from="Tiestikö" to="Tiesitkö" />
+    <Word from="Iakimiehiä" to="lakimiehiä" />
+    <Word from="Äläkää" to="Älkää" />
+    <Word from="O/en" to="Olen" />
+    <Word from="minsta" to="minusta" />
+    <Word from="Iuennosta" to="luennosta" />
+    <Word from="Iakimiehestä" to="lakimiehestä" />
+    <Word from="Iopetatte" to="lopetatte" />
+    <Word from="0/it" to="0lit" />
+    <Word from="tu/it" to="tulit" />
+    <Word from="Mayhew'Ita" to="Mayhew'lta" />
+    <Word from="Iähietäisyydellä" to="lähietäisyydellä" />
+    <Word from="ennenkuin" to="ennen kuin" />
+    <Word from="nukkuä" to="nukkua" />
+    <Word from="ihmisia" to="ihmisiä" />
+    <Word from="elossä" to="elossa" />
+    <Word from="tiedettävá" to="tiedettävä" />
+    <Word from="Etsikáá" to="Etsikää" />
+    <Word from="Aıjaı" to="Aijai" />
+    <Word from="Välonneitsyen" to="Valonneitsyen" />
+    <Word from="Iupäustäsi" to="lupaustasi" />
+    <Word from="Yämikugyo" to="Yamikugyo" />
+    <Word from="epäonnistumisiä" to="epäonnistumisia" />
+    <Word from="Ymmárrätkö" to="Ymmärrätkö" />
+    <Word from="Iohikäärmekuula" to="lohikäärmekuula" />
+    <Word from="tasta" to="tästä" />
+    <Word from="taynna" to="täynnä" />
+    <Word from="mina" to="minä" />
+    <Word from="tata" to="tätä" />
+    <Word from="tyhmaa" to="tyhmää" />
+    <Word from="enemman" to="enemmän" />
+    <Word from="pátevöity" to="pätevöity" />
+    <Word from="kylla" to="kyllä" />
+    <Word from="ärvokästä" to="arvokasta" />
+    <Word from="selviytyjáksi" to="selviytyjäksi" />
+    <Word from="myyda" to="myydä" />
+    <Word from="hanet" to="hänet" />
+    <Word from="äpuäsi" to="apuasi" />
+    <Word from="Kukä" to="Kuka" />
+    <Word from="sänoi" to="sanoi" />
+    <Word from="äutän" to="autan" />
+    <Word from="Äla" to="Älä" />
+    <Word from="Han" to="Hän" />
+    <Word from="Mita" to="Mitä" />
+    <Word from="tama" to="tämä" />
+    <Word from="Olettiellamme" to="Olet tiellämme" />
+    <Word from="Kylani" to="Kyläni" />
+    <Word from="Iahdemme" to="lähdemme" />
+    <Word from="viela" to="vielä" />
+    <Word from="yhdeksan" to="yhdeksän" />
+    <Word from="Nasaviisaudet" to="Näsäviisaudet" />
+    <Word from="Láhempänä" to="Lähempänä" />
+    <Word from="tietaa" to="tietää" />
+    <Word from="mentava" to="mentävä" />
+    <Word from="onkään" to="onkaan" />
+    <Word from="tekemista" to="tekemistä" />
+    <Word from="Sina" to="Sinä" />
+    <Word from="sina" to="sinä" />
+    <Word from="kiitettävá" to="kiitettävä" />
+    <Word from="edellámme" to="edellämme" />
+    <Word from="eika" to="eikä" />
+    <Word from="Takanasfl" to="Takanasi!" />
+    <Word from="Iankaan" to="lankaan" />
+    <Word from="välloillensä" to="valloillensa" />
+    <Word from="siita" to="siitä" />
+    <Word from="Iohikaarmekuulan" to="lohikäärmekuulan" />
+    <Word from="Keta" to="Ketä" />
+    <Word from="nama" to="nämä" />
+    <Word from="ajateltavaal" to="ajateltavaa!" />
+    <Word from="olläkseni" to="ollakseni" />
+    <Word from="värmä" to="varma" />
+    <Word from="hanta" to="häntä" />
+    <Word from="hanelle" to="hänelle" />
+    <Word from="Osäätko" to="Osaatko" />
+    <Word from="rajahteita" to="räjähteitä" />
+    <Word from="Jyashil" to="Jyashi!" />
+    <Word from="Nama" to="Nämä" />
+    <Word from="sita" to="sitä" />
+    <Word from="koskään" to="koskaan" />
+    <Word from="Viekáá" to="Viekää" />
+    <Word from="Pidáttäkää" to="Pidättäkää" />
+    <Word from="Oclottakaal" to="Odottakaa!" />
+    <Word from="pelkáämá" to="pelkäämä" />
+    <Word from="ostävänne" to="ostavanne" />
+    <Word from="rovoillänne" to="rovoillanne" />
+    <Word from="Jonäin" to="Jonain" />
+    <Word from="piit'taa" to="piittaa" />
+    <Word from="&gt;" to="" />
+    <Word from="táysikuu" to="täysikuu" />
+    <Word from="sinuttänne" to="sinut tänne" />
+    <Word from="Iahtea" to="lähteä" />
+    <Word from="Paastaksemme" to="Päästäksemme" />
+    <Word from="Párjáämme" to="Pärjäämme" />
+    <Word from="hänskässä" to="hanskassa" />
+    <Word from="Tama" to="Tämä" />
+    <Word from="Menkaa" to="Menkää" />
+    <Word from="Häipykáá" to="Häipykää" />
+    <Word from="kasin" to="käsin" />
+    <Word from="Tata" to="Tätä" />
+    <Word from="Hylkaatkö" to="Hylkäätkö" />
+    <Word from="Paasta" to="Päästä" />
+    <Word from="ryöstäá" to="ryöstää" />
+    <Word from="Iivistä" to="livistä" />
+    <Word from="viivytát" to="viivytät" />
+    <Word from="Pysähtykáä" to="Pysähtykää" />
+    <Word from="kännoiltä" to="kannoilta" />
+    <Word from="kásken" to="käsken" />
+    <Word from="Pysähtykáá" to="Pysähtykää" />
+    <Word from="huonojátkä" to="huono jätkä" />
+    <Word from="kátyrini" to="kätyrini" />
+    <Word from="mitaan" to="mitään" />
+    <Word from="Missa" to="Missä" />
+    <Word from="kyntäván" to="kyntävän" />
+    <Word from="pärjánneet" to="pärjänneet" />
+    <Word from="ruokää" to="ruokaa" />
+    <Word from="märjojä" to="marjoja" />
+    <Word from="kuinkä" to="kuinka" />
+    <Word from="ollä" to="olla" />
+    <Word from="missa" to="missä" />
+    <Word from="Peráänny" to="Peräänny" />
+    <Word from="Pysykáä" to="Pysykää" />
+    <Word from="Vetelàt" to="Vetelät" />
+    <Word from="täppää" to="tappaa" />
+    <Word from="ketaan" to="ketään" />
+    <Word from="pelkaamaan" to="pelkäämään" />
+    <Word from="ovatja" to="ovat ja" />
+    <Word from="ymmarra" to="ymmärrä" />
+    <Word from="ystväni" to="ystäväni" />
+    <Word from="Kärpásiäkö" to="Kärpäsiäkö" />
+    <Word from="metsástät" to="metsästät" />
+    <Word from="Iiittya" to="liittyä" />
+    <Word from="Alá" to="Älä" />
+    <Word from="pyörtyá" to="pyörtyä" />
+    <Word from="nälästá" to="nälästä" />
+    <Word from="hyva" to="hyvä" />
+    <Word from="syömaan" to="syömään" />
+    <Word from="katyreita" to="kätyreitä" />
+    <Word from="Epáreilua" to="Epäreilua" />
+    <Word from="Läuttä" to="Lautta" />
+    <Word from="iltänä" to="iltana" />
+    <Word from="Täisimme" to="Taisimme" />
+    <Word from="Voihän" to="Voihan" />
+    <Word from="hittoläinen" to="hittolainen" />
+    <Word from="Jä" to="Ja" />
+    <Word from="Iohikáármekivi" to="lohikäärmekivi" />
+    <Word from="siina" to="siinä" />
+    <Word from="Iaake" to="lääke" />
+    <Word from="purrutjokin" to="purrut jokin" />
+    <Word from="tahan" to="tähän" />
+    <Word from="paasseet" to="päässeet" />
+    <Word from="Iaakkeen" to="lääkkeen" />
+    <Word from="Ieposija" to="leposija" />
+    <Word from="Kylla" to="Kyllä" />
+    <Word from="pitkalta" to="pitkältä" />
+    <Word from="eivat" to="eivät" />
+    <Word from="tanne" to="tänne" />
+    <Word from="taman" to="tämän" />
+    <Word from="Ehka" to="Ehkä" />
+    <Word from="han" to="hän" />
+    <Word from="mista" to="mistä" />
+    <Word from="pidat" to="pidät" />
+    <Word from="Joutukää" to="Joutukaa" />
+    <Word from="Hanen" to="Hänen" />
+    <Word from="sisallaan" to="sisällään" />
+    <Word from="Pysykáá" to="Pysykää" />
+    <Word from="Lähtekäá" to="Lähtekää" />
+    <Word from="tilään" to="tilaan" />
+    <Word from="paatella" to="päätellä" />
+    <Word from="isani" to="isäni" />
+    <Word from="paasemme" to="pääsemme" />
+    <Word from="haipyivat" to="häipyivät" />
+    <Word from="Tehán" to="Tehän" />
+    <Word from="Hyökkáätte" to="Hyökkäätte" />
+    <Word from="Iiikahdattekaan" to="liikahdattekaan" />
+    <Word from="jä" to="ja" />
+    <Word from="välmistäuduin" to="valmistauduin" />
+    <Word from="Hikavvassa" to="Hikawassa" />
+    <Word from="Kuolel" to="Kuole!" />
+    <Word from="hanen" to="hänen" />
+    <Word from="yhta" to="yhtä" />
+    <Word from="Sisalla" to="Sisällä" />
+    <Word from="ruumiissä" to="ruumiissa" />
+    <Word from="minka" to="minkä" />
+    <Word from="Iihää" to="lihaa" />
+    <Word from="Iuutä" to="luuta" />
+    <Word from="Sisàllàmme" to="Sisällämme" />
+    <Word from="Tottelel" to="Tottele!" />
+    <Word from="Äläjätä" to="Älä jätä" />
+    <Word from="aitisi" to="äitisi" />
+    <Word from="Mina" to="Minä" />
+    <Word from="ymmartamaan" to="ymmärtämään" />
+    <Word from="syödaan" to="syödään" />
+    <Word from="pähältä" to="pahalta" />
+    <Word from="Däkuän" to="Dakuan" />
+    <Word from="sirkutahti" to="sirkustähti" />
+    <Word from="Iapiota" to="lapiota" />
+    <Word from="mieltasi" to="mieltäsi" />
+    <Word from="pitaisi" to="pitäisi" />
+    <Word from="vieda" to="viedä" />
+    <Word from="táálläkäán" to="täälläkään" />
+    <Word from="taytyy" to="täytyy" />
+    <Word from="kivesta" to="kivestä" />
+    <Word from="etsia" to="etsiä" />
+    <Word from="Poikatytöstà" to="Poikatytöstä" />
+    <Word from="hyökkasi" to="hyökkäsi" />
+    <Word from="takaapain" to="takaapäin" />
+    <Word from="Iäskee" to="laskee" />
+    <Word from="haipya" to="häipyä" />
+    <Word from="tehclákseni" to="tehdäkseni" />
+    <Word from="piän" to="pian" />
+    <Word from="tyrkyttäá" to="tyrkyttää" />
+    <Word from="minuä" to="minua" />
+    <Word from="nálkáinen" to="nälkäinen" />
+    <Word from="Sydametön" to="Sydämetön" />
+    <Word from="hylata" to="hylätä" />
+    <Word from="yha" to="yhä" />
+    <Word from="käuniisti" to="kauniisti" />
+    <Word from="ihmisverestá" to="ihmisverestä" />
+    <Word from="Siiiä" to="Sinä" />
+    <Word from="häluät" to="haluat" />
+    <Word from="Iahemmin" to="lähemmin" />
+    <Word from="kayttaa" to="käyttää" />
+    <Word from="hyvaksi" to="hyväksi" />
+    <Word from="paase" to="pääse" />
+    <Word from="siivilla" to="siivillä" />
+    <Word from="jälkeläisá" to="jälkeläisiä" />
+    <Word from="syista" to="syistä" />
+    <Word from="pyháä" to="pyhää" />
+    <Word from="Tyhmat" to="Tyhmät" />
+    <Word from="pyytavat" to="pyytävät" />
+    <Word from="Hölynpölyäl" to="Hölynpölyä!" />
+    <Word from="Nakivat" to="Näkivät" />
+    <Word from="kannissa" to="kännissä" />
+    <Word from="kasivarren" to="käsivarren" />
+    <Word from="hánenlaisensa" to="hänenlaisensa" />
+    <Word from="solää" to="solaa" />
+    <Word from="Iiioitella" to="liioitella" />
+    <Word from="Iiioittele" to="liioittele" />
+    <Word from="Tiedathan" to="Tiedäthän" />
+    <Word from="pyhástä" to="pyhästä" />
+    <Word from="Iohikáármekivestä" to="lohikäärmekivestä" />
+    <Word from="Ymmárrát" to="Ymmärrät" />
+    <Word from="ärmonne" to="armonne" />
+    <Word from="näisten" to="naisten" />
+    <Word from="Iupäukseni" to="lupaukseni" />
+    <Word from="kekseliáisyytesi" to="kekseliäisyytesi" />
+    <Word from="Iaudalta" to="laudalta" />
+    <Word from="kestávyytesi" to="kestävyytesi" />
+    <Word from="taiclakaan" to="taidakaan" />
+    <Word from="tyttöystava" to="tyttöystävä" />
+    <Word from="sormissäni" to="sormissani" />
+    <Word from="räivoisän" to="raivoisan" />
+    <Word from="kärhun" to="karhun" />
+    <Word from="helvetista" to="helvetistä" />
+    <Word from="väi" to="vai" />
+    <Word from="poissä" to="poissa" />
+    <Word from="elamani" to="elämäni" />
+    <Word from="pitkátjalkasi" to="pitkät jalkasi" />
+    <Word from="Kadet" to="Kädet" />
+    <Word from="niita" to="niitä" />
+    <Word from="Kaske" to="Käske" />
+    <Word from="paastaa" to="päästää" />
+    <Word from="Pida" to="Pidä" />
+    <Word from="Iohikaarmekivi" to="lohikäärmekivi" />
+    <Word from="sinustä" to="sinusta" />
+    <Word from="syöksyyjo" to="syöksyy jo" />
+    <Word from="veljeasi" to="veljeäsi" />
+    <Word from="Odotä" to="Odota" />
+    <Word from="Pysáhdy" to="Pysähdy" />
+    <Word from="kivea" to="kiveä" />
+    <Word from="Missaan" to="Missään" />
+    <Word from="tiheámpi" to="tiheämpi" />
+    <Word from="Iuulitkaan" to="luulitkaan" />
+    <Word from="kaarmekuula" to="käärmekuula" />
+    <Word from="muttajätän" to="mutta jätän" />
+    <Word from="kuoletl" to="kuolet!" />
+    <Word from="Iohikaarmekuula" to="lohikäärmekuula" />
+    <Word from="kieltava" to="kieltävä" />
+    <Word from="Láhtekáá" to="Lähtekää" />
+    <Word from="Iohikáärmekuulaa" to="lohikäärmekuulaa" />
+    <Word from="hereilla" to="hereillä" />
+    <Word from="kaljupaa" to="kaljupää" />
+    <Word from="äntämällä" to="antamalla" />
+    <Word from="kuulän" to="kuulan" />
+    <Word from="täkäisin" to="takaisin" />
+    <Word from="puolikkään" to="puolikkaan" />
+    <Word from="pohjoisessaja" to="pohjoisessa ja" />
+    <Word from="metsasta" to="metsästä" />
+    <Word from="Iohikäärmekuulälle" to="lohikäärmekuulalle" />
+    <Word from="teita" to="teitä" />
+    <Word from="Linnutkään" to="Linnutkaan" />
+    <Word from="Puolikkään" to="Puolikkaan" />
+    <Word from="äntänut" to="antanut" />
+    <Word from="tiedan" to="tiedän" />
+    <Word from="heráttámássá" to="herättämässä" />
+    <Word from="Iäsin" to="lasin" />
+    <Word from="hätánä" to="hätänä" />
+    <Word from="Iöysitte" to="löysitte" />
+    <Word from="a//ı'gaal'torıh" to="alligaattorin" />
+    <Word from="Tyttbparka" to="tyttöparka" />
+    <Word from="bänãä" to="bänää" />
+    <Word from="Co/en" to="Colen" />
+    <Word from="Iapsikoıfin" to="lapsikortin" />
+    <Word from="rauhallisemminl" to="rauhallisemmin!" />
+    <Word from="Iahjasi" to="lahjasi" />
+    <Word from="Ruokihänet" to="Ruoki hänet" />
+    <Word from="Iöystymistä" to="löystymistä" />
+    <Word from="Iapsestaan" to="lapsestaan" />
+    <Word from="Iaatuaikaa" to="laatuaikaa" />
+    <Word from="Ioukkaannuit" to="loukkaannuit" />
+    <Word from="Ioistojuttu" to="loistojuttu" />
+    <Word from="Ioukkaavaa" to="loukkaavaa" />
+    <Word from="Ioukkaan" to="loukkaan" />
+    <Word from="l'ıedän" to="Tiedän" />
+    <Word from="Iyömästä" to="lyömästä" />
+    <Word from="C/ıâteauneuf" to="Châteauneuf" />
+    <Word from="Iikaisten" to="likaisten" />
+    <Word from="Iapsenlapseton" to="lapsenlapseton" />
+    <Word from="Ieukani" to="leukani" />
+    <Word from="Ientokonetta" to="lentokonetta" />
+    <Word from="Iorrainea" to="lorrainea" />
+    <Word from="Iastentarhaan" to="lastentarhaan" />
+    <Word from="Iupaavin" to="lupaavin" />
+    <Word from="Iastenhoitaja" to="lastenhoitaja" />
+    <Word from="Kegeleitã" to="Kegeleitä" />
+    <Word from="helkkaril" to="helkkari!" />
+    <Word from="Ieukaani" to="leukaani" />
+    <Word from="Iaihtuneen" to="laihtuneen" />
+    <Word from="Iahjoittamaan" to="lahjoittamaan" />
+    <Word from="trefflt" to="treffit" />
+    <Word from="Iöysyys" to="löysyys" />
+    <Word from="Diggleriã" to="Diggleriä" />
+    <Word from="Kuıfi//a" to="Kurtilla" />
+    <Word from="pysãhdellä" to="pysähdellä" />
+    <Word from="Iomaasi" to="lomaasi" />
+    <Word from="Iastattu" to="lastattu" />
+    <Word from="Iasinne" to="lasinne" />
+    <Word from="Iuihin" to="luihin" />
+    <Word from="Iastensuojelujuttuun" to="lastensuojelujuttuun" />
+    <Word from="Ieffaan" to="leffaan" />
+    <Word from="mulkkul" to="mulkku!" />
+    <Word from="Iapsenvahtia" to="lapsenvahtia" />
+    <Word from="Iähelläsi" to="lähelläsi" />
+    <Word from="stã" to="stä" />
+    <Word from="TOSi" to="Tosi" />
+    <Word from="Ioistoidea" to="loistoidea" />
+    <Word from="Tyısiä" to="Tylsiä" />
+    <Word from="lsi" to="Isi" />
+    <Word from="Iaastarin" to="laastarin" />
+    <Word from="Viewjatkuu" to="View jatkuu" />
+    <Word from="lnStylen" to="InStylen" />
+    <Word from="köriläsl" to="köriläs!" />
+    <Word from="Ieffoissa" to="leffoissa" />
+    <Word from="Ieffaseuraksi" to="leffaseuraksi" />
+    <Word from="Iueskelemaan" to="lueskelemaan" />
+    <Word from="Mitäjätkä" to="Mitä jätkä" />
+    <Word from="Iaukesitkaan" to="laukesitkaan" />
+    <Word from="Kiitã" to="Kiitä" />
+    <Word from="ÄãIiö" to="Ääliö" />
+    <Word from="Iyhytpöksy" to="lyhytpöksy" />
+    <Word from="Iacrosse" to="lacrosse" />
+    <Word from="Iöytãmãttã" to="löytämättä" />
+    <Word from="samojajuttuja" to="samoja juttuja" />
+    <Word from="Järvellel" to="Järvelle!" />
+    <Word from="Talouspaperitl" to="Talouspaperit!" />
+    <Word from="Älkäãs" to="Älkääs" />
+    <Word from="pillunaamal" to="pillunaama!" />
+    <Word from="poikaystävänsã" to="poikaystävänsä" />
+    <Word from="Iapsenvahti" to="lapsenvahti" />
+    <Word from="Nykistã" to="Nykistä" />
+    <Word from="Iaatuaikamme" to="laatuaikamme" />
+    <Word from="Käãnsin" to="Käänsin" />
+    <Word from="Iatinaksi" to="latinaksi" />
+    <Word from="yleensäjuo" to="yleensä juo" />
+    <Word from="kreisejãjuttuja" to="kreisejä juttuja" />
+    <Word from="Iiitostasi" to="liitostasi" />
+    <Word from="Mitäjos" to="Mitä jos" />
+    <Word from="Sinullaja" to="Sinulla ja" />
+    <Word from="Iempparini" to="lempparini" />
+    <Word from="Iienetkin" to="lienetkin" />
+    <Word from="Iuokkajuhla" to="luokkajuhla" />
+    <Word from="Iuokkakokouksesta" to="luokkakokouksesta" />
+    <Word from="Iukuteeman" to="lukuteeman" />
+    <Word from="Menejo" to="Mene jo" />
+    <Word from="Sinãjätit" to="Sinä jätit" />
+    <Word from="Iähtöãsi" to="lähtöäsi" />
+    <Word from="Iãäkikseen" to="lääkikseen" />
+    <Word from="puhuajostain" to="puhua jostain" />
+    <Word from="tavatajoku" to="tavata joku" />
+    <Word from="Iookia" to="lookia" />
+    <Word from="Iapsiystävällisempãnã" to="lapsiystävällisempänä" />
+    <Word from="isãnnälle" to="isännälle" />
+    <Word from="tã" to="tä" />
+    <Word from="Ieidi" to="leidi" />
+    <Word from="Kãvisikö" to="Kävisikö" />
+    <Word from="marisãtkä" to="marisätkä" />
+    <Word from="kännissäjärveen" to="kännissä järveen" />
+    <Word from="sinullajotain" to="sinulla jotain" />
+    <Word from="Iuntun" to="luntun" />
+    <Word from="Iunttu" to="lunttu" />
+    <Word from="Iukitsin" to="lukitsin" />
+    <Word from="jyystãä" to="jyystää" />
+    <Word from="Iuokkajuhlaan" to="luokkajuhlaan" />
+    <Word from="Michellestã" to="Michellestä" />
+    <Word from="Iuokkakokous" to="luokkakokous" />
+    <Word from="sinäja" to="sinä ja" />
+    <Word from="Sinãja" to="Sinä ja" />
+    <Word from="Sillãjoskus" to="Sillä joskus" />
+    <Word from="Iopetimme" to="lopetimme" />
+    <Word from="Ymmãrrãtkö" to="Ymmärrätkö" />
+    <Word from="kanssajoka" to="kanssa joka" />
+    <Word from="Iiioitellusti" to="liioitellusti" />
+    <Word from="Iaihalta" to="laihalta" />
+    <Word from="Miaja" to="Mia ja" />
+    <Word from="Mietitãänpã" to="Mietitäänpä" />
+    <Word from="Kyııä" to="Kyllä" />
+    <Word from="Pidãttelel" to="Pidättele!" />
+    <Word from="ymmärtãmisestä" to="ymmärtämisestä" />
+    <Word from="jajään" to="ja jään" />
+    <Word from="Selenaja" to="Selena ja" />
+    <Word from="Iuokkakokousta" to="luokkakokousta" />
+    <Word from="ákápussi" to="äkäpussi" />
+    <Word from="karkoituksen" to="karkotuksen" />
+  </WholeWords>
+  <PartialWordsAlways />
+  <PartialWords />
+  <PartialLines />
+  <PartialLinesAlways />
+  <BeginLines />
+  <EndLines />
+  <WholeLines>
+    <Line from="Katsokaa pa." to="Katsokaapa." />
+    <Line from="Mik!&#xD;&#xA;&quot;&quot;e“9iräı" to="Mik!&#xD;&#xA;-Hengitä!" />
+    <Line from="Tu lta!" to="Tulta!" />
+    <Line from="...0I1..." to="...on..." />
+    <Line from="Ken gän nauh oja?" to="Kengännauhoja?" />
+    <Line from="kãmmottãVãllã mUiStollã." to="kammottavana muistona." />
+    <Line from="Hän näki naisen menevän&#xD;&#xA;kellarikerroksen ksen asun to o nsä." to="Hän näki naisen menevän&#xD;&#xA;kellarikerroksen asuntoonsa." />
+    <Line from="Minä etsin käsiini miehen, joka&#xD;&#xA;on aurtanutiestradea ja minua:" to="Minä etsin käsiini miehen, joka&#xD;&#xA;on auttanut Lestradea ja minua:" />
+    <Line from="Huomaa erityisesti&#xD;&#xA;punaisella merkitty &quot;kitoris." to="Huomaa erityisesti&#xD;&#xA;punaisella merkitty &quot;klitoris&quot;." />
+    <Line from="Tulkaa, meillä on&#xD;&#xA;Ha vaıji-bileet suihkussa" to="Tulkaa, meillä on&#xD;&#xA;Havaiji-bileet suihkussa" />
+    <Line from="Ta rkoitatko että&#xD;&#xA;hänet myrkytettiin?" to="Tarkoitatko että&#xD;&#xA;hänet myrkytettiin?" />
+    <Line from="Odotta kaa soittoani&#xD;&#xA;Ievähdyspaikalla." to="Odottakaa soittoani&#xD;&#xA;levähdyspaikalla." />
+    <Line from="Nyt kuuntelet, perska rva." to="Nyt kuuntelet, perskarva." />
+    <Line from="Ta patko hänet sitten?" to="Tapatko hänet sitten?" />
+    <Line from="Seuraa vissa va/oissa." to="Seuraavissa valoissa." />
+    <Line from="Aıoıt rapattaa minut.&#xD;&#xA;- En." to="Aioit tapattaa minut.&#xD;&#xA;- En." />
+    <Line from="Todella vaku uttavaa." to="Todella vakuuttavaa." />
+    <Line from="I-le ovat tuolla alhaalla" to="He ovat tuolla alhaalla" />
+    <Line from="Nainen kuuluu minulle.&#xD;&#xA;- I-Iàivy siitä, ylikasvuinen hyttynen!" to="Nainen kuuluu minulle.&#xD;&#xA;- Häivy siitä, ylikasvuinen hyttynen!" />
+    <Line from="I-Ialuatte käyttää pyhàà kiveä&#xD;&#xA;dynastian aarteen löytämiseksi." to="Haluatte käyttää pyhàà kiveä&#xD;&#xA;dynastian aarteen löytämiseksi." />
+    <Line from="Mitäf?" to="Mitä.. ?" />
+    <Line from="Kuuluuko Hiru ko-klaanista mitään?&#xD;&#xA;- Ninjasoturit ovat edellämme." to="Kuuluuko Hiruko-klaanista mitään?&#xD;&#xA;- Ninjasoturit ovat edellämme." />
+    <Line from="Anteeksı} painoin kai... -" to="Anteeksi, painoin kai... -" />
+    <Line from="ja Rea! Ho usewíves." to="ja Real Housewives." />
+    <Line from="Et halu n n ut Julkkistansseihinkaan." to="Et halunnut Julkkistansseihinkaan." />
+    <Line from="Laard i käsi?" to="Laardikäsi?" />
+    <Line from="Varo kaa!" to="Varokaa!" />
+    <Line from="Näyttävät kö tytöt väh än&#xD;&#xA;h uorahtavi m m i lta?" to="Näyttävätkö tytöt vähän&#xD;&#xA;huorahtavimmilta?" />
+    <Line from="Stif... Ier." to="Stif... ler." />
+    <Line from="J u mantsu kka! M itä?" to="Jumantsukka! Mitä?" />
+    <Line from="Varasin Ch u m bawam ban," to="Varasin Chumbawamban," />
+    <Line from="J u malavita!" to="Jumalavita!" />
+    <Line from="S" to="Isi..." />
+    <Line from="Haluan kertoa jotai n" to="Haluan kertoa jotain" />
+    <Line from="I-Ialuatte" to="Haluatte" />
+  </WholeLines>
+  <RegularExpressions />
+</OCRFixReplaceList>
\ No newline at end of file
diff --git a/libs/subzero/modification/dictionaries/xml/fra_OCRFixReplaceList.xml b/libs/subzero/modification/dictionaries/xml/fra_OCRFixReplaceList.xml
new file mode 100644
index 000000000..0bbe1f004
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/xml/fra_OCRFixReplaceList.xml
@@ -0,0 +1,270 @@
+<OCRFixReplaceList>
+  <WholeWords>
+    <Word from="@immatriculation" to="d'immatriculation" />
+    <Word from="acquer" to="acquér" />
+    <Word from="acteurjoue" to="acteur joue" />
+    <Word from="aerien" to="aérien" />
+    <Word from="agreable" to="agréable" />
+    <Word from="aientjamais" to="aient jamais" />
+    <Word from="AII" to="All" />
+    <Word from="aitjamais" to="ait jamais" />
+    <Word from="aitjus" to="ait jus" />
+    <Word from="alle" to="allé" />
+    <Word from="alles" to="allés" />
+    <Word from="appele" to="appelé" />
+    <Word from="apres" to="après" />
+    <Word from="aujourdhui" to="aujourd'hui" />
+    <Word from="aupres" to="auprès" />
+    <Word from="beaute" to="beauté" />
+    <Word from="cabossee" to="cabossée" />
+    <Word from="carj'" to="car j'" />
+    <Word from="Carj'" to="Car j'" />
+    <Word from="carla" to="car la" />
+    <Word from="CEdipe" to="Œdipe" />
+    <Word from="Cest" to="C'est" />
+    <Word from="c'etaient" to="c'étaient" />
+    <Word from="Cétaient" to="C'étaient" />
+    <Word from="c'etait" to="c'était" />
+    <Word from="C'etait" to="C'était" />
+    <Word from="Cétait" to="C'était" />
+    <Word from="choregraphiee" to="chorégraphiée" />
+    <Word from="cinema" to="cinéma" />
+    <Word from="cl'AIcatraz" to="d'Alcatraz" />
+    <Word from="cles" to="clés" />
+    <Word from="cœurjoie" to="cœur-joie" />
+    <Word from="completer" to="compléter" />
+    <Word from="costumiere" to="costumière" />
+    <Word from="cree" to="créé" />
+    <Word from="daccord" to="d'accord" />
+    <Word from="d'AIbert" to="d'Albert" />
+    <Word from="d'AIdous" to="d'Aldous" />
+    <Word from="d'AIec" to="d'Alec" />
+    <Word from="danniversaire" to="d'anniversaire" />
+    <Word from="d'Arra'bida" to="d'Arrabida" />
+    <Word from="d'autodérision" to="d'auto-dérision" />
+    <Word from="dautres" to="d'autres" />
+    <Word from="debattait" to="débattait" />
+    <Word from="decor" to="décor" />
+    <Word from="decorateurs" to="décorateurs" />
+    <Word from="decors" to="décors" />
+    <Word from="defi" to="défi" />
+    <Word from="dejà" to="déjà" />
+    <Word from="déjàm" to="déjà..." />
+    <Word from="dejeunait" to="déjeunait" />
+    <Word from="dengager" to="d'engager" />
+    <Word from="déquipement" to="d'équipement" />
+    <Word from="dérnièré" to="dernière" />
+    <Word from="Desole" to="Désolé" />
+    <Word from="dessayage" to="d'essayage" />
+    <Word from="dessence" to="d'essence" />
+    <Word from="détaient" to="c'étaient" />
+    <Word from="detail" to="détail" />
+    <Word from="dexcellents" to="d'excellents" />
+    <Word from="dexpérience" to="d'expérience" />
+    <Word from="dexpériences" to="d'expériences" />
+    <Word from="d'héro'l'ne" to="d'héroïne" />
+    <Word from="d'idees" to="d'idées" />
+    <Word from="d'intensite" to="d'intensité" />
+    <Word from="dontj" to="dont j" />
+    <Word from="doublaitAlfo" to="doublait Alfo" />
+    <Word from="DrNo" to="Dr No" />
+    <Word from="e'" to="é" />
+    <Word from="ecrit" to="écrit" />
+    <Word from="elegant" to="élégant" />
+    <Word from="Ellé" to="Elle" />
+    <Word from="én" to="en" />
+    <Word from="equipe" to="équipe" />
+    <Word from="erjus" to="er jus" />
+    <Word from="estjamais" to="est jamais" />
+    <Word from="ét" to="et" />
+    <Word from="etaient" to="étaient" />
+    <Word from="etait" to="était" />
+    <Word from="ete" to="été" />
+    <Word from="etiez" to="étiez" />
+    <Word from="etj'" to="et j'" />
+    <Word from="Etj'" to="Et j'" />
+    <Word from="etje" to="et je" />
+    <Word from="Etje" to="Et je" />
+    <Word from="EtsouvenL" to="Et souvent" />
+    <Word from="eviter" to="éviter" />
+    <Word from="Fabsence" to="l'absence" />
+    <Word from="fadapter" to="t'adapter" />
+    <Word from="fadore" to="j'adore" />
+    <Word from="Fâge" to="l'âge" />
+    <Word from="Fagent" to="l'agent" />
+    <Word from="faiessayé" to="j'ai essayé" />
+    <Word from="Failure" to="l'alllure" />
+    <Word from="Fambiance" to="l'ambiance" />
+    <Word from="Famener" to="l'amener" />
+    <Word from="Fanniversaire" to="l'anniversaire" />
+    <Word from="Fapparence" to="l'apparence" />
+    <Word from="Fapres" to="l'apres" />
+    <Word from="Faprès" to="l'après" />
+    <Word from="Farmée" to="l'armée" />
+    <Word from="Farrière" to="l'arrière" />
+    <Word from="Farrivée" to="l'arrivée" />
+    <Word from="Fascenseur" to="l'ascenseur" />
+    <Word from="Fascension" to="l'ascension" />
+    <Word from="Fassaut" to="l'assaut" />
+    <Word from="Fassomme" to="l'assomme" />
+    <Word from="Fatmosphère" to="l'atmosphère" />
+    <Word from="Fattention" to="l'attention" />
+    <Word from="Favalanche" to="l'avalanche" />
+    <Word from="Féclairage" to="l'éclairage" />
+    <Word from="Fécran" to="l'écran" />
+    <Word from="Fémotion" to="l'émotion" />
+    <Word from="Femplacement" to="l'emplacement" />
+    <Word from="Fendroit" to="l'endroit" />
+    <Word from="Fenseigne" to="l'enseigne" />
+    <Word from="Fensemble" to="l'ensemble" />
+    <Word from="Fentouraient" to="l'entouraient" />
+    <Word from="Fentrée" to="l'entrée" />
+    <Word from="Fépaisseur" to="l'épaisseur" />
+    <Word from="Fépoque" to="l'époque" />
+    <Word from="Féquipe" to="Équipe" />
+    <Word from="Fespace" to="l'espace" />
+    <Word from="fespérais" to="j'espérais" />
+    <Word from="Fespère" to="l'espère" />
+    <Word from="Festhétique" to="l'esthétique" />
+    <Word from="Fetranger" to="l'etranger" />
+    <Word from="Févasion" to="l'évasion" />
+    <Word from="Févoque" to="l'évoque" />
+    <Word from="Fexpérience" to="l'expérience" />
+    <Word from="Fexplique" to="l'explique" />
+    <Word from="Fexplosion" to="l'explosion" />
+    <Word from="Fextérieur" to="l'extérieur" />
+    <Word from="Fhabituelle" to="l'habituelle" />
+    <Word from="Fhélicoptère" to="l'hélicoptère" />
+    <Word from="Fhéliport" to="l'héliport" />
+    <Word from="Fhélistation" to="l'hélistation" />
+    <Word from="Fhonneur" to="l'honneur" />
+    <Word from="Fhorloge" to="l'horloge" />
+    <Word from="Fidée" to="l'idée" />
+    <Word from="Fimage" to="l'image" />
+    <Word from="Fimportance" to="l'importance" />
+    <Word from="Fimpression" to="l'impression" />
+    <Word from="Finfluence" to="l'influence" />
+    <Word from="Finscription" to="l'inscription" />
+    <Word from="Fintérieur" to="l'intérieur" />
+    <Word from="Fintrigue" to="l'intrigue" />
+    <Word from="Fobjectif" to="l'objectif" />
+    <Word from="Foccasion" to="l'occasion" />
+    <Word from="Fordre" to="l'ordre" />
+    <Word from="Forigine" to="l'origine" />
+    <Word from="frêre" to="frère" />
+    <Word from="gaylns" to="gaijins" />
+    <Word from="general" to="général" />
+    <Word from="hawaïennel" to="hawaïenne" />
+    <Word from="hawa'l'en" to="hawaïen" />
+    <Word from="Ia" to="la" />
+    <Word from="Ià" to="là" />
+    <Word from="Iaryngotomie" to="laryngotomie" />
+    <Word from="idee" to="idée" />
+    <Word from="idees" to="idées" />
+    <Word from="Ie" to="le" />
+    <Word from="Ies" to="les" />
+    <Word from="Iester" to="Lester" />
+    <Word from="II" to="Il" />
+    <Word from="Iimit" to="limit" />
+    <Word from="IIs" to="Ils" />
+    <Word from="immediatement" to="immédiatement" />
+    <Word from="insufflee" to="insufflée" />
+    <Word from="integrer" to="intégrer" />
+    <Word from="interessante" to="intéressante" />
+    <Word from="Iogions" to="logions" />
+    <Word from="Iorsqu" to="lorsqu" />
+    <Word from="isee" to="isée" />
+    <Word from="Iumiere" to="lumiere" />
+    <Word from="Iynchage" to="lynchage" />
+    <Word from="J'espere" to="J'espère" />
+    <Word from="Jessaie" to="J'essaie" />
+    <Word from="j'etais" to="j'étais" />
+    <Word from="J'etais" to="J'étais" />
+    <Word from="latéralémént" to="latéralement" />
+    <Word from="lci" to="Ici" />
+    <Word from="Lci" to="Ici" />
+    <Word from="lé-" to="là-" />
+    <Word from="lepidopteres" to="lépidoptères" />
+    <Word from="litteraire" to="littéraire" />
+    <Word from="ll" to="il" />
+    <Word from="Ll" to="Il" />
+    <Word from="lls" to="ils" />
+    <Word from="Lls" to="Ils" />
+    <Word from="maintenanu" to="maintenant" />
+    <Word from="maniere" to="manière" />
+    <Word from="mariee" to="mariée" />
+    <Word from="Mayer/ing" to="Mayerling" />
+    <Word from="meilleurjour" to="meilleur jour" />
+    <Word from="melange" to="mélange" />
+    <Word from="n'avaiént" to="n'avaient" />
+    <Word from="n'etait" to="n'était" />
+    <Word from="oitjamais" to="oit jamais" />
+    <Word from="oitjus" to="oit jus" />
+    <Word from="ontete" to="ont été" />
+    <Word from="operateur" to="opérateur" />
+    <Word from="ouvérté" to="ouverte" />
+    <Word from="Pépreuve" to="l'épreuve" />
+    <Word from="pere" to="père" />
+    <Word from="plateforme" to="plate-forme" />
+    <Word from="pourjouer" to="pour jouer" />
+    <Word from="precipice" to="précipice" />
+    <Word from="preferes" to="préférés" />
+    <Word from="premierjour" to="premier jour" />
+    <Word from="presenter" to="présenter" />
+    <Word from="prevu" to="prévu" />
+    <Word from="prevue" to="prévue" />
+    <Word from="propriete" to="propriété" />
+    <Word from="protègeraient" to="protégeraient" />
+    <Word from="qué" to="que" />
+    <Word from="qwangoissé" to="qu'angoissé" />
+    <Word from="realisateur" to="réalisateur" />
+    <Word from="reception" to="réception" />
+    <Word from="reévalu" to="réévalu" />
+    <Word from="repute" to="réputé" />
+    <Word from="reussi" to="réussi" />
+    <Word from="s'arrétait" to="s'arrêtait" />
+    <Word from="s'ave'rer" to="s'avérer" />
+    <Word from="scenario" to="scénario" />
+    <Word from="scene" to="scène" />
+    <Word from="scenes" to="scènes" />
+    <Word from="seances" to="séances" />
+    <Word from="sequence" to="séquence" />
+    <Word from="sflécrasa" to="s'écrasa" />
+    <Word from="speciale" to="spéciale" />
+    <Word from="Supen" to="Super" />
+    <Word from="torturee" to="torturée" />
+    <Word from="Uadmirable" to="L'admirable" />
+    <Word from="Uensemblier" to="L'ensemblier" />
+    <Word from="Uexplosion" to="L'explosion" />
+    <Word from="Uouvre" to="L'ouvre" />
+    <Word from="Vaise" to="l'aise" />
+    <Word from="vecu" to="vécu" />
+    <Word from="vehicules" to="véhicules" />
+    <Word from="Ÿappréciais" to="J'appréciais" />
+    <Word from="Ÿespère" to="J'espère" />
+    <Word from="ÿétrangle" to="s'étrangle" />
+  </WholeWords>
+  <PartialWordsAlways />
+  <PartialWords />
+  <PartialLines>
+    <LinePart from=" I'" to=" l'" />
+    <LinePart from=" |'" to=" l'" />
+  </PartialLines>
+  <PartialLinesAlways />
+  <BeginLines />
+  <EndLines />
+  <WholeLines>
+    <Line from="&quot;D'ac:c:ord.&quot;" to="&quot;D'accord.&quot;" />
+    <Line from="“i QUÎ gagne, qui perd," to="ni qui gagne, qui perd," />
+    <Line from="L'ac:c:ent est mis &#xD;&#xA; &#xD;&#xA; sur son trajet jusqu'en Suisse." to="L'accent est mis &#xD;&#xA; &#xD;&#xA; sur son trajet jusqu'en Suisse." />
+    <Line from="C'est la plus gentille chose &#xD;&#xA; &#xD;&#xA; qu'Hitchc:oc:k m'ait jamais dite." to="C'est la plus gentille chose &#xD;&#xA; &#xD;&#xA; qu'Hitchcock m'ait jamais dite." />
+    <Line from="Tout le monde, en revanche, qualifie &#xD;&#xA; &#xD;&#xA; Goldfinger d'aventu re structurée," to="Tout le monde, en revanche, qualifie &#xD;&#xA; &#xD;&#xA; Goldfinger d'aventure structurée," />
+    <Line from="et le film Shadow of a man &#xD;&#xA; &#xD;&#xA; a lancé sa carrière au cinéma." to="et le film &lt;i&gt;Shadow of a man&lt;/i&gt; &#xD;&#xA; &#xD;&#xA; a lancé sa carrière au cinéma." />
+    <Line from="En 1948, Young est passé à la réalisation &#xD;&#xA; &#xD;&#xA; avec One night with you." to="En 1948, Young est passé à la réalisation &#xD;&#xA; &#xD;&#xA; avec &lt;i&gt;One night with you&lt;/i&gt;." />
+    <Line from="Il a construit tous ces véhicules &#xD;&#xA; &#xD;&#xA; à C)c:ala, en Floride." to="Il a construit tous ces véhicules &#xD;&#xA; &#xD;&#xA; à Ocala, en Floride." />
+    <Line from="Tokyo Pop et A Taxing Woman? Return." to="Tokyo Pop et A Taxing Woman's Return." />
+    <Line from="Peter H u nt." to="Peter Hunt." />
+    <Line from="&quot;C'est bien mieux dans Peau. &#xD;&#xA; &#xD;&#xA; On peut sfléclabousser, faire du bruit.&quot;" to="&quot;C'est bien mieux dans l'eau. &#xD;&#xA; &#xD;&#xA; On peut s'éclabousser, faire du bruit.&quot;" />
+  </WholeLines>
+  <RegularExpressions />
+</OCRFixReplaceList>
\ No newline at end of file
diff --git a/libs/subzero/modification/dictionaries/xml/hrv_OCRFixReplaceList.xml b/libs/subzero/modification/dictionaries/xml/hrv_OCRFixReplaceList.xml
new file mode 100644
index 000000000..4097a7519
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/xml/hrv_OCRFixReplaceList.xml
@@ -0,0 +1,3046 @@
+<OCRFixReplaceList>
+  <WholeWords>
+    <Word from="advokati" to="odvjetnici" />
+    <Word from="Advokati" to="Odvjetnici" />
+    <Word from="advokatima" to="odvjetnicima" />
+    <Word from="Advokatima" to="Odvjetnicima" />
+    <Word from="afirmiše" to="afirmira" />
+    <Word from="akcenat" to="naglasak" />
+    <Word from="akcionara" to="dioničara" />
+    <Word from="akvarijum" to="akvarij" />
+    <Word from="akvarijumu" to="akvariju" />
+    <Word from="amin" to="amen" />
+    <Word from="Amin" to="Amen" />
+    <Word from="ans" to="nas" />
+    <Word from="apsorbovanje" to="apsorbiranje" />
+    <Word from="apsorbuje" to="apsorbira" />
+    <Word from="azot" to="dušik" />
+    <Word from="bašta" to="vrt" />
+    <Word from="Bašta" to="Vrt" />
+    <Word from="bašte" to="vrtovi" />
+    <Word from="Bašte" to="Vrtovi" />
+    <Word from="bašti" to="vrtu" />
+    <Word from="baštu" to="vrt" />
+    <Word from="Baštu" to="Vrt" />
+    <Word from="baštom" to="vrtom" />
+    <Word from="bedan" to="bijedan" />
+    <Word from="bede" to="bijede" />
+    <Word from="bedi" to="bijedi" />
+    <Word from="bejah" to="bijah" />
+    <Word from="bejahu" to="bijahu" />
+    <Word from="belešci" to="bilješci" />
+    <Word from="bešike" to="mjehure" />
+    <Word from="bebisiterka" to="dadilja" />
+    <Word from="beg" to="bijeg" />
+    <Word from="begu" to="bijegu" />
+    <Word from="begstva" to="bijega" />
+    <Word from="bejaše" to="bijaše" />
+    <Word from="bekstvo" to="bijeg" />
+    <Word from="bekstvu" to="bijegu" />
+    <Word from="begstvu" to="bijegu" />
+    <Word from="bes" to="bijes" />
+    <Word from="besa" to="bijesa" />
+    <Word from="besan" to="bijesan" />
+    <Word from="besom" to="bijesom" />
+    <Word from="besu" to="bijesu" />
+    <Word from="beše" to="bješe" />
+    <Word from="bimso" to="bismo" />
+    <Word from="blijeđi" to="bljeđi" />
+    <Word from="bioje" to="bio je" />
+    <Word from="bi smo" to="bismo" />
+    <Word from="bi ste" to="biste" />
+    <Word from="bioskop" to="kino" />
+    <Word from="bioskopi" to="kina" />
+    <Word from="bitci" to="bitki" />
+    <Word from="bled" to="blijed" />
+    <Word from="blede" to="blijede" />
+    <Word from="boksuješ" to="boksaš" />
+    <Word from="bolesan" to="bolestan" />
+    <Word from="bolila" to="boljela" />
+    <Word from="borićeš" to="borit ćeš" />
+    <Word from="Borićeš" to="Borit ćeš" />
+    <Word from="braon" to="smeđa" />
+    <Word from="bregu" to="brijegu" />
+    <Word from="bti" to="biti" />
+    <Word from="cedilu" to="cjedilu" />
+    <Word from="ceo" to="cijeli" />
+    <Word from="Ceo" to="Cijeli" />
+    <Word from="cepa" to="cijepa" />
+    <Word from="cev" to="cijev" />
+    <Word from="cevi" to="cijevi" />
+    <Word from="cjevi" to="cijevi" />
+    <Word from="cevima" to="cijevima" />
+    <Word from="Cevi" to="Cijevi" />
+    <Word from="Cjevi" to="Cijevi" />
+    <Word from="Cevima" to="Cijevima" />
+    <Word from="Cjevima" to="Cijevima" />
+    <Word from="cevčica" to="cjevčica" />
+    <Word from="cevčicu" to="cjevčicu" />
+    <Word from="cutanje" to="šutnja" />
+    <Word from="čutanje" to="šutnja" />
+    <Word from="ćutanje" to="šutnja" />
+    <Word from="Cutanje" to="Šutnja" />
+    <Word from="Čutanje" to="Šutnja" />
+    <Word from="Ćutanje" to="Šutnja" />
+    <Word from="cutanjem" to="šutnjom" />
+    <Word from="čutanjem" to="šutnjom" />
+    <Word from="ćutanjem" to="šutnjom" />
+    <Word from="Cutanjem" to="Šutnjom" />
+    <Word from="Čutanjem" to="Šutnjom" />
+    <Word from="Ćutanjem" to="Šutnjom" />
+    <Word from="cvetaju" to="cvjetaju" />
+    <Word from="cvetove" to="cvjetove" />
+    <Word from="cvetu" to="cvijetu" />
+    <Word from="cvjetu" to="cvijetu" />
+    <Word from="cvetalo" to="cvjetalo" />
+    <Word from="cvjetom" to="cvijetom" />
+    <Word from="Čakom" to="Chuckom" />
+    <Word from="čaršav" to="plahta" />
+    <Word from="čaršave" to="plahte" />
+    <Word from="čaršavi" to="plahte" />
+    <Word from="čaršavima" to="plahtama" />
+    <Word from="čas" to="sat" />
+    <Word from="četvoro" to="četvero" />
+    <Word from="Čitaću" to="Čitat ću" />
+    <Word from="čerku" to="kćer" />
+    <Word from="Čerku" to="Kćer" />
+    <Word from="ćerku" to="kćer" />
+    <Word from="Ćerku" to="Kćer" />
+    <Word from="ćerkama" to="kćerima" />
+    <Word from="čerkama" to="kćerima" />
+    <Word from="ćerkom" to="kćeri" />
+    <Word from="čerkom" to="kćeri" />
+    <Word from="kćerkom" to="kćeri" />
+    <Word from="kčerkom" to="kćeri" />
+    <Word from="Ču" to="Ću" />
+    <Word from="Češ" to="Ćeš" />
+    <Word from="Če" to="Će" />
+    <Word from="Čemo" to="Ćemo" />
+    <Word from="Čete" to="Ćete" />
+    <Word from="ču" to="ću" />
+    <Word from="češ" to="ćeš" />
+    <Word from="če" to="će" />
+    <Word from="čemo" to="ćemo" />
+    <Word from="čete" to="ćete" />
+    <Word from="ćebe" to="deku" />
+    <Word from="ćebetu" to="deki" />
+    <Word from="čk" to="čak" />
+    <Word from="ćš" to="ćeš" />
+    <Word from="ćale" to="tata" />
+    <Word from="ćaletom" to="ocem" />
+    <Word from="ćaleta" to="oca" />
+    <Word from="ćaletu" to="ocu" />
+    <Word from="ćorsokak" to="slijepa ulica" />
+    <Word from="ćorsokaku" to="slijepoj ulici" />
+    <Word from="ćošak" to="ugao" />
+    <Word from="ćošku" to="uglu" />
+    <Word from="ćerka" to="kći" />
+    <Word from="Ćerka" to="Kći" />
+    <Word from="ćmo" to="ćemo" />
+    <Word from="ćte" to="ćete" />
+    <Word from="čuće" to="čut će" />
+    <Word from="čućemo" to="čut ćemo" />
+    <Word from="Čućemo" to="Čut ćemo" />
+    <Word from="Čućete" to="Čut ćete" />
+    <Word from="Čuće" to="Čut će" />
+    <Word from="ćuo" to="čuo" />
+    <Word from="ćutao" to="šutio" />
+    <Word from="Ćutao" to="Šutio" />
+    <Word from="ćute" to="šute" />
+    <Word from="Ćute" to="Šute" />
+    <Word from="cvetova" to="cvjetova" />
+    <Word from="daga" to="da ga" />
+    <Word from="damas" to="danas" />
+    <Word from="date" to="dane" />
+    <Word from="deda" to="djed" />
+    <Word from="Deda" to="Djed" />
+    <Word from="dede" to="djeda" />
+    <Word from="dedi" to="djedu" />
+    <Word from="dedom" to="djedom" />
+    <Word from="definiše" to="definira" />
+    <Word from="dejstvo" to="djelovanje" />
+    <Word from="Dejstvo" to="Djelovanje" />
+    <Word from="dejstvom" to="djelovanjem" />
+    <Word from="Dejstvom" to="Djelovanjem" />
+    <Word from="deleći" to="dijeleći" />
+    <Word from="deo" to="dio" />
+    <Word from="Deo" to="Dio" />
+    <Word from="dešava" to="događa" />
+    <Word from="dete" to="dijete" />
+    <Word from="Dete" to="Dijete" />
+    <Word from="diluje" to="dila" />
+    <Word from="diluju" to="dilaju" />
+    <Word from="diskutuje" to="raspravlja" />
+    <Word from="Diskutuje" to="Raspravlja" />
+    <Word from="diskutujemo" to="raspravljamo" />
+    <Word from="Diskutujemo" to="Raspravljamo" />
+    <Word from="djete" to="dijete" />
+    <Word from="Djete" to="Dijete" />
+    <Word from="detektuje" to="detektira" />
+    <Word from="dodju" to="dođu" />
+    <Word from="dole" to="dolje" />
+    <Word from="Dole" to="Dolje" />
+    <Word from="donijeo" to="donio" />
+    <Word from="Donijeo" to="Donio" />
+    <Word from="Donijeću" to="Donijet ću" />
+    <Word from="dosledan" to="dosljedan" />
+    <!-- nije za regex [ni dospeo - ni dospeju - mora ostati ovako] -->
+    <Word from="dospeo" to="dospio" />
+    <Word from="dospeju" to="dospiju" />
+    <Word from="dođavola" to="dovraga" />
+    <Word from="Dođavola" to="Dovraga" />
+    <Word from="drug" to="prijatelj" />
+    <Word from="drugari" to="prijatelji" />
+    <Word from="drugare" to="prijatelje" />
+    <Word from="drugčiji" to="drugačiji" />
+    <Word from="drugde" to="drugdje" />
+    <Word from="duuga" to="dúga" />
+    <Word from="duvana" to="duhana" />
+    <Word from="dve" to="dvije" />
+    <Word from="Dve" to="Dvije" />
+    <Word from="dvema" to="dvjema" />
+    <Word from="đavo" to="vrag" />
+    <Word from="đavola" to="vraga" />
+    <Word from="đemper" to="džemper" />
+    <Word from="džanki" to="ovisnik" />
+    <Word from="dželat" to="krvnik" />
+    <Word from="đubre" to="smeće" />
+    <Word from="efekat" to="efekt" />
+    <Word from="eksperata" to="stručnjaka" />
+    <Word from="eksperti" to="stručnjaci" />
+    <Word from="Eksperti" to="Stručnjaci" />
+    <Word from="ekspertima" to="stručnjacima" />
+    <Word from="en" to="ne" />
+    <Word from="emitovao" to="emitirao" />
+    <Word from="emitovati" to="emitirati" />
+    <Word from="emituje" to="emitira" />
+    <Word from="emitujem" to="emitiram" />
+    <Word from="Emitujem" to="Emitiram" />
+    <Word from="emituju" to="emitiraju" />
+    <Word from="evra" to="eura" />
+    <Word from="familija" to="obitelj" />
+    <Word from="Familija" to="Obitelj" />
+    <Word from="familiju" to="obitelj" />
+    <Word from="Familiju" to="Obitelj" />
+    <Word from="familijama" to="obiteljima" />
+    <Word from="familiji" to="obitelji" />
+    <Word from="flertuje" to="očijuka" />
+    <Word from="foka" to="tuljan" />
+    <Word from="foku" to="tuljana" />
+    <Word from="foke" to="tuljani" />
+    <Word from="fokama" to="tuljanima" />
+    <Word from="fotografišu" to="fotografiraju" />
+    <Word from="gasova" to="plinova" />
+    <Word from="gde" to="gdje" />
+    <Word from="Gde" to="Gdje" />
+    <Word from="gluhonem" to="gluhonijem" />
+    <Word from="greše" to="griješe" />
+    <Word from="grješe" to="griješe" />
+    <Word from="greši" to="griješi" />
+    <Word from="grješi" to="griješi" />
+    <Word from="greški" to="grešci" />
+    <Word from="grijehova" to="grijeha" />
+    <Word from="grijehove" to="grijehe" />
+    <Word from="hipnotisao" to="hipnotizirao" />
+    <Word from="hipnotisana" to="hipnotizirana" />
+    <Word from="hipnotiše" to="hipnotizira" />
+    <Word from="Historija" to="Povijest" />
+    <Word from="Historiju" to="Povijest" />
+    <Word from="Historije" to="Povijesti" />
+    <Word from="Historiji" to="Povijesti" />
+    <Word from="Istorija" to="Povijest" />
+    <Word from="Istoriju" to="Povijest" />
+    <Word from="Istorije" to="Povijesti" />
+    <Word from="Istoriji" to="Povijesti" />
+    <Word from="historije" to="povijesti" />
+    <Word from="historiji" to="povijesti" />
+    <Word from="istorije" to="povijesti" />
+    <Word from="istoriji" to="povijesti" />
+    <Word from="istorijom" to="poviješću" />
+    <Word from="hakuje" to="hakira" />
+    <Word from="Hakuje" to="Hakira" />
+    <Word from="hakujemo" to="hakiramo" />
+    <Word from="Hakujemo" to="Hakiramo" />
+    <Word from="Hakuju" to="Hakiraju" />
+    <Word from="hakuju" to="hakiraju" />
+    <Word from="hoču" to="hoću" />
+    <Word from="Hoču" to="Hoću" />
+    <Word from="hteće" to="htjet će" />
+    <Word from="htedoh" to="htjedoh" />
+    <Word from="Htjeo" to="Htio" />
+    <Word from="Hteo" to="Htio" />
+    <Word from="htjeo" to="htio" />
+    <Word from="hteo" to="htio" />
+    <Word from="iči" to="ići" />
+    <Word from="Iči" to="Ići" />
+    <Word from="iko" to="itko" />
+    <Word from="ignoriši" to="ignoriraj" />
+    <Word from="Ignoriši" to="Ignoriraj" />
+    <Word from="ignorišite" to="ignorirajte" />
+    <Word from="Ignorišite" to="Ignorirajte" />
+    <Word from="ignorišu" to="ignoriraju" />
+    <Word from="ilustruju" to="ilustriraju" />
+    <Word from="inspirisao" to="inspirirao" />
+    <Word from="interesantan" to="zanimljiv" />
+    <Word from="Interesantan" to="Zanimljiv" />
+    <Word from="interesuje" to="zanima" />
+    <Word from="Interesuje" to="Zanima" />
+    <Word from="interesujemo" to="zanimamo" />
+    <Word from="Interesujemo" to="Zanimamo" />
+    <Word from="interesujete" to="zanimate" />
+    <Word from="Interesujete" to="Zanimate" />
+    <Word from="Interesuju" to="Zanimaju" />
+    <Word from="interesuju" to="zanimaju" />
+    <Word from="isekao" to="izrezao" />
+    <Word from="isterao" to="istjerao" />
+    <Word from="isteraš" to="istjeraš" />
+    <Word from="Isteraš" to="Istjeraš" />
+    <Word from="istrebi" to="istrijebi" />
+    <Word from="istrebiti" to="istrijebiti" />
+    <Word from="isuviše" to="previše" />
+    <Word from="ivica" to="rub" />
+    <Word from="ivice" to="ruba" />
+    <Word from="ivici" to="rubu" />
+    <Word from="ivicu" to="rub" />
+    <Word from="izduvaj" to="ispuši" />
+    <Word from="izduvamo" to="ispušemo" />
+    <Word from="izoluje" to="izolira" />
+    <Word from="izolujemo" to="izoliramo" />
+    <Word from="izoluješ" to="izoliraš" />
+    <Word from="Izolujete" to="Izolirate" />
+    <Word from="Izolujte" to="Izolirajte" />
+    <Word from="izolujte" to="izolirajte" />
+    <Word from="izgladneo" to="izgladnio" />
+    <Word from="izmeriti" to="izmjeriti" />
+    <Word from="izmerio" to="izmjerio" />
+    <Word from="izmešane" to="izmiješane" />
+    <Word from="izneo" to="iznio" />
+    <Word from="izneti" to="iznijeti" />
+    <Word from="izvestan" to="izvjestan" />
+    <Word from="izvinem" to="ispričam" />
+    <Word from="izvineš" to="ispričaš" />
+    <Word from="Izvinem" to="Ispričam" />
+    <Word from="Izvineš" to="Ispričaš" />
+    <Word from="izvinim" to="ispričam" />
+    <Word from="izviniš" to="ispričaš" />
+    <Word from="izviniti" to="ispričati" />
+    <Word from="izvinjenje" to="isprika" />
+    <Word from="izvinjenja" to="isprike" />
+    <Word from="izvinjenju" to="isprici" />
+    <Word from="jedamput" to="jedanput" />
+    <Word from="jelda" to="jel' da" />
+    <Word from="Ješćemo" to="Jest ćemo" />
+    <Word from="Ješćeš" to="Jest ćeš" />
+    <Word from="ješće" to="jest će" />
+    <Word from="ješću" to="jest ću" />
+    <Word from="Ješću" to="Jest ću" />
+    <Word from="ješćeš" to="jest ćeš" />
+    <Word from="ješćemo" to="jest ćemo" />
+    <Word from="juče" to="jučer" />
+    <Word from="Juče" to="Jučer" />
+    <Word from="kakava" to="kakva" />
+    <Word from="kampovao" to="kampirao" />
+    <Word from="kampuje" to="kampira" />
+    <Word from="kampujemo" to="kampiramo" />
+    <Word from="kampuju" to="kampiraju" />
+    <Word from="kancelarija" to="ured" />
+    <Word from="kancelarijama" to="uredima" />
+    <Word from="kancelariju" to="ured" />
+    <Word from="Kancelarija" to="Ured" />
+    <Word from="Kancelariju" to="Ured" />
+    <Word from="kancelariji" to="uredu" />
+    <Word from="kancelarije" to="ureda" />
+    <Word from="kancelarijom" to="uredom" />
+    <Word from="kancera" to="raka" />
+    <Word from="kandidovati" to="kandidirati" />
+    <Word from="kandidujem" to="kandidiram" />
+    <Word from="kapar" to="kopar" />
+    <Word from="kapra" to="kopra" />
+    <Word from="karmin" to="ruž" />
+    <Word from="karminom" to="ružem" />
+    <Word from="kćerci" to="kćeri" />
+    <Word from="kćerka" to="kći" />
+    <Word from="kčerka" to="kći" />
+    <Word from="Kćerka" to="Kći" />
+    <Word from="Kčerka" to="Kći" />
+    <Word from="kćerkama" to="kćerima" />
+    <Word from="ker" to="pas" />
+    <Word from="Ker" to="Pas" />
+    <Word from="kerova" to="pasa" />
+    <Word from="kidnapovan" to="otet" />
+    <Word from="Kidnapovan" to="Otet" />
+    <Word from="kiji" to="koji" />
+    <Word from="kijim" to="kojim" />
+    <Word from="klasifikuju" to="klasificiraju" />
+    <Word from="klešta" to="kliješta" />
+    <Word from="klješta" to="kliješta" />
+    <Word from="Ko" to="Tko" />
+    <Word from="koa" to="kao" />
+    <Word from="koaj" to="koja" />
+    <Word from="kola" to="auto" />
+    <Word from="kolima" to="autu" />
+    <Word from="komandni" to="zapovjedni" />
+    <Word from="kombinuju" to="kombiniraju" />
+    <Word from="kompanija" to="tvrtka" />
+    <Word from="komponovao" to="skladao" />
+    <Word from="komšija" to="susjed" />
+    <Word from="komšiji" to="susjedu" />
+    <Word from="komšiju" to="susjeda" />
+    <Word from="komšiluk" to="susjedstvo" />
+    <Word from="komšiluka" to="susjedstva" />
+    <Word from="komšiluku" to="susjedstvu" />
+    <Word from="komšije" to="susjedi" />
+    <Word from="komšijama" to="susjedima" />
+    <Word from="komšinica" to="susjeda" />
+    <Word from="komšinicu" to="susjedu" />
+    <Word from="konektovan" to="spojen" />
+    <Word from="konektovati" to="spojiti" />
+    <Word from="kontrolišu" to="kontroliraju" />
+    <Word from="Kontrolišu" to="Kontroliraju" />
+    <Word from="Kontroliši" to="Kontroliraj" />
+    <Word from="kontroliši" to="kontroliraj" />
+    <Word from="Kontrolišite" to="Kontrolirajte" />
+    <Word from="kontrolišite" to="kontrolirajte" />
+    <Word from="korpu" to="košaru" />
+    <Word from="kritikuju" to="kritiziraju" />
+    <Word from="krsta" to="križa" />
+    <Word from="krstaši" to="križari" />
+    <Word from="krstu" to="križu" />
+    <Word from="krstića" to="križića" />
+    <Word from="krstiću" to="križiću" />
+    <Word from="Krsta" to="Križa" />
+    <Word from="Krstu" to="Križu" />
+    <Word from="Krstića" to="Križića" />
+    <Word from="Krstiću" to="Križiću" />
+    <Word from="krstom" to="križem" />
+    <Word from="krstove" to="križeve" />
+    <Word from="Krstove" to="Križeve" />
+    <Word from="krstovima" to="križevima" />
+    <Word from="Krstovima" to="Križevima" />
+    <Word from="križom" to="križem" />
+    <Word from="kupatilo" to="kupaona" />
+    <Word from="kupatilu" to="kupaoni" />
+    <Word from="kvalifikuju" to="kvalificiraju" />
+    <Word from="lažeju" to="lažu" />
+    <Word from="Lažov" to="Lažljivac" />
+    <Word from="lažov" to="lažljivac" />
+    <Word from="lažovi" to="lažljivci" />
+    <Word from="lažovu" to="lažljivcu" />
+    <Word from="lažovima" to="lažljivcima" />
+    <Word from="lažovom" to="lažljivcem" />
+    <Word from="lebdeo" to="lebdio" />
+    <Word from="leči" to="liječi" />
+    <Word from="leče" to="liječe" />
+    <Word from="lječi" to="liječi" />
+    <Word from="Leči" to="Liječi" />
+    <Word from="Lječi" to="Liječi" />
+    <Word from="Lejn" to="Lane" />
+    <Word from="Lenja" to="Lijena" />
+    <Word from="lenji" to="lijeni" />
+    <Word from="lenja" to="lijena" />
+    <Word from="lešnik" to="lješnjak" />
+    <Word from="Leta" to="Ljeta" />
+    <Word from="leto" to="ljeto" />
+    <Word from="Leto" to="Ljeto" />
+    <Word from="letos" to="ljetos" />
+    <Word from="letiti" to="letjeti" />
+    <Word from="leve" to="lijeve" />
+    <Word from="loži" to="pali" />
+    <Word from="lza" to="Iza" />
+    <Word from="ljepiti" to="lijepiti" />
+    <Word from="ljepili" to="lijepili" />
+    <Word from="magnezijuma" to="magnezija" />
+    <Word from="magnezijumu" to="magneziju" />
+    <Word from="maja" to="svibnja"/>
+    <Word from="maju" to="svibnju"/>
+    <Word from="majem" to="svibnjem"/>
+    <Word from="majca" to="majica" />
+    <Word from="majce" to="majice" />
+    <Word from="majcu" to="majicu" />
+    <Word from="majcom" to="majicom" />
+    <Word from="Malopre" to="Malo prije" />
+    <Word from="malopre" to="malo prije" />
+    <Word from="maloprije" to="malo prije" />
+    <Word from="manifestuje" to="manifestira" />
+    <Word from="manifestuju" to="manifestiraju" />
+    <Word from="marta" to="ožujka" />
+    <Word from="martu" to="ožujku"/>
+    <Word from="martom" to="ožujkom" />
+    <Word from="mehur" to="mjehur" />
+    <Word from="menom" to="mnom" />
+    <Word from="merač" to="mjerač" />
+    <Word from="meri" to="mjeri" />
+    <Word from="mere" to="mjere" />
+    <Word from="merdevine" to="ljestve" />
+    <Word from="merdevinama" to="ljestvama" />
+    <Word from="merljivo" to="mjerljivo" />
+    <Word from="mešane" to="miješane" />
+    <Word from="mešavina" to="mješavina" />
+    <Word from="mešavine" to="mješavine" />
+    <Word from="mešavinu" to="mješavinu" />
+    <Word from="minut" to="minutu" />
+    <Word from="mleo" to="mljeo" />
+    <Word from="moč" to="moć" />
+    <Word from="mofu" to="mogu" />
+    <Word from="momenat" to="trenutak" />
+    <Word from="momenta" to="trena" />
+    <Word from="muzejem" to="muzejom" />
+    <Word from="muzici" to="glazbi" />
+    <Word from="muzika" to="glazba" />
+    <Word from="muzike" to="glazbe" />
+    <Word from="muzikom" to="glazbom" />
+    <Word from="Muzika" to="Glazba" />
+    <Word from="Muzike" to="Glazbe" />
+    <Word from="Muzikom" to="Glazbom" />
+    <Word from="nači" to="naći" />
+    <Word from="nadevati" to="nadijevati" />
+    <Word from="naduvan" to="napušen" />
+    <Word from="najpre" to="najprije" />
+    <Word from="Najpre" to="Najprije" />
+    <Word from="najzad" to="napokon" />
+    <Word from="nanevši" to="nanjevši" />
+    <Word from="nanjeli" to="nanijeli" />
+    <Word from="napastvuje" to="napastuje" />
+    <Word from="Napolje" to="Van" />
+    <Word from="napolje" to="van" />
+    <Word from="Napolju" to="Vani" />
+    <Word from="napolju" to="vani" />
+    <Word from="nauka" to="znanost" />
+    <Word from="Nauka" to="Znanost" />
+    <Word from="nauci" to="znanosti" />
+    <Word from="nazad" to="natrag" />
+    <Word from="Nazad" to="Natrag" />
+    <Word from="napred" to="naprijed" />
+    <Word from="Napred" to="Naprijed" />
+    <Word from="naprimjer" to="na primjer" />
+    <Word from="naseo" to="nasjeo" />
+    <Word from="nasesti" to="nasjesti" />
+    <Word from="nasreću" to="na sreću" />
+    <Word from="nebi" to="ne bi" />
+    <Word from="nebih" to="ne bih" />
+    <Word from="Nebi" to="Ne bi" />
+    <Word from="Nebih" to="Ne bih" />
+    <Word from="nebismo" to="ne bismo" />
+    <Word from="Nebismo" to="Ne bismo" />
+    <Word from="nebiste" to="ne biste" />
+    <Word from="Nebiste" to="Ne biste" />
+    <Word from="nedaj" to="ne daj" />
+    <Word from="negde" to="negdje" />
+    <Word from="Negde" to="Negdje" />
+    <Word from="neguje" to="njeguje" />
+    <Word from="neguju" to="njeguju" />
+    <Word from="nekto" to="netko" />
+    <Word from="nemi" to="nijemi" />
+    <Word from="nemrem" to="ne mogu" />
+    <Word from="nemogu" to="ne mogu" />
+    <Word from="Nemogu" to="Ne mogu" />
+    <Word from="nemora" to="ne mora" />
+    <Word from="Nemora" to="Ne mora" />
+    <Word from="nene" to="njene" />
+    <Word from="nešo" to="nešto" />
+    <Word from="nevesta" to="nevjesta" />
+    <Word from="nevreme" to="nevrijeme" />
+    <Word from="nezi" to="njezi" />
+    <Word from="niasm" to="nisam" />
+    <Word from="nigde" to="nigdje" />
+    <Word from="Nigde" to="Nigdje" />
+    <Word from="nikakave" to="nikakve" />
+    <Word from="niko" to="nitko" />
+    <Word from="Niko" to="Nitko" />
+    <Word from="nisma" to="nisam" />
+    <Word from="Nisma" to="Nisam" />
+    <Word from="nećš" to="nećeš" />
+    <Word from="nejde" to="ne ide" />
+    <Word from="Nejde" to="Ne ide" />
+    <Word from="neda" to="ne da" />
+    <Word from="nedam" to="ne dam" />
+    <Word from="negujem" to="njegujem" />
+    <Word from="njegi" to="njezi" />
+    <Word from="neželi" to="ne želi" />
+    <Word from="niej" to="nije" />
+    <Word from="nili" to="niti" />
+    <Word from="njie" to="nije" />
+    <Word from="njem" to="nijem" />
+    <Word from="njeme" to="njene" />
+    <Word from="nominovan" to="nominiran" />
+    <Word from="nsiam" to="nisam" />
+    <Word from="nteko" to="netko" />
+    <Word from="obe" to="obje" />
+    <Word from="Obe" to="Obje" />
+    <Word from="obema" to="objema" />
+    <Word from="Obezbeđuju" to="Osiguravaju" />
+    <Word from="obezbeđuju" to="osiguravaju" />
+    <Word from="objekat" to="objekt" />
+    <Word from="oblast" to="područje" />
+    <Word from="oblastima" to="područjima" />
+    <Word from="oblasti" to="područj*" />
+    <Word from="obolelu" to="oboljelu" />
+    <Word from="obožavalac" to="obožavatelj" />
+    <Word from="obuči" to="obući" />
+    <Word from="obuhvata" to="obuhvaća" />
+    <Word from="odandje" to="odande" />
+    <Word from="odavdje" to="odavde" />
+    <Word from="Odavdje" to="Odavde" />
+    <Word from="odbićeš" to="odbit ćeš" />
+    <Word from="odbićemo" to="odbit ćemo" />
+    <Word from="odela" to="odjela" />
+    <Word from="odelu" to="odjelu" />
+    <Word from="odelenja" to="odjela" />
+    <Word from="odelenje" to="odjel" />
+    <Word from="odelenju" to="odjelu" />
+    <Word from="odeljak" to="odjeljak" />
+    <Word from="odeljenje" to="odjel" />
+    <Word from="Odeljenje" to="Odjel" />
+    <Word from="odjeljenje" to="odjel" />
+    <Word from="Odjeljenje" to="Odjel" />
+    <Word from="odeljenjem" to="odjelom" />
+    <Word from="odma" to="odmah" />
+    <Word from="Odneću" to="Odnijet ću" />
+    <Word from="odneću" to="odnijet ću" />
+    <Word from="odneće" to="odnijet će" />
+    <Word from="odoliti" to="odoljeti" />
+    <Word from="odneti" to="odnijeti" />
+    <Word from="odseo" to="odsjeo" />
+    <Word from="odsela" to="odsjela" />
+    <Word from="odsesti" to="odsjesti" />
+    <!-- odseli ne može - jer je riječ u hrv [da se odseli] -->
+    <Word from="odupreti" to="oduprijeti" />
+    <Word from="oduvek" to="oduvijek" />
+    <Word from="Oduvek" to="Oduvijek" />
+    <Word from="oduvjek" to="oduvijek" />
+    <Word from="Oduvjek" to="Oduvijek" />
+    <Word from="ogladneo" to="ogladnio" />
+    <Word from="okoreli" to="okorjeli" />
+    <Word from="organizuju" to="organiziraju" />
+    <Word from="Organizuju" to="Organiziraju" />
+    <Word from="osjećanja" to="osjećaje" />
+    <Word from="osmehe" to="osmijehe" />
+    <Word from="osmehne" to="osmjehne" />
+    <Word from="osmehnu" to="osmjehnu" />
+    <Word from="osobenosti" to="osobnosti" />
+    <Word from="ostareli" to="ostarjeli" />
+    <Word from="ostrva" to="otoka" />
+    <Word from="ostrvu" to="otoku" />
+    <Word from="ostrvom" to="otokom" />
+    <Word from="Ostrva" to="Otoka" />
+    <Word from="Ostrvu" to="Otoku" />
+    <Word from="Ostrvom" to="Otokom" />
+    <Word from="ostrvima" to="otocima" />
+    <Word from="osete" to="osjete" />
+    <Word from="ostrvo" to="otok" />
+    <Word from="Ostrvo" to="Otok" />
+    <Word from="osvjetljen" to="osvijetljen" />
+    <Word from="ovde" to="ovdje" />
+    <Word from="Ovde" to="Ovdje" />
+    <Word from="ovdej" to="ovdje" />
+    <Word from="ovdije" to="ovdje" />
+    <Word from="Ovdije" to="Ovdje" />
+    <Word from="ovjde" to="ovdje" />
+    <Word from="Ovjde" to="Ovdje" />
+    <Word from="pakuje" to="pakira" />
+    <Word from="Pakuje" to="Pakira" />
+    <Word from="Pakuju" to="Pakiraju" />
+    <Word from="pakuju" to="pakiraju" />
+    <Word from="palatama" to="palačama" />
+    <Word from="palate" to="palače" />
+    <Word from="palatu" to="palaču" />
+    <Word from="palati" to="palači" />
+    <Word from="pantalone" to="hlače" />
+    <Word from="Pantalone" to="Hlače" />
+    <Word from="pantalona" to="hlača" />
+    <Word from="pantalonama" to="hlačama" />
+    <Word from="parče" to="komadić" />
+    <Word from="parčeta" to="komadića" />
+    <Word from="parčetu" to="komadiću" />
+    <Word from="parčetom" to="komadićem" />
+    <Word from="paramparčad" to="komadići" />
+    <Word from="pastuv" to="pastuh" />
+    <Word from="pastuva" to="pastuha" />
+    <Word from="pastuvu" to="pastuhu" />
+    <Word from="pd" to="od" />
+    <Word from="pemzija" to="penzija" />
+    <Word from="pemziju" to="penziju" />
+    <Word from="penzionerski" to="umirovljenički" />
+    <Word from="Penzionerski" to="Umirovljenički" />
+    <Word from="pertle" to="žnirance" />
+    <Word from="pesama" to="pjesama" />
+    <Word from="pesnicima" to="pjesnicima" />
+    <Word from="pešice" to="pješice" />
+    <Word from="Pešice" to="Pješice" />
+    <Word from="peške" to="pješke" />
+    <Word from="plata" to="plaća" />
+    <Word from="plača" to="plaća" />
+    <Word from="platom" to="plaćom" />
+    <Word from="platu" to="plaću" />
+    <Word from="plačanje" to="plaćanje" />
+    <Word from="plačanjem" to="plaćanjem" />
+    <Word from="plaćeš" to="plačeš" />
+    <Word from="plen" to="plijen" />
+    <Word from="Plen" to="Plijen" />
+    <Word from="pljen" to="plijen" />
+    <Word from="Pljen" to="Plijen" />
+    <Word from="počeću" to="počet ću" />
+    <Word from="podjelimo" to="podijelimo" />
+    <Word from="podnesti" to="podnijeti" />
+    <Word from="podstrekač" to="poticatelj" />
+    <Word from="podsete" to="podsjete" />
+    <Word from="poen" to="bod" />
+    <Word from="poena" to="boda" />
+    <Word from="poene" to="bodove" />
+    <Word from="poeni" to="bodovi" />
+    <Word from="Poeni" to="Bodovi" />
+    <Word from="poenima" to="bodovima" />
+    <Word from="poludili" to="poludjeli" />
+    <Word from="pomaći" to="pomaknuti" />
+    <Word from="pomaknim" to="pomaknem" />
+    <Word from="pomaknio" to="pomaknuo" />
+    <Word from="pomakniš" to="pomakneš" />
+    <Word from="pomakniti" to="pomaknuti" />
+    <Word from="pomenu" to="spomenu" />
+    <Word from="Pomera" to="Miče" />
+    <Word from="pomera" to="miče" />
+    <Word from="pomjera" to="pomiče" />
+    <Word from="pomerajte" to="mičite" />
+    <Word from="pomjeri" to="pomakni" />
+    <Word from="pomeraj" to="miči" />
+    <Word from="pomjeraj" to="miči" />
+    <Word from="pomeraju" to="miču" />
+    <Word from="pomerala" to="micala" />
+    <Word from="pomjerala" to="pomicala" />
+  	<Word from="pomjeraju" to="pomiču" />
+    <Word from="pomeranja" to="pomicanja" />
+    <Word from="pomerati" to="micati" />
+    <Word from="pomjerati" to="pomicati" />
+    <Word from="pomeriš" to="pomakneš" />
+    <Word from="ponaosob" to="osobno" />
+    <Word from="ponesla" to="ponijela" />
+    <Word from="Ponesla" to="Ponijela" />
+    <Word from="poređenje" to="usporedba" />
+    <Word from="poređenju" to="usporedbi" />
+    <Word from="porekla" to="podrijetla" />
+    <Word from="poreklo" to="podrijetlo" />
+    <Word from="poreklu" to="podrijetlu" />
+    <Word from="Porodica" to="Obitelj" />
+    <Word from="Porodice" to="Obitelji" />
+    <Word from="porodica" to="obitelj" />
+    <Word from="porodice" to="obitelji" />
+    <Word from="porodici" to="obitelji" />
+    <Word from="porodicama" to="obiteljima" />
+    <Word from="porodicom" to="obitelji" />
+    <Word from="porodicu" to="obitelj" />
+    <Word from="poslata" to="poslana" />
+    <Word from="posle" to="poslije" />
+    <Word from="Posle" to="Poslije" />
+    <Word from="poslje" to="poslije" />
+    <Word from="posredi" to="posrijedi" />
+    <Word from="postara" to="pobrine" />
+    <Word from="Postaraću" to="Pobrinut ću" />
+    <Word from="postaraću" to="pobrinut ću" />
+    <Word from="postaraj" to="pobrini" />
+    <Word from="Postaraj" to="Pobrini" />
+    <Word from="Postaraju" to="Pobrinu" />
+    <Word from="postaraju" to="pobrinu" />
+    <Word from="postarajmo" to="pobrinimo" />
+    <Word from="postaramo" to="pobrinemo" />
+    <Word from="postaraš" to="pobrineš" />
+    <Word from="povesne" to="povijesne" />
+    <Word from="Povinuju" to="Pokoravaju" />
+    <Word from="povinuju" to="pokoravaju" />
+    <Word from="pozadi" to="iza" />
+    <Word from="poželeo" to="poželio" />
+    <Word from="Poželeo" to="Poželio" />
+    <Word from="Poželjeo" to="Poželio" />
+    <Word from="poželjeo" to="poželio" />
+    <Word from="praktikuj" to="prakticiraj" />
+    <Word from="praktikuju" to="prakticiraju" />
+    <Word from="praktikovala" to="prakticirala" />
+    <Word from="praktikovati" to="prakticirati" />
+    <Word from="pre" to="prije" />
+    <Word from="Pre" to="Prije" />
+    <Word from="predela" to="predjela" />
+    <Word from="predelu" to="predjelu" />
+    <Word from="Preći" to="Prijeći" />
+    <Word from="preći" to="prijeći" />
+    <Word from="prećutkuje" to="prešućuje" />
+    <Word from="predame" to="preda me" />
+    <Word from="predamnom" to="preda mnom" />
+    <Word from="Predamnom" to="Preda mnom" />
+    <Word from="preformuliši" to="preformuliraj" />
+    <Word from="preklo" to="porijeklo" />
+    <Word from="preloma" to="prijeloma" />
+    <Word from="Preneću" to="Prenijet ću" />
+    <Word from="preneću" to="prenijet ću" />
+    <Word from="prenos" to="prijenos" />
+    <Word from="prenosa" to="prijenosa" />
+    <Word from="prenosom" to="prijenosom" />
+    <Word from="prenosu" to="prijenosu" />
+    <Word from="preneo" to="prenio" />
+    <Word from="Preneo" to="Prenio" />
+    <Word from="prenela" to="prenijela" />
+    <Word from="prenjela" to="prenijela" />
+    <Word from="preneli" to="prenijeli" />
+    <Word from="prenjeli" to="prenijeli" />
+    <Word from="preneti" to="prenijeti" />
+    <Word from="preporuča" to="preporučuje" />
+    <Word from="preseći" to="presjeći" />
+    <Word from="preti" to="prijeti" />
+    <Word from="prete" to="prijete" />
+    <Word from="Prete" to="Prijete" />
+    <Word from="prjeti" to="prijeti" />
+    <Word from="prjete" to="prijete" />
+    <Word from="pretećim" to="prijetećim" />
+    <Word from="pretećih" to="prijetećih" />
+    <Word from="pretrpeo" to="pretrpio" />
+    <Word from="prevod" to="prijevod" />
+    <Word from="Prevod" to="Prijevod" />
+    <Word from="prezentovati" to="prezentirati" />
+    <Word from="prezentovane" to="prezentirane" />
+    <Word from="prezentovan" to="prezentiran" />
+    <Word from="prezentovani" to="prezentirani" />
+    <Word from="prezentovano" to="prezentirano" />
+    <Word from="pridonjeti" to="pridonijeti" />
+    <Word from="prijatan" to="ugodan" />
+    <Word from="primećivao" to="primjećivao" />
+    <Word from="primedbi" to="primjedbi" />
+    <Word from="primjete" to="primijete" />
+    <Word from="prisetim" to="prisjetim" />
+    <Word from="prisetio" to="prisjetio" />
+    <Word from="prisetite" to="prisjetite" />
+    <Word from="pritiskam" to="pritišćem" />
+    <Word from="prmda" to="iako" />
+    <Word from="procenat" to="postotak" />
+    <Word from="procent" to="postotak" />
+    <Word from="procenta" to="postotka" />
+    <Word from="procenata" to="postotaka" />
+    <Word from="procenti" to="postoci" />
+    <Word from="Procenti" to="Postoci" />
+    <Word from="procente" to="postotke" />
+    <Word from="Procente" to="Postotke" />
+    <Word from="procentu" to="postotku" />
+    <Word from="Procentu" to="Postotku" />
+    <Word from="procentima" to="postocima" />
+    <Word from="prodato" to="prodano" />
+    <Word from="prohte" to="prohtije" />
+    <Word from="projekat" to="projekt" />
+    <Word from="Projekat" to="Projekt" />
+    <Word from="promijena" to="promjena" />
+    <Word from="prosledili" to="proslijedili" />
+    <Word from="protestvovat" to="protestirat" />
+    <Word from="Protestvovat" to="Protestirat" />
+    <Word from="Protestvujem" to="Protestiram" />
+    <Word from="protestvujem" to="protestiram" />
+    <Word from="protestvuju" to="protestiraju" />
+    <Word from="protestujući" to="protestirajući" />
+    <Word from="psihićki" to="psihički" />
+    <Word from="pto" to="što" />
+    <Word from="ptom" to="potom" />
+    <Word from="punoletan" to="punoljetan" />
+    <Word from="Punoletan" to="Punoljetan" />
+    <Word from="računari" to="računala" />
+    <Word from="računare" to="računala" />
+    <Word from="radijo" to="radio" />
+    <Word from="rađe" to="radije" />
+    <Word from="ranac" to="ruksak" />
+    <Word from="rancu" to="ruksaku" />
+    <Word from="rascep" to="rascjep" />
+    <Word from="rasejan" to="rastresen" />
+    <Word from="rasejana" to="rastresena" />
+    <Word from="raspust" to="odmor" />
+    <Word from="razbiću" to="razbit ću" />
+    <Word from="razbijesneo" to="razbjesnio" />
+    <Word from="rašće" to="rast će" />
+    <Word from="Razbiću" to="Razbit ću" />
+    <Word from="razdeviče" to="razdjeviče" />
+    <Word from="razgovrati" to="razgovarati" />
+    <Word from="razreši" to="razriješi" />
+    <Word from="razume" to="razumije" />
+    <Word from="razumeju" to="razumiju" />
+    <Word from="rečju" to="riječju" />
+    <Word from="Rečju" to="Riječju" />
+    <Word from="rječju" to="riječju" />
+    <Word from="Rječju" to="Riječju" />
+    <Word from="reagujte" to="reagirajte" />
+    <Word from="redov" to="vojnik" />
+    <Word from="redovu" to="vojniku" />
+    <Word from="ređe" to="rjeđe" />
+    <Word from="ređi" to="rjeđi" />
+    <Word from="rejv" to="rave" />
+    <Word from="rejvu" to="raveu" />
+    <Word from="reko" to="rekao" />
+    <Word from="rengen" to="rendgen" />
+    <Word from="repuješ" to="repaš" />
+    <Word from="resetuje" to="resetira" />
+    <Word from="resetujte" to="resetirajte" />
+    <Word from="Resetujte" to="Resetirajte" />
+    <Word from="rijeđi" to="rjeđi" />
+    <Word from="Rizikuj" to="Riskiraj" />
+    <Word from="rizikuju" to="riskiraju" />
+    <Word from="rizikuje" to="riskira" />
+    <Word from="rizikujte" to="riskirajte" />
+    <Word from="rješio" to="riješio" />
+    <Word from="rokenrol" to="rock'n'roll" />
+    <Word from="ronioc" to="ronilac" />
+    <Word from="saviješću" to="savješću" />
+    <Word from="savešću" to="savješću" />
+    <Word from="secka" to="sjecka" />
+    <Word from="seckam" to="sjeckam" />
+    <Word from="sedećeš" to="sjedit ćeš" />
+    <Word from="sedeli" to="sjedili" />
+    <Word from="sedišta" to="sjedala" />
+    <Word from="sedište" to="sjedalo" />
+    <Word from="sedištu" to="sjedalu" />
+    <Word from="sedni" to="sjedni" />
+    <Word from="Sedni" to="Sjedni" />
+    <Word from="sedi" to="sjedi" />
+    <Word from="Sedi" to="Sjedi" />
+    <Word from="sedite" to="sjedite" />
+    <Word from="sesti" to="sjesti" />
+    <Word from="sekire" to="sjekire" />
+    <Word from="sekiraj" to="brini" />
+    <Word from="sekiram" to="brinem" />
+    <Word from="sekiramo" to="brinemo" />
+    <Word from="sekiraš" to="brineš" />
+    <Word from="sekirate" to="brinete" />
+    <Word from="sekirajte" to="brinite" />
+    <Word from="seme" to="sjeme" />
+    <Word from="sertan" to="sretan" />
+    <Word from="Sešću" to="Sjest ću" />
+    <Word from="sešću" to="sjest ću" />
+    <Word from="sješćemo" to="sjest ćemo" />
+    <Word from="seta" to="sjeta" />
+    <Word from="sigruno" to="sigurno" />
+    <Word from="siguan" to="siguran" />
+    <Word from="sija" to="sja" />
+    <Word from="sijaju" to="sjaju" />
+    <Word from="sirće" to="ocat" />
+    <Word from="sirćeta" to="octa" />
+    <Word from="sirćetu" to="octu" />
+    <Word from="sješću" to="sjest ću" />
+    <Word from="sješće" to="sjest će" />
+    <Word from="sleće" to="slijeće" />
+    <Word from="sleću" to="slijeću" />
+    <Word from="slećemo" to="slijećemo" />
+    <Word from="sleva" to="slijeva" />
+    <Word from="sećanjima" to="sjećanjima" />
+    <Word from="seo" to="sjeo" />
+    <Word from="Seo" to="Sjeo" />
+    <Word from="sem" to="osim" />
+    <Word from="sma" to="sam" />
+    <Word from="smao" to="samo" />
+    <Word from="Smao" to="Samo" />
+    <Word from="sme" to="smije" />
+    <Word from="Sme" to="Smije" />
+    <Word from="smećpm" to="smećem" />
+    <Word from="smej" to="smij" />
+    <Word from="Smejte" to="Smijte" />
+    <Word from="smejte" to="smijte" />
+    <Word from="smesta" to="smjesta" />
+    <Word from="Smesta" to="Smjesta" />
+    <Word from="smeste" to="smjeste" />
+    <Word from="smešak" to="smješak" />
+    <Word from="smeši" to="smiješi" />
+    <Word from="Smeši" to="Smiješi" />
+    <Word from="smešio" to="smiješio" />
+    <Word from="smešiš" to="smiješiš" />
+    <Word from="smeškom" to="smješkom" />
+    <Word from="smjeo" to="smio" />
+    <Word from="smrdeo" to="smrdio" />
+    <Word from="sintersajzer" to="synthesizer" />
+    <Word from="sitnisajzer" to="synthesizer" />
+    <Word from="skelet" to="kostur" />
+    <Word from="sočiva" to="leće" />
+    <Word from="sočivima" to="lećama" />
+    <Word from="sočivo" to="leća" />
+    <Word from="sočivom" to="lećom" />
+    <Word from="sočivu" to="leći" />
+    <Word from="Spakuj" to="Spakiraj" />
+    <Word from="Spakujte" to="Spakirajte" />
+    <Word from="spakujte" to="spakirajte" />
+    <Word from="spasao" to="spasio" />
+    <Word from="Spasao" to="Spasio" />
+    <Word from="spasen" to="spašen" />
+    <Word from="spasla" to="spasila" />
+    <Word from="spasli" to="spasili" />
+    <Word from="speluje" to="sriče" />
+    <Word from="speluju" to="sriču" />
+    <Word from="spojiće" to="spojit će" />
+    <Word from="spolja" to="izvana" />
+    <Word from="Srediće" to="Sredit će" />
+    <Word from="Srediću" to="Sredit ću" />
+    <!-- nisu za regex - ne odgovaraju zbog dodatnog ju na kraju -->
+    <Word from="stabilizuju" to="stabiliziraju" />
+    <Word from="starao" to="brinuo" />
+    <Word from="starati" to="brinuti" />
+    <Word from="Starati" to="Brinuti" />
+    <Word from="steni" to="stijeni" />
+    <Word from="stepen" to="stupanj" />
+    <Word from="stepena" to="stupnjeva" />
+    <Word from="stepeni" to="stupnjeva" />
+    <Word from="stepenu" to="stupnju" />
+    <Word from="sticati" to="stjecati" />
+    <Word from="stiditi" to="stidjeti" />
+    <Word from="streljamo" to="strijeljamo" />
+    <Word from="streljati" to="strijeljati" />
+    <Word from="stoleća" to="stoljeća" />
+    <Word from="stobom" to="s tobom" />
+    <Word from="stvrano" to="stvarno" />
+    <Word from="Stupiću" to="Stupit ću" />
+    <Word from="stupiću" to="stupit ću" />
+    <Word from="subjekat" to="subjekt" />
+    <Word from="sudija" to="sudac" />
+    <Word from="Sudija" to="Sudac" />
+    <Word from="sudije" to="suca" />
+    <Word from="sudiji" to="sucu" />
+    <Word from="sudijo" to="suče" />
+    <Word from="sudiju" to="suca" />
+    <Word from="sudijom" to="sucem" />
+    <Word from="sudijskog" to="sudskog" />
+    <Word from="sugerišu" to="predlažu" />
+    <Word from="sugeriše" to="predlaže" />
+    <Word from="supa" to="juha" />
+    <Word from="supe" to="juhe" />
+    <Word from="supi" to="juhi" />
+    <Word from="supu" to="juhu" />
+    <Word from="supom" to="juhom" />
+    <Word from="supama" to="juhama" />
+    <Word from="Supa" to="Juha" />
+    <Word from="Supe" to="Juhe" />
+    <Word from="Supi" to="Juhi" />
+    <Word from="Supu" to="Juhu" />
+    <Word from="Supom" to="Juhom" />
+    <Word from="Supama" to="Juhama" />
+    <Word from="surfuje" to="surfa" />
+    <Word from="surfuješ" to="surfaš" />
+    <Word from="surfuju" to="surfaju" />
+    <Word from="suština" to="bit" />
+    <Word from="suštinski" to="bitni" />
+    <Word from="suvom" to="suhom" />
+    <Word from="suvog" to="suhog" />
+    <Word from="suvoj" to="suhoj" />
+    <Word from="Suvom" to="Suhom" />
+    <Word from="Suvog" to="Suhog" />
+    <Word from="Suvoj" to="Suhoj" />
+    <Word from="suvim" to="suhim" />
+    <Word from="Suvim" to="Suhim" />
+    <Word from="svestan" to="svjestan" />
+    <Word from="svjest" to="svijest" />
+    <Word from="Svjest" to="Svijest" />
+    <Word from="svjesti" to="svijesti" />
+    <Word from="Svjesti" to="Svijesti" />
+    <Word from="svetova" to="svjetova" />
+    <Word from="svetove" to="svjetove" />
+    <Word from="svugde" to="svugdje" />
+    <Word from="šolja" to="šalica" />
+    <Word from="šolju" to="šalicu" />
+    <Word from="Šta" to="Što" />
+    <Word from="štagod" to="što god" />
+    <Word from="šta" to="što" />
+    <Word from="štp" to="što" />
+    <Word from="štampa" to="tisak" />
+    <Word from="štampu" to="tisak" />
+    <Word from="štampom" to="tiskom" />
+    <Word from="štampi" to="tisku" />
+    <Word from="štampati" to="tiskati" />
+    <Word from="Šutjeće" to="Šutjet će" />
+    <Word from="tablu" to="ploču" />
+    <Word from="taguje" to="tagira" />
+    <Word from="takođe" to="također" />
+    <Word from="Takođe" to="Također" />
+    <Word from="talas" to="val" />
+    <Word from="Talas" to="Val" />
+    <Word from="talasa" to="valova" />
+    <Word from="talase" to="valove" />
+    <Word from="talasi" to="valovi" />
+    <Word from="Talasi" to="Valovi" />
+    <Word from="talasima" to="valovima" />
+    <Word from="Talasima" to="Valovima" />
+    <Word from="tečnost" to="tekućina" />
+    <Word from="tečnosti" to="tekućine" />
+    <Word from="tečnošću" to="tekućinom" />
+    <Word from="tekšo" to="teško" />
+    <Word from="Tekšo" to="Teško" />
+    <Word from="terajte" to="tjerajte" />
+    <Word from="tešio" to="tješio" />
+    <Word from="tešiš" to="tješiš" />
+    <Word from="tki" to="tko" />
+    <Word from="točak" to="kotač" />
+    <Word from="Točak" to="Kotač" />
+    <Word from="toha" to="toga" />
+    <Word from="tovj" to="tvoj" />
+    <Word from="trabam" to="trebam" />
+    <Word from="trkanje" to="utrkivanje" />
+    <Word from="trkanja" to="utrkivanja" />
+    <Word from="trkao" to="utrkivao" />
+    <Word from="trougao" to="trokut" />
+    <Word from="trougla" to="trokuta" />
+    <Word from="trouglu" to="trokutu" />
+    <Word from="trouglove" to="trokute" />
+    <Word from="trpeo" to="trpio" />
+    <Word from="Trpeo" to="Trpio" />
+    <Word from="tugi" to="tuzi" />
+    <Word from="tvrtci" to="tvrtki" />
+    <Word from="ubede" to="uvjere" />
+    <Word from="Ubeđivao" to="Uvjeravao" />
+    <Word from="ubeđivati" to="uvjeravati" />
+    <Word from="ubjeđivati" to="uvjeravati" />
+    <Word from="ubeđuje" to="uvjerava" />
+    <Word from="ubeđuješ" to="uvjeravaš" />
+    <Word from="ubeđuju" to="uvjeravaju" />
+    <Word from="ubjediti" to="uvjeriti" />
+    <Word from="učtivo" to="uljudno" />
+    <Word from="učtivost" to="uljudnost" />
+    <Word from="učtivošću" to="uljudnošću" />
+    <Word from="udata" to="udana" />
+    <Word from="Udata" to="Udana" />
+    <Word from="udatoj" to="udanoj" />
+    <Word from="udeo" to="udio" />
+    <Word from="ugljenik" to="ugljik" />
+    <Word from="uliva" to="ulijeva" />
+    <Word from="ulivali" to="ulijevali" />
+    <Word from="ulivate" to="ulijevate" />
+    <Word from="uljeva" to="ulijeva" />
+    <Word from="ujutru" to="ujutro" />
+    <Word from="Ukoliko" to="Ako" />
+    <Word from="ukoliko" to="ako" />
+    <Word from="ume" to="zna" />
+    <Word from="umem" to="umijem" />
+    <Word from="umeš" to="umiješ" />
+    <Word from="umesto" to="umjesto" />
+    <Word from="Umesto" to="umjesto" />
+    <Word from="umete" to="znate" />
+    <Word from="umijesto" to="umjesto" />
+    <Word from="Umijesto" to="Umjesto" />
+    <Word from="umetninama" to="umjetninama" />
+    <Word from="umreti" to="umrijeti" />
+    <Word from="Umret" to="Umrijet" />
+    <Word from="umrijećeš" to="umrijet ćeš" />
+    <Word from="umrijećete" to="umrijet ćete" />
+    <Word from="Uneću" to="Unijet ću" />
+    <Word from="univerzitet" to="sveučilište" />
+    <Word from="univerzitetu" to="sveučilištu" />
+    <Word from="Uopšte" to="Uopće" />
+    <Word from="uopšte" to="uopće" />
+    <Word from="uopče" to="uopće" />
+    <Word from="upustva" to="uputstva" />
+    <Word from="uprkos" to="usprkos" />
+    <Word from="Uprkos" to="Usprkos" />
+    <Word from="uradio" to="učinio" />
+    <Word from="Uredu" to="U redu" />
+    <Word from="uspe" to="uspije" />
+    <Word from="Uspe" to="Uspije" />
+    <Word from="uspeo" to="uspio" />
+    <Word from="Uspeo" to="Uspio" />
+    <Word from="uspećeš" to="uspjet ćeš" />
+    <Word from="uspjećeš" to="uspjet ćeš" />
+    <Word from="uspećemo" to="uspjet ćemo" />
+    <Word from="uspeš" to="uspiješ" />
+    <Word from="uspeju" to="uspiju" />
+    <Word from="uspjevala" to="uspijevala" />
+    <Word from="uspijo" to="uspio" />
+    <Word from="u sred" to="usred" />
+    <Word from="usled" to="uslijed" />
+    <Word from="Usled" to="Uslijed" />
+    <Word from="usledila" to="uslijedila" />
+    <Word from="usljed" to="uslijed" />
+    <Word from="Usljed" to="Uslijed" />
+    <Word from="ušunjate" to="ušuljate" />
+    <Word from="utehe" to="utjehe" />
+    <Word from="uveče" to="navečer" />
+    <Word from="uvek" to="uvijek" />
+    <Word from="Uvek" to="Uvijek" />
+    <Word from="uvjek" to="uvijek" />
+    <Word from="Uvjek" to="Uvijek" />
+    <Word from="uvijet" to="uvjet" />
+    <Word from="uvijeti" to="uvjeti" />
+    <Word from="uvijetima" to="uvjetima" />
+    <Word from="uva" to="uha" />
+    <Word from="Uva" to="Uha" />
+    <Word from="uvo" to="uho" />
+    <Word from="Uvo" to="Uho" />
+    <Word from="uvom" to="uhom" />
+    <Word from="Uvom" to="Uhom" />
+    <Word from="uvu" to="uhu" />
+    <Word from="Uvu" to="Uhu" />
+    <Word from="vaistinu" to="uistinu" />
+    <Word from="Vaistinu" to="Uistinu" />
+    <Word from="vajar" to="kipar" />
+    <Word from="vakciniše" to="cijepi" />
+    <Word from="varnica" to="iskra" />
+    <Word from="varnicu" to="iskru" />
+    <Word from="vaspitala" to="odgojila" />
+    <Word from="vaspitavan" to="odgajan" />
+    <Word from="vaspitavanju" to="odgoju" />
+    <Word from="vašljivi" to="ušljivi" />
+    <Word from="važi" to="vrijedi" />
+    <Word from="večan" to="vječan" />
+    <Word from="većati" to="vijećati" />
+    <Word from="vek" to="stoljeće" />
+    <Word from="veka" to="stoljeća" />
+    <Word from="veke" to="vijeke" />
+    <Word from="vekova" to="stoljeća" />
+    <Word from="venca" to="vijenca" />
+    <Word from="večnost" to="vječnost" />
+    <Word from="veoma" to="vrlo" />
+    <Word from="Veoma" to="Vrlo" />
+    <Word from="vera" to="vjera" />
+    <Word from="vere" to="vjere" />
+    <Word from="veri" to="vjeri" />
+    <Word from="verom" to="vjerom" />
+    <Word from="veru" to="vjeru" />
+    <Word from="veran" to="vjeran" />
+    <Word from="verama" to="vjerama" />
+    <Word from="Vera" to="Vjera" />
+    <Word from="Vere" to="Vjere" />
+    <Word from="Veri" to="Vjeri" />
+    <Word from="Verom" to="Vjerom" />
+    <Word from="Veru" to="Vjeru" />
+    <Word from="Veran" to="Vjeran" />
+    <Word from="Verama" to="Vjerama" />
+    <Word from="veren" to="zaručen" />
+    <Word from="Veren" to="Zaručen" />
+    <Word from="verena" to="zaručena" />
+    <Word from="vereni" to="zaručeni" />
+    <Word from="verimo" to="zaručimo" />
+    <Word from="vest" to="vijest" />
+    <Word from="Vest" to="Vijest" />
+    <Word from="vesti" to="vijesti" />
+    <Word from="Vesti" to="Vijesti" />
+    <Word from="Vjesti" to="Vijesti" />
+    <Word from="vjesti" to="vijesti" />
+    <Word from="vestima" to="vijestima" />
+    <Word from="Vestima" to="Vijestima" />
+    <Word from="vjestima" to="vijestima" />
+    <Word from="Vjestima" to="Vijestima" />
+    <Word from="vešala" to="vješala" />
+    <Word from="vešću" to="viješću" />
+    <Word from="vešu" to="rublju" />
+    <Word from="videše" to="vidješe" />
+    <Word from="vidjeo" to="vidio" />
+    <Word from="Vidjeo" to="Vidio" />
+    <Word from="vjerojatnoća" to="vjerojatnost" />
+    <Word from="vješću" to="viješću" />
+    <Word from="vlo" to="vrlo" />
+    <Word from="Vodiće" to="Vodit će" />
+    <Word from="Vodiću" to="Vodit ću" />
+    <Word from="voliti" to="voljeti" />
+    <Word from="vredelo" to="vrijedilo" />
+    <Word from="vrednom" to="vrijednom" />
+    <Word from="vrednog" to="vrijednog" />
+    <Word from="vreme" to="vrijeme" />
+    <Word from="Vreme" to="Vrijeme" />
+    <Word from="vrjeme" to="vrijeme" />
+    <Word from="Vrjeme" to="Vrijeme" />
+    <Word from="vrteo" to="vrtio" />
+    <Word from="vrvela" to="vrvjela" />
+    <Word from="whiskey" to="viski" />
+    <Word from="zaceljivanje" to="zacjeljivanje" />
+    <Word from="zagreva" to="zagrijava" />
+    <Word from="Zagreva" to="Zagrijava" />
+    <Word from="Zagrevate" to="Zagrijavate" />
+    <Word from="zagrevanje" to="zagrijavanje" />
+    <Word from="zakunio" to="zakleo" />
+    <Word from="zalepili" to="zalijepili" />
+    <Word from="zalepiti" to="zalijepiti" />
+    <Word from="zaliv" to="zaljev" />
+    <Word from="zalivu" to="zaljevu" />
+    <Word from="zanm" to="znam" />
+    <Word from="zanma" to="zanima" />
+    <Word from="zaplena" to="zapljena" />
+    <Word from="zapleni" to="zaplijeni" />
+    <Word from="zaplenu" to="zapljenu" />
+    <Word from="zaspem" to="zaspim" />
+    <Word from="zastareo" to="zastario" />
+    <Word from="zauvek" to="zauvijek" />
+    <Word from="Zauvek" to="Zauvijek" />
+    <Word from="zauvjek" to="zauvijek" />
+    <Word from="Zauvjek" to="Zauvijek" />
+    <Word from="zavera" to="zavjera" />
+    <Word from="zahtev" to="zahtjev" />
+    <Word from="Zahtev" to="Zahtjev" />
+    <Word from="zasede" to="zasjede" />
+    <Word from="zasedi" to="zasjedi" />
+    <Word from="zasedu" to="zasjedu" />
+    <Word from="zatp" to="zato" />
+    <Word from="Zatp" to="Zato" />
+    <Word from="zaželeo" to="zaželio" />
+    <Word from="Zaželeo" to="Zaželio" />
+    <Word from="Zaželjeo" to="Zaželio" />
+    <Word from="zaželjeo" to="zaželio" />
+    <Word from="zbg" to="zbog" />
+    <Word from="zdrvo" to="zdravo" />
+    <Word from="Zdrvo" to="Zdravo" />
+    <Word from="zlodela" to="zlodjela" />
+    <Word from="znaći" to="znači" />
+    <Word from="zvaničan" to="služben" />
+    <Word from="zvezdom" to="zvijezdom" />
+    <Word from="žemo" to="ćemo" />
+    <Word from="želeo" to="želio" />
+    <Word from="Želeo" to="Želio" />
+    <Word from="Željeo" to="Želio" />
+    <Word from="željeo" to="želio" />
+    <Word from="Živeo" to="Živio" />
+    <Word from="živeo" to="živio" />
+    <Word from="žmureo" to="žmirio" />
+
+    <!-- imena -->
+    <Word from="Abi" to="Abby" />
+    <Word from="Alis" to="Alice" />
+    <Word from="Ajk" to="Ike" />
+    <Word from="Ajku" to="Ikeu" />
+    <Word from="Ajrin" to="Irene" />
+    <Word from="Ajris" to="Iris" />
+    <Word from="Ajron" to="Iron" />
+    <Word from="Ajvi" to="Ivy" />
+    <Word from="Anđeles" to="Angeles" />
+    <Word from="Anđelesa" to="Angelesa" />
+    <Word from="Anđelesu" to="Angelesu" />
+    <Word from="Anđelesom" to="Angelesom" />
+    <Word from="Antoni" to="Anthony" />
+    <Word from="Antoniju" to="Anthonyju" />
+    <Word from="Arči" to="Archie" />
+    <Word from="Beverli" to="Beverly" />
+    <Word from="Bejker" to="Baker" />
+    <Word from="Bitls" to="Beatles" />
+    <Word from="Bitlsi" to="Beatlesi" />
+    <Word from="Bridžit" to="Bridget" />
+    <Word from="Brižit" to="Brigitte" />
+    <Word from="Bruks" to="Brooks" />
+    <Word from="Dablin" to="Dublin" />
+    <Word from="Dablina" to="Dublina" />
+    <Word from="Dablinu" to="Dublinu" />
+    <Word from="Dag" to="Doug" />
+    <Word from="Darvin" to="Darwin" />
+    <Word from="Darvina" to="Darwina" />
+    <Word from="Darvinu" to="Darwinu" />
+    <Word from="Darvinom" to="Darwinom" />
+    <Word from="Dejv" to="Dave" />
+    <Word from="Dejvi" to="Davie" />
+    <Word from="Dejva" to="Davea" />
+    <Word from="Dejvu" to="Daveu" />
+    <Word from="Dejvom" to="Daveom" />
+    <Word from="Den" to="Dan" />
+    <Word from="Deril" to="Daryl" />
+    <Word from="Dijaz" to="Diaz" />
+    <Word from="Dru" to="Drew" />
+    <Word from="Đeni" to="Jenny" />
+    <Word from="Đošua" to="Joshua" />
+    <Word from="Džejmi" to="Jamie" />
+    <Word from="Džad" to="Jude" />
+    <Word from="Džeri" to="Jerry" />
+    <Word from="Džerija" to="Jerryja" />
+    <Word from="Džo" to="Joe" />
+    <Word from="Džoel" to="Joel" />
+    <Word from="Džoelu" to="Joelu" />
+    <Word from="Džoš" to="Josh" />
+    <Word from="Džošu" to="Joshu" />
+    <Word from="Džosi" to="Josie" />
+    <Word from="Džozi" to="Josie" />
+    <Word from="Džes" to="Jess" />
+    <Word from="Džen" to="Jen" />
+    <Word from="Džej" to="Jay" />
+    <Word from="Džejn" to="Jane" />
+    <Word from="Džil" to="Jill" />
+    <Word from="Džodi" to="Jody" />
+    <Word from="Džud" to="Jude" />
+    <Word from="Džuli" to="Julie" />
+    <Word from="Ebi" to="Abby" />
+    <Word from="Ejb" to="Abe" />
+    <Word from="Ejba" to="Abea" />
+    <Word from="Ejmi" to="Amy" />
+    <Word from="Ejpril" to="April" />
+    <Word from="Empajer" to="Empire" />
+    <Word from="Enđel" to="Angel" />
+    <Word from="Endži" to="Angie" />
+    <Word from="Entoni" to="Anthony" />
+    <Word from="Ešford" to="Ashford" />
+    <Word from="Ešforda" to="Ashforda" />
+    <Word from="Ešli" to="Ashley" />
+    <Word from="Fibi" to="Phoebe" />
+    <Word from="Filovo" to="Philovo" />
+    <Word from="Flober" to="Flaubert" />
+    <Word from="Fokner" to="Faulkner" />
+    <Word from="Fren" to="Fran" />
+    <Word from="Grečen" to="Gretchen" />
+    <Word from="Grejs" to="Grace" />
+    <Word from="Hadson" to="Hudson" />
+    <Word from="Hadsonu" to="Hudsonu" />
+    <Word from="Hant" to="Hunt" />
+    <Word from="Hemingvej" to="Hemingway" />
+    <Word from="Henk" to="Hank" />
+    <Word from="Hejstings" to="Hastings" />
+    <Word from="Hju" to="Hugh" />
+    <Word from="Hjua" to="Hugha" />
+    <Word from="Hjuz" to="Hughes" />
+    <Word from="Hjuza" to="Hughesa" />
+    <Word from="Hjuston" to="Houston" />
+    <Word from="Hjustonu" to="Houstonu" />
+    <Word from="Igo" to="Hugo" />
+    <Word from="Ilejn" to="Elaine" />
+    <Word from="Židovin" to="Židov" />
+    <Word from="Johni" to="Johnny" />
+    <Word from="Judžin" to="Eugene" />
+    <Word from="Kasl" to="Castle" />
+    <Word from="Kejdž" to="Cage" />
+    <Word from="Kejn" to="Kane" />
+    <Word from="Kejsi" to="Casey" />
+    <Word from="Kejti" to="Katie" />
+    <Word from="Keren" to="Karen" />
+    <Word from="Kerol" to="Carol" />
+    <Word from="Kerolajn" to="Caroline" />
+    <Word from="Klajv" to="Clive" />
+    <Word from="Klajva" to="Clivea" />
+    <Word from="Klajve" to="Clive" />
+    <Word from="Klajvu" to="Cliveu" />
+    <Word from="Klarens" to="Clarence" />
+    <Word from="Kler" to="Claire" />
+    <Word from="Kloi" to="Chloe" />
+    <Word from="Klod" to="Claude" />
+    <Word from="Klode" to="Claude" />
+    <Word from="Kol" to="Cole" />
+    <Word from="Kolins" to="Collins" />
+    <Word from="Kortni" to="Courtney" />
+    <Word from="Krej?g" to="Craig" />
+    <Word from="Kristi" to="Christie" />
+    <Word from="Lajf" to="Life" />
+    <Word from="Lajl" to="Lile" />
+    <Word from="Lejk" to="Lake" />
+    <Word from="Lorejn" to="Loraine" />
+    <Word from="Lorens" to="Lawrence" />
+    <Word from="Lusi" to="Lucy" />
+    <Word from="Majk" to="Mike" />
+    <Word from="Majkeve" to="Mikeove" />
+    <Word from="Majlo" to="Milo" />
+    <Word from="Maslou" to="Maslow" />
+    <Word from="Medlin" to="Madelaine" />
+    <Word from="Medelin" to="Madeline" />
+    <Word from="Mejbel" to="Mabel" />
+    <Word from="Mejn" to="Maine" />
+    <Word from="Mejna" to="Mainea" />
+    <Word from="Mejnu" to="Maineu" />
+    <Word from="Mejnom" to="Maineom" />
+    <Word from="Mejpls" to="Maples" />
+    <Word from="Mejsi" to="Maisy" />
+    <Word from="Mek" to="Mac" />
+    <Word from="Merilend" to="Maryland" />
+    <Word from="Mičel" to="Mitchell" />
+    <Word from="Nensi" to="Nancy" />
+    <Word from="Niče" to="Nietzsche" />
+    <Word from="Ničea" to="Nietzschea" />
+    <Word from="Ničeu" to="Nietzscheu" />
+    <Word from="Ničeom" to="Nietzscheom" />
+    <Word from="Odri" to="Audrey" />
+    <Word from="Ohajo" to="Ohio" />
+    <Word from="Ohaja" to="Ohia" />
+    <Word from="Ohaju" to="Ohiu" />
+    <Word from="Olbrajt" to="Albright" />
+    <Word from="O'Nil" to="O'Neal" />
+    <Word from="Orlins" to="Orleans" />
+    <Word from="Orlinsa" to="Orleansa" />
+    <Word from="Orlinsu" to="Orleansu" />
+    <Word from="Pem" to="Pam" />
+    <Word from="Pejdž" to="Paige" />
+    <Word from="Redži" to="Reggie" />
+    <Word from="Redžinald" to="Reginald" />
+    <Word from="Rej" to="Ray" />
+    <Word from="Rejčel" to="Rachel" />
+    <Word from="Rič" to="Rich" />
+    <Word from="Rouz" to="Rose" />
+    <Word from="Sendi" to="Sandy" />
+    <Word from="Sidnej" to="Sidney" />
+    <Word from="Sindi" to="Cindy" />
+    <Word from="Sojer" to="Sawyer" />
+    <Word from="Sojeru" to="Sawyeru" />
+    <Word from="Sole" to="Saule" />
+    <Word from="Stejsi" to="Stacy" />
+    <Word from="Stoun" to="Stone" />
+    <Word from="Šeron" to="Sharon" />
+    <Word from="Šeril" to="Cheryl" />
+    <Word from="Širli" to="Shirley" />
+    <Word from="Španiji" to="Španjolskoj" />
+    <Word from="Tajms" to="Times" />
+    <Word from="Tejlor" to="Taylor" />
+    <Word from="Vajlder" to="Wilder" />
+    <Word from="Valš" to="Walsh" />
+    <Word from="Vins" to="Vince" />
+    <Word from="Voren" to="Warren" />
+    <Word from="Vud" to="Wood" />
+    <Word from="Žak" to="Jacques" />
+    <Word from="Žil" to="Jules" />
+    <!-- imena mjeseci -->
+    <Word from="januar" to="siječanj" />
+    <Word from="Januar" to="Siječanj" />
+    <Word from="februar" to="veljača" />
+    <Word from="februara" to="veljače" />
+    <Word from="februaru" to="veljači" />
+    <Word from="Februar" to="Veljača" />
+    <Word from="Februara" to="Veljače" />
+    <Word from="Februaru" to="Veljači" />
+    <Word from="mart" to="ožujak" />
+    <Word from="Mart" to="Ožujak" />
+    <Word from="april" to="travanj" />
+    <Word from="April" to="Travanj" />
+    <Word from="maj" to="svibanj" />
+    <Word from="Maj" to="Svibanj" />
+    <Word from="svibnjom" to="svibnjem" />
+    <Word from="jun" to="lipanj" />
+    <Word from="juna" to="lipnja" />
+    <Word from="junu" to="lipnju" />
+    <Word from="Jun" to="Lipanj" />
+    <Word from="Juni" to="Lipanj" />
+    <Word from="juli" to="srpanj" />
+    <Word from="jula" to="srpnja" />
+    <Word from="julu" to="srpnju" />
+    <Word from="Juli" to="Srpanj" />
+    <Word from="septembar" to="rujan" />
+    <Word from="Septembar" to="Rujan" />
+    <Word from="oktobar" to="listopad" />
+    <Word from="Oktobar" to="Listopad" />
+    <Word from="oktobra" to="listopada" />
+    <Word from="oktobru" to="listopadu" />
+    <Word from="novembar" to="studeni" />
+    <Word from="november" to="studeni" />
+    <Word from="novembra" to="studenog" />
+    <Word from="novembru" to="studenom" />
+    <Word from="Novembar" to="Studeni" />
+    <Word from="November" to="Studeni" />
+    <Word from="Novembra" to="Studenog" />
+    <Word from="Novembru" to="Studenom" />
+    <Word from="decembar" to="prosinac" />
+    <Word from="Decembar" to="Prosinac" />
+  </WholeWords>
+  <PartialWordsAlways />
+  <PartialWords />
+  <PartialLines>
+    <LinePart from="Ako ej" to="Ako je" />
+    <LinePart from="ako ej" to="ako je" />
+    <LinePart from="bez svesti" to="bez svijesti" />
+    <LinePart from="Biću uz" to="Bit ću uz" />
+    <LinePart from="bi ja" to="bih ja" />
+    <LinePart from="bi la" to="bila" />
+    <LinePart from="biti uredu" to="biti u redu" />
+    <LinePart from="bi da bude" to="bi biti" />
+    <LinePart from="Bi ste" to="Biste" />
+    <LinePart from="Bilo ko" to="Bilo tko" />
+    <LinePart from="bilo ko" to="bilo tko" />
+    <LinePart from="će da dođe" to="će doći" />
+    <LinePart from="Da li će" to="Hoće li" />
+    <LinePart from="Da li ćemo" to="Hoćemo li" />
+    <LinePart from="Da li ću" to="Hoću li" />
+    <LinePart from="da li ću" to="hoću li" />
+    <LinePart from="dali ću" to="hoću li" />
+    <LinePart from="Da li je" to="Je li" />
+    <LinePart from="da li je" to="je li" />
+    <LinePart from="dali je" to="je li" />
+    <LinePart from="Da li ste" to="Jeste li" />
+    <LinePart from="Da li si" to="Jesi li" />
+    <LinePart from="dali si" to="jesi li" />
+    <LinePart from="da li će" to="hoće li" />
+    <LinePart from="dali će" to="hoće li" />
+    <LinePart from="do srede" to="do srijede" />
+    <LinePart from="Dobro veče" to="Dobra večer" />
+    <LinePart from="Dobro večer" to="Dobra večer" />
+    <LinePart from="Dobar večer" to="Dobra večer" />
+    <LinePart from="gdje ideš" to="kamo ideš" />
+    <LinePart from="Gdje ideš" to="Kamo ideš" />
+    <LinePart from="Gdje sada" to="Kamo sada" />
+    <LinePart from="gle ko" to="gle tko" />
+    <LinePart from="hoću da budem" to="želim biti" />
+    <LinePart from="Hoću da budem" to="Želim biti" />
+    <LinePart from="hoću da kažem" to="želim reći" />
+    <LinePart from="hoćeš da kažeš" to="želiš reći" />
+    <LinePart from="hoće da kaže" to="želi reći" />
+    <LinePart from="hoću da živim" to="želim živjeti" />
+    <LinePart from="Izvini se" to="Ispričaj se" />    
+    <LinePart from="izvini se" to="ispričaj se" />
+    <LinePart from="Izvinite me" to="Ispričajte me" />
+    <LinePart from="Izvinite nas" to="Ispričajte nas" />
+    <LinePart from="izvinite nas" to="ispričajte nas" />
+    <LinePart from="Izvinjavamo se" to="Ispričavamo se" />
+    <LinePart from="ja bi" to="ja bih" />
+    <LinePart from="Ja bi" to="Ja bih" />
+    <LinePart from="Jel sam ti" to="Jesam li ti" />
+    <LinePart from="Jeli se" to="Je li se" />
+    <LinePart from="Jeli sve" to="Je li sve" />
+    <LinePart from="Jeli ti" to="Je li ti" />
+    <LinePart from="ko je" to="tko je" />
+    <LinePart from="ko si" to="tko si" />
+    <LinePart from="ko ti je" to="tko ti je" />
+    <LinePart from="ko te je" to="tko te je" />
+    <LinePart from="ko zna" to="tko zna" />
+    <LinePart from="moći da idemo" to="moći ići" />
+    <LinePart from="moglo da bude" to="moglo biti" />
+    <LinePart from="moje saučešće" to="moja sućut" />
+    <LinePart from="mora da bude" to="mora biti" />
+    <LinePart from="moram da budem" to="moram biti" />
+    <LinePart from="Moram da idem" to="Moram ići" />
+    <LinePart from="moram da idem" to="moram ići" />
+    <LinePart from="Moraš da ideš" to="Moraš ići" />
+    <LinePart from="Moramo da idemo" to="Moramo ići" />
+    <LinePart from="moram da vidim" to="moram vidjeti" />
+    <LinePart from="moram da zaboravim" to="moram zaboraviti" />
+    <LinePart from="moraš da zaboraviš" to="moraš zaboraviti" />
+    <LinePart from="mora da zna" to="mora znati" />
+    <LinePart from="moram da znam" to="moram znati" />
+    <LinePart from="Moram da znam" to="Moram znati" />
+    <LinePart from="moraš da znaš" to="moraš znati" />
+    <LinePart from="moraš da ideš" to="moraš ići" />
+    <LinePart from="može da bude" to="može biti" />
+    <LinePart from="možeš da budeš" to="možeš biti" />
+    <LinePart from="može da diše" to="može disati" />
+    <LinePart from="možeš da dobiješ" to="možeš dobiti" />
+    <LinePart from="možemo da imamo" to="možemo imati" />
+    <LinePart from="na večer" to="navečer" />
+    <LinePart from="Na večer" to="Navečer" />
+    <LinePart from="neće da bude" to="neće biti" />
+    <LinePart from="nećeš da budeš" to="nećeš biti" />
+    <LinePart from="nećeš da požališ" to="nećeš požaliti" />
+    <LinePart from="Neko ko" to="Netko tko" />
+    <LinePart from="neko ko" to="netko tko" />
+    <LinePart from="neko nešto" to="netko nešto" />
+    <LinePart from="nedjelju dana" to="tjedan dana" />
+    <LinePart from="Ne mogu da verujem" to="Ne mogu vjerovati" />
+    <LinePart from="new yorški" to="njujorški" />
+    <LinePart from="nju jorški" to="njujorški" />
+    <LinePart from="od kako" to="otkako" />
+    <LinePart from="Plašim se" to="Bojim se" />
+    <LinePart from="plašim se" to="bojim se" />
+    <LinePart from="pravo u oči" to="ravno u oči" />
+    <LinePart from="sa njim" to="s njim" />
+    <LinePart from="sa njima" to="s njima" />
+    <LinePart from="sa njom" to="s njom" />
+    <LinePart from="sa tim" to="s tim" />
+    <LinePart from="sa tom" to="s tom" />
+    <LinePart from="sa tobom" to="s tobom" />
+    <LinePart from="sa vama" to="s vama" />
+    <LinePart from="sam da budem" to="sam biti" />
+    <LinePart from="sići dolje" to="sići" />
+    <LinePart from="Si dobro" to="Jesi li dobro" />
+    <LinePart from="Svako ko" to="Svatko tko" />
+    <LinePart from="Svo vreme" to="Sve vrijeme" />
+    <LinePart from="Svo vrijeme" to="Sve vrijeme" />
+    <LinePart from="smeo da" to="smio" />
+    <LinePart from="smeli da" to="smjeli" />
+    <LinePart from="Što ej" to="Što je" />
+    <LinePart from="što ej" to="što je" />
+    <LinePart from="to j" to="to je" />
+    <LinePart from="to ej" to="to je" />
+    <LinePart from="To ej" to="To je" />
+    <LinePart from="tamo natrag" to="tamo iza" />
+    <LinePart from="tamo je natrag" to="tamo je iza" />
+    <LinePart from="Tamo je natrag" to="Tamo je iza" />
+    <LinePart from="treba da bude" to="treba biti" />
+    <LinePart from="u jutro" to="ujutro" />
+    <LinePart from="ući unutra" to="ući" />
+    <LinePart from="vas je lagao" to="vam je lagao" />
+    <LinePart from="za uvijek" to="zauvijek" />
+    <LinePart from="zato sto" to="zato što" />
+    <LinePart from="zna da bude" to="zna biti" />
+    <LinePart from="zna ko" to="zna tko" />
+    <LinePart from="znati ko" to="znati tko" />
+    <LinePart from="žele da budu" to="žele biti" />
+    <LinePart from="želi da bude" to="želi biti" />
+    <LinePart from="želio da budem" to="želio biti" />
+    <LinePart from="želim da budem" to="želim biti" />
+    <LinePart from="Želim da budem" to="Želim biti" />
+    <LinePart from="želiš da budeš" to="želiš biti" />
+    <LinePart from="želim da idem" to="želim ići" />
+    <LinePart from="želim da odem" to="želim otići" />
+    <LinePart from="želiš da odeš" to="želiš otići" />
+    <LinePart from="želiš da uđeš" to="želiš ući" />
+    <LinePart from="želim da umrem" to="želim umrijeti" />
+    <LinePart from="Želim da znam" to="Želim znati" />
+    <LinePart from="želim da znam" to="želim znati" />
+    <LinePart from="želiš da znaš" to="želiš znati" />
+  </PartialLines>
+  <PartialLinesAlways />
+  <BeginLines />
+  <EndLines />
+  <WholeLines />
+  <RegularExpressions>
+    <!-- deklinacije imenica i konjugacije glagola -->
+    <RegEx find="([0-9])-ogodišnj" replaceWith="$1-godišnj" />
+    <RegEx find="(jeda|dva|tri|četr|pet|šes|sedam|osam|devet)najst([aeiou]|i[mh]|o[mgj]|ima)\b" replaceWith="$1naest$2" />
+    <RegEx find="bsorbira" replaceWith="psorbira" />
+    <RegEx find="bstraktn" replaceWith="pstraktn" />
+    <RegEx find="\badvokat(?![si])" replaceWith="odvjetnik" />
+    <RegEx find="Advokat(?![si])" replaceWith="Odvjetnik" />
+    <RegEx find="\badvokatsk" replaceWith="odvjetničk" />
+    <RegEx find="Advokatsk" replaceWith="Odvjetničk" />
+    <RegEx find="ajsmiješnij" replaceWith="ajsmješnij" />
+    <RegEx find="([aA])kcion(?!ar)" replaceWith="$1kcijsk" />
+    <RegEx find="Akcionar" replaceWith="Dioničar" />
+    <RegEx find="akcionar" replaceWith="dioničar" />
+    <RegEx find="\b[aA]las([kc])" replaceWith="Aljas$1" />
+    <RegEx find="([dnl])ijum" replaceWith="$1ij" />
+    <RegEx find="ngažov" replaceWith="ngažir" />
+    <RegEx find="armij" replaceWith="vojsk" />
+    <RegEx find="Armij" replaceWith="Vojsk" />
+    <RegEx find="svalt" replaceWith="sfalt" />
+    <RegEx find="([aA])zbu[kc]" replaceWith="$1beced" />
+    <RegEx find="akcil" replaceWith="acil" />
+    <RegEx find="bardovanj" replaceWith="bardiranj" />
+    <RegEx find="baštensk" replaceWith="vrtn" />
+    <RegEx find="ataljon" replaceWith="ataljun" />
+    <RegEx find="beđivać" replaceWith="vjeravat ć" />
+    <RegEx find="beđujuć" replaceWith="vjeravajuć" />
+    <RegEx find="ekstv" replaceWith="ijeg" />
+    <RegEx find="bj?elac" replaceWith="bijelac" />
+    <RegEx find="([bB])ele([šgž])" replaceWith="$1ilje$2" />
+    <!-- nikada sa velikim slovom jer je Bela ime -->
+    <RegEx find="([bc])elin" replaceWith="$1jelin" />
+    <RegEx find="belkinj" replaceWith="bjelkinj" />
+    <RegEx find="([bB])erz" replaceWith="$1urz" />
+    <RegEx find="([bB])esom" replaceWith="$1jesom" />
+    <RegEx find="\bbezbj?ed" replaceWith="sigur" />
+    <RegEx find="\bBezbj?ed" replaceWith="Sigur" />
+    <RegEx find="\bbiblij([aeiou]|om|ama)\b" replaceWith="Biblij$1" />
+    <RegEx find="\b([bBpP])iće(š|mo|te)\b" replaceWith="$1it ć$2" />
+    <!-- futur 1. nema i na kraju glagola - "Pogrešno je pisati: biti ću" -->
+    <RegEx find="\b([bB])iti ć([ue]š?|emo|ete)\b" replaceWith="$1it ć$2" />
+    <RegEx find="biro(?!k)" replaceWith="ured" />
+    <RegEx find="Biro(?!k)" replaceWith="Ured" />
+    <RegEx find="\b([bB])j?edn([aeiou]|k[aeou]?)" replaceWith="$1ijedn$2" />
+    <RegEx find="\b([bB])j?el([aeiou]|ac|c[aeiu]|cima|o[mgj]|i[mh])\b" replaceWith="$1ijel$2" />
+    <RegEx find="(?&lt;![uU]rne)([bB])j?esn([aeiou])" replaceWith="$1ijesn$2" />
+    <RegEx find="zvrj?ed" replaceWith="zvrijed" />
+    <RegEx find="znadež" replaceWith="znad" />
+    <RegEx find="([bB])ežanj" replaceWith="$1ježanj" />
+    <RegEx find="([bB])i?j?ež([ei]|i[mš]|imo|ite|ao|al[aeio]|ati)\b" replaceWith="$1jež$2" />
+    <RegEx find="bioskop(?![si])" replaceWith="kin" />
+    <RegEx find="Bioskop(?![si])" replaceWith="Kin" />
+    <RegEx find="([bB])lj?ed([aeiouj])" replaceWith="$1lijed$2" />
+    <RegEx find="bliži[čć]" replaceWith="bližit ć" />
+    <RegEx find="lagosloven" replaceWith="lagoslovljen" />
+    <RegEx find="ogat?st?v" replaceWith="ogatstv" />
+    <RegEx find="([bBvV])o[Il]e(n|l[aieo]|ti)\b" replaceWith="$1olje$2" />
+    <RegEx find="([dbvmBVM])oleo" replaceWith="$1olio" />
+    <RegEx find="ožij" replaceWith="ožj" />
+    <RegEx find="boži[čć]([aeiu]|em|ima)?\b" replaceWith="Božić$1" />
+    <RegEx find="(?&lt;!\A|[.!?][&quot;”’]?\s+)\bBoži[čć]n([aeiou]|om|im)\b" replaceWith="božićn$1" />
+    <RegEx find="[bB]ubašvab" replaceWith="žohar" />
+    <RegEx find="bukval" replaceWith="doslov" />
+    <RegEx find="Bukval" replaceWith="Doslov" />
+    <RegEx find="\bCalifornij?" replaceWith="Kalifornij" />
+    <RegEx find="\b([cC])j?el([aeiou]|o[mgj]|i[mh]|ima?|osti)\b" replaceWith="$1ijel$2" />
+    <RegEx find="\b([cC])j?en([aeiou])" replaceWith="$1ijen$2" />
+    <RegEx find="([cC])j?enjen" replaceWith="$1ijenjen" />
+    <RegEx find="([cC])j?eni([lt])" replaceWith="$1ijeni$2" />
+    <RegEx find="([cC])rj?ev" replaceWith="$1rijev" />
+    <RegEx find="([cCsS])vj?e[ćč]([aeiou]|[oe]m|ama)\b" replaceWith="$1vijeć$2" />
+    <!-- časopisa » satopisa NE! - ne diraj te 2 linije! -->
+    <RegEx find="čas([au]|om|ov[aei]|ovima)\b" replaceWith="sat$1" />
+    <RegEx find="Čas([au]|om|ov[aei]|ovima)\b" replaceWith="Sat$1" />
+    <RegEx find="([čČ])eka[čć]" replaceWith="$1ekat ć" />
+    <RegEx find="([čČ])ovi?j?e([kč])" replaceWith="$1ovje$2" />
+    <RegEx find="ćopa" replaceWith="šepa" />
+    <RegEx find="ćuti" replaceWith="šuti" />
+    <RegEx find="Ćuti" replaceWith="Šuti" />
+    <RegEx find="\bćuta(?!o)" replaceWith="šutje" />
+    <RegEx find="\bĆuta(?!o)" replaceWith="Šutje" />
+    <RegEx find="[cčć]ut([ln])j" replaceWith="šut$1j" />
+    <RegEx find="[CČĆ]ut([ln])j" replaceWith="Šut$1j" />
+    <RegEx find="ćurk" replaceWith="puric" />
+    <RegEx find="Ćurk" replaceWith="Puric" />
+    <RegEx find="\b([dD])a[čć]([eu])" replaceWith="$1at ć$2" />
+    <RegEx find="ejstv(?!o)" replaceWith="jelovanj" />
+    <RegEx find="eklarisa" replaceWith="eklarira" />
+    <RegEx find="\b([dD])el([aou](?!x)|ić|ić[aeiu]|ima)" replaceWith="$1jel$2" />
+    <RegEx find="([dD])elova([lnt])" replaceWith="$1jelova$2" />
+    <RegEx find="\b([dD])j?eli([mšo]|mo|l[aeio]|t[ei])\b" replaceWith="$1ijeli$2" />
+    <RegEx find="\b([bBdD])j?el([ei])\b" replaceWith="$1ijel$2" />
+    <RegEx find="ikvent" replaceWith="inkvent" />
+    <RegEx find="([dD])elimi" replaceWith="$1jelomi" />
+    <RegEx find="([dD])eluj" replaceWith="$1jeluj" />
+    <RegEx find="([dD])isać" replaceWith="$1isat ć" />
+    <RegEx find="diskutova" replaceWith="raspravlja" />
+    <RegEx find="\b([dD])i?j?etet([au]|o[mv]|ov[aeiou]|ovo[mjg])\b" replaceWith="$1jetet$2" />
+    <RegEx find="\b([dD])ec([aeiou]|om)\b" replaceWith="$1jec$2" />
+    <RegEx find="\b([dD])e[čć]ic" replaceWith="$1ječic" />
+    <RegEx find="\b([dD])j?elov([aei]|ima)\b" replaceWith="$1ijelov$2" />
+    <RegEx find="\b([dD])evi([cč])" replaceWith="$1jevi$2" />
+    <RegEx find="\b([dD])evoj" replaceWith="$1jevoj" />
+    <RegEx find="([dD])eča" replaceWith="$1ječa" />
+    <RegEx find="delji" replaceWith="djelji" />
+    <RegEx find="([dD])j?eči?j" replaceWith="$1ječj" />
+    <RegEx find="([dD])etinj" replaceWith="$1jetinj" />
+    <RegEx find="\b([dD])esi(?!ć)" replaceWith="$1ogodi" />
+    <RegEx find="\b([dD])esić" replaceWith="$1ogodit ć" />
+    <RegEx find="\b([dD])j?eljenj" replaceWith="$1ijeljenj" />
+    <RegEx find="\b([dD])ijec([aeiou]|om)\b" replaceWith="$1jec$2" />
+    <RegEx find="ragoce" replaceWith="ragocje" />
+    <RegEx find="([dD])obi[čćc](?!i)" replaceWith="$1obit ć" />
+    <RegEx find="\b([dD])obij(a|en)" replaceWith="$1obiv$2" />
+    <RegEx find="([dD])o[čć]ić([eu])" replaceWith="$1oći ć$2" />
+    <RegEx find="([dD])ol?j?nj" replaceWith="$1onj" />
+    <RegEx find="([dD]o|[NnZz]a|[OoUu]d?)neo" replaceWith="$1nio" />
+    <RegEx find="\b([dDpP])o(d?)nj?e([lt])" replaceWith="$1o$2nije$3" />
+    <RegEx find="\b([dDpP])o(d?)nj?eć([eu])" replaceWith="$1o$2nijet ć$3" />
+    <RegEx find="\b([oO])dnj?e(l[aeio]|ti)\b" replaceWith="$1dnije$2" />
+    <RegEx find="\bdopada" replaceWith="sviđa" />
+    <RegEx find="\bDopada" replaceWith="Sviđa" />
+    <RegEx find="([dD])oprinj?e([ltv])" replaceWith="$1oprinije$2" />
+    <RegEx find="([dD])oprin(j?es?o)" replaceWith="$1oprinio" />
+    <RegEx find="\b([dD])osije" replaceWith="$1osje" />
+    <RegEx find="([dD])ospe(l[aeio]|lo[mgj]|lima|ti)\b" replaceWith="$1ospje$2" />
+    <RegEx find="([dD])ospe(?=[mš]|te\b)" replaceWith="$1ospije" />
+    <RegEx find="dostaja[čćc]" replaceWith="dostajat ć" />
+    <RegEx find="oveš[čćc]" replaceWith="ovest ć" />
+    <RegEx find="([dD])rj?ema" replaceWith="$1rijema" />
+    <RegEx find="drugaric" replaceWith="prijateljic" />
+    <RegEx find="Drugaric" replaceWith="Prijateljic" />
+    <RegEx find="dušek" replaceWith="madrac" />
+    <RegEx find="Dušek" replaceWith="Madrac" />
+    <RegEx find="džigeric" replaceWith="jetr" />
+    <RegEx find="Džigeric" replaceWith="Jetr" />
+    <RegEx find="žinovsk" replaceWith="ivovsk" />
+    <RegEx find="\bđep" replaceWith="džep" />
+    <RegEx find="Đep" replaceWith="Džep" />
+    <RegEx find="\bđubret" replaceWith="smeć" />
+    <RegEx find="\bđubriš" replaceWith="smetliš" />
+    <RegEx find="eklariše" replaceWith="eklarira" />
+    <RegEx find="ekspert(?![ni])" replaceWith="stručnjak" />
+    <RegEx find="Ekspert(?![ni])" replaceWith="Stručnjak" />
+    <RegEx find="ekspertn" replaceWith="stručn" />
+    <RegEx find="Ekspertn" replaceWith="Stručn" />
+    <RegEx find="enerk" replaceWith="enirk" />
+    <RegEx find="vakuiše" replaceWith="vakuira" />
+    <RegEx find="vakuišu" replaceWith="vakuiraju" />
+    <RegEx find="volucij?on(?![ar])" replaceWith="volucijsk" />
+    <RegEx find="vrop" replaceWith="urop" />
+    <RegEx find="fabri[kc]" replaceWith="tvornic" />
+    <RegEx find="Fabri[kc]" replaceWith="Tvornic" />
+    <RegEx find="fabrič" replaceWith="tvornič" />
+    <RegEx find="\bfarb" replaceWith="boj" />
+    <RegEx find="Farb(?!er)" replaceWith="Boj" />
+    <RegEx find="fij?o[ck]" replaceWith="ladic" />
+    <RegEx find="Fij?o[ck]" replaceWith="Ladic" />
+    <RegEx find="inansi" replaceWith="inanci" />
+    <RegEx find="ormacij?on" replaceWith="ormacijsk" />
+    <RegEx find="\bfu[dt]bal(?![se])" replaceWith="nogomet" />
+    <RegEx find="\bFu[dt]bal(?![se])" replaceWith="Nogomet" />
+    <RegEx find="fu[dt]balsk" replaceWith="nogometn" />
+    <RegEx find="cioniše" replaceWith="cionira" />
+    <RegEx find="([fF])orezni" replaceWith="$1orenzi" />
+    <RegEx find="ejsbu" replaceWith="aceboo" />
+    <RegEx find="arant(uje|ova)" replaceWith="arantira" />
+    <RegEx find="([gGsS])luv" replaceWith="$1luh" />
+    <RegEx find="([gG])nev" replaceWith="$1njev" />
+    <RegEx find="\b([gG])nj?ezd" replaceWith="$1nijezd" />
+    <RegEx find="([gG])odić" replaceWith="$1odit ć" />
+    <RegEx find="ospodj" replaceWith="ospođ" />
+    <RegEx find="([gG])ore([lt])" replaceWith="$1orje$2" />
+    <!-- ne diraj! [dogorio/razgorio/ izgorio] -->
+    <RegEx find="([gG])oreo" replaceWith="$1orio" />
+    <RegEx find="([gG])rej(?!p)" replaceWith="$1rij" />
+    <RegEx find="\b([gG])rj?e([hs])" replaceWith="$1rije$2" />
+    <RegEx find="\b([gG])riješn" replaceWith="$1rješn" />
+    <RegEx find="([gG])rj?eši([šsmotl])" replaceWith="$1riješi$2" />
+    <RegEx find="gvožđ" replaceWith="željez" />
+    <RegEx find="Gvožđ" replaceWith="Željez" />
+    <RegEx find="haos" replaceWith="kaos" />
+    <RegEx find="Haos" replaceWith="Kaos" />
+    <RegEx find="hemi(?![sfgmt])" replaceWith="kemi" />
+    <RegEx find="Hemi(?![sfgmt])" replaceWith="Kemi" />
+    <RegEx find="\bh?istorij[ei]" replaceWith="povijesti" />
+    <RegEx find="\bh?istorij[au]" replaceWith="povijest" />
+    <RegEx find="\bh?istorijsk" replaceWith="povijesn" />
+    <RegEx find="\bHistorijsk" replaceWith="Povijesn" />
+    <RegEx find="\bIstorijsk" replaceWith="Povijesn" />
+    <RegEx find="\bhiljad([aeiou]|om|ama)\b" replaceWith="tisuć$1" />
+    <RegEx find="\bHiljad([aeiou]|om|ama)\b" replaceWith="Tisuć$1" />
+    <RegEx find="hirur" replaceWith="kirur" />
+    <RegEx find="Hirur" replaceWith="Kirur" />
+    <RegEx find="hleb" replaceWith="kruh" />
+    <RegEx find="Hleb" replaceWith="Kruh" />
+    <RegEx find="\b([hH])oče" replaceWith="$1oće" />
+    <!-- [h->k]olesterol -->
+    <RegEx find="holest" replaceWith="kolest" />
+    <RegEx find="Holest" replaceWith="Kolest" />
+    <RegEx find="\bhor([au]|om|ov[ia]|ovima)\b" replaceWith="zbor$1" />
+    <RegEx find="\bHor([au]|om|ov[ia]|ovima)\b" replaceWith="Zbor$1" />
+    <RegEx find="hri?šćan" replaceWith="kršćan" />
+    <RegEx find="Hri?šćan" replaceWith="Kršćan" />
+    <RegEx find="[kh]romo[sz]om" replaceWith="kromosom" />
+    <RegEx find="[KH]romo[sz]om" replaceWith="Kromosom" />
+    <RegEx find="hronič" replaceWith="kronič" />
+    <RegEx find="Hronič" replaceWith="Kronič" />
+    <RegEx find="([hH])te([lt])" replaceWith="$1tje$2" />
+    <RegEx find="idja" replaceWith="iđa" />
+    <RegEx find="\b([iI])mać" replaceWith="$1mat ć" />
+    <RegEx find="nostranstv" replaceWith="nozemstv" />
+    <RegEx find="nstikt" replaceWith="nstinkt" />
+    <RegEx find="interesantn" replaceWith="zanimljiv" />
+    <RegEx find="Interesantn" replaceWith="Zanimljiv" />
+    <RegEx find="inuć" replaceWith="inut ć" />
+    <RegEx find="teresova" replaceWith="teresira" />
+    <RegEx find="vjuis" replaceWith="vjuir" />
+    <RegEx find="vjuiše" replaceWith="vjuira" />
+    <RegEx find="vjuišu" replaceWith="vjuiraju" />
+    <RegEx find="ntezivn" replaceWith="ntenzivn" />
+    <RegEx find="([iI])seče" replaceWith="$1zreže" />
+    <RegEx find="spoljava" replaceWith="zražava" />
+    <RegEx find="spovj?e(d|st)" replaceWith="spovije$1" />
+    <RegEx find="zbe([gć])" replaceWith="zbje$1" />
+    <RegEx find="spresj?ecan" replaceWith="spresijecan" />
+    <RegEx find="spri[čć]ać" replaceWith="spričat ć" />
+    <RegEx find="italijan" replaceWith="talijan" />
+    <RegEx find="Italijan" replaceWith="Talijan" />
+    <RegEx find="\b([iI])zmen" replaceWith="$1zmjen" />
+    <RegEx find="([iI])znj?eć" replaceWith="$1znijet ć" />
+    <RegEx find="znj?el" replaceWith="znijel" />
+    <RegEx find="zolova" replaceWith="zolira" />
+    <RegEx find="zume([ltv])" replaceWith="zumje$1" />
+    <RegEx find="zvesn" replaceWith="zvjesn" />
+    <RegEx find="zvinjava([mšojlt]) se" replaceWith="spričava$1 se" />
+    <RegEx find="([iI])zvin[iu]([lo])" replaceWith="$1spriča$2" />
+    <RegEx find="jaket" replaceWith="jakn" />
+    <RegEx find="\b([jJ])agnje" replaceWith="$1anje" />
+    <RegEx find="jereti" replaceWith="hereti" />
+    <RegEx find="Jereti" replaceWith="Hereti" />
+    <RegEx find="jevanđelj" replaceWith="evanđelj" />
+    <RegEx find="\b([kK])af([aeiou]|om|ama|anama|ic[aeiu]|an[aeiuo]|anom|ansk[aeiuo])\b" replaceWith="$1av$2" />
+    <RegEx find="([kK]alib(?:ar|r[aeui]))\. *([0-9])" replaceWith="$1 .$2" />
+    <RegEx find="arantin" replaceWith="aranten" />
+    <RegEx find="kašik" replaceWith="žlic" />
+    <RegEx find="Kašik" replaceWith="Žlic" />
+    <RegEx find="(k[ćč]|[ćč])erk([eio](?!m))" replaceWith="kćeri" />
+    <RegEx find="(K[ćč]|[ĆČ])erk([eio](?!m))" replaceWith="Kćeri" />
+    <RegEx find="\b([kK])[čć]erku\b" replaceWith="$1ćer" />
+    <RegEx find="elner" replaceWith="onobar" />
+    <RegEx find="\bkero?v?([aeiu]|om)\b" replaceWith="ps$1" />
+    <RegEx find="\bKero?v?([aeiu]|om)\b" replaceWith="Ps$1" />
+    <RegEx find="kev([aeiou]|om)\b" replaceWith="majk$1" />
+    <RegEx find="Kev([aeiou]|om)\b" replaceWith="Majk$1" />
+    <RegEx find="kidnapova([otl])" replaceWith="ote$1" />
+    <RegEx find="Kidnapova([otl])" replaceWith="Ote$1" />
+    <RegEx find="kidnapovanj" replaceWith="otimanj" />
+    <RegEx find="Kidnapovanj" replaceWith="Otimanj" />
+    <RegEx find="\bkirij" replaceWith="stanarin" />
+    <RegEx find="Kirij" replaceWith="Stanarin" />
+    <RegEx find="iseonik" replaceWith="isik" />
+    <RegEx find="([kK])lovn" replaceWith="$1laun" />
+    <RegEx find="olj?ev([kc])" replaceWith="olijev$1" />
+    <RegEx find="oleginic" replaceWith="olegic" />
+    <!-- ne vadi iz RegEx -->
+    <RegEx find="komanduj" replaceWith="naređuj" />
+    <RegEx find="inuje" replaceWith="inira" />
+    <RegEx find="binova" replaceWith="binira" />
+     <RegEx find="\b([kKvV])olen" replaceWith="$1oljen" />
+    <RegEx find="komitet" replaceWith="odbor" />
+    <RegEx find="Komitet" replaceWith="Odbor" />
+    <RegEx find="plikuj" replaceWith="plicira" />
+    <!-- kompromitova -->
+    <RegEx find="omitova" replaceWith="omitira" />
+    <RegEx find="komšijsk" replaceWith="susjedn" />
+    <RegEx find="onfor" replaceWith="omfor" />
+    <RegEx find="konkurs" replaceWith="natječaj" />
+    <RegEx find="Konkurs" replaceWith="Natječaj" />
+    <RegEx find="krenuć" replaceWith="krenut ć" />
+    <RegEx find="kuris" replaceWith="kurir" />
+    <RegEx find="roli(sa|še)" replaceWith="rolira" />
+    <RegEx find="([eo])risa" replaceWith="$1rira" />
+    <RegEx find="oristić" replaceWith="oristit ć" />
+    <RegEx find="oriš[ćč]en" replaceWith="orišten" />
+    <RegEx find="([kK])orj?en" replaceWith="$1orijen" />
+    <RegEx find="\b([kK])orp([aei])" replaceWith="$1ošar$2" />
+    <RegEx find="ritikova([olt])" replaceWith="ritizira$1" />
+    <RegEx find="ritikuje" replaceWith="ritizira" />
+    <RegEx find="rofn" replaceWith="rafn" />
+    <RegEx find="rompir" replaceWith="rumpir" />
+    <RegEx find="rstašk" replaceWith="rižarsk" />
+    <RegEx find="([kK])učk" replaceWith="$1uj" />
+    <RegEx find="([kKlL])upić" replaceWith="$1upit ć" />
+    <RegEx find="([kK])uva(?!jt)" replaceWith="$1uha" />
+    <RegEx find="([lL])etnj" replaceWith="$1jetn" />
+    <RegEx find="ezbej" replaceWith="ezbij" />
+    <RegEx find="([lL])j?eči([mštol])" replaceWith="$1iječi$2" />
+    <RegEx find="([lL])j?e[čć]ni([cč])" replaceWith="$1iječni$2" />
+    <RegEx find="([lL])j?e[čć]nik(?!i)" replaceWith="$1iječnik" />
+    <RegEx find="\b([lL])ekar(?![inso])" replaceWith="$1iječnik" />
+    <RegEx find="\b([lL])j?ek([au]|om|ov[aei]|ovima)?\b" replaceWith="$1ijek$2" />
+    <RegEx find="\b([iI]zl|[lL])j?ečen" replaceWith="$1iječen" />
+    <RegEx find="\blenj?([aeiou]|om|osti?|ošću|ima?|čin[aieou]|činama)?\b" replaceWith="lijen$1" />
+    <!-- Lena je englesko ime i zato ne može -->
+    <RegEx find="\bLenj?(om?|osti?|ošću|ima?|čin[aieou]|činama)?\b" replaceWith="Lijen$1" />
+    <RegEx find="\b([lL])j?ep([aeiou]|o[mgj]|ih|ima?)?\b" replaceWith="$1ijep$2" />
+    <RegEx find="([lL])j?epot" replaceWith="$1jepot" />
+    <RegEx find="\b([lL])ep([šil])" replaceWith="$1jep$2" />
+    <RegEx find="\b([lL])ev(?!is)" replaceWith="$1ijev" />
+    <RegEx find="(?&lt;!p)([lL])ete([lt])" replaceWith="$1etje$2" />
+    <!-- ne diraj! [uzletio/razletio/sletio/podletio] -->
+    <RegEx find="([lL])eteo" replaceWith="$1etio" />
+    <RegEx find="\b([lL])eto([ms])" replaceWith="$1jeto$2" />
+    <RegEx find="icemer" replaceWith="icemjer" />
+    <RegEx find="\bličn([aeiou]|im|o[mgj])" replaceWith="osobn$1" />
+    <RegEx find="\bLičn([aeiou]|im|o[mgj])" replaceWith="Osobn$1" />
+    <RegEx find="(?&lt;![kz])obanj" replaceWith="ubanj" />
+    <RegEx find="([lL])ović" replaceWith="$1ovit ć" />
+    <RegEx find="\b([lL])jep([aeiou]|om|oj|ima)\b" replaceWith="$1ijep$2" />
+    <RegEx find="\b([lL])uda([kcč])" replaceWith="$1uđa$2" />
+    <RegEx find="(u|[Pp]re|[sS]vi)deo" replaceWith="$1dio" />
+    <RegEx find="\b([lL])juski" replaceWith="$1judski" />
+    <RegEx find="makaz" replaceWith="škar" />
+    <RegEx find="Makaz" replaceWith="Škar" />
+    <RegEx find="maknil" replaceWith="maknul" />
+    <RegEx find="\bmap(?!ir)" replaceWith="kart" />
+    <RegEx find="\bMap(?!ir)" replaceWith="Kart" />
+    <RegEx find="mator" replaceWith="star" />
+    <RegEx find="Mator" replaceWith="Star" />
+    <RegEx find="\b([mM])er([aou]|i[lt]|e(?!d))" replaceWith="$1jer$2" />
+    <RegEx find="([mM])ese([cč])" replaceWith="$1jese$2" />
+    <RegEx find="\b([mM])est([aoiu])" replaceWith="$1jest$2" />
+    <RegEx find="mešt(?!r)" replaceWith="mješt" />
+    <RegEx find="igracion" replaceWith="igracijsk" />
+    <RegEx find="(is|si)lić" replaceWith="$1lit ć" />
+    <RegEx find="išič" replaceWith="išić" />
+    <RegEx find="([mM])j?ešalic" replaceWith="$1iješalic" />
+    <RegEx find="([mM])j?eša([jmnšo]|n[aio]|no[mgj]|nima?|mo|ju|njem|nj[aeu]|l[aeio]|t[ei])?\b" replaceWith="$1iješa$2" />
+    <RegEx find="([mM])edve([dđ])" replaceWith="$1edvje$2" />
+    <RegEx find="minđuš" replaceWith="naušnic" />
+    <RegEx find="ilij?[ou]n" replaceWith="ilijun" />
+    <RegEx find="(?&lt;![iI]|[kK]a)([mM])j?enja([jmnšo]|mo|njem?|ju|l[aeio]|t[ei])?\b" replaceWith="$1ijenja$2" />
+    <RegEx find="([mM])lj?ek([aou])" replaceWith="$1lijek$2" />
+    <RegEx find="([mM])lj?ečn" replaceWith="$1liječn" />
+    <RegEx find="leven" replaceWith="ljeven" />
+    <RegEx find="([mM])oč([iun])" replaceWith="$1oć$2" />
+    <RegEx find="oguč" replaceWith="oguć" />
+    <RegEx find="([mpsMPS])olić" replaceWith="$1olit ć" />
+    <RegEx find="([mM])orać" replaceWith="$1orat ć" />
+    <RegEx find="otivisa" replaceWith="otivira" />
+    <RegEx find="([mM])rze([šolt])" replaceWith="$1rzi$2" />
+    <RegEx find="rzeć(?!i)" replaceWith="rzit ć" />
+    <RegEx find="([mM])uva([mjovšlt])" replaceWith="$1ota$2" />
+    <RegEx find="([mM])uv([eou])" replaceWith="$1uh$2" />
+    <RegEx find="muzičk" replaceWith="glazben" />
+    <RegEx find="Muzičk" replaceWith="Glazben" />
+    <RegEx find="nabdjeva(?!č)" replaceWith="nabdijeva" />
+    <RegEx find="([nN])aden" replaceWith="$1adjen" />
+    <RegEx find="([nN])amer" replaceWith="$1amjer" />
+    <RegEx find="agovj?est" replaceWith="agovijest" />
+    <RegEx find="ajcijenjen" replaceWith="ajcjenjen" />
+    <RegEx find="\b([nN])amj?en([aeiou])" replaceWith="$1amjen$2" />
+    <RegEx find="\b([nN])amj?eni([mštol])" replaceWith="$1amijeni$2" />
+    <RegEx find="(?&lt;![zZ])amest" replaceWith="amjest" />
+    <RegEx find="([nN])ane([lt])" replaceWith="$1anje$2" />
+    <RegEx find="aočar(?!k)" replaceWith="aočal" />
+    <RegEx find="aran[đd]ž" replaceWith="aranč" />
+    <RegEx find="arudžbin" replaceWith="arudžb" />
+    <RegEx find="([nN])asel([aeio])\b" replaceWith="$1asjel$2" />
+    <RegEx find="([nN]a|[Ii])smej" replaceWith="$1smij" />
+    <RegEx find="asle([dđ])" replaceWith="aslje$1" />
+    <RegEx find="([nN])atera" replaceWith="$1atjera" />
+    <RegEx find="([nN])atj?erać" replaceWith="$1atjerat ć" />
+    <RegEx find="([nN])a(gradi|pravi|tera|uči|zva)ć" replaceWith="$1a$2t ć" />
+    <RegEx find="naučn" replaceWith="znanstven" />
+    <RegEx find="Naučn" replaceWith="Znanstven" />
+    <RegEx find="\b([nN])e[cč]([eu]š?|emo|ete)\b" replaceWith="$1eć$2" />
+    <RegEx find="edelj" replaceWith="edjelj" />
+    <RegEx find="\b([nN])eg([aeu]|om|ama)\b" replaceWith="$1jeg$2" />
+    <RegEx find="\b([nN])ež(an|n[aeiou]|nom|nima)\b" replaceWith="$1jež$2" />
+    <RegEx find="(?&lt;!j)emačk" replaceWith="jemačk" />
+    <RegEx find="[nN]j?em(?=a?c)" replaceWith="Nijem" />
+    <RegEx find="emo[zž]e" replaceWith="e može" />
+    <RegEx find="eprijat(?!e)" replaceWith="eugod" />
+    <RegEx find="erj?ešen" replaceWith="eriješen" />
+    <RegEx find="nerv(?![no])" replaceWith="živc" />
+    <RegEx find="Nerv(?![no])" replaceWith="Živc" />
+    <RegEx find="nervn" replaceWith="živčan" />
+    <RegEx find="Nervn" replaceWith="Živčan" />
+    <RegEx find="esmij" replaceWith="e smij" />
+    <RegEx find="esre[cćč]n" replaceWith="esretn" />
+    <RegEx find="esvj?est" replaceWith="esvijest" />
+    <RegEx find="(?&lt;!mhv)ališ[eu]" replaceWith="alizira" />
+    <RegEx find="([nN])ezna(?![bčlnt])" replaceWith="$1e zna" />
+    <RegEx find="([nN])ežn" replaceWith="$1ježn" />
+    <RegEx find="\b([nN])oč([iu]|n[aeiou]|no[mjg]|nim)?" replaceWith="$1oć$2" />
+    <RegEx find="\b([oO])dbra" replaceWith="$1bra" />
+    <RegEx find="bavj?est" replaceWith="bavijest" />
+    <RegEx find="belod" replaceWith="bjelod" />
+    <RegEx find="bešen" replaceWith="bješen" />
+    <RegEx find="bezbj?edi" replaceWith="sigura" />
+    <RegEx find="bezbj?eđen" replaceWith="siguran" />
+    <RegEx find="bezbijeđenj" replaceWith="siguranj" />
+    <RegEx find="bezbeđivanj([aeu]|ima)" replaceWith="siguravanj$1" />
+    <RegEx find="bezbj?eđuje" replaceWith="sigurava" />
+    <RegEx find="brača" replaceWith="braća" />
+    <RegEx find="\b([oO])deć" replaceWith="$1djeć" />
+    <RegEx find="([oO])dj?eljenj(?!e)" replaceWith="$1djel" />
+    <RegEx find="dgaji" replaceWith="dgoji" />
+    <RegEx find="\b([oO])dj?elo" replaceWith="$1dijelo" />
+    <RegEx find="\b([oO])dnje(l[aeio]|t|t[ei])\b" replaceWith="$1odnije$2" />
+    <RegEx find="\b([oO]|[pP]o|[rR]a|[sS]a)(d?)se([cć])" replaceWith="$1$2sje$3" />
+    <RegEx find="dvešć" replaceWith="dvest ć" />
+    <RegEx find="oficir(?!s)" replaceWith="časnik" />
+    <RegEx find="oficirs" replaceWith="časnič" />
+    <RegEx find="gladne([lvt])" replaceWith="gladnje$1" />
+    <RegEx find="kean" replaceWith="cean" />
+    <RegEx find="\bokvasi" replaceWith="smoči" />
+    <RegEx find="pklad" replaceWith="klad" />
+    <RegEx find="(?&lt;![mdp])ostić" replaceWith="ostit ć" />
+    <RegEx find="psedn" replaceWith="psjedn" />
+    <RegEx find="(?&lt;!d)([oO])pšt" replaceWith="$1pć" />
+    <RegEx find="\b([oO])rman" replaceWith="$1rmar" />
+    <RegEx find="ortova([lt])" replaceWith="ortira$1" />
+    <RegEx find="ružij" replaceWith="ružj" />
+    <RegEx find="([oO])set" replaceWith="$1sjet" />
+    <RegEx find="(?&lt;![dDPp]rv?)([oO])si?j?e[ćč]a" replaceWith="$1sjeća" />
+    <RegEx find="slobodić" replaceWith="slobodit ć" />
+    <RegEx find="([oOuU])sta[čć]" replaceWith="$1stat ć" />
+    <RegEx find="otadžbin" replaceWith="domovin" />
+    <RegEx find="Otadžbin" replaceWith="Domovin" />
+    <RegEx find="\b([oO])teć(?!i)" replaceWith="$1tet ć" />
+    <RegEx find="\b([oOsSuU])tera" replaceWith="$1tjera" />
+    <RegEx find="([oO])tmen" replaceWith="$1tmjen" />
+    <RegEx find="ovaploćenj" replaceWith="utjelovljenj" />
+    <RegEx find="Ovaploćenj" replaceWith="Utjelovljenj" />
+    <RegEx find="vlaš[cćč]en" replaceWith="vlašten" />
+    <RegEx find="ozbir" replaceWith="obzir" />
+    <RegEx find="\b([oO])zli?j?ed([aeiu]|om|ama)\b" replaceWith="$1zljed$2" />
+    <RegEx find="\b([oO])zlj?edi([moštl])" replaceWith="$1zlijedi$2" />
+    <RegEx find="zleđen" replaceWith="zlijeđen" />
+    <RegEx find="acj?ent" replaceWith="acijent" />
+    <RegEx find="pacov" replaceWith="štakor" />
+    <RegEx find="Pacov" replaceWith="Štakor" />
+    <RegEx find="(?&lt;!\b[zZ]apre)([pP])ašć([eu])" replaceWith="$1ast ć$2" />
+    <RegEx find="([pP])esni(?!c)" replaceWith="$1jesni" />
+    <RegEx find="\b([pP])j?es([ak](?!m))" replaceWith="$1ijes$2" />
+    <RegEx find="\b([pP])j?eš[čć]an" replaceWith="$1ješčan" />
+    <RegEx find="([pP])e(sm|ša)" replaceWith="$1je$2" />
+    <RegEx find="peškir(?!i(ma)?\b)" replaceWith="ručnik" />
+    <RegEx find="Peškir(?!i(ma)?\b)" replaceWith="Ručnik" />
+    <RegEx find="peškir(?=i(ma)?\b)" replaceWith="ručnic" />
+    <RegEx find="Peškir(?=i(ma)?\b)" replaceWith="Ručnic" />
+    <RegEx find="([pP])eva" replaceWith="$1jeva" />
+    <RegEx find="\bpijac" replaceWith="tržnic" />
+    <RegEx find="Pijac" replaceWith="Tržnic" />
+    <RegEx find="([pP])(ita|lati|obrinu|okaza|oveza|riča)ć" replaceWith="$1$2t ć" />
+    <RegEx find="\b([pP])lj?en\b" replaceWith="$1lijen" />
+    <RegEx find="\b([pP])lj?en([au]|om)\b" replaceWith="$1lijen$2" />
+    <RegEx find="([pP])luč([an])" replaceWith="$1luć$2" />
+    <RegEx find="\b([pP])obj?edi([mštol])" replaceWith="$1obijedi$2" />
+    <RegEx find="([pP])obe([đgć])" replaceWith="$1obje$2" />
+    <RegEx find="očastvovan" replaceWith="očašćen" />
+    <RegEx find="odst(ica|ak)" replaceWith="ot$1" />
+    <RegEx find="([pP])o[dt]stič" replaceWith="$1otič" />
+    <RegEx find="\b([pP])o[dt]sj?eti([šmo]|l[aieo]|t[ei])?\b" replaceWith="$1odsjeti$2" />
+    <RegEx find="([dDpP])odel" replaceWith="$1odjel" />
+    <RegEx find="([dDpP])odj?eli([lto])" replaceWith="$1odijeli$2" />
+    <RegEx find="odretl" replaceWith="orijekl" />
+    <RegEx find="(?&lt;![mn])o(d?)se([kć])(?!s)" replaceWith="o$1sje$2" />
+    <RegEx find="odu?hvat" replaceWith="othvat" />
+    <RegEx find="(?&lt;!r)oent" replaceWith="oant" />
+    <RegEx find="([pP])ogrj?eši(?!v)" replaceWith="$1ogriješi" />
+    <RegEx find="([pP])olen" replaceWith="$1elud" />
+    <RegEx find="lude([lt])" replaceWith="ludje$1" />
+    <RegEx find="([pP]o|[iI]z)ludeć" replaceWith="$1ludjet ć" />
+    <RegEx find="ludj?eo" replaceWith="ludio" />
+    <RegEx find="pomarandž" replaceWith="naranč" />
+    <RegEx find="\bpomen" replaceWith="spomen" />
+    <RegEx find="\bPomen" replaceWith="Spomen" />
+    <RegEx find="pomera([mšt])" replaceWith="miče$1" />
+    <RegEx find="Pomera([mšt])" replaceWith="Miče$1" />
+    <RegEx find="pomeren" replaceWith="pomaknut" />
+    <RegEx find="([pP])omj?eri" replaceWith="$1omakni" />
+    <RegEx find="([pP])omoč" replaceWith="$1omoć" />
+    <RegEx find="([pP])oresk" replaceWith="$1orezn" />
+    <RegEx find="porodičn" replaceWith="obiteljsk" />
+    <RegEx find="Porodičn" replaceWith="Obiteljsk" />
+    <RegEx find="([pP])os([lt])a[čć]" replaceWith="$1os$2at ć" />
+    <RegEx find="([pP])os(l?)e([dt])" replaceWith="$1os$2je$3" />
+    <RegEx find="([pP])osmatra" replaceWith="$1romatra" />
+    <RegEx find="([pP])ose([td])" replaceWith="$1osje$2" />
+    <RegEx find="otcenjiva" replaceWith="odcjenjiva" />
+    <RegEx find="([pP])oter" replaceWith="$1otjer" />
+    <RegEx find="ovinuje" replaceWith="okorava" />
+    <RegEx find="vrj?edi([lomšt])" replaceWith="vrijedi$1" />
+    <RegEx find="([pP]r?)over" replaceWith="$1ovjer" />
+    <RegEx find="([uUo])ver(en|lji)" replaceWith="$1vjer$2" />
+    <RegEx find="pozoriš" replaceWith="kazališ" />
+    <RegEx find="Pozoriš" replaceWith="Kazališ" />
+    <RegEx find="raktikuje" replaceWith="rakticira" />
+    <RegEx find="rebić" replaceWith="rebit ć" />
+    <RegEx find="reci?j?edni" replaceWith="redsjedni" />
+    <RegEx find="redsedni" replaceWith="redsjedni" />
+    <RegEx find="rj?edlo([gz])" replaceWith="rijedlo$1" />
+    <RegEx find="repostav" replaceWith="retpostav" />
+    <RegEx find="ređaš" replaceWith="rijaš" />
+    <RegEx find="premić" replaceWith="premit ć" />
+    <RegEx find="renje([lt])" replaceWith="renije$1" />
+    <RegEx find="rese([čk])" replaceWith="resje$1" />
+    <RegEx find="([pP])r([oe])ter" replaceWith="$1r$2tjer" />
+    <RegEx find="([pP])rets" replaceWith="$1reds" />
+    <RegEx find="prevazi" replaceWith="nadi" />
+    <RegEx find="Prevazi" replaceWith="Nadi" />
+    <RegEx find="ridik" replaceWith="rodik" />
+    <RegEx find="rihvata" replaceWith="rihvaća" />
+    <RegEx find="prijatn" replaceWith="ugodn" />
+    <RegEx find="Prijatn" replaceWith="Ugodn" />
+    <RegEx find="([pP])rimj?en([ji])" replaceWith="$1rimijen$2" />
+    <RegEx find="([pP])(r?)([io])veš[čć]" replaceWith="$1$2$3vest ć" />
+    <RegEx find="rj?edlog([au]|om)?\b" replaceWith="rijedlog$1" />
+    <RegEx find="rijtelj" replaceWith="rijatelj" />
+    <RegEx find="(ri|[Ss])tiskaj" replaceWith="$1tišći" />
+    <RegEx find="rj?estupni([kc])([aeu]|om)\b" replaceWith="rijestupni$1$2" />
+    <RegEx find="\b([pP])rj?evoz([aiu]|om)?\b" replaceWith="$1rijevoz$2" />
+    <RegEx find="\b([pP])rj?etnj" replaceWith="$1rijetnj" />
+    <RegEx find="rimi?j?ećuj" replaceWith="rimjećuj" />
+    <RegEx find="\b([pP])rimj?e(ćen|ćen[aeiou]|tio?|til[aeio]|njen|šati|šan|[st]iti)\b" replaceWith="$1rimije$2" />
+    <RegEx find="([pP])rime([rn])" replaceWith="$1rimje$2" />
+    <RegEx find="\b([pP])rimet([aln])" replaceWith="$1rimjet$2" />
+    <RegEx find="([pP])rimj?et([ie])" replaceWith="$1rimijet$2" />
+    <RegEx find="\b([pP])rimj?eni([lošmt])" replaceWith="$1rimijeni$2" />
+    <RegEx find="([pP])(ri|od)sj?e[čć]a" replaceWith="$1$2sjeća" />
+    <RegEx find="\b([pP])rocen(?!t)" replaceWith="$1rocjen" />
+    <RegEx find="([pP])rose([kcč])" replaceWith="$1rosje$2" />
+    <RegEx find="([pP])romj?eni([mštol])" replaceWith="$1romijeni$2" />
+    <RegEx find="([pP])rj?eti([mštol])" replaceWith="$1rijeti$2" />
+    <RegEx find="r[io]davnic" replaceWith="rodavaonic" />
+    <RegEx find="roglašuje" replaceWith="roglašava" />
+    <RegEx find="roklestv" replaceWith="rokletstv" />
+    <RegEx find="([pP])role(ć|t[no])" replaceWith="$1rolje$2" />
+    <RegEx find="romen(?!ad)" replaceWith="romjen" />
+    <RegEx find="([pP])romj?eni([mštl])" replaceWith="$1romijeni$2" />
+    <RegEx find="([pP])rotiv([adkoprstz])" replaceWith="$1rotu$2" />
+    <RegEx find="rovid([an])" replaceWith="rozir$1" />
+    <RegEx find="rovj?erić" replaceWith="rovjerit ć" />
+    <RegEx find="punić" replaceWith="punit ć" />
+    <RegEx find="ustić(?!i)" replaceWith="ustit ć" />
+    <RegEx find="put[ae]?r" replaceWith="maslac" />
+    <RegEx find="Put[ae]?r" replaceWith="Maslac" />
+    <RegEx find="(?&lt;!g)([rR])a([dn])ić([eu])" replaceWith="$1a$2it ć$3" />
+    <RegEx find="atosilja" replaceWith="iješi" />
+    <RegEx find="azme([nr])" replaceWith="azmje$1" />
+    <RegEx find="azumi?j?eć" replaceWith="azumjet ć" />
+    <RegEx find="azumi?j?eo" replaceWith="azumio" />
+    <RegEx find="([rR])azumj?e([mšv]|te)" replaceWith="$1azumije$2" />
+    <RegEx find="aznj?e([lt])" replaceWith="aznije$1" />
+    <RegEx find="aznj?eo" replaceWith="aznio" />
+    <RegEx find="eag(uje|ova)" replaceWith="eagira" />
+    <RegEx find="eaguju" replaceWith="eagiraju" />
+    <RegEx find="([rRlL])e[čć]ić([eu])" replaceWith="$1eći ć$2" />
+    <RegEx find="egistrova" replaceWith="egistrira" />
+    <RegEx find="(?&lt;!r)ištić" replaceWith="ištit ć" />
+    <RegEx find="([rR])editelj" replaceWith="$1edatelj" />
+    <RegEx find="egulis" replaceWith="egulir" />
+    <RegEx find="reme([sš])t" replaceWith="remje$1t" />
+    <RegEx find="eskira" replaceWith="iskira" />
+    <RegEx find="\b([rR])i?j?ešava" replaceWith="$1ješava" />
+    <RegEx find="(?&lt;!k)amj?enjen" replaceWith="amijenjen" />
+    <RegEx find="mjenjen" replaceWith="mijenjen" />
+    <RegEx find="izik(ova|uje)" replaceWith="iskira" />
+    <RegEx find="([^d])rješit" replaceWith="$1riješit" />
+    <RegEx find="([Rr])j?ešić" replaceWith="$1iješit ć" />
+    <RegEx find="([rR])i?j?ešenj([aeiu])" replaceWith="$1ješenj$2" />
+    <RegEx find="\b([rR])j?eč(i|ima)?\b" replaceWith="$1iječ$2" />
+    <RegEx find="\b([rR])i?j?ečni([kcč])" replaceWith="$1ječni$2" />
+    <RegEx find="\b([rR])j?ek([aeu]|om|ama)\b" replaceWith="$1ijek$2" />
+    <RegEx find="\b([rR])j?eš([ei]o?|il[aeio]|it[ei]|imo?|i[mš]|en|en[aeiou])\b" replaceWith="$1iješ$2" />
+    <RegEx find="\b([rR])j?etk([aiou])" replaceWith="$1ijetk$2" />
+    <RegEx find="sačeka" replaceWith="pričeka" />
+    <RegEx find="Sačeka" replaceWith="Pričeka" />
+    <RegEx find="aglasno" replaceWith="uglasno" />
+    <RegEx find="\bsam sam\b" replaceWith="sam sâm" />
+    <RegEx find="amoubic" replaceWith="amoubojic" />
+    <RegEx find="\bsanti" replaceWith="centi" />
+    <RegEx find="saobraćaj(?![ac])" replaceWith="promet" />
+    <RegEx find="Saobraćaj(?![ac])" replaceWith="Promet" />
+    <RegEx find="aosj?e[čć]a" replaceWith="uosjeća" />
+    <RegEx find="aputni" replaceWith="uputni" />
+    <RegEx find="([sS])ara([dđ])" replaceWith="$1ura$2" />
+    <RegEx find="([sS])atan" replaceWith="$1oton" />
+    <RegEx find="učesni" replaceWith="sudioni" />
+    <RegEx find="Učesni" replaceWith="Sudioni" />
+    <RegEx find="([sS])avi?j?e([sš])" replaceWith="$1avje$2" />
+    <RegEx find="\b([sSzZ])avet" replaceWith="$1avjet" />
+    <RegEx find="avremen" replaceWith="uvremen" />
+    <RegEx find="(aža|k)lj?eva" replaceWith="$1lijeva" />
+    <RegEx find="\b([sS])ed([ei]|i[mš]|imo|it[ei]|eć[iaeu]|il[aeio]|iše)\b" replaceWith="$1jed$2" />
+    <RegEx find="\b([sS])e[ćč]a([mšo]|mo|t[ei]|ju|l[aeio]|nj[aeu]|njem?)?\b" replaceWith="$1jeća$2" />
+    <RegEx find="([sS])ede([olt])" replaceWith="$1jedi$2" />
+    <RegEx find="([sS])j?ed[ei]ć(?!i)" replaceWith="$1jedit ć" />
+    <RegEx find="sedmičn" replaceWith="tjedn" />
+    <RegEx find="Sedmičn" replaceWith="Tjedn" />
+    <RegEx find="([sS])edn([eui])" replaceWith="$1jedn$2" />
+    <RegEx find="([sS])ekir(?!a)" replaceWith="$1jekir" />
+    <RegEx find="\b([sS])enk?([aeiou]|om|ci)\b" replaceWith="$1jen$2" />
+    <RegEx find="\b([sS])eti([hšmo]|mo|l[aeio]|še|vši|t[ei])?\b" replaceWith="$1jeti$2" />
+    <RegEx find="([sS])ever" replaceWith="$1jever" />
+    <RegEx find="\b([sS])emen" replaceWith="$1jemen" />
+    <RegEx find="([sS])h?vata" replaceWith="$1hvaća" />
+    <RegEx find="h?vati[čćc]" replaceWith="hvatit ć" />
+    <RegEx find="\b([sS])istem(?!s)" replaceWith="$1ustav" />
+    <RegEx find="([sS])kuv" replaceWith="$1kuh" />
+    <RegEx find="lj?etanj" replaceWith="lijetanj" />
+    <RegEx find="li?j?edbeni" replaceWith="ljedbeni" />
+    <RegEx find="([sS])li?j?edeć" replaceWith="$1ljedeć" />
+    <RegEx find="\b([sS])lj?e([dp])([aeiuo]|o[mgj]|i[mš]|imo|it[ei]|il[aeio]|ac|c[aeiu]|cem)?\b" replaceWith="$1lije$2$3" />
+    <RegEx find="edoslj?ed" replaceWith="edoslijed" />
+    <RegEx find="smara(?!g)" replaceWith="gnjavi" />
+    <RegEx find="Smara(?!g)" replaceWith="Gnjavi" />
+    <RegEx find="\b([sS])men([aeiu]|ama)\b" replaceWith="$1mjen$2" />
+    <RegEx find="([sS])mj?eh([au]|om)?\b" replaceWith="$1mijeh$2" />
+    <RegEx find="me[ćč]ar" replaceWith="metlar" />
+    <RegEx find="\b([sS])mj?e([mš]|mo|t[ei]|šn[aeiou]|šno[mgj]|ima?)\b" replaceWith="$1mije$2" />
+    <RegEx find="\b([sS])mej([aeu])" replaceWith="$1mij$2" />
+    <RegEx find="\b([sS])mer" replaceWith="$1mjer" />
+    <RegEx find="([sS])mes(?!t)" replaceWith="$1mjes" />
+    <RegEx find="([sS])mesti([šmolt])" replaceWith="$1mjesti$2" />
+    <RegEx find="([sS])mj?eš([en])" replaceWith="$1miješ$2" />
+    <RegEx find="([sS])nj?eg([au]|om|ovima)?\b" replaceWith="$1nijeg$2" />
+    <RegEx find="sopstven" replaceWith="vlastit" />
+    <RegEx find="Sopstven" replaceWith="Vlastit" />
+    <RegEx find="\b([sS]?)([PphH])akova" replaceWith="$1$2akira" />
+    <RegEx find="pasava" replaceWith="pašava" />
+    <RegEx find="pelova" replaceWith="rica" />
+    <RegEx find="([sS])pase(\b|[mšt])" replaceWith="$1pasi$2" />
+    <RegEx find="([sS])pasen(?!j)" replaceWith="$1pašen" />
+    <RegEx find="spolja?š?nj?" replaceWith="vanjsk" />
+    <RegEx find="Spolja?š?nj?" replaceWith="Vanjsk" />
+    <RegEx find="portist" replaceWith="portaš" />
+    <RegEx find="\bsprat" replaceWith="kat" />
+    <RegEx find="\bSprat" replaceWith="Kat" />
+    <RegEx find="pri?j?ečava" replaceWith="prječava" />
+    <RegEx find="prj?eči" replaceWith="priječi" />
+    <RegEx find="prj?eče" replaceWith="priječe" />
+    <RegEx find="([sS])reč" replaceWith="$1reć" />
+    <RegEx find="([sS])re[cčć](a?)n" replaceWith="$1ret$2n" />
+    <RegEx find="\b([sS])rj?ed([au]|om|ama)\b" replaceWith="$1rijed$2" />
+    <RegEx find="\b([sS])ta[čć]([eu])" replaceWith="$1tat ć$2" />
+    <RegEx find="tavr" replaceWith="tvar" />
+    <RegEx find="\b([sS])tj?en([aeu])" replaceWith="$1tijen$2" />
+    <RegEx find="\b([sSuU])tica" replaceWith="$1tjeca" />
+    <RegEx find="stomak" replaceWith="trbuh" />
+    <RegEx find="Stomak" replaceWith="Trbuh" />
+    <RegEx find="stomačn" replaceWith="trbušn" />
+    <RegEx find="Stomačn" replaceWith="Trbušn" />
+    <RegEx find="\b([sS])trj?el([aeouc]|i(?!c[aeiou]))" replaceWith="$1trijel$2" />
+    <RegEx find="sugeriše" replaceWith="predlaže" />
+    <RegEx find="Sugeriše" replaceWith="Predlaže" />
+    <RegEx find="sujever" replaceWith="praznovjer" />
+    <RegEx find="Sujever" replaceWith="Praznovjer" />
+    <RegEx find="([sS])umlj" replaceWith="$1umnj" />
+    <RegEx find="unđer" replaceWith="pužva" />
+    <RegEx find="used" replaceWith="usjed" />
+    <RegEx find="\b([sS])uv([aeiou])\b" replaceWith="$1uh$2" />
+    <RegEx find="suštin[eio]" replaceWith="biti" />
+    <RegEx find="Suštin[eio]" replaceWith="Biti" />
+    <RegEx find="vedo([čkc])" replaceWith="vjedo$1" />
+    <RegEx find="([sS])vesn" replaceWith="$1vjesn" />
+    <!-- razlikuju se svjetlo i svijetlo no tu automatske pomoći nema, već je na korisnicima da dodaju i gdje je potrebno! -->
+    <RegEx find="\b([sS])vetl" replaceWith="$1vjetl" />
+    <RegEx find="\b([sS])vešteni" replaceWith="$1većeni" />
+    <RegEx find="([sS])vež([aeiu]|e[mg]|[io]m|oj|in[aeiou]|inom)?\b" replaceWith="$1vjež$2" />
+    <RegEx find="\b([sS])vj?et([au]|om)?\b(?!\s+([A-ZČĐŠŽ]|vod|stvari?|čovj?ek|pism|zemlj))" replaceWith="$1vijet$2" />
+    <RegEx find="([sS])vi?j?etsk" replaceWith="$1vjetsk" />
+    <RegEx find="šar?garep" replaceWith="mrkv" />
+    <RegEx find="Šar?garep" replaceWith="Mrkv" />
+    <RegEx find="([šŠ])ečer" replaceWith="$1ećer" />
+    <RegEx find="([šŠ])olj" replaceWith="$1alic" />
+    <RegEx find="štab" replaceWith="stožer" />
+    <RegEx find="Štab" replaceWith="Stožer" />
+    <RegEx find="štamparsk" replaceWith="tiskovn" />
+    <RegEx find="Štamparsk" replaceWith="Tiskovn" />
+    <RegEx find="takmičenj" replaceWith="natjecanj" />
+    <RegEx find="Takmičenj" replaceWith="Natjecanj" />
+    <RegEx find="\b([tT])ač([ank])" replaceWith="$1oč$2" />
+    <RegEx find="\b([nN])etač" replaceWith="$1etoč" />
+    <RegEx find="talasn" replaceWith="valn" />
+    <RegEx find="lentov" replaceWith="lentir" />
+    <RegEx find="anjir" replaceWith="anjur" />
+    <RegEx find="\b([tT])j?el([aiou])" replaceWith="$1ijel$2" />
+    <RegEx find="\b([tT])elesn" replaceWith="$1jelesn" />
+    <RegEx find="\b([tT])era([mnjoš]|mo|ju|l[aeio]|še|t[ei])?\b" replaceWith="$1jera$2" />
+    <RegEx find="([^\Wi])terati\b" replaceWith="$1tjerati" />
+    <RegEx find="([tT])erać" replaceWith="$1jerat ć" />
+    <RegEx find="([tT])e?rba" replaceWith="$1reba" />
+    <RegEx find="tester" replaceWith="pil" />
+    <RegEx find="Tester" replaceWith="Pil" />
+    <RegEx find="\b([tT])j?esn([aeiou])" replaceWith="$1ijesn$2" />
+    <RegEx find="točkov" replaceWith="kotač" />
+    <RegEx find="\b([tT])okom(?!\s+ri?j?eke)" replaceWith="$1ijekom" />
+    <RegEx find="oplot(?!n)" replaceWith="oplin" />
+    <RegEx find="([tT])raći" replaceWith="$1rati" />
+    <RegEx find="([tT])ra([jg]a|ži)ć" replaceWith="$1ra$2t ć" />
+    <RegEx find="([tT])rj?eza" replaceWith="$1rijeza" />
+    <RegEx find="\b([tT])rpe([lt])" replaceWith="$1rpje$2" />
+    <RegEx find="retrpe([lt])" replaceWith="retrpje$1" />
+    <RegEx find="trudni([lt])" replaceWith="trudnje$1" />
+    <RegEx find="([tT])ržn(?!ic)" replaceWith="$1rgovačk" />
+    <RegEx find="([uU])bi?j?edi" replaceWith="$1vjeri" />
+    <RegEx find="bj?edljiv" replaceWith="vjerljiv" />
+    <RegEx find="bi?j?eđen" replaceWith="vjeren" />
+    <RegEx find="bj?eđivanj" replaceWith="vjeravanj" />
+    <RegEx find="\b([uU])bic" replaceWith="$1bojic" />
+    <RegEx find="(?&lt;!l)([Uu])([bd])ić" replaceWith="$1$2it ć" />
+    <RegEx find="(?&lt;![Kk])([uU])bist" replaceWith="$1bojst" />
+    <RegEx find="ucać" replaceWith="ucat ć" />
+    <RegEx find="\b([uUoO])cen" replaceWith="$1cjen" />
+    <RegEx find="učestv" replaceWith="sudjel" />
+    <RegEx find="Učestv" replaceWith="Sudjel" />
+    <RegEx find="\b([uU])ćut" replaceWith="$1šut" />
+    <RegEx find="\b([uU])davi" replaceWith="$1topi" />
+    <RegEx find="([uU])logova" replaceWith="$1logira" />
+    <RegEx find="([uU])mešan" replaceWith="$1mješan" />
+    <RegEx find="([uU])metni([kcč])" replaceWith="$1mjetni$2" />
+    <RegEx find="([uU])metno" replaceWith="$1mjetno" />
+    <RegEx find="([uU])mrj?eć" replaceWith="$1mrijet ć" />
+    <RegEx find="\b([uU])nj?e([lt])" replaceWith="$1nije$2" />
+    <RegEx find="\b([uU]?)([nN])aprj?ed\b" replaceWith="$1$2aprijed" />
+    <RegEx find="([uU])pore" replaceWith="$1spore" />
+    <RegEx find="([uU])potrj?ebi([štol])" replaceWith="$1potrijebi$2" />
+    <RegEx find="propa[sš][čćc]ava" replaceWith="propaštava" />
+    <RegEx find="([uU])radić" replaceWith="$1činit ć" />
+    <RegEx find="ezuslov" replaceWith="ezuvjet" />
+    <RegEx find="\b([uU])slov" replaceWith="$1vjet" />
+    <RegEx find="([uU])smer([aie])" replaceWith="$1smjer$2" />
+    <RegEx find="spi?j?e(h|si)" replaceWith="spje$1" />
+    <RegEx find="spi?j?eš([an]|n[aeiou])" replaceWith="spješ$1" />
+    <RegEx find="\b([uU])spe([lt])" replaceWith="$1spje$2" />
+    <RegEx find="\b([uU])spj?e(mo?|va[mšt]?)\b" replaceWith="$1spije$2" />
+    <RegEx find="sred?sre[dđ]" replaceWith="sredotoč" />
+    <RegEx find="([uU])strj?el" replaceWith="$1strijel" />
+    <RegEx find="\b([uU])te([hš])" replaceWith="$1tje$2" />
+    <RegEx find="univerzum" replaceWith="svemir" />
+    <RegEx find="Univerzum" replaceWith="Svemir" />
+    <RegEx find="\buskrs([aeiu]|om|ima)?\b" replaceWith="Uskrs$1" />
+    <RegEx find="([uU])tiče" replaceWith="$1tječe" />
+    <RegEx find="\b([uU])ver([aeil])" replaceWith="$1vjer$2" />
+    <RegEx find="\b([uUcC])vet([aeiu]|om|ima|n[aeiou]|nima?|no[mgj])?\b" replaceWith="$1vjet$2" />
+    <RegEx find="\b([uU])zeć" replaceWith="$1zet ć" />
+    <RegEx find="([uU])zok" replaceWith="$1zrok" />
+    <RegEx find="vajarstv" replaceWith="kiparstv" />
+    <RegEx find="Vajarstv" replaceWith="Kiparstv" />
+    <RegEx find="vakcinira" replaceWith="cijepi" />
+    <RegEx find="Vakcinira" replaceWith="Cijepi" />
+    <RegEx find="(?&lt;!z)vanred" replaceWith="izvanred" />
+    <RegEx find="(?&lt;!z)Vanred" replaceWith="Izvanred" />
+    <RegEx find="varać" replaceWith="varat ć" />
+    <RegEx find="\bvarvar" replaceWith="barbar" />
+    <RegEx find="\bVarvar" replaceWith="Barbar" />
+    <RegEx find="vaskrsn" replaceWith="uskrns" />
+    <RegEx find="Vaskrsn" replaceWith="Uskrns" />
+    <RegEx find="vaspitan" replaceWith="obrazovan" />
+    <RegEx find="Vaspitan" replaceWith="Obrazovan" />
+    <RegEx find="vaspitn" replaceWith="obrazovn" />
+    <RegEx find="Vaspitn" replaceWith="Obrazovn" />
+    <RegEx find="vazduh" replaceWith="zrak" />
+    <RegEx find="Vazduh" replaceWith="Zrak" />
+    <RegEx find="vazdušn" replaceWith="zračn" />
+    <RegEx find="Vazdušn" replaceWith="Zračn" />
+    <!-- bez e, jer mijenja veče(r) u veće, što je gnjavaža -->
+    <RegEx find="\b([vV])eč([aiu]|[ei][mg]|ih|ima|in[iu]|inom|o[mj])?\b" replaceWith="$1eć$2" />
+    <RegEx find="([vV])e[čć]n" replaceWith="$1ječn" />
+    <RegEx find="([vV])ečit" replaceWith="$1ječit" />
+    <RegEx find="([vV])enča" replaceWith="$1jenča" />
+    <RegEx find="\b([vV])er([ova|ns])" replaceWith="$1jer$2" />
+    <RegEx find="([nN])ever(?!b)" replaceWith="$1evjer" />
+    <RegEx find="([vV])erova" replaceWith="$1jerova" />
+    <RegEx find="([vV])j?ero[vj]at(a?)n" replaceWith="$1jerojat$2n" />
+    <RegEx find="([vV])eruj" replaceWith="$1jeruj" />
+    <RegEx find="\bvereni([ckč])" replaceWith="zaručni$1" />
+    <RegEx find="\bVereni([ckč])" replaceWith="Zaručni$1" />
+    <RegEx find="([vV])ešanj" replaceWith="$1ješanj" />
+    <RegEx find="([vV])ešt" replaceWith="$1ješt" />
+    <RegEx find="\b([vV])j?en(ac|c[aeiu]m?)" replaceWith="$1ijen$2" />
+    <RegEx find="vj?eštačk" replaceWith="umjetn" />
+    <RegEx find="Vj?eštačk" replaceWith="Umjetn" />
+    <RegEx find="([vV])et(ar|r[aeuo])" replaceWith="$1jet$2" />
+    <RegEx find="([vV])ever" replaceWith="$1jever" />
+    <RegEx find="([vV])ežb" replaceWith="$1ježb" />
+    <RegEx find="([vV])ide([hlt])" replaceWith="$1idje$2" />
+    <RegEx find="([vVTt])idj?eć(?!i)" replaceWith="$1idjet ć" />
+    <RegEx find="([vV])ideo(?!zapis|tek[aiue]|\s+(ka[zs]et[aeiu]|igri?c?[aeiou]|snim[kc]|trgovin[aeoiu]))\b" replaceWith="$1idio" />
+    <RegEx find="\b([vV])išlj" replaceWith="$1iš" />
+    <RegEx find="([vV])olj?eć" replaceWith="$1oljet ć" />
+    <RegEx find="\b([vV])oz([au]|om|ov[ie]|ovima)?\b" replaceWith="$1lak$2" />
+    <RegEx find="\b([vV])ozi[čć]([eu])" replaceWith="$1ozit ć$2" />
+    <RegEx find="\b([vV])rj?ed(e|an|n[aeiou]|nih|nosti?|nošću)?\b" replaceWith="$1rijed$2" />
+    <RegEx find="\b([vV])red([ei])" replaceWith="$1rijed$2" />
+    <RegEx find="([vV])rj?eđa" replaceWith="$1rijeđa" />
+    <RegEx find="vređen" replaceWith="vrijeđen" />
+    <RegEx find="([vV])rtel" replaceWith="$1rtjel" />
+    <RegEx find="ahtjeva([ojlmšt])" replaceWith="ahtijeva$1" />
+    <RegEx find="ahtev([aeioun])" replaceWith="ahtjev$1" />
+    <RegEx find="([zZ])amen" replaceWith="$1amjen" />
+    <RegEx find="(?&lt;!k)amenj(uj|iv)" replaceWith="amjenj$1" />
+    <RegEx find="\b([zZnN]a[mv])er" replaceWith="$1jer" />
+    <RegEx find="([zZ])amj?eni([šmo]|mo|t[mš]|l[aeio]|še)?\b" replaceWith="$1amijeni$2" />
+    <RegEx find="\b([zZ])ane([lt])" replaceWith="$1anje$2" />
+    <RegEx find="apoved" replaceWith="apovjed" />
+    <RegEx find="apovj?est" replaceWith="apovijed" />
+    <RegEx find="zasmej" replaceWith="nasmij" />
+    <RegEx find="([zZ])ave([rs])([aeuo])" replaceWith="$1avje$2$3" />
+    <RegEx find="\bzavis([ni])" replaceWith="ovis$1" />
+    <RegEx find="\bZavis([ni])" replaceWith="Ovis$1" />
+    <RegEx find="\b([zZ])eva" replaceWith="$1ijeva" />
+    <RegEx find="zvaničn" replaceWith="služben" />
+    <RegEx find="Zvaničn" replaceWith="Služben" />
+    <RegEx find="([zZ])([nv])ać" replaceWith="$1$2at ć" />
+    <RegEx find="([zZ])vj?er(?!s)" replaceWith="$1vijer" />
+    <RegEx find="\b([zZ])vj?ezd([aeiou]|ama)\b" replaceWith="$1vijezd$2" />
+    <RegEx find="([zZ])vezd([ai])" replaceWith="$1vjezd$2" />
+    <RegEx find="([žŽ])el[ei]([lz]|ti)" replaceWith="$1elje$2" />
+    <RegEx find="([žŽ])eleć(?!i)" replaceWith="$1eljet ć" />
+    <RegEx find="([žŽ])ive([lt])" replaceWith="$1ivje$2" />
+    <RegEx find="iveć(?!i)" replaceWith="ivjet ć" />
+    <RegEx find="lj?ezd" replaceWith="lijezd" />
+    <RegEx find="([žŽ])muri" replaceWith="$1miri" />
+    <RegEx find="([žŽ])ude([lt])" replaceWith="$1udje$2" />
+    <RegEx find="žur[ck]" replaceWith="zabav" />
+    <RegEx find="Žur[ck]" replaceWith="Zabav" />
+    <RegEx find="([sSzZ])amnom" replaceWith="$1a mnom" />
+    <RegEx find="([sSnNpPzZ]r?[aoi]z[vn])ać" replaceWith="$1at ć" />
+    <!-- mjeseci [\b mora biti nakon jun]-->
+    <RegEx find="januar([au]|ima)" replaceWith="siječnj$1" />
+    <RegEx find="([Ss])j?ečnj([au]|ima)" replaceWith="$1iječnj$2" />
+    <RegEx find="april([au]|ima)" replaceWith="travnj$1" />
+    <RegEx find="\ba[uv]gust" replaceWith="kolovoz" />
+    <RegEx find="septembr" replaceWith="rujn" />
+    <RegEx find="oktobr" replaceWith="listopad" />
+    <RegEx find="decembr" replaceWith="prosinc" />
+    <RegEx find="Januar(?!s)" replaceWith="Siječnj" />
+    <RegEx find="April(?!s)" replaceWith="Travnj" />
+    <!--Marta je ime / Maja je ime-->
+    <RegEx find="\bA[uv]gust(?!o)" replaceWith="Kolovoz" />
+    <RegEx find="Septembr" replaceWith="Rujn" />
+    <RegEx find="Oktobr" replaceWith="Listopad" />
+    <RegEx find="Decembr" replaceWith="Prosinc" />
+    <!-- pridjevi optimalan, minimalan i maksimalan nemaju komparativ i superlativ. -->
+    <RegEx find="[Nn]aj(opt|min|maks)imalnij" replaceWith="$1imaln" />
+    <!-- experimental -->
+    <RegEx find="ÄŤ" replaceWith="č" />
+    <RegEx find="Ä" replaceWith="č" />
+    <RegEx find="ć" replaceWith="ć" />
+    <RegEx find="Ä‘" replaceWith="đ" />
+    <RegEx find="Ĺľ" replaceWith="ž" />
+    <RegEx find="ž" replaceWith="ž" />
+    <RegEx find="š" replaceWith="š" />
+    <RegEx find="Å¡" replaceWith="š" />
+    <RegEx find="ÄŚ" replaceWith="Č" />
+    <RegEx find="ÄŒ" replaceWith="Č" /> 
+    <RegEx find="Ć" replaceWith="Ć" />
+    <RegEx find="Ä" replaceWith="Đ" />
+    <RegEx find="Ĺ " replaceWith="Š" />
+    <RegEx find="Å " replaceWith="Š" />
+    <RegEx find="Ĺ˝" replaceWith="Ž" />
+    <RegEx find="Ž" replaceWith="Ž" />
+    <RegEx find="[^e]seda(?!m|tiv)" replaceWith="sjeda" />
+    <RegEx find="ii" replaceWith="i" />
+    <RegEx find="đž" replaceWith="dž" />
+    <RegEx find="zž" replaceWith="ž" />
+    <RegEx find="(?&lt;![Hh])abs" replaceWith="aps" />
+    <RegEx find="acel" replaceWith="acjel" />
+    <RegEx find="adji" replaceWith="ađi" />
+    <RegEx find="adk" replaceWith="atk" />
+    <RegEx find="(?&lt;![ml])a([blcrnz])ić" replaceWith="a$1it ć" />
+    <RegEx find="a(jm|mn)(t?)ić" replaceWith="a$1$2it ć" />
+    <RegEx find="ajuc" replaceWith="ajuć" />
+    <RegEx find="\bajpod" replaceWith="iPod" />
+    <RegEx find="alepn" replaceWith="aljepn" />
+    <RegEx find="alj?epi" replaceWith="alijepi" />
+    <RegEx find="alolet" replaceWith="aloljet" />
+    <RegEx find="amens" replaceWith="amjens" />
+    <RegEx find="ampovan" replaceWith="ampiran" />
+    <RegEx find="(an|ru|men|mi)tovan" replaceWith="$1tiran" />
+    <RegEx find="(?&lt;!gl|[Nn])avić" replaceWith="avit ć" />
+    <RegEx find="asmj?eš" replaceWith="asmiješ" />
+    <RegEx find="asnić" replaceWith="asnit ć" />
+    <RegEx find="ašić" replaceWith="ašit ć" />
+    <RegEx find="azać" replaceWith="azat ć" />
+    <RegEx find="atrać" replaceWith="atrat ć" />
+    <RegEx find="aterać" replaceWith="atjerat ć" />
+    <RegEx find="(?&lt;!s)avešć" replaceWith="avest ć" />
+    <RegEx find="aviknuće" replaceWith="aviknut će" />
+    <RegEx find="avirin" replaceWith="abirin" />
+    <RegEx find="([aeiou])z([kp])" replaceWith="$1s$2" />
+    <RegEx find="(?&lt;![Ss]p)avać" replaceWith="avat ć" />
+    <RegEx find="be[čć]aje" replaceWith="bećava" />
+    <RegEx find="begl" replaceWith="bjegl" />
+    <RegEx find="iliše" replaceWith="ilizira" />
+    <RegEx find="ilišu" replaceWith="iliziraju" />
+    <RegEx find="izc" replaceWith="isc" />
+    <RegEx find="ćič" replaceWith="čić" />
+    <RegEx find="dilova" replaceWith="dila" />
+    <RegEx find="diteljk" replaceWith="diteljic" />
+    <RegEx find="citov" replaceWith="citir" />
+    <RegEx find="cjenil" replaceWith="cijenil" />
+    <RegEx find="dnačin" replaceWith="dnadžb" />
+    <RegEx find="\bdral" replaceWith="deral" />
+    <RegEx find="dranj" replaceWith="deranj" />
+    <RegEx find="dsek" replaceWith="dsjek" />
+    <RegEx find="[dt]cj?en(i|jen)" replaceWith="dcijen$1" />
+    <RegEx find="(?&lt;![dt])cj?enim" replaceWith="cijenim" />
+    <RegEx find="ebać" replaceWith="ebat ć" />
+    <RegEx find="editov" replaceWith="editir" />
+    <RegEx find="edituje" replaceWith="editira" />
+    <RegEx find="edituju" replaceWith="editiraju" />
+    <RegEx find="edjen" replaceWith="eđen" />
+    <RegEx find="ed([kph])" replaceWith="et$1" />
+    <RegEx find="(?&lt;![NnJj])edać" replaceWith="edat ć" />
+    <RegEx find="eide(?!n)" replaceWith="e ide" />
+    <RegEx find="eizbež" replaceWith="eizbjež" />
+    <RegEx find="efiniši" replaceWith="efiniraj" />
+    <RegEx find="efinišu" replaceWith="efiniraju" />
+    <RegEx find="empton" replaceWith="ampton" />
+    <!-- bjegunac-->
+    <RegEx find="(?&lt;!j)egun" replaceWith="jegun" />
+    <RegEx find="(?&lt;!j)elokup" replaceWith="jelokup" />
+    <RegEx find="enlj" replaceWith="enj" />
+    <RegEx find="eoni([cč])" replaceWith="ioni$1" />
+    <RegEx find="erišu" replaceWith="eriraju" />
+    <RegEx find="ermer" replaceWith="ramor" />
+    <!-- bez j zbog nesvjestica npr. -->
+    <RegEx find="esvest" replaceWith="esvijest" />
+    <RegEx find="etektov" replaceWith="etektir" />
+    <RegEx find="evać" replaceWith="evat ć" />
+    <RegEx find="fanziv" replaceWith="fenziv" />
+    <RegEx find="figurisa" replaceWith="figurira" />
+    <RegEx find="(mpl|st|f)ikova([nlot])" replaceWith="$1icira$2" />
+    <RegEx find="fikuj" replaceWith="ficir" />
+    <RegEx find="(fi[ln]|form)isa" replaceWith="$1ira" />
+    <RegEx find="(?&lt;!o)formiš" replaceWith="formiraj" />
+    <RegEx find="fi(sa|še)" replaceWith="fira" />
+    <RegEx find="fiskov" replaceWith="fiscir" />
+    <RegEx find="frov" replaceWith="frir" />
+    <RegEx find="grišć" replaceWith="grist ć" />
+    <RegEx find="grutova" replaceWith="grutira" />
+    <RegEx find="haot" replaceWith="kaot" />
+    <RegEx find="hrono" replaceWith="krono" />
+    <RegEx find="(?&lt;![MH])ick([eoiu])" replaceWith="ičk$1" />
+    <RegEx find="idev" replaceWith="idjev" />
+    <RegEx find="ijo([absdegknptz])" replaceWith="io$1" />
+    <RegEx find="([ai])nić" replaceWith="$1nit ć" />
+    <RegEx find="(?&lt;!\b[Oo]zlo|\b[Ii]sp(rip)?ov|i)jeđen" replaceWith="ijeđen" />
+    <RegEx find="(?&lt;!hva)lisa([ol])" replaceWith="lira$1" />
+    <RegEx find="(?&lt;!hva)lisati" replaceWith="lirati" />
+    <RegEx find="irać" replaceWith="irat ć" />
+    <RegEx find="jći" replaceWith="jući" />
+    <RegEx find="jdin" replaceWith="jedin" />
+    <RegEx find="kodnevnic" replaceWith="kodnevic" />
+    <RegEx find="([kKpPvVtT])ratić" replaceWith="$1ratit ć" />
+    <RegEx find="koriš[čć]a" replaceWith="korišta" />
+    <!-- doktorica / profesorica -->
+    <RegEx find="(kt|s)ork" replaceWith="$1oric" />
+    <RegEx find="ktovanj" replaceWith="ktiranj" />
+    <RegEx find="ktuj" replaceWith="ktiraj" />
+    <RegEx find="(?&lt;![Oo]b)([nl])izuj[eu]" replaceWith="$1izira" />
+    <RegEx find="\bl([čćžzvsmrtpdbgkn])" replaceWith="i$1" />
+    <RegEx find="\bL([čćžzvsmrtpdbgkn])" replaceWith="I$1" />
+    <RegEx find="(?&lt;![Hh])omić" replaceWith="omit ć" />
+    <RegEx find="laćać" replaceWith="laćat ć" />
+    <RegEx find="ledov" replaceWith="ljedov" />
+    <RegEx find="lj?epić" replaceWith="lijepit ć" />
+    <RegEx find="lepš" replaceWith="ljepš" />
+    <RegEx find="lizankinj" replaceWith="lizank" />
+    <RegEx find="ljubc" replaceWith="ljupc" />
+    <RegEx find="ljutić" replaceWith="ljutit ć" />
+    <RegEx find="lša" replaceWith="iša" />
+    <RegEx find="Lša" replaceWith="Iša" />
+    <RegEx find="l([ou])žić" replaceWith="l$1žit ć" />
+    <RegEx find="luparenj" replaceWith="lupiranj" />
+    <RegEx find="([mv])ešten" replaceWith="$1ješten" />
+    <RegEx find="miniš[eu]" replaceWith="minira" />
+    <RegEx find="m([io]t?)rić" replaceWith="m$1rit ć" />
+    <RegEx find="mi?j?enić" replaceWith="mijenit ć" />
+    <RegEx find="mjenim" replaceWith="mijenim" />
+    <RegEx find="napredi" replaceWith="naprijedi" />
+    <RegEx find="ngažuj" replaceWith="ngažiraj" />
+    <RegEx find="nho" replaceWith="nko" />
+    <RegEx find="nisa([nlot])" replaceWith="nira$1" />
+    <RegEx find="(?&lt;!am)nesti" replaceWith="nijeti" />
+    <RegEx find="(?&lt;!sit)niše([mš])" replaceWith="nira$1" />
+    <RegEx find="(?&lt;!sit|fi)nišu" replaceWith="niraju" />
+    <RegEx find="niše(mo|te)" replaceWith="nira$1" />
+    <RegEx find="njaće" replaceWith="njat će" />
+    <RegEx find="nspirisa([nlt])" replaceWith="nspirira$1" />
+    <RegEx find="novj?eta" replaceWith="novijeta" />
+    <RegEx find="nović" replaceWith="novit ć" />
+    <RegEx find="ntis" replaceWith="ntir" />
+    <RegEx find="ntiše" replaceWith="ntira" />
+    <RegEx find="ntišu" replaceWith="ntiraju" />
+    <RegEx find="ntitj?el" replaceWith="ntitijel" />
+    <RegEx find="nzuje" replaceWith="nzira" />
+    <RegEx find="atursk" replaceWith="aturaln" />
+    <RegEx find="azuij" replaceWith="azumij" />
+    <RegEx find="([pg])asić" replaceWith="$1asit ć" />
+    <RegEx find="obed" replaceWith="objed" />
+    <RegEx find="([oO])besi" replaceWith="$1bjesi" />
+    <RegEx find="o[cčć]aren" replaceWith="očaran" />
+    <RegEx find="([oO])d([kp])" replaceWith="$1t$2" />
+    <RegEx find="oćeju" replaceWith="oće" />
+    <RegEx find="očeće" replaceWith="očet će" />
+    <RegEx find="očmi" replaceWith="očni" />
+    <RegEx find="odseč" replaceWith="odsječ" />
+    <RegEx find="odsetni" replaceWith="odsjetni" />
+    <RegEx find="oež" replaceWith="ože" />
+    <RegEx find="oješć" replaceWith="ojest ć" />
+    <RegEx find="ojtn" replaceWith="ojatn" />
+    <RegEx find="(?&lt;![Pp])oletn" replaceWith="oljetn" />
+    <RegEx find="onova([lt])" replaceWith="onira$1" />
+    <RegEx find="(?&lt;![nt])opić" replaceWith="opit ć" />
+    <RegEx find="([eoa])pisać" replaceWith="$1pisat ć" />
+    <RegEx find="oriće(mo|te)" replaceWith="orit će$1" />
+    <RegEx find="orks" replaceWith="orsk" />
+    <RegEx find="osejan" replaceWith="osijan" />
+    <RegEx find="o([dbjpv])ać(?!o)" replaceWith="o$1at ć" />
+    <RegEx find="oslj?ep" replaceWith="oslijep" />
+    <RegEx find="sj?etić" replaceWith="sjetit ć" />
+    <RegEx find="osb" replaceWith="osob" />
+    <RegEx find="ovinova([lt])" replaceWith="okorava$1" />
+    <RegEx find="posel" replaceWith="posjel" />
+    <RegEx find="produkova" replaceWith="producira" />
+    <RegEx find="\bpominj" replaceWith="spominj" />
+    <!-- ignoriše / koncentriše /operiše /toleriše /-->
+    <RegEx find="([te]|ku|pi|no)riše" replaceWith="$1rira" />
+    <RegEx find="(?&lt;![Pp]r|[Nn])adje(?!(v|n(e|u[olt]))\b)" replaceWith="ađe" />
+    <RegEx find="par nedj?elja" replaceWith="par tjedana" />
+    <RegEx find="pendov" replaceWith="pendir" />
+    <RegEx find="ralijs" replaceWith="rals" />
+    <RegEx find="kratij" replaceWith="kracij" />
+    <RegEx find="(?&lt;![is]|S)redić" replaceWith="rjedit ć" />
+    <RegEx find="(?&lt;![mr])ejt" replaceWith="ate" />
+    <RegEx find="rešć" replaceWith="rest ć" />
+    <!-- preduzeti / preduzetnik -->
+    <RegEx find="reduz" replaceWith="oduz" />
+    <RegEx find="relj?ep" replaceWith="relijep" />
+    <RegEx find="(?&lt;!e)rime([dt])" replaceWith="rimje$1" />
+    <RegEx find="risać(?!o)" replaceWith="risat ć" />
+    <RegEx find="ristun" replaceWith="risutn" />
+    <RegEx find="(?&lt;!k)rimić" replaceWith="rimit ć" />
+    <RegEx find="prostav" replaceWith="protstav" />
+    <RegEx find="pulis" replaceWith="pulir" />
+    <RegEx find="rićemo" replaceWith="rit ćemo" />
+    <RegEx find="rčaće" replaceWith="rčat će" />
+    <RegEx find="renaduvan" replaceWith="renapuhan" />
+    <RegEx find="rijedel" replaceWith="rijedil" />
+    <RegEx find="r([mv])isa" replaceWith="r$1ira" />
+    <RegEx find="rj?evozn" replaceWith="rijevozn" />
+    <RegEx find="rutuje" replaceWith="rutira" />
+    <RegEx find="rviši" replaceWith="rviraj" />
+    <RegEx find="ržać" replaceWith="ržat ć" />
+    <RegEx find="s([čć])" replaceWith="š$1" />
+    <RegEx find="seden" replaceWith="sjeden" />
+    <RegEx find="smeva" replaceWith="smijava" />
+    <RegEx find="stać(?!i)" replaceWith="stat ć" />
+    <RegEx find="\bstaral" replaceWith="brinul" />
+    <RegEx find="\bStaral" replaceWith="Brinul" />
+    <RegEx find="stovet" replaceWith="stovjet" />
+    <RegEx find="struis" replaceWith="struir" />
+    <RegEx find="struiše" replaceWith="struira" />
+    <RegEx find="struišu" replaceWith="struiraju" />
+    <RegEx find="(?&lt;!n)([sz])vesti([lt])" replaceWith="$1vijest$2" />
+    <RegEx find="svetić" replaceWith="svetit ć" />
+    <RegEx find="svetlj(?!iv)" replaceWith="svjetlj" />
+    <RegEx find="([šđ])ać" replaceWith="$1ač" />
+    <RegEx find="šević" replaceWith="ševit ć" />
+    <RegEx find="šunjać" replaceWith="šuljat ć" />
+    <RegEx find="tambul" replaceWith="tanbul" />
+    <RegEx find="tarisa" replaceWith="tira" />
+    <RegEx find="taun" replaceWith="town" />
+    <RegEx find="tćeš" replaceWith="t ćeš" />
+    <RegEx find="tideo" replaceWith="tidio" />
+    <RegEx find="tede(?![oć])" replaceWith="tedje" />
+    <RegEx find="tedeo" replaceWith="tedio" />
+    <RegEx find="tešn" replaceWith="tješn" />
+    <RegEx find="tisanj" replaceWith="tiranj" />
+    <RegEx find="(mo|ti|r)viš[eu]" replaceWith="$1vira" />
+    <RegEx find="tegri(sa|še)" replaceWith="tegrira" />
+    <RegEx find="teriv" replaceWith="tjeriv" />
+    <RegEx find="tnerk" replaceWith="tneric" />
+    <RegEx find="trisa" replaceWith="trira" />
+    <RegEx find="triši" replaceWith="triraj" />
+    <!-- ne diraj!!! - mijenja drugačije (komentira) -->
+    <RegEx find="tariše" replaceWith="tira" />
+    <RegEx find="tarišu" replaceWith="tiraju" />
+    <RegEx find="trišu" replaceWith="triraju" />
+    <RegEx find="ueln" replaceWith="ualn" />
+    <RegEx find="uisa" replaceWith="uira" />
+    <RegEx find="tvd" replaceWith="tvrd" />
+    <RegEx find="tvrn" replaceWith="tvarn" />
+    <RegEx find="u([bd])ić" replaceWith="u$1it ć" />
+    <RegEx find="u([cdtš])ać" replaceWith="u$1at ć" />
+    <RegEx find="(?&lt;![Kk]lj|[Uu]n|[Vv]|[jJ]ast|[Ss]and)učić" replaceWith="učit ć" />
+    <RegEx find="udijin" replaceWith="učev" />
+    <RegEx find="uduč" replaceWith="uduć" />
+    <RegEx find="udj([ai])" replaceWith="uđ$1" />
+    <RegEx find="(?&lt;!r)ugao" replaceWith="kut" />
+    <RegEx find="\bugl([au]|om|ovi|ovima)\b" replaceWith="kut$1" />
+    <RegEx find="([uU])meo" replaceWith="$1mio" />
+    <RegEx find="uliše" replaceWith="ulira" />
+    <RegEx find="ulišu" replaceWith="uliraju" />
+    <RegEx find="umere" replaceWith="umjere" />
+    <RegEx find="upoce" replaceWith="upocje" />
+    <RegEx find="urfovan" replaceWith="urfan" />
+    <RegEx find="ušać" replaceWith="ušat ć" />
+    <RegEx find="uzp" replaceWith="usp" />
+    <RegEx find="(?&lt;!kr|m)užić" replaceWith="užit ć" />
+    <RegEx find="veri([lt])" replaceWith="vjeri$1" />
+    <RegEx find="([do])vešć" replaceWith="$1vest ć" />
+    <RegEx find="vetion" replaceWith="vjetion" />
+    <RegEx find="visić" replaceWith="visit ć" />
+    <RegEx find="visa([lt])" replaceWith="vira$1" />
+    <RegEx find="([vV])jeov" replaceWith="$1jerov" />
+    <RegEx find="vljstv" replaceWith="voljstv" />
+    <RegEx find="v([or])dić" replaceWith="v$1dit ć" />
+    <RegEx find="(?&lt;![ČčĆć])vorić" replaceWith="vorit ć" />
+    <RegEx find="vpj" replaceWith="voj" />
+    <!-- mijenja u korist češće riječi -->
+    <RegEx find="([vV])rača" replaceWith="$1raća" />
+    <RegEx find="vršić" replaceWith="vršit ć" />
+    <RegEx find="zleči" replaceWith="zliječi" />
+    <RegEx find="zmern" replaceWith="zmjern" />
+    <RegEx find="znst" replaceWith="znost" />
+    <RegEx find="(?&lt;![Oo]bra|o)zova([lton])" replaceWith="zira$1" />
+    <RegEx find="zpr" replaceWith="spr" />
+    <RegEx find="zuslov" replaceWith="zuvjet" />
+    <RegEx find="zvešć" replaceWith="zvest ć" />
+    <RegEx find="zvolić" replaceWith="zvolit ć" />
+    <RegEx find="žalj?ev" replaceWith="žalijev" />
+    <RegEx find="živać" replaceWith="živat ć" />
+    <RegEx find="žive([lot])" replaceWith="živi$1" />
+
+    <!-- osobna imena/prezimena i imena gradova/država itd. -->
+    <RegEx find="Afghanistan" replaceWith="Afganistan" />
+    <RegEx find="Ajdah" replaceWith="Idah" />
+    <RegEx find="Ajl[ae]nd" replaceWith="Island" />
+    <RegEx find="Ajzak" replaceWith="Isaac" />
+    <RegEx find="Ajzenhauer" replaceWith="Eisenhower" />
+    <RegEx find="([aA])l[cz]h[ae]jmer" replaceWith="$1lzheimer" />
+    <RegEx find="Atin" replaceWith="Aten" />
+    <RegEx find="rčer" replaceWith="rcher" />
+    <RegEx find="Avgani" replaceWith="Afgani" />
+    <RegEx find="Bejkon" replaceWith="Bacon" />
+    <RegEx find="Belgijan" replaceWith="Belgij" />
+    <RegEx find="endž(?!o)" replaceWith="enj" />
+    <RegEx find="Betmen" replaceWith="Batman" />
+    <RegEx find="Blejk" replaceWith="Blake" />
+    <RegEx find="Bruklin" replaceWith="Brooklyn" />
+    <RegEx find="Brajan" replaceWith="Brian" />
+    <RegEx find="Brajs" replaceWith="Bryce" />
+    <RegEx find="Braun" replaceWith="Brown" />
+    <RegEx find="Brussels" replaceWith="Bruxelles" />
+    <RegEx find="Čarls" replaceWith="Charles" />
+    <RegEx find="Č[eu]rčil" replaceWith="Churchill" />
+    <RegEx find="Čikag" replaceWith="Chicag" />
+    <RegEx find="Dajan" replaceWith="Dian" />
+    <RegEx find="Dankan" replaceWith="Duncan" />
+    <RegEx find="Dejvi([ds])" replaceWith="Davi$1" />
+    <RegEx find="Dijeg" replaceWith="Dieg" />
+    <RegEx find="Diznilend" replaceWith="Disneyland" />
+    <RegEx find="Doson" replaceWith="Dawson" />
+    <RegEx find="Dvajt" replaceWith="Dwight" />
+    <RegEx find="Džastin" replaceWith="Justin" />
+    <RegEx find="Džef" replaceWith="Jeff" />
+    <RegEx find="Džejn" replaceWith="Jane" />
+    <RegEx find="Džejk" replaceWith="Jake" />
+    <RegEx find="Džejms" replaceWith="James" />
+    <RegEx find="Džejson" replaceWith="Jason" />
+    <RegEx find="Džek" replaceWith="Jack" />
+    <RegEx find="Džeremi" replaceWith="Jeremy" />
+    <RegEx find="Džesik" replaceWith="Jessic" />
+    <RegEx find="Džim" replaceWith="Jim" />
+    <RegEx find="Džon" replaceWith="John" />
+    <RegEx find="Džoni" replaceWith="Johnny" />
+    <RegEx find="Džonson" replaceWith="Johnson" />
+    <RegEx find="Džordž" replaceWith="George" />
+    <RegEx find="Džouns" replaceWith="Jones" />
+    <RegEx find="Džulij" replaceWith="Juli" />
+    <RegEx find="Efrejm" replaceWith="Ephraim" />
+    <RegEx find="Ejmos" replaceWith="Amos" />
+    <RegEx find="[EA]jnštajn" replaceWith="Einstein" />
+    <RegEx find="Endi" replaceWith="Andy" />
+    <RegEx find="Endrj?u" replaceWith="Andrew" />
+    <RegEx find="Filadelfij" replaceWith="Philadelphi" />
+    <RegEx find="Finiks" replaceWith="Phoenix" />
+    <RegEx find="\bFrojd" replaceWith="Freud" />
+    <RegEx find="Frenk" replaceWith="Frank" />
+    <RegEx find="Gejts" replaceWith="Gates" />
+    <RegEx find="\bĐovani" replaceWith="Giovanni" />
+    <RegEx find="Hari" replaceWith="Harry" />
+    <RegEx find="Hauard" replaceWith="Howard" />
+    <RegEx find="Hitrou" replaceWith="Heathrow" />
+    <RegEx find="Hrist" replaceWith="Krist" />
+    <RegEx find="Holandij" replaceWith="Nizozemsk" />
+    <RegEx find="\bHolands" replaceWith="Nizozems" />
+    <RegEx find="Holivud" replaceWith="Hollywood" />
+    <RegEx find="Holms" replaceWith="Holmes" />
+    <RegEx find="indijan(?!s)" replaceWith="Indijan" />
+    <RegEx find="Iraq" replaceWith="Irak" />
+    <RegEx find="Itan" replaceWith="Ethan" />
+    <RegEx find="Jejl" replaceWith="Yale" />
+    <RegEx find="Jevrej" replaceWith="Židov" />
+    <RegEx find="jevrej" replaceWith="židov" />
+    <RegEx find="Jovan" replaceWith="Ivan" />
+    <RegEx find="kadilak" replaceWith="Cadillac" />
+    <RegEx find="Kajl" replaceWith="Kyle" />
+    <RegEx find="Kavendiš" replaceWith="Cavendish" />
+    <RegEx find="Kejleb" replaceWith="Caleb" />
+    <RegEx find="Kembridž" replaceWith="Cambridge" />
+    <RegEx find="Kinkejd" replaceWith="Kincaid" />
+    <RegEx find="Klej" replaceWith="Clay" />
+    <RegEx find="Klif" replaceWith="Cliff" />
+    <RegEx find="Konn?ektik[aeu]t" replaceWith="Connecticut" />
+    <RegEx find="Korejan" replaceWith="Korej" />
+    <RegEx find="Kris(?!t)" replaceWith="Chris" />
+    <RegEx find="Kvins" replaceWith="Queens" />
+    <RegEx find="Lajonel" replaceWith="Lionel" />
+    <RegEx find="Leri" replaceWith="Larry" />
+    <RegEx find="Klivlend" replaceWith="Cleveland" />
+    <RegEx find="(?&lt;![LT])ejl" replaceWith="ale" />
+    <RegEx find="Losanđeles" replaceWith="Los Angeles" />
+    <RegEx find="Majami" replaceWith="Miami" />
+    <RegEx find="Majkl" replaceWith="Michael" />
+    <RegEx find="Majls" replaceWith="Miles" />
+    <RegEx find="Marfi" replaceWith="Murphy" />
+    <RegEx find="Mejson" replaceWith="Mason" />
+    <RegEx find="Memfis" replaceWith="Memphis" />
+    <RegEx find="Menhetn" replaceWith="Manhattan" />
+    <RegEx find="Metju" replaceWith="Matthew" />
+    <RegEx find="Mexic" replaceWith="Meksik" />
+    <RegEx find="ičigen" replaceWith="ichigan" />
+    <RegEx find="Misisipi" replaceWith="Mississippi" />
+    <RegEx find="Mocart" replaceWith="Mozart" />
+    <RegEx find="Nejt" replaceWith="Nate" />
+    <RegEx find="Nešvil" replaceWith="Nashville" />
+    <RegEx find="Nizuzem" replaceWith="Nizozem" />
+    <RegEx find="Njutn" replaceWith="Newton" />
+    <RegEx find="N[jJ]u Džer[sz]i" replaceWith="New Jersey" />
+    <RegEx find="N[jJ]u Jork" replaceWith="New York" />
+    <RegEx find="N[jJ]u Orleans" replaceWith="New Orleans" />
+    <RegEx find="Njujork" replaceWith="New York" />
+    <RegEx find="Njuton" replaceWith="Newton" />
+    <RegEx find="Pokipsi" replaceWith="Poughkeepsie" />
+    <RegEx find="ulicer" replaceWith="ulitzer" />
+    <RegEx find="Rajan" replaceWith="Ryan" />
+    <RegEx find="Rič" replaceWith="Rich" />
+    <RegEx find="odže" replaceWith="oge" />
+    <RegEx find="rols rojs" replaceWith="Rolls-Royce" />
+    <RegEx find="Sajmon" replaceWith="Simon" />
+    <RegEx find="S[ae]mjuel" replaceWith="Samuel" />
+    <RegEx find="Sijetl" replaceWith="Seattle" />
+    <RegEx find="Sinsinati" replaceWith="Cincinnati" />
+    <RegEx find="Sten" replaceWith="Stan" />
+    <RegEx find="Stiv" replaceWith="Steve" />
+    <RegEx find="Stiven" replaceWith="Stephen" />
+    <RegEx find="Stjuart" replaceWith="Stuart" />
+    <RegEx find="Sančez" replaceWith="Sanchez" />
+    <RegEx find="Šejn" replaceWith="Shane" />
+    <RegEx find="Šerlok" replaceWith="Sherlock" />
+    <RegEx find="Španij([aeou])" replaceWith="Španjolsk$1" />
+    <RegEx find="([šŠ])pansk" replaceWith="$1panjolsk" />
+    <RegEx find="([šŠ])vetsk" replaceWith="$1vedsk" />
+    <RegEx find="Štokh?olm" replaceWith="Stockholm" />
+    <RegEx find="vajcar" replaceWith="vicar" />
+    <RegEx find="Tajms" replaceWith="Times" />
+    <RegEx find="Tajler" replaceWith="Tyler" />
+    <RegEx find="Vajoming" replaceWith="Wyoming" />
+    <RegEx find="Valt" replaceWith="Walt" />
+    <RegEx find="V[ao]šington" replaceWith="Washington" />
+    <RegEx find="Vavilon" replaceWith="Babilon" />
+    <RegEx find="vavilons" replaceWith="babilons" />
+    <RegEx find="Vejn" replaceWith="Wayne" />
+    <RegEx find="Vejder" replaceWith="Vader" />
+    <RegEx find="Vilijam" replaceWith="William" />
+    <RegEx find="Vinči" replaceWith="Vinci" />
+    <RegEx find="Vinsent" replaceWith="Vincent" />
+    <RegEx find="Viskonsin" replaceWith="Wisconsin" />
+    <RegEx find="Volter" replaceWith="Walter" />
+    <RegEx find="Vots" replaceWith="Wats" />
+    <!-- 10kg » 10 kg   |  20cm » 20 cm   |  44dag » 44 dag -->
+    <RegEx find="\b(\d+)([a-z]{2,4})\b" replaceWith="$1 $2" />
+    <!-- 34m » 34 m -->
+    <RegEx find="([\d]){1}?m" replaceWith="$1 m" />
+    <!-- From here credit goes to: MilanRS [http://www.prijevodi-online.org] -->
+    <RegEx find="([ks]ao)\.:" replaceWith="$1:" />
+    <RegEx find="([a-zčđšž])Ij([a-zčđšž])" replaceWith="$1lj$2" />
+    <RegEx find="([^A-ZČĐŠŽa-zčđšž])Iju(bav|d|t)" replaceWith="$1lju$2" />
+    <!-- kad postoji razmak između tagova </i> <i> -->
+    <!-- <RegEx find="(&gt;) +(&lt;)" replaceWith="$1$2" /> -->
+    <!-- ',"' to '",' -->
+    <RegEx find="(\w),&quot;(\s|$)" replaceWith="$1&quot;,$2" />
+    <RegEx find=",\.{3}|\.{3},|\.{2} \." replaceWith="..." />
+    <!-- "1 :", "2 :"... "n :" to "n:" -->
+    <RegEx find="([0-9]) +: +(\D)" replaceWith="$1: $2" />
+    <!-- Two or more consecutive "," to "..." -->
+    <RegEx find=",{2,}" replaceWith="..." />
+    <!-- Two or more consecutive "-" to "..." -->
+    <RegEx find="-{2,}" replaceWith="..." />
+    <RegEx find="([^().])\.{2}([^().:])" replaceWith="$1...$2" />
+    <!-- separator stotica i decimalnog ostatka 1,499,000.00 -> 1.499.000,00 -->
+    <RegEx find="([0-9]{3})\.([0-9]{2}[^0-9])" replaceWith="$1,$2" />
+    <RegEx find="([0-9]),([0-9]{3}\D)" replaceWith="$1.$2" />
+    <!-- Apostrophes -->
+    <RegEx find="´´" replaceWith="&quot;" />
+    <!-- <RegEx find="[´`]" replaceWith="'" /> -->
+    <!-- <RegEx find="[“”]" replaceWith="&quot;" /> -->
+    <RegEx find="''" replaceWith="&quot;" />
+    <!-- Two or more consecutive '"' to one '"' -->
+    <RegEx find="&quot;{2,}" replaceWith="&quot;" />
+    <!-- Fix zero and capital 'o' ripping mistakes -->
+    <RegEx find="(?&lt;=[0-9]\.?)O" replaceWith="0" />
+    <RegEx find="\b0(?=[A-ZČĐŠŽa-zčđšž])" replaceWith="O" />
+    <!-- Brisanje crte - na početku 1. reda (i kada ima dva reda) -->
+    <RegEx find="\A- ?([A-ZČĐŠŽa-zčđšž0-9„'&quot;]|\.{3})" replaceWith="$1" />
+    <RegEx find="\A(&lt;[ibu]&gt;)- ?" replaceWith="$1" />
+    <RegEx find="  - " replaceWith=" -" />
+    <!-- Brisanje razmaka iza crte - na početku 2. reda -->
+    <RegEx find="(?&lt;=\n(&lt;[ibu]&gt;)?)- (?=[A-ZČĐŠŽčš0-9„'&quot;&lt;])" replaceWith="-" />
+    <!-- Korigiranje crte - kad je u sredini prvog reda -->
+    <RegEx find="([.!?&quot;&gt;]) - ([A-ZČĐŠŽčš'&quot;&lt;])" replaceWith="$1 -$2" />
+    <!-- Zatvoren tag pa razmak poslije crtice -->
+    <RegEx find="(&gt;) - ([A-ZČĐŠŽčš„'&quot;])" replaceWith="$1 -$2" />
+    <!-- Zatvoren tag pa crtica razmak -->
+    <RegEx find="(&gt;)- ([A-ZČĐŠŽčš„'&quot;])" replaceWith="$1-$2" />
+    <!-- Zagrada pa crtica razmak -->
+    <RegEx find="\(- ([A-ZČĐŠŽčš„'&quot;])" replaceWith="(-$1" />
+    <!-- Smart space after dot -->
+    <!-- osim kad je zadnje t (riječ kolt) -->
+    <RegEx find="([a-su-zá-úñä-ü])\.([^\s\n().:?!*^“”'&quot;&lt;])" replaceWith="$1. $2" />
+    <!-- Oznaka za kalibar. Npr. "Colt .45" -->
+    <!-- Da bi radilo, da bi ovaj razmak bio dozvoljen, odčekirajte "Razmaci ispred točke" -->
+    <RegEx find="t\.(?=[0-9]{2}})" replaceWith="t ." />
+    <!-- Joey(j)a -->
+    <RegEx find="([A-Z][a-z])eyj([a-z])" replaceWith="$1ey$2" />
+    <!-- Sređuje zarez sa razmakom -->
+    <RegEx find="([A-ZČĐŠŽa-zčđšžá-úñä-ü&quot;]),([^\s\n(),?!“&lt;])" replaceWith="$1, $2" />
+    <RegEx find="([?!])-" replaceWith="$1 -" />
+    <!-- Space after last of some consecutive dots (eg. "...") -->
+    <RegEx find="(?&lt;=[a-zčđšž])(\.{3}|!)(?=[a-zčđšž])" replaceWith="$1 " />
+    <!-- Delete space after "..." that is at the beginning of the line. You may delete this line if you don't like it -->
+    <!-- <RegEx find="^\.{3} +" replaceWith="..." /> -->
+    <!-- "tekst ... tekst" mijenja u "tekst... tekst" -->
+    <RegEx find="([A-ZČĐŠŽa-zčđšž]) \.{3} " replaceWith="$1... " />
+    <RegEx find="(\S)\. &quot;" replaceWith="$1.&quot;" />
+    <RegEx find="&quot; \." replaceWith="&quot;." />
+    <RegEx find="(\S\.{3}) &quot;(\s|$)" replaceWith="$1&quot;$2" />
+    <RegEx find=" \.{3}$" replaceWith="..." />
+    <RegEx find="([a-zčđšž])( \.{3}|\.{2}$)" replaceWith="$1..." />
+    <!-- Razmak ispred zagrade -->
+    <RegEx find="([A-ZČĐŠŽa-zčđšž])\(" replaceWith="$1 (" />
+    <!-- Razmak iza upitnika -->
+    <RegEx find="\?([A-ZČĐŠŽčš])" replaceWith="? $1" />
+    <RegEx find="(^|&gt;)\.{3} ([A-ZČĐŠŽčš])" replaceWith="$1...$2" />
+    <!-- Briše ... kad je na početku reda "... -->
+    <RegEx find="^&quot;\.{3} " replaceWith="&quot;" />
+    <RegEx find="([0-9])\$" replaceWith="$1 $$" />
+    <!-- ti š -> t š by Strider -->
+    <!-- Zamijeni sva "**ti šu*" s "**t šu*" i "**ti še*" s "**t še*" -->
+    <!-- <RegEx find="([a-z])ti (š+[eu])" replaceWith="$1t $2" /> -->
+    <!-- <RegEx find="([A-Za-z])ti( |\r?\n)(š[eu])" replaceWith="$1t$2$3" /> -->
+    <!-- <RegEx find="(?i)\b(ni)t (š[eu])" replaceWith="$1ti $2" /> -->
+    <!-- Razmak poslije <i> i poslije .. -->
+    <RegEx find="^(&lt;[ibu]&gt;) +" replaceWith="$1" />
+    <!-- Razmak ? "</i> -->
+    <RegEx find="([.?!]) +(&quot;&lt;)" replaceWith="$1$2" />
+    <!-- Bez razmaka kod Npr.: -->
+    <RegEx find="([Nn])pr\. +:" replaceWith="$1pr.:" />
+    <RegEx find="\. ," replaceWith=".," />
+    <RegEx find="([?!])\." replaceWith="$1" />
+    <!-- Da ne kvari potpise sa ..:: -->
+    <RegEx find="\.{3}::" replaceWith="..::" />
+    <RegEx find="::\.{3}" replaceWith="::.." />
+    <RegEx find="\.{2} ::" replaceWith="..::" />
+    <!-- Skraćenice bez razmaka -->
+    <RegEx find="d\. o\.o\." replaceWith="d.o.o." />
+  </RegularExpressions>
+</OCRFixReplaceList>
diff --git a/libs/subzero/modification/dictionaries/xml/hrv_diacriticOCRFixReplaceList.xml b/libs/subzero/modification/dictionaries/xml/hrv_diacriticOCRFixReplaceList.xml
new file mode 100644
index 000000000..4983307f0
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/xml/hrv_diacriticOCRFixReplaceList.xml
@@ -0,0 +1,1592 @@
+<OCRFixReplaceList>
+  <WholeWords>
+    <Word from="andele" to="anđele" />
+    <Word from="andeli" to="anđeli" />
+    <Word from="bas" to="baš" />
+    <Word from="basta" to="vrt" />
+    <Word from="Basta" to="Vrt" />
+    <Word from="baste" to="vrtovi" />
+    <Word from="Baste" to="Vrtovi" />
+    <Word from="basti" to="vrtu" />
+    <Word from="Basti" to="Vrtu" />
+    <Word from="bastu" to="vrt" />
+    <Word from="Bastu" to="Vrt" />
+    <Word from="bastom" to="vrtom" />
+    <Word from="Bastom" to="Vrtom" />
+    <Word from="Bice" to="Biće" />
+    <Word from="bice" to="biće" />
+    <Word from="Biceš" to="Bit ćeš" />
+    <Word from="Bicu" to="Bit ću" />
+    <Word from="bicu" to="biću" />
+    <Word from="blizi" to="bliži" />
+    <Word from="bojis" to="bojiš" />
+    <Word from="braca" to="braća" />
+    <Word from="Braca" to="Braća" />
+    <Word from="broncane" to="brončane" />
+    <Word from="budes" to="budeš" />
+    <Word from="buducnost" to="budućnost" />
+    <Word from="buducnosti" to="budućnosti" />
+    <Word from="buducnoscu" to="budućnošću" />
+    <Word from="Cak" to="Čak" />
+    <Word from="cak" to="čak" />
+    <Word from="Cao" to="Ćao" />
+    <Word from="cao" to="ćao" />
+    <Word from="cas" to="sat" />
+    <Word from="casu" to="cašu" />
+    <Word from="cašu" to="čašu" />
+    <Word from="caj" to="čaj" />
+    <Word from="caja" to="čaja" />
+    <Word from="casno" to="časno" />
+    <Word from="Casno" to="Časno" />
+    <Word from="cale" to="tata" />
+    <Word from="cebe" to="deku" />
+    <Word from="cekali" to="čekali" />
+    <Word from="cekas" to="čekaš" />
+    <Word from="Cemu" to="Čemu" />
+    <Word from="cemu" to="čemu" />
+    <Word from="cerku" to="kćer" />
+    <Word from="Cerku" to="Kćer" />
+    <Word from="ceš" to="ćeš" />
+    <Word from="ces" to="ćeš" />
+    <Word from="ćes" to="ćeš" />
+    <Word from="cesto" to="često" />
+    <Word from="Cesto" to="Često" />
+    <Word from="cesce" to="češće" />
+    <Word from="Cesce" to="Češće" />
+    <Word from="cega" to="čega" />
+    <Word from="cetri" to="četiri" />
+    <Word from="cetiri" to="četiri" />
+    <Word from="Cetiri" to="Četiri" />
+    <Word from="Cetverokut" to="Četverokut" />
+    <Word from="cetvrtak" to="četvrtak" />
+    <Word from="cetvrtu" to="četvrtu" />
+    <Word from="ceznja" to="čežnja" />
+    <Word from="ceznje" to="čežnje" />
+    <Word from="ceznji" to="čežnji" />
+    <Word from="ceznju" to="čežnju" />
+    <Word from="ceznjom" to="čežnjom" />
+    <Word from="Cim" to="Čim" />
+    <Word from="cim" to="čim" />
+    <Word from="Cija" to="Čija" />
+    <Word from="cija" to="čija" />
+    <Word from="cije" to="čije" />
+    <Word from="Ciji" to="Čiji" />
+    <Word from="ciji" to="čiji" />
+    <Word from="cijih" to="čijih" />
+    <Word from="Cijih" to="Čijih" />
+    <Word from="cijim" to="čijim" />
+    <Word from="Cijim" to="Čijim" />
+    <Word from="Čime" to="Čime" />
+    <Word from="cime" to="čime" />
+    <Word from="cizme" to="čizme" />
+    <Word from="cinio" to="činio" />
+    <Word from="cinila" to="činila" />
+    <Word from="cinili" to="činili" />
+    <Word from="ciniti" to="činiti" />
+    <Word from="cipka" to="čipka" />
+    <Word from="cipku" to="čipku" />
+    <Word from="cita" to="čita" />
+    <Word from="citao" to="čitao" />
+    <Word from="citas" to="čitaš" />
+    <Word from="citavu" to="čitavu" />
+    <Word from="corsokak" to="slijepa ulica" />
+    <Word from="corsokaku" to="slijepoj ulici" />
+    <Word from="cosak" to="ugao" />
+    <Word from="cosku" to="uglu" />
+    <Word from="covek" to="čovjek" />
+    <Word from="covjek" to="čovjek" />
+    <Word from="covjeka" to="čovjeka" />
+    <Word from="covjeku" to="čovjeku" />
+    <Word from="covece" to="čovječe" />
+    <Word from="covjece" to="čovječe" />
+    <Word from="covjecnost" to="čovječnost" />
+    <Word from="necovjecnost" to="nečovječnost" />
+    <Word from="necovjecnosti" to="nečovječnosti" />
+    <Word from="necovjecnoscu" to="nečovječnošću" />
+    <Word from="cerka" to="kći" />
+    <Word from="Cerka" to="Kći" />
+    <Word from="cerke" to="kćeri" />
+    <Word from="Cerke" to="Kćeri" />
+    <Word from="clan" to="član" />
+    <Word from="Clan" to="Član" />
+    <Word from="clanke" to="članke" />
+    <Word from="clanovi" to="članovi" />
+    <Word from="clanove" to="članove" />
+    <Word from="clanovima" to="članovima" />
+    <Word from="cinis" to="činiš" />
+    <Word from="cmo" to="ćemo" />
+    <Word from="crpeci" to="crpeći" />
+    <Word from="cte" to="ćete" />
+    <Word from="ćte" to="ćete" />
+    <Word from="cu" to="ću" />
+    <Word from="cuo" to="čuo" />
+    <Word from="Cuo" to="Čuo" />
+    <Word from="Cudo" to="Čudo" />
+    <Word from="cudo" to="čudo" />
+    <Word from="cudi" to="čudi" />
+    <Word from="Cujte" to="Čujte" />
+    <Word from="cula" to="čula" />
+    <Word from="culi" to="čuli" />
+    <Word from="Culi" to="Čuli" />
+    <Word from="culima" to="čulima" />
+    <Word from="cupam" to="čupam" />
+    <Word from="cuti" to="čuti" />
+    <Word from="cutanje" to="šutnja" />
+    <Word from="Cutanje" to="Šutnja" />
+    <Word from="cutljiv" to="šutljiv" />
+    <Word from="cutnja" to="šutnja" />
+    <Word from="cutao" to="šutio" />
+    <Word from="Cutao" to="Šutio" />
+    <Word from="cuvali" to="čuvali" />
+    <Word from="cuveni" to="čuveni" />
+    <!--d-->
+    <Word from="davo" to="vrag" />
+    <Word from="definise" to="definira" />
+    <Word from="definisi" to="definiraj" />
+    <Word from="delimicno" to="djelomično" />
+    <Word from="delimicni" to="djelomični" />
+    <Word from="Desava" to="Događa" />
+    <Word from="desava" to="događa" />
+    <Word from="disi" to="diši" />
+    <Word from="Dodji" to="Dođi" />
+    <Word from="Dodjite" to="Dođite" />
+    <Word from="dodji" to="dođi" />
+    <Word from="dodjite" to="dođite" />
+    <Word from="Dodju" to="Dođu" />
+    <Word from="dodju" to="dođu" />
+    <Word from="dodu" to="dođu" />
+    <Word from="dobijes" to="dobiješ" />
+    <Word from="doci" to="doći" />
+    <Word from="Dodi" to="Dođi" />
+    <Word from="dodi" to="dođi" />
+    <Word from="dodite" to="dođite" />
+    <Word from="dode" to="dođe" />
+    <Word from="dodes" to="dođeš" />
+    <Word from="dodeš" to="dođeš" />
+    <Word from="dodem" to="dođem" />
+    <Word from="dodjem" to="dođem" />
+    <Word from="dolazis" to="dolaziš" />
+    <Word from="dodete" to="dođete" />
+    <Word from="dopustao" to="dopuštao" />
+    <Word from="dorucak" to="doručak" />
+    <Word from="dorucku" to="doručku" />
+    <Word from="dosaduju" to="dosađuju" />
+    <Word from="drhteci" to="drhteći" />
+    <Word from="drukciji" to="drugačiji" />
+    <Word from="drugaciji" to="drugačiji" />
+    <Word from="Drugacije" to="Drugačije" />
+    <Word from="drugacije" to="drugačije" />
+    <Word from="drzi" to="drži" />
+    <Word from="dzanki" to="ovisnik" />
+    <Word from="drhteći" to="drhteći" />
+    <Word from="Drhteći" to="Drhteći" />
+    <Word from="druze" to="druže" />
+    <Word from="duze" to="duže" />
+    <Word from="duzinom" to="dužinom" />
+    <Word from="drveca" to="drveća" />
+    <Word from="drvece" to="drveće" />
+    <Word from="drvecu" to="drveću" />
+    <Word from="drvecem" to="drvećem" />
+    <Word from="flasom" to="flašom" />
+    <Word from="flasu" to="flašu" />
+    <Word from="fucka" to="fućka" />
+    <Word from="funkcionisu" to="funkcioniraju" />
+    <!--g-->
+    <Word from="gacice" to="gaćice" />
+    <Word from="gadao" to="gađao" />
+    <Word from="gadis" to="gadiš" />
+    <Word from="Gadis" to="Gadiš" />
+    <Word from="gdica" to="gđica" />
+    <Word from="gdice" to="gđice" />
+    <Word from="gdicu" to="gđicu" />
+    <Word from="gdici" to="gđici" />
+    <Word from="gda" to="gđa" />
+    <Word from="gdu" to="gđu" />
+    <Word from="gdo" to="gđo" />
+    <Word from="gdi" to="gđi" />
+    <Word from="glupaco" to="glupačo" />
+    <Word from="gorucu" to="goruću" />
+    <Word from="goruce" to="goruće" />
+    <Word from="govoris" to="govoriš" />
+    <Word from="gradani" to="građani" />
+    <Word from="gradic" to="gradić" />
+    <Word from="gradicu" to="gradiću" />
+    <Word from="gradica" to="gradića" />
+    <Word from="grese" to="griješe" />
+    <Word from="greski" to="grešci" />
+    <Word from="gresku" to="grešku" />
+    <Word from="gresci" to="grešci" />
+    <Word from="gubis" to="gubiš" />
+    <Word from="htjeo" to="htio" />
+    <Word from="hocu" to="hoću" />
+    <Word from="Hocu" to="Hoću" />
+    <Word from="Hoces" to="Hoćeš" />
+    <Word from="hoces" to="hoćeš" />
+    <Word from="hodas" to="hodaš" />
+    <Word from="Ici" to="Ići" />
+    <Word from="ici" to="ići" />
+    <Word from="iceg" to="ičeg" />
+    <Word from="icega" to="ičega" />
+    <Word from="icemu" to="ičemu" />
+    <Word from="Ides" to="Ideš" />
+    <Word from="ides" to="ideš" />
+    <Word from="Iduci" to="Idući" />
+    <Word from="iduci" to="idući" />
+    <Word from="iduce" to="iduće" />
+    <Word from="iducem" to="idućem" />
+    <Word from="iduceg" to="idućeg" />
+    <Word from="isao" to="išao" />
+    <Word from="isla" to="išla" />
+    <Word from="istjece" to="istječe" />
+    <Word from="istrazio" to="istrazio" />
+    <Word from="Istrazio" to="Istrazio" />
+    <Word from="išcupao" to="iščupao" />
+    <Word from="iscupao" to="iščupao" />
+    <Word from="imas" to="imaš" />
+    <Word from="Ijudi" to="ljudi" />
+    <Word from="imidz" to="imidž" />
+    <Word from="igras" to="igraš" />
+    <Word from="ignorisi" to="ignoriraj" />
+    <Word from="ignorisi" to="ignoriraju" />
+    <Word from="isuvise" to="previše" />
+    <Word from="izaci" to="izaći" />
+    <Word from="Izadi" to="Izađi" />
+    <Word from="izadi" to="izađi" />
+    <Word from="izade" to="izađe" />
+    <Word from="izades" to="izađeš" />
+    <Word from="izasao" to="izašao" />
+    <Word from="izasla" to="izašla" />
+    <Word from="izici" to="izaći" />
+    <Word from="izmedu" to="između" />
+    <Word from="Izmedu" to="Između" />
+    <Word from="izvuci" to="izvući" />
+    <Word from="jebes" to="jebeš" />
+    <Word from="Jebes" to="Jebeš" />
+    <Word from="jos" to="još" />
+    <Word from="Jos" to="Još" />
+    <Word from="juce" to="jučer" />
+    <Word from="Juce" to="Jučer" />
+    <Word from="jucer" to="jučer" />
+    <Word from="Jucer" to="Jučer" />
+    <!--k-->
+    <Word from="kaslja" to="kašlja" />
+    <Word from="kaze" to="kaže" />
+    <Word from="Kaze" to="Kaže" />
+    <Word from="Kazite" to="Kažite" />
+    <Word from="nekaze" to="ne kaže" />
+    <Word from="kazu" to="kažu" />
+    <Word from="kcer" to="kćer" />
+    <Word from="kcerka" to="kći" />
+    <Word from="Kcerka" to="Kći" />
+    <Word from="kcerkama" to="kćerima" />
+    <Word from="kcerku" to="kćer" />
+    <Word from="Kcerku" to="Kćer" />
+    <Word from="kecap" to="kečap" />
+    <Word from="kecapa" to="kečapa" />
+    <Word from="kociji" to="kočiji" />
+    <Word from="kolaca" to="kolača" />
+    <Word from="kolace" to="kolače" />
+    <Word from="komadic" to="komadić" />
+    <Word from="komšija" to="susjed" />
+    <Word from="komsiji" to="susjedu" />
+    <Word from="komsiluk" to="susjedstvo" />
+    <Word from="komsiluku" to="susjedstvu" />
+    <Word from="komsije" to="susjedi" />
+    <Word from="komsijama" to="susjedima" />
+    <Word from="kontrolisu" to="kontroliraju" />
+    <Word from="konkurisem" to="konkuriram" />
+    <Word from="konkurise" to="konkurira" />
+    <Word from="kovceg" to="kovčeg" />
+    <Word from="kovcegu" to="kovčegu" />
+    <Word from="krada" to="krađa" />
+    <Word from="krece" to="kreće" />
+    <Word from="Kreci" to="Kreći" />
+    <Word from="kreci" to="kreći" />
+    <Word from="krosnje" to="krošnje" />
+    <Word from="kuca" to="kuća" />
+    <Word from="kuča" to="kuća" />
+    <Word from="kuči" to="kući" />
+    <Word from="kuce" to="kuće" />
+    <Word from="kuci" to="kući" />
+    <Word from="kucama" to="kućama" />
+    <Word from="kusa" to="kuša" />
+    <Word from="kusas" to="kušaš" />
+    <!--l-->
+    <Word from="lakocom" to="lakoćom" />
+    <Word from="laz" to="laž" />
+    <Word from="lazac" to="lažljivac" />
+    <Word from="laze" to="laže" />
+    <Word from="lazi" to="laži" />
+    <Word from="lazne" to="lažne" />
+    <Word from="lazov" to="lažljivac" />
+    <Word from="ledja" to="leđa" />
+    <Word from="ledjima" to="leđima" />
+    <Word from="lezati" to="ležati" />
+    <Word from="odlezati" to="odležati" />
+    <Word from="lezala" to="ležala" />
+    <Word from="lezali" to="ležali" />
+    <Word from="lezis" to="ležiš" />
+    <Word from="Lezis" to="Ležiš" />
+    <Word from="lici" to="liči" />
+    <Word from="licim" to="ličim" />
+    <Word from="licis" to="ličiš" />
+    <Word from="licnost" to="ličnost" />
+    <Word from="licnosti" to="ličnosti" />
+    <Word from="lijecniku" to="liječniku" />
+    <Word from="logican" to="logičan" />
+    <Word from="los" to="loš" />
+    <Word from="losa" to="loša" />
+    <Word from="losu" to="lošu" />
+    <Word from="ljubis" to="ljubiš" />
+    <!--m-->
+    <Word from="majcine" to="majčine" />
+    <Word from="Medutim" to="Međutim" />
+    <Word from="medutim" to="međutim" />
+    <Word from="mici" to="miči" />
+    <Word from="Mici" to="Miči" />
+    <Word from="mislis" to="misliš" />
+    <Word from="Mislis" to="Misliš" />
+    <Word from="moc" to="moć" />
+    <Word from="moci" to="moći" />
+    <Word from="motivisu" to="motiviraju" />
+    <Word from="mozda" to="možda" />
+    <Word from="Mozda" to="Možda" />
+    <Word from="mreza" to="mreža" />
+    <Word from="mrezu" to="mrežu" />
+    <Word from="mrzis" to="mrziš" />
+    <Word from="muce" to="muče" />
+    <Word from="mucenik" to="mučenik" />
+    <Word from="muska" to="muška" />
+    <Word from="muz" to="muž" />
+    <Word from="muza" to="muža" />
+    <!--n-->
+    <Word from="nadem" to="nađem" />
+    <Word from="nades" to="nađeš" />
+    <Word from="naci" to="naći" />
+    <Word from="Naci" to="Naći" />
+    <Word from="nacin" to="način" />
+    <Word from="nadje" to="nađe" />
+    <Word from="Nadje" to="Nađe" />
+    <Word from="nadjem" to="nađem" />
+    <Word from="nadjes" to="nađeš" />
+    <Word from="Nadjes" to="Nađeš" />
+    <Word from="najvise" to="najvise" />
+    <Word from="Najvise" to="Najviše" />
+    <Word from="naocale" to="naočale" />
+    <Word from="Napisite" to="Napišite" />
+    <Word from="nasa" to="naša" />
+    <Word from="Nase" to="Naše" />
+    <Word from="nase" to="naše" />
+    <Word from="naseg" to="našeg" />
+    <Word from="nasi" to="naši" />
+    <Word from="Nasi" to="Naši" />
+    <Word from="nasu" to="našu" />
+    <Word from="nasoj" to="našoj" />
+    <Word from="nastavis" to="nastaviš" />
+    <Word from="nagovestaj" to="nagovještaj" />
+    <Word from="nasla" to="našla" />
+    <Word from="Nasla" to="Našla" />
+    <Word from="nasli" to="našli" />
+    <Word from="Nasli" to="Našli" />
+    <Word from="nasrecu" to="na sreću" />
+    <Word from="nauce" to="nauče" />
+    <Word from="necim" to="nečim" />
+    <Word from="necije" to="nečije" />
+    <Word from="neciji" to="nečiji" />
+    <Word from="necemu" to="nečemu" />
+    <Word from="necemo" to="nećemo" />
+    <Word from="necega" to="nečega" />
+    <Word from="nekoc" to="nekoć" />
+    <Word from="Nesreca" to="Nesreća" />
+    <Word from="nesto" to="nešto" />
+    <Word from="Nesto" to="Nešto" />
+    <Word from="nezan" to="nježan" />
+    <Word from="nicega" to="ničega" />
+    <Word from="niceg" to="ničeg" />
+    <Word from="nicemu" to="ničemu" />
+    <Word from="nicim" to="ničim" />
+    <Word from="niciji" to="ničiji" />
+    <Word from="nicija" to="ničija" />
+    <Word from="necu" to="neću" />
+    <Word from="Necu" to="Neću" />
+    <Word from="Nemas" to="Nemaš" />
+    <Word from="nemas" to="nemaš" />
+    <Word from="nezna" to="nježna" />
+    <Word from="nezni" to="nježni" />
+    <Word from="neznim" to="nježnim" />
+    <Word from="neznih" to="nježnih" />
+    <Word from="neznu" to="nježnu" />
+    <Word from="nezno" to="nježno" />
+    <Word from="njezno" to="nježno" />
+    <Word from="new yorski" to="njujorški" />
+    <Word from="nju jorski" to="njujorški" />
+    <Word from="noci" to="noći" />
+    <Word from="nocnu" to="noćnu" />
+    <Word from="nosac" to="nosač" />
+    <Word from="nosis" to="nosiš" />
+    <Word from="nosices" to="nosit ćeš" />
+    <Word from="noz" to="nož" />
+    <Word from="nozem" to="nožem" />
+    <!-- o -->
+    <Word from="Obecao" to="Obećao" />
+    <Word from="obozavalac" to="obožavatelj" />
+    <Word from="obide" to="obiđe" />
+    <Word from="Obezbedjuju" to="Osiguravaju" />
+    <Word from="obezbedjuju" to="osiguravaju" />
+    <Word from="obracas" to="obraćaš" />
+    <Word from="obraćas" to="obraćaš" />
+    <Word from="ocito" to="očito" />
+    <Word from="ocnjaci" to="očnjaci" />
+    <Word from="odes" to="odeš" />
+    <Word from="odreden" to="određen" />
+    <Word from="odvec" to="odveć" />
+    <Word from="opasac" to="opasač" />
+    <Word from="opca" to="opća" />
+    <Word from="opcih" to="općih" />
+    <Word from="opci" to="opći" />
+    <Word from="operise" to="operira" />
+    <Word from="operiseš" to="operiraš" />
+    <Word from="operisemo" to="operiramo" />  
+    <Word from="osjecam" to="osjećam" />
+    <Word from="osjecanja" to="osjećanja" />
+    <Word from="operisete" to="operirate" />
+    <Word from="osjecaces" to="osjećat ćeš" />
+    <Word from="osecaces" to="osjećat ćeš" />
+    <Word from="oceve" to="očeve" />
+    <Word from="odlazis" to="odlaziš" />
+    <Word from="odlucim" to="odlučim" />
+    <Word from="okrece" to="okreće" />
+    <Word from="ogrtac" to="ogrtač" />
+    <Word from="ostra" to="oštra" />
+    <Word from="ostre" to="oštre" />
+    <Word from="ostri" to="oštri" />
+    <Word from="ostru" to="oštru" />
+    <Word from="ostrom" to="oštrom" />
+    <Word from="otezala" to="otežala" />
+    <Word from="otidi" to="otiđi" />
+    <Word from="otidji" to="otiđi" />
+    <Word from="otisao" to="otišao" />
+    <Word from="otputujes" to="otputuješ" />
+    <Word from="oziljak" to="ožiljak" />
+    <!--p-->
+    <Word from="palaca" to="palača" />
+    <Word from="palaci" to="palači" />
+    <Word from="palacu" to="palaču" />
+    <Word from="papucama" to="papučama" />
+    <Word from="parce" to="komadić" />
+    <Word from="pateci" to="pateći" />
+    <Word from="patis" to="patiš" />
+    <Word from="pcela" to="pčela" />
+    <Word from="pcele" to="pčele" />
+    <Word from="peraca" to="perača" />
+    <Word from="Peraci" to="Perači" />
+    <Word from="pica" to="pića" />
+    <Word from="pice" to="piće" />
+    <Word from="picem" to="pićem" />
+    <Word from="pijes" to="piješ" />
+    <Word from="pise" to="piše" />
+    <Word from="pisu" to="pišu" />
+    <Word from="pisem" to="pišem" />
+    <Word from="pises" to="pišeš" />
+    <Word from="pisite" to="pišite" />
+    <Word from="pitas" to="pitaš" />
+    <Word from="placa" to="plaća" />
+    <Word from="placam" to="plaćam" />
+    <Word from="place" to="plače" />
+    <Word from="placu" to="plaću" />
+    <Word from="placanje" to="plaćanje" />
+    <Word from="placanjem" to="plaćanjem" />
+    <Word from="placeš" to="plačeš" />
+    <Word from="placuci" to="plačući" />
+    <Word from="plazu" to="plažu" />
+    <Word from="plazi" to="plaži" />
+    <Word from="plese" to="pleše" />
+    <Word from="plesemo" to="plešemo" />
+    <Word from="plesete" to="plešete" />
+    <Word from="plesu" to="plešu" />
+    <Word from="ploca" to="ploča" />
+    <Word from="ploce" to="ploče" />
+    <Word from="pluca" to="pluća" />
+    <Word from="plucima" to="plućima" />
+    <Word from="pobjeci" to="pobjeći" />
+    <Word from="poceo" to="počeo" />
+    <Word from="poceli" to="počeli" />
+    <Word from="pocetak" to="početak" />
+    <Word from="pocevsi" to="počevši" />
+    <Word from="pocevši" to="počevši" />
+    <Word from="poci" to="poći" />
+    <Word from="pocinje" to="počinje" />
+    <Word from="pociva" to="počiva" />
+    <Word from="pocivao" to="počivao" />
+    <Word from="pocivali" to="počivali" />
+    <Word from="Podji" to="Pođi" />
+    <Word from="podji" to="pođi" />
+    <Word from="pode" to="pođe" />
+    <Word from="podje" to="pođe" />
+    <Word from="Podje" to="Pođe" />
+    <Word from="podici" to="podići" />
+    <Word from="Podici" to="Podići" />
+    <Word from="podimo" to="pođimo" />
+    <Word from="podjem" to="pođem" />
+    <Word from="podjemo" to="pođemo" />
+    <Word from="poduzeca" to="poduzeća" />
+    <Word from="poduzece" to="poduzeće" />
+    <Word from="poduzecu" to="poduzeću" />
+    <Word from="pojesce" to="pojest će" />
+    <Word from="pokazi" to="pokaži" />
+    <Word from="Pokazi" to="Pokaži" />
+    <Word from="pokrece" to="pokreće" />
+    <Word from="pomaci" to="pomaknuti" />
+    <Word from="pomoc" to="pomoć" />
+    <Word from="pomoci" to="pomoći" />
+    <Word from="poletis" to="poletiš" />
+    <Word from="pomazes" to="pomažeš" />
+    <Word from="pomognes" to="pomogneš" />
+    <Word from="poreci" to="poreći" />
+    <Word from="porice" to="poriče" />
+    <Word from="posalji" to="pošalji" />
+    <Word from="Posalji" to="Pošalji" />
+    <Word from="posaljite" to="pošaljite" />
+    <Word from="posle" to="poslije" />
+    <Word from="Posluzite" to="Poslužite" />
+    <Word from="posluzite" to="poslužite" />
+    <Word from="posluzili" to="poslužili" />
+    <Word from="postaras" to="pobrineš" />
+    <Word from="posto" to="pošto" />
+    <Word from="Posto" to="Pošto" />
+    <Word from="potpises" to="potpišeš" />
+    <Word from="pozuda" to="požuda" />
+    <Word from="pozude" to="požude" />
+    <Word from="pozudi" to="požudi" />
+    <Word from="pozudu" to="požudu" />
+    <Word from="prakticno" to="praktično" />
+    <Word from="presao" to="prešao" />
+    <Word from="Previse" to="Previše" />
+    <Word from="previse" to="previše" />
+    <Word from="preziveo" to="preživio" />
+    <Word from="Priblizi" to="Približi" />
+    <Word from="Pridji" to="Priđi" />
+    <Word from="pridji" to="priđi" />
+    <Word from="pricam" to="pričam" />
+    <Word from="pricati" to="pričati" />
+    <Word from="pricaš" to="pričaš" />
+    <Word from="pricu" to="priču" />
+    <Word from="prici" to="priči" />
+    <Word from="prijedi" to="prijeđi" />
+    <Word from="priusti" to="priušti" />
+    <Word from="priustiti" to="priuštiti" />
+    <Word from="priustimo" to="priuštimo" />
+    <Word from="proci" to="proći" />
+    <Word from="prodavac" to="prodavač" />
+    <Word from="promasio" to="promašio" />
+    <Word from="Promasio" to="Promašio" />
+    <Word from="proslo" to="prošlo" />
+    <Word from="Proslo" to="Prošlo" />
+    <Word from="prosloscu" to="prošlošću" />
+    <Word from="pricas" to="pričaš" />
+    <Word from="prisao" to="prišao" />
+    <Word from="prosao" to="prošao" />
+    <Word from="prosla" to="prošla" />
+    <Word from="prosle" to="prošle" />
+    <Word from="prosli" to="prošli" />
+    <Word from="Prosli" to="Prošli" />
+    <Word from="proslim" to="prošlim" />
+    <Word from="preporuca" to="preporučuje" />
+    <Word from="pticica" to="ptičica" />
+    <Word from="pticicu" to="ptičicu" />
+    <Word from="pusac" to="pušač" />
+    <Word from="pusaci" to="pušači" />
+    <!--r-->
+    <Word from="racunari" to="računala" />
+    <Word from="racunare" to="računala" />
+    <Word from="radis" to="radiš" />
+    <Word from="raskosni" to="raskošni" />
+    <Word from="razgovaras" to="razgovaraš" />
+    <Word from="razumes" to="razumiješ" />
+    <Word from="Razumes" to="Razumiješ" />
+    <Word from="Receno" to="Rečeno" />
+    <Word from="receno" to="rečeno" />
+    <Word from="recima" to="riječima" />
+    <Word from="resimo" to="riješimo" />
+    <Word from="rijedji" to="rjeđi" />
+    <Word from="rjedji" to="rjeđi" />
+    <Word from="rec" to="riječ" />
+    <Word from="rijec" to="riječ" />
+    <Word from="Rijeci" to="Riječi" />
+    <Word from="Rjesit" to="Riješit" />
+    <Word from="rodena" to="rođena" />
+    <Word from="rucno" to="ručno" />
+    <Word from="ruza" to="ruža" />
+    <Word from="ruzu" to="ružu" />
+    <Word from="ruzan" to="ružan" />
+
+    <!-- s -->
+    <Word from="salje" to="šalje" />
+    <Word from="salju" to="šalju" />
+    <Word from="saljes" to="šalješ" />
+    <Word from="sasio" to="sašio" />
+    <Word from="sasila" to="sašila" />
+    <Word from="sasili" to="sašili" />
+    <Word from="sasiti" to="sašiti" />
+    <Word from="savijescu" to="savješću" />
+    <Word from="savescu" to="savješću" />
+    <Word from="sedis" to="sjediš" />
+    <Word from="sedeces" to="sjedit ćeš" />
+    <Word from="sedista" to="sjedala" />
+    <Word from="sediste" to="sjedalo" />
+    <Word from="setala" to="šetala" />
+    <Word from="setam" to="šetam" />
+    <Word from="sendvic" to="sendvič" />
+    <Word from="seva" to="ševa" />
+    <Word from="sevu" to="ševu" />
+    <Word from="sijecanj" to="siječanj" />
+    <Word from="Sidji" to="Siđi" />
+    <Word from="sidji" to="siđi" />
+    <Word from="siroki" to="široki" />
+    <Word from="sjecam" to="sjećam" />
+    <Word from="Sjecam" to="Sjećam" />
+    <Word from="sjecanja" to="sjećanja" />
+    <Word from="sjecanje" to="sjećanje" />
+    <Word from="sjecaju" to="sjećaju" />
+    <Word from="slicno" to="slično" />
+    <Word from="sledeca" to="sljedeća" />
+    <Word from="sledeci" to="sljedeći" />
+    <Word from="Sledeci" to="Sljedeći" />
+    <Word from="Sledece" to="Sljedeće" />
+    <Word from="slucaja" to="slučaja" />
+    <Word from="sljedeci" to="sljedeći" />
+    <Word from="Sljedeci" to="Sljedeći" />
+    <Word from="skace" to="skače" />
+    <Word from="skaci" to="skači" />
+    <Word from="skacu" to="skaču" />
+    <Word from="Skotska" to="Škotska" />
+    <Word from="Skotskoj" to="Škotskoj" />
+    <Word from="skrt" to="škrt" />
+    <Word from="skrte" to="škrte" />
+    <Word from="slozio" to="složio" />
+    <Word from="slozila" to="složila" />
+    <Word from="slozili" to="složili" />
+    <Word from="sloziti" to="složiti" />
+    <Word from="smece" to="smeće" />
+    <Word from="smesak" to="smješak" />
+    <Word from="Smijes" to="Smiješ" />
+    <Word from="smijes" to="smiješ" />
+    <Word from="smraci" to="smrači" />
+    <Word from="smracilo" to="smračilo" />
+    <Word from="smrcu" to="smrću" />
+    <Word from="sokiras" to="šokiraš" />
+    <Word from="spominjes" to="spominješ" />
+    <Word from="srljas" to="srljaš" />
+    <Word from="Sta" to="Što" />
+    <Word from="stagod" to="što god" />
+    <Word from="sta" to="što" />
+    <Word from="stab" to="stožer" />
+    <Word from="Stab" to="Stožer" />
+    <Word from="standa" to="štanda" />
+    <Word from="standu" to="štandu" />
+    <Word from="stavis" to="staviš" />
+    <Word from="stp" to="što" />
+    <Word from="spavaca" to="spavaća" />
+    <Word from="spavacoj" to="spavaćoj" />
+    <Word from="srdacan" to="srdačan" />
+    <Word from="srecom" to="srećom" />
+    <Word from="sresce" to="srest će" />
+    <Word from="srešce" to="srest će" />
+    <Word from="stampa" to="tisak" />
+    <Word from="stampu" to="tisak" />
+    <Word from="stampom" to="tiskom" />
+    <Word from="stampi" to="tisku" />
+    <Word from="stampati" to="tiskati" />
+    <Word from="steceni" to="stečeni" />
+    <Word from="stici" to="stići" />
+    <Word from="strasan" to="strašan" />
+    <Word from="strasno" to="strašno" />
+    <Word from="sudeci" to="sudeći" />
+    <Word from="sudenja" to="suđenja" />
+    <Word from="sudenje" to="suđenje" />
+    <Word from="sudenju" to="suđenju" />
+    <Word from="sugerisu" to="predlažu" />
+    <Word from="sumnjas" to="sumnjaš" />
+    <Word from="sumska" to="šumska" />
+    <Word from="sumski" to="šumski" />
+    <Word from="sumskoj" to="šumskoj" />
+    <Word from="supak" to="šupak" />
+    <Word from="suti" to="šuti" />
+    <Word from="Suti" to="Šuti" />
+    <Word from="sustina" to="bit" />
+    <Word from="sustinski" to="bitni" />
+    <Word from="svacije" to="svačije" />
+    <Word from="svaciji" to="svačiji" />
+    <Word from="svaciju" to="svačiju" />
+    <Word from="svecan" to="svečan" />
+    <Word from="svecani" to="svečani" />
+    <Word from="Svida" to="Sviđa" />
+    <Word from="svidam" to="sviđam" />
+    <Word from="svidala" to="sviđala" />
+    <Word from="svidalo" to="sviđalo" />
+    <Word from="svidao" to="sviđao" />
+    <!--t-->
+    <Word from="takode" to="također" />
+    <Word from="takodje" to="također" />
+    <Word from="Takodje" to="Također" />
+    <Word from="takoder" to="također" />
+    <Word from="taknes" to="takneš" />
+    <Word from="teska" to="teška" />
+    <Word from="Teska" to="Teška" />
+    <Word from="teske" to="teške" />
+    <Word from="teski" to="teški" />
+    <Word from="tesko" to="teško" />
+    <Word from="Tesko" to="Teško" />
+    <Word from="teskom" to="teškom" />
+    <Word from="tezak" to="težak" />
+    <Word from="Tezak" to="Težak" />  
+    <Word from="tisucu" to="tisuću" />
+    <Word from="tisuce" to="tisuće" />
+    <Word from="trazis" to="tražiš" />
+    <Word from="Tocak" to="Kotač" />
+    <Word from="tocak" to="kotač" />
+    <Word from="tocka" to="točka" />
+    <Word from="tocku" to="točku" />
+    <Word from="tece" to="teče" />
+    <Word from="teze" to="teže" />
+    <Word from="tezi" to="teži" />
+    <Word from="tezis" to="težiš" />
+    <Word from="tezinu" to="težinu" />
+    <Word from="tezimo" to="težimo" />
+    <Word from="Tezi" to="Teži" />
+    <Word from="Teziš" to="Težiš" />
+    <Word from="Tezimo" to="Težimo" />
+    <Word from="trajace" to="trajat će" />
+    <Word from="Trajace" to="Trajat će" />
+    <Word from="trci" to="trči" />
+    <Word from="trcim" to="trčim" />
+    <Word from="treci" to="treći" />
+    <Word from="trcao" to="trčao" />
+    <Word from="trebas" to="trebaš" />
+    <Word from="Trebas" to="Trebaš" />
+    <Word from="trudis" to="trudiš" />
+    <Word from="tuces" to="tučeš" />
+    <Word from="tucu" to="tučnjavu" />
+    <Word from="tuce" to="tuče" />
+    <Word from="tucom" to="tučom" />
+    <Word from="tudje" to="tuđe" />
+    <Word from="tudjeg" to="tuđeg" />
+    <Word from="tudjem" to="tuđem" />
+    <Word from="tumaras" to="tumaraš" />
+    <Word from="tvoris" to="tvoriš" />
+    <!--u-->
+    <Word from="ubijes" to="ubiješ" />
+    <Word from="Ubijes" to="Ubiješ" />
+    <Word from="uci" to="ući" />
+    <Word from="ucio" to="učio" />
+    <Word from="Ucio" to="Učio" />
+    <Word from="ucinimo" to="učinimo" />
+    <Word from="ucinio" to="učinio" />
+    <Word from="udas" to="udaš" />
+    <Word from="udi" to="uđi" />
+    <Word from="Udi" to="Uđi" />
+    <Word from="Udji" to="Uđi" />
+    <Word from="udji" to="uđi" />
+    <Word from="Udje" to="Uđe" />
+    <Word from="udje" to="uđe" />
+    <Word from="udeš" to="udeš" />
+    <Word from="Udju" to="Uđu" />
+    <Word from="udjes" to="uđeš" />
+    <Word from="ucine" to="učine" />
+    <Word from="ukljucujuci" to="uključujući" />
+    <Word from="umiruci" to="umirući" />
+    <Word from="umes" to="umiješ" />
+    <Word from="umrecu" to="umrijet ću" />
+    <Word from="unistice" to="uništit će" />
+    <Word from="ubedjuju" to="uvjeravaju" />
+    <Word from="ubeduju" to="uvjeravaju" />
+    <Word from="ubedujuci" to="uvjeravajući" />
+    <Word from="uceni" to="učeni" />
+    <Word from="uopce" to="uopće" />
+    <Word from="ugriscu" to="ugrist ću" />
+    <Word from="Uopce" to="Uopće" />
+    <Word from="Uopste" to="Uopće" />
+    <Word from="uopste" to="uopće" />
+    <Word from="usao" to="ušao" />
+    <Word from="uspanicio" to="uspaničio" />
+    <Word from="Usao" to="Ušao" />
+    <Word from="utapas" to="utapaš" />
+    <Word from="utesi" to="utješi" />
+    <Word from="utesim" to="utješim" />
+    <Word from="uradis" to="učiniš" />
+    <Word from="uzinu" to="užinu" />
+    <Word from="uzivo" to="uživo" />
+    <!--v-->
+    <Word from="valda" to="valjda" />
+    <Word from="vasa" to="vaša" />
+    <Word from="vasem" to="vašem" />
+    <Word from="vaseg" to="vašeg" />
+    <Word from="Vaseg" to="Vašeg" />
+    <Word from="vasoj" to="vašoj" />
+    <Word from="vasi" to="vaši" />
+    <Word from="vazi" to="vrijedi" />
+    <Word from="vecan" to="vječan" />
+    <Word from="vecih" to="većih" />
+    <Word from="vecitim" to="vječitim" />
+    <Word from="Vec" to="Već" />
+    <Word from="vec" to="već" />
+    <Word from="vecna" to="vječna" />
+    <Word from="vecno" to="vječno" />
+    <Word from="vecnost" to="vječnost" />
+    <Word from="Veceras" to="Večeras" />
+    <Word from="vecera" to="večera" />
+    <Word from="vecere" to="večere" />
+    <Word from="veceri" to="večeri" />
+    <Word from="veceru" to="večeru" />
+    <Word from="veceras" to="večeras" />
+    <Word from="verovacu" to="vjerovat ću" />
+    <Word from="viden" to="viđen" />
+    <Word from="Viden" to="Viđen" />
+    <Word from="vishe" to="više" />
+    <Word from="vjerujes" to="vjeruješ" />
+    <Word from="vjencati" to="vjenčati" />
+    <Word from="vjencali" to="vjenčali" />
+    <Word from="voce" to="voće" />
+    <Word from="vocka" to="voćka" />
+    <Word from="vocku" to="voćku" />
+    <Word from="vocnjak" to="voćnjak" />
+    <Word from="vocnjaku" to="voćnjaku" />
+    <Word from="vodic" to="vodič" />
+    <Word from="vodju" to="vođu" />
+    <Word from="Vozac" to="Vozač" />
+    <Word from="vozac" to="vozač" />
+    <Word from="vozaca" to="vozača" />
+    <Word from="vracam" to="vraćam" />
+    <Word from="vracen" to="vračen" />
+    <Word from="vreca" to="vreča" />
+    <Word from="vrece" to="vreće" />
+    <Word from="vrecu" to="vreću" />
+    <Word from="vredjanje" to="vrijeđanje" />
+    <Word from="vredja" to="vrijeđa" />
+    <Word from="vrticu" to="vrtiću" />
+
+    <!--z-->
+    <Word from="zaduzen" to="zadužen" />
+    <Word from="Zaduzen" to="Zadužen" />
+    <Word from="zarucen" to="zaručen" />
+    <Word from="zacepe" to="začepe" />
+    <Word from="Zacepi" to="Začepi" />
+    <Word from="zapoceli" to="započeli" />
+    <Word from="zasto" to="zašto" />
+    <Word from="Zasto" to="Zašto" />
+    <Word from="zateci" to="zateći" />
+    <Word from="Zele" to="Žele" />
+    <Word from="zele" to="žele" />
+    <Word from="zelila" to="željela" />
+    <Word from="zene" to="žene" />
+    <Word from="zenke" to="ženke" />
+    <Word from="zesce" to="žešće" />
+    <Word from="zezas" to="zezaš" />
+    <Word from="zita" to="žita" />
+    <Word from="zito" to="žito" />
+    <Word from="zitu" to="žitu" />
+    <Word from="ziv" to="živ" />
+    <Word from="ziva" to="živa" />
+    <Word from="zive" to="žive" />
+    <Word from="zivi" to="živi" />
+    <Word from="zivis" to="živiš" />
+    <Word from="Živeo" to="Živio" />
+    <Word from="zivjeo" to="živio" />
+    <Word from="Zivjeo" to="Živio" />
+    <Word from="zlocestom" to="zločestom" />
+    <Word from="zlocestog" to="zločestog" />
+    <Word from="zlocestoj" to="zločestoj" />
+    <Word from="zmureo" to="žmirio" />
+    <Word from="znacaj" to="značaj" />
+    <Word from="znacaja" to="značaja" />
+    <Word from="znace" to="znače" />
+    <Word from="znaceš" to="znat ćeš" />
+    <Word from="znas" to="znaš" />
+    <Word from="Znas" to="Znaš" />
+    <Word from="zuris" to="zuriš" />
+    <Word from="zvanican" to="služben" />
+
+  </WholeWords>
+  <PartialWordsAlways />
+  <PartialWords />
+  <PartialLines>
+    <LinePart from="da nadjem" to="naći" />
+    <LinePart from="da budes" to="biti" />
+    <LinePart from="da ides" to="ići" />
+    <LinePart from="gdje ides" to="kamo ideš" />
+    <LinePart from="Gdje ides" to="Kamo ideš" />
+    <LinePart from="hocu da budem" to="želim biti" />
+    <LinePart from="Hocu da budem" to="Želim biti" />
+    <LinePart from="hocu da kazem" to="želim reći" />
+    <LinePart from="hoces da kazes" to="želiš reći" />
+    <LinePart from="hoce da kaze" to="želi reći" />
+    <LinePart from="medu nama" to="među nama" />
+    <LinePart from="moramo da idemo" to="moramo ići" />
+    <LinePart from="moras da ides" to="moraš ići" />
+    <LinePart from="na vecer" to="navečer" />
+    <LinePart from="Na vecer" to="Navečer" />
+    <LinePart from="ne cu" to="neću" />
+    <LinePart from="ne ces" to="nećeš" />
+    <LinePart from="ono sto" to="ono što" />
+    <LinePart from="Zao mi" to="Žao mi" />
+    <LinePart from="zao mi" to="žao mi" />
+    <LinePart from="Zato sto" to="Zato što" />
+    <LinePart from="zato sto" to="zato što" />
+  </PartialLines>
+  <PartialLinesAlways />
+  <BeginLines />
+  <EndLines />
+  <WholeLines />
+  <RegularExpressions>
+    <RegEx find="acma" replaceWith="ačma" />
+    <RegEx find="(?&lt;![Pp]r|[Nn])adje(?!(v|n(e|u[olt]))\b)" replaceWith="ađe" />
+    <RegEx find="ndj?el" replaceWith="nđel" />
+    <RegEx find="areduj" replaceWith="aređuj" />
+    <RegEx find="(?&lt;![ou])ndje" replaceWith="nđe" />
+    <RegEx find="([0-9])-ogodisnj([aeiu])\b" replaceWith="$1-godišnj$2" />
+    <RegEx find="(cetr|ses)najst([aeiou]|i[mh]|o[mgj]|ima)\b" replaceWith="$1naest$2" />
+    <RegEx find="ajsmijesnij" replaceWith="ajsmješnij" />
+    <RegEx find="avljas" replaceWith="avljaš" />
+    <RegEx find="bastensk" replaceWith="vrtn" />
+    <RegEx find="beres" replaceWith="bereš" />
+    <RegEx find="([bB])elesk" replaceWith="$1ilješk" />
+    <RegEx find="([bB])elez" replaceWith="$1iljež" />
+    <RegEx find="\b([bBpP])ice(s|mo|te)\b" replaceWith="$1it će$2" />
+    <RegEx find="\b([bBpP])iti +c([ue]s?|emo|ete)\b" replaceWith="$1it ć$2" />
+    <RegEx find="eznadez" replaceWith="eznad" />
+    <RegEx find="([bB])ezanj" replaceWith="$1ježanj" />
+    <RegEx find="([bB])i?j?ez([ei]|i[ms]|imo|ite|ao|al[aeio]|ati)\b" replaceWith="$1jež$2" />
+    <RegEx find="boljs" replaceWith="boljš" />
+    <RegEx find="([bB])oric" replaceWith="$1orit ć" />
+    <RegEx find="([bB])ozij([aeiu]|om|ima)?\b" replaceWith="$1ožj$2" />
+    <RegEx find="[bB]o[zž]ic([aeiun]|em|ima)?\b" replaceWith="Božić$1" />
+    <RegEx find="bracun" replaceWith="bračun" />
+    <RegEx find="([bB])udu[cč]" replaceWith="$1uduć" />
+    <RegEx find="([cCsS])vj?ec([aeiou]|[oe]m|ama)\b" replaceWith="$1vijeć$2" />
+    <RegEx find="[Cc]acka" replaceWith="čačka" />
+    <RegEx find="[cC]amac" replaceWith="čamac" />
+    <RegEx find="[cC]amc" replaceWith="čamc" />
+    <RegEx find="\bcaro" replaceWith="čaro" />
+    <RegEx find="Caroli(?!n)" replaceWith="Čaroli" />
+    <RegEx find="cast" replaceWith="čast" />
+    <RegEx find="Cast" replaceWith="Čast" />
+    <RegEx find="cas([au]|om|ovima)\b" replaceWith="sat$1" />
+    <RegEx find="Cas([au]|om|ovima)\b" replaceWith="Sat$1" />
+    <RegEx find="[cC]ascen" replaceWith="čašćen" />
+    <RegEx find="\bc([eu]|emo|ete)\b" replaceWith="ć$1" />
+    <RegEx find="\bC([eu]|emo|ete)\b" replaceWith="Ć$1" />
+    <RegEx find="\b[cC]([ae])k\b" replaceWith="č$1k" />
+    <RegEx find="[cC]ek" replaceWith="ček" />
+    <RegEx find="[cC]ekov" replaceWith="čekov" />
+    <RegEx find="celij" replaceWith="ćelij" />
+    <RegEx find="[cC]etvrt" replaceWith="četvrt" />
+    <RegEx find="cetver" replaceWith="četver" />
+    <RegEx find="[cC]ist" replaceWith="čist" />
+    <RegEx find="[cC]istoc" replaceWith="čistoć" />
+    <RegEx find="[cC]isce" replaceWith="čišće" />
+    <RegEx find="[cC]ita" replaceWith="čita" />
+    <RegEx find="\bcin" replaceWith="čin" />
+    <RegEx find="\bCin" replaceWith="Čin" />
+    <RegEx find="[cC]lan" replaceWith="član" />
+    <RegEx find="[cC]okolad" replaceWith="čokolad" />
+    <RegEx find="[cC]ovi?j?ek" replaceWith="čovjek" />
+    <RegEx find="[cC]uda" replaceWith="čuda" />
+    <RegEx find="[cC]udes" replaceWith="čudes" />
+    <RegEx find="[cC]udn" replaceWith="čudn" />
+    <RegEx find="[cCČč]udovi[sš]" replaceWith="čudoviš" />
+    <RegEx find="\b[cC]uje" replaceWith="čuje" />
+    <RegEx find="[cC]u([vlp])a" replaceWith="ču$1a" />
+    <RegEx find="cut([ei])" replaceWith="šut$1" />
+    <RegEx find="Cut([ei])" replaceWith="Šut$1" />
+    <RegEx find="cuta([ltšv])" replaceWith="šutje$1" />
+    <RegEx find="Cuta([ltšv])" replaceWith="Šutje$1" />
+    <RegEx find="[cC]vrst" replaceWith="čvrst" />
+    <RegEx find="\b([dD])ac([eu])" replaceWith="$1at ć$2" />
+    <RegEx find="dj?avol" replaceWith="vrag" />
+    <RegEx find="([Dd])eck" replaceWith="$1ečk" />
+    <RegEx find="([dD])j?evojcic" replaceWith="$1jevojčic" />
+    <RegEx find="\b([dD])elic" replaceWith="$1jelić" />
+    <RegEx find="\b([dD])j?elis\b" replaceWith="$1ijeliš" />
+    <RegEx find="\b([dD])ecic([aeiou]|om)\b" replaceWith="$1ječic$2" />
+    <RegEx find="([dD])j?eca([kc])" replaceWith="$1ječa$2" />
+    <RegEx find="([dD])eci?j([aeiou])" replaceWith="$1ječj$2" />
+    <RegEx find="\b([dD])esic" replaceWith="$1ogodit ć" />
+    <RegEx find="dnoslj" replaceWith="dnošlj" />
+    <RegEx find="\b([dD])omac" replaceWith="$1omać" />
+    <RegEx find="ogada" replaceWith="ogađa" />
+    <RegEx find="osaduj" replaceWith="osađuj" />
+    <RegEx find="\b([dD])rustv" replaceWith="$1ruštv" />
+    <RegEx find="drzim" replaceWith="držim" />
+    <RegEx find="([dD])o[bc]ic([eu])" replaceWith="$1oći ć$2" />
+    <RegEx find="\b([dDpP])o(d?)nj?ec([eu])" replaceWith="$1o$2nijet ć$3" />
+    <RegEx find="([dDpP])ovesc([eu])" replaceWith="$1ovest ć$2" />
+    <RegEx find="\bd[jz]ep" replaceWith="džep" />
+    <RegEx find="\bD[jz]ep" replaceWith="Džep" />
+    <RegEx find="([dD])osao" replaceWith="$1ošao" />
+    <!-- posao i pošao je drugačije pa ne može biti uopće u skripti -->
+    <RegEx find="([dD])osl([aio])\b" replaceWith="$1ošl$2" />
+    <RegEx find="([dD])rza([volt])" replaceWith="$1rža$2" />
+    <RegEx find="dsijekl" replaceWith="dsjekl" />
+    <RegEx find="([dD])us([aeiou])" replaceWith="$1uš$2" />
+    <RegEx find="dzigeric" replaceWith="jetr" />
+    <RegEx find="Dzigeric" replaceWith="Jetr" />
+    <RegEx find="([dD])zinovsk" replaceWith="$1ivovsk" />
+    <RegEx find="gipcan" replaceWith="gipćan" />
+    <RegEx find="entise" replaceWith="entira" />
+    <RegEx find="eskuc" replaceWith="eskuć" />
+    <RegEx find="onise" replaceWith="onira" />
+    <RegEx find="gadanj" replaceWith="gađanj" />
+    <RegEx find="([gG])dj(?!e)" replaceWith="$1đ" />
+    <RegEx find="([gG])ledac" replaceWith="$1ledat ć" />
+    <RegEx find="\b([gG])radj?([ae])n" replaceWith="$1rađ$2n" />
+    <RegEx find="\b([gG])rijesn" replaceWith="$1rješn" />
+    <RegEx find="([gG])rj?esi([smotl])" replaceWith="$1riješi$2" />
+    <RegEx find="([gG])reska" replaceWith="$1reška" />
+    <RegEx find="([hH])oce(š|mo|te)?\b" replaceWith="$1oće$2" />
+    <RegEx find="([hH])o[cć]es" replaceWith="$1oćeš" />
+    <RegEx find="hri?scan" replaceWith="kršćan" />
+    <RegEx find="Hri?scan" replaceWith="Kršćan" />
+    <RegEx find="hronicn" replaceWith="kroničn" />
+    <RegEx find="Hronicn" replaceWith="Kroničn" />
+    <RegEx find="ijeci([lt])" replaceWith="iječi$1" />
+    <RegEx find="gnorise" replaceWith="gnorira" />
+    <RegEx find="gnori[sš]e[sš]" replaceWith="gnoriraš" />
+    <RegEx find="ilack" replaceWith="ilačk" />
+    <RegEx find="\b([iI])mac([eu]|es|emo|ete)\b" replaceWith="$1mat ć$2" />
+    <RegEx find="\b([iI])mas" replaceWith="$1maš" />
+    <RegEx find="([iI])nace" replaceWith="$1nače" />
+    <RegEx find="nsistirac" replaceWith="nzistirat ć" />
+    <RegEx find="([iI])zadj([ei])" replaceWith="$1zađ$2" />
+    <RegEx find="zbec" replaceWith="zbjeć" />
+    <RegEx find="nadj?en" replaceWith="nađen" />
+    <RegEx find="([iI])scezn" replaceWith="$1ščezn" />
+    <RegEx find="(?&lt;![ŠšSs])([Pp])rica" replaceWith="$1riča" />
+    <RegEx find="([iI])znj?ec" replaceWith="$1znijet ć" />
+    <RegEx find="zvesta" replaceWith="zvješta" />
+    <RegEx find="zvj?esc" replaceWith="zvješć" />
+    <RegEx find="jacanj" replaceWith="jačanj" />
+    <RegEx find="jevandjelj" replaceWith="evanđelj" />
+    <RegEx find="kasi[kc]" replaceWith="žlic" />
+    <RegEx find="Kasi[kc]" replaceWith="Žlic" />
+    <RegEx find="([kKLl])aze([mt])" replaceWith="$1aže$2" />
+    <RegEx find="([kKLl])azes" replaceWith="$1ažeš" />
+    <RegEx find="([kK])aznjava" replaceWith="$1ažnjava" />
+    <RegEx find="kcerk[eio]" replaceWith="kćeri" />
+    <RegEx find="Kcerk[eio]" replaceWith="Kćeri" />
+    <RegEx find="kljuc" replaceWith="ključ" />
+    <RegEx find="oledz" replaceWith="oledž" />
+    <RegEx find="\b([kK])olicin" replaceWith="$1oličin" />
+    <RegEx find="arise" replaceWith="ira" />
+    <RegEx find="komsijsk" replaceWith="susjedn" />
+    <RegEx find="onacn" replaceWith="onačn" />
+    <RegEx find="krecu" replaceWith="kreću" />
+    <RegEx find="centrise" replaceWith="centrira" />
+    <RegEx find="centrisi" replaceWith="centriraj" />
+    <RegEx find="trolise" replaceWith="trolira" />
+    <RegEx find="([kK])ori[sš]cen" replaceWith="$1orišten" />
+    <RegEx find="([kKTtSs])rece" replaceWith="$1reće" />
+    <RegEx find="rivicn" replaceWith="aznen" />
+    <RegEx find="krsten" replaceWith="kršten" />
+    <RegEx find="([kK])uck" replaceWith="$1uj" />
+    <RegEx find="([kK])uc([iueo]|no)" replaceWith="$1uć$2" />
+    <RegEx find="kupic" replaceWith="kupit ć" />
+    <RegEx find="\b([kK])rstask([aeiou]|om)?\b" replaceWith="$1rižarsk$2" />
+    <RegEx find="\b([lL])j?eci([stol])?" replaceWith="$1iječi$2" />
+    <RegEx find="([lL])j?ecni([kc])" replaceWith="$1iječni$2" />
+    <RegEx find="\b([lL])j?ecen" replaceWith="$1iječen" />
+    <RegEx find="\b([lL])aks" replaceWith="$1akš" />
+    <RegEx find="laksava" replaceWith="akšava" />
+    <RegEx find="([lL])eps" replaceWith="$1jepš" />
+    <RegEx find="[lL]isce" replaceWith="lišće" />
+    <RegEx find="locest" replaceWith="ločest" />
+    <RegEx find="([lL])ogic([kn])" replaceWith="$1ogič$2" />
+    <RegEx find="\blicn([aeiou]|im|o[mgj])" replaceWith="osobn$1" />
+    <RegEx find="\bLicn([aeiou]|im|o[mgj])" replaceWith="Osobn$1" />
+    <RegEx find="\b([lL])os([aeiu]|o[mj]|e[mg])" replaceWith="$1oš$2" />
+    <RegEx find="udack([aeiou]|om)\b" replaceWith="uđa$1" />
+    <RegEx find="\b([Mm])ack" replaceWith="$1ačk" />
+    <RegEx find="(?&lt;![iI]|[kK]a)([mM])j?enjas\b" replaceWith="$1ijenjaš" />
+    <RegEx find="([mM])ast([auoi](?!r))" replaceWith="$1ašt$2" />
+    <!--** besmislicu ?**-->
+    <RegEx find="([mM])islic([eu])" replaceWith="$1islit ć$2" />
+    <RegEx find="mislje" replaceWith="mišlje" />
+    <RegEx find="([mM])j?esalic([aeiou]|ama)\b" replaceWith="$1iješalic$2" />
+    <RegEx find="([mM])j?esa([jmns]|n[aio]|no[mgj]|nima?|mo|ju|njem|nju|l[aeio]|t[ei])\b" replaceWith="$1iješa$2" />
+    <RegEx find="([mM])lj?ecn" replaceWith="$1liječn" />
+    <RegEx find="\b([mMNn])oc([iuna])" replaceWith="$1oć$2" />
+    <RegEx find="([mM])oguc" replaceWith="$1oguć" />
+    <RegEx find="([mM])oras" replaceWith="$1oraš" />
+    <RegEx find="([mM])orac([eu])" replaceWith="$1orat ć$2" />
+    <RegEx find="otivise([mst])" replaceWith="otivira$1" />
+    <RegEx find="medju" replaceWith="među" />
+    <RegEx find="([mMbB])oze" replaceWith="$1ože" />
+    <RegEx find="([mM])o[zž]es" replaceWith="$1ožeš" />
+    <RegEx find="([mM])racn" replaceWith="$1račn" />
+    <RegEx find="([mM])rznj([aeiuo])" replaceWith="$1ržnj$2" />
+    <RegEx find="([mM])rzec([eu])" replaceWith="$1rzit ć$2" />
+    <RegEx find="([mM])uci([mstol])" replaceWith="$1uči$2" />
+    <RegEx find="([mM])uskar" replaceWith="$1uškar" />
+    <RegEx find="uvas" replaceWith="otaš" />
+    <RegEx find="muzick" replaceWith="glazben" />
+    <RegEx find="Muzick" replaceWith="Glazben" />
+    <RegEx find="([nNZz])acel" replaceWith="$1ačel" />
+    <RegEx find="([nN])acin" replaceWith="$1ačin" />
+    <RegEx find="(?&lt;![iI])([nN])acic" replaceWith="$1aći ć" />
+    <RegEx find="([nN])adji" replaceWith="$1ađi" />
+    <RegEx find="aocit" replaceWith="aočit" />
+    <RegEx find="ameravas" replaceWith="amjeravaš" />
+    <RegEx find="amj?enis" replaceWith="amijeniš" />
+    <RegEx find="amesta" replaceWith="amješta" />
+    <RegEx find="aocar(?!k)" replaceWith="aočal" />
+    <RegEx find="(?&lt;![[tT])apise" replaceWith="apiše" />
+    <RegEx find="([nN])as([io])([mj])\b" replaceWith="$1aš$2" />
+    <RegEx find="([nNvV])asi([mh])" replaceWith="$1aši$2" />
+    <RegEx find="\b([nN])asao\b" replaceWith="$1ašao" />
+    <RegEx find="([nN])auci([mstl])" replaceWith="$1auči$2" />
+    <RegEx find="([nN])aucic" replaceWith="$1aučit ć" />
+    <RegEx find="naucn" replaceWith="znanstven" />
+    <RegEx find="Naucn" replaceWith="Znanstven" />
+    <RegEx find="([nN])a?zvac" replaceWith="$1azvat ć" />
+    <RegEx find="([nN])eca([kc])" replaceWith="$1eća$2" />
+    <RegEx find="\b([nN])ec([ue]|emo|ete)\b" replaceWith="$1eć$2" />
+    <RegEx find="([Nn])edac" replaceWith="$1edać" />
+    <RegEx find="\b([nN])ezna(s|juci|vsi)\b" replaceWith="$1e zna$2" />
+    <RegEx find="(?&lt;!j)emack" replaceWith="jemačk" />
+    <RegEx find="([nN])erj?esen" replaceWith="$1eriješen" />
+    <RegEx find="eutralis[eu]" replaceWith="eutralizira" />
+    <RegEx find="\b([nN])ista" replaceWith="$1išta" />
+    <RegEx find="\b([nN])oc([iu]|n[aeiou]|no[mjg]|nim)?" replaceWith="$1oć$2" />
+    <RegEx find="noic" replaceWith="noič" />
+    <RegEx find="\b([nN])ovcan" replaceWith="$1ovčan" />
+    <RegEx find="beca" replaceWith="beća" />
+    <RegEx find="besen" replaceWith="bješen" />
+    <RegEx find="bezbj?edjenj" replaceWith="siguranj" />
+    <RegEx find="bezbj?edjivanj" replaceWith="siguravanj" />
+    <RegEx find="bezbj?edjuje" replaceWith="sigurava" />
+    <RegEx find="([oO])bidj" replaceWith="$1biđ" />
+    <RegEx find="([oO])bicn" replaceWith="$1bičn" />
+    <RegEx find="bozava" replaceWith="božava" />
+    <RegEx find="([oO])brac" replaceWith="$1brać" />
+    <RegEx find="([oO])bucen" replaceWith="$1bučen" />
+    <RegEx find="\b([oO])caj" replaceWith="$1čaj" />
+    <RegEx find="\b([oO])cev" replaceWith="$1čev" />
+    <RegEx find="([oO])cek" replaceWith="$1ček" />
+    <RegEx find="\b([oO])ci" replaceWith="$1či" />
+    <RegEx find="([oO])dbacen" replaceWith="$1dbačen" />
+    <RegEx find="([oO])dl([iu])can" replaceWith="$1dl$2can" />
+    <RegEx find="\b([oO])dj?ec([aeiou]|om)" replaceWith="$1djeć$2" />
+    <RegEx find="\b((?:[oO]|[pP]o|[rR]a|[sS]a)d?)sec" replaceWith="$1sjeć" />
+    <RegEx find="([oO])dvesc([eu])" replaceWith="$1dvest ć$2" />
+    <RegEx find="ogadj?a" replaceWith="ogađa" />
+    <RegEx find="onizav" replaceWith="onižav" />
+    <RegEx find="rosti[cć]" replaceWith="rostit ć" />
+    <RegEx find="([oO])ruzj([aeu])" replaceWith="$1ružj$2" />
+    <RegEx find="([oO])sj?e[cč]a" replaceWith="$1sjeća" />
+    <RegEx find="osjecu" replaceWith="osjeću" />
+    <RegEx find="([oO])slobodić([eu])" replaceWith="$1slobodit ć$2" />
+    <RegEx find="([oO])sta[čć]([eu])" replaceWith="$1stat ć$2" />
+    <RegEx find="([oO])svez" replaceWith="$1svjež" />
+    <RegEx find="([oO])tkri[cč]" replaceWith="$1tkrić" />
+    <RegEx find="([oOSs])tici" replaceWith="$1tići" />
+    <RegEx find="([oO])tis([al])" replaceWith="$1tiš$2" />
+    <RegEx find="zledjen" replaceWith="zlijeđen" />
+    <RegEx find="([pP])az([nl])j" replaceWith="$1až$2j" />
+    <RegEx find="\b([pP])j?es[cć]an" replaceWith="$1ješčan" />
+    <RegEx find="([pP])esa([kc])" replaceWith="$1ješa$2" />
+    <RegEx find="([pP](?:ita|lati|obrinu|okaza|oveza|rica))c" replaceWith="$1t ć" />
+    <RegEx find="istolj" replaceWith="ištolj" />
+    <RegEx find="isuc" replaceWith="išuć" />
+    <RegEx find="([pP])lasi([mslt])" replaceWith="$1laši$2" />
+    <RegEx find="([pP])lace([sn])" replaceWith="$1laće$2" />
+    <RegEx find="(?&lt;![mM])ljacka" replaceWith="ljačka" />
+    <RegEx find="([pP])obj?ec" replaceWith="$1objeć" />
+    <RegEx find="objedis" replaceWith="obijediš" />
+    <RegEx find="([Pp])objeduj" replaceWith="$1objeđuj" />
+    <RegEx find="obacaj" replaceWith="obačaj" />
+    <RegEx find="([pP])oce([tl])" replaceWith="$1oče$2" />
+    <RegEx find="([pPTt])ocn" replaceWith="$1očn" />
+    <RegEx find="\b([pP])o[dt]sj?etis?\b" replaceWith="$1odsjetiš" />
+    <RegEx find="oducava" replaceWith="odučava" />
+    <RegEx find="([pP])ogres" replaceWith="$1greš" />
+    <RegEx find="([pP])ogrj?esi(o|l[aeio]|t[ei])?\b" replaceWith="$1ogriješi$2" />
+    <RegEx find="([pP])okusa([jo])" replaceWith="$1okuša$2" />
+    <RegEx find="([pP])omoc" replaceWith="$1omoć" />
+    <RegEx find="([pP]o|[Ii]z)ludec" replaceWith="$1ludjet ć" />
+    <RegEx find="([pP])onasa" replaceWith="$1onaša" />
+    <RegEx find="porodicn" replaceWith="obiteljsk" />
+    <RegEx find="Porodicn" replaceWith="Obiteljsk" />
+    <RegEx find="([pP])os([lt])ac" replaceWith="$1os$2at ć" />
+    <RegEx find="([pP])osten" replaceWith="$1ošten" />
+    <RegEx find="([pP])ostuje" replaceWith="$1oštuje" />
+    <RegEx find="([pP])ostova" replaceWith="$1oštova" />
+    <RegEx find="([pP])ovredj?en" replaceWith="$1ovrijeđen" />
+    <RegEx find="([pP])ovrj?edis" replaceWith="$1ovrijediš" />
+    <RegEx find="pozoris([tn](?:[aeu]|[eo]m|ima?)?)\b" replaceWith="kazališ$1" />
+    <RegEx find="Pozoris([tn](?:[aeu]|[eo]m|ima?)?)\b" replaceWith="Kazališ$1" />
+    <RegEx find="([pP])ozuri" replaceWith="$1ožuri" />
+    <RegEx find="redjas" replaceWith="rijaš" />
+    <RegEx find="redlaz" replaceWith="redlaž" />
+    <RegEx find="(?&lt;![Šš])([pP])rica" replaceWith="$1riča" />
+    <RegEx find="\b([pP])rilicn" replaceWith="$1riličn" />
+    <RegEx find="romj?enis" replaceWith="romijeniš" />
+    <RegEx find="([pP](?:ri|od))sj?eca" replaceWith="$1sjeća" />
+    <RegEx find="rosec" replaceWith="rosječ" />
+    <RegEx find="rosj?ecn" replaceWith="rosječn" />
+    <RegEx find="roslost" replaceWith="rošlost" />
+    <RegEx find="([pP]r?[io])vesc" replaceWith="$1vest ć" />
+    <RegEx find="rolec" replaceWith="roljeć" />
+    <RegEx find="romj?eniš" replaceWith="romijeniš" />
+    <RegEx find="([pP])ronac" replaceWith="$1ronać" />
+    <RegEx find="([pP])ruzi([lt])" replaceWith="$1ruži$2" />
+    <RegEx find="acun" replaceWith="ačun" />
+    <RegEx find="azlicit" replaceWith="azličit" />
+    <RegEx find="azmislja" replaceWith="azmišlja" />
+    <RegEx find="azumijec" replaceWith="azumjeć" />
+    <RegEx find="(?&lt;!v)ecenic" replaceWith="ečenic" />
+    <RegEx find="ecic" replaceWith="eći ć" />
+    <RegEx find="rivlac" replaceWith="rivlač" />
+    <RegEx find="([^d])rjesit" replaceWith="$1riješit" />
+    <RegEx find="\b([rR])i?j?esava" replaceWith="$1ješava" />
+    <RegEx find="([rR])i?j?esenj([aeiu])" replaceWith="$1ješenj$2" />
+    <RegEx find="\b([rR])jec(i|ima)?\b" replaceWith="$1iječ$2" />
+    <RegEx find="\b([rR])i?j?ecni([kc])" replaceWith="$1ječni$2" />
+    <RegEx find="(?&lt;!t)rocita" replaceWith="ročita" />
+    <RegEx find="([Rr])oden" replaceWith="$1ođen" />
+    <RegEx find="([dDrRvVg])odje" replaceWith="$1ođe" />
+    <RegEx find="([rR])ucak" replaceWith="$1učak" />
+    <RegEx find="ruce" replaceWith="ruće" />
+    <RegEx find="rucio" replaceWith="ručio" />
+    <RegEx find="arud[zž]bin" replaceWith="arudžb" />
+    <RegEx find="([rR])uck([auo])" replaceWith="$1učk$2" />
+    <RegEx find="\b([Rr])uca([lt])" replaceWith="$1uča$2" />
+    <RegEx find="saceka" replaceWith="pričeka" />
+    <RegEx find="Saceka" replaceWith="Pričeka" />
+    <RegEx find="sagarep" replaceWith="mrkv" />
+    <RegEx find="Sagarep" replaceWith="Mrkv" />
+    <RegEx find="([sS])amoc" replaceWith="$1amoć" />
+    <RegEx find="[sS]ans" replaceWith="šans" />
+    <RegEx find="([sS])alj([eu])" replaceWith="$1alj$2" />
+    <RegEx find="saobracaj(?!ac)" replaceWith="promet" />
+    <RegEx find="Saobracaj(?!ac)" replaceWith="Promet" />
+    <RegEx find="aosj?eca" replaceWith="uosjeća" />
+    <RegEx find="aucesni([kc])" replaceWith="udioni$1" />
+    <RegEx find="([sSZZ])avrs([ei])" replaceWith="$1avrš$2" />
+    <RegEx find="azvac" replaceWith="azvat ć" />
+    <RegEx find="azalj?eva" replaceWith="ažalijeva" />
+    <RegEx find="\b([sS])eca([msšo]|mo|t[ei]|ju|l[aeio]|nj[aeu]|njem?)?\b" replaceWith="$1jeća$2" />
+    <RegEx find="([sSŠš])ecer" replaceWith="šećer" />
+    <RegEx find="([sS])edec" replaceWith="$1jedit ć" />
+    <RegEx find="([sS])icusn" replaceWith="$1ićušn" />
+    <RegEx find="([sS])isark" replaceWith="češer" />
+    <RegEx find="([sS])koci" replaceWith="$1koči" />
+    <RegEx find="[sS]kol([aeiu]|om|sk[aeiuo]|sko[mgj])" replaceWith="škol$1" />
+    <RegEx find="([sS])li?j?ede[cč]" replaceWith="$1ljedeć" />
+    <RegEx find="([sS])licn" replaceWith="$1ličn" />
+    <RegEx find="([sS])lucaj" replaceWith="$1lučaj" />
+    <RegEx find="([sS])lusa" replaceWith="$1luša" />
+    <RegEx find="([sS])luz([eb])" replaceWith="$1luž$2" />
+    <RegEx find="\b([sS])jeca[sš]\b" replaceWith="$1jećaš" />
+    <RegEx find="\b([sS])mj?es(n[aeiou]|no[mgj])\b" replaceWith="$1miješ$2" />
+    <RegEx find="mestis" replaceWith="mjestiš" />
+    <RegEx find="([sS])nazn" replaceWith="$1nažn" />
+    <RegEx find="nizen" replaceWith="nižen" />
+    <RegEx find="([sS])okira" replaceWith="šokira" />
+    <RegEx find="([sS])pases" replaceWith="$1pasiš" />
+    <RegEx find="spoljasnj?([aeiu])" replaceWith="vanjsk$1" />
+    <RegEx find="Spoljasnj?([aeiu])" replaceWith="Vanjsk$1" />
+    <RegEx find="([sS])pri?j?ecava" replaceWith="$1prječava" />
+    <RegEx find="([sS])prj?ec([ei])" replaceWith="$1priječ$2" />
+    <RegEx find="rdacn" replaceWith="rdačn" />
+    <RegEx find="([sS])rec([aeiou])" replaceWith="$1reć$2" />
+    <RegEx find="([sS])rec(a?)n" replaceWith="$1ret$2n" />
+    <RegEx find="spijun" replaceWith="špijun" />
+    <RegEx find="Spijun" replaceWith="Špijun" />
+    <RegEx find="([sS])rusi" replaceWith="$1ruši" />
+    <RegEx find="\b([sS])tac([eu])" replaceWith="$1tat ć$2" />
+    <RegEx find="stanes" replaceWith="staneš" />
+    <RegEx find="stomac" replaceWith="trbuš" />
+    <RegEx find="Stomac" replaceWith="Trbuš" />
+    <RegEx find="strasi" replaceWith="straši" />
+    <RegEx find="trucn" replaceWith="tručn" />
+    <RegEx find="sugerise" replaceWith="predlaže" />
+    <RegEx find="Sugerise" replaceWith="Predlaže" />
+    <RegEx find="sustin([eio])" replaceWith="biti" />
+    <RegEx find="Sustin([eio])" replaceWith="Biti" />
+    <RegEx find="vesteni([kc])" replaceWith="većeni$1" />
+    <RegEx find="([sS])vez([aeiu]|[io]m|oj|in[aeiou]|inom)?\b" replaceWith="$1vjež$2" />
+    <RegEx find="([Ss])olj" replaceWith="šalic" />
+    <RegEx find="\bSpanij([aeou])" replaceWith="Španjolsk$1" />
+    <RegEx find="\bSpansk" replaceWith="Španjolsk" />
+    <RegEx find="stabl" replaceWith="stožer" />
+    <RegEx find="Stabl" replaceWith="Stožer" />
+    <RegEx find="stamparsk" replaceWith="tiskovn" />
+    <RegEx find="Stamparsk" replaceWith="Tiskovn" />
+    <RegEx find="[sš]ticen" replaceWith="štićen" />
+    <RegEx find="stedj?e" replaceWith="štedje" />
+    <RegEx find="sicen" replaceWith="sićen" />
+    <RegEx find="eskoc" replaceWith="eškoć" />
+    <RegEx find="trucn" replaceWith="tručn" />
+    <RegEx find="([sS])tize" replaceWith="$1tiže" />
+    <RegEx find="([sS])uoci" replaceWith="$1uoči" />
+    <RegEx find="\b([sS])uti" replaceWith="$1uti" />
+    <RegEx find="resut" replaceWith="rešut" />
+    <RegEx find="([RVrvg])odja" replaceWith="$1ođa" />
+    <RegEx find="([sS])veći" replaceWith="$1vijeći" />
+    <RegEx find="takmicenj" replaceWith="natjecanj" />
+    <RegEx find="Takmicenj" replaceWith="Natjecanj" />
+    <RegEx find="\b([tT])ac(an|n[aeoiu]|no[mgj]|nima?|nij[aeiu]|nij[ei]m|nijoj|k[aeiou]|kama)" replaceWith="$1oč$2" />
+    <RegEx find="ehnic(?!i)" replaceWith="ehnič" />
+    <RegEx find="\b([tT])ice" replaceWith="$1iče" />
+    <RegEx find="ticn" replaceWith="tičn" />
+    <RegEx find="\b([tTSs])rcan" replaceWith="$1rčan" />
+    <RegEx find="\b([tT])re[čc]in" replaceWith="$1rećin" />
+    <RegEx find="\b([tT])rce" replaceWith="$1rče" />
+    <RegEx find="\b([tTDd])rzis" replaceWith="$1ržiš" />
+    <RegEx find="\b([tT])isin" replaceWith="$1išin" />
+    <RegEx find="\b([tT])is([aeiu]|om|e[mg])\b" replaceWith="$1iš$2" />
+    <RegEx find="\b([tT])raz([ei])" replaceWith="$1raž$2" />
+    <RegEx find="\b([nN])etac([an])" replaceWith="$1etoč$2" />
+    <RegEx find="\b([uU])cenj" replaceWith="$1čenj" />
+    <RegEx find="\b([uU])ci([mntl])" replaceWith="$1či$2" />
+    <RegEx find="([uU])ci([lt])" replaceWith="$1či$2" />
+    <RegEx find="paljac" replaceWith="paljač" />
+    <RegEx find="\b([uU])redj" replaceWith="$1ređ" />
+    <RegEx find="([uU])spijes(an|n[aeiou]|no[mgj])" replaceWith="$1spješ$2" />
+    <RegEx find="\b([uU])dje([mst])" replaceWith="$1đe$2" />
+    <RegEx find="\b([uU])sl([aeio])" replaceWith="$1šl$2" />
+    <RegEx find="\b([uU])zasn" replaceWith="$1žasn" />
+    <RegEx find="\b([uU])zec([eu])" replaceWith="$1zet ć$2" />
+    <RegEx find="\b([uU])zmes" replaceWith="$1zmeš" />
+    <RegEx find="\b([uU])ziva" replaceWith="$1živa" />
+    <RegEx find="([vV])as([aeu]|o[jm])\b" replaceWith="$1aš$2" />
+    <RegEx find="([vV]l?)azn([aeiu]|o[mgj])\b" replaceWith="$1ažn$2" />
+    <RegEx find="([vV])ecn" replaceWith="$1ječn" />
+    <RegEx find="([vV])e[cč]in" replaceWith="$1ećin" />
+    <RegEx find="([vV])estin" replaceWith="$1ještin" />
+    <RegEx find="elicin" replaceWith="eličin" />
+    <RegEx find="\b([vV])i?j?enca" replaceWith="$1jenča" />
+    <RegEx find="([vV])j?ezb" replaceWith="$1ježb" />
+    <RegEx find="([vV])idj?ec" replaceWith="$1idjet ć" />
+    <RegEx find="(?&lt;!Da)([vV])idj?a" replaceWith="$1iđa" />
+    <RegEx find="([vV])idis" replaceWith="$1idiš" />
+    <RegEx find="\b([vV])ec([aeiu]|[ei]m|ima|o[mj])?\b" replaceWith="$1eć$2" />
+    <RegEx find="([vV])ezes" replaceWith="$1ezeš" />
+    <RegEx find="\b([vV])ise" replaceWith="$1iše" />
+    <RegEx find="\b([vV])islj" replaceWith="$1iš" />
+    <RegEx find="odj?enj(?!a[kc])" replaceWith="ođenj" />
+    <RegEx find="([vV])olis" replaceWith="$1oliš" />
+    <RegEx find="([vV])olj?ec" replaceWith="$1oljet ć" />
+    <RegEx find="\b([vV])ozic([eu])" replaceWith="$1ozit ć$2" />
+    <RegEx find="([vV])rac" replaceWith="$1rač" />
+    <RegEx find="vrsen" replaceWith="vršen" />
+    <RegEx find="\b([vV])ratic" replaceWith="$1ratit ć" />
+    <RegEx find="zalost" replaceWith="žalost" />
+    <RegEx find="zalosna" replaceWith="žalosna" />
+    <RegEx find="zalosno" replaceWith="žalosno" />
+    <RegEx find="zalosni" replaceWith="žalosni" />
+    <RegEx find="zalosc" replaceWith="žalošć" />
+    <RegEx find="gorca" replaceWith="gorča" />
+    <RegEx find="ahtjevas" replaceWith="ahtijevaš" />
+    <RegEx find="\bz([ae])li" replaceWith="ž$1li" />
+    <RegEx find="\bZ([ae])li" replaceWith="Ž$1li" />
+    <RegEx find="[zZ]alic" replaceWith="žalit ć" />
+    <RegEx find="apo[cč]mi" replaceWith="apočni" />
+    <RegEx find="asluzuj" replaceWith="aslužuj" />
+    <RegEx find="([zZ])astit" replaceWith="$1aštit" />
+    <RegEx find="astrasujuc" replaceWith="astrašujuć" />
+    <RegEx find="[zZ]edn" replaceWith="žedn" />
+    <RegEx find="\b[zZ]en([aeui]|om|io|il[aei]|sk)" replaceWith="žen$1" />
+    <RegEx find="[zZ]eli([mt])" replaceWith="želi$1" />
+    <RegEx find="[zZ]ele([ltz])" replaceWith="želje$1" />
+    <RegEx find="[zZ]elil" replaceWith="željel" />
+    <RegEx find="[zZ]eli[sš]" replaceWith="želiš" />
+    <RegEx find="[zZ]elj?eo" replaceWith="želio" />
+    <RegEx find="[zZ]elj([aeiou])" replaceWith="želj$1" />
+    <RegEx find="zidem" replaceWith="ziđem" />
+    <RegEx find="\b[zZ]ive([lt])" replaceWith="živje$1" />
+    <RegEx find="[zZ]ivec([eu])" replaceWith="živjet ć$1" />
+    <RegEx find="([žŽ])ive([lt])" replaceWith="$1ivje$2" />
+    <RegEx find="[zZ]ivi([mšt])" replaceWith="živi$1" />
+    <RegEx find="[zZ]ivo([mgjt])" replaceWith="živo$1" />
+    <RegEx find="[zZ]lj?ezd([aeiou])" replaceWith="žlijezd$1" />
+    <RegEx find="\b([zZ])locin" replaceWith="$1ločin" />
+    <RegEx find="zluduj" replaceWith="zluđuj" />
+    <RegEx find="znajes" replaceWith="znaješ" />
+    <RegEx find="zopacen" replaceWith="zopačen" />
+    <RegEx find="dajes" replaceWith="daješ" />
+    <RegEx find="zur[ck]" replaceWith="zabav" />
+    <RegEx find="Zur[ck]" replaceWith="Zabav" />
+    <RegEx find="zvanicn" replaceWith="služben" />
+    <RegEx find="Zvanicn" replaceWith="Služben" />
+    <RegEx find="zvecark" replaceWith="zvečark" />
+    <RegEx find="([zZ])vuca([lto])" replaceWith="$1vuča$2" />
+    <RegEx find="\b([zZ])vuci" replaceWith="$1vuči" />
+    <!-- yxy experimental -->
+    <RegEx find="([aez])vrsi" replaceWith="$1vrši" />
+    <RegEx find="aces" replaceWith="aćeš" />
+    <RegEx find="agicn" replaceWith="agičn" />
+    <RegEx find="ajvec" replaceWith="ajveć" />
+    <RegEx find="amcen" replaceWith="amčen" />
+    <RegEx find="antic([nk])" replaceWith="antič$1" />
+    <RegEx find="aredj" replaceWith="aređ" />
+    <RegEx find="arezlj" replaceWith="arežlj" />
+    <RegEx find="aruci" replaceWith="aruči" />
+    <RegEx find="asticn" replaceWith="astičn" />
+    <RegEx find="avlac" replaceWith="avlač" />
+    <RegEx find="azoc" replaceWith="azoč" />
+    <RegEx find="bacen" replaceWith="bačen" />
+    <RegEx find="bicaj" replaceWith="bičaj" />
+    <RegEx find="bivse" replaceWith="bivše" />
+    <RegEx find="blizn" replaceWith="bližn" />
+    <RegEx find="buden" replaceWith="buđen" />
+    <RegEx find="cemo" replaceWith="ćemo" />
+    <RegEx find="ucestvuj" replaceWith="sudjeluj" />
+    <RegEx find="cinje" replaceWith="činje" />
+    <RegEx find="[Cc]injenicn" replaceWith="činjeničn" />
+    <RegEx find="cisc" replaceWith="čišć" />
+    <RegEx find="Cisc" replaceWith="Čišć" />
+    <RegEx find="dacn" replaceWith="dačn" />
+    <RegEx find="dace" replaceWith="dat će" />
+    <RegEx find="daces" replaceWith="dat ćeš" />
+    <RegEx find="dinacn" replaceWith="dinačn" />
+    <RegEx find="dlucn" replaceWith="dlučn" />
+    <RegEx find="dlucuj" replaceWith="dlučuj" />
+    <RegEx find="djit" replaceWith="đit" />
+    <RegEx find="djuj" replaceWith="đuj" />
+    <RegEx find="djujes" replaceWith="đuješ" />
+    <RegEx find="draz([ao])" replaceWith="draž$1" />
+    <RegEx find="(?&lt;!a)druzi" replaceWith="druži" />
+    <RegEx find="([dD])rzi([ia](?!k))" replaceWith="$1rž$2" />
+    <RegEx find="e[cć]as" replaceWith="ećaš" />
+    <RegEx find="emo[zž]e" replaceWith="e može" />
+    <RegEx find="(?&lt;![Rr])eces" replaceWith="ećeš" />
+    <RegEx find="enadjen" replaceWith="enađen" />
+    <RegEx find="erisu" replaceWith="eriraju" />
+    <RegEx find="esavin" replaceWith="ešavin" />
+    <RegEx find="estace[sš]" replaceWith="estat ćeš" />
+    <RegEx find="eticn" replaceWith="etičn" />
+    <RegEx find="fise" replaceWith="fira" />
+    <RegEx find="frick" replaceWith="fričk" />
+    <!-- popravlja i iz/nad/gledaš -->
+    <RegEx find="gledas" replaceWith="gledaš" />
+    <RegEx find="granicava" replaceWith="graničava" />
+    <RegEx find="grisc(?!i)" replaceWith="grist ć" />
+    <RegEx find="guslj" replaceWith="gušlj" />
+    <RegEx find="gusi" replaceWith="guši" />
+    <RegEx find="(?&lt;!\b[oO]zlo|\b[iI]sp(rip)?ov|i)jedjen" replaceWith="ijeđen" />
+    <RegEx find="hic(k|en)" replaceWith="hić$1" />
+    <RegEx find="hoticn" replaceWith="hotičn" />
+    <RegEx find="hvaca" replaceWith="hvaća" />
+    <RegEx find="hvacas" replaceWith="hvaćaš" />
+    <RegEx find="hva([lt])is" replaceWith="hva$1iš" />
+    <RegEx find="(?&lt;![Gg]r|[Ll])icka" replaceWith="ička" />
+    <RegEx find="(?&lt;!M)ick([eoiu])" replaceWith="ičk$1" />
+    <RegEx find="igrac" replaceWith="igrač" />
+    <RegEx find="iznervira" replaceWith="iživcira" />
+    <RegEx find="asnjav" replaceWith="ašnjav" />
+    <RegEx find="jasnic([eu])" replaceWith="jasnit ć$1" />
+    <RegEx find="juci" replaceWith="jući" />
+    <RegEx find="kaslja" replaceWith="kašlja" />
+    <RegEx find="kusava" replaceWith="kušava" />
+    <RegEx find="lican" replaceWith="ličan" />
+    <RegEx find="lacen" replaceWith="lačen" />
+    <RegEx find="l([ae])dj" replaceWith="l$1đ" />
+    <RegEx find="licn" replaceWith="ličn" />
+    <RegEx find="(?&lt;!e)mj?ecen" replaceWith="mjećen" />
+    <RegEx find="([mv])edje" replaceWith="$1eđe" />
+    <RegEx find="micn" replaceWith="mičn" />
+    <RegEx find="miruce" replaceWith="miruće" />
+    <RegEx find="mec([eu])" replaceWith="meć$1" />
+    <RegEx find="mrsav" replaceWith="mršav" />
+    <RegEx find="naranc" replaceWith="naranč" />
+    <RegEx find="nacenj" replaceWith="načenj" />
+    <RegEx find="(?&lt;![Rr]evo)lucio" replaceWith="lučio" />
+    <RegEx find="(?&lt;!sit)nisem" replaceWith="niram" />
+    <RegEx find="(?&lt;!sit)nises" replaceWith="niraš" />
+    <RegEx find="([rn])adj?en" replaceWith="$1ađen" />
+    <RegEx find="nisemo" replaceWith="niramo" />
+    <RegEx find="nisten" replaceWith="ništen" />
+    <RegEx find="(?&lt;![Ee]t|[Gg]e|[Rr]i|[Tt]am)noc" replaceWith="noć" />
+    <RegEx find="oceju" replaceWith="oće" />
+    <RegEx find="oceo" replaceWith="očeo" />
+    <RegEx find="ocni" replaceWith="očni" />
+    <RegEx find="o([mk])aze" replaceWith="o$1aže" />
+    <RegEx find="sta([jn])es" replaceWith="sta$1eš" />
+    <RegEx find="osvece" replaceWith="osveće" />
+    <RegEx find="ozen" replaceWith="ožen" />
+    <RegEx find="pecific" replaceWith="pecifič" />
+    <RegEx find="plase" replaceWith="plaše" />
+    <RegEx find="ptuz" replaceWith="ptuž" />
+    <RegEx find="pustaj" replaceWith="puštaj" />
+    <RegEx find="pustas" replaceWith="puštaš" />
+    <RegEx find="pusten" replaceWith="pušten" />
+    <RegEx find="racen" replaceWith="raćen" />
+    <RegEx find="reden" replaceWith="ređen" />
+    <RegEx find="redoce" replaceWith="redoče" />
+    <RegEx find="rucin" replaceWith="rućin" />
+    <RegEx find="([lr])adj" replaceWith="$1ađ" />
+    <RegEx find="redje([nm])" replaceWith="ređe$1" />
+    <RegEx find="rocit" replaceWith="ročit" />
+    <RegEx find="ronad" replaceWith="ronađ" />
+    <RegEx find="([KkPp])renes\b" replaceWith="$1reneš" />
+    <RegEx find="sapni" replaceWith="šapni" />
+    <RegEx find="setnj" replaceWith="šetnj" />
+    <RegEx find="sjecni" replaceWith="sječni" />
+    <RegEx find="slusk" replaceWith="slušk" />
+    <RegEx find="slj?edece" replaceWith="sljedeće" />
+    <RegEx find="spesn" replaceWith="spješn" />
+    <RegEx find="splac" replaceWith="splač" />
+    <RegEx find="stand(?!a)" replaceWith="štand" />
+    <RegEx find="sudj?en" replaceWith="suđen" />
+    <RegEx find="tace" replaceWith="tat će" />
+    <RegEx find="tces" replaceWith="t ćeš" />
+    <RegEx find="teza([kv])" replaceWith="teža$1" />
+    <RegEx find="tjece" replaceWith="tječe" />
+    <RegEx find="tjesi" replaceWith="tješi" />
+    <RegEx find="trazi([vo])" replaceWith="traži$1" />
+    <RegEx find="trazuj" replaceWith="tražuj" />
+    <RegEx find="trise" replaceWith="trira" />
+    <RegEx find="trisi" replaceWith="triraj" />
+    <RegEx find="tros([ek])" replaceWith="troš$1" />
+    <RegEx find="tumaci" replaceWith="tumači" />
+    <RegEx find="\b([DdtTRrNn])uzn" replaceWith="$1užn" />
+    <RegEx find="\b([dtDTRr])uzan" replaceWith="$1užan" />
+    <RegEx find="tvrdju" replaceWith="tvrđu" />
+    <RegEx find="tvrden" replaceWith="tvrđen" />
+    <RegEx find="\bujes\b" replaceWith="uješ" />
+    <RegEx find="\bzes\b" replaceWith="žeš" />
+    <RegEx find="ucis" replaceWith="učiš" />
+    <RegEx find="ucice" replaceWith="učit će" />
+    <RegEx find="(?&lt;![Kk]lj)učiće" replaceWith="učit će" />
+    <RegEx find="udju" replaceWith="uđu" />
+    <RegEx find="([Uu])nisti" replaceWith="$1ništi" />
+    <!--busenje je iznimka, ali bušenje nije, dakle češća riječ prevladava-->
+    <RegEx find="usenj" replaceWith="ušenj" />
+    <RegEx find="uspece" replaceWith="uspjet će" />
+    <RegEx find="vazn" replaceWith="važn" />
+    <RegEx find="vadj" replaceWith="vađ" />
+    <RegEx find="vidja" replaceWith="viđa" />
+    <RegEx find="vidja([sš])" replaceWith="viđa$1" />
+    <RegEx find="visis" replaceWith="visiš" />
+    <RegEx find="([Vv])jecn" replaceWith="$1ječn" />
+    <RegEx find="vjezb" replaceWith="vježb" />
+    <RegEx find="(?&lt;!p)rsten" replaceWith="ršten" />
+    <RegEx find="vruc" replaceWith="vruć" />
+    <RegEx find="vuce" replaceWith="vuče" />
+    <RegEx find="([Sso])naci" replaceWith="$1naći" />
+    <RegEx find="([Zz])naci" replaceWith="$1nači" />
+    <RegEx find="([Zz])r?tv" replaceWith="žrtv" />
+    <RegEx find="ziljk" replaceWith="žiljk" />
+    <RegEx find="zitk" replaceWith="žitk" />
+    <RegEx find="zgajivac" replaceWith="zgajivač" />
+    <RegEx find="zogira" replaceWith="žogira" />
+    <!-- preživeo/doživeo/nadživeo etc. -->
+    <RegEx find="zivj?e([lt])i" replaceWith="živje$1i" />
+    <RegEx find="ziveo" replaceWith="živio" />
+    <!-- pozoveš nazoveš sazoveš -->
+    <RegEx find="zoves" replaceWith="zoveš" />
+    <RegEx find="zurb" replaceWith="žurb" />
+    <RegEx find="Zurb" replaceWith="Žurb" />
+    <RegEx find="zvucen" replaceWith="zvučen" />
+  </RegularExpressions>
+</OCRFixReplaceList>
diff --git a/libs/subzero/modification/dictionaries/xml/hun_OCRFixReplaceList.xml b/libs/subzero/modification/dictionaries/xml/hun_OCRFixReplaceList.xml
new file mode 100644
index 000000000..999b7fff0
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/xml/hun_OCRFixReplaceList.xml
@@ -0,0 +1,25 @@
+<OCRFixReplaceList>
+  <WholeWords />
+  <PartialWordsAlways />
+  <PartialWords />
+  <PartialLines />
+  <PartialLinesAlways />
+  <BeginLines />
+  <EndLines />
+  <WholeLines />
+  <RegularExpressions>
+    <!-- nagy I-l javítások -->
+    <RegEx find="([\x41-\x5a\x61-\x7a\xc1-\xfc])II" replaceWith="$1ll" />
+    <RegEx find="II([\x61-\x7a\xe1-\xfc])" replaceWith="ll$1" />
+    <RegEx find="([\x61-\x7a\xe1-\xfc])I" replaceWith="$1l" />
+    <RegEx find="([\x20])I([^aeou\x41-\x5a\xc1-\xdc])" replaceWith="$1l$2" />
+    <RegEx find="\bl([bcdfghjklmnpqrstvwxz])" replaceWith="I$1" />
+    <RegEx find="([\x41-\x5a\xc1-\xdc])I([\x61-\x7a\xe1-\xfc])" replaceWith="$1l$2" />
+    <RegEx find="([\x61-\x7a\xe1-\xfc][\-])I([\x61-\x7a\xe1-\xfc])" replaceWith="$1l$2" />
+    <RegEx find="([\x41-\x5a\xc1-\xdc])I([\-][\x41-\x5a\xc1-\xdc][\x61-\x7a\xe1-\xfc])" replaceWith="$1l$2" />
+    <RegEx find="\b([AEÜÓ])I([^\x41-\x5a\xc1-\xdc])" replaceWith="$1l$2" />
+    <RegEx find="\bI([aáeéiíoóöuúüy\xf5\xfb])" replaceWith="l$1" />
+    <RegEx find="\b(?:II|ll)" replaceWith="Il" />
+    <RegEx find="([\xf5\xfb])I" replaceWith="$1l" />
+  </RegularExpressions>
+</OCRFixReplaceList>
\ No newline at end of file
diff --git a/libs/subzero/modification/dictionaries/xml/nld_OCRFixReplaceList.xml b/libs/subzero/modification/dictionaries/xml/nld_OCRFixReplaceList.xml
new file mode 100644
index 000000000..5f9b0f664
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/xml/nld_OCRFixReplaceList.xml
@@ -0,0 +1,24 @@
+<OCRFixReplaceList>
+  <WholeWords>
+    <Word from="ls" to="Is" />
+    <Word from="ln" to="In" />
+    <Word from="lk" to="Ik" />
+    <Word from="ledereen" to="Iedereen" />
+    <Word from="ledere" to="Iedere" />
+    <Word from="lemand" to="Iemand" />
+  </WholeWords>
+  <PartialWordsAlways />
+  <PartialWords />
+  <PartialLines />
+  <PartialLinesAlways />
+  <BeginLines />
+  <EndLines />
+  <WholeLines />
+  <RegularExpressions>
+    <RegEx find="\blk(?=\p{Ll}{2})" replaceWith="Ik" />
+    <RegEx find="\bln(?=\p{Ll}{2})" replaceWith="In" />
+    <RegEx find="\bls(?=\p{Ll}{2})" replaceWith="Is" />
+    <RegEx find="\beIk" replaceWith="elk" />
+    <RegEx find="\bler(land|se|s|)\b" replaceWith="Ier$1" />
+  </RegularExpressions>
+</OCRFixReplaceList>
\ No newline at end of file
diff --git a/libs/subzero/modification/dictionaries/xml/nob_OCRFixReplaceList.xml b/libs/subzero/modification/dictionaries/xml/nob_OCRFixReplaceList.xml
new file mode 100644
index 000000000..64007ef91
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/xml/nob_OCRFixReplaceList.xml
@@ -0,0 +1,58 @@
+<ReplaceList>
+  <WholeWords>
+    <Word from="varjeg" to="var jeg" />
+    <Word from="omjeg" to="om jeg" />
+    <Word from="menjeg" to="men jeg" />
+    <Word from="noejeg" to="noe jeg" />
+    <Word from="førjeg" to="før jeg" />
+    <Word from="harjobbet" to="har jobbet" />
+    <Word from="Kunnejeg" to="Kunne jeg" />
+    <Word from="haddejeg" to="hadde jeg" />
+    <Word from="påjorden" to="på jorden" />
+    <Word from="nårjeg" to="når jeg" />
+    <Word from="tenkerjeg" to="tenker jeg" />
+    <Word from="helejorden" to="hele jorden" />
+    <Word from="menjorden" to="men jorden" />
+    <Word from="rundtjorden" to="rundt jorden" />
+    <Word from="forjorden" to="for jorden" />
+    <Word from="avjordens" to="av jordens" />
+  </WholeWords>
+  <PartialWords>
+    <!-- Will be used to check words not in dictionary -->
+    <!-- If new word(s) exists in spelling dictionary, it(they) is accepted -->
+    <WordPart from="fi" to="fi" />
+    <WordPart from="fl" to="fl" />
+    <WordPart from="/" to="l" />
+    <WordPart from="vv" to="w" />
+    <WordPart from="m" to="rn" />
+    <WordPart from="l" to="i" />
+    <WordPart from="€" to="e" />
+    <WordPart from="I" to="l" />
+    <WordPart from="c" to="o" />
+    <WordPart from="i" to="t" />
+    <WordPart from="cc" to="oo" />
+    <WordPart from="ii" to="tt" />
+    <WordPart from="n/" to="ry" />
+    <WordPart from="ae" to="æ" />
+
+    <!-- "f " will be two words -->
+    <WordPart from="f" to="f " />
+    <WordPart from="c" to="e" />
+    <WordPart from="o" to="e" />
+    <WordPart from="I" to="t" />
+    <WordPart from="n" to="o" />
+    <WordPart from="s" to="e" />
+    <WordPart from="\A" to="Vi" />
+    <WordPart from="n/" to="rv" />
+    <WordPart from="Ã" to="Å" />
+    <WordPart from="í" to="i" />
+  </PartialWords>
+  <BeginLines />
+  <EndLines />
+  <WholeLines />
+  <RemovedWholeWords />
+  <RemovedPartialLines />
+  <RemovedBeginLines />
+  <RemovedEndLines />
+  <RemovedWholeLines />
+</ReplaceList>
\ No newline at end of file
diff --git a/libs/subzero/modification/dictionaries/xml/nor_OCRFixReplaceList.xml b/libs/subzero/modification/dictionaries/xml/nor_OCRFixReplaceList.xml
new file mode 100644
index 000000000..475d7dc2c
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/xml/nor_OCRFixReplaceList.xml
@@ -0,0 +1,43 @@
+<OCRFixReplaceList>
+  <WholeWords />
+  <PartialWordsAlways />
+  <PartialWords>
+    <!-- Will be used to check words not in dictionary -->
+    <!-- If new word(s) exists in spelling dictionary, it(they) is accepted -->
+    <WordPart from="¤" to="o" />
+    <WordPart from="fi" to="fi" />
+    <WordPart from="fl" to="fl" />
+    <WordPart from="/" to="l" />
+    <WordPart from="vv" to="w" />
+    <WordPart from="IVI" to="M" />
+    <WordPart from="lVI" to="M" />
+    <WordPart from="IVl" to="M" />
+    <WordPart from="lVl" to="M" />
+    <WordPart from="m" to="rn" />
+    <WordPart from="l" to="i" />
+    <WordPart from="€" to="e" />
+    <WordPart from="I" to="l" />
+    <WordPart from="c" to="o" />
+    <WordPart from="i" to="t" />
+    <WordPart from="cc" to="oo" />
+    <WordPart from="ii" to="tt" />
+    <WordPart from="n/" to="ry" />
+    <WordPart from="ae" to="æ" />
+    <!-- "f " will be two words -->
+    <WordPart from="f" to="f " />
+    <WordPart from="c" to="e" />
+    <WordPart from="I" to="t" />
+    <WordPart from="n" to="o" />
+    <WordPart from="s" to="e" />
+    <WordPart from="\A" to="Vi" />
+    <WordPart from="n/" to="rv" />
+    <WordPart from="Ã" to="Å" />
+    <WordPart from="í" to="i" />
+  </PartialWords>
+  <PartialLines />
+  <PartialLinesAlways />
+  <BeginLines />
+  <EndLines />
+  <WholeLines />
+  <RegularExpressions />
+</OCRFixReplaceList>
\ No newline at end of file
diff --git a/libs/subzero/modification/dictionaries/xml/por_OCRFixReplaceList.xml b/libs/subzero/modification/dictionaries/xml/por_OCRFixReplaceList.xml
new file mode 100644
index 000000000..4be515db2
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/xml/por_OCRFixReplaceList.xml
@@ -0,0 +1,508 @@
+<OCRFixReplaceList>
+  <WholeWords>
+    <Word from="abitual" to="habitual" />
+    <Word from="àcerca" to="acerca" />
+    <Word from="acessor" to="assessor" />
+    <Word from="acólico" to="acólito" />
+    <Word from="açoreano" to="açoriano" />
+    <Word from="actuacao" to="actuação" />
+    <Word from="acucar" to="açúcar" />
+    <Word from="açucar" to="açúcar" />
+    <Word from="advinhar" to="adivinhar" />
+    <Word from="africa" to="África" />
+    <Word from="ajuisar" to="ajuizar" />
+    <Word from="album" to="álbum" />
+    <Word from="alcoolémia" to="alcoolemia" />
+    <Word from="aldião" to="aldeão" />
+    <Word from="algerino" to="argelino" />
+    <Word from="ameixeal" to="ameixial" />
+    <Word from="amiaça" to="ameaça" />
+    <Word from="analizar" to="analisar" />
+    <Word from="andáste" to="andaste" />
+    <Word from="anemona" to="anémona" />
+    <Word from="antartico" to="antárctico" />
+    <Word from="antártico" to="antárctico" />
+    <Word from="antepôr" to="antepor" />
+    <Word from="apárte" to="aparte" />
+    <Word from="apiadeiro" to="apeadeiro" />
+    <Word from="apiar" to="apear" />
+    <Word from="apreciacao" to="apreciação" />
+    <Word from="arctico" to="árctico" />
+    <Word from="arrazar" to="arrasar" />
+    <Word from="ártico" to="árctico" />
+    <Word from="artifice" to="artífice" />
+    <Word from="artifícial" to="artificial" />
+    <Word from="ascenção" to="ascensão" />
+    <!-- <Word from="assucar" to="açúcar" /> assucar é uma palavra existente no dicionário -->
+    <Word from="assúcar" to="açúcar" />
+    <Word from="aste" to="haste" />
+    <Word from="asterístico" to="asterisco" />
+    <Word from="averção" to="aversão" />
+    <Word from="avizar" to="avisar" />
+    <Word from="avulsso" to="avulso" />
+    <Word from="baínha" to="bainha" />
+    <Word from="banca-rota" to="bancarrota" />
+    <Word from="bandeija" to="bandeja" />
+    <Word from="bébé" to="bebé" />
+    <Word from="beige" to="bege" />
+    <Word from="benção" to="bênção" />
+    <Word from="beneficiência" to="beneficência" />
+    <Word from="beneficiente" to="beneficente" />
+    <Word from="benvinda" to="bem-vinda" />
+    <Word from="benvindo" to="bem-vindo" />
+    <Word from="boasvindas" to="boas-vindas" />
+    <Word from="borborinho" to="burburinho" />
+    <Word from="Brazil" to="Brasil" />
+    <Word from="bussula" to="bússola" />
+    <Word from="cabo-verdeano" to="cabo-verdiano" />
+    <Word from="caimbras" to="cãibras" />
+    <Word from="calcáreo" to="calcário" />
+    <Word from="calsado" to="calçado" />
+    <Word from="calvíce" to="calvície" />
+    <Word from="camoneano" to="camoniano" />
+    <Word from="campião" to="campeão" />
+    <Word from="cançacos" to="cansaços" />
+    <Word from="caracter" to="carácter" />
+    <Word from="caractéres" to="caracteres" />
+    <Word from="catequeze" to="catequese" />
+    <Word from="catequisador" to="catequizador" />
+    <Word from="catequisar" to="catequizar" />
+    <Word from="chícara" to="xícara" />
+    <Word from="ciclano" to="sicrano" />
+    <Word from="cicrano" to="sicrano" />
+    <Word from="cidadães" to="cidadãos" />
+    <Word from="cidadões" to="cidadãos" />
+    <Word from="cincoenta" to="cinquenta" />
+    <Word from="cinseiro" to="cinzeiro" />
+    <Word from="cinsero" to="sincero" />
+    <Word from="citacoes" to="citações" />
+    <Word from="coalizão" to="colisão" />
+    <Word from="côdia" to="côdea" />
+    <Word from="combóio" to="comboio" />
+    <Word from="compôr" to="compor" />
+    <Word from="concerteza" to="com certeza" />
+    <Word from="constituia" to="constituía" />
+    <Word from="constituíu" to="constituiu" />
+    <Word from="contato" to="contacto" />
+    <Word from="contensão" to="contenção" />
+    <Word from="contribuicoes" to="contribuições" />
+    <Word from="côr" to="cor" />
+    <Word from="corassão" to="coração" />
+    <Word from="corçario" to="corsário" />
+    <Word from="corçário" to="corsário" />
+    <Word from="cornprimidosinbo" to="comprimidozinho" />
+    <!-- <Word from="cota-parte" to="quota-parte" /> é uma palavra existente no dicionário -->
+    <Word from="crâneo" to="crânio" />
+    <Word from="dE" to="de" />
+    <Word from="defenição" to="definição" />
+    <Word from="defenido" to="definido" />
+    <Word from="defenir" to="definir" />
+    <Word from="deficite" to="défice" />
+    <Word from="degladiar" to="digladiar" />
+    <Word from="deiche" to="deixe" />
+    <Word from="desinteria" to="disenteria" />
+    <Word from="despendio" to="dispêndio" />
+    <Word from="despêndio" to="dispêndio" />
+    <Word from="desplicência" to="displicência" />
+    <Word from="dificulidade" to="dificuldade" />
+    <Word from="dispender" to="despender" />
+    <Word from="dispendio" to="dispêndio" />
+    <Word from="distribuido" to="distribuído" />
+    <Word from="druída" to="druida" />
+    <Word from="écrã" to="ecrã" />
+    <Word from="ecran" to="ecrã" />
+    <Word from="écran" to="ecrã" />
+    <Word from="êle" to="ele" />
+    <Word from="elice" to="hélice" />
+    <Word from="élice" to="hélice" />
+    <Word from="emiratos" to="emirados" />
+    <Word from="engolis-te" to="engoliste" />
+    <Word from="engulir" to="engolir" />
+    <Word from="enguliste" to="engoliste" />
+    <Word from="entertido" to="entretido" />
+    <Word from="entitular" to="intitular" />
+    <Word from="entreterimento" to="entretenimento" />
+    <Word from="entreti-me" to="entretive-me" />
+    <Word from="envólucro" to="invólucro" />
+    <Word from="erói" to="herói" />
+    <Word from="escluir" to="excluir" />
+    <Word from="esclusão" to="exclusão" />
+    <Word from="escrivões" to="escrivães" />
+    <Word from="esqueiro" to="isqueiro" />
+    <Word from="esquesito" to="esquisito" />
+    <Word from="estacoes" to="estações" />
+    <Word from="esteje" to="esteja" />
+    <Word from="excavação" to="escavação" />
+    <Word from="excavar" to="escavar" />
+    <Word from="exdrúxula" to="esdrúxula" />
+    <Word from="exdrúxulas" to="esdrúxulas" />
+    <Word from="exitar" to="hesitar" />
+    <Word from="explicacoes" to="explicações" />
+    <Word from="exquisito" to="esquisito" />
+    <Word from="extende" to="estende" />
+    <Word from="extender" to="estender" />
+    <Word from="fàcilmenfe" to="facilmente" />
+    <Word from="fàcilmente" to="facilmente" />
+    <Word from="fariam-lhe" to="far-lhe-iam" />
+    <Word from="FARMÁClAS" to="FARMÁCIAS" />
+    <Word from="farmecêutico" to="farmacêutico" />
+    <Word from="fassa" to="faça" />
+    <Word from="fébre" to="febre" />
+    <Word from="fecula" to="fécula" />
+    <Word from="fémea" to="fêmea" />
+    <Word from="femenino" to="feminino" />
+    <Word from="femininismo" to="feminismo" />
+    <Word from="físiologista" to="fisiologista" />
+    <Word from="fizémos" to="fizemos" />
+    <Word from="fizes-te" to="fizeste" />
+    <Word from="flôr" to="flor" />
+    <Word from="forão" to="foram" />
+    <Word from="formalisar" to="formalizar" />
+    <Word from="fôro" to="foro" />
+    <Word from="fos-te" to="foste" />
+    <Word from="fragância" to="fragrância" />
+    <Word from="françês" to="francês" />
+    <Word from="frasqutnho" to="frasquinho" />
+    <Word from="frustado" to="frustrado" />
+    <Word from="furá" to="furar" />
+    <Word from="gaz" to="gás" />
+    <Word from="gáz" to="gás" />
+    <Word from="geito" to="jeito" />
+    <Word from="geneceu" to="gineceu" />
+    <Word from="geropiga" to="jeropiga" />
+    <Word from="glicémia" to="glicemia" />
+    <Word from="gorgeta" to="gorjeta" />
+    <Word from="grangear" to="granjear" />
+    <Word from="guizar" to="guisar" />
+    <Word from="hectar" to="hectare" />
+    <Word from="herméticamente" to="hermeticamente" />
+    <Word from="hernia" to="hérnia" />
+    <Word from="higiéne" to="higiene" />
+    <Word from="hilariedade" to="hilaridade" />
+    <Word from="hiperacídez" to="hiperacidez" />
+    <Word from="hontem" to="ontem" />
+    <Word from="igiene" to="higiene" />
+    <Word from="igienico" to="higiénico" />
+    <Word from="igiénico" to="higiénico" />
+    <Word from="igreija" to="igreja" />
+    <Word from="iguasu" to="iguaçu" />
+    <Word from="ilacção" to="ilação" />
+    <Word from="imbigo" to="umbigo" />
+    <Word from="impecilho" to="empecilho" />
+    <Word from="íncas" to="incas" />
+    <Word from="incêsto" to="incesto" />
+    <Word from="inclusivé" to="inclusive" />
+    <Word from="incômodos" to="incómodos" />
+    <Word from="incontestávelmente" to="incontestavelmente" />
+    <Word from="incontestàvelmente" to="incontestavelmente" />
+    <Word from="indespensáveis" to="indispensáveis" />
+    <Word from="indespensável" to="indispensável" />
+    <Word from="India" to="Índia" />
+    <Word from="indiguinação" to="indignação" />
+    <Word from="indiguinado" to="indignado" />
+    <Word from="indiguinar" to="indignar" />
+    <Word from="inflacção" to="inflação" />
+    <Word from="ingreja" to="igreja" />
+    <Word from="INSCRICOES" to="INSCRIÇÕES" />
+    <Word from="intensão" to="intenção" />
+    <Word from="intertido" to="entretido" />
+    <Word from="intoxica" to="Intoxica" />
+    <Word from="intrega" to="entrega" />
+    <Word from="inverosímel" to="inverosímil" />
+    <Word from="iorgute" to="iogurte" />
+    <Word from="ipopótamo" to="hipopótamo" />
+    <Word from="ipsilon" to="ípsilon" />
+    <Word from="ipslon" to="ípsilon" />
+    <Word from="isquesito" to="esquisito" />
+    <Word from="juíz" to="juiz" />
+    <Word from="juiza" to="juíza" />
+    <Word from="júniores" to="juniores" />
+    <Word from="justanzente" to="justamente" />
+    <Word from="juz" to="jus" />
+    <Word from="kilo" to="quilo" />
+    <Word from="laboratório-porque" to="laboratório porque" />
+    <Word from="ladravaz" to="ladrava" />
+    <Word from="lamentàvelmente" to="lamentavelmente" />
+    <Word from="lampeão" to="lampião" />
+    <Word from="largartixa" to="lagartixa" />
+    <Word from="largarto" to="lagarto" />
+    <Word from="lêm" to="lêem" />
+    <Word from="leucémia" to="leucemia" />
+    <Word from="licensa" to="licença" />
+    <Word from="linguísta" to="linguista" />
+    <Word from="lisongear" to="lisonjear" />
+    <Word from="logista" to="lojista" />
+    <Word from="maçajar" to="massajar" />
+    <Word from="Macfadden-o" to="Macfadden o" />
+    <Word from="mae" to="mãe" />
+    <Word from="magestade" to="majestade" />
+    <Word from="mãgua" to="mágoa" />
+    <Word from="mangerico" to="manjerico" />
+    <Word from="mangerona" to="manjerona" />
+    <Word from="manteem-se" to="mantêm-se" />
+    <Word from="mantega" to="manteiga" />
+    <Word from="mantem-se" to="mantém-se" />
+    <Word from="massiço" to="maciço" />
+    <Word from="massisso" to="maciço" />
+    <Word from="médica-Rio" to="médica Rio" />
+    <Word from="menistro" to="ministro" />
+    <Word from="merciaria" to="mercearia" />
+    <Word from="metrelhadora" to="metralhadora" />
+    <Word from="miscegenação" to="miscigenação" />
+    <Word from="misogenia" to="misoginia" />
+    <Word from="misogeno" to="misógino" />
+    <Word from="misógeno" to="misógino" />
+    <Word from="mº" to="º" />
+    <Word from="môlho" to="molho" />
+    <Word from="monumentânea" to="momentânea" />
+    <Word from="mortandela" to="mortadela" />
+    <Word from="morteIa" to="mortela" />
+    <Word from="muinto" to="muito" />
+    <Word from="nasaias" to="nasais" />
+    <Word from="nêle" to="nele" />
+    <Word from="nest" to="neste" />
+    <Word from="Nivea" to="Nívea" />
+    <Word from="nonagessimo" to="nonagésimo" />
+    <Word from="nonagéssimo" to="nonagésimo" />
+    <Word from="nornal" to="normal" />
+    <Word from="notàvelmente" to="notavelmente" />
+    <Word from="obcessão" to="obsessão" />
+    <Word from="obesidae" to="obesidade" />
+    <Word from="óbviamente" to="obviamente" />
+    <Word from="òbviamente" to="obviamente" />
+    <Word from="ofecina" to="oficina" />
+    <Word from="oje" to="hoje" />
+    <Word from="omem" to="homem" />
+    <Word from="opcoes" to="opções" />
+    <Word from="opóbrio" to="opróbrio" />
+    <Word from="opróbio" to="opróbrio" />
+    <Word from="orfão" to="órfão" />
+    <Word from="organigrama" to="organograma" />
+    <Word from="organisar" to="organizar" />
+    <Word from="orgão" to="órgão" />
+    <Word from="orta" to="horta" />
+    <Word from="ótima" to="óptima" />
+    <Word from="ótimos" to="óptimos" />
+    <Word from="paralização" to="paralisação" />
+    <Word from="paralizado" to="paralisado" />
+    <Word from="paralizar" to="paralisar" />
+    <Word from="paráste" to="paraste" />
+    <Word from="Pátria" to="pátria" />
+    <Word from="paúl" to="Paul" />
+    <Word from="pecalço" to="percalço" />
+    <Word from="pêga" to="pega" />
+    <Word from="periodo" to="período" />
+    <Word from="pertubar" to="perturbar" />
+    <Word from="perú" to="peru" />
+    <Word from="piqueno" to="pequeno" />
+    <Word from="pirinéus" to="Pirenéus" />
+    <Word from="poblema" to="problema" />
+    <Word from="pobrema" to="problema" />
+    <Word from="poden" to="podem" />
+    <Word from="poder-mos" to="pudermos" />
+    <Word from="ponteagudo" to="pontiagudo" />
+    <Word from="pontuacoes" to="pontuações" />
+    <Word from="prazeiroso" to="prazeroso" />
+    <Word from="precaridade" to="precariedade" />
+    <Word from="precizar" to="precisar" />
+    <Word from="preserverança" to="perseverança" />
+    <Word from="previlégio" to="privilégio" />
+    <Word from="primária-que" to="primária que" />
+    <Word from="priúdo" to="período" />
+    <Word from="probalidade" to="probabilidade" />
+    <Word from="progreso" to="progresso" />
+    <Word from="proibído" to="proibido" />
+    <Word from="proíbido" to="proibido" />
+    <Word from="própia" to="própria" />
+    <Word from="propiedade" to="propriedade" />
+    <Word from="propio" to="próprio" />
+    <Word from="própio" to="próprio" />
+    <Word from="provocacoes" to="provocações" />
+    <Word from="prsença" to="presença" />
+    <Word from="prustituta" to="prostituta" />
+    <Word from="pudérmos" to="pudermos" />
+    <Word from="púlico" to="público" />
+    <Word from="pús" to="pus" />
+    <Word from="pusémos" to="pusemos" />
+    <Word from="quadricomia" to="quadricromia" />
+    <Word from="quadriplicado" to="quadruplicado" />
+    <Word from="quaisqueres" to="quaisquer" />
+    <Word from="quer-a" to="quere-a" />
+    <Word from="quere-se" to="quer-se" />
+    <Word from="quer-o" to="quere-o" />
+    <Word from="químco" to="químico" />
+    <Word from="quises-te" to="quiseste" />
+    <Word from="quizer" to="quiser" />
+    <Word from="quizeram" to="quiseram" />
+    <Word from="quizesse" to="quisesse" />
+    <Word from="quizessem" to="quisessem" />
+    <Word from="raínha" to="rainha" />
+    <Word from="raíz" to="raiz" />
+    <Word from="raizes" to="raízes" />
+    <Word from="ratato" to="retrato" />
+    <Word from="raúl" to="raul" />
+    <Word from="razar" to="rasar" />
+    <Word from="rectaguarda" to="retaguarda" />
+    <Word from="rédia" to="rédea" />
+    <Word from="reestabelecer" to="restabelecer" />
+    <Word from="refeicoes" to="refeições" />
+    <Word from="refêrencia" to="referência" />
+    <Word from="regeitar" to="rejeitar" />
+    <Word from="regurjitar" to="regurgitar" />
+    <Word from="reinvidicação" to="reivindicação" />
+    <Word from="reinvidicar" to="reivindicar" />
+    <Word from="requer-a" to="requere-a" />
+    <Word from="requere-se" to="requer-se" />
+    <Word from="requer-o" to="requere-o" />
+    <Word from="requesito" to="requisito" />
+    <Word from="requisicoes" to="requisições" />
+    <Word from="RESIDENCIA" to="RESIDÊNCIA" />
+    <Word from="respiraçáo" to="respiração" />
+    <Word from="restablecer" to="restabelecer" />
+    <Word from="réstea" to="réstia" />
+    <Word from="ruborisar" to="ruborizar" />
+    <Word from="rúbrica" to="rubrica" />
+    <Word from="sàdia" to="sadia" />
+    <Word from="saiem" to="saem" />
+    <Word from="salchicha" to="salsicha" />
+    <Word from="salchichas" to="salsichas" />
+    <Word from="saloice" to="saloiice" />
+    <Word from="salvé" to="salve" />
+    <Word from="salve-raínha" to="salve-rainha" />
+    <Word from="salvé-rainha" to="salve-rainha" />
+    <Word from="salvé-raínha" to="salve-rainha" />
+    <Word from="sao" to="são" />
+    <Word from="sargeta" to="sarjeta" />
+    <Word from="seções" to="secções" />
+    <Word from="seija" to="seja" />
+    <Word from="seissentos" to="seiscentos" />
+    <Word from="seje" to="seja" />
+    <Word from="semiar" to="semear" />
+    <Word from="séniores" to="seniores" />
+    <Word from="sensibilidadc" to="sensibilidade" />
+    <Word from="sensívelmente" to="sensivelmente" />
+    <Word from="setessentos" to="setecentos" />
+    <Word from="siclano" to="sicrano" />
+    <Word from="Sifilis" to="Sífilis" />
+    <Word from="sifílis" to="sífilis" />
+    <Word from="sinão" to="senão" />
+    <Word from="sinmtoma" to="sintoma" />
+    <Word from="sintéticamente" to="sinteticamente" />
+    <Word from="sintetisa" to="sintetiza" />
+    <Word from="SÓ" to="só" />
+    <Word from="sôfra" to="sofra" />
+    <Word from="sôfregamente" to="sofregamente" />
+    <Word from="somáste" to="somaste" />
+    <Word from="sombracelha" to="sobrancelha" />
+    <Word from="sombrancelha" to="sobrancelha" />
+    <Word from="sombrancelhas" to="sobrancelhas" />
+    <Word from="suavisar" to="suavizar" />
+    <Word from="substituido" to="substituído" />
+    <Word from="suburbio" to="subúrbio" />
+    <!-- <Word from="sues" to="seus" /> sues existe "Cuidado, não sues muito." -->
+    <Word from="suI" to="sul" />
+    <Word from="Suiça" to="Suíça" />
+    <Word from="suiças" to="suíças" />
+    <Word from="suiço" to="suíço" />
+    <Word from="suiços" to="suíços" />
+    <Word from="supôr" to="supor" />
+    <Word from="tabeliões" to="tabeliães" />
+    <Word from="taínha" to="tainha" />
+    <Word from="tava" to="estava" />
+    <Word from="têem" to="têm" />
+    <Word from="telemovel" to="telemóvel" />
+    <Word from="telémovel" to="telemóvel" />
+    <Word from="terminacoes" to="terminações" />
+    <Word from="toráxico" to="torácico" />
+    <Word from="tou" to="estou" />
+    <Word from="transpôr" to="transpor" />
+    <Word from="trasnporte" to="transporte" />
+    <Word from="tumors" to="tumores" />
+    <Word from="úmida" to="húmida" />
+    <Word from="umidade" to="unidade" />
+    <Word from="vai-vem" to="vaivém" />
+    <Word from="vegilância" to="vigilância" />
+    <Word from="vegilante" to="vigilante" />
+    <Word from="ventoínha" to="ventoinha" />
+    <Word from="verosímel" to="verosímil" />
+    <Word from="video" to="vídeo" />
+    <Word from="virus" to="vírus" />
+    <Word from="visiense" to="viseense" />
+    <Word from="voçe" to="você" />
+    <Word from="voçê" to="você" />
+    <Word from="vôo" to="voo" />
+    <Word from="xadrês" to="xadrez" />
+    <Word from="xafariz" to="chafariz" />
+    <Word from="xéxé" to="xexé" />
+    <Word from="xilindró" to="chilindró" />
+    <Word from="zaíre" to="Zaire" />
+    <Word from="zepelin" to="zepelim" />
+    <Word from="zig-zag" to="ziguezague" />
+    <Word from="zoô" to="zoo" />
+    <Word from="zôo" to="zoo" />
+    <Word from="zuar" to="zoar" />
+    <Word from="zum-zum" to="zunzum" />
+  </WholeWords>
+  <PartialWordsAlways />
+  <PartialWords />
+  <PartialLines>
+    <LinePart from="IN 6-E" to="N 6 E" />
+    <LinePart from="in tegrar-se" to="integrar-se" />
+    <LinePart from="in teresse" to="interesse" />
+    <LinePart from="in testinos" to="intestinos" />
+    <LinePart from="indica ção" to="indicação" />
+    <LinePart from="inte tino" to="intestino" />
+    <LinePart from="intes tinos" to="intestinos" />
+    <LinePart from="L da" to="Lda" />
+    <LinePart from="mal estar" to="mal-estar" />
+    <LinePart from="mastiga çáo" to="mastigação" />
+    <LinePart from="médi cas" to="médicas" />
+    <LinePart from="mineo rais" to="minerais" />
+    <LinePart from="mola res" to="molares" />
+    <LinePart from="movi mentos" to="movimentos" />
+    <LinePart from="movimen to" to="movimento" />
+    <LinePart from="N 5-Estendido" to="Nº 5 Estendido" />
+    <LinePart from="oxigé nio" to="oxigénio" />
+    <LinePart from="pod mos" to="podemos" />
+    <LinePart from="poder-se ia" to="poder-se-ia" />
+    <LinePart from="pos sibilidade" to="possibilidade" />
+    <LinePart from="possibi lidades" to="possibilidades" />
+    <LinePart from="pro duto" to="produto" />
+    <LinePart from="procu rar" to="procurar" />
+    <LinePart from="Q u e" to="Que" />
+    <LinePart from="qualifi cam" to="qualificam" />
+    <LinePart from="R egião" to="Região" />
+    <LinePart from="unsuficien temente" to="insuficientemente" />
+  </PartialLines>
+  <PartialLinesAlways />
+  <BeginLines />
+  <EndLines />
+  <WholeLines />
+  <RegularExpressions>
+    <!-- <RegEx find="\bi\b" replaceWith="I" /> just an example - do not use this regex -->
+    <RegEx find="([0-9]) +º" replaceWith="$1º" />
+    <RegEx find="\Bcao\b" replaceWith="ção" />
+    <RegEx find="\Bcoes\b" replaceWith="ções" />
+    <!-- <RegEx find="\Bccao\b" replaceWith="cção" /> não faz sentido ter este e ter a linha de cima -->
+    <!-- <RegEx find="\Bccoes\b" replaceWith="cções" /> não faz sentido ter este e ter a linha de cima -->
+    <RegEx find="\b(m|M)ae\b" replaceWith="$1ãe" />
+    <RegEx find="\Bdmnis\B" replaceWith="dminis" />
+    <RegEx find="\Blcól\B" replaceWith="lcoól" />
+    <RegEx find="\b(t|T)a[nm]b[eé]m\b" replaceWith="$1ambém" />
+    <RegEx find="\bzeppeli[mn]\b" replaceWith="zepelim" />
+    <RegEx find="\b(s|S)ufe?ciente\b" replaceWith="$1uficiente" />
+    <RegEx find="\b(n|N)ao\b" replaceWith="$1ão" />
+    <RegEx find="\b(B|b)elem\b" replaceWith="$1elém" />
+    <RegEx find="\b(s|S)u[íi]sso(s)?\b" replaceWith="$1uíço$2" />
+    <RegEx find="\b(s|S)u[íi]ssa(s)?\b" replaceWith="$1uíça$2" />
+    <RegEx find="\b(p|P)rivelig[ie]\p{Ll}d" replaceWith="$1rivelegiad" />
+    <RegEx find="\bpud(?:és|e-)se\b" replaceWith="pudesse" />
+    <RegEx find="\biquilíbr(?:e|i)o\b" replaceWith="equilíbrio" />
+    <RegEx find="\b(c|C)orregi\B" replaceWith="$1orrigid" />
+    <RegEx find="(?&lt;=A|a)ssociacao" replaceWith="ssociação" />
+    <RegEx find="(?&lt;=N|n)inguem" replaceWith="inguém" />
+    <RegEx find="(?&lt;=g|G)rat(?:uí|úi)to" replaceWith="ratuito" />
+    <RegEx find="(?&lt;=d|D)esiquilíbr[ei]o" replaceWith="esequilíbrio" />
+    <RegEx find="\b[k|K]il(ogramas?|ómetros?)" replaceWith="qui$1" />
+  </RegularExpressions>
+</OCRFixReplaceList>
\ No newline at end of file
diff --git a/libs/subzero/modification/dictionaries/xml/rus_OCRFixReplaceList.xml b/libs/subzero/modification/dictionaries/xml/rus_OCRFixReplaceList.xml
new file mode 100644
index 000000000..8bffbd904
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/xml/rus_OCRFixReplaceList.xml
@@ -0,0 +1,257 @@
+<OCRFixReplaceList>
+  <WholeWords>
+    <Word from="НЄЙ" to="НЕЙ" />
+    <Word from="ОРГЗНИЗМОБ" to="ОРГАНИЗМА" />
+    <Word from="Чї0" to="ЧТО" />
+    <Word from="НЭ" to="НА" />
+    <Word from="СОСЄДНЮЮ" to="СОСЕДНЮЮ" />
+    <Word from="ПЛЗНЄТУ" to="ПЛАНЕТУ" />
+    <Word from="ЗЗГЭДОК" to="ЗАГАДОК" />
+    <Word from="СОТВОРЄНИЯ" to="СОТВОРЕНИЯ" />
+    <Word from="МИРЭ" to="МИРА" />
+    <Word from="ПОЯБЛЄНИЯ" to="ПОЯВЛЕНИЯ" />
+    <Word from="ЗЄМЛЄ" to="ЗЕМЛЕ" />
+    <Word from="ЄЩЄ" to="ЕЩЁ" />
+    <Word from="ТЄМНЬІХ" to="ТЕМНЫХ" />
+    <Word from="СЄРЬЄЗНЬІМ" to="СЕРЬЕЗНЫМ" />
+    <Word from="ПОШІІ0" to="ПОШЛО" />
+    <Word from="Пр0ИЗ0ШЄЛ" to="ПРОИЗОШЕЛ" />
+    <Word from="СЄКРЄТЭМИ" to="СЕКРЕТАМИ" />
+    <Word from="МЭТЄРИЗЛЬІ" to="МАТЕРИАЛЫ" />
+    <Word from="ПЯТЄН" to="ПЯТЕН" />
+    <Word from="ПЛаНЄїЄ" to="ПЛАНЕТЕ" />
+    <Word from="КЗТЭКЛИЗМ" to="КАТАКЛИЗМ" />
+    <Word from="ОКЗЗЗЛСЯ" to="ОКАЗАЛСЯ" />
+    <Word from="ДЭЛЬШЕ" to="ДАЛЬШЕ" />
+    <Word from="ТВК" to="ТАК" />
+    <Word from="ПЛЗНЄТЗ" to="ПЛАНЕТА" />
+    <Word from="ЧЄГО" to="ЧЕГО" />
+    <Word from="УЗНЭТЬ" to="УЗНАТЬ" />
+    <Word from="ПЛЭНЄТЄ" to="ПЛАНЕТЕ" />
+    <Word from="НЄМ" to="НЕМ" />
+    <Word from="БОЗМОЖНЗ" to="ВОЗМОЖНА" />
+    <Word from="СОБЄРШЄННО" to="СОВЕРШЕННО" />
+    <Word from="ИНЭЧЄ" to="ИНАЧЕ" />
+    <Word from="БСЄ" to="ВСЕ" />
+    <Word from="НЕДОСТЗТКИ" to="НЕДОСТАТКИ" />
+    <Word from="НОВЬІЄ" to="НОВЫЕ" />
+    <Word from="ВЄЛИКОЛЄПНЭЯ" to="ВЕЛИКОЛЕПНАЯ" />
+    <Word from="ОСТЭІІОСЬ" to="ОСТАЛОСЬ" />
+    <Word from="НЗЛИЧИЄ" to="НАЛИЧИЕ" />
+    <Word from="бЫ" to="бы" />
+    <Word from="ПРОЦВЕТВТЬ" to="ПРОЦВЕТАТЬ" />
+    <Word from="КЗК" to="КАК" />
+    <Word from="ВОДЗ" to="ВОДА" />
+    <Word from="НЗШЕЛ" to="НАШЕЛ" />
+    <Word from="НЄ" to="НЕ" />
+    <Word from="ТОЖЄ" to="ТОЖЕ" />
+    <Word from="ВУЛКЭНИЧЄСКОЙ" to="ВУЛКАНИЧЕСКОЙ" />
+    <Word from="ЭКТИБНОСТИ" to="АКТИВНОСТИ" />
+    <Word from="ПОЯВИЛЗСЬ" to="ПОЯВИЛАСЬ" />
+    <Word from="НОВЗЯ" to="НОВАЯ" />
+    <Word from="СТРЭТЄГИЯ" to="СТРАТЕГИЯ" />
+    <Word from="УСПЄШН0" to="УСПЕШНО" />
+    <Word from="ПОСЗДКУ" to="ПОСАДКУ" />
+    <Word from="ГОТОБЫ" to="ГОТОВЫ" />
+    <Word from="НЗЧЗТЬ" to="НАЧАТЬ" />
+    <Word from="ОХОТЭ" to="ОХОТА" />
+    <Word from="ПРИЗНЗКЗМИ" to="ПРИЗНАКАМИ" />
+    <Word from="Пр0ШЛОМ" to="ПРОШЛОМ" />
+    <Word from="НЭСТОЯЩЄМ" to="НАСТОЯЩЕМ" />
+    <Word from="ПУСТОТЗХ" to="ПУСТОТАХ" />
+    <Word from="БЛЗЖНОЙ" to="ВЛАЖНОЙ" />
+    <Word from="ПОЧБЄ" to="ПОЧВЕ" />
+    <Word from="МЬІ" to="МЫ" />
+    <Word from="СЄЙЧЗС" to="СЕЙЧАС" />
+    <Word from="ЄСЛИ" to="ЕСЛИ" />
+    <Word from="ЗЗТРОНЕМ" to="ЗАТРОНЕМ" />
+    <Word from="ОПЗСЗЄМСЯ" to="ОПАСАЕМСЯ" />
+    <Word from="СИЛЬН0" to="СИЛЬНО" />
+    <Word from="ОТЛИЧЗЄТСЯ" to="ОТЛИЧАЕТСЯ" />
+    <Word from="РЭНЬШЄ" to="РАНЬШЕ" />
+    <Word from="НЗЗЬІВЗЮТ" to="НАЗЫВАЮТ" />
+    <Word from="ТЄКЛ3" to="ТЕКЛА" />
+    <Word from="ОСЗДОЧНЫМИ" to="ОСАДОЧНЫМИ" />
+    <Word from="ПОСТЄПЄНН0" to="ПОСТЕПЕННО" />
+    <Word from="ИСПЭРЯЛЗСЬ" to="ИСПАРЯЛАСЬ" />
+    <Word from="ЄОЛЬШОЄ" to="БОЛЬШОЕ" />
+    <Word from="КОЛИЧЄСТБО" to="КОЛИЧЕСТВО" />
+    <Word from="ГЄМЗТИТЕ" to="ГЕМАТИТА" />
+    <Word from="ПОЛУЧЭЄТ" to="ПОЛУЧАЕТ" />
+    <Word from="НЄДОСТЗЧН0" to="НЕДОСТАТОЧНО" />
+    <Word from="ПИТЭНИЯ" to="ПИТАНИЯ" />
+    <Word from="ПОКЗ" to="ПОКА" />
+    <Word from="БЬІХОДИЛИ" to="ВЫХОДИЛИ" />
+    <Word from="ЗЄМІІЄ" to="ЗЕМЛЕ" />
+    <Word from="ВЄСЬІИЗ" to="ВЕСЬМА" />
+    <Word from="ЗЄМЛИ" to="ЗЕМЛИ" />
+    <Word from="бЬІЛО" to="БЫЛО" />
+    <Word from="КИЗНИ" to="ЖИЗНИ" />
+    <Word from="СТЗНОВИЛЗСЬ" to="СТАНОВИЛАСЬ" />
+    <Word from="СОЛЄНЄЄ" to="СОЛЁНЕЕ" />
+    <Word from="МЭГНИТНЫМ" to="МАГНИТНЫМ" />
+    <Word from="ЧТОбЬІ" to="ЧТОБЫ" />
+    <Word from="СОЗДЕТЬ" to="СОЗДАТЬ" />
+    <Word from="МЗГНИТНОЄ" to="МАГНИТНОЕ" />
+    <Word from="КЭЖУТСЯ" to="КАЖУТСЯ" />
+    <Word from="ОЗНЗЧЗЄТ" to="ОЗНАЧАЕТ" />
+    <Word from="МОГЛЗ" to="МОГЛА" />
+    <Word from="ИМЄТЬ" to="ИМЕТЬ" />
+    <Word from="КОСМОСЭ" to="КОСМОСА" />
+    <Word from="СОЛНЄЧНЗЯ" to="СОЛНЕЧНАЯ" />
+    <Word from="СИСТЄМЗ" to="СИСТЕМА" />
+    <Word from="ПОСІІУЖИЛО" to="ПОСЛУЖИЛО" />
+    <Word from="МЗГНИТНОГО" to="МАГНИТНОГО" />
+    <Word from="ПЛВНЄТЫ" to="ПЛАНЕТЫ" />
+    <Word from="ЛОКЗЛЬНЬІХ" to="ЛОКАЛЬНЫХ" />
+    <Word from="ПОЛЄЙ" to="ПОЛЕЙ" />
+    <Word from="КЗЖУТСЯ" to="КАЖУТСЯ" />
+    <Word from="КЗКОГО" to="КАКОГО" />
+    <Word from="СТРЗШНОГО" to="СТРАШНОГО" />
+    <Word from="СТОЛКНОЕЄНИЯ" to="СТОЛКНОВЕНИЯ" />
+    <Word from="МЕСТЗМИ" to="МЕСТАМИ" />
+    <Word from="СДЄЛЗТЬ" to="СДЕЛАТЬ" />
+    <Word from="СТЗЛО" to="СТАЛО" />
+    <Word from="МЭГНИТНОГО" to="МАГНИТНОГО" />
+    <Word from="ЗЗКЛЮЧЗВШЄЙСЯ" to="ЗАКЛЮЧАВШЕЙСЯ" />
+    <Word from="ЄГО" to="ЕГО" />
+    <Word from="ЯДРЄ" to="ЯДРЕ" />
+    <Word from="НЗ" to="НА" />
+    <Word from="ИСЧЄЗЛ3" to="ИСЧЕЗЛА" />
+    <Word from="СЧИТЗЮ" to="СЧИТАЮ" />
+    <Word from="ШЭНСЫ" to="ШАНСЫ" />
+    <Word from="ИНЗЧЄ" to="ИНАЧЕ" />
+    <Word from="СТЗЛ" to="СТАЛ" />
+    <Word from="ТРЗТИТЬ" to="ТРАТИТЬ" />
+    <Word from="НЗПРЗВЛЯЄТСЯ" to="НАПРАВЛЯЕТСЯ" />
+    <Word from="ОБЛЭСТИ" to="ОБЛАСТИ" />
+    <Word from="ЯВЛЯІОТСЯ" to="ЯВЛЯЮТСЯ" />
+    <Word from="ГЛЭВНОЙ" to="ГЛАВНОЙ" />
+    <Word from="ДОКЗЗЗТЄЛЬСТВ" to="ДОКАЗАТЕЛЬСТВ" />
+    <Word from="КИСЛОТЭМИ" to="КИСЛОТАМИ" />
+    <Word from="ОНЭ" to="ОНА" />
+    <Word from="ПРЗКТИЧЄСКИ" to="ПРАКТИЧЕСКИ" />
+    <Word from="ЛЄСУ" to="ЛЕСУ" />
+    <Word from="УСЛОБИЯМ" to="УСЛОВИЯМ" />
+    <Word from="СПЗСТИСЬ" to="СПАСТИСЬ" />
+    <Word from="РЗЗВИВЗЮЩИЄСЯ" to="РАЗВИВАЮЩИЕСЯ" />
+    <Word from="ШЭПКИ" to="ШАПКИ" />
+    <Word from="ЗНЗЄМ" to="ЗНАЕМ" />
+    <Word from="СООИРЭЄМСЯ" to="СОБИРАЕМСЯ" />
+    <Word from="БЫЯСНИТЬ" to="ВЫЯСНИТЬ" />
+    <Word from="СЗМ" to="САМ" />
+    <Word from="РЗСПОЗНЗТЬ" to="РАСПОЗНАТЬ" />
+    <Word from="УЗНЗТЬ" to="УЗНАТЬ" />
+    <Word from="КЭЖЄТСЯ" to="КАЖЕТСЯ" />
+    <Word from="ОРЄИТЗЛЬНЬІЄ" to="ОРБИТАЛЬНЫЕ" />
+    <Word from="ЛЄТЭТЄЛЬНЬІЄ" to="ЛЕТАТЕЛЬНЫЕ" />
+    <Word from="ЗППЗРЕТЬІ" to="АППАРАТЫ" />
+    <Word from="ЖЄ" to="ЖЕ" />
+    <Word from="ТЗКЗЯ" to="ТАКАЯ" />
+    <Word from="МЗЛЄНЬКЗЯ" to="МАЛЕНЬКАЯ" />
+    <Word from="ПЛЭНЄТЗ" to="ПЛАНЕТА" />
+    <Word from="СПЗІІЬКО" to="СТОЛЬКО" />
+    <Word from="бЬІЛ3" to="БЫЛА" />
+    <Word from="ЁЕСЧИСЛЄННОЄ" to="БЕСЧИСЛЕННОЕ" />
+    <Word from="МЗГНИїНЬІХ" to="МАГНИТНЫХ" />
+    <Word from="ПОСТраД3Л" to="ПОСТРАДАЛ" />
+    <Word from="ДЗЖЄ" to="ДАЖЕ" />
+    <Word from="РЗЗНЬІМИ" to="РАЗНЫМИ" />
+    <Word from="СУЩЄСТБОВЭНИЄ" to="СУЩЕСТВОВАНИЕ" />
+    <Word from="ПЛаНЄїЬІ" to="ПЛАНЕТЫ" />
+    <Word from="ПОДВЄРГЛЗСЬ" to="ПОДВЕРГЛАСЬ" />
+    <Word from="ОПЗСІ-ІОСТИ" to="ОПАСНОСТИ" />
+    <Word from="ПЛЗНЄТЄ" to="ПЛАНЕТЕ" />
+    <Word from="Н0" to="НО" />
+    <Word from="бЬІ" to="БЫ" />
+    <Word from="ОТДЗЛЄННЫЄ" to="ОТДАЛЁННЫЕ" />
+    <Word from="ПОЛЯРНЬІЄ" to="ПОЛЯРНЫЕ" />
+    <Word from="ЦЄЛЬІ-О" to="ЦЕЛЬЮ" />
+    <Word from="ПЄЩЄРЗХ" to="ПЕЩЕРАХ" />
+    <Word from="НЗПОЛНЄННЬІХ" to="НАПОЛНЕННЫХ" />
+    <Word from="ИСПЗРЄНИЯМИ" to="ИСПАРЕНИЯМИ" />
+    <Word from="МИНИЗТЮРНЬІЄ" to="МИНИАТЮРНЫЕ" />
+    <Word from="ТЭКЗЯ" to="ТАКАЯ" />
+    <Word from="ПрИСП0СОбИТЬСЯ" to="ПРИСПОСОБИТЬСЯ" />
+    <Word from="НЄОЄХОДИМЬІЄ" to="НЕОБХОДИМЫЕ" />
+    <Word from="ОРГВНИЧЄСКИЄ" to="ОРГАНИЧЕСКИЕ" />
+    <Word from="МЗРСИЗНСКИЄ" to="МАРСИАНСКИЕ" />
+    <Word from="МЄСТЄ" to="МЕСТЕ" />
+    <Word from="І\/ІАККЕЙШ" to="МАККЕЙН" />
+    <Word from="НЗХОДЯЩИЄСЯ" to="НАХОДЯЩИЕСЯ" />
+    <Word from="НЄЗКТИВНОМ" to="НЕАКТИВНОМ" />
+    <Word from="ЗЭСНЯТЬ" to="ЗАСНЯТЬ" />
+    <Word from="ОРГЗНИЗМЬІ" to="ОРГАНИЗМЫ" />
+    <Word from="ВЗЕИМОДЄЙСТВОВЕТЬ" to="ВЗАИМОДЕЙСТВОВАТЬ" />
+    <Word from="ПУТЄШЄСТБИЄ" to="ПУТЕШЕСТВИЕ" />
+    <Word from="ПуСїЬІННЫХ" to="ПУСТЫННЫХ" />
+    <Word from="ТЗКИХ" to="ТАКИХ" />
+    <Word from="ПЄРЄТЗСКИВЗЄМ" to="ПЕРЕТАСКИВАЕМ" />
+    <Word from="ЧТ0" to="ЧТО" />
+    <Word from="ВЄСЬМЗ" to="ВЕСЬМА" />
+    <Word from="ПОЛОСЗМИ" to="ПОЛОСАМИ" />
+    <Word from="ОрїЭНИЗМЬІ" to="ОРГАНИЗМЫ" />
+    <Word from="ОЁЛЗСТИ" to="ОБЛАСТИ" />
+    <Word from="ЯБЛЯЮТСЯ" to="ЯВЛЯЮТСЯ" />
+    <Word from="ЦЄЛЬЮ" to="ЦЕЛЬЮ" />
+    <Word from="ПОИСКОБ" to="ПОИСКОВ" />
+    <Word from="ДОКЗЗЗТЄІІЬСТВ" to="ДОКАЗАТЕЛЬСТВ" />
+    <Word from="МОЖЄТ" to="МОЖЕТ" />
+    <Word from="НЭХОДИТЬСЯ" to="НАХОДИТЬСЯ" />
+    <Word from="ОЧЄНЬ" to="ОЧЕНЬ" />
+    <Word from="СРЗВНИТЬ" to="СРАВНИТЬ" />
+    <Word from="ОЄНЗРУЖИЛ" to="ОБНАРУЖИЛ" />
+    <Word from="ЛЬДЗ" to="ЛЬДА" />
+    <Word from="ПОТЄПЛЄНИЄІИ" to="ПОТЕПЛЕНИЕМ" />
+    <Word from="ПОХОЛОДЗНИЄБД" to="ПОХОЛОДАНИЕМ" />
+    <Word from="КЭК" to="КАК" />
+    <Word from="ТЄЛО" to="ТЕЛО" />
+    <Word from="бОЛЬШЄ" to="БОЛЬШЕ" />
+    <Word from="НЭКЛОНЯЄТСЯ" to="НАКЛОНЯЕТСЯ" />
+    <Word from="СОІІНЦУ" to="СОЛНЦУ" />
+    <Word from="СТ3бИЛИЗИрОБЗТЬ" to="СТАБИЛИЗИРОВАТЬ" />
+    <Word from="СТЭБИЛЬНЭ" to="СТАБИЛЬНА" />
+    <Word from="МИЛІІИОНОВ" to="МИЛЛИОНОВ" />
+    <Word from="НЗЗЭД" to="НАЗАД" />
+    <Word from="ТЄПЛ0" to="ТЕПЛО" />
+    <Word from="ПОІІЯРНЫХ" to="ПОЛЯРНЫХ" />
+    <Word from="СОІІЕНЫМИ" to="СОЛЕНЫМИ" />
+    <Word from="КЕКИМИ" to="КАКИМИ" />
+    <Word from="кислютнюсггь" to="кислотность" />
+    <Word from="ТЗМ" to="ТАМ" />
+    <Word from="ОРГЗНИЗМЫ" to="ОРГАНИЗМЫ" />
+    <Word from="СУЩЄСТВОВЄТЬ" to="СУЩЕСТВОВАТЬ" />
+    <Word from="ВНИМЗНИЄ" to="ВНИМАНИЕ" />
+    <Word from="СДЄЛЗЄТ" to="СДЕЛАЕТ" />
+    <Word from="ПОЗНЭКОМИТЬСЯ" to="ПОЗНАКОМИТЬСЯ" />
+    <Word from="НЭШИМ" to="НАШИМ" />
+    <Word from="ДОКЗЗЭТЄЛЬСТБО" to="ДОКАЗАТЕЛЬСТВО" />
+    <Word from="ЩЗЗЩЄНИЯ" to="ВРАЩЕНИЯ" />
+    <Word from="бЬІЛ0" to="БЫЛО" />
+    <Word from="ОЄЛЕСТЯХ" to="ОБЛАСТЯХ" />
+    <Word from="бЬІЛИ" to="БЫЛИ" />
+    <Word from="РЭЗМЬІШЛЯІІИ" to="РАЗМЫШЛЯЛИ" />
+    <Word from="КОЛИЧЄСТБЄ" to="КОЛИЧЕСТВЕ" />
+    <Word from="ЩЄІІОЧНЫЄ" to="ЩЕЛОЧНЫЕ" />
+    <Word from="НЄКОТЩЗЬІЄ" to="НЕКОТОРЫЕ" />
+    <Word from="ПрИБІ1ЕКуї" to="ПРИВЛЕКУТ" />
+    <Word from="НЗЗЬІВЭЄМЫЄ" to="НАЗЫВАЕМЫЕ" />
+    <Word from="Чї06Ы" to="ЧТОБЫ" />
+  </WholeWords>
+  <PartialWordsAlways />
+  <PartialWords>
+    <WordPart from="Є" to="Е" />
+    <WordPart from="ЬІ" to="Ы" />
+    <WordPart from="КЗ" to="КА" />
+    <WordPart from="ЛЗ" to="ЛА" />
+    <WordPart from="НЗ" to="НА" />
+    <WordPart from="ШЗ" to="ША" />
+    <WordPart from="І\/І" to="М" />
+  </PartialWords>
+  <PartialLines />
+  <PartialLinesAlways />
+  <BeginLines />
+  <EndLines />
+  <WholeLines />
+  <RegularExpressions />
+</OCRFixReplaceList>
\ No newline at end of file
diff --git a/libs/subzero/modification/dictionaries/xml/spa_OCRFixReplaceList.xml b/libs/subzero/modification/dictionaries/xml/spa_OCRFixReplaceList.xml
new file mode 100644
index 000000000..938e90a89
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/xml/spa_OCRFixReplaceList.xml
@@ -0,0 +1,952 @@
+<OCRFixReplaceList>
+  <WholeWords>
+    <!-- Abreviaturas simples -->
+    <Word from="KBs" to="kB" />
+    <Word from="Vd" to="Ud" />
+    <Word from="N°" to="N.°" />
+    <Word from="n°" to="n.°" />
+    <Word from="nro." to="n.°" />
+    <Word from="Nro." to="N.°" />
+    <!-- Ortografía básica -->
+    <Word from="aca" to="acá" />
+    <Word from="actuas" to="actúas" />
+    <Word from="actues" to="actúes" />
+    <Word from="adios" to="adiós" />
+    <Word from="agarrenla" to="agárrenla" />
+    <Word from="agarrenlo" to="agárrenlo" />
+    <Word from="agarrandose" to="agarrándose" />
+    <Word from="algun" to="algún" />
+    <Word from="alli" to="allí" />
+    <Word from="alla" to="allá" />
+    <Word from="alejate" to="aléjate" />
+    <Word from="ahi" to="ahí" />
+    <Word from="angel" to="ángel" />
+    <Word from="angeles" to="ángeles" />
+    <Word from="ansian" to="ansían" />
+    <Word from="apagala" to="apágala" />
+    <Word from="aqui" to="aquí" />
+    <Word from="asi" to="así" />
+    <Word from="bahia" to="bahía" />
+    <Word from="busqueda" to="búsqueda" />
+    <Word from="busquedas" to="búsquedas" />
+    <Word from="callate" to="cállate" />
+    <Word from="carcel" to="cárcel" />
+    <Word from="camara" to="cámara" />
+    <Word from="caido" to="caído" />
+    <Word from="cabron" to="cabrón" />
+    <Word from="camion" to="camión" />
+    <Word from="codigo" to="código" />
+    <Word from="codigos" to="códigos" />
+    <Word from="comence" to="comencé" />
+    <Word from="comprate" to="cómprate" />
+    <Word from="consegui" to="conseguí" />
+    <Word from="confias" to="confías" />
+    <Word from="convertira" to="convertirá" />
+    <Word from="corazon" to="corazón" />
+    <Word from="crei" to="creí" />
+    <Word from="creia" to="creía" />
+    <Word from="creido" to="creído" />
+    <Word from="creiste" to="creíste" />
+    <Word from="cubrenos" to="cúbrenos" />
+    <Word from="comio" to="comió" />
+    <Word from="dara" to="dará" />
+    <Word from="dia" to="día" />
+    <Word from="dias" to="días" />
+    <Word from="debio" to="debió" />
+    <Word from="demelo" to="démelo" />
+    <Word from="dimelo" to="dímelo" />
+    <Word from="denoslo" to="dénoslo" />
+    <Word from="deselo" to="déselo" />
+    <Word from="decia" to="decía" />
+    <Word from="decian" to="decían" />
+    <Word from="detras" to="detrás" />
+    <Word from="deberia" to="debería" />
+    <Word from="deberas" to="deberás" />
+    <Word from="deberias" to="deberías" />
+    <Word from="deberian" to="deberían" />
+    <Word from="deberiamos" to="deberíamos" />
+    <Word from="dejame" to="déjame" />
+    <Word from="dejate" to="déjate" />
+    <Word from="dejalo" to="déjalo" />
+    <Word from="dejarian" to="dejarían" />
+    <Word from="damela" to="dámela" />
+    <Word from="despues" to="después" />
+    <Word from="diciendome" to="diciéndome" />
+    <Word from="dificil" to="difícil" />
+    <Word from="dificiles" to="difíciles" />
+    <Word from="disculpate" to="discúlpate" />
+    <Word from="dolares" to="dólares" />
+    <Word from="hechar" to="echar" />
+    <Word from="examenes" to="exámenes" />
+    <Word from="empezo" to="empezó" />
+    <Word from="empujon" to="empujón" />
+    <Word from="empujalo" to="empújalo" />
+    <Word from="energia" to="energía" />
+    <Word from="enfrian" to="enfrían" />
+    <Word from="escondanme" to="escóndanme" />
+    <Word from="esperame" to="espérame" />
+    <Word from="estara" to="estará" />
+    <Word from="estare" to="estaré" />
+    <Word from="estaria" to="estaría" />
+    <Word from="estan" to="están" />
+    <Word from="estaran" to="estarán" />
+    <Word from="estabamos" to="estábamos" />
+    <Word from="estuvieramos" to="estuviéramos" />
+    <Word from="exito" to="éxito" />
+    <Word from="facil" to="fácil" />
+    <Word from="fiscalia" to="fiscalía" />
+    <Word from="fragil" to="frágil" />
+    <Word from="fragiles" to="frágiles" />
+    <Word from="frances" to="francés" />
+    <Word from="gustaria" to="gustaría" />
+    <Word from="habia" to="había" />
+    <Word from="habias" to="habías" />
+    <Word from="habian" to="habían" />
+    <Word from="habrian" to="habrían" />
+    <Word from="habrias" to="habrías" />
+    <Word from="hagalo" to="hágalo" />
+    <Word from="haria" to="haría" />
+    <Word from="increible" to="increíble" />
+    <Word from="incredulo" to="incrédulo" />
+    <Word from="intentalo" to="inténtalo" />
+    <Word from="ire" to="iré" />
+    <Word from="jovenes" to="jóvenes" />
+    <Word from="ladron" to="ladrón" />
+    <Word from="linea" to="línea" />
+    <Word from="llamame" to="llámame" />
+    <Word from="llevalo" to="llévalo" />
+    <Word from="mama" to="mamá" />
+    <Word from="maricon" to="maricón" />
+    <Word from="mayoria" to="mayoría" />
+    <Word from="metodo" to="método" />
+    <Word from="metodos" to="métodos" />
+    <Word from="mio" to="mío" />
+    <Word from="mostro" to="mostró" />
+    <Word from="morira" to="morirá" />
+    <Word from="muevete" to="muévete" />
+    <Word from="murio" to="murió" />
+    <Word from="numero" to="número" />
+    <Word from="numeros" to="números" />
+    <Word from="ningun" to="ningún" />
+    <Word from="oido" to="oído" />
+    <Word from="oidos" to="oídos" />
+    <Word from="oimos" to="oímos" />
+    <Word from="oiste" to="oíste" />
+    <Word from="pasale" to="pásale" />
+    <Word from="pasame" to="pásame" />
+    <Word from="paraiso" to="paraíso" />
+    <Word from="parate" to="párate" />
+    <Word from="pense" to="pensé" />
+    <Word from="peluqueria" to="peluquería" />
+    <Word from="platano" to="plátano" />
+    <Word from="plastico" to="plástico" />
+    <Word from="plasticos" to="plásticos" />
+    <Word from="policia" to="policía" />
+    <Word from="policias" to="policías" />
+    <Word from="poster" to="póster" />
+    <Word from="podia" to="podía" />
+    <Word from="podias" to="podías" />
+    <Word from="podria" to="podría" />
+    <Word from="podrian" to="podrían" />
+    <Word from="podrias" to="podrías" />
+    <Word from="podriamos" to="podríamos" />
+    <Word from="prometio" to="prometió" />
+    <Word from="proposito" to="propósito" />
+    <Word from="pideselo" to="pídeselo" />
+    <Word from="ponganse" to="pónganse" />
+    <Word from="prometeme" to="prométeme" />
+    <Word from="publico" to="público" />
+    <Word from="publicos" to="públicos" />
+    <Word from="publicamente" to="públicamente" />
+    <Word from="quedate" to="quédate" />
+    <Word from="queria" to="quería" />
+    <Word from="querrias" to="querrías" />
+    <Word from="querian" to="querían" />
+    <Word from="rapido" to="rápido" />
+    <Word from="rapidamente" to="rápidamente" />
+    <Word from="razon" to="razón" />
+    <Word from="rehusen" to="rehúsen" />
+    <Word from="rie" to="ríe" />
+    <Word from="rias" to="rías" />
+    <Word from="rindete" to="ríndete" />
+    <Word from="sacame" to="sácame" />
+    <Word from="sentian" to="sentían" />
+    <Word from="sientate" to="siéntate" />
+    <Word from="sera" to="será" />
+    <Word from="soplon" to="soplón" />
+    <Word from="sueltalo" to="suéltalo" />
+    <Word from="tambien" to="también" />
+    <Word from="teoria" to="teoría" />
+    <Word from="tendra" to="tendrá" />
+    <Word from="telefono" to="teléfono" />
+    <Word from="tipica" to="típica" />
+    <Word from="todavia" to="todavía" />
+    <Word from="tomalo" to="tómalo" />
+    <Word from="tonterias" to="tonterías" />
+    <Word from="torci" to="torcí" />
+    <Word from="traelos" to="tráelos" />
+    <Word from="traiganlo" to="tráiganlo" />
+    <Word from="traiganlos" to="tráiganlos" />
+    <Word from="trio" to="trío" />
+    <Word from="tuvieramos" to="tuviéramos" />
+    <Word from="union" to="unión" />
+    <Word from="ultimo" to="último" />
+    <Word from="ultima" to="última" />
+    <Word from="ultimos" to="últimos" />
+    <Word from="ultimas" to="últimas" />
+    <Word from="unica" to="única" />
+    <Word from="unico" to="único" />
+    <Word from="vamonos" to="vámonos" />
+    <Word from="vayanse" to="váyanse" />
+    <Word from="victima" to="víctima" />
+    <Word from="vivira" to="vivirá" />
+    <Word from="volvio" to="volvió" />
+    <Word from="volvia" to="volvía" />
+    <Word from="volvian" to="volvían" />
+    <!-- Palabras con eír/oír más usadas -->
+    <Word from="reir" to="reír" />
+    <Word from="freir" to="freír" />
+    <Word from="sonreir" to="sonreír" />
+    <Word from="hazmerreir" to="hazmerreír" />
+    <Word from="oir" to="oír" />
+    <Word from="oirlo" to="oírlo" />
+    <Word from="oirte" to="oírte" />
+    <Word from="oirse" to="oírse" />
+    <Word from="oirme" to="oírme" />
+    <Word from="oirle" to="oírle" />
+    <Word from="oirla" to="oírla" />
+    <Word from="oirles" to="oírles" />
+    <Word from="oirnos" to="oírnos" />
+    <Word from="oirlas" to="oírlas" />
+    <!-- Palabras que no llevan acento -->
+    <Word from="bién" to="bien" />
+    <Word from="crímen" to="crimen" />
+    <Word from="fué" to="fue" />
+    <Word from="fuí" to="fui" />
+    <Word from="quiéres" to="quieres" />
+    <Word from="tí" to="ti" />
+    <Word from="dí" to="di" />
+    <Word from="vá" to="va" />
+    <Word from="vé" to="ve" />
+    <Word from="ví" to="vi" />
+    <Word from="vió" to="vio" />
+    <Word from="ó" to="o" />
+    <Word from="clón" to="clon" />
+    <Word from="dió" to="dio" />
+    <Word from="guión" to="guion" />
+    <Word from="dón" to="don" />
+    <Word from="fé" to="fe" />
+    <Word from="áquel" to="aquel" />
+    <!-- Palabras donde se puede prescindir de la tilde diacrítica -->
+    <Word from="éste" to="este" />
+    <Word from="ésta" to="esta" />
+    <Word from="éstos" to="estos" />
+    <Word from="éstas" to="estas" />
+    <Word from="ése" to="ese" />
+    <Word from="ésa" to="esa" />
+    <Word from="ésos" to="esos" />
+    <Word from="ésas" to="esas" />
+    <Word from="sólo" to="solo" />
+    <!-- Errores no relacionados con los tildes -->
+    <Word from="coktel" to="cóctel" />
+    <Word from="cocktel" to="cóctel" />
+    <Word from="conciente" to="consciente" />
+    <Word from="comenzé" to="comencé" />
+    <Word from="desilucionarte" to="desilusionarte" />
+    <Word from="dijieron" to="dijeron" />
+    <Word from="empezé" to="empecé" />
+    <Word from="hize" to="hice" />
+    <Word from="ilucionarte" to="ilusionarte" />
+    <Word from="inconciente" to="inconsciente" />
+    <Word from="quize" to="quise" />
+    <Word from="quizo" to="quiso" />
+    <Word from="verguenza" to="vergüenza" />
+    <!-- Errores en nombres propios o de países -->
+    <Word from="Nuñez" to="Núñez" />
+    <Word from="Ivan" to="Iván" />
+    <Word from="Japon" to="Japón" />
+    <Word from="Monica" to="Mónica" />
+    <Word from="Maria" to="María" />
+    <Word from="Jose" to="José" />
+    <Word from="Ramon" to="Ramón" />
+    <Word from="Garcia" to="García" />
+    <Word from="Gonzalez" to="González" />
+    <Word from="Jesus" to="Jesús" />
+    <Word from="Alvarez" to="Álvarez" />
+    <Word from="Damian" to="Damián" />
+    <Word from="Rene" to="René" />
+    <Word from="Nicolas" to="Nicolás" />
+    <Word from="Jonas" to="Jonás" />
+    <Word from="Lopez" to="López" />
+    <Word from="Hernandez" to="Hernández" />
+    <Word from="Bermudez" to="Bermúdez" />
+    <Word from="Fernandez" to="Fernández" />
+    <Word from="Suarez" to="Suárez" />
+    <Word from="Sofia" to="Sofía" />
+    <Word from="Seneca" to="Séneca" />
+    <Word from="Tokyo" to="Tokio" />
+    <Word from="Canada" to="Canadá" />
+    <Word from="Paris" to="París" />
+    <Word from="Turquia" to="Turquía" />
+    <Word from="Mexico" to="México" />
+    <Word from="Mejico" to="México" />
+    <Word from="Matias" to="Matías" />
+    <Word from="Valentin" to="Valentín" />
+    <Word from="mejicano" to="mexicano" />
+    <Word from="mejicanos" to="mexicanos" />
+    <Word from="mejicana" to="mexicana" />
+    <Word from="mejicanas" to="mexicanas" />
+    <!-- Creados por SE -->
+    <Word from="io" to="lo" />
+    <Word from="ia" to="la" />
+    <Word from="ie" to="le" />
+    <Word from="Io" to="lo" />
+    <Word from="Ia" to="la" />
+    <Word from="AI" to="Al" />
+    <Word from="Ie" to="le" />
+    <Word from="EI" to="El" />
+    <Word from="subafluente" to="subafluente" />
+    <Word from="aflójalo" to="aflójalo" />
+    <Word from="Aflójalo" to="Aflójalo" />
+    <Word from="perdi" to="perdí" />
+    <Word from="Podria" to="Podría" />
+    <Word from="confia" to="confía" />
+    <Word from="pasaria" to="pasaría" />
+    <Word from="Podias" to="Podías" />
+    <Word from="responsabke" to="responsable" />
+    <Word from="Todavia" to="Todavía" />
+    <Word from="envien" to="envíen" />
+    <Word from="Queria" to="Quería" />
+    <Word from="tio" to="tío" />
+    <Word from="traido" to="traído" />
+    <Word from="Asi" to="Así" />
+    <Word from="elegi" to="elegí" />
+    <Word from="habria" to="habría" />
+    <Word from="encantaria" to="encantaría" />
+    <Word from="leido" to="leído" />
+    <Word from="conocias" to="conocías" />
+    <Word from="harias" to="harías" />
+    <Word from="Aqui" to="Aquí" />
+    <Word from="decidi" to="decidí" />
+    <Word from="mia" to="mía" />
+    <Word from="Crei" to="Creí" />
+    <Word from="podiamos" to="podíamos" />
+    <Word from="avisame" to="avísame" />
+    <Word from="debia" to="debía" />
+    <Word from="pensarias" to="pensarías" />
+    <Word from="reuniamos" to="reuníamos" />
+    <Word from="POÏ" to="por" />
+    <Word from="vendria" to="vendría" />
+    <Word from="caida" to="caída" />
+    <Word from="venian" to="venían" />
+    <Word from="compañias" to="compañías" />
+    <Word from="leiste" to="leíste" />
+    <Word from="Leiste" to="Leíste" />
+    <Word from="fiaria" to="fiaría" />
+    <Word from="Hungria" to="Hungría" />
+    <Word from="fotografia" to="fotografía" />
+    <Word from="cafeteria" to="cafetería" />
+    <Word from="Digame" to="Dígame" />
+    <Word from="debias" to="debías" />
+    <Word from="tendria" to="tendría" />
+    <Word from="CÏGO" to="creo" />
+    <Word from="anteg" to="antes" />
+    <Word from="SóIo" to="Solo" />
+    <Word from="Ilamándola" to="llamándola" />
+    <Word from="Cáflaté" to="Cállate" />
+    <Word from="Ilamaste" to="llamaste" />
+    <Word from="daria" to="daría" />
+    <Word from="Iargaba" to="largaba" />
+    <Word from="Yati" to="Y a ti" />
+    <Word from="querias" to="querías" />
+    <Word from="Iimpiarlo" to="limpiarlo" />
+    <Word from="Iargado" to="largado" />
+    <Word from="galeria" to="galería" />
+    <Word from="Bartomeu" to="Bertomeu" />
+    <Word from="Iocalizarlo" to="localizarlo" />
+    <Word from="Ilámame" to="llámame" />
+  </WholeWords>
+  <PartialWordsAlways />
+  <PartialWords />
+  <PartialLines>
+    <!-- Varios -->
+    <LinePart from="de gratis" to="gratis" />
+    <LinePart from="si quiera" to="siquiera" />
+    <LinePart from="Cada una de los" to="Cada uno de los" />
+    <LinePart from="Cada uno de las" to="Cada una de las" />
+    <!-- Uso incorrecto de haber / a ver -->
+    <LinePart from="haber que" to="a ver qué" />
+    <LinePart from="haber qué" to="a ver qué" />
+    <LinePart from="Haber si" to="A ver si" />
+    <!-- Ponombres exclamativos o interrogativos Parte 1 -->
+    <LinePart from=" que hora" to=" qué hora" />
+    <LinePart from="yo que se" to="yo qué sé" />
+    <LinePart from="Yo que se" to="Yo qué sé" />
+    <!-- Acentos al final de los signos de exclamación -->
+    <LinePart from=" tu!" to=" tú!" />
+    <LinePart from=" si!" to=" sí!" />
+    <LinePart from=" mi!" to=" mí!" />
+    <LinePart from=" el!" to=" él!" />
+    <!-- Acentos al final de los signos de interrogación -->
+    <LinePart from=" tu?" to=" tú?" />
+    <LinePart from=" si?" to=" sí?" />
+    <LinePart from=" mi?" to=" mí?" />
+    <LinePart from=" el?" to=" él?" />
+    <LinePart from=" aun?" to=" aún?" />
+    <LinePart from=" mas?" to=" más?" />
+    <LinePart from=" que?" to=" qué?" />
+    <LinePart from=" paso?" to=" pasó?" />
+    <LinePart from=" cuando?" to=" cuándo?" />
+    <LinePart from=" cuanto?" to=" cuánto?" />
+    <LinePart from=" cuanta?" to=" cuánta?" />
+    <LinePart from=" cuantas?" to=" cuántas?" />
+    <LinePart from=" cuantos?" to=" cuántos?" />
+    <LinePart from=" donde?" to=" dónde?" />
+    <LinePart from=" quien?" to=" quién?" />
+    <LinePart from=" como?" to=" cómo?" />
+    <LinePart from=" adonde?" to=" adónde?" />
+    <LinePart from=" cual?" to=" cuál?" />
+    <!-- Acentos en los signos de interrogación completos -->
+    <LinePart from="¿Si?" to="¿Sí?" />
+    <LinePart from="¿esta bien?" to="¿está bien?" />
+    <!-- Enunciados que son a la vez interrogativos y exclamativos -->
+    <LinePart from="¿Pero qué haces?" to="¡¿Pero qué haces?!" />
+    <LinePart from="¿pero qué haces?" to="¡¿pero qué haces?!" />
+    <LinePart from="¿Es que no me has escuchado?" to="¡¿Es que no me has escuchado?!" />
+    <LinePart from="¡¿es que no me has escuchado?!" to="¡¿es que no me has escuchado?!" />
+    <!-- Acentos al principio de los signos de interrogación con minúsculas -->
+    <LinePart from="¿aun" to="¿aún" />
+    <LinePart from="¿tu " to="¿tú " />
+    <LinePart from="¿que " to="¿qué " />
+    <LinePart from="¿sabes que" to="¿sabes qué" />
+    <LinePart from="¿sabes adonde" to="¿sabes adónde" />
+    <LinePart from="¿sabes cual" to="¿sabes cuál" />
+    <LinePart from="¿sabes quien" to="¿sabes quién" />
+    <LinePart from="¿sabes como" to="¿sabes cómo" />
+    <LinePart from="¿sabes cuan" to="¿sabes cuán" />
+    <LinePart from="¿sabes cuanto" to="¿sabes cuánto" />
+    <LinePart from="¿sabes cuanta" to="¿sabes cuánta" />
+    <LinePart from="¿sabes cuantos" to="¿sabes cuántos" />
+    <LinePart from="¿sabes cuantas" to="¿sabes cuántas" />
+    <LinePart from="¿sabes cuando" to="¿sabes cuándo" />
+    <LinePart from="¿sabes donde" to="¿sabes dónde" />
+    <LinePart from="¿sabe que" to="¿sabe qué" />
+    <LinePart from="¿sabe adonde" to="¿sabe adónde" />
+    <LinePart from="¿sabe cual" to="¿sabe cuál" />
+    <LinePart from="¿sabe quien" to="¿sabe quién" />
+    <LinePart from="¿sabe como" to="¿sabe cómo" />
+    <LinePart from="¿sabe cuan" to="¿sabe cuán" />
+    <LinePart from="¿sabe cuanto" to="¿sabe cuánto" />
+    <LinePart from="¿sabe cuanta" to="¿sabe cuánta" />
+    <LinePart from="¿sabe cuantos" to="¿sabe cuántos" />
+    <LinePart from="¿sabe cuantas" to="¿sabe cuántas" />
+    <LinePart from="¿sabe cuando" to="¿sabe cuándo" />
+    <LinePart from="¿sabe donde" to="¿sabe dónde" />
+    <LinePart from="¿saben que" to="¿saben qué" />
+    <LinePart from="¿saben adonde" to="¿saben adónde" />
+    <LinePart from="¿saben cual" to="¿saben cuál" />
+    <LinePart from="¿saben quien" to="¿saben quién" />
+    <LinePart from="¿saben como" to="¿saben cómo" />
+    <LinePart from="¿saben cuan" to="¿saben cuán" />
+    <LinePart from="¿saben cuanto" to="¿saben cuánto" />
+    <LinePart from="¿saben cuanta" to="¿saben cuánta" />
+    <LinePart from="¿saben cuantos" to="¿saben cuántos" />
+    <LinePart from="¿saben cuantas" to="¿saben cuántas" />
+    <LinePart from="¿saben cuando" to="¿saben cuándo" />
+    <LinePart from="¿saben donde" to="¿saben dónde" />
+    <LinePart from="¿de que" to="¿de qué" />
+    <LinePart from="¿de donde" to="¿de dónde" />
+    <LinePart from="¿de cual" to="¿de cuál" />
+    <LinePart from="¿de quien" to="¿de quién" />
+    <LinePart from="¿de cuanto" to="¿de cuánto" />
+    <LinePart from="¿de cuanta" to="¿de cuánta" />
+    <LinePart from="¿de cuantos" to="¿de cuántos" />
+    <LinePart from="¿de cuantas" to="¿de cuántas" />
+    <LinePart from="¿de cuando" to="¿de cuándo" />
+    <LinePart from="¿sobre que" to="¿sobre qué" />
+    <LinePart from="¿como " to="¿cómo " />
+    <LinePart from="¿cual " to="¿cuál " />
+    <LinePart from="¿en cual" to="¿en cuál" />
+    <LinePart from="¿cuando" to="¿cuándo" />
+    <LinePart from="¿hasta cual" to="¿hasta cuál" />
+    <LinePart from="¿hasta quien" to="¿hasta quién" />
+    <LinePart from="¿hasta cuanto" to="¿hasta cuánto" />
+    <LinePart from="¿hasta cuantas" to="¿hasta cuántas" />
+    <LinePart from="¿hasta cuantos" to="¿hasta cuántos" />
+    <LinePart from="¿hasta cuando" to="¿hasta cuándo" />
+    <LinePart from="¿hasta donde" to="¿hasta dónde" />
+    <LinePart from="¿hasta que" to="¿hasta qué" />
+    <LinePart from="¿hasta adonde" to="¿hasta adónde" />
+    <LinePart from="¿desde que" to="¿desde qué" />
+    <LinePart from="¿desde cuando" to="¿desde cuándo" />
+    <LinePart from="¿desde quien" to="¿desde quién" />
+    <LinePart from="¿desde donde" to="¿desde dónde" />
+    <LinePart from="¿cuanto" to="¿cuánto" />
+    <LinePart from="¿cuantos" to="¿cuántos" />
+    <LinePart from="¿donde" to="¿dónde" />
+    <LinePart from="¿adonde" to="¿adónde" />
+    <LinePart from="¿con que" to="¿con qué" />
+    <LinePart from="¿con cual" to="¿con cuál" />
+    <LinePart from="¿con quien" to="¿con quién" />
+    <LinePart from="¿con cuantos" to="¿con cuántos" />
+    <LinePart from="¿con cuantas" to="¿con cuántas" />
+    <LinePart from="¿con cuanta" to="¿con cuánta" />
+    <LinePart from="¿con cuanto" to="¿con cuánto" />
+    <LinePart from="¿para donde" to="¿para dónde" />
+    <LinePart from="¿para adonde" to="¿para adónde" />
+    <LinePart from="¿para cuando" to="¿para cuándo" />
+    <LinePart from="¿para que" to="¿para qué" />
+    <LinePart from="¿para quien" to="¿para quién" />
+    <LinePart from="¿para cuanto" to="¿para cuánto" />
+    <LinePart from="¿para cuanta" to="¿para cuánta" />
+    <LinePart from="¿para cuantos" to="¿para cuántos" />
+    <LinePart from="¿para cuantas" to="¿para cuántas" />
+    <LinePart from="¿a donde" to="¿a dónde" />
+    <LinePart from="¿a que" to="¿a qué" />
+    <LinePart from="¿a cual" to="¿a cuál" />
+    <LinePart from="¿a quien" to="¿a quien" />
+    <LinePart from="¿a como" to="¿a cómo" />
+    <LinePart from="¿a cuanto" to="¿a cuánto" />
+    <LinePart from="¿a cuanta" to="¿a cuánta" />
+    <LinePart from="¿a cuantos" to="¿a cuántos" />
+    <LinePart from="¿a cuantas" to="¿a cuántas" />
+    <LinePart from="¿por que" to="¿por qué" />
+    <LinePart from="¿por cual" to="¿por cuál" />
+    <LinePart from="¿por quien" to="¿por quién" />
+    <LinePart from="¿por cuanto" to="¿por cuánto" />
+    <LinePart from="¿por cuanta" to="¿por cuánta" />
+    <LinePart from="¿por cuantos" to="¿por cuántos" />
+    <LinePart from="¿por cuantas" to="¿por cuántas" />
+    <LinePart from="¿por donde" to="¿por dónde" />
+    <LinePart from="¿porque" to="¿por qué" />
+    <LinePart from="¿porqué" to="¿por qué" />
+    <LinePart from="¿y que" to="¿y qué" />
+    <LinePart from="¿y como" to="¿y cómo" />
+    <LinePart from="¿y cuando" to="¿y cuándo" />
+    <LinePart from="¿y cual" to="¿y cuál" />
+    <LinePart from="¿y quien" to="¿y quién" />
+    <LinePart from="¿y cuanto" to="¿y cuánto" />
+    <LinePart from="¿y cuanta" to="¿y cuánta" />
+    <LinePart from="¿y cuantos" to="¿y cuántos" />
+    <LinePart from="¿y cuantas" to="¿y cuántas" />
+    <LinePart from="¿y donde" to="¿y dónde" />
+    <LinePart from="¿y adonde" to="¿y adónde" />
+    <LinePart from="¿quien " to="¿quién " />
+    <LinePart from="¿esta " to="¿está " />
+    <LinePart from="¿estas " to="¿estás " />
+    <!-- Acentos al principio de los signos de interrogación con mayúsculas -->
+    <LinePart from="¿Aun" to="¿Aún" />
+    <LinePart from="¿Que " to="¿Qué " />
+    <LinePart from="¿Sabes que" to="¿Sabes qué" />
+    <LinePart from="¿Sabes adonde" to="¿Sabes adónde" />
+    <LinePart from="¿Sabes cual" to="¿Sabes cuál" />
+    <LinePart from="¿Sabes quien" to="¿Sabes quién" />
+    <LinePart from="¿Sabes como" to="¿Sabes cómo" />
+    <LinePart from="¿Sabes cuan" to="¿Sabes cuán" />
+    <LinePart from="¿Sabes cuanto" to="¿Sabes cuánto" />
+    <LinePart from="¿Sabes cuanta" to="¿Sabes cuánta" />
+    <LinePart from="¿Sabes cuantos" to="¿Sabes cuántos" />
+    <LinePart from="¿Sabes cuantas" to="¿Sabes cuántas" />
+    <LinePart from="¿Sabes cuando" to="¿Sabes cuándo" />
+    <LinePart from="¿Sabes donde" to="¿Sabes dónde" />
+    <LinePart from="¿Sabe que" to="¿Sabe qué" />
+    <LinePart from="¿Sabe adonde" to="¿Sabe adónde" />
+    <LinePart from="¿Sabe cual" to="¿Sabe cuál" />
+    <LinePart from="¿Sabe quien" to="¿Sabe quién" />
+    <LinePart from="¿Sabe como" to="¿Sabe cómo" />
+    <LinePart from="¿Sabe cuan" to="¿Sabe cuán" />
+    <LinePart from="¿Sabe cuanto" to="¿Sabe cuánto" />
+    <LinePart from="¿Sabe cuanta" to="¿Sabe cuánta" />
+    <LinePart from="¿Sabe cuantos" to="¿Sabe cuántos" />
+    <LinePart from="¿Sabe cuantas" to="¿Sabe cuántas" />
+    <LinePart from="¿Sabe cuando" to="¿Sabe cuándo" />
+    <LinePart from="¿Sabe donde" to="¿Sabe dónde" />
+    <LinePart from="¿Saben que" to="¿Saben qué" />
+    <LinePart from="¿Saben adonde" to="¿Saben adónde" />
+    <LinePart from="¿Saben cual" to="¿Saben cuál" />
+    <LinePart from="¿Saben quien" to="¿Saben quién" />
+    <LinePart from="¿Saben como" to="¿Saben cómo" />
+    <LinePart from="¿Saben cuan" to="¿Saben cuán" />
+    <LinePart from="¿Saben cuanto" to="¿Saben cuánto" />
+    <LinePart from="¿Saben cuanta" to="¿Saben cuánta" />
+    <LinePart from="¿Saben cuantos" to="¿Saben cuántos" />
+    <LinePart from="¿Saben cuantas" to="¿Saben cuántas" />
+    <LinePart from="¿Saben cuando" to="¿Saben cuándo" />
+    <LinePart from="¿Saben donde" to="¿Saben dónde" />
+    <LinePart from="¿De que" to="¿De qué" />
+    <LinePart from="¿De donde" to="¿De dónde" />
+    <LinePart from="¿De cual" to="¿De cuál" />
+    <LinePart from="¿De quien" to="¿De quién" />
+    <LinePart from="¿De cuanto" to="¿De cuánto" />
+    <LinePart from="¿De cuanta" to="¿De cuánta" />
+    <LinePart from="¿De cuantos" to="¿De cuántos" />
+    <LinePart from="¿De cuantas" to="¿De cuántas" />
+    <LinePart from="¿De cuando" to="¿De cuándo" />
+    <LinePart from="¿Desde que" to="¿Desde qué" />
+    <LinePart from="¿Desde cuando" to="¿Desde cuándo" />
+    <LinePart from="¿Desde quien" to="¿Desde quién" />
+    <LinePart from="¿Desde donde" to="¿Desde dónde" />
+    <LinePart from="¿Sobre que" to="¿Sobre qué" />
+    <LinePart from="¿Como " to="¿Cómo " />
+    <LinePart from="¿Cual " to="¿Cuál " />
+    <LinePart from="¿En cual" to="¿En cuál" />
+    <LinePart from="¿Cuando" to="¿Cuándo" />
+    <LinePart from="¿Hasta cual" to="¿Hasta cuál" />
+    <LinePart from="¿Hasta quien" to="¿Hasta quién" />
+    <LinePart from="¿Hasta cuanto" to="¿Hasta cuánto" />
+    <LinePart from="¿Hasta cuantas" to="¿Hasta cuántas" />
+    <LinePart from="¿Hasta cuantos" to="¿Hasta cuántos" />
+    <LinePart from="¿Hasta cuando" to="¿Hasta cuándo" />
+    <LinePart from="¿Hasta donde" to="¿Hasta dónde" />
+    <LinePart from="¿Hasta que" to="¿Hasta qué" />
+    <LinePart from="¿Hasta adonde" to="¿Hasta adónde" />
+    <LinePart from="¿Cuanto" to="¿Cuánto" />
+    <LinePart from="¿Cuantos" to="¿Cuántos" />
+    <LinePart from="¿Donde" to="¿Dónde" />
+    <LinePart from="¿Adonde" to="¿Adónde" />
+    <LinePart from="¿Con que" to="¿Con qué" />
+    <LinePart from="¿Con cual" to="¿Con cuál" />
+    <LinePart from="¿Con quien" to="¿Con quién" />
+    <LinePart from="¿Con cuantos" to="¿Con cuántos" />
+    <LinePart from="¿Con cuanta" to="¿Con cuántas" />
+    <LinePart from="¿Con cuanta" to="¿Con cuánta" />
+    <LinePart from="¿Con cuanto" to="¿Con cuánto" />
+    <LinePart from="¿Para donde" to="¿Para dónde" />
+    <LinePart from="¿Para adonde" to="¿Para adónde" />
+    <LinePart from="¿Para cuando" to="¿Para cuándo" />
+    <LinePart from="¿Para que" to="¿Para qué" />
+    <LinePart from="¿Para quien" to="¿Para quién" />
+    <LinePart from="¿Para cuanto" to="¿Para cuánto" />
+    <LinePart from="¿Para cuanta" to="¿Para cuánta" />
+    <LinePart from="¿Para cuantos" to="¿Para cuántos" />
+    <LinePart from="¿Para cuantas" to="¿Para cuántas" />
+    <LinePart from="¿A donde" to="¿A dónde" />
+    <LinePart from="¿A que" to="¿A qué" />
+    <LinePart from="¿A cual" to="¿A cuál" />
+    <LinePart from="¿A quien" to="¿A quien" />
+    <LinePart from="¿A como" to="¿A cómo" />
+    <LinePart from="¿A cuanto" to="¿A cuánto" />
+    <LinePart from="¿A cuanta" to="¿A cuánta" />
+    <LinePart from="¿A cuantos" to="¿A cuántos" />
+    <LinePart from="¿A cuantas" to="¿A cuántas" />
+    <LinePart from="¿Por que" to="¿Por qué" />
+    <LinePart from="¿Por cual" to="¿Por cuál" />
+    <LinePart from="¿Por quien" to="¿Por quién" />
+    <LinePart from="¿Por cuanto" to="¿Por cuánto" />
+    <LinePart from="¿Por cuanta" to="¿Por cuánta" />
+    <LinePart from="¿Por cuantos" to="¿Por cuántos" />
+    <LinePart from="¿Por cuantas" to="¿Por cuántas" />
+    <LinePart from="¿Por donde" to="¿Por dónde" />
+    <LinePart from="¿Porque" to="¿Por qué" />
+    <LinePart from="¿Porqué" to="¿Por qué" />
+    <LinePart from="¿Y que" to="¿Y qué" />
+    <LinePart from="¿Y como" to="¿Y cómo" />
+    <LinePart from="¿Y cuando" to="¿Y cuándo" />
+    <LinePart from="¿Y cual" to="¿Y cuál" />
+    <LinePart from="¿Y quien" to="¿Y quién" />
+    <LinePart from="¿Y cuanto" to="¿Y cuánto" />
+    <LinePart from="¿Y cuanta" to="¿Y cuánta" />
+    <LinePart from="¿Y cuantos" to="¿Y cuántos" />
+    <LinePart from="¿Y cuantas" to="¿Y cuántas" />
+    <LinePart from="¿Y donde" to="¿Y dónde" />
+    <LinePart from="¿Y adonde" to="¿Y adónde" />
+    <LinePart from="¿Quien " to="¿Quién " />
+    <LinePart from="¿Esta " to="¿Está " />
+    <!-- Tilde diacrítica en oraciones interrogativas o exclamativas indirectas -->
+    <LinePart from="el porque" to="el porqué" />
+    <LinePart from="su porque" to="su porqué" />
+    <LinePart from="los porqués" to="los porqués" />
+    <!-- aún -->
+    <LinePart from="aun," to="aún," />
+    <LinePart from="aun no" to="aún no" />
+    <!-- dé -->
+    <LinePart from=" de y " to=" dé y " />
+    <LinePart from=" nos de " to=" nos dé " />
+    <!-- tú -->
+    <LinePart from=" tu ya " to=" tú ya " />
+    <LinePart from="Tu ya " to="Tú ya " />
+    <!-- casos específicos antes de la coma -->
+    <LinePart from=" de, " to=" dé," />
+    <LinePart from=" mi, " to=" mí," />
+    <LinePart from=" tu, " to=" tú," />
+    <LinePart from=" el, " to=" él," />
+    <LinePart from=" te, " to=" té," />
+    <LinePart from=" mas, " to=" más," />
+    <LinePart from=" quien, " to=" quién," />
+    <LinePart from=" cual," to=" cuál," />
+    <LinePart from="porque, " to="porqué," />
+    <LinePart from="cuanto, " to="cuánto," />
+    <LinePart from="cuando, " to="cuándo," />
+    <!-- sé -->
+    <LinePart from=" se," to=" sé," />
+    <LinePart from="se donde" to="sé dónde" />
+    <LinePart from="se cuando" to="sé cuándo" />
+    <LinePart from="se adonde" to="sé adónde" />
+    <LinePart from="se como" to="sé cómo" />
+    <LinePart from="se cual" to="sé cuál" />
+    <LinePart from="se quien" to="sé quién" />
+    <LinePart from="se cuanto" to="sé cuánto" />
+    <LinePart from="se cuanta" to="sé cuánta" />
+    <LinePart from="se cuantos" to="sé cuántos" />
+    <LinePart from="se cuantas" to="sé cuántas" />
+    <LinePart from="se cuan" to="sé cuán" />
+    <!-- si/sí -->
+    <LinePart from=" el si " to=" el sí " />
+    <LinePart from="si mismo" to="sí mismo" />
+    <LinePart from="si misma" to="sí misma" />
+    <!-- Errores de "l" en vez de "i" en casos específicos -->
+    <LinePart from=" llegal" to=" ilegal" />
+    <LinePart from=" lluminar" to=" iluminar" />
+    <LinePart from="sllbato" to="silbato" />
+    <LinePart from="sllenclo" to="silencio" />
+    <LinePart from="clemencla" to="clemencia" />
+    <LinePart from="socledad" to="sociedad" />
+    <LinePart from="tlene" to="tiene" />
+    <LinePart from="tlempo" to="tiempo" />
+    <LinePart from="equlvocaba" to="equivocaba" />
+    <LinePart from="qulnce" to="quince" />
+    <LinePart from="comlen" to="comien" />
+    <LinePart from="historl" to="histori" />
+    <LinePart from="misterl" to="misteri" />
+    <LinePart from="vivencl" to="vivenci" />
+  </PartialLines>
+  <PartialLinesAlways />
+  <BeginLines />
+  <EndLines>
+    <Ending from=".»." to="»." />
+  </EndLines>
+  <WholeLines>
+    <!-- Todas las líneas -->
+    <Line from="No" to="No." />
+  </WholeLines>
+  <RegularExpressions>
+    <!-- Abreviaturas compuestas -->
+    <RegEx find="\b[Ss](r|ra|rta)\b\.?" replaceWith="S$1." />
+    <RegEx find="\b[Dd](r|ra)\b\.?" replaceWith="D$1." />
+    <RegEx find="\b[Uu](d|ds)\b\.?" replaceWith="U$1." />
+    <RegEx find="(\d)(\s){0,1}([Aa])(\.){0,1}([Mm])(\.){0,1}(\W){0,1}" replaceWith="$1 a. m.$7" />
+    <RegEx find="(\d)(\s){0,1}([Pp])(\.){0,1}([Mm])(\.){0,1}(\W){0,1}" replaceWith="$1 p. m.$7" />
+    <RegEx find="(\d)(\s){0,1}(h)(s\b|r\b|rs\b){0,1}(\.){0,1}(\W){0,1}" replaceWith="$1 $3$6" />
+    <RegEx find="(\d)(\s){0,1}([Kk])(m\b|ms\b)(\.){0,1}(\W){0,1}" replaceWith="$1 km$6" />
+    <RegEx find="(\d)(\s){0,1}(s)(g\b|eg\b){0,1}(\.){0,1}(\W){0,1}" replaceWith="$1 s$6" />
+    <RegEx find="(\d)(\s){0,1}([Kk])(g\b|gs\b)(\.){0,1}(\W){0,1}" replaceWith="$1 kg$6" />
+    <RegEx find="(\d)(\s){0,1}(m)(t\b|ts\b){0,1}(\.){0,1}(\W){0,1}" replaceWith="$1 m$6" />
+    <RegEx find="(\d)KBs(\W){0,1}" replaceWith="$1 kB$2" />
+    <RegEx find="([Nn])°(\s){0,1}(\d)" replaceWith="$1.° $3" />
+    <RegEx find="([Nn])ro(\.){0,1}(\s){0,1}(\d)" replaceWith="$1.° $4" />
+    <!-- Signos invertidos -->
+    <RegEx find="\?¿(\W|\w)" replaceWith="? ¿$1" />
+    <RegEx find="\!¡(\W|\w)" replaceWith="! ¡$1" />
+    <RegEx find="\?¿¿(\W|\w)" replaceWith="? ¿$1" />
+    <RegEx find="\!¡¡(\W|\w)" replaceWith="! ¡$1" />
+    <!-- Inicio de línea -->
+    <RegEx find="^_(\s)" replaceWith="-$1" />
+    <RegEx find="^_(\w)" replaceWith="- $1" />
+    <!-- Uso de comillas según la recomendación de la RAE y la Wikipedia -->
+    <RegEx find="(«[^“«»]+)«" replaceWith="$1“" />
+    <RegEx find="(“[^«»”]+)»" replaceWith="$1”" />
+    <RegEx find="`" replaceWith="‘" />
+    <RegEx find="´" replaceWith="’" />
+    <RegEx find="([\wá-ú])(\.)(«|»)" replaceWith="$1»." />
+    <RegEx find="«(\?)" replaceWith="»?" />
+    <RegEx find="«(\!)" replaceWith="»!" />
+    <RegEx find="«\s" replaceWith="» " />
+    <RegEx find="«(\))" replaceWith="»)" />
+    <RegEx find="(\?)«" replaceWith="?»" />
+    <RegEx find="(\!)«" replaceWith="!»" />
+    <RegEx find="«(,)" replaceWith="»," />
+    <RegEx find="«(;)" replaceWith="»;" />
+    <RegEx find="«(:)" replaceWith="»:" />
+    <RegEx find="(¿)»" replaceWith="¿«" />
+    <RegEx find="(¡)»" replaceWith="¡«" />
+    <!-- Uso de comillas (ANSI) según la recomendación de la RAE («\x22» es el carácter «"») -->
+    <RegEx find="([\wá-ú])([\.,]) ?[\x22»]" replaceWith="$1»$2" />
+    <RegEx find="([\wá-ú])\?[\x22»](\s|$)" replaceWith="$1?».$2" />
+    <RegEx find="^(\.\.\.)(\s){0,1}\x22" replaceWith="$1«" />
+    <RegEx find="«\x22" replaceWith="«" />
+    <RegEx find="\x22»" replaceWith="»" />
+    <RegEx find="^\x22{2,}" replaceWith="«" />
+    <RegEx find="\x22{2,}$" replaceWith="»" />
+    <RegEx find="\x22\r" replaceWith="»" />
+    <RegEx find="^\x22" replaceWith="«" />
+    <RegEx find="\x22$" replaceWith="»." />
+    <RegEx find="([\wá-ú])\.[\x22»]" replaceWith="$1»." />
+    <RegEx find="\s\x22" replaceWith=" «" />
+    <RegEx find="\x22\s" replaceWith="» " />
+    <RegEx find="\x22(,)" replaceWith="»," />
+    <RegEx find="\x22(\.)" replaceWith="»." />
+    <RegEx find="\x22(;)" replaceWith="»;" />
+    <RegEx find="\x22(:)" replaceWith="»:" />
+    <RegEx find="(\!)\x22" replaceWith="!»" />
+    <RegEx find="\x22(\!)" replaceWith="»!" />
+    <RegEx find="(\?)\x22" replaceWith="?»" />
+    <RegEx find="\x22(\?)" replaceWith="»?" />
+    <RegEx find="\x22(¿)" replaceWith="«¿" />
+    <RegEx find="(¿)\x22" replaceWith="¿«" />
+    <RegEx find="\x22(¡)" replaceWith="«¡" />
+    <RegEx find="(¡)\x22" replaceWith="¡«" />
+    <RegEx find="\x22(\))" replaceWith="»)" />
+    <RegEx find="(\))\x22" replaceWith=")»" />
+    <RegEx find="(\()\x22" replaceWith="(«" />
+    <!-- Uso de comillas (Unicode) según la recomendación de la RAE («\u0022» es el carácter «"») -->
+    <RegEx find="^(\.\.\.)(\s){0,1}\u0022" replaceWith="$1«" />
+    <RegEx find="^\u0022{2,}" replaceWith="«" />
+    <RegEx find="\u0022{2,}$" replaceWith="»" />
+    <RegEx find="\u0022\r" replaceWith="»" />
+    <RegEx find="^\u0022" replaceWith="«" />
+    <RegEx find="\u0022$" replaceWith="»" />
+    <RegEx find="(\w)(\.)\u0022" replaceWith="$1»." />
+    <RegEx find="\s\u0022" replaceWith=" «" />
+    <RegEx find="\u0022\s" replaceWith="» " />
+    <RegEx find="\u0022(,)" replaceWith="»," />
+    <RegEx find="\u0022(\.)" replaceWith="»." />
+    <RegEx find="\u0022(;)" replaceWith="»;" />
+    <RegEx find="\u0022(:)" replaceWith="»:" />
+    <RegEx find="(\!)\u0022" replaceWith="!»" />
+    <RegEx find="\u0022(\!)" replaceWith="»!" />
+    <RegEx find="(\?)\u0022" replaceWith="?»" />
+    <RegEx find="\u0022(\?)" replaceWith="»?" />
+    <RegEx find="\u0022(¿)" replaceWith="«¿" />
+    <RegEx find="(¿)\u0022" replaceWith="¿«" />
+    <RegEx find="\u0022(¡)" replaceWith="«¡" />
+    <RegEx find="(¡)\u0022" replaceWith="¡«" />
+    <RegEx find="\u0022(\))" replaceWith="»)" />
+    <RegEx find="(\))\u0022" replaceWith=")»" />
+    <RegEx find="(\()\u0022" replaceWith="(«" />
+    <!-- Numeración -->
+    <RegEx find="([0-9])\.([0-9])\b" replaceWith="$1,$2" />
+    <RegEx find="(^|\s|[¡¿«])([0-9])(,|\.)?([0-9]{3})\b" replaceWith="$1$2$4" />
+    <RegEx find="(\d)\s(?=\d{2}\b)" replaceWith="$1-" />
+    <!-- "1 :", "2 :"... "n :" a "n:" -->
+    <RegEx find="(\d) ([:;])" replaceWith="$1$2" />
+    <!-- Corregir las comas y puntos por ej. «, ,» por «,» & «,,,» o similar por «...» -->
+    <RegEx find="(\.\.\.+)$" replaceWith="..." />
+    <RegEx find="(, ,+)$" replaceWith="," />
+    <RegEx find="(,\s),+\s" replaceWith="$1" />
+    <RegEx find="(\.\.\.),$" replaceWith="$1" />
+    <RegEx find="([\wá-ú])(\.\.)$" replaceWith="$1." />
+    <!-- Puntos innecesarios (complemento) -->
+    <RegEx find="([\w\W]\.{3})([¡¿])" replaceWith="$1 $2" />
+    <RegEx find="(\w)\.\.(\s)" replaceWith="$1.$2" />
+    <RegEx find="([\wá-ú\x22»])\.([\?\!])" replaceWith="$1$2" />
+    <RegEx find="([\:\;])\." replaceWith="$1" />
+    <RegEx find="\.([\:\;])" replaceWith="$1" />
+    <RegEx find="\:+" replaceWith=":" />
+    <!-- Terminaciones ción/sión -->
+    <RegEx find="([sc]i)o(n)\b" replaceWith="$1ó$2" />
+    <RegEx find="([SC]I)O(N)\b" replaceWith="$1Ó$2" />
+    <!-- "i" en vez de "l" en terminaciones «clón» -->
+    <RegEx find="clón\b" replaceWith="ción" />
+    <!-- "si" en vez de "sl" -->
+    <RegEx find="\b([Ss])(l)\b" replaceWith="$1i" />
+    <!-- Para corregir por ej. raclones, perforaclones, opclones, etc -->
+    <RegEx find="([Rr]ac)l(o)" replaceWith="$1i$2" />
+    <RegEx find="([Oo]pc)l(o)" replaceWith="$1i$2" />
+    <!-- Para corregir por ej. tenldo, víctlmas, olvldarlo, legítlmo, etc -->
+    <RegEx find="([BbCcDdFfHhMmNnRrSsTtVv])l([bcdhmnrstv])" replaceWith="$1i$2" />
+    <!-- Corrige los errores en el ripeo de la «o» mayúscula por el cero «0» y viceversa -->
+    <RegEx find="(\d)O" replaceWith="$1 0" />
+    <RegEx find="(\d)[,\.]O" replaceWith="$1.0" />
+    <RegEx find="([A-Z])0" replaceWith="$1O" />
+    <RegEx find="\b0([A-Za-z])" replaceWith="O$1" />
+    <!-- Signos musicales -->
+    <RegEx find="[♪♫☺☹♥©☮☯Σ∞≡⇒π#](\r\n)[♪♫☺☹♥©☮☯Σ∞≡⇒π#]" replaceWith="$1" />
+    <!-- Tilde diacrítica antes del punto -->
+    <RegEx find="(\s)([dst])e\.(\s|\$)" replaceWith="$1$2é.$3" />
+    <RegEx find="(\s)mi\.(\s|\$)" replaceWith="$1mí.$2" />
+    <RegEx find="(\s)el\.(\s|\$)" replaceWith="$1él.$2" />
+    <RegEx find="(\s)tu\.(\s|\$)" replaceWith="$1tú.$2" />
+    <RegEx find="(\s)si\.(\s|\$)" replaceWith="$1sí.$2" />
+    <RegEx find="(\s)aun\.(\s|\$)" replaceWith="$1aún.$2" />
+    <RegEx find="(\s)mas\.(\s|\$)" replaceWith="$1más.$2" />
+    <RegEx find="(\s)quien\.(\s|\$)" replaceWith="$1quién.$2" />
+    <RegEx find="(\s)cual\.(\s|\$)" replaceWith="$1cuál.$2" />
+    <RegEx find="(\s)que\.(\s|\$)" replaceWith="$1qué.$2" />
+    <RegEx find="(\s)porque\.(\s|\$)" replaceWith="$1porqué.$2" />
+    <RegEx find="(\s)cuanto\.(\s|\$)" replaceWith="$1cuánto.$2" />
+    <RegEx find="(\s)cuando\.(\s|\$)" replaceWith="$1cuándo.$2" />
+    <!-- Prefijos; palabras compuestas (simple) -->
+    <RegEx find="(\b[Ee]x|\b[Ss]uper|\b[Aa]nti|\b[Pp]os|\b[Pp]re|\b[Pp]ro|\b[Vv]ice)[\s\x2D]([a-zá-ú]{3,20})(\b)" replaceWith="$1$2" />
+    <!-- Prefijos; palabras compuestas (números) -->
+    <RegEx find="(\b[Ss]ub|\b[Ss]uper)[\s\x2D](\d{2})(\b)" replaceWith="$1-$2$3" />
+    <!-- Prefijos; palabras compuestas (mayúsculas) -->
+    <RegEx find="(\b[Aa]nti|\b[Mm]ini|\b[Pp]os|\b[Pp]ro)\s([A-Z]{1,10})([A-Z][a-zá-ú]){0,10}(\b)" replaceWith="$1-$2$3" />
+    <!-- Casos de mayúsculas con dos puntos -->
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(a)" replaceWith="$1A" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(b)" replaceWith="$1B" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(c)" replaceWith="$1C" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(d)" replaceWith="$1D" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(e)" replaceWith="$1E" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(f)" replaceWith="$1F" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(g)" replaceWith="$1G" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(h)" replaceWith="$1H" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(i)" replaceWith="$1I" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(j)" replaceWith="$1J" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(k)" replaceWith="$1K" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(l)" replaceWith="$1L" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(m)" replaceWith="$1M" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(n)" replaceWith="$1N" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(ñ)" replaceWith="$1Ñ" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(o)" replaceWith="$1O" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(p)" replaceWith="$1P" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(q)" replaceWith="$1Q" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(r)" replaceWith="$1R" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(s)" replaceWith="$1S" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(t)" replaceWith="$1T" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(u)" replaceWith="$1U" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(v)" replaceWith="$1V" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(w)" replaceWith="$1W" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(x)" replaceWith="$1X" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(y)" replaceWith="$1Y" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(z)" replaceWith="$1Z" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(á)" replaceWith="$1Á" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(é)" replaceWith="$1É" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(í)" replaceWith="$1Í" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(ó)" replaceWith="$1Ó" />
+    <RegEx find="([\wá-ú]:\s[«\x22]?)(ú)" replaceWith="$1Ú" />
+    <!-- Usos correctos de la coma -->
+    <RegEx find="(\b[Pp]ero),(\s)([¡¿])" replaceWith="$1$2$3" />
+    <RegEx find="(\b[Aa]unque),(\s|$)" replaceWith="$1$2" />
+    <!-- Vocativos -->
+    <RegEx find="(\bHola|\bBueno|\bBien|\bVen|\bVen acá|\besto|\bBuenos días|\bFeliz cumpleaños|\bsiento)\s([A-Z][a-zá-ú]{3,12}\b|seño(r|ra|rita)\b|hij(o|a) mío\b|amig(o|a)\b)" replaceWith="$1, $2" />
+    <!-- «aún» cuando son sinónimos de «incluso» o «hasta» -->
+    <RegEx find="(\W|^)(\b[Aa])ú(n)(\s)(así\b|cuando\b|los\b|las\b|negar(te|se)\b)" replaceWith="$1$2u$3$4$5" />
+    <RegEx find="(\b[Nn]i)(\s)(a)ú(n)(\W|$)" replaceWith="$1$2$3u$4$5" />
+    <!-- «sí» -->
+    <RegEx find="\b([Ss])i(:|;|\.)" replaceWith="$1í$2" />
+    <!-- «sé» -->
+    <RegEx find="(\b[Ll]o|\b[Ll]a|\b[Ll]e)(\s)se(\W|$)" replaceWith="$1$2sé$3" />
+    <RegEx find="[Ss]e\s(dónde\b|cuándo\b|adónde\b|cómo\b|cuál\b|quién\b|cuánto\b|cuánta\b|cuántos\b|cuántas\b|cuán\b)" replaceWith="sé $1" />
+    <!-- «té» -->
+    <RegEx find="\b([Tt])e\s(verde\b|negro\b|perla\b|de manzanilla\b|de lim[óo]n\b|de jazm[íi]n\b)" replaceWith="$1é $2" />
+    <!-- Apóstrofo -->
+    <RegEx find="(\b[A-Z][a-zá-ú]{3,12})\s(’|')(\d\d(\s|$))" replaceWith="$1 $3" />
+    <RegEx find="(\b[A-Z]{2,5})(’|')(s)" replaceWith="(Ej. Devedés)$1$3" />
+    <RegEx find="(\b\d{1,2})(’|')(\d{2})\s(s|m)(\W|$)" replaceWith="$1,$3 $4$5" />
+    <RegEx find="(\b\d{1,2})(’|')(\d{2})\s(h)(\W|$)" replaceWith="$1:$3 $4$5" />
+    <!-- Porcentaje (debe llevar espacio) -->
+    <RegEx find="(\b\d{1,3})%(\W)" replaceWith="$1 %$2" />
+    <!-- Haz/has -->
+    <RegEx find="(\b)([Hh])as\s(la\b|lo\b|clic\b)(\W)" replaceWith="$1$2az $3$4" />
+    <RegEx find="(\b)([Hh])az\s(de\b)(\W)" replaceWith="$1$2as $3$4" />
+    <RegEx find="(\b)([Hh])as(le\b|nos\b|me\b)(\W)" replaceWith="$1$2az$3$4" />
+    <!-- Quitar itálicas en 3 o menos letras -->
+    <RegEx find="\x3ci\x3e(.{1,3})\x3c\/i\x3e" replaceWith="$1" />
+    <!-- Miscelánea -->
+    <RegEx find="(\b[Cc]erca|\b[Ee]ncima|\b[Dd]ebajo|\b[Dd]etrás|\b[Dd]elante)(\s)mío" replaceWith="$1 de mí" />
+    <RegEx find="(\b[Cc]erca|\b[Ee]ncima|\b[Dd]ebajo|\b[Dd]etrás|\b[Dd]elante)(\s)tuyo" replaceWith="$1 de ti" />
+    <!-- Punto antes de «¿» y «¡» -->
+    <RegEx find="([\wá-ú»])\s(?=(¿|¡)[A-ZÁ-Ú])" replaceWith="$1. " />
+    <!-- Espacios después del guión -->
+    <RegEx find="(^|\n)(-)([^\s])" replaceWith="$1$2 $3" />
+    <!-- Punto antes del guión -->
+    <RegEx find="([^\.\?\!]) - " replaceWith="$1. - " />
+    <!-- Terminaciones en «ólogo», «ílogo» y «álogo» -->
+    <RegEx find="\Bo(log[ao]s?\b)" replaceWith="ó$1" />
+    <RegEx find="\Ba(log[ao]s?\b)" replaceWith="á$1" />
+    <RegEx find="\Bi(log[ao]s?\b)" replaceWith="í$1" />
+
+    <RegEx find="\bIes\b" replaceWith="les" />
+    <RegEx find="\bIos\b" replaceWith="los" />
+  </RegularExpressions>
+</OCRFixReplaceList>
\ No newline at end of file
diff --git a/libs/subzero/modification/dictionaries/xml/srp_OCRFixReplaceList.xml b/libs/subzero/modification/dictionaries/xml/srp_OCRFixReplaceList.xml
new file mode 100644
index 000000000..7b682c6fd
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/xml/srp_OCRFixReplaceList.xml
@@ -0,0 +1,268 @@
+<!-- Credit goes to: MilanRS [http://www.prijevodi-online.org] -->
+<OCRFixReplaceList>
+  <WholeWords>
+    <Word from="ču" to="ću" />
+    <Word from="češ" to="ćeš" />
+    <Word from="če" to="će" />
+    <Word from="ćš" to="ćeš" />
+    <Word from="ćmo" to="ćemo" />
+    <Word from="ćte" to="ćete" />
+    <Word from="čemo" to="ćemo" />
+    <Word from="čete" to="ćete" />
+    <Word from="djete" to="dijete" />
+    <Word from="Hey" to="Hej" />
+    <Word from="hey" to="hej" />
+    <Word from="htjeo" to="htio" />
+    <Word from="iči" to="ići" />
+    <Word from="jel" to="je l'" />
+    <Word from="Jel" to="Je l'" />
+    <Word from="Nebi" to="Ne bi" />
+    <Word from="Nebih" to="Ne bih" />
+    <Word from="nebi" to="ne bi" />
+    <Word from="nebih" to="ne bih" />
+    <Word from="nedaj" to="ne daj" />
+    <Word from="Nedaj" to="Ne daj" />
+    <Word from="nedam" to="ne dam" />
+    <Word from="Nedam" to="Ne dam" />
+    <Word from="nedaš" to="ne daš" />
+    <Word from="Nedaš" to="Ne daš" />
+    <Word from="nemogu" to="ne mogu" />
+    <Word from="Nemogu" to="Ne mogu" />
+    <Word from="nemora" to="ne mora" />
+    <Word from="Nemora" to="Ne mora" />
+    <Word from="nemoraš" to="ne moraš" />
+    <Word from="Nemoraš" to="Ne moraš" />
+    <Word from="predamnom" to="preda mnom" />
+    <Word from="Predamnom" to="Preda mnom" />
+    <Word from="Rješit" to="Riješit" />
+    <Word from="samnom" to="sa mnom" />
+    <Word from="Samnom" to="Sa mnom" />
+    <Word from="smjeo" to="smio" />
+    <Word from="uopče" to="uopće" />
+    <Word from="Uopče" to="Uopće" />
+    <Word from="umijesto" to="umjesto" />
+    <Word from="Umijesto" to="Umjesto" />
+    <Word from="uspiješan" to="uspješan" />
+    <Word from="uvjek" to="uvijek" />
+    <Word from="Uvjek" to="Uvijek" />
+    <Word from="valda" to="valjda" />
+    <Word from="zamnom" to="za mnom" />
+    <Word from="Zamnom" to="Za mnom" />
+    <Word from="želila" to="željela" />
+  </WholeWords>
+  <PartialWordsAlways />
+  <PartialWords>
+    <WordPart from="¤" to="o" />
+    <WordPart from="vv" to="w" />
+    <WordPart from="IVI" to="M" />
+    <WordPart from="lVI" to="M" />
+    <WordPart from="IVl" to="M" />
+    <WordPart from="lVl" to="M" />
+  </PartialWords>
+  <PartialLines>
+    <LinePart from="bi smo" to="bismo" />
+    <LinePart from="dali je" to="da li je" />
+    <LinePart from="dali si" to="da li si" />
+    <LinePart from="Dali si" to="Da li si" />
+    <LinePart from="Jel sam ti" to="Jesam li ti" />
+    <LinePart from="Jel si" to="Jesi li" />
+    <LinePart from="Jel' si" to="Jesi li" />
+    <LinePart from="Je I'" to="Jesi li" />
+    <LinePart from="Jel si to" to="Jesi li to" />
+    <LinePart from="Jel' si to" to="Da li si to" />
+    <LinePart from="jel si to" to="da li si to" />
+    <LinePart from="jel' si to" to="jesi li to" />
+    <LinePart from="Jel si ti" to="Da li si ti" />
+    <LinePart from="Jel' si ti" to="Da li si ti" />
+    <LinePart from="jel si ti" to="da li si ti" />
+    <LinePart from="jel' si ti" to="da li si ti" />
+    <LinePart from="jel ste " to="jeste li " />
+    <LinePart from="Jel ste" to="Jeste li" />
+    <LinePart from="jel' ste " to="jeste li " />
+    <LinePart from="Jel' ste " to="Jeste li " />
+    <LinePart from="Jel su " to="Jesu li " />
+    <LinePart from="Jel da " to="Zar ne" />
+    <LinePart from="jel da " to="zar ne" />
+    <LinePart from="jel'da " to="zar ne" />
+    <LinePart from="Jeli sve " to="Je li sve" />
+    <LinePart from="Jeli on " to="Je li on" />
+    <LinePart from="Jeli ti " to="Je li ti" />
+    <LinePart from="jeli ti " to="je li ti" />
+    <LinePart from="Jeli to " to="Je li to" />
+    <LinePart from="Nebrini" to="Ne brini" />
+    <LinePart from="ne ću" to="neću" />
+    <LinePart from="od kako" to="otkako" />
+    <LinePart from="Si dobro" to="Jesi li dobro" />
+    <LinePart from="Svo vreme" to="Sve vrijeme" />
+    <LinePart from="Svo vrijeme" to="Sve vrijeme" />
+    <LinePart from="Cijelo vrijeme" to="Sve vrijeme" />
+  </PartialLines>
+  <PartialLinesAlways />
+  <BeginLines />
+  <EndLines />
+  <WholeLines />
+  <RegularExpressions>
+    <RegEx find="ÄŤ" replaceWith="č" />
+    <RegEx find="Ä" replaceWith="č" />
+    <RegEx find="ć" replaceWith="ć" />
+    <RegEx find="Ä‘" replaceWith="đ" />
+    <RegEx find="Ĺľ" replaceWith="ž" />
+    <RegEx find="ž" replaceWith="ž" />
+    <RegEx find="š" replaceWith="š" />
+    <RegEx find="Å¡" replaceWith="š" />
+    <RegEx find="ÄŚ" replaceWith="Č" />
+    <RegEx find="ÄŒ" replaceWith="Č" /> 
+    <RegEx find="Ć" replaceWith="Ć" />
+    <RegEx find="Ĺ " replaceWith="Š" />
+    <RegEx find="Å " replaceWith="Š" />
+    <RegEx find="Ĺ˝" replaceWith="Ž" />
+    <RegEx find="Ž" replaceWith="Ž" />
+    <RegEx find="đž" replaceWith="dž" />
+    <RegEx find="ajsmiješnij" replaceWith="ajsmješnij" />
+    <RegEx find="boži[čć]([aeiu]|em|ima)?\b" replaceWith="Božić$1" />
+    <RegEx find=" g-dine\.$" replaceWith=" gospodine." />
+    <RegEx find=" g-dine +(?=[A-ZČĐŠŽ])" replaceWith=" g. " />
+    <RegEx find="([gG])dine? +(?=[A-ZČĐŠŽ])" replaceWith="$1. " />
+    <RegEx find="([gG])-đo +(?=[A-ZČĐŠŽ])" replaceWith="$1gđo " />
+    <RegEx find="gdina +(?=[A-ZČĐŠŽ])" replaceWith="g. " />
+    <RegEx find=" gosp +" replaceWith=" g. " />
+    <RegEx find="([hH])oč" replaceWith="$1oć" />
+    <RegEx find="Jel si sigur" replaceWith="Jesi li sigur" />
+    <RegEx find="Jel' si sigur" replaceWith="Jesi li sigur" />
+    <RegEx find="\b([jJ])el\?" replaceWith="$1e l'?" />
+    <RegEx find="\bJel'" replaceWith="Je l'" />
+    <RegEx find="([kK]alib(?:ar|r[aeui]))\. *([0-9])" replaceWith="$1 .$2" />
+    <RegEx find="([mM])jenja(?!č)" replaceWith="$1ijenja" />
+    <RegEx find="oguč" replaceWith="oguć" />
+    <RegEx find="\b([nN])eč([ue]š?|emo|ete)\b" replaceWith="$1eć$2" />
+    <RegEx find="emo[zž]e" replaceWith="e može" />
+    <RegEx find="\b([nN])ezna([šm]o?|t[ei]|ju|jući|vši)?\b" replaceWith="$1e zna$2" />
+    <RegEx find="najcijenjen" replaceWith="najcjenjen" />
+    <RegEx find="N[jJ]u Jork" replaceWith="Njujork" />
+    <RegEx find="([oO])d([kp])" replaceWith="$1t$2" />
+    <RegEx find="ružij" replaceWith="ružj" />
+    <RegEx find="([oO])sječa" replaceWith="$1sjeća" />
+    <RegEx find="([pPdD])onje([lt])" replaceWith="$1onije$2" />
+    <RegEx find="([pP])objedi([mšto])" replaceWith="$1obijedi$2" />
+    <RegEx find="ed([ph])" replaceWith="et$1" />
+    <RegEx find="rimjeti" replaceWith="rimijeti" />
+    <RegEx find="romjeni([mštol])" replaceWith="romijeni$1" />
+    <RegEx find="azumijeć" replaceWith="azumjeć" />
+    <RegEx find="([Cc])jepljen" replaceWith="$1ijepljen" />
+    <RegEx find="rimjenjen" replaceWith="rimijenjen" />
+    <RegEx find="([^d])rješit" replaceWith="$1riješit" />
+    <RegEx find="lijede[čć]([aeiu]|e[mg])" replaceWith="ljedeć$1" />
+    <RegEx find="([sS])mješno" replaceWith="$1miješno" />
+    <RegEx find="spijeh" replaceWith="spjeh" />
+    <RegEx find="spiješn" replaceWith="spješn" />
+    <RegEx find="\b([vV])eč([aiu]|[ei][mg]|ih|ima|in[iu]|uom|o[mj])?\b" replaceWith="$1eć$2" />
+    <RegEx find="([zZ])ahtjeva([ojlmšt])" replaceWith="$1ahtijeva$2" />
+    <RegEx find="([ks]ao)\.:" replaceWith="$1:" />
+    <RegEx find="(?&lt;=[a-zčđšž])Ij(?=[a-zčđšž])" replaceWith="lj" />
+    <RegEx find="(?&lt;=[^A-ZČĐŠŽa-zčđšž])Iju(?=bav|d|t)" replaceWith="lju" />
+    <!-- 10kg » 10 kg   |  20cm » 20 cm   |  44dag » 44 dag -->
+    <RegEx find="\b(\d+)([a-z]{2,4})\b" replaceWith="$1 $2" />
+    <!-- 10m » 10 m -->
+    <RegEx find="([\d]){1}?m" replaceWith="$1 m" />
+    <!-- kad ima razmak između tagova </i> <i> -->
+    <!-- <RegEx find="(&gt;) +(&lt;)" replaceWith="$1$2" /> -->
+    <!-- ',"' to '",' -->
+    <RegEx find="(?&lt;=\w),&quot;(?=\s|$)" replaceWith="&quot;," />
+    <RegEx find=",\.{3}|\.{3},|\.{2} \." replaceWith="..." />
+    <!-- "1 :", "2 :"... "n :" to "n:" -->
+    <RegEx find="([0-9]) +: +(\D)" replaceWith="$1: $2" />
+    <!-- Two or more consecutive "," to "..." -->
+    <RegEx find=",{2,}" replaceWith="..." />
+    <!-- Two or more consecutive "-" to "..." -->
+    <RegEx find="-{2,}" replaceWith="..." />
+    <RegEx find="([^().])\.{2}([^().:])" replaceWith="$1...$2" />
+    <!-- separator stotica i decimalnog ostatka 1,499,000.00 -> 1.499.000,00 -->
+    <RegEx find="([0-9]{3})\.([0-9]{2}[^0-9])" replaceWith="$1,$2" />
+    <RegEx find="([0-9]),([0-9]{3}\D)" replaceWith="$1.$2" />
+    <!-- Apostrophes -->
+    <RegEx find="´´" replaceWith="&quot;" />
+    <!-- <RegEx find="[´`]" replaceWith="'" /> -->
+    <!-- <RegEx find="[“”]" replaceWith="&quot;" /> -->
+    <RegEx find="''" replaceWith="&quot;" />
+    <!-- Two or more consecutive '"' to one '"' -->
+    <RegEx find="&quot;{2,}" replaceWith="&quot;" />
+    <!-- Fix zero and capital 'o' ripping mistakes -->
+    <RegEx find="(?&lt;=[0-9]\.?)O" replaceWith="0" />
+    <RegEx find="\b0(?=[A-ZČĐŠŽa-zčđšž])" replaceWith="O" />
+    <!-- Brisanje crte - na početku 1. reda (i kada ima dva reda) -->
+    <RegEx find="\A- ?([A-ZČĐŠŽa-zčđšž0-9„'&quot;]|\.{3})" replaceWith="$1" />
+    <RegEx find="\A(&lt;[ibu]&gt;)- ?" replaceWith="$1" />
+    <RegEx find="  - " replaceWith=" -" />
+    <!-- Brisanje razmaka iza crte - na početku 2. reda -->
+    <RegEx find="(?&lt;=\n(&lt;[ibu]&gt;)?)- (?=[A-ZČĐŠŽčš0-9„'&quot;&lt;])" replaceWith="-" />
+    <!-- Korigovanje crte - kad je u sredini prvog reda -->
+    <RegEx find="([.!?&quot;&gt;]) - ([A-ZČĐŠŽčš'&quot;&lt;])" replaceWith="$1 -$2" />
+    <!-- Zatvoren tag pa razmak poslije crtice -->
+    <RegEx find="(&gt;) - ([A-ZČĐŠŽčš„'&quot;])" replaceWith="$1 -$2" />
+    <!-- Zatvoren tag pa crtica razmak -->
+    <RegEx find="(&gt;)- ([A-ZČĐŠŽčš„'&quot;])" replaceWith="$1-$2" />
+    <!-- Zagrada pa crtica razmak -->
+    <RegEx find="\(- ([A-ZČĐŠŽčš„'&quot;])" replaceWith="(-$1" />
+    <!-- Smart space after dot -->
+    <!-- osim kad je zadnje t (riječ kolt) -->
+    <RegEx find="(?&lt;=[a-su-zá-úñä-ü])\.(?=[^\s\n().:?!*^“”'&quot;&lt;])" replaceWith=". " />
+    <!-- Oznaka za kalibar. Npr. "Colt .45" -->
+    <!-- Da bi radilo, da bi ovaj razmak bio dozvoljen, odčekirajte "Razmaci ispred tačke" -->
+    <RegEx find="t\.(?=[0-9]{2})" replaceWith="t ." />
+    <!-- Joey(j)a -->
+    <RegEx find="(?&lt;=\b[A-Z][a-z])eyj(?=[a-z])" replaceWith="ey" />
+    <!-- Sređuje zarez sa razmakom -->
+    <RegEx find="(?&lt;=[A-ZČĐŠŽa-zčđšžá-úñä-ü&quot;]),(?=[^\s(),?!“&lt;])" replaceWith=", " />
+    <RegEx find=" +,(?=[A-ZČĐŠŽa-zčđšž])" replaceWith=", " />
+    <RegEx find=" +, +" replaceWith=", " />
+    <RegEx find=" +,$" replaceWith="," />
+    <RegEx find="([?!])-" replaceWith="$1 -" />
+    <!-- Space after last of some consecutive dots (eg. "...") -->
+    <RegEx find="(?&lt;=[a-zčđšž])(\.{3}|!)(?=[a-zčđšž])" replaceWith="$1 " />
+    <!-- Delete space after "..." that is at the beginning of the line. You may delete this line if you don't like it -->
+    <!-- <RegEx find="^\.{3} +" replaceWith="..." /> -->
+    <!-- "tekst ... tekst" mijenja u "tekst... tekst" -->
+    <RegEx find="(?&lt;=[A-ZČĐŠŽa-zčđšž]) +\.{3} +" replaceWith="... " />
+    <RegEx find="(?&lt;=\S)\. +&quot;" replaceWith=".&quot;" />
+    <RegEx find="&quot; +\." replaceWith="&quot;." />
+    <RegEx find="(?&lt;=\S\.{3}) +&quot;(?=\s|$)" replaceWith="&quot;" />
+    <RegEx find=" +\.{3}$" replaceWith="..." />
+    <RegEx find="(?&lt;=[a-zčđšž])(?: +\.{3}|\.{2}$)" replaceWith="..." />
+    <!-- Razmak ispred zagrade -->
+    <RegEx find="(?&lt;=[A-ZČĐŠŽa-zčđšž])\(" replaceWith=" (" />
+    <!-- Razmak iza upitnika -->
+    <RegEx find="\?(?=[A-ZČĐŠŽčš])" replaceWith="? " />
+    <RegEx find="(?&lt;=^|&gt;)\.{3} +(?=[A-ZČĐŠŽčš])" replaceWith="..." />
+    <!-- Brise ... kad je na poč. reda "... -->
+    <RegEx find="^&quot;\.{3} +" replaceWith="&quot;" />
+    <RegEx find="(?&lt;=[0-9])\$" replaceWith=" $$" />
+    <!-- ti š -> t š by Strider -->
+    <!-- Zamijeni sva "**ti šu*" s "**t šu*" i "**ti še*" s "**t še*" -->
+    <!-- <RegEx find="([a-z])ti (š+[eu])" replaceWith="$1t $2" /> -->
+    <!-- <RegEx find="([A-Za-z])ti( |\r?\n)(š[eu])" replaceWith="$1t$2$3" /> -->
+    <!-- <RegEx find="(?i)\b(ni)t (š[eu])" replaceWith="$1ti $2" /> -->
+    <!-- <RegEx find="\. +Mr. " replaceWith=". G. " /> -->
+    <!-- <RegEx find="\. +Mrs. " replaceWith=". Gđa " /> -->
+    <!-- <RegEx find="\. +Miss " replaceWith=". Gđica " /> -->
+    <!-- <RegEx find=", +Mrs. " replaceWith=", gđo " /> -->
+    <!-- <RegEx find=", +Miss " replaceWith=", gđice " /> -->
+    <!-- Razmak poslije <i> i poslije .. -->
+    <RegEx find="^(&lt;[ibu]&gt;) +" replaceWith="$1" />
+    <RegEx find="^\.{2} +" replaceWith="..." />
+    <!-- Razmak ? "</i> -->
+    <RegEx find="([.?!]) +(&quot;&lt;)" replaceWith="$1$2" />
+    <!-- Bez razmaka kod Npr.: -->
+    <RegEx find="(?&lt;=[Nn]pr\.) *: *" replaceWith=": " />
+    <RegEx find="\. ," replaceWith=".," />
+    <RegEx find="([?!])\." replaceWith="$1" />
+    <!-- Da ne kvari potpise sa ..:: -->
+    <RegEx find="\.{3}::" replaceWith="..::" />
+    <RegEx find="::\.{3}" replaceWith="::.." />
+    <RegEx find="\.{2} +::" replaceWith="..::" />
+    <!-- Skracenice bez razmaka -->
+    <RegEx find="d\. o\.o\." replaceWith="d.o.o." />
+    <!-- Kad red počinje sa ...pa malo slovo -->
+    <!-- <RegEx find="^\.{3}([a-zčđšž&quot;&lt;])" replaceWith="$1" /> -->
+    <!-- <RegEx find=" +([.?!])" replaceWith="$1" /> -->
+  </RegularExpressions>
+</OCRFixReplaceList>
diff --git a/libs/subzero/modification/dictionaries/xml/swe_OCRFixReplaceList.xml b/libs/subzero/modification/dictionaries/xml/swe_OCRFixReplaceList.xml
new file mode 100644
index 000000000..9eadfca8a
--- /dev/null
+++ b/libs/subzero/modification/dictionaries/xml/swe_OCRFixReplaceList.xml
@@ -0,0 +1,452 @@
+<?xml version="1.0" encoding="utf-8"?>
+<OCRFixReplaceList>
+  <WholeWords>
+    <Word from="lârt" to="lärt" />
+    <Word from="hedervårda" to="hedervärda" />
+    <Word from="stormâstare" to="stormästare" />
+    <Word from="Avfârd" to="Avfärd" />
+    <Word from="tâlten" to="tälten" />
+    <Word from="ârjag" to="är jag" />
+    <Word from="ärjag" to="är jag" />
+    <Word from="jâmlikar" to="jämlikar" />
+    <Word from="Riskakofl" to="Riskakor" />
+    <Word from="Karamellen/" to="Karamellen" />
+    <Word from="Lngenüng" to="Ingenting" />
+    <Word from="ärju" to="är ju" />
+    <Word from="Sá" to="Så" />
+    <Word from="närjag" to="när jag" />
+    <Word from="alltjag" to="allt jag" />
+    <Word from="görjag" to="gör jag" />
+    <Word from="trorjag" to="tror jag" />
+    <Word from="varju" to="var ju" />
+    <Word from="görju" to="gör ju" />
+    <Word from="kanju" to="kan ju" />
+    <Word from="blirjag" to="blir jag" />
+    <Word from="sägerjag" to="säger jag" />
+    <Word from="behållerjag" to="behåller jag" />
+    <Word from="prøblem" to="problem" />
+    <Word from="räddadeju" to="räddade ju" />
+    <Word from="honøm" to="honom" />
+    <Word from="Ln" to="In" />
+    <Word from="svårflörtad" to="svårflörtad" />
+    <Word from="øch" to="och" />
+    <Word from="flörtar" to="flörtar" />
+    <Word from="kännerjag" to="känner jag" />
+    <Word from="flickan" to="flickan" />
+    <Word from="snø" to="snö" />
+    <Word from="gerju" to="ger ju" />
+    <Word from="køntakter" to="kontakter" />
+    <Word from="ølycka" to="olycka" />
+    <Word from="nølla" to="nolla" />
+    <Word from="sinnenajublar" to="sinnena jublar" />
+    <Word from="ijobbet" to="i jobbet" />
+    <Word from="Fårjag" to="Får jag" />
+    <Word from="Ar" to="Är" />
+    <Word from="liggerju" to="ligger ju" />
+    <Word from="um" to="om" />
+    <Word from="lbland" to="Ibland" />
+    <Word from="skjuterjag" to="skjuter jag" />
+    <Word from="Vaddå" to="Vad då" />
+    <Word from="pratarjämt" to="pratar jämt" />
+    <Word from="harju" to="har ju" />
+    <Word from="sitterjag" to="sitter jag" />
+    <Word from="häfla" to="härja" />
+    <Word from="sfiäl" to="stjäl" />
+    <Word from="FÖU" to="Följ" />
+    <Word from="varförjag" to="varför jag" />
+    <Word from="sfiärna" to="stjärna" />
+    <Word from="böflar" to="börjar" />
+    <Word from="böflan" to="början" />
+    <Word from="stäri" to="står" />
+    <Word from="pä" to="på" />
+    <Word from="harjag" to="har jag" />
+    <Word from="attjag" to="att jag" />
+    <Word from="Verkarjag" to="Verkar jag" />
+    <Word from="Kännerjag" to="Känner jag" />
+    <Word from="därjag" to="där jag" />
+    <Word from="tufi" to="tuff" />
+    <Word from="lurarjag" to="lurar jag" />
+    <Word from="varjättebra" to="var jättebra" />
+    <Word from="allvan" to="allvar" />
+    <Word from="dethär" to="det här" />
+    <Word from="vafle" to="varje" />
+    <Word from="FöUer" to="Följer" />
+    <Word from="personalmötetl" to="personalmötet!" />
+    <Word from="harjust" to="har just" />
+    <Word from="ärjätteduktig" to="är jätteduktig" />
+    <Word from="därja" to="där ja" />
+    <Word from="lngenüng" to="lngenting" />
+    <Word from="iluften" to="i luften" />
+    <Word from="ösen" to="öser" />
+    <Word from="tvâ" to="två" />
+    <Word from="Uejerna" to="Tjejerna" />
+    <Word from="hån*" to="hårt" />
+    <Word from="Ärjag" to="Är jag" />
+    <Word from="keL" to="Okej" />
+    <Word from="Förjag" to="För jag" />
+    <Word from="varjättekul" to="var jättekul" />
+    <Word from="kämpan" to="kämpar" />
+    <Word from="mycketjobb" to="mycket jobb" />
+    <Word from="Uus" to="ljus" />
+    <Word from="serjag" to="ser jag" />
+    <Word from="vetjag" to="vet jag" />
+    <Word from="fårjag" to="får jag" />
+    <Word from="hurjag" to="hur jag" />
+    <Word from="försökerjag" to="försöker jag" />
+    <Word from="tánagel" to="tånagel" />
+    <Word from="vaüe" to="varje" />
+    <Word from="Uudet" to="ljudet" />
+    <Word from="amhopa" to="allihopa" />
+    <Word from="Väü" to="Välj" />
+    <Word from="gäri" to="går" />
+    <Word from="rödüus" to="rödljus" />
+    <Word from="Uuset" to="ljuset" />
+    <Word from="Ridàn" to="Ridån" />
+    <Word from="viüa" to="vilja" />
+    <Word from="gåri" to="går i" />
+    <Word from="Hurdå" to="Hur då" />
+    <Word from="inter\/juar" to="intervjuar" />
+    <Word from="menarjag" to="menar jag" />
+    <Word from="spyrjag" to="spyr jag" />
+    <Word from="briüera" to="briljera" />
+    <Word from="Närjag" to="När jag" />
+    <Word from="ner\/ös" to="nervös" />
+    <Word from="ilivets" to="i livets" />
+    <Word from="nägot" to="något" />
+    <Word from="pà" to="på" />
+    <Word from="Lnnan" to="Innan" />
+    <Word from="Uf" to="Ut" />
+    <Word from="lnnan" to="Innan" />
+    <Word from="Dàren" to="Dåren" />
+    <Word from="Fàrjag" to="Får jag" />
+    <Word from="VadärdetdäL" to="Vad är det där" />
+    <Word from="smàtjuv" to="småtjuv" />
+    <Word from="tàgrånare" to="tågrånare" />
+    <Word from="ditàt" to="ditåt" />
+    <Word from="sä" to="så" />
+    <Word from="vàrdslösa" to="vårdslösa" />
+    <Word from="nàn" to="nån" />
+    <Word from="kommerjag" to="kommer jag" />
+    <Word from="ärjättebra" to="är jättebra" />
+    <Word from="ärjävligt" to="är jävligt" />
+    <Word from="àkerjag" to="åker jag" />
+    <Word from="ellerjapaner" to="eller japaner" />
+    <Word from="attjaga" to="att jaga" />
+    <Word from="eften" to="efter" />
+    <Word from="hästan" to="hästar" />
+    <Word from="Lntensivare" to="Intensivare" />
+    <Word from="fràgarjag" to="frågar jag" />
+    <Word from="pen/ers" to="pervers" />
+    <Word from="ràbarkade" to="råbarkade" />
+    <Word from="styrkon" to="styrkor" />
+    <Word from="Difåf" to="Ditåt" />
+    <Word from="händen" to="händer" />
+    <Word from="föfia" to="följa" />
+    <Word from="Idioten/" to="Idioter!" />
+    <Word from="Varförjagade" to="Varför jagade" />
+    <Word from="därförjag" to="därför jag" />
+    <Word from="forjag" to="for jag" />
+    <Word from="Iivsgladje" to="livsglädje" />
+    <Word from="narjag" to="när jag" />
+    <Word from="sajag" to="sa jag" />
+    <Word from="genastja" to="genast ja" />
+    <Word from="rockumentàren" to="rockumentären" />
+    <Word from="turne" to="turné" />
+    <Word from="fickjag" to="fick jag" />
+    <Word from="sager" to="säger" />
+    <Word from="Ijushårig" to="ljushårig" />
+    <Word from="tradgårdsolycka" to="trädgårdsolycka" />
+    <Word from="kvavdes" to="kvävdes" />
+    <Word from="dàrja" to="där ja" />
+    <Word from="hedersgaster" to="hedersgäster" />
+    <Word from="Nar" to="När" />
+    <Word from="smakiösa" to="smaklösa" />
+    <Word from="lan" to="Ian" />
+    <Word from="Lan" to="Ian" />
+    <Word from="eri" to="er i" />
+    <Word from="universitetsamne" to="universitetsämne" />
+    <Word from="garna" to="gärna" />
+    <Word from="ar" to="är" />
+    <Word from="baltdjur" to="bältdjur" />
+    <Word from="varjag" to="var jag" />
+    <Word from="àr" to="är" />
+    <Word from="förförstàrkare" to="förförstärkare" />
+    <Word from="arjattespeciell" to="är jättespeciell" />
+    <Word from="hàrgår" to="här går" />
+    <Word from="Ia" to="la" />
+    <Word from="Iimousinen" to="limousinen" />
+    <Word from="krickettra" to="kricketträ" />
+    <Word from="hårdrockvàrlden" to="hårdrockvärlden" />
+    <Word from="tràbit" to="träbit" />
+    <Word from="Mellanvastern" to="Mellanvästern" />
+    <Word from="arju" to="är ju" />
+    <Word from="turnen" to="turnén" />
+    <Word from="kanns" to="känns" />
+    <Word from="battre" to="bättre" />
+    <Word from="vàrldsturne" to="världsturne" />
+    <Word from="dar" to="där" />
+    <Word from="sjàlvantànder" to="självantänder" />
+    <Word from="jattelange" to="jättelänge" />
+    <Word from="berattade" to="berättade" />
+    <Word from="Sä" to="Så" />
+    <Word from="vandpunkten" to="vändpunkten" />
+    <Word from="Nàrjag" to="När jag" />
+    <Word from="lasa" to="läsa" />
+    <Word from="skitlàskigt" to="skitläskigt" />
+    <Word from="sambandsvàg" to="sambandsväg" />
+    <Word from="valdigt" to="väldigt" />
+    <Word from="Stamgafiel" to="Stämgaffel" />
+    <Word from="àrjag" to="är jag" />
+    <Word from="tajming" to="tajmning" />
+    <Word from="utgäng" to="utgång" />
+    <Word from="Hàråt" to="Häråt" />
+    <Word from="hàråt" to="häråt" />
+    <Word from="anvander" to="använder" />
+    <Word from="harjobbat" to="har jobbat" />
+    <Word from="imageide" to="imageidé" />
+    <Word from="klafien" to="klaffen" />
+    <Word from="sjalv" to="själv" />
+    <Word from="dvarg" to="dvärg" />
+    <Word from="detjag" to="det jag" />
+    <Word from="dvargarna" to="dvärgarna" />
+    <Word from="fantasivàrld" to="fantasivärld" />
+    <Word from="fiolliga" to="Fjolliga" />
+    <Word from="mandoiinstràngar" to="mandollnsträngar" />
+    <Word from="mittjobb" to="mitt jobb" />
+    <Word from="Skajag" to="Ska jag" />
+    <Word from="landari" to="landar i" />
+    <Word from="gang" to="gäng" />
+    <Word from="Detjag" to="Det jag" />
+    <Word from="Narmre" to="Närmre" />
+    <Word from="Iåtjavelni" to="låtjäveln" />
+    <Word from="Hållerjag" to="Håller jag" />
+    <Word from="visionarer" to="visionärer" />
+    <Word from="Tülvad" to="Till vad" />
+    <Word from="militàrbas" to="militärbas" />
+    <Word from="jattegiada" to="jätteglada" />
+    <Word from="Fastjag" to="Fast jag" />
+    <Word from="såjag" to="så jag" />
+    <Word from="rockvarlden" to="rockvärlden" />
+    <Word from="saknarjag" to="saknar jag" />
+    <Word from="allafall" to="alla fall" />
+    <Word from="fianta" to="fjanta" />
+    <Word from="Kràma" to="Kräma" />
+    <Word from="stammer" to="stämmer" />
+    <Word from="budbàrare" to="budbärare" />
+    <Word from="Iivsfiiosofi" to="livsfiiosofi" />
+    <Word from="förjämnan" to="för jämnan" />
+    <Word from="gillarjag" to="gillar jag" />
+    <Word from="Iarvat" to="larvat" />
+    <Word from="klararjag" to="klarar jag" />
+    <Word from="hattafi'àr" to="hattaffär" />
+    <Word from="Dà" to="Då" />
+    <Word from="uppfinna" to="uppfinna" />
+    <Word from="Ràttfåglar" to="Råttfåglar" />
+    <Word from="Sväüboda" to="Sväljboda" />
+    <Word from="Påböflar" to="Påbörjar" />
+    <Word from="slutarju" to="slutar ju" />
+    <Word from="nifiskebuüken" to="i fiskebutiken" />
+    <Word from="härjäkeln" to="här jäkeln" />
+    <Word from="Hßppa" to="Hoppa" />
+    <Word from="förstörds" to="förstördes" />
+    <Word from="varjättegoda" to="var jättegoda" />
+    <Word from="Kor\/" to="Korv" />
+    <Word from="brüléel" to="brülée!" />
+    <Word from="Hei" to="Hej" />
+    <Word from="älskarjordgubbsglass" to="älskar jordgubbsglass" />
+    <Word from="Snöbom" to="Snöboll" />
+    <Word from="SnöboH" to="Snöboll" />
+    <Word from="Snöbol" to="Snöboll" />
+    <Word from="snöboH" to="snöboll" />
+    <Word from="Läggerpå" to="Lägger på" />
+    <Word from="lngefl" to="lnget!" />
+    <Word from="Sägerjättesmarta" to="Säger jättesmarta" />
+    <Word from="dopplen/äderradar" to="dopplerväderradar" />
+    <Word from="säkertjättefin" to="säkert jättefin" />
+    <Word from="ärjättefin" to="är jättefin" />
+    <Word from="verkarju" to="verkar ju" />
+    <Word from="blirju" to="blir ju" />
+    <Word from="kor\/" to="korv" />
+    <Word from="naturkatastrofi" to="naturkatastrof!" />
+    <Word from="stickerjag" to="stickerj ag" />
+    <Word from="jättebufié" to="jättebuffé" />
+    <Word from="befinner" to="befinner" />
+    <Word from="Spflng" to="Spring" />
+    <Word from="trecfie" to="tredje" />
+    <Word from="ryckerjag" to="rycker jag" />
+    <Word from="skullejag" to="skulle jag" />
+    <Word from="vetju" to="vet ju" />
+    <Word from="afljag" to="att jag" />
+    <Word from="flnns" to="finns" />
+    <Word from="ärlång" to="är lång" />
+    <Word from="kåra" to="kära" />
+    <Word from="ärfina" to="är fina" />
+    <Word from="äri" to="är i" />
+    <Word from="hörden" to="hör den" />
+    <Word from="ättjäg" to="att jäg" />
+    <Word from="gär" to="går" />
+    <Word from="föri" to="för i" />
+    <Word from="Hurvisste" to="Hur visste" />
+    <Word from="fick" to="fick" />
+    <Word from="finns" to="finns" />
+    <Word from="fin" to="fin" />
+    <Word from="Fa" to="Bra." />
+    <Word from="bori" to="bor i" />
+    <Word from="fiendeplanl" to="fiendeplan!" />
+    <Word from="iförnamn" to="i förnamn" />
+    <Word from="detju" to="det ju" />
+    <Word from="Nüd" to="Niki" />
+    <Word from="hatarjag" to="hatar jag" />
+    <Word from="Klararjag" to="Klarar jag" />
+    <Word from="detafier" to="detaljer" />
+    <Word from="vä/" to="väl" />
+    <Word from="smakarju" to="smakar ju" />
+    <Word from="Teachefl" to="Teacher!" />
+    <Word from="imorse" to="i morse" />
+    <Word from="drickerjag" to="dricker jag" />
+    <Word from="ståri" to="står i" />
+    <Word from="Harjag" to="Har jag" />
+    <Word from="Talarjag" to="Talar jag" />
+    <Word from="undrarjag" to="undrar jag" />
+    <Word from="ålderjag" to="ålder jag" />
+    <Word from="vafie" to="varje" />
+    <Word from="förfalskningl" to="förfalskning!" />
+    <Word from="Vifiiiiam" to="William" />
+    <Word from="V\filliams" to="Williams" />
+    <Word from="attjobba" to="att jobba" />
+    <Word from="intei" to="inte i" />
+    <Word from="närV\filliam" to="när William" />
+    <Word from="V\filliam" to="William" />
+    <Word from="Efiersom" to="Eftersom" />
+    <Word from="Vlfilliam" to="William" />
+    <Word from="Iängejag" to="länge jag" />
+    <Word from="'fidigare" to="Tidigare" />
+    <Word from="börjadei" to="började i" />
+    <Word from="merjust" to="mer just" />
+    <Word from="efieråt" to="efteråt" />
+    <Word from="gjordejag" to="gjorde jag" />
+    <Word from="hadeju" to="hade ju" />
+    <Word from="gårvi" to="går vi" />
+    <Word from="köperjag" to="köper jag" />
+    <Word from="Måstejag" to="Måste jag" />
+    <Word from="kännerju" to="känner ju" />
+    <Word from="fln" to="fin" />
+    <Word from="treviig" to="trevlig" />
+    <Word from="Grattisl" to="Grattis!" />
+    <Word from="kande" to="kände" />
+    <Word from="'llden" to="Tiden" />
+    <Word from="sakjag" to="sak jag" />
+    <Word from="klartjag" to="klart jag" />
+    <Word from="häfiigt" to="häftigt" />
+    <Word from="Iämnarjag" to="lämnar jag" />
+    <Word from="gickju" to="gick ju" />
+    <Word from="skajag" to="ska jag" />
+    <Word from="Görjag" to="Gör jag" />
+    <Word from="måstejag" to="måste jag" />
+    <Word from="gra\/iditet" to="graviditet" />
+    <Word from="hittadqdin" to="hittade din" />
+    <Word from="ärjobbigt" to="är jobbigt" />
+    <Word from="Overdrivet" to="Överdrivet" />
+    <Word from="hOgtidlig" to="högtidlig" />
+    <Word from="Overtyga" to="Övertyga" />
+    <Word from="SKILSMASSA" to="SKILSMÄSSA" />
+    <Word from="brukarju" to="brukar ju" />
+    <Word from="lsabel" to="Isabel" />
+    <Word from="kundejag" to="kunde jag" />
+    <Word from="ärläget" to="är läget" />
+    <Word from="blirinte" to="blir inte" />
+    <Word from="ijakt" to="i jakt" />
+    <Word from="avjordens" to="av jordens" />
+    <Word from="90000O" to="900000" />
+    <Word from="9O0" to="900" />
+    <Word from="ärpå" to="är på" />
+    <Word from="ärproteserna" to="är proteserna" />
+    <Word from="ärytterst" to="är ytterst" />
+    <Word from="beborjorden" to="bebor jorden" />
+    <Word from="filmjag" to="film jag" />
+    <Word from="fokuserarpå" to="fokuserar på" />
+    <Word from="folkjag" to="folk jag" />
+    <Word from="föreställdejag" to="föreställde jag" />
+    <Word from="förpubliken" to="för publiken" />
+    <Word from="gilladejag" to="gillade jag" />
+    <Word from="hållerpå" to="håller på" />
+    <Word from="harpå" to="har på" />
+    <Word from="harplaner" to="har planer" />
+    <Word from="harprylar" to="har prylar" />
+    <Word from="kommerpubliken" to="kommer publiken" />
+    <Word from="kostymerpå" to="kostymer på" />
+    <Word from="litarpå" to="litar på" />
+    <Word from="lngen" to="Ingen" />
+    <Word from="lnom" to="Inom" />
+    <Word from="lnte" to="Inte" />
+    <Word from="ochjag" to="och jag" />
+    <Word from="Ochjag" to="Och jag" />
+    <Word from="ochjorden" to="och jorden" />
+    <Word from="omjag" to="om jag" />
+    <Word from="Omjag" to="Om jag" />
+    <Word from="passarperfekt" to="passar perfekt" />
+    <Word from="sättetjag" to="sättet jag" />
+    <Word from="silverpå" to="silver på" />
+    <Word from="skruvarjag" to="skruvar jag" />
+    <Word from="somjag" to="som jag" />
+    <Word from="Somjag" to="Som jag" />
+    <Word from="talarpå" to="talar på" />
+    <Word from="tänktejag" to="tänkte jag" />
+    <Word from="tapparjag" to="tappar jag" />
+    <Word from="tittarpå" to="tittar på" />
+    <Word from="visstejag" to="visste jag" />
+    <Word from="medjetpacks" to="med jetpacks" />
+    <Word from="sätterpå" to="sätter på" />
+    <Word from="stårpå" to="står på" />
+    <Word from="tillhörpå" to="tillhör på" />
+  </WholeWords>
+  <PartialWordsAlways />
+  <PartialWords>
+    <!-- Will be used to check words not in dictionary -->
+    <!-- If new word(s) exists in spelling dictionary, it(they) is accepted -->
+    <WordPart from="¤" to="o" />
+    <WordPart from="fi" to="fi" />
+    <WordPart from="â" to="ä" />
+    <WordPart from="/" to="l" />
+    <WordPart from="vv" to="w" />
+    <WordPart from="IVI" to="M" />
+    <WordPart from="lVI" to="M" />
+    <WordPart from="IVl" to="M" />
+    <WordPart from="lVl" to="M" />
+    <WordPart from="m" to="rn" />
+    <WordPart from="l" to="i" />
+    <WordPart from="€" to="e" />
+    <WordPart from="I" to="l" />
+    <WordPart from="c" to="o" />
+    <WordPart from="i" to="t" />
+    <WordPart from="cc" to="oo" />
+    <WordPart from="ii" to="tt" />
+    <WordPart from="n/" to="ry" />
+    <WordPart from="ae" to="æ" />
+    <!-- "f " will be two words -->
+    <WordPart from="f" to="f " />
+    <WordPart from="c" to="e" />
+    <WordPart from="o" to="e" />
+    <WordPart from="I" to="t" />
+    <WordPart from="n" to="o" />
+    <WordPart from="s" to="e" />
+    <WordPart from="å" to="ä" />
+    <WordPart from="à" to="å" />
+    <WordPart from="n/" to="rv" />
+    <WordPart from="djag" to="d jag" />
+    <WordPart from="sjag" to="s jag" />
+    <WordPart from="rjag" to="r jag" />
+    <WordPart from="tjag" to="t jag" />
+    <WordPart from="ejag" to="e jag" />
+    <WordPart from="ärp" to="är p" />
+  </PartialWords>
+  <PartialLines />
+  <PartialLinesAlways />
+  <BeginLines>
+    <Beginning from="Ln " to="In " />
+    <Beginning from="U ppfattat" to="Uppfattat" />
+  </BeginLines>
+  <EndLines />
+  <WholeLines />
+  <RegularExpressions />
+</OCRFixReplaceList>
\ No newline at end of file
diff --git a/libs/subzero/modification/main.py b/libs/subzero/modification/main.py
new file mode 100644
index 000000000..05c882d9e
--- /dev/null
+++ b/libs/subzero/modification/main.py
@@ -0,0 +1,381 @@
+# coding=utf-8
+
+import traceback
+import re
+import pysubs2
+import logging
+import time
+
+from mods import EMPTY_TAG_PROCESSOR, EmptyEntryError
+from registry import registry
+from subzero.language import Language
+
+logger = logging.getLogger(__name__)
+
+
+lowercase_re = re.compile(ur'(?sux)[a-zà-ž]')
+
+
+class SubtitleModifications(object):
+    debug = False
+    language = None
+    initialized_mods = {}
+    mods_used = []
+    only_uppercase = False
+    f = None
+
+    font_style_tag_start = u"{\\"
+
+    def __init__(self, debug=False):
+        self.debug = debug
+        self.initialized_mods = {}
+        self.mods_used = []
+
+    def load(self, fn=None, content=None, language=None, encoding="utf-8"):
+        """
+        
+        :param encoding: used for decoding the content when fn is given, not used in case content is given
+        :param language: babelfish.Language language of the subtitle
+        :param fn:  filename
+        :param content: unicode 
+        :return: 
+        """
+        if language:
+            self.language = Language.rebuild(language, forced=False)
+        self.initialized_mods = {}
+        try:
+            if fn:
+                self.f = pysubs2.load(fn, encoding=encoding)
+            elif content:
+                self.f = pysubs2.SSAFile.from_string(content)
+        except (IOError,
+                UnicodeDecodeError,
+                pysubs2.exceptions.UnknownFPSError,
+                pysubs2.exceptions.UnknownFormatIdentifierError,
+                pysubs2.exceptions.FormatAutodetectionError):
+            if fn:
+                logger.exception("Couldn't load subtitle: %s: %s", fn, traceback.format_exc())
+            elif content:
+                logger.exception("Couldn't load subtitle: %s", traceback.format_exc())
+
+        return bool(self.f)
+
+    @classmethod
+    def parse_identifier(cls, identifier):
+        # simple identifier
+        if identifier in registry.mods:
+            return identifier, {}
+
+        # identifier with params; identifier(param=value)
+        split_args = identifier[identifier.find("(")+1:-1].split(",")
+        args = dict((key, value) for key, value in [sub.split("=") for sub in split_args])
+        return identifier[:identifier.find("(")], args
+
+    @classmethod
+    def get_mod_class(cls, identifier):
+        identifier, args = cls.parse_identifier(identifier)
+        return registry.mods[identifier]
+
+    @classmethod
+    def get_mod_signature(cls, identifier, **kwargs):
+        return cls.get_mod_class(identifier).get_signature(**kwargs)
+
+    def prepare_mods(self, *mods):
+        parsed_mods = [(SubtitleModifications.parse_identifier(mod), mod) for mod in mods]
+        final_mods = {}
+        line_mods = []
+        non_line_mods = []
+        used_mods = []
+        mods_merged = {}
+        mods_merged_log = {}
+
+        for mod_data, orig_identifier in parsed_mods:
+            identifier, args = mod_data
+            if identifier not in registry.mods:
+                logger.error("Mod %s not loaded", identifier)
+                continue
+
+            mod_cls = registry.mods[identifier]
+            # exclusive mod, kill old, use newest
+            if identifier in final_mods and mod_cls.exclusive:
+                final_mods.pop(identifier)
+
+            # language-specific mod, check validity
+            if mod_cls.languages and self.language not in mod_cls.languages:
+                if self.debug:
+                    logger.debug("Skipping %s, because %r is not a valid language for this mod",
+                                 identifier, self.language)
+                continue
+
+            if mod_cls.only_uppercase and not self.only_uppercase:
+                if self.debug:
+                    logger.debug("Skipping %s, because the subtitle isn't all uppercase", identifier)
+                continue
+
+            # merge args of duplicate mods if possible
+            elif mod_cls.args_mergeable and identifier in mods_merged:
+                mods_merged[identifier] = mod_cls.merge_args(mods_merged[identifier], args)
+                mods_merged_log[identifier]["identifiers"].append(orig_identifier)
+                continue
+
+            if mod_cls.args_mergeable:
+                mods_merged[identifier] = mod_cls.merge_args(args, {})
+                mods_merged_log[identifier] = {"identifiers": [orig_identifier], "final_identifier": orig_identifier}
+                used_mods.append("%s_ORIG_POSITION" % identifier)
+                continue
+
+            final_mods[identifier] = args
+            used_mods.append(orig_identifier)
+
+        # finalize merged mods into final and used mods
+        for identifier, args in mods_merged.iteritems():
+            pos_preserve_index = used_mods.index("%s_ORIG_POSITION" % identifier)
+
+            # clear empty mods after merging
+            if not any(args.values()):
+                if self.debug:
+                    logger.debug("Skipping %s, empty args", identifier)
+
+                if pos_preserve_index > -1:
+                    used_mods.pop(pos_preserve_index)
+
+                mods_merged_log.pop(identifier)
+                continue
+
+            # clear empty args
+            final_mod_args = dict(filter(lambda (k, v): bool(v), args.iteritems()))
+
+            _data = SubtitleModifications.get_mod_signature(identifier, **final_mod_args)
+            if _data == mods_merged_log[identifier]["final_identifier"]:
+                mods_merged_log.pop(identifier)
+            else:
+                mods_merged_log[identifier]["final_identifier"] = _data
+
+            if pos_preserve_index > -1:
+                used_mods[pos_preserve_index] = _data
+            else:
+                # should never happen
+                used_mods.append(_data)
+            final_mods[identifier] = args
+
+        if self.debug:
+            for identifier, data in mods_merged_log.iteritems():
+                logger.debug("Merged %s to %s", data["identifiers"], data["final_identifier"])
+
+        # separate all mods into line and non-line mods
+        for identifier, args in final_mods.iteritems():
+            mod_cls = registry.mods[identifier]
+            if mod_cls.modifies_whole_file:
+                non_line_mods.append((identifier, args))
+            else:
+                line_mods.append((mod_cls.order, identifier, args))
+
+            # initialize the mods
+            if identifier not in self.initialized_mods:
+                self.initialized_mods[identifier] = mod_cls(self)
+
+        return line_mods, non_line_mods, used_mods
+
+    def detect_uppercase(self):
+        entries_used = 0
+        for entry in self.f:
+            entry_used = False
+            for sub in entry.text.strip().split("\N"):
+                # skip HI bracket entries, those might actually be lowercase
+                sub = sub.strip()
+                for processor in registry.mods["remove_HI"].processors[:4]:
+                    sub = processor.process(sub)
+
+                if sub.strip():
+                    if lowercase_re.search(sub):
+                        return False
+
+                    entry_used = True
+                else:
+                    # skip full entry
+                    break
+
+            if entry_used:
+                entries_used += 1
+
+            if entries_used == 40:
+                break
+
+        return True
+
+    def modify(self, *mods):
+        new_entries = []
+        start = time.time()
+        self.only_uppercase = self.detect_uppercase()
+
+        if self.only_uppercase and self.debug:
+            logger.debug("Full-uppercase subtitle found")
+
+        line_mods, non_line_mods, mods_used = self.prepare_mods(*mods)
+        self.mods_used = mods_used
+
+        # apply non-last file mods
+        if non_line_mods:
+            non_line_mods_start = time.time()
+            self.apply_non_line_mods(non_line_mods)
+
+            if self.debug:
+                logger.debug("Non-Line mods took %ss", time.time() - non_line_mods_start)
+
+        # sort line mods
+        line_mods.sort(key=lambda x: (x is None, x))
+
+        # apply line mods
+        if line_mods:
+            line_mods_start = time.time()
+            self.apply_line_mods(new_entries, line_mods)
+
+            if self.debug:
+                logger.debug("Line mods took %ss", time.time() - line_mods_start)
+
+            if new_entries:
+                self.f.events = new_entries
+
+        # apply last file mods
+        if non_line_mods:
+            non_line_mods_start = time.time()
+            self.apply_non_line_mods(non_line_mods, only_last=True)
+
+            if self.debug:
+                logger.debug("Final Non-Line mods took %ss", time.time() - non_line_mods_start)
+
+        if self.debug:
+            logger.debug("Subtitle Modification took %ss", time.time() - start)
+            logger.debug("Mods applied: %s" % self.mods_used)
+
+    def apply_non_line_mods(self, mods, only_last=False):
+        for identifier, args in mods:
+            mod = self.initialized_mods[identifier]
+            if (not only_last and not mod.apply_last) or (only_last and mod.apply_last):
+                if self.debug:
+                    logger.debug("Applying %s", identifier)
+                mod.modify(None, debug=self.debug, parent=self, **args)
+
+    def apply_line_mods(self, new_entries, mods):
+        for index, entry in enumerate(self.f, 1):
+            applied_mods = []
+            lines = []
+
+            line_count = 0
+            start_tags = []
+            end_tags = []
+
+            t = entry.text.strip()
+            if not t:
+                if self.debug:
+                    logger.debug(u"Skipping empty line: %s", index)
+                continue
+
+            skip_entry = False
+            for line in t.split(ur"\N"):
+                # don't bother the mods with surrounding tags
+                old_line = line
+                line = line.strip()
+                skip_line = False
+                line_count += 1
+
+                if not line:
+                    continue
+
+                # clean {\X0} tags before processing
+                # fixme: handle nested tags?
+                start_tag = u""
+                end_tag = u""
+                if line.startswith(self.font_style_tag_start):
+                    start_tag = line[:5]
+                    line = line[5:]
+                if line[-5:-3] == self.font_style_tag_start:
+                    end_tag = line[-5:]
+                    line = line[:-5]
+
+                for order, identifier, args in mods:
+                    mod = self.initialized_mods[identifier]
+
+                    try:
+                        line = mod.modify(line.strip(), entry=entry.text, debug=self.debug, parent=self, index=index,
+                                          **args)
+                    except EmptyEntryError:
+                        if self.debug:
+                            logger.debug(u"%d: %s: %r -> ''", index, identifier, entry.text)
+                        skip_entry = True
+                        break
+
+                    if not line:
+                        if self.debug:
+                            logger.debug(u"%d: %s: %r -> ''", index, identifier, old_line)
+                        skip_line = True
+                        break
+
+                    applied_mods.append(identifier)
+
+                if skip_entry:
+                    lines = []
+                    break
+
+                if skip_line:
+                    continue
+
+                if start_tag:
+                    start_tags.append(start_tag)
+
+                if end_tag:
+                    end_tags.append(end_tag)
+
+                # append new line and clean possibly newly added empty tags
+                cleaned_line = EMPTY_TAG_PROCESSOR.process(start_tag + line + end_tag, debug=self.debug).strip()
+                if cleaned_line:
+                    # we may have a single closing tag, if so, try appending it to the previous line
+                    if len(cleaned_line) == 5 and cleaned_line.startswith("{\\") and cleaned_line.endswith("0}"):
+                        if lines:
+                            prev_line = lines.pop()
+                            lines.append(prev_line + cleaned_line)
+                            continue
+
+                    lines.append(cleaned_line)
+                else:
+                    if self.debug:
+                        logger.debug(u"%d: Ditching now empty line (%r)", index, line)
+
+            if not lines:
+                # don't bother logging when the entry only had one line
+                if self.debug and line_count > 1:
+                    logger.debug(u"%d: %r -> ''", index, entry.text)
+                continue
+
+            new_text = ur"\N".join(lines)
+
+            # cheap man's approach to avoid open tags
+            add_start_tags = []
+            add_end_tags = []
+            if len(start_tags) != len(end_tags):
+                for tag in start_tags:
+                    end_tag = tag.replace("1", "0")
+                    if end_tag not in end_tags and new_text.count(tag) > new_text.count(end_tag):
+                        add_end_tags.append(end_tag)
+                for tag in end_tags:
+                    start_tag = tag.replace("0", "1")
+                    if start_tag not in start_tags and new_text.count(tag) > new_text.count(start_tag):
+                        add_start_tags.append(start_tag)
+
+                if add_end_tags or add_start_tags:
+                    entry.text = u"".join(add_start_tags) + new_text + u"".join(add_end_tags)
+                    if self.debug:
+                        logger.debug(u"Fixing tags: %s (%r -> %r)", str(add_start_tags+add_end_tags), new_text,
+                                     entry.text)
+                else:
+                    entry.text = new_text
+            else:
+                entry.text = new_text
+
+            new_entries.append(entry)
+
+SubMod = SubtitleModifications
+
+
+
+
diff --git a/libs/subzero/modification/mods/__init__.py b/libs/subzero/modification/mods/__init__.py
new file mode 100644
index 000000000..10d0553da
--- /dev/null
+++ b/libs/subzero/modification/mods/__init__.py
@@ -0,0 +1,109 @@
+# coding=utf-8
+import re
+import logging
+
+from subzero.modification.processors.re_processor import ReProcessor, NReProcessor
+
+logger = logging.getLogger(__name__)
+
+
+class SubtitleModification(object):
+    identifier = None
+    description = None
+    long_description = None
+    exclusive = False
+    advanced = False  # has parameters
+    args_mergeable = False
+    order = None
+    modifies_whole_file = False  # operates on the whole file, not individual entries
+    apply_last = False
+    only_uppercase = False
+    pre_processors = []
+    processors = []
+    post_processors = []
+    languages = []
+
+    def __init__(self, parent):
+        return
+
+    def _process(self, content, processors, debug=False, parent=None, index=None, **kwargs):
+        if not content:
+            return
+
+        # processors may be a list or a callable
+        #if callable(processors):
+        #    _processors = processors()
+        #else:
+        #    _processors = processors
+        _processors = processors
+
+        new_content = content
+        for processor in _processors:
+            if not processor.supported(parent):
+                if debug and processor.enabled:
+                    logger.debug("Processor not supported, skipping: %s", processor.name)
+                    processor.enabled = False
+                continue
+
+            old_content = new_content
+            new_content = processor.process(new_content, debug=debug, **kwargs)
+            if not new_content:
+                if debug:
+                    logger.debug("Processor returned empty line: %s", processor.name)
+                break
+            if debug:
+                if old_content == new_content:
+                    continue
+                logger.debug("%d: %s: %s -> %s", index, processor.name, repr(old_content), repr(new_content))
+
+        return new_content
+
+    def pre_process(self, content, debug=False, parent=None, **kwargs):
+        return self._process(content, self.pre_processors, debug=debug, parent=parent, **kwargs)
+
+    def process(self, content, debug=False, parent=None, **kwargs):
+        return self._process(content, self.processors, debug=debug, parent=parent, **kwargs)
+
+    def post_process(self, content, debug=False, parent=None, **kwargs):
+        return self._process(content, self.post_processors, debug=debug, parent=parent, **kwargs)
+
+    def modify(self, content, debug=False, parent=None, **kwargs):
+        if not content:
+            return
+
+        new_content = content
+        for method in ("pre_process", "process", "post_process"):
+            if not new_content:
+                return
+            new_content = getattr(self, method)(new_content, debug=debug, parent=parent, **kwargs)
+
+        return new_content
+
+    @classmethod
+    def get_signature(cls, **kwargs):
+        string_args = ",".join(["%s=%s" % (key, value) for key, value in kwargs.iteritems()])
+        return "%s(%s)" % (cls.identifier, string_args)
+
+    @classmethod
+    def merge_args(cls, args1, args2):
+        raise NotImplementedError
+
+
+class SubtitleTextModification(SubtitleModification):
+    pass
+
+
+TAG = ur"(?:\s*{\\[iusb][0-1]}\s*)*"
+EMPTY_TAG_PROCESSOR = ReProcessor(re.compile(r'({\\\w1})[\s.,-_!?]*({\\\w0})'), "", name="empty_tag")
+
+empty_line_post_processors = [
+    # empty tag
+    EMPTY_TAG_PROCESSOR,
+
+    # empty line (needed?)
+    NReProcessor(re.compile(r'^[\s-]+$'), "", name="empty_line"),
+]
+
+
+class EmptyEntryError(Exception):
+    pass
diff --git a/libs/subzero/modification/mods/color.py b/libs/subzero/modification/mods/color.py
new file mode 100644
index 000000000..9e883b101
--- /dev/null
+++ b/libs/subzero/modification/mods/color.py
@@ -0,0 +1,51 @@
+# coding=utf-8
+
+import logging
+from collections import OrderedDict
+
+from subzero.modification.mods import SubtitleModification
+from subzero.modification import registry
+
+logger = logging.getLogger(__name__)
+
+
+COLOR_MAP = OrderedDict([
+    ("white", "#FFFFFF"),
+    ("light-grey", "#C0C0C0"),
+    ("red", "#FF0000"),
+    ("green", "#00FF00"),
+    ("yellow", "#FFFF00"),
+    ("blue", "#0000FF"),
+    ("magenta", "#FF00FF"),
+    ("cyan", "#00FFFF"),
+    ("black", "#000000"),
+    ("dark-red", "#800000"),
+    ("dark-green", "#008000"),
+    ("dark-yellow", "#808000"),
+    ("dark-blue", "#000080"),
+    ("dark-magenta", "#800080"),
+    ("dark-cyan", "#008080"),
+    ("dark-grey", "#808080"),
+])
+
+
+class Color(SubtitleModification):
+    identifier = "color"
+    description = "Change the color of the subtitle"
+    exclusive = True
+    advanced = True
+    modifies_whole_file = True
+    apply_last = True
+
+    colors = COLOR_MAP
+
+    long_description = "Adds the requested color to every line of the subtitle. Support depends on player."
+
+    def modify(self, content, debug=False, parent=None, **kwargs):
+        color = self.colors.get(kwargs.get("name"))
+        if color:
+            for entry in parent.f:
+                entry.text = u'<font color="%s">%s</font>' % (color, entry.text)
+
+
+registry.register(Color)
diff --git a/libs/subzero/modification/mods/common.py b/libs/subzero/modification/mods/common.py
new file mode 100644
index 000000000..896a1f2f8
--- /dev/null
+++ b/libs/subzero/modification/mods/common.py
@@ -0,0 +1,185 @@
+# coding=utf-8
+
+import re
+
+from subzero.language import Language
+from subzero.modification.mods import SubtitleTextModification, empty_line_post_processors, SubtitleModification
+from subzero.modification.processors import FuncProcessor
+from subzero.modification.processors.re_processor import NReProcessor
+from subzero.modification import registry
+
+
+ENGLISH = Language("eng")
+
+
+class CommonFixes(SubtitleTextModification):
+    identifier = "common"
+    description = "Basic common fixes"
+    exclusive = True
+    order = 40
+
+    long_description = "Fix common and whitespace/punctuation issues in subtitles"
+
+    processors = [
+        # normalize hyphens
+        NReProcessor(re.compile(ur'(?u)([‑‐﹘﹣])'), u"-", name="CM_hyphens"),
+
+        # -- = em dash
+        NReProcessor(re.compile(r'(?u)(\w|\b|\s|^)(-\s?-{1,2})'), ur"\1—", name="CM_multidash"),
+
+        # line = _/-/\s
+        NReProcessor(re.compile(r'(?u)(^\W*[-_.:]+\W*$)'), "", name="CM_non_word_only"),
+
+        # line = : text
+        NReProcessor(re.compile(r'(?u)(^\W*:\s*(?=\w+))'), "", name="CM_empty_colon_start"),
+
+        # multi space
+        NReProcessor(re.compile(r'(?u)(\s{2,})'), " ", name="CM_multi_space"),
+
+        # fix music symbols
+        NReProcessor(re.compile(ur'(?u)(?:^[-\s]*[*#¶]+(?![^\s\-*#¶]))|(?:[*#¶]+\s*$)'), u"♪", name="CM_music_symbols"),
+
+        # '' = "
+        NReProcessor(re.compile(ur'(?u)([\'’ʼ❜‘‛][\'’ʼ❜‘‛]+)'), u'"', name="CM_double_apostrophe"),
+
+        # double quotes instead of single quotes inside words
+        NReProcessor(re.compile(ur'(?u)([A-zÀ-ž])"([A-zÀ-ž])'), ur"\1'\2", name="CM_double_as_single"),
+
+        # normalize quotes
+        NReProcessor(re.compile(ur'(?u)(\s*["”“‟„])\s*(["”“‟„]["”“‟„\s]*)'),
+                     lambda match: '"' + (" " if match.group(2).endswith(" ") else ""),
+                     name="CM_normalize_quotes"),
+
+        # normalize single quotes
+        NReProcessor(re.compile(ur'(?u)([\'’ʼ❜‘‛])'), u"'", name="CM_normalize_squotes"),
+
+        # remove leading ...
+        NReProcessor(re.compile(r'(?u)^\.\.\.[\s]*'), "", name="CM_leading_ellipsis"),
+
+        # remove "downloaded from" tags
+        NReProcessor(re.compile(r'(?ui).+downloaded\s+from.+'), "", name="CM_crap"),
+
+        # no space after ellipsis
+        NReProcessor(re.compile(r'(?u)\.\.\.(?![\s.,!?\'"])(?!$)'), "... ", name="CM_ellipsis_no_space"),
+
+        # no space before spaced ellipsis
+        NReProcessor(re.compile(r'(?u)(?<=[^\s])(?<!\s)\. \. \.'), " . . .", name="CM_ellipsis_no_space2"),
+
+        # multiple spaces
+        NReProcessor(re.compile(r'(?u)[\s]{2,}'), " ", name="CM_multiple_spaces"),
+
+        # more than 3 dots
+        NReProcessor(re.compile(r'(?u)\.{3,}'), "...", name="CM_dots"),
+
+        # no space after starting dash
+        NReProcessor(re.compile(r'(?u)^-(?![\s-])'), "- ", name="CM_dash_space"),
+
+        # remove starting spaced dots (not matching ellipses)
+        NReProcessor(re.compile(r'(?u)^(?!\s?(\.\s\.\s\.)|(\s?\.{3}))(?=\.+\s+)[\s.]*'), "",
+                     name="CM_starting_spacedots"),
+
+        # space missing before doublequote
+        # ReProcessor(re.compile(r'(?u)(?<!^)(?<![\s(\["])("[^"]+")'), r' \1', name="CM_space_before_dblquote"),
+
+        # space missing after doublequote
+        # ReProcessor(re.compile(r'(?u)("[^"\s][^"]+")([^\s.,!?)\]]+)'), r"\1 \2", name="CM_space_after_dblquote"),
+
+        # space before ending doublequote?
+
+        # remove >>
+        NReProcessor(re.compile(r'(?u)^\s?>>\s*'), "", name="CM_leading_crocodiles"),
+
+        # replace uppercase I with lowercase L in words
+        NReProcessor(re.compile(ur'(?u)([a-zà-ž]+)(I+)'),
+                     lambda match: ur'%s%s' % (match.group(1), "l" * len(match.group(2))),
+                     name="CM_uppercase_i_in_word"),
+
+        # fix spaces in numbers (allows for punctuation: ,.:' (comma/dot only fixed if after space, those may be
+        # countdowns otherwise); don't break up ellipses
+        NReProcessor(
+            re.compile(r'(?u)(\b[0-9]+[0-9:\']*(?<!\.\.)\s+(?!\.\.)[0-9,.:\'\s]*(?=[0-9]+)[0-9,.:\'])'),
+            lambda match: match.group(1).replace(" ", "") if match.group(1).count(" ") == 1 else match.group(1),
+            name="CM_spaces_in_numbers"),
+
+        # uppercase after dot
+        NReProcessor(re.compile(ur'(?u)((?<!(?=\s*[A-ZÀ-Ž-_0-9.]\s*))(?:[^.\s])+\.\s+)([a-zà-ž])'),
+                     lambda match: ur'%s%s' % (match.group(1), match.group(2).upper()), name="CM_uppercase_after_dot"),
+
+        # remove double interpunction
+        NReProcessor(re.compile(ur'(?u)(\s*[,!?])\s*([,.!?][,.!?\s]*)'),
+                     lambda match: match.group(1).strip() + (" " if match.group(2).endswith(" ") else ""),
+                     name="CM_double_interpunct"),
+
+        # remove spaces before punctuation; don't break spaced ellipses
+        NReProcessor(re.compile(r'(?u)(?:(?<=^)|(?<=\w)) +([!?.,](?![!?.,]| \.))'), r"\1", name="CM_punctuation_space"),
+
+        # add space after punctuation
+        NReProcessor(re.compile(r'(?u)([!?.,:])([A-zÀ-ž]{2,})'), r"\1 \2", name="CM_punctuation_space2"),
+
+        # fix lowercase I in english
+        NReProcessor(re.compile(r'(?u)(\b)i(\b)'), r"\1I\2", name="CM_EN_lowercase_i",
+                     supported=lambda p: p.language == ENGLISH),
+    ]
+
+    post_processors = empty_line_post_processors
+
+
+class RemoveTags(SubtitleModification):
+    identifier = "remove_tags"
+    description = "Remove all style tags"
+    exclusive = True
+    modifies_whole_file = True
+
+    long_description = "Removes all possible style tags from the subtitle, such as font, bold, color etc."
+
+    def modify(self, content, debug=False, parent=None, **kwargs):
+        for entry in parent.f:
+            # this actually plaintexts the entry and by re-assigning it to plaintext, it replaces \n with \N again
+            entry.plaintext = entry.plaintext
+
+
+class ReverseRTL(SubtitleModification):
+    identifier = "reverse_rtl"
+    description = "Reverse punctuation in RTL languages"
+    exclusive = True
+    order = 50
+    languages = [Language(l) for l in ('heb', 'ara', 'fas')]
+
+    long_description = "Some playback devices don't properly handle right-to-left markers for punctuation. " \
+                       "Physically swap punctuation. Applicable to languages: hebrew, arabic, farsi, persian"
+
+    processors = [
+        # new? (?u)(^([\s.!?]*)(.+?)(\s*)(-?\s*)$); \5\4\3\2
+        #NReProcessor(re.compile(ur"(?u)((?=(?<=\b|^)|(?<=\s))([.!?-]+)([^.!?-]+)(?=\b|$|\s))"), r"\3\2",
+        #             name="CM_RTL_reverse")
+        NReProcessor(re.compile(ur"(?u)(^([\s.!?:,'-]*)(.+?)(\s*)(-?\s*)$)"), r"\5\4\3\2",
+                     name="CM_RTL_reverse")
+    ]
+
+
+split_upper_re = re.compile(ur"(\s*[.!?♪\-]\s*)")
+
+
+class FixUppercase(SubtitleModification):
+    identifier = "fix_uppercase"
+    description = "Fixes all-uppercase subtitles"
+    modifies_whole_file = True
+    exclusive = True
+    order = 41
+    only_uppercase = True
+    apply_last = True
+
+    long_description = "Some subtitles are in all-uppercase letters. This at least makes them readable."
+
+    def capitalize(self, c):
+        return u"".join([s.capitalize() for s in split_upper_re.split(c)])
+
+    def modify(self, content, debug=False, parent=None, **kwargs):
+        for entry in parent.f:
+            entry.plaintext = self.capitalize(entry.plaintext)
+
+
+registry.register(CommonFixes)
+registry.register(RemoveTags)
+registry.register(ReverseRTL)
+registry.register(FixUppercase)
diff --git a/libs/subzero/modification/mods/fps.py b/libs/subzero/modification/mods/fps.py
new file mode 100644
index 000000000..b209eddff
--- /dev/null
+++ b/libs/subzero/modification/mods/fps.py
@@ -0,0 +1,25 @@
+# coding=utf-8
+
+import logging
+
+from subzero.modification.mods import SubtitleModification
+from subzero.modification import registry
+
+logger = logging.getLogger(__name__)
+
+
+class ChangeFPS(SubtitleModification):
+    identifier = "change_FPS"
+    description = "Change the FPS of the subtitle"
+    exclusive = True
+    advanced = True
+    modifies_whole_file = True
+
+    long_description = "Re-syncs the subtitle to the framerate of the current media file."
+
+    def modify(self, content, debug=False, parent=None, **kwargs):
+        fps_from = kwargs.get("from")
+        fps_to = kwargs.get("to")
+        parent.f.transform_framerate(float(fps_from), float(fps_to))
+
+registry.register(ChangeFPS)
diff --git a/libs/subzero/modification/mods/hearing_impaired.py b/libs/subzero/modification/mods/hearing_impaired.py
new file mode 100644
index 000000000..10dade9ee
--- /dev/null
+++ b/libs/subzero/modification/mods/hearing_impaired.py
@@ -0,0 +1,92 @@
+# coding=utf-8
+import re
+
+from subzero.modification.mods import SubtitleTextModification, empty_line_post_processors, EmptyEntryError, TAG
+from subzero.modification.processors.re_processor import NReProcessor
+from subzero.modification import registry
+
+
+class FullBracketEntryProcessor(NReProcessor):
+    def process(self, content, debug=False, **kwargs):
+        entry = kwargs.get("entry")
+        if entry:
+            rep_content = super(FullBracketEntryProcessor, self).process(entry, debug=debug, **kwargs)
+            if not rep_content.strip():
+                raise EmptyEntryError()
+        return content
+
+
+class HearingImpaired(SubtitleTextModification):
+    identifier = "remove_HI"
+    description = "Remove Hearing Impaired tags"
+    exclusive = True
+    order = 20
+
+    long_description = "Removes tags, text and characters from subtitles that are meant for hearing impaired people"
+
+    processors = [
+        # full bracket entry, single or multiline; starting with brackets and ending with brackets
+        FullBracketEntryProcessor(re.compile(ur'(?sux)^-?%(t)s[([].+(?=[^)\]]{3,}).+[)\]]%(t)s$' % {"t": TAG}),
+                                  "", name="HI_brackets_full"),
+
+        # brackets (only remove if at least 3 chars in brackets)
+        NReProcessor(re.compile(ur'(?sux)-?%(t)s[([][^([)\]]+?(?=[A-zÀ-ž"\'.]{3,})[^([)\]]+[)\]][\s:]*%(t)s' %
+                                {"t": TAG}), "", name="HI_brackets"),
+
+        NReProcessor(re.compile(ur'(?sux)-?%(t)s[([]%(t)s(?=[A-zÀ-ž"\'.]{3,})[^([)\]]+%(t)s$' % {"t": TAG}),
+                     "", name="HI_bracket_open_start"),
+
+        NReProcessor(re.compile(ur'(?sux)-?%(t)s(?=[A-zÀ-ž"\'.]{3,})[^([)\]]+[)\]][\s:]*%(t)s' % {"t": TAG}), "",
+                     name="HI_bracket_open_end"),
+
+        # text before colon (and possible dash in front), max 11 chars after the first whitespace (if any)
+        # NReProcessor(re.compile(r'(?u)(^[A-z\-\'"_]+[\w\s]{0,11}:[^0-9{2}][\s]*)'), "", name="HI_before_colon"),
+
+        # starting text before colon (at least 3 chars)
+        #NReProcessor(re.compile(ur'(?u)(\b|^)([\s-]*(?=[A-zÀ-ž-_0-9"\']{3,})[A-zÀ-ž-_0-9"\']+:\s*)'), "",
+        #             name="HI_before_colon"),
+
+        # uppercase text before colon (at least 3 uppercase chars); at start or after a sentence,
+        # possibly with a dash in front; ignore anything ending with a quote
+        NReProcessor(re.compile(ur'(?u)(?:(?<=^)|(?<=[.\-!?\"\']))([\s-]*(?=[A-ZÀ-Ž&+]\s*[A-ZÀ-Ž&+]\s*[A-ZÀ-Ž&+])'
+                                ur'[A-ZÀ-Ž-_0-9\s\"\'&+]+:(?![\"\'’ʼ❜‘‛”“‟„])(?:\s+|$))(?![0-9])'), "",
+                     name="HI_before_colon_caps"),
+
+        # any text before colon (at least 3 chars); at start or after a sentence,
+        # possibly with a dash in front; try not breaking actual sentences with a colon at the end by not matching if
+        # a space is inside the text; ignore anything ending with a quote
+        NReProcessor(re.compile(ur'(?u)(?:(?<=^)|(?<=[.\-!?\"]))([\s-]*((?=[A-zÀ-ž&+]\s*[A-zÀ-ž&+]\s*[A-zÀ-ž&+])'
+                                ur'[A-zÀ-ž-_0-9\s\"\'&+]+:)(?![\"’ʼ❜‘‛”“‟„])\s*)(?![0-9])'),
+                     lambda match:
+                     match.group(1) if (match.group(2).count(" ") > 0 or match.group(1).count("-") > 0)
+                     else "" if not match.group(1).startswith(" ") else " ",
+                     name="HI_before_colon_noncaps"),
+
+        # text in brackets at start, after optional dash, before colon or at end of line
+        # fixme: may be too aggressive
+        #NReProcessor(re.compile(ur'(?um)(^-?\s?[([][A-zÀ-ž-_\s]{3,}[)\]](?:(?=$)|:\s*))'), "",
+        #             name="HI_brackets_special"),
+
+        # all caps line (at least 4 consecutive uppercase chars)
+        NReProcessor(re.compile(ur'(?u)(^(?=.*[A-ZÀ-Ž&+]{4,})[A-ZÀ-Ž-_\s&+]+$)'), "", name="HI_all_caps",
+                     supported=lambda p: not p.only_uppercase),
+
+        # remove MAN:
+        NReProcessor(re.compile(ur'(?suxi)(.*MAN:\s*)'), "", name="HI_remove_man"),
+
+        # dash in front
+        # NReProcessor(re.compile(r'(?u)^\s*-\s*'), "", name="HI_starting_dash"),
+
+        # all caps at start before new sentence
+        NReProcessor(re.compile(ur'(?u)^(?=[A-ZÀ-Ž]{4,})[A-ZÀ-Ž-_\s]+\s([A-ZÀ-Ž][a-zà-ž].+)'), r"\1",
+                     name="HI_starting_upper_then_sentence", supported=lambda p: not p.only_uppercase),
+
+        # remove music symbols
+        NReProcessor(re.compile(ur'(?u)(^%(t)s[*#¶♫♪\s]*%(t)s[*#¶♫♪\s]+%(t)s[*#¶♫♪\s]*%(t)s$)' % {"t": TAG}),
+                     "", name="HI_music_symbols_only"),
+    ]
+
+    post_processors = empty_line_post_processors
+
+
+registry.register(HearingImpaired)
diff --git a/libs/subzero/modification/mods/ocr_fixes.py b/libs/subzero/modification/mods/ocr_fixes.py
new file mode 100644
index 000000000..ec57ca006
--- /dev/null
+++ b/libs/subzero/modification/mods/ocr_fixes.py
@@ -0,0 +1,55 @@
+# coding=utf-8
+import logging
+
+import re
+
+from subzero.modification.mods import SubtitleTextModification
+from subzero.modification.processors.string_processor import MultipleLineProcessor, WholeLineProcessor
+from subzero.modification.processors.re_processor import MultipleWordReProcessor, NReProcessor
+from subzero.modification import registry
+from subzero.modification.dictionaries.data import data as OCR_fix_data
+
+logger = logging.getLogger(__name__)
+
+
+class FixOCR(SubtitleTextModification):
+    identifier = "OCR_fixes"
+    description = "Fix common OCR issues"
+    exclusive = True
+    order = 10
+    data_dict = None
+
+    long_description = "Fix issues that happen when a subtitle gets converted from bitmap to text through OCR"
+
+    def __init__(self, parent):
+        super(FixOCR, self).__init__(parent)
+        data_dict = OCR_fix_data.get(parent.language.alpha3t)
+        if not data_dict:
+            logger.debug("No SnR-data available for language %s", parent.language)
+            return
+
+        self.data_dict = data_dict
+        self.processors = self.get_processors()
+
+    def get_processors(self):
+        if not self.data_dict:
+            return []
+
+        return [
+            # remove broken HI tag colons (ANNOUNCER'., ". instead of :) after at least 3 uppercase chars
+            # don't modify stuff inside quotes
+            NReProcessor(re.compile(ur'(?u)(^[^"\'’ʼ❜‘‛”“‟„]*(?<=[A-ZÀ-Ž]{3})[A-ZÀ-Ž-_\s0-9]+)'
+                                    ur'(["\'’ʼ❜‘‛”“‟„]*[.,‚،⹁、;]+)(\s*)(?!["\'’ʼ❜‘‛”“‟„])'),
+                         r"\1:\3", name="OCR_fix_HI_colons", supported=lambda p: not p.only_uppercase),
+            # fix F'bla
+            NReProcessor(re.compile(ur'(?u)(\bF)(\')([A-zÀ-ž]*\b)'), r"\1\3", name="OCR_fix_F"),
+            WholeLineProcessor(self.data_dict["WholeLines"], name="OCR_replace_line"),
+            MultipleWordReProcessor(self.data_dict["WholeWords"], name="OCR_replace_word"),
+            MultipleWordReProcessor(self.data_dict["BeginLines"], name="OCR_replace_beginline"),
+            MultipleWordReProcessor(self.data_dict["EndLines"], name="OCR_replace_endline"),
+            MultipleWordReProcessor(self.data_dict["PartialLines"], name="OCR_replace_partialline"),
+            MultipleLineProcessor(self.data_dict["PartialWordsAlways"], name="OCR_replace_partialwordsalways")
+        ]
+
+
+registry.register(FixOCR)
diff --git a/libs/subzero/modification/mods/offset.py b/libs/subzero/modification/mods/offset.py
new file mode 100644
index 000000000..2e342c0a1
--- /dev/null
+++ b/libs/subzero/modification/mods/offset.py
@@ -0,0 +1,41 @@
+# coding=utf-8
+
+import logging
+
+from subzero.modification.mods import SubtitleModification
+from subzero.modification import registry
+
+logger = logging.getLogger(__name__)
+
+
+class ShiftOffset(SubtitleModification):
+    identifier = "shift_offset"
+    description = "Change the timing of the subtitle"
+    exclusive = False
+    advanced = True
+    args_mergeable = True
+    modifies_whole_file = True
+
+    long_description = "Adds or substracts a certain amount of time from the whole subtitle to match your media"
+
+    @classmethod
+    def merge_args(cls, args1, args2):
+        new_args = dict((key, int(value)) for key, value in args1.iteritems())
+
+        for key, value in args2.iteritems():
+            if not int(value):
+                continue
+
+            if key in new_args:
+                new_args[key] += int(value)
+            else:
+                new_args[key] = int(value)
+
+        return dict(filter(lambda (k, v): bool(v), new_args.iteritems()))
+
+    def modify(self, content, debug=False, parent=None, **kwargs):
+        parent.f.shift(h=int(kwargs.get("h", 0)), m=int(kwargs.get("m", 0)), s=int(kwargs.get("s", 0)),
+                       ms=int(kwargs.get("ms", 0)))
+
+
+registry.register(ShiftOffset)
diff --git a/libs/subzero/modification/processors/__init__.py b/libs/subzero/modification/processors/__init__.py
new file mode 100644
index 000000000..7cfb0aa33
--- /dev/null
+++ b/libs/subzero/modification/processors/__init__.py
@@ -0,0 +1,43 @@
+# coding=utf-8
+
+
+class Processor(object):
+    """
+    Processor base class
+    """
+    name = None
+    parent = None
+    supported = None
+    enabled = True
+
+    def __init__(self, name=None, parent=None, supported=None):
+        self.name = name
+        self.parent = parent
+        self.supported = supported if supported else lambda parent: True
+
+    @property
+    def info(self):
+        return self.name
+
+    def process(self, content, debug=False, **kwargs):
+        return content
+
+    def __repr__(self):
+        return "Processor <%s %s>" % (self.__class__.__name__, self.info)
+
+    def __str__(self):
+        return repr(self)
+
+    def __unicode__(self):
+        return unicode(repr(self))
+
+
+class FuncProcessor(Processor):
+    func = None
+
+    def __init__(self, func, name=None, parent=None, supported=None):
+        super(FuncProcessor, self).__init__(name=name, supported=supported)
+        self.func = func
+
+    def process(self, content, debug=False, **kwargs):
+        return self.func(content)
diff --git a/libs/subzero/modification/processors/re_processor.py b/libs/subzero/modification/processors/re_processor.py
new file mode 100644
index 000000000..5ff76331e
--- /dev/null
+++ b/libs/subzero/modification/processors/re_processor.py
@@ -0,0 +1,48 @@
+# coding=utf-8
+import re
+import logging
+
+from subzero.modification.processors import Processor
+
+logger = logging.getLogger(__name__)
+
+
+class ReProcessor(Processor):
+    """
+    Regex processor
+    """
+    pattern = None
+    replace_with = None
+
+    def __init__(self, pattern, replace_with, name=None, supported=None):
+        super(ReProcessor, self).__init__(name=name, supported=supported)
+        self.pattern = pattern
+        self.replace_with = replace_with
+
+    def process(self, content, debug=False, **kwargs):
+        return self.pattern.sub(self.replace_with, content)
+
+
+class NReProcessor(ReProcessor):
+    pass
+
+
+class MultipleWordReProcessor(ReProcessor):
+    """
+    Expects a dictionary in the form of:
+    dict = {
+        "data": {"old_value": "new_value"},
+        "pattern": compiled re object that matches data.keys()
+    }
+    replaces found key in pattern with the corresponding value in data
+    """
+    def __init__(self, snr_dict, name=None, parent=None, supported=None):
+        super(ReProcessor, self).__init__(name=name, supported=supported)
+        self.snr_dict = snr_dict
+
+    def process(self, content, debug=False, **kwargs):
+        if not self.snr_dict["data"]:
+            return content
+
+        return self.snr_dict["pattern"].sub(lambda x: self.snr_dict["data"][x.group(0)], content)
+
diff --git a/libs/subzero/modification/processors/string_processor.py b/libs/subzero/modification/processors/string_processor.py
new file mode 100644
index 000000000..270fd76f8
--- /dev/null
+++ b/libs/subzero/modification/processors/string_processor.py
@@ -0,0 +1,84 @@
+# coding=utf-8
+
+import logging
+
+from subzero.modification.processors import Processor
+
+logger = logging.getLogger(__name__)
+
+
+class StringProcessor(Processor):
+    """
+    String replacement processor base
+    """
+
+    def __init__(self, search, replace, name=None, parent=None, supported=None):
+        super(StringProcessor, self).__init__(name=name, supported=supported)
+        self.search = search
+        self.replace = replace
+
+    def process(self, content, debug=False, **kwargs):
+        return content.replace(self.search, self.replace)
+
+
+class MultipleLineProcessor(Processor):
+    """
+    replaces stuff in whole lines
+    
+    takes a search/replace dict as first argument
+    Expects a dictionary in the form of:
+    dict = {
+        "data": {"old_value": "new_value"}
+    }
+    """
+    def __init__(self, snr_dict, name=None, parent=None, supported=None):
+        super(MultipleLineProcessor, self).__init__(name=name, supported=supported)
+        self.snr_dict = snr_dict
+
+    def process(self, content, debug=False, **kwargs):
+        if not self.snr_dict["data"]:
+            return content
+
+        for key, value in self.snr_dict["data"].iteritems():
+            if debug and key in content:
+                logger.debug(u"Replacing '%s' with '%s' in '%s'", key, value, content)
+
+            content = content.replace(key, value)
+
+        return content
+
+
+class WholeLineProcessor(MultipleLineProcessor):
+    def process(self, content, debug=False, **kwargs):
+        if not self.snr_dict["data"]:
+            return content
+        content = content.strip()
+
+        for key, value in self.snr_dict["data"].iteritems():
+            if content == key:
+                if debug:
+                    logger.debug(u"Replacing '%s' with '%s'", key, value)
+
+                content = value
+                break
+
+        return content
+
+
+class MultipleWordProcessor(MultipleLineProcessor):
+    """
+    replaces words
+
+    takes a search/replace dict as first argument
+    Expects a dictionary in the form of:
+    dict = {
+        "data": {"old_value": "new_value"}
+    }
+    """
+    def process(self, content, debug=False, **kwargs):
+        words = content.split(u" ")
+        new_words = []
+        for word in words:
+            new_words.append(self.snr_dict.get(word, word))
+
+        return u" ".join(new_words)
diff --git a/libs/subzero/modification/registry.py b/libs/subzero/modification/registry.py
new file mode 100644
index 000000000..7b240a69c
--- /dev/null
+++ b/libs/subzero/modification/registry.py
@@ -0,0 +1,17 @@
+# coding=utf-8
+from collections import OrderedDict
+
+
+class SubtitleModRegistry(object):
+    mods = None
+    mods_available = None
+
+    def __init__(self):
+        self.mods = OrderedDict()
+        self.mods_available = []
+
+    def register(self, mod):
+        self.mods[mod.identifier] = mod
+        self.mods_available.append(mod.identifier)
+
+registry = SubtitleModRegistry()
diff --git a/libs/subzero/prefs.py b/libs/subzero/prefs.py
new file mode 100644
index 000000000..252164fb9
--- /dev/null
+++ b/libs/subzero/prefs.py
@@ -0,0 +1,39 @@
+# coding=utf-8
+import traceback
+from constants import PLUGIN_IDENTIFIER
+
+
+def get_user_prefs(Prefs, Logger):
+    """
+    loads all user prefs regardless of whether they exist in DefaultPrefs or not
+    :param Prefs:
+    :param Logger:
+    :return:
+    """
+
+    try:
+        prefs_set = Prefs._sandbox.preferences._sets[PLUGIN_IDENTIFIER]
+    except:
+        Logger.Error("Loading user prefs failed: %s", traceback.format_exc())
+        return {}
+
+    user_prefs = {}
+    try:
+        xml_path = prefs_set._user_file_path
+        if not Prefs._core.storage.file_exists(xml_path):
+            return {}
+        prefs_str = Prefs._core.storage.load(xml_path, mtime_key=prefs_set)
+        prefs_xml = Prefs._core.data.xml.from_string(prefs_str)
+        for el in prefs_xml:
+            user_prefs[str(el.tag)] = str(el.text)
+    except:
+        Logger.Error("Loading user prefs failed: %s", traceback.format_exc())
+    else:
+        return user_prefs
+    return {}
+
+
+def update_user_prefs(update_prefs, Prefs, Logger):
+    prefs_set = Prefs._sandbox.preferences._sets[PLUGIN_IDENTIFIER]
+    prefs_set.update_user_values(**update_prefs)
+    Logger.Info("User prefs updated")
diff --git a/libs/subzero/sandbox.py b/libs/subzero/sandbox.py
new file mode 100644
index 000000000..f409b1824
--- /dev/null
+++ b/libs/subzero/sandbox.py
@@ -0,0 +1,15 @@
+# coding=utf-8
+import sys
+
+
+def fix_environment_stuff(module, base):
+    # restore builtins
+    module.__builtins__ = [x for x in base.__class__.__base__.__subclasses__() if x.__name__ == 'catch_warnings'][0]()._module.__builtins__
+
+    # patch getfilesystemencoding for NVIDIA Shield
+    getfilesystemencoding_orig = sys.getfilesystemencoding
+
+    def getfilesystemencoding():
+        return getfilesystemencoding_orig() or "utf-8"
+
+    sys.getfilesystemencoding = getfilesystemencoding
diff --git a/libs/subzero/score_range.py b/libs/subzero/score_range.py
new file mode 100644
index 000000000..ec80d665f
--- /dev/null
+++ b/libs/subzero/score_range.py
@@ -0,0 +1,22 @@
+# coding=utf-8
+
+import sys
+from itertools import chain, combinations, permutations
+
+from subliminal.video import Episode
+
+
+def permute(x):
+    return [base_score + i + j for i in x for j in x]
+
+if __name__ == "__main__":
+    scores = Episode.scores
+    base_score_keys = ["series", "season", "episode"]
+    leftover_keys = list(set(scores.keys()) - set(base_score_keys))
+    base_score = sum([val for key, val in scores.items() if key in base_score_keys])
+    leftover_scores = set([score for key, score in scores.items() if key in leftover_keys])
+    print "base score:", base_score
+    print "leftover:", sorted(set(leftover_scores))
+    # print sum_possible_scores(base_score, leftover_scores)
+    # print list(permutations(leftover_scores))
+    print ",\n".join(map(lambda x: '"%s"' % x, ["66"] + sorted(set(permute(leftover_scores)))))
diff --git a/libs/subzero/subtitle_storage.py b/libs/subzero/subtitle_storage.py
new file mode 100644
index 000000000..186a03a38
--- /dev/null
+++ b/libs/subzero/subtitle_storage.py
@@ -0,0 +1,544 @@
+# coding=utf-8
+import datetime
+import gzip
+import hashlib
+import os
+import logging
+import traceback
+import types
+import zlib
+
+import sys
+
+from json_tricks.nonp import loads
+from subzero.lib.json import dumps
+from scandir import scandir, scandir_generic as _scandir_generic
+from constants import mode_map
+
+logger = logging.getLogger(__name__)
+
+
+class JSONStoredSubtitle(object):
+    score = None
+    storage_type = None
+    hash = None
+    provider_name = None
+    id = None
+    date_added = None
+    mode = "a"  # auto/manual/auto-better (a/m/b)
+    content = None
+    mods = None
+    encoding = None
+    last_mod = None  # file modification
+
+    def initialize(self, score, storage_type, hash, provider_name, id, date_added=None, mode="a", content=None,
+                 mods=None, encoding=None, last_mod=None):
+        self.score = int(score)
+        self.storage_type = storage_type
+        self.hash = hash
+        self.provider_name = provider_name
+        self.id = id
+        self.date_added = date_added or datetime.datetime.now()
+        self.mode = mode
+        self.content = content
+        self.mods = mods or []
+        self.encoding = encoding
+        self.last_mod = last_mod
+
+    def add_mod(self, identifier):
+        self.mods = self.mods or []
+        if identifier is None:
+            self.mods = []
+            return
+
+        self.mods.append(identifier)
+
+    @classmethod
+    def get_mode_verbose(cls, mode):
+        return mode_map.get(mode, "Unknown")
+
+    @property
+    def mode_verbose(self):
+        return self.get_mode_verbose(self.mode)
+
+    def serialize(self):
+        return self.__dict__
+
+    def deserialize(self, data):
+        if data["content"]:
+            # legacy: storage was unicode; content is always present in encoded form
+            if isinstance(data["content"], types.UnicodeType):
+                data["content"] = data["content"].encode(data["encoding"])
+
+        self.initialize(**data)
+
+    @property
+    def key(self):
+        return self.provider_name, self.id
+
+
+class JSONStoredVideoSubtitles(object):
+    """
+    manages stored subtitles for video_id per media_part/language combination
+    """
+    video_id = None  # rating_key
+    title = None
+    parts = None
+    version = None
+    item_type = None  # movie / episode
+    added_at = None
+
+    def initialize(self, plex_item, version=None):
+        self.video_id = str(plex_item.rating_key)
+
+        self.title = plex_item.title
+        self.parts = {}
+        self.version = version
+        self.item_type = plex_item.type
+        self.added_at = datetime.datetime.fromtimestamp(plex_item.added_at)
+
+    def deserialize(self, data):
+        parts = data.pop("parts")
+        self.parts = {}
+        self.__dict__.update(data)
+
+        if parts:
+            for part_id, part in parts.iteritems():
+                self.parts[part_id] = {}
+                for language, sub_data in part.iteritems():
+                    self.parts[part_id][language] = {}
+
+                    for sub_key, subtitle_data in sub_data.iteritems():
+                        if sub_key == "current":
+                            if not isinstance(subtitle_data, tuple):
+                                subtitle_data = tuple(subtitle_data.split("__"))
+                            self.parts[part_id][language]["current"] = subtitle_data
+                        elif sub_key == "blacklist":
+                            bl = dict((tuple([str(a) for a in k.split("__")]), v) for k, v in subtitle_data.iteritems())
+                            self.parts[part_id][language]["blacklist"] = bl
+                        else:
+                            sub = JSONStoredSubtitle()
+
+                            sub.initialize(**subtitle_data)
+                            if not isinstance(sub_key, tuple):
+                                sub_key = tuple(sub_key.split("__"))
+
+                            self.parts[part_id][language][sub_key] = sub
+
+    def serialize(self):
+        data = {"parts": {}}
+        for key, value in self.__dict__.iteritems():
+            if key != "parts":
+                data[key] = value
+
+        for part_id, part in self.parts.iteritems():
+            data["parts"][part_id] = {}
+            for language, sub_data in part.iteritems():
+                data["parts"][part_id][language] = {}
+
+                for sub_key, stored_subtitle in sub_data.iteritems():
+                    if sub_key == "current":
+                        data["parts"][part_id][language]["current"] = "__".join(stored_subtitle)
+                    elif sub_key == "blacklist":
+                        data["parts"][part_id][language]["blacklist"] = dict(("__".join(k), v) for k, v in
+                                                                             stored_subtitle.iteritems())
+                    else:
+                        if stored_subtitle.content and not stored_subtitle.encoding:
+                            continue
+
+                        serialized_sub = stored_subtitle.serialize()
+                        if serialized_sub:
+                            data["parts"][part_id][language]["__".join(sub_key)] = serialized_sub
+
+        return data
+
+    def add(self, part_id, lang, subtitle, storage_type, date_added=None, mode="a", last_mod=None, set_current=True):
+        part_id = str(part_id)
+        part = self.parts.get(part_id)
+        if not part:
+            self.parts[part_id] = {}
+            part = self.parts[part_id]
+
+        subs = part.get(lang)
+        if not subs:
+            part[lang] = {}
+            subs = part[lang]
+
+        sub_key = self.get_sub_key(subtitle.provider_name, subtitle.id)
+        subs[sub_key] = JSONStoredSubtitle()
+        subs[sub_key].initialize(subtitle.score, storage_type, hashlib.md5(subtitle.content).hexdigest(),
+                                 subtitle.provider_name, subtitle.id, date_added=date_added, mode=mode,
+                                 content=subtitle.content, mods=subtitle.mods, encoding="utf-8",
+                                 last_mod=last_mod)
+
+        if set_current:
+            logger.debug(u"Setting subtitle as current: %r", subtitle)
+            subs["current"] = sub_key
+
+        return True
+
+    def get_any(self, part_id, lang):
+        part_id = str(part_id)
+        part = self.parts.get(part_id)
+        if not part:
+            return
+
+        subs = part.get(str(lang))
+        if not subs:
+            return
+
+        if "current" in subs and subs["current"]:
+            return subs.get(subs["current"])
+
+    def get(self, part_id, lang, sub_key):
+        subs = self.get_all(part_id, lang)
+        if not subs:
+            return
+
+        return subs.get(sub_key)
+
+    def get_all(self, part_id, lang):
+        part_id = str(part_id)
+        part = self.parts.get(part_id)
+        if not part:
+            return
+
+        return part.get(str(lang))
+
+    def set_current(self, part_id, lang, sub_key):
+        subs = self.get_all(part_id, lang)
+        if not subs:
+            return
+
+        if sub_key not in subs:
+            logger.info("Tried setting unknown subtitle %s as current" % sub_key)
+            return
+
+        subs["current"] = sub_key
+        logger.debug("Set subtitle %s as current for %s, %s" % (sub_key, part_id, lang))
+
+    def get_by_provider(self, part_id, lang, provider_name):
+        out = []
+        all_subs = self.get_all(part_id, lang)
+        if not all_subs:
+            return out
+
+        for key, subtitle in all_subs.iteritems():
+            if key in ("current", "blacklist"):
+                continue
+
+            if subtitle.provider_name == provider_name:
+                out.append(subtitle)
+        return out
+
+    def count(self, part_id, lang):
+        part_id = str(part_id)
+        part = self.parts.get(part_id)
+        if not part:
+            return 0
+
+        subs = part.get(str(lang))
+        return len(filter(lambda key: key not in ("current", "blacklist"), subs.keys()))
+
+    def get_sub_key(self, provider_name, id):
+        return provider_name, str(id)
+
+    def get_blacklist(self, part_id, lang):
+        part_id = str(part_id)
+        part = self.parts.get(part_id)
+        if not part:
+            return {}, {}
+
+        subs = part.get(str(lang))
+        if not subs:
+            return {}, {}
+
+        current_bl = subs.get("blacklist", {})
+        return current_bl, subs
+
+    def blacklist(self, part_id, lang, sub_key, add=True):
+        current_bl, subs = self.get_blacklist(part_id, lang)
+        sub = subs.get(subs["current"])
+        if not sub:
+            return
+
+        if sub_key in current_bl:
+            if add:
+                return
+            else:
+                del current_bl[sub_key]
+                subs["blacklist"] = current_bl
+                return
+
+        current_bl[sub_key] = {"date_added": sub.date_added, "score": sub.score, "mode": sub.mode, "storage_type":
+            sub.storage_type}
+        subs["blacklist"] = current_bl
+
+    def __repr__(self):
+        return unicode(self)
+
+    def __unicode__(self):
+        return u"%s (%s)" % (self.title, self.video_id)
+
+    def __str__(self):
+        return str(self.video_id)
+
+
+class StoredSubtitlesManager(object):
+    """
+    manages the storage and retrieval of StoredVideoSubtitles instances for a given video_id
+    """
+    storage = None
+    version = 3
+    extension = ".json.gz"
+
+    def __init__(self, storage, threadkit, plexapi_item_getter):
+        self.storage = storage
+        self.get_item = plexapi_item_getter
+        self.threadkit = threadkit
+
+    def destroy(self):
+        self.storage = None
+        self.get_item = None
+        self.threadkit = None
+
+    def get_storage_filename(self, video_id):
+        return "subs_%s" % video_id
+
+    @property
+    def dataitems_path(self):
+        return os.path.join(getattr(self.storage, "_core").storage.data_path, "DataItems")
+
+    def get_json_data_path(self, bare_fn):
+        if not bare_fn.endswith(self.extension):
+            return os.path.join(self.dataitems_path, "%s%s" % (bare_fn, self.extension))
+        return os.path.join(self.dataitems_path, bare_fn)
+
+    def get_all_files(self, scandir_generic=False):
+        _scandir = _scandir_generic if scandir_generic else scandir
+        for entry in _scandir(self.dataitems_path):
+            if entry.is_file(follow_symlinks=False) and \
+                    entry.name.startswith("subs_") and \
+                    entry.name.endswith(self.extension):
+                yield entry.name
+
+    def get_recent_files(self, age_days=30):
+        fl = []
+        root = self.dataitems_path
+        recent_dt = datetime.datetime.now() - datetime.timedelta(days=age_days)
+
+        def run(scandir_generic=False):
+            for fn in self.get_all_files(scandir_generic=scandir_generic):
+                ctime = os.path.getctime(os.path.join(root, fn))
+                created = datetime.datetime.fromtimestamp(ctime)
+                if created > recent_dt:
+                    fl.append(fn)
+        try:
+            run()
+        except OSError:
+            run(scandir_generic=True)
+        return fl
+
+    def load_recent_files(self, age_days=30):
+        fl = self.get_recent_files(age_days=age_days)
+        out = {}
+        for fn in fl:
+            data = self.load(filename=fn)
+            if data:
+                out[fn] = data
+        return out
+
+    def delete_missing(self, wanted_languages=set(), scandir_generic=False):
+        deleted = []
+
+        def delete_fn(filename):
+            if filename.endswith(self.extension):
+                self.delete(self.get_json_data_path(filename))
+            else:
+                self.legacy_delete(filename)
+
+        for fn in self.get_all_files(scandir_generic=scandir_generic):
+            video_id = os.path.basename(fn).split(".")[0].split("subs_")[1]
+            item = self.get_item(video_id)
+
+            # item missing, delete storage
+            if not item:
+                delete_fn(fn)
+                deleted.append(video_id)
+
+            else:
+                known_parts = []
+
+                # wrong (legacy) info, delete storage
+                if not hasattr(item, "media"):
+                    delete_fn(fn)
+                    deleted.append(video_id)
+                    continue
+
+                for media in item.media:
+                    for part in media.parts:
+                        known_parts.append(str(part.id))
+                stored_subs = self.load(filename=fn)
+
+                if not stored_subs:
+                    continue
+
+                missing_parts = set(stored_subs.parts).difference(set(known_parts))
+
+                changed_any = False
+
+                # remove known info about deleted parts
+                if missing_parts:
+                    logger.debug("Parts removed: %s:%s, removing data", video_id, missing_parts)
+                    for missing_part in missing_parts:
+                        if missing_part in stored_subs.parts:
+                            try:
+                                del stored_subs.parts[missing_part]
+                                changed_any = True
+                            except:
+                                pass
+
+                # remove known info about non-existing languages
+                for part_id, part in stored_subs.parts.iteritems():
+                    missing_languages = set(part).difference(wanted_languages)
+                    if missing_languages:
+                        logger.debug("Languages removed: %s:%s:%s, removing data", video_id, part_id, missing_languages)
+                        for missing_language in missing_languages:
+                            try:
+                                del stored_subs.parts[part_id][missing_language]
+                                changed_any = True
+                            except:
+                                pass
+
+                if changed_any:
+                    self.save(stored_subs)
+                stored_subs = None
+                missing_parts = None
+                missing_languages = None
+
+        return deleted
+
+    def migrate_v2(self, subs_for_video):
+        plex_item = self.get_item(subs_for_video.video_id)
+        if not plex_item:
+            return False
+        subs_for_video.item_type = plex_item.type
+        subs_for_video.added_at = datetime.datetime.fromtimestamp(plex_item.added_at)
+        subs_for_video.version = 2
+        return True
+
+    def migrate_v3(self, subs_for_video):
+        subs_for_video.version = 3
+        return True
+
+    def load(self, video_id=None, filename=None):
+        subs_for_video = None
+        bare_fn = self.get_storage_filename(video_id) if video_id else filename
+        json_path = self.get_json_data_path(bare_fn)
+        basename = os.path.basename(json_path)
+
+        #logger.debug("Loading subtitle storage data file: %s", basename)
+
+        if os.path.exists(json_path):
+            # new style data
+            subs_for_video = JSONStoredVideoSubtitles()
+            try:
+                with self.threadkit.Lock(key="sub_storage_%s" % basename):
+                    if sys.platform == "win32":
+                        try:
+                            with open(json_path, 'rb') as f:
+                                s = zlib.decompress(f.read())
+                        except zlib.error:
+                            # fallback to old gzip win32 implementation
+                            with gzip.open(json_path, 'rb', compresslevel=6) as f:
+                                s = f.read()
+
+                    else:
+                        with gzip.open(json_path, 'rb', compresslevel=6) as f:
+                            s = f.read()
+
+                data = loads(s)
+            except:
+                logger.error("Couldn't load JSON data for %s: %s", bare_fn, traceback.format_exc())
+                return
+
+            subs_for_video.deserialize(data)
+            data = None
+
+        if not subs_for_video:
+            return
+
+        # apply possible migrations
+        cur_ver = old_ver = subs_for_video.version
+
+        if cur_ver < self.version:
+            success = False
+            while cur_ver < self.version:
+                cur_ver += 1
+                mig_func = "migrate_v%s" % cur_ver
+                if hasattr(self, mig_func):
+                    logger.info("Migrating subtitle storage for %s %s>%s" % (subs_for_video.video_id, old_ver, cur_ver))
+                    success = getattr(self, mig_func)(subs_for_video)
+                    if success is False:
+                        logger.error("Couldn't migrate %s, removing data", subs_for_video.video_id)
+                        self.delete(json_path)
+                        break
+
+            if cur_ver > old_ver and success:
+                logger.info("Storing migrated subtitle storage for %s" % subs_for_video.video_id)
+                self.save(subs_for_video)
+            elif not success:
+                logger.info("Migration of %s %s>%s failed" % (subs_for_video.video_id, old_ver, cur_ver))
+
+        return subs_for_video
+
+    def new(self, plex_item):
+        subs_for_video = JSONStoredVideoSubtitles()
+        subs_for_video.initialize(plex_item, version=self.version)
+        return subs_for_video
+
+    def load_or_new(self, plex_item, save=False):
+        subs_for_video = self.load(plex_item.rating_key)
+        if not subs_for_video:
+            logger.info("Creating new subtitle storage for: %s", plex_item.rating_key)
+            subs_for_video = self.new(plex_item)
+            if save:
+                self.save(subs_for_video)
+        return subs_for_video
+
+    def save(self, subs_for_video):
+        data = subs_for_video.serialize()
+        temp_fn = self.get_json_data_path(self.get_storage_filename(subs_for_video.video_id) + "_tmp")
+        fn = self.get_json_data_path(self.get_storage_filename(subs_for_video.video_id))
+        basename = os.path.basename(fn)
+        json_data = str(dumps(data, ensure_ascii=False))
+        with self.threadkit.Lock(key="sub_storage_%s" % basename):
+            if sys.platform == "win32":
+                try:
+                    f = open(temp_fn, "w+b")
+
+                    try:
+                        f.seek(0, os.SEEK_CUR)
+                        f.write(zlib.compress(json_data, 6))
+                        f.flush()
+                    except:
+                        logger.error("Something went wrong when writing to: %s: %s", basename, traceback.format_exc())
+                    finally:
+                        f.close()
+                except:
+                    logger.error("Something went REALLY wrong when writing to: %s: %s", basename,
+                                 traceback.format_exc())
+            else:
+                with gzip.open(temp_fn, "wb", compresslevel=6) as f:
+                    f.write(json_data)
+
+            os.rename(temp_fn, fn)
+
+    def delete(self, filename):
+        os.remove(filename)
+
+    def legacy_delete(self, filename):
+        try:
+            self.storage.Remove(filename)
+        except:
+            logger.error("Failed to delete item %s: %s" % (filename, traceback.format_exc()))
diff --git a/libs/subzero/util.py b/libs/subzero/util.py
new file mode 100644
index 000000000..25ab0cd60
--- /dev/null
+++ b/libs/subzero/util.py
@@ -0,0 +1,7 @@
+# coding=utf-8
+import os
+from subzero.lib.io import get_viable_encoding
+
+
+def get_root_path():
+    return os.path.abspath(os.path.join(os.path.dirname(os.path.abspath(unicode(__file__, get_viable_encoding()))), ".."))
diff --git a/libs/subzero/video.py b/libs/subzero/video.py
new file mode 100644
index 000000000..cb5b8d172
--- /dev/null
+++ b/libs/subzero/video.py
@@ -0,0 +1,180 @@
+# coding=utf-8
+
+import logging
+import os
+
+from babelfish.exceptions import LanguageError
+from subzero.language import Language, language_from_stream
+from subliminal_patch import scan_video, refine, search_external_subtitles
+
+logger = logging.getLogger(__name__)
+
+
+def has_external_subtitle(part_id, stored_subs, language):
+    stored_sub = stored_subs.get_any(part_id, language)
+    if stored_sub and stored_sub.storage_type == "filesystem":
+        return True
+
+
+def set_existing_languages(video, video_info, external_subtitles=False, embedded_subtitles=False, known_embedded=None,
+                           stored_subs=None, languages=None, only_one=False):
+    logger.debug(u"Determining existing subtitles for %s", video.name)
+
+    # scan for external subtitles
+    external_langs_found = set(search_external_subtitles(video.name, languages=languages,
+                                                         only_one=only_one).values())
+
+    # found external subtitles should be considered?
+    if external_subtitles:
+        # |= is update, thanks plex
+        video.subtitle_languages.update(external_langs_found)
+
+    else:
+        # did we already download subtitles for this?
+        if stored_subs and external_langs_found:
+            for lang in external_langs_found:
+                if has_external_subtitle(video_info["plex_part"].id, stored_subs, lang):
+                    logger.info("Not re-downloading subtitle for language %s, it already exists on the filesystem",
+                                lang)
+                    video.subtitle_languages.add(lang)
+
+    # add known embedded subtitles
+    if embedded_subtitles and known_embedded:
+        # mp4 and stuff, check burned in
+        for language in known_embedded:
+            logger.debug('Found embedded subtitle %r', language)
+            video.subtitle_languages.add(language)
+
+
+def parse_video(fn, hints, skip_hashing=False, dry_run=False, providers=None):
+    logger.debug("Parsing video: %s, hints: %s", os.path.basename(fn), hints)
+    return scan_video(fn, hints=hints, dont_use_actual_file=dry_run, providers=providers,
+                      skip_hashing=skip_hashing)
+
+
+def refine_video(video, no_refining=False, refiner_settings=None):
+    refiner_settings = refiner_settings or {}
+    video_info = video.plexapi_metadata
+    hints = video.hints
+
+    if no_refining:
+        logger.debug("Taking parse_video shortcut")
+        return video
+
+    # refiners
+    refine_kwargs = {
+        "episode_refiners": ['sz_tvdb', 'sz_omdb',],
+        "movie_refiners": ['sz_omdb',],
+        "embedded_subtitles": False,
+    }
+    refine_kwargs.update(refiner_settings)
+
+    if "filebot" in refiner_settings:
+        # filebot always comes first
+        refine_kwargs["episode_refiners"].insert(0, "filebot")
+        refine_kwargs["movie_refiners"].insert(0, "filebot")
+
+    if "symlinks" in refiner_settings:
+        refine_kwargs["episode_refiners"].insert(0, "symlinks")
+        refine_kwargs["movie_refiners"].insert(0, "symlinks")
+
+    if "file_info_file" in refiner_settings:
+        # file_info_file always comes first
+        refine_kwargs["episode_refiners"].insert(0, "file_info_file")
+        refine_kwargs["movie_refiners"].insert(0, "file_info_file")
+
+    if "sonarr" in refiner_settings:
+        # drone always comes last
+        refine_kwargs["episode_refiners"].append("drone")
+
+    if "radarr" in refiner_settings:
+        refine_kwargs["movie_refiners"].append("drone")
+
+    # our own metadata refiner :)
+    if "stream" in video_info:
+        for key, value in video_info["stream"].iteritems():
+            if hasattr(video, key) and not getattr(video, key):
+                logger.info(u"Adding stream %s info: %s", key, value)
+                setattr(video, key, value)
+
+    plex_title = video_info.get("original_title") or video_info.get("title")
+    if hints["type"] == "episode":
+        plex_title = video_info.get("original_title") or video_info.get("series")
+
+    year = video_info.get("year")
+    if not video.year and year:
+        logger.info(u"Adding PMS year info: %s", year)
+        video.year = year
+
+    refine(video, **refine_kwargs)
+    logger.info(u"Using filename: %s", video.original_name)
+
+    if hints["type"] == "movie" and not video.imdb_id:
+        if plex_title:
+            logger.info(u"Adding PMS title/original_title info: %s", plex_title)
+            old_title = video.title
+            video.title = plex_title.replace(" - ", " ").replace(" -", " ").replace("- ", " ")
+
+            # re-refine with new info
+            logger.info(u"Re-refining with movie title: '%s' instead of '%s'", plex_title, old_title)
+            refine(video, **refine_kwargs)
+
+            video.alternative_titles.append(old_title)
+
+        # still no match? add our own data
+        if not video.imdb_id:
+            video.imdb_id = video_info.get("imdb_id")
+            if video.imdb_id:
+                logger.info(u"Adding PMS imdb_id info: %s", video.imdb_id)
+
+    elif hints["type"] == "movie" and plex_title:
+        pt = plex_title.replace(" - ", " ").replace(" -", " ").replace("- ", " ")
+        if pt != video.title:
+            video.alternative_titles.append(pt)
+
+    if hints["type"] == "episode":
+        video.season = video_info.get("season", video.season)
+        video.episode = video_info.get("episode", video.episode)
+        if not video.series_tvdb_id and not video.tvdb_id and plex_title:
+            # add our title
+            logger.info(u"Adding PMS title/original_title info: %s", plex_title)
+            old_title = video.series
+            video.series = plex_title
+
+            # re-refine with new info
+            logger.info(u"Re-refining with series title: '%s' instead of '%s'", plex_title, old_title)
+            refine(video, **refine_kwargs)
+
+            video.alternative_series.append(old_title)
+
+        elif plex_title and video.series != plex_title:
+            video.alternative_series.append(plex_title)
+
+        # still no match? add our own data
+        if not video.series_tvdb_id or not video.tvdb_id:
+            logger.info(u"Adding PMS year info: %s", video_info.get("year"))
+            video.year = video_info.get("year")
+
+        if not video.series_tvdb_id and video_info.get("series_tvdb_id"):
+            logger.info(u"Adding PMS series_tvdb_id info: %s", video_info.get("series_tvdb_id"))
+            video.series_tvdb_id = video_info.get("series_tvdb_id")
+
+        if not video.tvdb_id and video_info.get("tvdb_id"):
+            logger.info(u"Adding PMS tvdb_id info: %s", video_info.get("tvdb_id"))
+            video.tvdb_id = video_info.get("tvdb_id")
+
+    # did it match?
+    if (hints["type"] == "episode" and not video.series_tvdb_id and not video.tvdb_id) \
+            or (hints["type"] == "movie" and not video.imdb_id):
+        logger.warning("Couldn't find corresponding series/movie in online databases, continuing")
+
+    # guess special
+    if hints["type"] == "episode":
+        if video.season == 0 or video.episode == 0:
+            video.is_special = True
+        else:
+            # check parent folder name
+            if os.path.dirname(video.name).split(os.path.sep)[-1].lower() in ("specials", "season 00"):
+                video.is_special = True
+
+    return video